As an Instructional Designer at Idaho State University, I work to help faculty design engaging, clear, and accessible online courses that improve outcomes for every learner. I'm enthusiastic about open educational resources (OERs) and open pedagogical approaches.
In my previous role as the Instruction Coordinator and Faculty Outreach Librarian for the College of Western Idaho, I worked with students, other librarians, faculty, and staff to promote critical information literacy and library use.
+
+
Prior to librarianship, I earned an MA in English from the University of California, Riverside and an MA in Visual and Cultural Studies from the University of Rochester. While a graduate student, then as an adjunct, I taught what librarians call information literacy skills as the instructor for many first-year writing seminar courses and lower-division American Studies and Film/Media courses. I was also a college writing tutor for undergraduate and graduate students. The path of librarianship took me to IU Bloomington's MLS program, where my favorite courses emphasized critical information literacy, humanities subject librarianship, and digital humanities.
As I recently mentioned on Mastodon, I’m going to try doing Academic Writing Month (aka “AcWriMo”; a fellow traveler of National Novel Writing Month, or “NaNoWriMo”) this year. Here I’m detailing my approach—I’ll likely also update this with my progress throughout the experiment.
+
+
La Lucha Continúa
+
+
My most consistent writing challenge has always been that writing anything longer than a blog post involves a noticeable state shift. I move—sometimes with effort, sometimes all-too-effortlessly—from mild-mannered riotnrrrd mode to superhuman hyperfocus mode, and occasionally veer into full-on ADHD lasereyes goblin mode.
+
+
This routinely produces good class & conference papers, but isn’t exactly compatible with what one might call responsible adulting.
+
+
So the crux of my dilemma: how to flip my brain into writing mode in sustainable ways that are in fact compatible with responsible adulting?
+
+
AcWriMo2023 Piece
+
+
Here are this year’s AcWriMo experiment parameters, written up somewhat as a Fluxus piece:
+
+
+
Aspire to get into the “writing headspace” for 30 minutes to an hour every other day, i.e. Mon or Tue, Wed or Thu, Fri or Sat., through November 2023.
+
Track the attempts. Probably share the progress & results.
+
“Writing headspace” here ≅ “successfully opened up my writing app and/or successfully annotated readings in one of my two reading apps.”
+
+
+
As you can see, this is taking a process-based approach, not a product-based one. The aim is to see how much I can make a habit of writing in rally mode (i.e. sustained movement) rather than sprinting mode.
+
+
To provide more structure and internal support, I’ve made myself a set of tasks, using Obsidian’s Tasks plugin. Whatever stands a good chance of supporting beneficial progress, right?
+
+
Obsidian & Tasks Details
+
+
While I haven’t yet written a post or note about the Tasks plugin specifically, it’s essentially what has drawn me from Dendron to Obsidian. So here I’ll detail how I’m using Tasks to help out with AcWriMo2023, in case you’re the sort of person who appreciates worked examples. If you’re also an Obsidian user, maybe it’ll be a useful example of how you might approach projects & to-dos, using the Tasks plugin?
+
+
Here’s a link to the project tracking file I’ve made for this month’s challenge. Please adapt it to your own use as you’d like! (Here’s a link direct to the file’s raw view, if you just want to copy & paste it from your browser without seeing all the GitHub interface.)
+
+
A few important use/configuration notes:
+
+
I use #tt as a global filter for Tasks. This tells the plugin not to track every single line that starts with a - [ ] checkbox, but only pay attention to the ones that start with - [ ] #tt. I’ll explain my reasons further in that eventual note, but for now, you’ll likely want to find & delete all of those tags, or find & replace them all with your own global filter if you use one.
+
I have #td/writing as an additional tag on each of these tasks. Using this sort of tag lets me use #td as a tag for all my “todo” tasks, then use the /whatever content to create subsets to display anywhere I want to have a Tasks query. Again, I’ll eventually explain this further; for now, I’m just giving any potential users of this a heads up.
+
I’ve also included the due dates for my own purposes. Again, you’ll want to change those for your own scenario. I’m just sharing all this, both to document it for Future Me and to help provide potential structures for anyone else who wants to give AcWriMo a go, last-minute.
+
There’s a Tasks query included in the file, under the Tasks View heading. This will display all the tasks on this very file, putting them in a dynamic pane that lets you change dates and interact with things more handily than you can with the Markdown / text view alone.
+
I feel like way too many people approach Obsidian as though there’s a single “correct way” to use it for tasks or projects. If you’ve read this far—and especially if you’re actually considering using my file—please approach it just as a springboard for your own experimentation. What I think might work for me, right now, isn’t guaranteed to work for me—let alone for you! I’d love it if you let me know that you found it handy or inspiring, of course.
What I didn’t include were particular recommendations for other programs that integrate nicely with Dropbox. Perhaps it’s my college dj training that makes me super hesitant to encourage people to buy a particular program or product when I’m in a more public forum?
+
+
In any case, this is my own space, so here are the programs that I have linked to Dropbox that I use almost daily. None of these are affiliate links, I just think highly of them:
+
+
+
nvALT A free program from Brett Terpstra that stores any number of text files. Using a search bar as the file-picking interface takes a bit of getting used to, but the program’s profoundly useful as a place to store ideas for the future. Just start using breadcrumbs that can help you recall the terms you’ve used—things like adding multiple “q” characters in a row for things of increasing importance, for instance. Michael Schechter shows you which settings to change in order to save your files individually rather than as a single database.
+
Editorial Ole Moritz’s program for iOS lets you work in plain text files and understands Markdown, TaskPaper, and Fountain formatting. It also has templates, automation, and Python scripting, so it’s ridiculously customizable and extendable.
';
+ }
+ resultdiv.append(searchitem);
+ }
+ });
+});
diff --git a/assets/js/lunr/lunr-store.js b/assets/js/lunr/lunr-store.js
new file mode 100644
index 000000000..bba8ffae5
--- /dev/null
+++ b/assets/js/lunr/lunr-store.js
@@ -0,0 +1,811 @@
+var store = [{
+ "title": "Apple Watch ADHD",
+ "excerpt":"I’ve been wanting to write about some ways that my smartwatch has helped me deal with the fact that I perceive time differently than most neurotypical people. It’s an example of what Aimi Hamraie has called “ADHD technologies.”1 Timers I use the timer function often—especially when I’m doing any kind...","categories": [],
+ "tags": [],
+ "url": "/notes/ADHD-tech/apple-watch-ADHD",
+ "teaser": null
+ },{
+ "title": "About ADHD technologies",
+ "excerpt":"I recently saw this tweet by Aimi Hamraie, with the hashtag ADHDtechnologies: Have been getting lots of questions about how to be an academic with ADHD. Different for all of us but here is one of my #adhdtechnologies: a flip-top notebook with running to do lists that I keep on...","categories": [],
+ "tags": [],
+ "url": "/notes/ADHD-tech/about-ADHD-technologies",
+ "teaser": null
+ },{
+ "title": "ADHD tech",
+ "excerpt":" Pinned ADHD tech notes 📌 About ADHD technologies :seedling: All ADHD tech items 📌 About ADHD technologies :seedling: Apple Watch ADHD :herb: ","categories": [],
+ "tags": [],
+ "url": "/notes/ADHD-tech/index",
+ "teaser": null
+ },{
+ "title": "ADHD",
+ "excerpt":" All ADHD items There's nothing here yet! ","categories": [],
+ "tags": [],
+ "url": "/notes/ADHD/index",
+ "teaser": null
+ },{
+ "title": "Accessibility",
+ "excerpt":" All Accessibility items Math Accessibility :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Accessibility/index",
+ "teaser": null
+ },{
+ "title": "Keywords",
+ "excerpt":"All Keywords folders Pinned Keywords notes All Keywords items There's nothing here yet! ","categories": [],
+ "tags": [],
+ "url": "/notes/Keywords/index",
+ "teaser": null
+ },{
+ "title": "Listening",
+ "excerpt":"Welcome to my Listening notes! All Listening items There's nothing here yet! ","categories": [],
+ "tags": [],
+ "url": "/notes/Listening/index",
+ "teaser": null
+ },{
+ "title": "Approaches",
+ "excerpt":" All Approaches items Casey Boyle's …something like a reading ethics… :seedling: Rhetorical Précis :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Approaches/index",
+ "teaser": null
+ },{
+ "title": "Literature Notes in Dendron",
+ "excerpt":"I’ve been refining a system for taking literature notes in Dendron, which complements keeping citations with Zotero. My systems remain perpetually in flux, but this is at least my most current write-up, if not my most current approach. Dendron is an extension for the text editor VS Code. If you...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Dendron/literature-notes-dendron",
+ "teaser": null
+ },{
+ "title": "Beginning to Use Dendron",
+ "excerpt":"What is Dendron? Dendron lets you create—and more importantly, organize—plain text notes in VS Code. It not only lets you link between notes like a wiki, it makes notes findable through a tree view and customizable, hierarchical organization. I’m such a fan that I switched from Atom to VS Code...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Dendron/beginning-to-use-dendron",
+ "teaser": null
+ },{
+ "title": "Casey Boyle's …something like a reading ethics…",
+ "excerpt":"This strategy for reading is meant to build better habits of reading, as well as better note-taking. It’s a nice complement to a rhetorical-precis, but more open-ended. Casey Boyle’s “…something like a reading ethics…” Casey’s post on his approach (via the WaybackMachine) explains it in excellent detail. It’s very much...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Approaches/casey-boyle-something-like-reading-ethics",
+ "teaser": null
+ },{
+ "title": "Rhetorical Précis",
+ "excerpt":"One of the most frustrating things about reading widely is the situation where you’ve read something, but can’t recall any details or situate that piece among the other things you’ve read. As with Casey Boyle’s “…something like a reading ethics…,” writing a rhetorical précis is a great, brief method for...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Approaches/rhetorical-precis",
+ "teaser": null
+ },{
+ "title": "Dendron",
+ "excerpt":" All Dendron items Beginning to Use Dendron :seedling: Literature Notes in Dendron :seedling: Task Tracking in Dendron :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Dendron/index",
+ "teaser": null
+ },{
+ "title": "Task Tracking in Dendron",
+ "excerpt":"My notes in Dendron are an unruly, monstrous hybrid of a bullet journal, a log, a set of resources, and other information. And I like it like that! They’re a continuation of the monthly planning files I used before Dendron came along. So if I use Dendron as a combination...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Dendron/task-tracking-in-dendron",
+ "teaser": null
+ },{
+ "title": "Beginning to Use Obsidian",
+ "excerpt":"What is Obsidian? Well, it’s complicated. And so are my feelings. The simple version is that Obsidian is an app that lets you write linked notes, mostly in Markdown format, and can render dynamically-updated sections of those notes. This last piece—the dynamic updating—is what makes it compelling and complicated. The...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Obsidian/beginning-to-use-obsidian",
+ "teaser": null
+ },{
+ "title": "Obsidian",
+ "excerpt":" All Obsidian items Beginning to Use Obsidian :seedling: Obsidian Plugins :herb: Obsidian Tasks Plugin :herb: ","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Obsidian/index",
+ "teaser": null
+ },{
+ "title": "Note taking",
+ "excerpt":"All Note taking folders Approaches Dendron Obsidian All Note taking items Casey Boyle's …something like a reading ethics… :seedling: Rhetorical Précis :seedling: Beginning to Use Dendron :seedling: Literature Notes in Dendron :seedling: Task Tracking in Dendron :seedling: Beginning to Use Obsidian :seedling: Obsidian Plugins :herb: Obsidian Tasks Plugin :herb: ","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/index",
+ "teaser": null
+ },{
+ "title": "Pedagogy",
+ "excerpt":" All Pedagogy items There's nothing here yet! ","categories": [],
+ "tags": [],
+ "url": "/notes/Pedagogy/index",
+ "teaser": null
+ },{
+ "title": "Articles",
+ "excerpt":" All my notes on articles I've read Actively Engaging Students in Asynchronous Online Classes. :herb: All my reading notes on articles by year There's nothing here yet! ","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Articles/index",
+ "teaser": null
+ },{
+ "title": "Capital is Dead. Is This Something Worse?",
+ "excerpt":"Wark asks us to think about information less like Marxists and more like Marx. ","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Books/wark-capital-is-dead",
+ "teaser": null
+ },{
+ "title": "Obsidian Plugins",
+ "excerpt":"Assumed audience People at least passably familiar with Obsidian. See my other notes on Obsidian for more context. What’s the Big Deal about Obsidian Plugins? One of the best—and most anxiety-producing, from the viewpoint of long-term stability—aspects of Obsidian is how the developers have opened up the app to community...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Obsidian/obsidian-plugins",
+ "teaser": null
+ },{
+ "title": "Obsidian Tasks Plugin",
+ "excerpt":"Assumed audience People at least passably familiar with Obsidian. See my other notes on Obsidian for more context. What is the Tasks plugin? Originally written by Martin Schenck and now expertly maintained by Clare Macrae, the Tasks plugin is the thing that ultimately convinced me to switch from Dendron to...","categories": [],
+ "tags": [],
+ "url": "/notes/Note-taking/Obsidian/obsidian-tasks-plugin-patterns",
+ "teaser": null
+ },{
+ "title": "Modernist Informatics: Literature, Information, and the State",
+ "excerpt":"Purdon examines modernist fiction to trace how writers experienced information culture as a disturbing interruption and governmental intrusion. ","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Books/purdon-modernist-informatics",
+ "teaser": null
+ },{
+ "title": "Actively Engaging Students in Asynchronous Online Classes.",
+ "excerpt":"From the paper’s own abstract: This paper suggests a three-pronged approach for conceptualizing active learning in the online asynchronous class: the creation of an architecture of engagement in the online classroom, the use of web-based tools in addition to the learning management system, and a re-imagining of discussion boards as...","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Articles/riggs-and-linder-actively-engaging-students",
+ "teaser": null
+ },{
+ "title": "Policing the Crisis: Mugging, the State, and Law and Order",
+ "excerpt":"Hall and cowriters provide a classic analysis of the rhetoric of a moral panic. ","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Books/hall-policing-the-crisis",
+ "teaser": null
+ },{
+ "title": "Books",
+ "excerpt":"All my notes on books I've read Capital is Dead. Is This Something Worse? :herb: Policing the Crisis: Mugging, the State, and Law and Order :herb: Overwhelmed: Literature, Aesthetics, and the Nineteenth-Century Information Revolution :herb: Modernist Informatics: Literature, Information, and the State :herb: All my reading notes on books by...","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Books/index",
+ "teaser": null
+ },{
+ "title": "Overwhelmed: Literature, Aesthetics, and the Nineteenth-Century Information Revolution",
+ "excerpt":"Lee explores the history of how various cultural formations around literature and information grew through the 19th Century Information Revolution. ","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/Books/lee-overwhelmed",
+ "teaser": null
+ },{
+ "title": "Reading",
+ "excerpt":"All Reading folders Articles Books All notes on what I've read Capital is Dead. Is This Something Worse? :herb: Overwhelmed: Literature, Aesthetics, and the Nineteenth-Century Information Revolution :herb: Policing the Crisis: Mugging, the State, and Law and Order :herb: Actively Engaging Students in Asynchronous Online Classes. :herb: Modernist Informatics: Literature,...","categories": [],
+ "tags": [],
+ "url": "/notes/Reading/index",
+ "teaser": null
+ },{
+ "title": "Snippets",
+ "excerpt":" All Snippets items Information Informatics :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Snippets/index",
+ "teaser": null
+ },{
+ "title": "Information Informatics",
+ "excerpt":"Here are some insightful snippets about “information” & “informatics” that I’ve found. 2020 Purdon, Modernist Informatics Modernist Informatics: Literature, Information, and the State In the company kept by the word—public service and business, agency and control—we can begin to discern the outline of a modern understanding of information as a...","categories": [],
+ "tags": [],
+ "url": "/notes/Snippets/information-informatics",
+ "teaser": null
+ },{
+ "title": "Jekyll",
+ "excerpt":" All Jekyll items Jekyll Guides :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/Jekyll/index",
+ "teaser": null
+ },{
+ "title": "Social Media",
+ "excerpt":" All Social Media items Mastodon Apps :seedling: Mastodon Settings :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/Social-Media/index",
+ "teaser": null
+ },{
+ "title": "VS Code",
+ "excerpt":" All VS Code items Daybreak Theme :herb: VS Code Snippets :herb: VS Code Spellcheck Squiggles :herb: VS Code note :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/VS-Code/index",
+ "teaser": null
+ },{
+ "title": "VS Code note",
+ "excerpt":"Here’s where I’ll detail aspects of how I set up and use of VS Code, which I adopted so I could use Dendron in particular. You can learn more about how I use Dendron in literature notes in dendron. ","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/VS-Code/vs-code",
+ "teaser": null
+ },{
+ "title": "Daybreak Theme",
+ "excerpt":"Horizon, then Daybreak I’m a big fan of dark themes. I’ve been using variants of Horizon for quite a while now in VS Code (as you can read about in vs code note), since I like the overall warmth of the theme’s color palette. Unfortunately, the person who initially designed...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/VS-Code/daybreak-theme",
+ "teaser": null
+ },{
+ "title": "Math Accessibility",
+ "excerpt":"Assumed audience People relatively—or almost entirely—new to web publishing I’ve lately done some work to improve the accessibility of math notation (equations, symbols, etc.) for users of screen readers online, particularly for the creation of open educational resources (OER). It’s been an unexpectedly engrossing investigation, so I figured I’d share...","categories": [],
+ "tags": [],
+ "url": "/notes/Accessibility/math-a11y",
+ "teaser": null
+ },{
+ "title": "Mastodon Apps",
+ "excerpt":"I’ve been using Mastodon for a while. Apparently at least since April of 2017‽?! I tend to use Mastodon on my phone at least as much as I do through a browser. At various times I’ve used Metatext, Mast, Amaroq, and a tab of Safari pinned to appear as its...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/Social-Media/mastodon-apps",
+ "teaser": null
+ },{
+ "title": "Mastodon Settings",
+ "excerpt":"This isn’t trying to be comprehensive, or even an overview. This is just me writing up some notes, as if I were explaining the settings to someone in my family. I’m not checking every setting to see if my recommendation varies from the default. If I remember, I’ll probably refine...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/Social-Media/mastodon-settings",
+ "teaser": null
+ },{
+ "title": "Jekyll Guides",
+ "excerpt":"I really enjoy using Jekyll, enough that I’d recommend it to anyone who is both looking to make their own site and has the time or inclination to do more “behind the scenes” than necessary for site made with WordPress or Squarespace. Jekyll’s own documentation is one of the most...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/Jekyll/jekyll-guides",
+ "teaser": null
+ },{
+ "title": "VS Code Snippets",
+ "excerpt":"This is one of my longest notes. Please don’t forget that the Table of Contents can help you jump to a particular section! I’m a fan of keeping a Bullet Journal in a text editor, as I’ve written about in task-tracking-in-dendron. A Digital Bullet Journal might not seem like a...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/VS-Code/vs-code-snippets",
+ "teaser": null
+ },{
+ "title": "VS Code Spellcheck Squiggles",
+ "excerpt":"There are a number of spellchecking extensions available for VS Code. I realized recently that I’d disabled the spellcheck I installed because of how distracting I found VS Code’s default squiggly lines. So I set about making them less intrusive, but still easily perceptible. Step 1: Check the Notification Class...","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/VS-Code/vs-code-spellcheck-squiggles",
+ "teaser": null
+ },{
+ "title": "Technology",
+ "excerpt":"All Technology folders Jekyll Social Media VS Code All Technology items Jekyll Guides :seedling: Mastodon Apps :seedling: Mastodon Settings :seedling: Daybreak Theme :herb: VS Code Snippets :herb: VS Code Spellcheck Squiggles :herb: VS Code note :seedling: ","categories": [],
+ "tags": [],
+ "url": "/notes/Technology/index",
+ "teaser": null
+ },{
+ "title": "Emerging Notes",
+ "excerpt":"Welcome to my notes! This is my digital garden—a loosely tended succulent collection. Pathways of thought represented via pixels, all perpetually in process. Show yourself around! :seedling: Emerging Notes _notes/ADHD-tech/about-ADHD-technologies.md :seedling: _notes/Accessibility/math-a11y.md :seedling: _notes/Note-taking/Approaches/casey-boyle-something-like-reading-ethics.md :seedling: _notes/Note-taking/Approaches/rhetorical-precis.md :seedling: _notes/Note-taking/Dendron/beginning-to-use-dendron.md :seedling: _notes/Note-taking/Dendron/literature-notes-dendron.md :seedling: _notes/Note-taking/Dendron/task-tracking-in-dendron.md :seedling: _notes/Note-taking/Obsidian/beginning-to-use-obsidian.md :seedling: _notes/Snippets/information-informatics.md :seedling: _notes/Technology/Jekyll/jekyll-guides.md :seedling: _notes/Technology/Social-Media/mastodon-apps.md...","categories": [],
+ "tags": [],
+ "url": "/notes/emerging-notes",
+ "teaser": null
+ },{
+ "title": "Notes Index",
+ "excerpt":"Welcome to my notes! This is my digital garden—a loosely tended succulent collection. Pathways of thought represented via pixels, all perpetually in process. Show yourself around! All folders ADHD ADHD-tech Accessibility Keywords Listening Note-taking Pedagogy Reading Snippets Technology :house_with_garden: All my notes _notes/ADHD-tech/about-ADHD-technologies.md :seedling: _notes/ADHD-tech/apple-watch-ADHD.md :herb: _notes/Accessibility/math-a11y.md :seedling: _notes/Note-taking/Approaches/casey-boyle-something-like-reading-ethics.md :seedling:...","categories": [],
+ "tags": [],
+ "url": "/notes/index",
+ "teaser": null
+ },{
+ "title": "New Site",
+ "excerpt":"Complicating, circulating…new site, new site. Operating, generating…new site, new site. Thanks for coming by, and for indulging my Depeche Mode reference.1 This new site is decidedly in an early state of becoming, as I figure out how to use Jekyll and this particular theme. I’ll probably use this for more...","categories": [],
+ "tags": ["meta"],
+ "url": "/new-site",
+ "teaser": null
+ },{
+ "title": "Test One",
+ "excerpt":" If everything is ready from the dark side of the moon… …play the five tones. ","categories": [],
+ "tags": ["meta"],
+ "url": "/test-one",
+ "teaser": null
+ },{
+ "title": "New Directions in Information Fluency",
+ "excerpt":"On April 4th & 5th, I drove up to Augustana College in Rock Island, Illinois with my friend & colleague Katherine Ahnberg for the New Directions in Information Literacy conference at Augustana College. As Katherine recently wrote, we presented a brief history of humanities computing (digital humanities or DH), an...","categories": ["blog"],
+ "tags": ["conferences","presentations","digital humanities"],
+ "url": "/blog/new-directions-in-information-fluency",
+ "teaser": null
+ },{
+ "title": "Bigfoot Spotting and Other Jekyll Adventures",
+ "excerpt":"Here’s a test of Bigfoot.js, a rather awesome addition to the web. 1 (edit: It’ll remain elusive, see footnote #2.)2 (edit № 2: I’ve gotten it to work, as of 2015-05-31! It wasn’t an issue with Jekyll or GitHub Pages, but rather with my understanding of how Jekyll & GitHub...","categories": [],
+ "tags": ["meta","tech tools"],
+ "url": "/bigfoot-spotting",
+ "teaser": null
+ },{
+ "title": "Review of Online Archive of California",
+ "excerpt":"This post was originally an assignment for John Walsh’s “Z652 Digital Libraries” course at IU-Bloomington. A fantastic clearing house of information about Californian collections, the Online Archive of California serves as a centralized set of links to and descriptions of an enormous number of collections from various archives, historical societies,...","categories": [],
+ "tags": ["digital humanities","coursework"],
+ "url": "/review-of-online-archive-of-california",
+ "teaser": null
+ },{
+ "title": "Software Carpentry Workshop Reflections",
+ "excerpt":"Welcome to the Command Line It wasn’t quite Tron: I jumped into the world of computing for two days while taking a Software Carpentry workshop and it turned out highly illuminating without being threatening. This post aims to summarize what I learned & its relevance to librarians and/or digital humanities...","categories": [],
+ "tags": ["digital humanities"],
+ "url": "/software-carpentry-workshop-reflections",
+ "teaser": null
+ },{
+ "title": "“Paper,” “Planned Obsolescence,” and Digital Libraries",
+ "excerpt":"This post was originally an assignment for John Walsh’s “Z652 Digital Libraries” course at IU-Bloomington. Two talks given at IU in the last month offer insights for digital libraries, one benefiting from direct experimentation with forms of scholarly communication and sustained analysis of academic practices, while the other’s scope provides...","categories": [],
+ "tags": ["digital libraries","coursework"],
+ "url": "/paper-planned-obsolescence-and-digital-libraries",
+ "teaser": null
+ },{
+ "title": "#critlib Chatty Critical Librarianship on Twitter",
+ "excerpt":"Here’s a post I wrote for Hack Libary School on critical librarianship and the #critlib chats on Twitter. I also discuss student-led interests groups, metacognition, and Bloom’s Taxonomy of educational objectives. There’s even a brief bibliography of anthologies to check out for more on critical librarianship. ","categories": [],
+ "tags": ["critlib chats","hack library school"],
+ "url": "/critlib-chatty-critical-librarianship-on-twitter",
+ "teaser": null
+ },{
+ "title": "How Do You Take Notes (or Markdown and Bullet Journals)",
+ "excerpt":"Here’s a post I wrote for Hack Library School discussing Markdown and the Bullet Journal system for note-taking. Markdown is a simplified way of writing html, and happens to also be what I use when writing this site through Jekyll and GitHub Pages. Bullet Journals are a system not for...","categories": [],
+ "tags": ["hack library school","markdown","meta","notetaking"],
+ "url": "/how-do-you-take-notes-or-markdown-and-bullet-journals",
+ "teaser": null
+ },{
+ "title": "Freire and Critical Librarianship",
+ "excerpt":"This post is for Week One of MOOC MOOC: Critical Pedagogy. Processes. Processes, all the way down. That’s what strikes me most about the first three chapters of Freire’s The Pedagogy of the Oppressed: his insistence on processes of becoming, of history, of liberation, and of course, of pedagogy through...","categories": [],
+ "tags": ["critlib chats","pedagogy","moocmooc","critical theory","featured"],
+ "url": "/freire-and-critical-librarianship",
+ "teaser": null
+ },{
+ "title": "#critlib Makerspaces",
+ "excerpt":"Friend or Foe? I recently had the pleasure of moderating a #critlib chat on Makerspaces. These spaces have been enjoying increasing popularity in libraries, demonstrating how libraries function as far more than warehouses for documents. At their best, makerspaces help community members learn by doing, regardless of whether these spaces...","categories": [],
+ "tags": ["critlib chats","pedagogy","makerspaces"],
+ "url": "/critlib-makerspaces",
+ "teaser": null
+ },{
+ "title": "Wojnarowicz on a Sphere",
+ "excerpt":":warning: :construction: This post is currently under construction. The actual project grew out of an assignment for John Walsh’s “Z652 Digital Libraries” course at IU-Bloomington. When I learned that we would be doing a mapping project for John Walsh’s Digital Humanities course, two artists quickly sprang to mind due to...","categories": [],
+ "tags": ["coursework","digital humanities","visual culture"],
+ "url": "/wojnarowicz-on-a-sphere",
+ "teaser": null
+ },{
+ "title": "Learning Subjectives",
+ "excerpt":"This post is for Week One of #rhizo15. Here’s something I constantly rediscover, sometimes painfully: although I’m a capable writer, I’m predisposed toward research. This orientation seems both a boon and a hindrance as an aspiring academic librarian. Research calls to me in large part because of its rhizomatic nature—I...","categories": [],
+ "tags": ["rhizo15","neutrality","pedagogy","digital humanities"],
+ "url": "/learning-subjectives",
+ "teaser": null
+ },{
+ "title": "Hack Quirk Your Presentations",
+ "excerpt":"A new post of mine recently went up at Hack Library School. It’s about a simple technique that I’ve noticed can help instruction sessions or resource demonstrations feel a bit more exciting and memorable: highlighting a quirky result or aspect of the interface. As a bonus, I talk about Batman,...","categories": [],
+ "tags": ["hack library school","instructional design & tools","digital humanities"],
+ "url": "/del-hack-del-quirk-your-presentations",
+ "teaser": null
+ },{
+ "title": "Everything Counts in Affective Amounts",
+ "excerpt":"This post is for Week Two of #rhizo15. Typing Hands Type What They Can Over the last week I’ve effectively been teaching myself Zurb’s Foundation website framework as part of using it to make a prototype website for an information architecture course. Participating in #rhizo15 has primed me to really...","categories": [],
+ "tags": ["rhizo15","digital humanities","tech tools"],
+ "url": "/everything-counts-in-affective-amounts",
+ "teaser": null
+ },{
+ "title": "#Rhizo15 Week Three: "Content is People"",
+ "excerpt":"This post is for Week Three of #rhizo15: “The Myth of Content.” Even though I’m writing this during Week Five, I’m trying to put my thoughts out a little quicker than usual in this post, in keeping with my post from Week One. For Week Three, Dave asked: So what...","categories": [],
+ "tags": ["rhizo15","pedagogy","critical information literacy"],
+ "url": "/rhizo15-week-three",
+ "teaser": null
+ },{
+ "title": "Quick Thoughts on Method & Knowledge Practices in Arts & Humanities",
+ "excerpt":"Earlier today I saw a few #critlib threads swirling around on Twitter—here’s one and here’s another. The ones that caught my eyes mostly had to do with how open #critlib twitter chats & their participants seem to critique or criticism, the extent to which critical theory has to do with...","categories": [],
+ "tags": ["critlib chats","pedagogy","method"],
+ "url": "/quick-thoughts-on-method",
+ "teaser": null
+ },{
+ "title": "Presentation Alternatives: Reveal.js",
+ "excerpt":"Here’s a post I wrote for Hack Library School talking about my experience with the Reveal.js JavaScript presentation framework. Not only does it hew to my goal of choosing open-source tools over proprietary formats whenever feasible, its functionality and inherent ability to make presentations shareable on the web make it...","categories": [],
+ "tags": ["presentations","tech tools","pedagogy","critical theory","a11y","hack library school"],
+ "url": "/reveal-js-hack-library-school",
+ "teaser": null
+ },{
+ "title": "Critical Hot Potato! aka #Rhizo15 Week Four",
+ "excerpt":"This post responds to the prompt for Week Four of #rhizo15: “How Do We Teach Rhizomatically?”. For Week Four, Dave asked: “I think there is value in the ‘course’ in the sense of the eventedness that it represents. It’s a chance for people to come together and focus on a...","categories": [],
+ "tags": ["rhizo15","critlib chats","critical theory"],
+ "url": "/critpotato-rhizo15-week-four",
+ "teaser": null
+ },{
+ "title": "All Hail Cloud Storage",
+ "excerpt":"I wrote for Hack Library School about why & how I use Dropbox. What I didn’t include were particular recommendations for other programs that integrate nicely with Dropbox. Perhaps it’s my college dj training that makes me super hesitant to encourage people to buy a particular program or product when...","categories": [],
+ "tags": ["hack library school","markdown","meta","tech tools"],
+ "url": "/all-hail-cloud-storage",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 36",
+ "excerpt":"#radlibchat “Librarians’ views on critical theories and critical practices” On Tuesday, 2015-09-01, there was a great #radlibchat focused on librarians’ views of critical theories and critical practices. Hosted by the Radical Librarians Collective, this recently-begun set of chats take place once a month. Much like #critlib chats, they suggest readings...","categories": ["weekly-assemblage"],
+ "tags": ["critical theory","privacy"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-36",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 37",
+ "excerpt":"#critlib chat on Information & Migrant Populations Tuesday, 2015-09-08, saw a #critlib Twitter chat on information & migrant populations. Amiably—and admirably—moderated by Greg Bemb, this chat took a broad approach to considering the information and access needs of different migrant communities. Participants considered international migration, urbanization within a particular country,...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","privacy","cfp","critical race studies"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-37",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 38",
+ "excerpt":"I’m posting this week’s write-up a bit late since this week was basically spent furiously packing and then on the road, moving from Bloomington, Indiana all the way to Boise, Idaho! This week we’ve got photos of that trip, plus reflections on a book I read before the trip. Westward,...","categories": ["weekly-assemblage"],
+ "tags": ["critical theory"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-38",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 39",
+ "excerpt":"I’m publishing this week’s write-up rather late—but I do want to document the experience of moving somewhat, for other future librarians who move! Couple new library cards to really help me feel welcomed! #westwardidaho A photo posted by Ryan Randall (@foureyedsoul) on Sep 26, 2015 at 5:07pm PDT This...","categories": ["weekly-assemblage"],
+ "tags": ["pedagogy","critical information literacy"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-39",
+ "teaser": null
+ },{
+ "title": "This Is Not a Pipette: Bringing Humanities Methods into LIS Programs",
+ "excerpt":"I recently wrote a post for Hack Library School on examples of how we might break humanities methodologies to bear on information studies. In part, I wrote this in response to the recent statement by the editors of College & Research Libraries that they are looking for papers that use...","categories": [],
+ "tags": ["hack library school","critical theory"],
+ "url": "/this-is-not-a-pipette",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 40",
+ "excerpt":"Here’s another decidedly-after-the-fact post—who knew that moving could upend so many things? This week I began my position as the Instruction and Outreach Librarian at the College of Western Idaho! Peculiarly enough, my starting date aligned with the annual conference of the Idaho state library association. Rather than have me...","categories": ["weekly-assemblage"],
+ "tags": ["conferences"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-40",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 41",
+ "excerpt":"#critlib chat on Scientific Objectivity Rory Litwin of Library Juice Press recently moderated a #critlib Twitter chat on neutrality and objectivity in scientific information. Referencing the “Scientific Objectivity” article by Julian Reiss and Jan Sprenger from the excellent, open-access Stanford Encyclopedia of Philosophy, this chat dealt with the tension between...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","critical information literacy","critical race studies"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-41",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 42",
+ "excerpt":"Crissinger’s “Being ‘Human’ in the Classroom” Live! Real! Human! Sarah Crissinger’s recent “Being ‘Human’ in the Classroom: A Case for Personal Testimony in Pedagogy” post at ACRLog does a wonderful job of giving specifics on how librarians can use our personal experiences with the research process while instructing students. Maybe...","categories": ["weekly-assemblage"],
+ "tags": ["critical information literacy","pedagogy"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-42",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 43",
+ "excerpt":"We’ve had two notable projects at our library this week: working on a “Five Year Vision of the Library” document and preparing for the Halloween outreach events. I’ll post photos of the outreach things next week, but this week I’ll just mention that a shared, editable Google Doc has worked...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","gender","librar* history"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-43",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 44",
+ "excerpt":"This Is Halloween A couple of the CWI Library student workers suggested Once Upon a Time as a theme for our Halloween decorations, and we ended up embracing it enthusiastically. I admittedly had to do some ahem “binge watching research” on Netflix, but our approach to the theme said that...","categories": ["weekly-assemblage"],
+ "tags": ["outreach"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-44",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage 2015 Week 45",
+ "excerpt":"Read of the Week As an Instruction & Outreach Librarian, one of the things I’m currently trying to do is revamp our fliers and other materials that broadcast what we can do for instructors. Our current materials were written before the ACRL Framework came out, so I’m trying to update...","categories": ["weekly-assemblage"],
+ "tags": ["critical information literacy","meta"],
+ "url": "/weekly-assemblage/weekly-assemblage-2015-week-45",
+ "teaser": null
+ },{
+ "title": "WA 2015 Week 46 Massumi and North",
+ "excerpt":"Reads of the Week! “Undigesting Deleuze” by Brian Massumi, accessible at LA Review of Books “The Idea of a Writing Center” by Stephen M. North in College English v46 n5 p433-46 Sep 1984 This has been a week of reading things that help me frame librarianship in new ways. The...","categories": ["weekly-assemblage"],
+ "tags": ["critical theory","infrastucture","critical information literacy"],
+ "url": "/weekly-assemblage/WA-2015-week-46-Massumi-and-North",
+ "teaser": null
+ },{
+ "title": "WA 2015 Week 47 Schoofs and Battista",
+ "excerpt":"Reads this Week How did I forget about the LOEX Quarterly’s articles being effectively open access after a year? This means it’s a great place to look for articles to share, such as for #critlib discussions. These two are both short enough that I won’t really reprise much of them...","categories": ["weekly-assemblage"],
+ "tags": ["critical information literacy"],
+ "url": "/weekly-assemblage/wa-2015-week-47",
+ "teaser": null
+ },{
+ "title": "WA 2015 Week 48 Fister, Kurz, Vecchione",
+ "excerpt":"Reads this Week It’s 2015-12-12 and I’m still looking at the rough draft of this post languishing unpublished. So instead of trying to annotate why I like these so much, I’m just going to grab a quote that I hope entices you to read each of them. Clearly, I’m still...","categories": ["weekly-assemblage"],
+ "tags": ["makerspaces"],
+ "url": "/weekly-assemblage/wa-2015-week-48",
+ "teaser": null
+ },{
+ "title": "WA 2015 Week 49 Holman, Mattern, Barron, Students",
+ "excerpt":"Reads This Week It’s 2015-12-12 and I’m still looking at the rough draft of this post languishing unpublished. So instead of heavily annotating why I like these so much, I’m just going to grab a quote that I hope entices you to read each of them. Clearly, I’m still figuring...","categories": ["weekly-assemblage"],
+ "tags": ["makerspaces","infrastucture"],
+ "url": "/weekly-assemblage/wa-2015-week-49",
+ "teaser": null
+ },{
+ "title": "critlib #feelings",
+ "excerpt":"This is a post for the upcoming #critlib chat: “#feelings”. Why are you a critical librarian? Libraries exist as spaces for transformation and change. Without being convinced about the effects of library access on his own life, Andrew Carnegie almost certainly wouldn’t have helped fund so many libraries with free...","categories": [],
+ "tags": ["critlib chats","critical theory","featured"],
+ "url": "/critlib-feelings",
+ "teaser": null
+ },{
+ "title": "Weekly Whaaa…?",
+ "excerpt":"Having written these for a while, I think I’ve finally got an inkling of what they are do & how to describe them! tl;dr version For the tl:dr version, I want to share things in a form that accommodates things outside of well-crafted shorter essays, “proper” blog posts, or posts...","categories": ["weekly-assemblage"],
+ "tags": ["meta"],
+ "url": "/weekly-assemblage/weekly-whaaa",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 01: #critlib chat on information resources & incarcerated people",
+ "excerpt":"Weekly Whaaa…? #critlib chat on Information Resources & Incarcerated People On Monday, 2016-01-04, I was lucky to co-moderate a #critlib chat with Seattle’s Books to Prisoners on information resources & incarcerated people. With my previous knowledge of prison libraries only being a bit of volunteering for Bloomington, Indiana’s Midwest Pages...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","moocmooc","tech tools"],
+ "url": "/weekly-assemblage/wa-2016-week-01",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 02: Giroux on Neutrality",
+ "excerpt":"Weekly Whaaa…? Giroux’s “Schooling and the Culture of Positivism: Notes on the Death of History” Over the holidays I read Giroux’s On Critical Pedagogy, a collection of some older and new essays. The one that particularly sticks with me is “Schooling and the Culture of Positivism: Notes on the Death...","categories": ["weekly-assemblage"],
+ "tags": ["critical theory","neutrality"],
+ "url": "/weekly-assemblage/wa-2016-week-02",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 03: Du Bois & scientific sociology, #WOCinTechChat stock photos, LIS Mental Health Week",
+ "excerpt":"Weekly Whaaa…? “The Case for Scholarly Reparations” and #critlib scholarly communication A great read starting off this week was Julian Go’s The Case for Scholarly Reparations, a review essay on Aldon Morris’ The Scholar Denied. The main argument—seemingly shared by Morris and Go—is that Du Bois’ Atlanta School began scientific...","categories": ["weekly-assemblage"],
+ "tags": ["scholarly communication","librar* history","outreach"],
+ "url": "/weekly-assemblage/wa-2016-week-03",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 04: Library Privacy",
+ "excerpt":"Weekly Whaaa…? I’m doing a few of these quite a bit after the fact. ACLU Idaho & Alison Macrina at Meridian Public Library These two presenters were stellar. Here’s just a bit of my notes from each. If you want notes in their entirety, feel free to contact me to...","categories": ["weekly-assemblage"],
+ "tags": ["privacy"],
+ "url": "/weekly-assemblage/wa-2016-week-04",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 05: #critlib chat on Patience and Impatience; Alison Hicks' LibGuides: Pedagogy to Oppress?",
+ "excerpt":"Weekly Whaaa…? I’m doing a few of these quite after the fact. One of the highlights of this week was the #critlib chat on Patience and Impatience, moderated by Lisa Hinchliffe , Cecily Walker, and April Hathcock. It was “a chance for everyone to talk about the struggles we face...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","pedagogy"],
+ "url": "/weekly-assemblage/wa-2016-week-05",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 06: THATCampBoiseState 2016",
+ "excerpt":"Weekly Whaaa…? Here’s another post I’m doing well after the fact. The highlight of this week was attending #THATCampBSU, an unconference around The Humanities and Technology. I met an awful lot of cool people ranging from local activists to coders to librarians. Thankfully, almost everyone there seemed to wear multiple...","categories": ["weekly-assemblage"],
+ "tags": ["conferences"],
+ "url": "/weekly-assemblage/wa-2016-week-06",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 07: Tools for Thinking",
+ "excerpt":"Weekly Whaaa…? Here’s another post I’m writing well after the fact. This week I taught a ton of information literacy/Library 101-style sessions. Tools for Thinking The main “new” things for me this week were that I found a few great handouts to use in these sessions—these are the type of...","categories": ["weekly-assemblage"],
+ "tags": ["tech tools","tools for thinking"],
+ "url": "/weekly-assemblage/wa-2016-week-07",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 08: CLAPS2016 Critical Librarianship and Pedagogy Symposium",
+ "excerpt":"Weekly Whaaa…? This week was :clap: :clap: :clap: #CLAPS2016, more formally known as the Critical Librarianship and Pedagogy Symposium at the University of Arizona in Tucson. It was fantastic meeting in person with folks I’ve conversed with online. I’m still mentally processing all of the different sessions, so here’s a...","categories": ["weekly-assemblage"],
+ "tags": ["conferences"],
+ "url": "/weekly-assemblage/wa-2016-week-08",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 12: DERAIL, Site Updates",
+ "excerpt":"Weekly Whaaa…? Although I aspire to write these “Weekly Assemblage” posts every week, in the spirit of a sort of weekly Library Day in the Life Project, that clearly doesn’t always happen. The last few weeks have been busy in various ways, so I’ll just do a quick round-up of...","categories": ["weekly-assemblage"],
+ "tags": ["conferences","meta"],
+ "url": "/weekly-assemblage/wa-2016-week-12",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 14: Intro to #critlib chat, Reveal.js image alt tags",
+ "excerpt":"Weekly Whaaa…? Intro to #critlib chat Courtney Boudreau hosted the second intro to #critlib chat, having co-hosted one earlier with Annie Pho. Here’s a link to the Storify made by Alice Prael. A3. It would be cool to see #critlib extend across all of LAM. Fascinating stuff is going on...","categories": ["weekly-assemblage"],
+ "tags": ["critlib chats","makerspaces","a11y"],
+ "url": "/weekly-assemblage/wa-2016-week-14",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 15: UC Davis Wants Some Scrubs",
+ "excerpt":"Weekly Whaaa…? Radical Librarians #radlibchat This week, the Radical Librarians hosted a chat with April Hathcock. UC Davis wants some scrubs UC Davis paid consultants at least $175,000 for attempts to scrub the Internet of links about their pepper spraying of nonviolent student protestors. someones going to write about how...","categories": ["weekly-assemblage"],
+ "tags": ["dissent","critical librarianship history"],
+ "url": "/weekly-assemblage/wa-2016-week-15",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 16: SWILA 2016; Joacim Hansson on Chantal Mouffe",
+ "excerpt":"Weekly Whaaa…? SWILA UnConference 2016 The Southwest Idaho Library UnConference, held at the Collister branch of the Boise Public Library, went wonderfully! Here’s what people tweeted about it. For me, the (unplanned!) outreach session was a highlight, as well as the very planned user experience one. Read Hansson on Mouffe...","categories": ["weekly-assemblage"],
+ "tags": ["conferences"],
+ "url": "/weekly-assemblage/wa-2016-week-16",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 17: Research Notebook is Go!",
+ "excerpt":"Weekly Whaaa…? Having kicked the idea around for a while, I finally took a couple evenings to work out how I’ll attempt an Open Humanities Research Notebook. Behold: it lives! As I say over there, I realized that I often feel a need to wrap posts up tidily here somehow....","categories": ["weekly-assemblage"],
+ "tags": ["meta"],
+ "url": "/weekly-assemblage/wa-2016-week-17",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 18: First Reading Notes and #critlib on Emotional Labor",
+ "excerpt":"Weekly Whaaa…? Reading Notes I posted the first reading notes on my open research notebook, as well as starting to read the Information Literacy chapter from Handbook for Community College Librarians by Michael A. Crumpton and Nora J. Bird. #critlib on Emotional Labor There was a #critlib chat focused on...","categories": ["weekly-assemblage"],
+ "tags": ["instruction assessment","critlib chats"],
+ "url": "/weekly-assemblage/wa-2016-week-18",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 19: SJL Seattle and Lots of Great Readings",
+ "excerpt":"Weekly Whaaa…? Social Justice and Libraries Student-Run Open Conference in Seattle SJL Seattle happened on 2016-05-14. Congratulations to the student organizers, Reed Garber-Pearson, Allison Reibel, and Marisa Petrich on what appears to have been a fantastic day! I considered driving over from Boise, but ultimately wasn’t able to make it....","categories": ["weekly-assemblage"],
+ "tags": ["conferences","critical librarianship","critical librarianship history","librar* history"],
+ "url": "/weekly-assemblage/wa-2016-week-19",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 27: Weekly Roundup and Website Housekeeping",
+ "excerpt":"Weekly Whaaa…? Weekly Roundup I read a lot this last week or so—too much to annotate each in depth. So I’ll just quickly post links to all of these and suggest you go check them out: Rebecca Halpern and Chimene Tucker’s “Leveraging Adult Learning Theory with Online Tutorials” article gave...","categories": ["weekly-assemblage"],
+ "tags": ["tools for thinking"],
+ "url": "/weekly-assemblage/wa-2016-week-27",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 31: Design Things Galore",
+ "excerpt":"Weekly Whaaa…? Design Things, Here, There, and Everywhere It’s been a while since I’ve had time to post one of these. I realized that there were a few design related things in my “I should post about this” file, so here they are! The buttons templates and tutorials from Librarian...","categories": ["weekly-assemblage"],
+ "tags": ["design","meta"],
+ "url": "/weekly-assemblage/wa-2016-week-31",
+ "teaser": null
+ },{
+ "title": "WA 2016 Week 32: Lots of Linkage; Comments Have Arrived",
+ "excerpt":"Weekly Whaaa…? Lots of Linkage Here’s a handful of links that I either shared or meant to share on Twitter: Rachael Neu linked to Richard Van Heertum’s “How Objective is Objectivity?” article in UCLA InterActions journal recently in a list-serv. I’m eagerly awaiting reading that article, but in the meanwhile...","categories": ["weekly-assemblage"],
+ "tags": ["meta"],
+ "url": "/weekly-assemblage/wa-2016-week-32",
+ "teaser": null
+ },{
+ "title": "Critical Reflection #critlib chat",
+ "excerpt":"Here’s a post in preparation for the “Critical Reflection” #critlib chat moderated by Lisa Hubbell. Lisa Hubbell’s commitment to making this chat about critical reflection more accessible to people for whom Twitter isn’t optimal inspired me enough to want to do a “seeding” blog post of my own. The topic...","categories": [],
+ "tags": ["critlib chats","tools for thinking"],
+ "url": "/critical-reflection",
+ "teaser": null
+ },{
+ "title": "WA 2017 Week 01: Journaling, Pedagogy, and Advocating for our Patrons",
+ "excerpt":"Weekly Whaaa…? Craig Eley’s Jekyll logbook theme Perhaps it was due to participating in the #critlib chat on reflection, moderated by Lisa Hubbell? Perhaps it was because I miss using DayOne, which I slowly abandoned after they changed how they sync the files? Perhaps it’s just that I’ve gotten really...","categories": ["weekly-assemblage"],
+ "tags": ["meta","critlib chats","neutrality","pedagogy"],
+ "url": "/weekly-assemblage/wa-2017-week-01",
+ "teaser": null
+ },{
+ "title": "WA 2017 Week 09: Badges, Type, BibTeX",
+ "excerpt":"Weekly Whaaa…? Emily Ford’s “To badge or not to badge? From ‘yes’ to ‘never again’” “To badge or not to badge? From ‘yes’ to ‘never again’” I really like this article and appreciate Emily Ford’s perspective here. Oddly enough, we’ve gone ahead with a variant of badging at my college...","categories": ["weekly-assemblage"],
+ "tags": ["badging","tech tools","type"],
+ "url": "/weekly-assemblage/wa-2017-week-09",
+ "teaser": null
+ },{
+ "title": "ALA Annual 2018: My Schedule, Our Notes",
+ "excerpt":"#ALAAC2018 I haven’t been to an Annual ALA Conference yet, so it’ll be interesting to see how my attention can hold up to meeting so many people and hearing so many ideas. I’ve been to a number of smaller conferences, but nothing on this scale. Building from the Critical ALA...","categories": [],
+ "tags": ["conferences"],
+ "url": "/my-ala-annual-2018-schedule",
+ "teaser": null
+ },{
+ "title": "ah, Carl, while you are not safe I am not safe",
+ "excerpt":"Braiding Together a Few Strands of Thought This post was prompted by a few things I saw on Mastodon and Twitter, plus having wanted to write something during LIS Mental Health Week for a few years now. I started drafting it as a short thread that brought in the social...","categories": [],
+ "tags": ["neurodiversity","LISMentalHealth","a11y"],
+ "url": "/while-you-are-not-safe-i-am-not-safe",
+ "teaser": null
+ },{
+ "title": "Introducing Monthly Signal Boosts",
+ "excerpt":"What’s This About? It’s pretty clear that my weekly assemblage posts aren’t particularly sustainable, at least at the moment. All the same, I want to get back to regular posts. With these I aim at boosting—sometimes also critiquing—things that I appreciate. Seeing Jessica Schomberg’s Monthly Reading Lists gave me the...","categories": ["monthly-signal-boost"],
+ "tags": [],
+ "url": "/monthly-signal-boost/introducing-monthly-signal-boosts",
+ "teaser": null
+ },{
+ "title": "July 2020 Monthly Signal Boost",
+ "excerpt":"Monthly What? Podcasts Organizing Ideas Podcast: Episode 20 with Jessica Schomberg Jessica Schomberg talks about their book, other readings they’ve learned from, how workplace improvements for disabled folks will lead to better workplaces for everyone, about relationships and solidarity in library work. It’s a really engaging listen! The Latino Card:...","categories": ["monthly-signal-boost"],
+ "tags": [],
+ "url": "/monthly-signal-boost/july-2020-monthly-signal-boost",
+ "teaser": null
+ },{
+ "title": "SIFT Links",
+ "excerpt":"Here are some links related to my submission to the “innovative ideas” lightning talk / virtual poster session of the 2020 MOSS Meetup organized by ICfL. The SIFT Moves Introducing SIFT, a Four Moves Acronym, Mike Caulfield’s initial post about the moves Check, Please! Course, an OER textbook with explanations...","categories": [],
+ "tags": ["conferences","pedagogy"],
+ "url": "/sift-links",
+ "teaser": null
+ },{
+ "title": "New note on Apple Watches and ADHD",
+ "excerpt":"I just published a new note on Apple Watches and ADHD in my digital garden / wonky wiki. It’s one of my first! ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-apple-watch-and-adhd",
+ "teaser": null
+ },{
+ "title": "August 2020 Monthly Signal Boost",
+ "excerpt":"Monthly What? 2020 has not been a kind year. This last month has been hectic and at times very overwhelming. Here’s some of what has worked to keep my spirits up. Mindfulness I’ve been trying to get back into mindfulness & meditation practices, since I’d like to more skillfully recognize...","categories": ["monthly-signal-boost"],
+ "tags": [],
+ "url": "/monthly-signal-boost/august-2020-monthly-signal-boost",
+ "teaser": null
+ },{
+ "title": "New note on ADHD technologies",
+ "excerpt":"I just published a new note on ADHD technologies in my digital garden / wonky wiki. It’s one of my first! ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-adhd-technologies",
+ "teaser": null
+ },{
+ "title": "New note on reading snippets about Information and Informatics",
+ "excerpt":"I just published a new note with some snippets about information and informatics in my digital garden / wonky wiki. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-informatics-readings",
+ "teaser": null
+ },{
+ "title": "New note on the VS Code editor",
+ "excerpt":"I’ve just made a new note about the VS Code text editor, and why I like it. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-vs-code",
+ "teaser": null
+ },{
+ "title": "New note on keeping literature notes in Dendron",
+ "excerpt":"I’ve just made a new note about how I keep literature notes in Dendron. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-keeping-literature-notes-in-dendron",
+ "teaser": null
+ },{
+ "title": "New note on the Daybreak theme for VS Code",
+ "excerpt":"I’ve just made a new note about the Daybreak theme for VS Code, and my customizations to it. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-the-daybreak-theme",
+ "teaser": null
+ },{
+ "title": "New note on beginning to use Dendron",
+ "excerpt":"I’ve just made a new note where I’ll keep suggestions for beginning to use Dendron. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-beginning-to-use-dendron",
+ "teaser": null
+ },{
+ "title": "New note on math accessibility",
+ "excerpt":"I’ve written a new note with what I’ve recently learned about ways to make equations and other math notation more accessible online. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-math-accessibility",
+ "teaser": null
+ },{
+ "title": "New note on task tracking in Dendron",
+ "excerpt":"I just published a new note on how I track tasks in Dendron in my digital garden / wonky wiki. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-task-tracking-in-dendron",
+ "teaser": null
+ },{
+ "title": "New note on Mastodon iOS apps",
+ "excerpt":"I’ve just made a new note where I’ll keep annotated links to particularly useful Jekyll guides. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-mastodon-ios-apps",
+ "teaser": null
+ },{
+ "title": "New note on Mastodon Settings",
+ "excerpt":"I’ve just made a new note where I’ll keep annotated links to particularly useful Jekyll guides. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-mastodon-settings",
+ "teaser": null
+ },{
+ "title": "Introducing Blips and Link Rhizomes",
+ "excerpt":"Here We Go, What’s Our Scenarios? Blips Blog posts feel to me like they should involve a few paragraphs, and probably shouldn’t happen more than once a day. Maybe just a few a week is what feels right for them on my own site. (This feeling is just for my...","categories": ["blips"],
+ "tags": [],
+ "url": "/blips/introducing-blips-and-link-rhizomes",
+ "teaser": null
+ },{
+ "title": "New note on Jekyll Guides",
+ "excerpt":"I’ve just made a new note where I’ll keep annotated links to particularly useful Jekyll guides. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/jekyll-guides-note",
+ "teaser": null
+ },{
+ "title": "Phone to Blog Blip Workflow",
+ "excerpt":"Couch to Internet With a cat snoozing on my lap and less than 10 minutes before I’m supposed to start watching a new-to-me episode of Star Trek: The Next Generation, the thought occurred to me: how quickly could I make a blog post happen? Long ago I set up Working...","categories": ["blips"],
+ "tags": [],
+ "url": "/blips/phone-to-blog-blip-workflow",
+ "teaser": null
+ },{
+ "title": "New note on Rhetorical Précis",
+ "excerpt":"I’ve just made a new note about the rhetorical précis format for taking reading notes. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-rhetorical-precis",
+ "teaser": null
+ },{
+ "title": "New note on Casey Boyle's …something like a reading ethics…",
+ "excerpt":"I’ve just made a new note about Casey Boyle’s …something like a reading ethics…, which is a very useful approach to reading and taking notes. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-casey-boyles-something-like-a-reading-ethics",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage for 2023 Week 09",
+ "excerpt":"Weekly Whaaa…? Daily Notes in Dendron For whatever reason, I’ve been using daily notes in Dendron this week, and it’s been a pleasant and useful addition to my usual practices. Although many people who use tools like Dendron or Obsidian seem to prefer working out of daily notes, I do...","categories": ["weekly-assemblage"],
+ "tags": [],
+ "url": "/weekly-assemblage/wa-2023-week-09",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage for 2023 Week 10",
+ "excerpt":"Weekly Whaaa…? Week of Sidequests In many ways, this week has felt like a bundle of sidequests, with little obvious at the end. But hey, some weeks are like that. I ended up spending a lot of time doing spring cleaning of my task notes. FOSS and Crafts Podcasts For...","categories": ["weekly-assemblage"],
+ "tags": [],
+ "url": "/weekly-assemblage/wa-2023-week-10",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage for 2023 Week 12",
+ "excerpt":"Weekly Whaaa…? Patterns for VS Code The last couple of weeks I’ve been helping some faculty members create more accessible data tables. That kind of repetitive structure is a great candidate for a code snippet—so I made a few! Here’s the surprisingly long VS Code Snippets note I just wrote...","categories": ["weekly-assemblage"],
+ "tags": [],
+ "url": "/weekly-assemblage/wa-2023-week-12",
+ "teaser": null
+ },{
+ "title": "New note on Snippets and VS Code",
+ "excerpt":"Last week I made a new note about some snippets I often use, both in VS Code and other places. I’m continuing to update the note with additional snippets. In fact, I just added three about time and dates. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-snippets-and-vs-code",
+ "teaser": null
+ },{
+ "title": "New note on Spellcheck Squiggles in VS Code",
+ "excerpt":"I made a new note about spellcheck squiggles in VS Code, and how to make them just perceptible enough. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/new-note-on-spellcheck-squiggles-in-vs-code",
+ "teaser": null
+ },{
+ "title": "Weekly Assemblage for 2023 Week 17",
+ "excerpt":"Weekly Whaaa…? Wow! This month has kept me busy—so much that I haven’t been updating this weekly. VS Code Snippets and Spellcheck Customizations At the beginning of the month, I made a couple of new notes. One explains some snippets I often use, both in VS Code and other places....","categories": ["weekly-assemblage"],
+ "tags": [],
+ "url": "/weekly-assemblage/wa-2023-week-17",
+ "teaser": null
+ },{
+ "title": "Light Mode in Progress",
+ "excerpt":"Today—the day after I finished up a “16 weeks condensed into 4” Spanish class—I happened to read some folks on Mastodon talking about light themes on websites. I’ve been wanting to add one to my site for years, my brain apparently wanted a project I could reasonably accomplish make noticeable...","categories": [],
+ "tags": [],
+ "url": "/light-mode-in-progress",
+ "teaser": null
+ },{
+ "title": "I've Been Using Obsidian",
+ "excerpt":"I’ve been using Obsidian, the app for linked notes. I’ve written a note with some first thoughts, and I’m planning to write more already. ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/beginning-to-use-obsidian",
+ "teaser": null
+ },{
+ "title": "My Obsidian plugins shortlist",
+ "excerpt":"Over the weekend, I wrote a note with a short list of the Obsidian plugins that do the most to make it feel like “my” notes. I’m already planning to detail some of these further in separate notes. If that’s somehow your sort of preferred reading, stay tuned! ","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/obsidian-plugins",
+ "teaser": null
+ },{
+ "title": "AcWriMo2023",
+ "excerpt":"As I recently mentioned on Mastodon, I’m going to try doing Academic Writing Month (aka “AcWriMo”; a fellow traveler of National Novel Writing Month, or “NaNoWriMo”) this year. Here I’m detailing my approach—I’ll likely also update this with my progress throughout the experiment. La Lucha Continúa My most consistent writing...","categories": [],
+ "tags": [],
+ "url": "/acwrimo2023",
+ "teaser": null
+ },{
+ "title": "Obsidian Tasks patterns",
+ "excerpt":"As I’ve mentioned a few times, I began using Obsidian earlier this year. Ultimately, the Tasks plugin was what convinced me to adopt it, despite my fondness for Dendron and my general hesitations/frustrations about Obsidian. It took quite a bit of delving into the Obsidian Discord forums and subsequent experimentation...","categories": ["notes"],
+ "tags": [],
+ "url": "/notes/obsidian-tasks-patterns",
+ "teaser": null
+ }]
diff --git a/assets/js/lunr/lunr.js b/assets/js/lunr/lunr.js
new file mode 100644
index 000000000..6aa370fbc
--- /dev/null
+++ b/assets/js/lunr/lunr.js
@@ -0,0 +1,3475 @@
+/**
+ * lunr - http://lunrjs.com - A bit like Solr, but much smaller and not as bright - 2.3.9
+ * Copyright (C) 2020 Oliver Nightingale
+ * @license MIT
+ */
+
+;(function(){
+
+/**
+ * A convenience function for configuring and constructing
+ * a new lunr Index.
+ *
+ * A lunr.Builder instance is created and the pipeline setup
+ * with a trimmer, stop word filter and stemmer.
+ *
+ * This builder object is yielded to the configuration function
+ * that is passed as a parameter, allowing the list of fields
+ * and other builder parameters to be customised.
+ *
+ * All documents _must_ be added within the passed config function.
+ *
+ * @example
+ * var idx = lunr(function () {
+ * this.field('title')
+ * this.field('body')
+ * this.ref('id')
+ *
+ * documents.forEach(function (doc) {
+ * this.add(doc)
+ * }, this)
+ * })
+ *
+ * @see {@link lunr.Builder}
+ * @see {@link lunr.Pipeline}
+ * @see {@link lunr.trimmer}
+ * @see {@link lunr.stopWordFilter}
+ * @see {@link lunr.stemmer}
+ * @namespace {function} lunr
+ */
+var lunr = function (config) {
+ var builder = new lunr.Builder
+
+ builder.pipeline.add(
+ lunr.trimmer,
+ lunr.stopWordFilter,
+ lunr.stemmer
+ )
+
+ builder.searchPipeline.add(
+ lunr.stemmer
+ )
+
+ config.call(builder, builder)
+ return builder.build()
+}
+
+lunr.version = "2.3.9"
+/*!
+ * lunr.utils
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * A namespace containing utils for the rest of the lunr library
+ * @namespace lunr.utils
+ */
+lunr.utils = {}
+
+/**
+ * Print a warning message to the console.
+ *
+ * @param {String} message The message to be printed.
+ * @memberOf lunr.utils
+ * @function
+ */
+lunr.utils.warn = (function (global) {
+ /* eslint-disable no-console */
+ return function (message) {
+ if (global.console && console.warn) {
+ console.warn(message)
+ }
+ }
+ /* eslint-enable no-console */
+})(this)
+
+/**
+ * Convert an object to a string.
+ *
+ * In the case of `null` and `undefined` the function returns
+ * the empty string, in all other cases the result of calling
+ * `toString` on the passed object is returned.
+ *
+ * @param {Any} obj The object to convert to a string.
+ * @return {String} string representation of the passed object.
+ * @memberOf lunr.utils
+ */
+lunr.utils.asString = function (obj) {
+ if (obj === void 0 || obj === null) {
+ return ""
+ } else {
+ return obj.toString()
+ }
+}
+
+/**
+ * Clones an object.
+ *
+ * Will create a copy of an existing object such that any mutations
+ * on the copy cannot affect the original.
+ *
+ * Only shallow objects are supported, passing a nested object to this
+ * function will cause a TypeError.
+ *
+ * Objects with primitives, and arrays of primitives are supported.
+ *
+ * @param {Object} obj The object to clone.
+ * @return {Object} a clone of the passed object.
+ * @throws {TypeError} when a nested object is passed.
+ * @memberOf Utils
+ */
+lunr.utils.clone = function (obj) {
+ if (obj === null || obj === undefined) {
+ return obj
+ }
+
+ var clone = Object.create(null),
+ keys = Object.keys(obj)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i],
+ val = obj[key]
+
+ if (Array.isArray(val)) {
+ clone[key] = val.slice()
+ continue
+ }
+
+ if (typeof val === 'string' ||
+ typeof val === 'number' ||
+ typeof val === 'boolean') {
+ clone[key] = val
+ continue
+ }
+
+ throw new TypeError("clone is not deep and does not support nested objects")
+ }
+
+ return clone
+}
+lunr.FieldRef = function (docRef, fieldName, stringValue) {
+ this.docRef = docRef
+ this.fieldName = fieldName
+ this._stringValue = stringValue
+}
+
+lunr.FieldRef.joiner = "/"
+
+lunr.FieldRef.fromString = function (s) {
+ var n = s.indexOf(lunr.FieldRef.joiner)
+
+ if (n === -1) {
+ throw "malformed field ref string"
+ }
+
+ var fieldRef = s.slice(0, n),
+ docRef = s.slice(n + 1)
+
+ return new lunr.FieldRef (docRef, fieldRef, s)
+}
+
+lunr.FieldRef.prototype.toString = function () {
+ if (this._stringValue == undefined) {
+ this._stringValue = this.fieldName + lunr.FieldRef.joiner + this.docRef
+ }
+
+ return this._stringValue
+}
+/*!
+ * lunr.Set
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * A lunr set.
+ *
+ * @constructor
+ */
+lunr.Set = function (elements) {
+ this.elements = Object.create(null)
+
+ if (elements) {
+ this.length = elements.length
+
+ for (var i = 0; i < this.length; i++) {
+ this.elements[elements[i]] = true
+ }
+ } else {
+ this.length = 0
+ }
+}
+
+/**
+ * A complete set that contains all elements.
+ *
+ * @static
+ * @readonly
+ * @type {lunr.Set}
+ */
+lunr.Set.complete = {
+ intersect: function (other) {
+ return other
+ },
+
+ union: function () {
+ return this
+ },
+
+ contains: function () {
+ return true
+ }
+}
+
+/**
+ * An empty set that contains no elements.
+ *
+ * @static
+ * @readonly
+ * @type {lunr.Set}
+ */
+lunr.Set.empty = {
+ intersect: function () {
+ return this
+ },
+
+ union: function (other) {
+ return other
+ },
+
+ contains: function () {
+ return false
+ }
+}
+
+/**
+ * Returns true if this set contains the specified object.
+ *
+ * @param {object} object - Object whose presence in this set is to be tested.
+ * @returns {boolean} - True if this set contains the specified object.
+ */
+lunr.Set.prototype.contains = function (object) {
+ return !!this.elements[object]
+}
+
+/**
+ * Returns a new set containing only the elements that are present in both
+ * this set and the specified set.
+ *
+ * @param {lunr.Set} other - set to intersect with this set.
+ * @returns {lunr.Set} a new set that is the intersection of this and the specified set.
+ */
+
+lunr.Set.prototype.intersect = function (other) {
+ var a, b, elements, intersection = []
+
+ if (other === lunr.Set.complete) {
+ return this
+ }
+
+ if (other === lunr.Set.empty) {
+ return other
+ }
+
+ if (this.length < other.length) {
+ a = this
+ b = other
+ } else {
+ a = other
+ b = this
+ }
+
+ elements = Object.keys(a.elements)
+
+ for (var i = 0; i < elements.length; i++) {
+ var element = elements[i]
+ if (element in b.elements) {
+ intersection.push(element)
+ }
+ }
+
+ return new lunr.Set (intersection)
+}
+
+/**
+ * Returns a new set combining the elements of this and the specified set.
+ *
+ * @param {lunr.Set} other - set to union with this set.
+ * @return {lunr.Set} a new set that is the union of this and the specified set.
+ */
+
+lunr.Set.prototype.union = function (other) {
+ if (other === lunr.Set.complete) {
+ return lunr.Set.complete
+ }
+
+ if (other === lunr.Set.empty) {
+ return this
+ }
+
+ return new lunr.Set(Object.keys(this.elements).concat(Object.keys(other.elements)))
+}
+/**
+ * A function to calculate the inverse document frequency for
+ * a posting. This is shared between the builder and the index
+ *
+ * @private
+ * @param {object} posting - The posting for a given term
+ * @param {number} documentCount - The total number of documents.
+ */
+lunr.idf = function (posting, documentCount) {
+ var documentsWithTerm = 0
+
+ for (var fieldName in posting) {
+ if (fieldName == '_index') continue // Ignore the term index, its not a field
+ documentsWithTerm += Object.keys(posting[fieldName]).length
+ }
+
+ var x = (documentCount - documentsWithTerm + 0.5) / (documentsWithTerm + 0.5)
+
+ return Math.log(1 + Math.abs(x))
+}
+
+/**
+ * A token wraps a string representation of a token
+ * as it is passed through the text processing pipeline.
+ *
+ * @constructor
+ * @param {string} [str=''] - The string token being wrapped.
+ * @param {object} [metadata={}] - Metadata associated with this token.
+ */
+lunr.Token = function (str, metadata) {
+ this.str = str || ""
+ this.metadata = metadata || {}
+}
+
+/**
+ * Returns the token string that is being wrapped by this object.
+ *
+ * @returns {string}
+ */
+lunr.Token.prototype.toString = function () {
+ return this.str
+}
+
+/**
+ * A token update function is used when updating or optionally
+ * when cloning a token.
+ *
+ * @callback lunr.Token~updateFunction
+ * @param {string} str - The string representation of the token.
+ * @param {Object} metadata - All metadata associated with this token.
+ */
+
+/**
+ * Applies the given function to the wrapped string token.
+ *
+ * @example
+ * token.update(function (str, metadata) {
+ * return str.toUpperCase()
+ * })
+ *
+ * @param {lunr.Token~updateFunction} fn - A function to apply to the token string.
+ * @returns {lunr.Token}
+ */
+lunr.Token.prototype.update = function (fn) {
+ this.str = fn(this.str, this.metadata)
+ return this
+}
+
+/**
+ * Creates a clone of this token. Optionally a function can be
+ * applied to the cloned token.
+ *
+ * @param {lunr.Token~updateFunction} [fn] - An optional function to apply to the cloned token.
+ * @returns {lunr.Token}
+ */
+lunr.Token.prototype.clone = function (fn) {
+ fn = fn || function (s) { return s }
+ return new lunr.Token (fn(this.str, this.metadata), this.metadata)
+}
+/*!
+ * lunr.tokenizer
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * A function for splitting a string into tokens ready to be inserted into
+ * the search index. Uses `lunr.tokenizer.separator` to split strings, change
+ * the value of this property to change how strings are split into tokens.
+ *
+ * This tokenizer will convert its parameter to a string by calling `toString` and
+ * then will split this string on the character in `lunr.tokenizer.separator`.
+ * Arrays will have their elements converted to strings and wrapped in a lunr.Token.
+ *
+ * Optional metadata can be passed to the tokenizer, this metadata will be cloned and
+ * added as metadata to every token that is created from the object to be tokenized.
+ *
+ * @static
+ * @param {?(string|object|object[])} obj - The object to convert into tokens
+ * @param {?object} metadata - Optional metadata to associate with every token
+ * @returns {lunr.Token[]}
+ * @see {@link lunr.Pipeline}
+ */
+lunr.tokenizer = function (obj, metadata) {
+ if (obj == null || obj == undefined) {
+ return []
+ }
+
+ if (Array.isArray(obj)) {
+ return obj.map(function (t) {
+ return new lunr.Token(
+ lunr.utils.asString(t).toLowerCase(),
+ lunr.utils.clone(metadata)
+ )
+ })
+ }
+
+ var str = obj.toString().toLowerCase(),
+ len = str.length,
+ tokens = []
+
+ for (var sliceEnd = 0, sliceStart = 0; sliceEnd <= len; sliceEnd++) {
+ var char = str.charAt(sliceEnd),
+ sliceLength = sliceEnd - sliceStart
+
+ if ((char.match(lunr.tokenizer.separator) || sliceEnd == len)) {
+
+ if (sliceLength > 0) {
+ var tokenMetadata = lunr.utils.clone(metadata) || {}
+ tokenMetadata["position"] = [sliceStart, sliceLength]
+ tokenMetadata["index"] = tokens.length
+
+ tokens.push(
+ new lunr.Token (
+ str.slice(sliceStart, sliceEnd),
+ tokenMetadata
+ )
+ )
+ }
+
+ sliceStart = sliceEnd + 1
+ }
+
+ }
+
+ return tokens
+}
+
+/**
+ * The separator used to split a string into tokens. Override this property to change the behaviour of
+ * `lunr.tokenizer` behaviour when tokenizing strings. By default this splits on whitespace and hyphens.
+ *
+ * @static
+ * @see lunr.tokenizer
+ */
+lunr.tokenizer.separator = /[\s\-]+/
+/*!
+ * lunr.Pipeline
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * lunr.Pipelines maintain an ordered list of functions to be applied to all
+ * tokens in documents entering the search index and queries being ran against
+ * the index.
+ *
+ * An instance of lunr.Index created with the lunr shortcut will contain a
+ * pipeline with a stop word filter and an English language stemmer. Extra
+ * functions can be added before or after either of these functions or these
+ * default functions can be removed.
+ *
+ * When run the pipeline will call each function in turn, passing a token, the
+ * index of that token in the original list of all tokens and finally a list of
+ * all the original tokens.
+ *
+ * The output of functions in the pipeline will be passed to the next function
+ * in the pipeline. To exclude a token from entering the index the function
+ * should return undefined, the rest of the pipeline will not be called with
+ * this token.
+ *
+ * For serialisation of pipelines to work, all functions used in an instance of
+ * a pipeline should be registered with lunr.Pipeline. Registered functions can
+ * then be loaded. If trying to load a serialised pipeline that uses functions
+ * that are not registered an error will be thrown.
+ *
+ * If not planning on serialising the pipeline then registering pipeline functions
+ * is not necessary.
+ *
+ * @constructor
+ */
+lunr.Pipeline = function () {
+ this._stack = []
+}
+
+lunr.Pipeline.registeredFunctions = Object.create(null)
+
+/**
+ * A pipeline function maps lunr.Token to lunr.Token. A lunr.Token contains the token
+ * string as well as all known metadata. A pipeline function can mutate the token string
+ * or mutate (or add) metadata for a given token.
+ *
+ * A pipeline function can indicate that the passed token should be discarded by returning
+ * null, undefined or an empty string. This token will not be passed to any downstream pipeline
+ * functions and will not be added to the index.
+ *
+ * Multiple tokens can be returned by returning an array of tokens. Each token will be passed
+ * to any downstream pipeline functions and all will returned tokens will be added to the index.
+ *
+ * Any number of pipeline functions may be chained together using a lunr.Pipeline.
+ *
+ * @interface lunr.PipelineFunction
+ * @param {lunr.Token} token - A token from the document being processed.
+ * @param {number} i - The index of this token in the complete list of tokens for this document/field.
+ * @param {lunr.Token[]} tokens - All tokens for this document/field.
+ * @returns {(?lunr.Token|lunr.Token[])}
+ */
+
+/**
+ * Register a function with the pipeline.
+ *
+ * Functions that are used in the pipeline should be registered if the pipeline
+ * needs to be serialised, or a serialised pipeline needs to be loaded.
+ *
+ * Registering a function does not add it to a pipeline, functions must still be
+ * added to instances of the pipeline for them to be used when running a pipeline.
+ *
+ * @param {lunr.PipelineFunction} fn - The function to check for.
+ * @param {String} label - The label to register this function with
+ */
+lunr.Pipeline.registerFunction = function (fn, label) {
+ if (label in this.registeredFunctions) {
+ lunr.utils.warn('Overwriting existing registered function: ' + label)
+ }
+
+ fn.label = label
+ lunr.Pipeline.registeredFunctions[fn.label] = fn
+}
+
+/**
+ * Warns if the function is not registered as a Pipeline function.
+ *
+ * @param {lunr.PipelineFunction} fn - The function to check for.
+ * @private
+ */
+lunr.Pipeline.warnIfFunctionNotRegistered = function (fn) {
+ var isRegistered = fn.label && (fn.label in this.registeredFunctions)
+
+ if (!isRegistered) {
+ lunr.utils.warn('Function is not registered with pipeline. This may cause problems when serialising the index.\n', fn)
+ }
+}
+
+/**
+ * Loads a previously serialised pipeline.
+ *
+ * All functions to be loaded must already be registered with lunr.Pipeline.
+ * If any function from the serialised data has not been registered then an
+ * error will be thrown.
+ *
+ * @param {Object} serialised - The serialised pipeline to load.
+ * @returns {lunr.Pipeline}
+ */
+lunr.Pipeline.load = function (serialised) {
+ var pipeline = new lunr.Pipeline
+
+ serialised.forEach(function (fnName) {
+ var fn = lunr.Pipeline.registeredFunctions[fnName]
+
+ if (fn) {
+ pipeline.add(fn)
+ } else {
+ throw new Error('Cannot load unregistered function: ' + fnName)
+ }
+ })
+
+ return pipeline
+}
+
+/**
+ * Adds new functions to the end of the pipeline.
+ *
+ * Logs a warning if the function has not been registered.
+ *
+ * @param {lunr.PipelineFunction[]} functions - Any number of functions to add to the pipeline.
+ */
+lunr.Pipeline.prototype.add = function () {
+ var fns = Array.prototype.slice.call(arguments)
+
+ fns.forEach(function (fn) {
+ lunr.Pipeline.warnIfFunctionNotRegistered(fn)
+ this._stack.push(fn)
+ }, this)
+}
+
+/**
+ * Adds a single function after a function that already exists in the
+ * pipeline.
+ *
+ * Logs a warning if the function has not been registered.
+ *
+ * @param {lunr.PipelineFunction} existingFn - A function that already exists in the pipeline.
+ * @param {lunr.PipelineFunction} newFn - The new function to add to the pipeline.
+ */
+lunr.Pipeline.prototype.after = function (existingFn, newFn) {
+ lunr.Pipeline.warnIfFunctionNotRegistered(newFn)
+
+ var pos = this._stack.indexOf(existingFn)
+ if (pos == -1) {
+ throw new Error('Cannot find existingFn')
+ }
+
+ pos = pos + 1
+ this._stack.splice(pos, 0, newFn)
+}
+
+/**
+ * Adds a single function before a function that already exists in the
+ * pipeline.
+ *
+ * Logs a warning if the function has not been registered.
+ *
+ * @param {lunr.PipelineFunction} existingFn - A function that already exists in the pipeline.
+ * @param {lunr.PipelineFunction} newFn - The new function to add to the pipeline.
+ */
+lunr.Pipeline.prototype.before = function (existingFn, newFn) {
+ lunr.Pipeline.warnIfFunctionNotRegistered(newFn)
+
+ var pos = this._stack.indexOf(existingFn)
+ if (pos == -1) {
+ throw new Error('Cannot find existingFn')
+ }
+
+ this._stack.splice(pos, 0, newFn)
+}
+
+/**
+ * Removes a function from the pipeline.
+ *
+ * @param {lunr.PipelineFunction} fn The function to remove from the pipeline.
+ */
+lunr.Pipeline.prototype.remove = function (fn) {
+ var pos = this._stack.indexOf(fn)
+ if (pos == -1) {
+ return
+ }
+
+ this._stack.splice(pos, 1)
+}
+
+/**
+ * Runs the current list of functions that make up the pipeline against the
+ * passed tokens.
+ *
+ * @param {Array} tokens The tokens to run through the pipeline.
+ * @returns {Array}
+ */
+lunr.Pipeline.prototype.run = function (tokens) {
+ var stackLength = this._stack.length
+
+ for (var i = 0; i < stackLength; i++) {
+ var fn = this._stack[i]
+ var memo = []
+
+ for (var j = 0; j < tokens.length; j++) {
+ var result = fn(tokens[j], j, tokens)
+
+ if (result === null || result === void 0 || result === '') continue
+
+ if (Array.isArray(result)) {
+ for (var k = 0; k < result.length; k++) {
+ memo.push(result[k])
+ }
+ } else {
+ memo.push(result)
+ }
+ }
+
+ tokens = memo
+ }
+
+ return tokens
+}
+
+/**
+ * Convenience method for passing a string through a pipeline and getting
+ * strings out. This method takes care of wrapping the passed string in a
+ * token and mapping the resulting tokens back to strings.
+ *
+ * @param {string} str - The string to pass through the pipeline.
+ * @param {?object} metadata - Optional metadata to associate with the token
+ * passed to the pipeline.
+ * @returns {string[]}
+ */
+lunr.Pipeline.prototype.runString = function (str, metadata) {
+ var token = new lunr.Token (str, metadata)
+
+ return this.run([token]).map(function (t) {
+ return t.toString()
+ })
+}
+
+/**
+ * Resets the pipeline by removing any existing processors.
+ *
+ */
+lunr.Pipeline.prototype.reset = function () {
+ this._stack = []
+}
+
+/**
+ * Returns a representation of the pipeline ready for serialisation.
+ *
+ * Logs a warning if the function has not been registered.
+ *
+ * @returns {Array}
+ */
+lunr.Pipeline.prototype.toJSON = function () {
+ return this._stack.map(function (fn) {
+ lunr.Pipeline.warnIfFunctionNotRegistered(fn)
+
+ return fn.label
+ })
+}
+/*!
+ * lunr.Vector
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * A vector is used to construct the vector space of documents and queries. These
+ * vectors support operations to determine the similarity between two documents or
+ * a document and a query.
+ *
+ * Normally no parameters are required for initializing a vector, but in the case of
+ * loading a previously dumped vector the raw elements can be provided to the constructor.
+ *
+ * For performance reasons vectors are implemented with a flat array, where an elements
+ * index is immediately followed by its value. E.g. [index, value, index, value]. This
+ * allows the underlying array to be as sparse as possible and still offer decent
+ * performance when being used for vector calculations.
+ *
+ * @constructor
+ * @param {Number[]} [elements] - The flat list of element index and element value pairs.
+ */
+lunr.Vector = function (elements) {
+ this._magnitude = 0
+ this.elements = elements || []
+}
+
+
+/**
+ * Calculates the position within the vector to insert a given index.
+ *
+ * This is used internally by insert and upsert. If there are duplicate indexes then
+ * the position is returned as if the value for that index were to be updated, but it
+ * is the callers responsibility to check whether there is a duplicate at that index
+ *
+ * @param {Number} insertIdx - The index at which the element should be inserted.
+ * @returns {Number}
+ */
+lunr.Vector.prototype.positionForIndex = function (index) {
+ // For an empty vector the tuple can be inserted at the beginning
+ if (this.elements.length == 0) {
+ return 0
+ }
+
+ var start = 0,
+ end = this.elements.length / 2,
+ sliceLength = end - start,
+ pivotPoint = Math.floor(sliceLength / 2),
+ pivotIndex = this.elements[pivotPoint * 2]
+
+ while (sliceLength > 1) {
+ if (pivotIndex < index) {
+ start = pivotPoint
+ }
+
+ if (pivotIndex > index) {
+ end = pivotPoint
+ }
+
+ if (pivotIndex == index) {
+ break
+ }
+
+ sliceLength = end - start
+ pivotPoint = start + Math.floor(sliceLength / 2)
+ pivotIndex = this.elements[pivotPoint * 2]
+ }
+
+ if (pivotIndex == index) {
+ return pivotPoint * 2
+ }
+
+ if (pivotIndex > index) {
+ return pivotPoint * 2
+ }
+
+ if (pivotIndex < index) {
+ return (pivotPoint + 1) * 2
+ }
+}
+
+/**
+ * Inserts an element at an index within the vector.
+ *
+ * Does not allow duplicates, will throw an error if there is already an entry
+ * for this index.
+ *
+ * @param {Number} insertIdx - The index at which the element should be inserted.
+ * @param {Number} val - The value to be inserted into the vector.
+ */
+lunr.Vector.prototype.insert = function (insertIdx, val) {
+ this.upsert(insertIdx, val, function () {
+ throw "duplicate index"
+ })
+}
+
+/**
+ * Inserts or updates an existing index within the vector.
+ *
+ * @param {Number} insertIdx - The index at which the element should be inserted.
+ * @param {Number} val - The value to be inserted into the vector.
+ * @param {function} fn - A function that is called for updates, the existing value and the
+ * requested value are passed as arguments
+ */
+lunr.Vector.prototype.upsert = function (insertIdx, val, fn) {
+ this._magnitude = 0
+ var position = this.positionForIndex(insertIdx)
+
+ if (this.elements[position] == insertIdx) {
+ this.elements[position + 1] = fn(this.elements[position + 1], val)
+ } else {
+ this.elements.splice(position, 0, insertIdx, val)
+ }
+}
+
+/**
+ * Calculates the magnitude of this vector.
+ *
+ * @returns {Number}
+ */
+lunr.Vector.prototype.magnitude = function () {
+ if (this._magnitude) return this._magnitude
+
+ var sumOfSquares = 0,
+ elementsLength = this.elements.length
+
+ for (var i = 1; i < elementsLength; i += 2) {
+ var val = this.elements[i]
+ sumOfSquares += val * val
+ }
+
+ return this._magnitude = Math.sqrt(sumOfSquares)
+}
+
+/**
+ * Calculates the dot product of this vector and another vector.
+ *
+ * @param {lunr.Vector} otherVector - The vector to compute the dot product with.
+ * @returns {Number}
+ */
+lunr.Vector.prototype.dot = function (otherVector) {
+ var dotProduct = 0,
+ a = this.elements, b = otherVector.elements,
+ aLen = a.length, bLen = b.length,
+ aVal = 0, bVal = 0,
+ i = 0, j = 0
+
+ while (i < aLen && j < bLen) {
+ aVal = a[i], bVal = b[j]
+ if (aVal < bVal) {
+ i += 2
+ } else if (aVal > bVal) {
+ j += 2
+ } else if (aVal == bVal) {
+ dotProduct += a[i + 1] * b[j + 1]
+ i += 2
+ j += 2
+ }
+ }
+
+ return dotProduct
+}
+
+/**
+ * Calculates the similarity between this vector and another vector.
+ *
+ * @param {lunr.Vector} otherVector - The other vector to calculate the
+ * similarity with.
+ * @returns {Number}
+ */
+lunr.Vector.prototype.similarity = function (otherVector) {
+ return this.dot(otherVector) / this.magnitude() || 0
+}
+
+/**
+ * Converts the vector to an array of the elements within the vector.
+ *
+ * @returns {Number[]}
+ */
+lunr.Vector.prototype.toArray = function () {
+ var output = new Array (this.elements.length / 2)
+
+ for (var i = 1, j = 0; i < this.elements.length; i += 2, j++) {
+ output[j] = this.elements[i]
+ }
+
+ return output
+}
+
+/**
+ * A JSON serializable representation of the vector.
+ *
+ * @returns {Number[]}
+ */
+lunr.Vector.prototype.toJSON = function () {
+ return this.elements
+}
+/* eslint-disable */
+/*!
+ * lunr.stemmer
+ * Copyright (C) 2020 Oliver Nightingale
+ * Includes code from - http://tartarus.org/~martin/PorterStemmer/js.txt
+ */
+
+/**
+ * lunr.stemmer is an english language stemmer, this is a JavaScript
+ * implementation of the PorterStemmer taken from http://tartarus.org/~martin
+ *
+ * @static
+ * @implements {lunr.PipelineFunction}
+ * @param {lunr.Token} token - The string to stem
+ * @returns {lunr.Token}
+ * @see {@link lunr.Pipeline}
+ * @function
+ */
+lunr.stemmer = (function(){
+ var step2list = {
+ "ational" : "ate",
+ "tional" : "tion",
+ "enci" : "ence",
+ "anci" : "ance",
+ "izer" : "ize",
+ "bli" : "ble",
+ "alli" : "al",
+ "entli" : "ent",
+ "eli" : "e",
+ "ousli" : "ous",
+ "ization" : "ize",
+ "ation" : "ate",
+ "ator" : "ate",
+ "alism" : "al",
+ "iveness" : "ive",
+ "fulness" : "ful",
+ "ousness" : "ous",
+ "aliti" : "al",
+ "iviti" : "ive",
+ "biliti" : "ble",
+ "logi" : "log"
+ },
+
+ step3list = {
+ "icate" : "ic",
+ "ative" : "",
+ "alize" : "al",
+ "iciti" : "ic",
+ "ical" : "ic",
+ "ful" : "",
+ "ness" : ""
+ },
+
+ c = "[^aeiou]", // consonant
+ v = "[aeiouy]", // vowel
+ C = c + "[^aeiouy]*", // consonant sequence
+ V = v + "[aeiou]*", // vowel sequence
+
+ mgr0 = "^(" + C + ")?" + V + C, // [C]VC... is m>0
+ meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$", // [C]VC[V] is m=1
+ mgr1 = "^(" + C + ")?" + V + C + V + C, // [C]VCVC... is m>1
+ s_v = "^(" + C + ")?" + v; // vowel in stem
+
+ var re_mgr0 = new RegExp(mgr0);
+ var re_mgr1 = new RegExp(mgr1);
+ var re_meq1 = new RegExp(meq1);
+ var re_s_v = new RegExp(s_v);
+
+ var re_1a = /^(.+?)(ss|i)es$/;
+ var re2_1a = /^(.+?)([^s])s$/;
+ var re_1b = /^(.+?)eed$/;
+ var re2_1b = /^(.+?)(ed|ing)$/;
+ var re_1b_2 = /.$/;
+ var re2_1b_2 = /(at|bl|iz)$/;
+ var re3_1b_2 = new RegExp("([^aeiouylsz])\\1$");
+ var re4_1b_2 = new RegExp("^" + C + v + "[^aeiouwxy]$");
+
+ var re_1c = /^(.+?[^aeiou])y$/;
+ var re_2 = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/;
+
+ var re_3 = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/;
+
+ var re_4 = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/;
+ var re2_4 = /^(.+?)(s|t)(ion)$/;
+
+ var re_5 = /^(.+?)e$/;
+ var re_5_1 = /ll$/;
+ var re3_5 = new RegExp("^" + C + v + "[^aeiouwxy]$");
+
+ var porterStemmer = function porterStemmer(w) {
+ var stem,
+ suffix,
+ firstch,
+ re,
+ re2,
+ re3,
+ re4;
+
+ if (w.length < 3) { return w; }
+
+ firstch = w.substr(0,1);
+ if (firstch == "y") {
+ w = firstch.toUpperCase() + w.substr(1);
+ }
+
+ // Step 1a
+ re = re_1a
+ re2 = re2_1a;
+
+ if (re.test(w)) { w = w.replace(re,"$1$2"); }
+ else if (re2.test(w)) { w = w.replace(re2,"$1$2"); }
+
+ // Step 1b
+ re = re_1b;
+ re2 = re2_1b;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ re = re_mgr0;
+ if (re.test(fp[1])) {
+ re = re_1b_2;
+ w = w.replace(re,"");
+ }
+ } else if (re2.test(w)) {
+ var fp = re2.exec(w);
+ stem = fp[1];
+ re2 = re_s_v;
+ if (re2.test(stem)) {
+ w = stem;
+ re2 = re2_1b_2;
+ re3 = re3_1b_2;
+ re4 = re4_1b_2;
+ if (re2.test(w)) { w = w + "e"; }
+ else if (re3.test(w)) { re = re_1b_2; w = w.replace(re,""); }
+ else if (re4.test(w)) { w = w + "e"; }
+ }
+ }
+
+ // Step 1c - replace suffix y or Y by i if preceded by a non-vowel which is not the first letter of the word (so cry -> cri, by -> by, say -> say)
+ re = re_1c;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ stem = fp[1];
+ w = stem + "i";
+ }
+
+ // Step 2
+ re = re_2;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ stem = fp[1];
+ suffix = fp[2];
+ re = re_mgr0;
+ if (re.test(stem)) {
+ w = stem + step2list[suffix];
+ }
+ }
+
+ // Step 3
+ re = re_3;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ stem = fp[1];
+ suffix = fp[2];
+ re = re_mgr0;
+ if (re.test(stem)) {
+ w = stem + step3list[suffix];
+ }
+ }
+
+ // Step 4
+ re = re_4;
+ re2 = re2_4;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ stem = fp[1];
+ re = re_mgr1;
+ if (re.test(stem)) {
+ w = stem;
+ }
+ } else if (re2.test(w)) {
+ var fp = re2.exec(w);
+ stem = fp[1] + fp[2];
+ re2 = re_mgr1;
+ if (re2.test(stem)) {
+ w = stem;
+ }
+ }
+
+ // Step 5
+ re = re_5;
+ if (re.test(w)) {
+ var fp = re.exec(w);
+ stem = fp[1];
+ re = re_mgr1;
+ re2 = re_meq1;
+ re3 = re3_5;
+ if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) {
+ w = stem;
+ }
+ }
+
+ re = re_5_1;
+ re2 = re_mgr1;
+ if (re.test(w) && re2.test(w)) {
+ re = re_1b_2;
+ w = w.replace(re,"");
+ }
+
+ // and turn initial Y back to y
+
+ if (firstch == "y") {
+ w = firstch.toLowerCase() + w.substr(1);
+ }
+
+ return w;
+ };
+
+ return function (token) {
+ return token.update(porterStemmer);
+ }
+})();
+
+lunr.Pipeline.registerFunction(lunr.stemmer, 'stemmer')
+/*!
+ * lunr.stopWordFilter
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * lunr.generateStopWordFilter builds a stopWordFilter function from the provided
+ * list of stop words.
+ *
+ * The built in lunr.stopWordFilter is built using this generator and can be used
+ * to generate custom stopWordFilters for applications or non English languages.
+ *
+ * @function
+ * @param {Array} token The token to pass through the filter
+ * @returns {lunr.PipelineFunction}
+ * @see lunr.Pipeline
+ * @see lunr.stopWordFilter
+ */
+lunr.generateStopWordFilter = function (stopWords) {
+ var words = stopWords.reduce(function (memo, stopWord) {
+ memo[stopWord] = stopWord
+ return memo
+ }, {})
+
+ return function (token) {
+ if (token && words[token.toString()] !== token.toString()) return token
+ }
+}
+
+/**
+ * lunr.stopWordFilter is an English language stop word list filter, any words
+ * contained in the list will not be passed through the filter.
+ *
+ * This is intended to be used in the Pipeline. If the token does not pass the
+ * filter then undefined will be returned.
+ *
+ * @function
+ * @implements {lunr.PipelineFunction}
+ * @params {lunr.Token} token - A token to check for being a stop word.
+ * @returns {lunr.Token}
+ * @see {@link lunr.Pipeline}
+ */
+lunr.stopWordFilter = lunr.generateStopWordFilter([
+ 'a',
+ 'able',
+ 'about',
+ 'across',
+ 'after',
+ 'all',
+ 'almost',
+ 'also',
+ 'am',
+ 'among',
+ 'an',
+ 'and',
+ 'any',
+ 'are',
+ 'as',
+ 'at',
+ 'be',
+ 'because',
+ 'been',
+ 'but',
+ 'by',
+ 'can',
+ 'cannot',
+ 'could',
+ 'dear',
+ 'did',
+ 'do',
+ 'does',
+ 'either',
+ 'else',
+ 'ever',
+ 'every',
+ 'for',
+ 'from',
+ 'get',
+ 'got',
+ 'had',
+ 'has',
+ 'have',
+ 'he',
+ 'her',
+ 'hers',
+ 'him',
+ 'his',
+ 'how',
+ 'however',
+ 'i',
+ 'if',
+ 'in',
+ 'into',
+ 'is',
+ 'it',
+ 'its',
+ 'just',
+ 'least',
+ 'let',
+ 'like',
+ 'likely',
+ 'may',
+ 'me',
+ 'might',
+ 'most',
+ 'must',
+ 'my',
+ 'neither',
+ 'no',
+ 'nor',
+ 'not',
+ 'of',
+ 'off',
+ 'often',
+ 'on',
+ 'only',
+ 'or',
+ 'other',
+ 'our',
+ 'own',
+ 'rather',
+ 'said',
+ 'say',
+ 'says',
+ 'she',
+ 'should',
+ 'since',
+ 'so',
+ 'some',
+ 'than',
+ 'that',
+ 'the',
+ 'their',
+ 'them',
+ 'then',
+ 'there',
+ 'these',
+ 'they',
+ 'this',
+ 'tis',
+ 'to',
+ 'too',
+ 'twas',
+ 'us',
+ 'wants',
+ 'was',
+ 'we',
+ 'were',
+ 'what',
+ 'when',
+ 'where',
+ 'which',
+ 'while',
+ 'who',
+ 'whom',
+ 'why',
+ 'will',
+ 'with',
+ 'would',
+ 'yet',
+ 'you',
+ 'your'
+])
+
+lunr.Pipeline.registerFunction(lunr.stopWordFilter, 'stopWordFilter')
+/*!
+ * lunr.trimmer
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * lunr.trimmer is a pipeline function for trimming non word
+ * characters from the beginning and end of tokens before they
+ * enter the index.
+ *
+ * This implementation may not work correctly for non latin
+ * characters and should either be removed or adapted for use
+ * with languages with non-latin characters.
+ *
+ * @static
+ * @implements {lunr.PipelineFunction}
+ * @param {lunr.Token} token The token to pass through the filter
+ * @returns {lunr.Token}
+ * @see lunr.Pipeline
+ */
+lunr.trimmer = function (token) {
+ return token.update(function (s) {
+ return s.replace(/^\W+/, '').replace(/\W+$/, '')
+ })
+}
+
+lunr.Pipeline.registerFunction(lunr.trimmer, 'trimmer')
+/*!
+ * lunr.TokenSet
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * A token set is used to store the unique list of all tokens
+ * within an index. Token sets are also used to represent an
+ * incoming query to the index, this query token set and index
+ * token set are then intersected to find which tokens to look
+ * up in the inverted index.
+ *
+ * A token set can hold multiple tokens, as in the case of the
+ * index token set, or it can hold a single token as in the
+ * case of a simple query token set.
+ *
+ * Additionally token sets are used to perform wildcard matching.
+ * Leading, contained and trailing wildcards are supported, and
+ * from this edit distance matching can also be provided.
+ *
+ * Token sets are implemented as a minimal finite state automata,
+ * where both common prefixes and suffixes are shared between tokens.
+ * This helps to reduce the space used for storing the token set.
+ *
+ * @constructor
+ */
+lunr.TokenSet = function () {
+ this.final = false
+ this.edges = {}
+ this.id = lunr.TokenSet._nextId
+ lunr.TokenSet._nextId += 1
+}
+
+/**
+ * Keeps track of the next, auto increment, identifier to assign
+ * to a new tokenSet.
+ *
+ * TokenSets require a unique identifier to be correctly minimised.
+ *
+ * @private
+ */
+lunr.TokenSet._nextId = 1
+
+/**
+ * Creates a TokenSet instance from the given sorted array of words.
+ *
+ * @param {String[]} arr - A sorted array of strings to create the set from.
+ * @returns {lunr.TokenSet}
+ * @throws Will throw an error if the input array is not sorted.
+ */
+lunr.TokenSet.fromArray = function (arr) {
+ var builder = new lunr.TokenSet.Builder
+
+ for (var i = 0, len = arr.length; i < len; i++) {
+ builder.insert(arr[i])
+ }
+
+ builder.finish()
+ return builder.root
+}
+
+/**
+ * Creates a token set from a query clause.
+ *
+ * @private
+ * @param {Object} clause - A single clause from lunr.Query.
+ * @param {string} clause.term - The query clause term.
+ * @param {number} [clause.editDistance] - The optional edit distance for the term.
+ * @returns {lunr.TokenSet}
+ */
+lunr.TokenSet.fromClause = function (clause) {
+ if ('editDistance' in clause) {
+ return lunr.TokenSet.fromFuzzyString(clause.term, clause.editDistance)
+ } else {
+ return lunr.TokenSet.fromString(clause.term)
+ }
+}
+
+/**
+ * Creates a token set representing a single string with a specified
+ * edit distance.
+ *
+ * Insertions, deletions, substitutions and transpositions are each
+ * treated as an edit distance of 1.
+ *
+ * Increasing the allowed edit distance will have a dramatic impact
+ * on the performance of both creating and intersecting these TokenSets.
+ * It is advised to keep the edit distance less than 3.
+ *
+ * @param {string} str - The string to create the token set from.
+ * @param {number} editDistance - The allowed edit distance to match.
+ * @returns {lunr.Vector}
+ */
+lunr.TokenSet.fromFuzzyString = function (str, editDistance) {
+ var root = new lunr.TokenSet
+
+ var stack = [{
+ node: root,
+ editsRemaining: editDistance,
+ str: str
+ }]
+
+ while (stack.length) {
+ var frame = stack.pop()
+
+ // no edit
+ if (frame.str.length > 0) {
+ var char = frame.str.charAt(0),
+ noEditNode
+
+ if (char in frame.node.edges) {
+ noEditNode = frame.node.edges[char]
+ } else {
+ noEditNode = new lunr.TokenSet
+ frame.node.edges[char] = noEditNode
+ }
+
+ if (frame.str.length == 1) {
+ noEditNode.final = true
+ }
+
+ stack.push({
+ node: noEditNode,
+ editsRemaining: frame.editsRemaining,
+ str: frame.str.slice(1)
+ })
+ }
+
+ if (frame.editsRemaining == 0) {
+ continue
+ }
+
+ // insertion
+ if ("*" in frame.node.edges) {
+ var insertionNode = frame.node.edges["*"]
+ } else {
+ var insertionNode = new lunr.TokenSet
+ frame.node.edges["*"] = insertionNode
+ }
+
+ if (frame.str.length == 0) {
+ insertionNode.final = true
+ }
+
+ stack.push({
+ node: insertionNode,
+ editsRemaining: frame.editsRemaining - 1,
+ str: frame.str
+ })
+
+ // deletion
+ // can only do a deletion if we have enough edits remaining
+ // and if there are characters left to delete in the string
+ if (frame.str.length > 1) {
+ stack.push({
+ node: frame.node,
+ editsRemaining: frame.editsRemaining - 1,
+ str: frame.str.slice(1)
+ })
+ }
+
+ // deletion
+ // just removing the last character from the str
+ if (frame.str.length == 1) {
+ frame.node.final = true
+ }
+
+ // substitution
+ // can only do a substitution if we have enough edits remaining
+ // and if there are characters left to substitute
+ if (frame.str.length >= 1) {
+ if ("*" in frame.node.edges) {
+ var substitutionNode = frame.node.edges["*"]
+ } else {
+ var substitutionNode = new lunr.TokenSet
+ frame.node.edges["*"] = substitutionNode
+ }
+
+ if (frame.str.length == 1) {
+ substitutionNode.final = true
+ }
+
+ stack.push({
+ node: substitutionNode,
+ editsRemaining: frame.editsRemaining - 1,
+ str: frame.str.slice(1)
+ })
+ }
+
+ // transposition
+ // can only do a transposition if there are edits remaining
+ // and there are enough characters to transpose
+ if (frame.str.length > 1) {
+ var charA = frame.str.charAt(0),
+ charB = frame.str.charAt(1),
+ transposeNode
+
+ if (charB in frame.node.edges) {
+ transposeNode = frame.node.edges[charB]
+ } else {
+ transposeNode = new lunr.TokenSet
+ frame.node.edges[charB] = transposeNode
+ }
+
+ if (frame.str.length == 1) {
+ transposeNode.final = true
+ }
+
+ stack.push({
+ node: transposeNode,
+ editsRemaining: frame.editsRemaining - 1,
+ str: charA + frame.str.slice(2)
+ })
+ }
+ }
+
+ return root
+}
+
+/**
+ * Creates a TokenSet from a string.
+ *
+ * The string may contain one or more wildcard characters (*)
+ * that will allow wildcard matching when intersecting with
+ * another TokenSet.
+ *
+ * @param {string} str - The string to create a TokenSet from.
+ * @returns {lunr.TokenSet}
+ */
+lunr.TokenSet.fromString = function (str) {
+ var node = new lunr.TokenSet,
+ root = node
+
+ /*
+ * Iterates through all characters within the passed string
+ * appending a node for each character.
+ *
+ * When a wildcard character is found then a self
+ * referencing edge is introduced to continually match
+ * any number of any characters.
+ */
+ for (var i = 0, len = str.length; i < len; i++) {
+ var char = str[i],
+ final = (i == len - 1)
+
+ if (char == "*") {
+ node.edges[char] = node
+ node.final = final
+
+ } else {
+ var next = new lunr.TokenSet
+ next.final = final
+
+ node.edges[char] = next
+ node = next
+ }
+ }
+
+ return root
+}
+
+/**
+ * Converts this TokenSet into an array of strings
+ * contained within the TokenSet.
+ *
+ * This is not intended to be used on a TokenSet that
+ * contains wildcards, in these cases the results are
+ * undefined and are likely to cause an infinite loop.
+ *
+ * @returns {string[]}
+ */
+lunr.TokenSet.prototype.toArray = function () {
+ var words = []
+
+ var stack = [{
+ prefix: "",
+ node: this
+ }]
+
+ while (stack.length) {
+ var frame = stack.pop(),
+ edges = Object.keys(frame.node.edges),
+ len = edges.length
+
+ if (frame.node.final) {
+ /* In Safari, at this point the prefix is sometimes corrupted, see:
+ * https://github.com/olivernn/lunr.js/issues/279 Calling any
+ * String.prototype method forces Safari to "cast" this string to what
+ * it's supposed to be, fixing the bug. */
+ frame.prefix.charAt(0)
+ words.push(frame.prefix)
+ }
+
+ for (var i = 0; i < len; i++) {
+ var edge = edges[i]
+
+ stack.push({
+ prefix: frame.prefix.concat(edge),
+ node: frame.node.edges[edge]
+ })
+ }
+ }
+
+ return words
+}
+
+/**
+ * Generates a string representation of a TokenSet.
+ *
+ * This is intended to allow TokenSets to be used as keys
+ * in objects, largely to aid the construction and minimisation
+ * of a TokenSet. As such it is not designed to be a human
+ * friendly representation of the TokenSet.
+ *
+ * @returns {string}
+ */
+lunr.TokenSet.prototype.toString = function () {
+ // NOTE: Using Object.keys here as this.edges is very likely
+ // to enter 'hash-mode' with many keys being added
+ //
+ // avoiding a for-in loop here as it leads to the function
+ // being de-optimised (at least in V8). From some simple
+ // benchmarks the performance is comparable, but allowing
+ // V8 to optimize may mean easy performance wins in the future.
+
+ if (this._str) {
+ return this._str
+ }
+
+ var str = this.final ? '1' : '0',
+ labels = Object.keys(this.edges).sort(),
+ len = labels.length
+
+ for (var i = 0; i < len; i++) {
+ var label = labels[i],
+ node = this.edges[label]
+
+ str = str + label + node.id
+ }
+
+ return str
+}
+
+/**
+ * Returns a new TokenSet that is the intersection of
+ * this TokenSet and the passed TokenSet.
+ *
+ * This intersection will take into account any wildcards
+ * contained within the TokenSet.
+ *
+ * @param {lunr.TokenSet} b - An other TokenSet to intersect with.
+ * @returns {lunr.TokenSet}
+ */
+lunr.TokenSet.prototype.intersect = function (b) {
+ var output = new lunr.TokenSet,
+ frame = undefined
+
+ var stack = [{
+ qNode: b,
+ output: output,
+ node: this
+ }]
+
+ while (stack.length) {
+ frame = stack.pop()
+
+ // NOTE: As with the #toString method, we are using
+ // Object.keys and a for loop instead of a for-in loop
+ // as both of these objects enter 'hash' mode, causing
+ // the function to be de-optimised in V8
+ var qEdges = Object.keys(frame.qNode.edges),
+ qLen = qEdges.length,
+ nEdges = Object.keys(frame.node.edges),
+ nLen = nEdges.length
+
+ for (var q = 0; q < qLen; q++) {
+ var qEdge = qEdges[q]
+
+ for (var n = 0; n < nLen; n++) {
+ var nEdge = nEdges[n]
+
+ if (nEdge == qEdge || qEdge == '*') {
+ var node = frame.node.edges[nEdge],
+ qNode = frame.qNode.edges[qEdge],
+ final = node.final && qNode.final,
+ next = undefined
+
+ if (nEdge in frame.output.edges) {
+ // an edge already exists for this character
+ // no need to create a new node, just set the finality
+ // bit unless this node is already final
+ next = frame.output.edges[nEdge]
+ next.final = next.final || final
+
+ } else {
+ // no edge exists yet, must create one
+ // set the finality bit and insert it
+ // into the output
+ next = new lunr.TokenSet
+ next.final = final
+ frame.output.edges[nEdge] = next
+ }
+
+ stack.push({
+ qNode: qNode,
+ output: next,
+ node: node
+ })
+ }
+ }
+ }
+ }
+
+ return output
+}
+lunr.TokenSet.Builder = function () {
+ this.previousWord = ""
+ this.root = new lunr.TokenSet
+ this.uncheckedNodes = []
+ this.minimizedNodes = {}
+}
+
+lunr.TokenSet.Builder.prototype.insert = function (word) {
+ var node,
+ commonPrefix = 0
+
+ if (word < this.previousWord) {
+ throw new Error ("Out of order word insertion")
+ }
+
+ for (var i = 0; i < word.length && i < this.previousWord.length; i++) {
+ if (word[i] != this.previousWord[i]) break
+ commonPrefix++
+ }
+
+ this.minimize(commonPrefix)
+
+ if (this.uncheckedNodes.length == 0) {
+ node = this.root
+ } else {
+ node = this.uncheckedNodes[this.uncheckedNodes.length - 1].child
+ }
+
+ for (var i = commonPrefix; i < word.length; i++) {
+ var nextNode = new lunr.TokenSet,
+ char = word[i]
+
+ node.edges[char] = nextNode
+
+ this.uncheckedNodes.push({
+ parent: node,
+ char: char,
+ child: nextNode
+ })
+
+ node = nextNode
+ }
+
+ node.final = true
+ this.previousWord = word
+}
+
+lunr.TokenSet.Builder.prototype.finish = function () {
+ this.minimize(0)
+}
+
+lunr.TokenSet.Builder.prototype.minimize = function (downTo) {
+ for (var i = this.uncheckedNodes.length - 1; i >= downTo; i--) {
+ var node = this.uncheckedNodes[i],
+ childKey = node.child.toString()
+
+ if (childKey in this.minimizedNodes) {
+ node.parent.edges[node.char] = this.minimizedNodes[childKey]
+ } else {
+ // Cache the key for this node since
+ // we know it can't change anymore
+ node.child._str = childKey
+
+ this.minimizedNodes[childKey] = node.child
+ }
+
+ this.uncheckedNodes.pop()
+ }
+}
+/*!
+ * lunr.Index
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * An index contains the built index of all documents and provides a query interface
+ * to the index.
+ *
+ * Usually instances of lunr.Index will not be created using this constructor, instead
+ * lunr.Builder should be used to construct new indexes, or lunr.Index.load should be
+ * used to load previously built and serialized indexes.
+ *
+ * @constructor
+ * @param {Object} attrs - The attributes of the built search index.
+ * @param {Object} attrs.invertedIndex - An index of term/field to document reference.
+ * @param {Object} attrs.fieldVectors - Field vectors
+ * @param {lunr.TokenSet} attrs.tokenSet - An set of all corpus tokens.
+ * @param {string[]} attrs.fields - The names of indexed document fields.
+ * @param {lunr.Pipeline} attrs.pipeline - The pipeline to use for search terms.
+ */
+lunr.Index = function (attrs) {
+ this.invertedIndex = attrs.invertedIndex
+ this.fieldVectors = attrs.fieldVectors
+ this.tokenSet = attrs.tokenSet
+ this.fields = attrs.fields
+ this.pipeline = attrs.pipeline
+}
+
+/**
+ * A result contains details of a document matching a search query.
+ * @typedef {Object} lunr.Index~Result
+ * @property {string} ref - The reference of the document this result represents.
+ * @property {number} score - A number between 0 and 1 representing how similar this document is to the query.
+ * @property {lunr.MatchData} matchData - Contains metadata about this match including which term(s) caused the match.
+ */
+
+/**
+ * Although lunr provides the ability to create queries using lunr.Query, it also provides a simple
+ * query language which itself is parsed into an instance of lunr.Query.
+ *
+ * For programmatically building queries it is advised to directly use lunr.Query, the query language
+ * is best used for human entered text rather than program generated text.
+ *
+ * At its simplest queries can just be a single term, e.g. `hello`, multiple terms are also supported
+ * and will be combined with OR, e.g `hello world` will match documents that contain either 'hello'
+ * or 'world', though those that contain both will rank higher in the results.
+ *
+ * Wildcards can be included in terms to match one or more unspecified characters, these wildcards can
+ * be inserted anywhere within the term, and more than one wildcard can exist in a single term. Adding
+ * wildcards will increase the number of documents that will be found but can also have a negative
+ * impact on query performance, especially with wildcards at the beginning of a term.
+ *
+ * Terms can be restricted to specific fields, e.g. `title:hello`, only documents with the term
+ * hello in the title field will match this query. Using a field not present in the index will lead
+ * to an error being thrown.
+ *
+ * Modifiers can also be added to terms, lunr supports edit distance and boost modifiers on terms. A term
+ * boost will make documents matching that term score higher, e.g. `foo^5`. Edit distance is also supported
+ * to provide fuzzy matching, e.g. 'hello~2' will match documents with hello with an edit distance of 2.
+ * Avoid large values for edit distance to improve query performance.
+ *
+ * Each term also supports a presence modifier. By default a term's presence in document is optional, however
+ * this can be changed to either required or prohibited. For a term's presence to be required in a document the
+ * term should be prefixed with a '+', e.g. `+foo bar` is a search for documents that must contain 'foo' and
+ * optionally contain 'bar'. Conversely a leading '-' sets the terms presence to prohibited, i.e. it must not
+ * appear in a document, e.g. `-foo bar` is a search for documents that do not contain 'foo' but may contain 'bar'.
+ *
+ * To escape special characters the backslash character '\' can be used, this allows searches to include
+ * characters that would normally be considered modifiers, e.g. `foo\~2` will search for a term "foo~2" instead
+ * of attempting to apply a boost of 2 to the search term "foo".
+ *
+ * @typedef {string} lunr.Index~QueryString
+ * @example
Simple single term query
+ * hello
+ * @example
Multiple term query
+ * hello world
+ * @example
term scoped to a field
+ * title:hello
+ * @example
term with a boost of 10
+ * hello^10
+ * @example
term with an edit distance of 2
+ * hello~2
+ * @example
terms with presence modifiers
+ * -foo +bar baz
+ */
+
+/**
+ * Performs a search against the index using lunr query syntax.
+ *
+ * Results will be returned sorted by their score, the most relevant results
+ * will be returned first. For details on how the score is calculated, please see
+ * the {@link https://lunrjs.com/guides/searching.html#scoring|guide}.
+ *
+ * For more programmatic querying use lunr.Index#query.
+ *
+ * @param {lunr.Index~QueryString} queryString - A string containing a lunr query.
+ * @throws {lunr.QueryParseError} If the passed query string cannot be parsed.
+ * @returns {lunr.Index~Result[]}
+ */
+lunr.Index.prototype.search = function (queryString) {
+ return this.query(function (query) {
+ var parser = new lunr.QueryParser(queryString, query)
+ parser.parse()
+ })
+}
+
+/**
+ * A query builder callback provides a query object to be used to express
+ * the query to perform on the index.
+ *
+ * @callback lunr.Index~queryBuilder
+ * @param {lunr.Query} query - The query object to build up.
+ * @this lunr.Query
+ */
+
+/**
+ * Performs a query against the index using the yielded lunr.Query object.
+ *
+ * If performing programmatic queries against the index, this method is preferred
+ * over lunr.Index#search so as to avoid the additional query parsing overhead.
+ *
+ * A query object is yielded to the supplied function which should be used to
+ * express the query to be run against the index.
+ *
+ * Note that although this function takes a callback parameter it is _not_ an
+ * asynchronous operation, the callback is just yielded a query object to be
+ * customized.
+ *
+ * @param {lunr.Index~queryBuilder} fn - A function that is used to build the query.
+ * @returns {lunr.Index~Result[]}
+ */
+lunr.Index.prototype.query = function (fn) {
+ // for each query clause
+ // * process terms
+ // * expand terms from token set
+ // * find matching documents and metadata
+ // * get document vectors
+ // * score documents
+
+ var query = new lunr.Query(this.fields),
+ matchingFields = Object.create(null),
+ queryVectors = Object.create(null),
+ termFieldCache = Object.create(null),
+ requiredMatches = Object.create(null),
+ prohibitedMatches = Object.create(null)
+
+ /*
+ * To support field level boosts a query vector is created per
+ * field. An empty vector is eagerly created to support negated
+ * queries.
+ */
+ for (var i = 0; i < this.fields.length; i++) {
+ queryVectors[this.fields[i]] = new lunr.Vector
+ }
+
+ fn.call(query, query)
+
+ for (var i = 0; i < query.clauses.length; i++) {
+ /*
+ * Unless the pipeline has been disabled for this term, which is
+ * the case for terms with wildcards, we need to pass the clause
+ * term through the search pipeline. A pipeline returns an array
+ * of processed terms. Pipeline functions may expand the passed
+ * term, which means we may end up performing multiple index lookups
+ * for a single query term.
+ */
+ var clause = query.clauses[i],
+ terms = null,
+ clauseMatches = lunr.Set.empty
+
+ if (clause.usePipeline) {
+ terms = this.pipeline.runString(clause.term, {
+ fields: clause.fields
+ })
+ } else {
+ terms = [clause.term]
+ }
+
+ for (var m = 0; m < terms.length; m++) {
+ var term = terms[m]
+
+ /*
+ * Each term returned from the pipeline needs to use the same query
+ * clause object, e.g. the same boost and or edit distance. The
+ * simplest way to do this is to re-use the clause object but mutate
+ * its term property.
+ */
+ clause.term = term
+
+ /*
+ * From the term in the clause we create a token set which will then
+ * be used to intersect the indexes token set to get a list of terms
+ * to lookup in the inverted index
+ */
+ var termTokenSet = lunr.TokenSet.fromClause(clause),
+ expandedTerms = this.tokenSet.intersect(termTokenSet).toArray()
+
+ /*
+ * If a term marked as required does not exist in the tokenSet it is
+ * impossible for the search to return any matches. We set all the field
+ * scoped required matches set to empty and stop examining any further
+ * clauses.
+ */
+ if (expandedTerms.length === 0 && clause.presence === lunr.Query.presence.REQUIRED) {
+ for (var k = 0; k < clause.fields.length; k++) {
+ var field = clause.fields[k]
+ requiredMatches[field] = lunr.Set.empty
+ }
+
+ break
+ }
+
+ for (var j = 0; j < expandedTerms.length; j++) {
+ /*
+ * For each term get the posting and termIndex, this is required for
+ * building the query vector.
+ */
+ var expandedTerm = expandedTerms[j],
+ posting = this.invertedIndex[expandedTerm],
+ termIndex = posting._index
+
+ for (var k = 0; k < clause.fields.length; k++) {
+ /*
+ * For each field that this query term is scoped by (by default
+ * all fields are in scope) we need to get all the document refs
+ * that have this term in that field.
+ *
+ * The posting is the entry in the invertedIndex for the matching
+ * term from above.
+ */
+ var field = clause.fields[k],
+ fieldPosting = posting[field],
+ matchingDocumentRefs = Object.keys(fieldPosting),
+ termField = expandedTerm + "/" + field,
+ matchingDocumentsSet = new lunr.Set(matchingDocumentRefs)
+
+ /*
+ * if the presence of this term is required ensure that the matching
+ * documents are added to the set of required matches for this clause.
+ *
+ */
+ if (clause.presence == lunr.Query.presence.REQUIRED) {
+ clauseMatches = clauseMatches.union(matchingDocumentsSet)
+
+ if (requiredMatches[field] === undefined) {
+ requiredMatches[field] = lunr.Set.complete
+ }
+ }
+
+ /*
+ * if the presence of this term is prohibited ensure that the matching
+ * documents are added to the set of prohibited matches for this field,
+ * creating that set if it does not yet exist.
+ */
+ if (clause.presence == lunr.Query.presence.PROHIBITED) {
+ if (prohibitedMatches[field] === undefined) {
+ prohibitedMatches[field] = lunr.Set.empty
+ }
+
+ prohibitedMatches[field] = prohibitedMatches[field].union(matchingDocumentsSet)
+
+ /*
+ * Prohibited matches should not be part of the query vector used for
+ * similarity scoring and no metadata should be extracted so we continue
+ * to the next field
+ */
+ continue
+ }
+
+ /*
+ * The query field vector is populated using the termIndex found for
+ * the term and a unit value with the appropriate boost applied.
+ * Using upsert because there could already be an entry in the vector
+ * for the term we are working with. In that case we just add the scores
+ * together.
+ */
+ queryVectors[field].upsert(termIndex, clause.boost, function (a, b) { return a + b })
+
+ /**
+ * If we've already seen this term, field combo then we've already collected
+ * the matching documents and metadata, no need to go through all that again
+ */
+ if (termFieldCache[termField]) {
+ continue
+ }
+
+ for (var l = 0; l < matchingDocumentRefs.length; l++) {
+ /*
+ * All metadata for this term/field/document triple
+ * are then extracted and collected into an instance
+ * of lunr.MatchData ready to be returned in the query
+ * results
+ */
+ var matchingDocumentRef = matchingDocumentRefs[l],
+ matchingFieldRef = new lunr.FieldRef (matchingDocumentRef, field),
+ metadata = fieldPosting[matchingDocumentRef],
+ fieldMatch
+
+ if ((fieldMatch = matchingFields[matchingFieldRef]) === undefined) {
+ matchingFields[matchingFieldRef] = new lunr.MatchData (expandedTerm, field, metadata)
+ } else {
+ fieldMatch.add(expandedTerm, field, metadata)
+ }
+
+ }
+
+ termFieldCache[termField] = true
+ }
+ }
+ }
+
+ /**
+ * If the presence was required we need to update the requiredMatches field sets.
+ * We do this after all fields for the term have collected their matches because
+ * the clause terms presence is required in _any_ of the fields not _all_ of the
+ * fields.
+ */
+ if (clause.presence === lunr.Query.presence.REQUIRED) {
+ for (var k = 0; k < clause.fields.length; k++) {
+ var field = clause.fields[k]
+ requiredMatches[field] = requiredMatches[field].intersect(clauseMatches)
+ }
+ }
+ }
+
+ /**
+ * Need to combine the field scoped required and prohibited
+ * matching documents into a global set of required and prohibited
+ * matches
+ */
+ var allRequiredMatches = lunr.Set.complete,
+ allProhibitedMatches = lunr.Set.empty
+
+ for (var i = 0; i < this.fields.length; i++) {
+ var field = this.fields[i]
+
+ if (requiredMatches[field]) {
+ allRequiredMatches = allRequiredMatches.intersect(requiredMatches[field])
+ }
+
+ if (prohibitedMatches[field]) {
+ allProhibitedMatches = allProhibitedMatches.union(prohibitedMatches[field])
+ }
+ }
+
+ var matchingFieldRefs = Object.keys(matchingFields),
+ results = [],
+ matches = Object.create(null)
+
+ /*
+ * If the query is negated (contains only prohibited terms)
+ * we need to get _all_ fieldRefs currently existing in the
+ * index. This is only done when we know that the query is
+ * entirely prohibited terms to avoid any cost of getting all
+ * fieldRefs unnecessarily.
+ *
+ * Additionally, blank MatchData must be created to correctly
+ * populate the results.
+ */
+ if (query.isNegated()) {
+ matchingFieldRefs = Object.keys(this.fieldVectors)
+
+ for (var i = 0; i < matchingFieldRefs.length; i++) {
+ var matchingFieldRef = matchingFieldRefs[i]
+ var fieldRef = lunr.FieldRef.fromString(matchingFieldRef)
+ matchingFields[matchingFieldRef] = new lunr.MatchData
+ }
+ }
+
+ for (var i = 0; i < matchingFieldRefs.length; i++) {
+ /*
+ * Currently we have document fields that match the query, but we
+ * need to return documents. The matchData and scores are combined
+ * from multiple fields belonging to the same document.
+ *
+ * Scores are calculated by field, using the query vectors created
+ * above, and combined into a final document score using addition.
+ */
+ var fieldRef = lunr.FieldRef.fromString(matchingFieldRefs[i]),
+ docRef = fieldRef.docRef
+
+ if (!allRequiredMatches.contains(docRef)) {
+ continue
+ }
+
+ if (allProhibitedMatches.contains(docRef)) {
+ continue
+ }
+
+ var fieldVector = this.fieldVectors[fieldRef],
+ score = queryVectors[fieldRef.fieldName].similarity(fieldVector),
+ docMatch
+
+ if ((docMatch = matches[docRef]) !== undefined) {
+ docMatch.score += score
+ docMatch.matchData.combine(matchingFields[fieldRef])
+ } else {
+ var match = {
+ ref: docRef,
+ score: score,
+ matchData: matchingFields[fieldRef]
+ }
+ matches[docRef] = match
+ results.push(match)
+ }
+ }
+
+ /*
+ * Sort the results objects by score, highest first.
+ */
+ return results.sort(function (a, b) {
+ return b.score - a.score
+ })
+}
+
+/**
+ * Prepares the index for JSON serialization.
+ *
+ * The schema for this JSON blob will be described in a
+ * separate JSON schema file.
+ *
+ * @returns {Object}
+ */
+lunr.Index.prototype.toJSON = function () {
+ var invertedIndex = Object.keys(this.invertedIndex)
+ .sort()
+ .map(function (term) {
+ return [term, this.invertedIndex[term]]
+ }, this)
+
+ var fieldVectors = Object.keys(this.fieldVectors)
+ .map(function (ref) {
+ return [ref, this.fieldVectors[ref].toJSON()]
+ }, this)
+
+ return {
+ version: lunr.version,
+ fields: this.fields,
+ fieldVectors: fieldVectors,
+ invertedIndex: invertedIndex,
+ pipeline: this.pipeline.toJSON()
+ }
+}
+
+/**
+ * Loads a previously serialized lunr.Index
+ *
+ * @param {Object} serializedIndex - A previously serialized lunr.Index
+ * @returns {lunr.Index}
+ */
+lunr.Index.load = function (serializedIndex) {
+ var attrs = {},
+ fieldVectors = {},
+ serializedVectors = serializedIndex.fieldVectors,
+ invertedIndex = Object.create(null),
+ serializedInvertedIndex = serializedIndex.invertedIndex,
+ tokenSetBuilder = new lunr.TokenSet.Builder,
+ pipeline = lunr.Pipeline.load(serializedIndex.pipeline)
+
+ if (serializedIndex.version != lunr.version) {
+ lunr.utils.warn("Version mismatch when loading serialised index. Current version of lunr '" + lunr.version + "' does not match serialized index '" + serializedIndex.version + "'")
+ }
+
+ for (var i = 0; i < serializedVectors.length; i++) {
+ var tuple = serializedVectors[i],
+ ref = tuple[0],
+ elements = tuple[1]
+
+ fieldVectors[ref] = new lunr.Vector(elements)
+ }
+
+ for (var i = 0; i < serializedInvertedIndex.length; i++) {
+ var tuple = serializedInvertedIndex[i],
+ term = tuple[0],
+ posting = tuple[1]
+
+ tokenSetBuilder.insert(term)
+ invertedIndex[term] = posting
+ }
+
+ tokenSetBuilder.finish()
+
+ attrs.fields = serializedIndex.fields
+
+ attrs.fieldVectors = fieldVectors
+ attrs.invertedIndex = invertedIndex
+ attrs.tokenSet = tokenSetBuilder.root
+ attrs.pipeline = pipeline
+
+ return new lunr.Index(attrs)
+}
+/*!
+ * lunr.Builder
+ * Copyright (C) 2020 Oliver Nightingale
+ */
+
+/**
+ * lunr.Builder performs indexing on a set of documents and
+ * returns instances of lunr.Index ready for querying.
+ *
+ * All configuration of the index is done via the builder, the
+ * fields to index, the document reference, the text processing
+ * pipeline and document scoring parameters are all set on the
+ * builder before indexing.
+ *
+ * @constructor
+ * @property {string} _ref - Internal reference to the document reference field.
+ * @property {string[]} _fields - Internal reference to the document fields to index.
+ * @property {object} invertedIndex - The inverted index maps terms to document fields.
+ * @property {object} documentTermFrequencies - Keeps track of document term frequencies.
+ * @property {object} documentLengths - Keeps track of the length of documents added to the index.
+ * @property {lunr.tokenizer} tokenizer - Function for splitting strings into tokens for indexing.
+ * @property {lunr.Pipeline} pipeline - The pipeline performs text processing on tokens before indexing.
+ * @property {lunr.Pipeline} searchPipeline - A pipeline for processing search terms before querying the index.
+ * @property {number} documentCount - Keeps track of the total number of documents indexed.
+ * @property {number} _b - A parameter to control field length normalization, setting this to 0 disabled normalization, 1 fully normalizes field lengths, the default value is 0.75.
+ * @property {number} _k1 - A parameter to control how quickly an increase in term frequency results in term frequency saturation, the default value is 1.2.
+ * @property {number} termIndex - A counter incremented for each unique term, used to identify a terms position in the vector space.
+ * @property {array} metadataWhitelist - A list of metadata keys that have been whitelisted for entry in the index.
+ */
+lunr.Builder = function () {
+ this._ref = "id"
+ this._fields = Object.create(null)
+ this._documents = Object.create(null)
+ this.invertedIndex = Object.create(null)
+ this.fieldTermFrequencies = {}
+ this.fieldLengths = {}
+ this.tokenizer = lunr.tokenizer
+ this.pipeline = new lunr.Pipeline
+ this.searchPipeline = new lunr.Pipeline
+ this.documentCount = 0
+ this._b = 0.75
+ this._k1 = 1.2
+ this.termIndex = 0
+ this.metadataWhitelist = []
+}
+
+/**
+ * Sets the document field used as the document reference. Every document must have this field.
+ * The type of this field in the document should be a string, if it is not a string it will be
+ * coerced into a string by calling toString.
+ *
+ * The default ref is 'id'.
+ *
+ * The ref should _not_ be changed during indexing, it should be set before any documents are
+ * added to the index. Changing it during indexing can lead to inconsistent results.
+ *
+ * @param {string} ref - The name of the reference field in the document.
+ */
+lunr.Builder.prototype.ref = function (ref) {
+ this._ref = ref
+}
+
+/**
+ * A function that is used to extract a field from a document.
+ *
+ * Lunr expects a field to be at the top level of a document, if however the field
+ * is deeply nested within a document an extractor function can be used to extract
+ * the right field for indexing.
+ *
+ * @callback fieldExtractor
+ * @param {object} doc - The document being added to the index.
+ * @returns {?(string|object|object[])} obj - The object that will be indexed for this field.
+ * @example
Extracting a nested field
+ * function (doc) { return doc.nested.field }
+ */
+
+/**
+ * Adds a field to the list of document fields that will be indexed. Every document being
+ * indexed should have this field. Null values for this field in indexed documents will
+ * not cause errors but will limit the chance of that document being retrieved by searches.
+ *
+ * All fields should be added before adding documents to the index. Adding fields after
+ * a document has been indexed will have no effect on already indexed documents.
+ *
+ * Fields can be boosted at build time. This allows terms within that field to have more
+ * importance when ranking search results. Use a field boost to specify that matches within
+ * one field are more important than other fields.
+ *
+ * @param {string} fieldName - The name of a field to index in all documents.
+ * @param {object} attributes - Optional attributes associated with this field.
+ * @param {number} [attributes.boost=1] - Boost applied to all terms within this field.
+ * @param {fieldExtractor} [attributes.extractor] - Function to extract a field from a document.
+ * @throws {RangeError} fieldName cannot contain unsupported characters '/'
+ */
+lunr.Builder.prototype.field = function (fieldName, attributes) {
+ if (/\//.test(fieldName)) {
+ throw new RangeError ("Field '" + fieldName + "' contains illegal character '/'")
+ }
+
+ this._fields[fieldName] = attributes || {}
+}
+
+/**
+ * A parameter to tune the amount of field length normalisation that is applied when
+ * calculating relevance scores. A value of 0 will completely disable any normalisation
+ * and a value of 1 will fully normalise field lengths. The default is 0.75. Values of b
+ * will be clamped to the range 0 - 1.
+ *
+ * @param {number} number - The value to set for this tuning parameter.
+ */
+lunr.Builder.prototype.b = function (number) {
+ if (number < 0) {
+ this._b = 0
+ } else if (number > 1) {
+ this._b = 1
+ } else {
+ this._b = number
+ }
+}
+
+/**
+ * A parameter that controls the speed at which a rise in term frequency results in term
+ * frequency saturation. The default value is 1.2. Setting this to a higher value will give
+ * slower saturation levels, a lower value will result in quicker saturation.
+ *
+ * @param {number} number - The value to set for this tuning parameter.
+ */
+lunr.Builder.prototype.k1 = function (number) {
+ this._k1 = number
+}
+
+/**
+ * Adds a document to the index.
+ *
+ * Before adding fields to the index the index should have been fully setup, with the document
+ * ref and all fields to index already having been specified.
+ *
+ * The document must have a field name as specified by the ref (by default this is 'id') and
+ * it should have all fields defined for indexing, though null or undefined values will not
+ * cause errors.
+ *
+ * Entire documents can be boosted at build time. Applying a boost to a document indicates that
+ * this document should rank higher in search results than other documents.
+ *
+ * @param {object} doc - The document to add to the index.
+ * @param {object} attributes - Optional attributes associated with this document.
+ * @param {number} [attributes.boost=1] - Boost applied to all terms within this document.
+ */
+lunr.Builder.prototype.add = function (doc, attributes) {
+ var docRef = doc[this._ref],
+ fields = Object.keys(this._fields)
+
+ this._documents[docRef] = attributes || {}
+ this.documentCount += 1
+
+ for (var i = 0; i < fields.length; i++) {
+ var fieldName = fields[i],
+ extractor = this._fields[fieldName].extractor,
+ field = extractor ? extractor(doc) : doc[fieldName],
+ tokens = this.tokenizer(field, {
+ fields: [fieldName]
+ }),
+ terms = this.pipeline.run(tokens),
+ fieldRef = new lunr.FieldRef (docRef, fieldName),
+ fieldTerms = Object.create(null)
+
+ this.fieldTermFrequencies[fieldRef] = fieldTerms
+ this.fieldLengths[fieldRef] = 0
+
+ // store the length of this field for this document
+ this.fieldLengths[fieldRef] += terms.length
+
+ // calculate term frequencies for this field
+ for (var j = 0; j < terms.length; j++) {
+ var term = terms[j]
+
+ if (fieldTerms[term] == undefined) {
+ fieldTerms[term] = 0
+ }
+
+ fieldTerms[term] += 1
+
+ // add to inverted index
+ // create an initial posting if one doesn't exist
+ if (this.invertedIndex[term] == undefined) {
+ var posting = Object.create(null)
+ posting["_index"] = this.termIndex
+ this.termIndex += 1
+
+ for (var k = 0; k < fields.length; k++) {
+ posting[fields[k]] = Object.create(null)
+ }
+
+ this.invertedIndex[term] = posting
+ }
+
+ // add an entry for this term/fieldName/docRef to the invertedIndex
+ if (this.invertedIndex[term][fieldName][docRef] == undefined) {
+ this.invertedIndex[term][fieldName][docRef] = Object.create(null)
+ }
+
+ // store all whitelisted metadata about this token in the
+ // inverted index
+ for (var l = 0; l < this.metadataWhitelist.length; l++) {
+ var metadataKey = this.metadataWhitelist[l],
+ metadata = term.metadata[metadataKey]
+
+ if (this.invertedIndex[term][fieldName][docRef][metadataKey] == undefined) {
+ this.invertedIndex[term][fieldName][docRef][metadataKey] = []
+ }
+
+ this.invertedIndex[term][fieldName][docRef][metadataKey].push(metadata)
+ }
+ }
+
+ }
+}
+
+/**
+ * Calculates the average document length for this index
+ *
+ * @private
+ */
+lunr.Builder.prototype.calculateAverageFieldLengths = function () {
+
+ var fieldRefs = Object.keys(this.fieldLengths),
+ numberOfFields = fieldRefs.length,
+ accumulator = {},
+ documentsWithField = {}
+
+ for (var i = 0; i < numberOfFields; i++) {
+ var fieldRef = lunr.FieldRef.fromString(fieldRefs[i]),
+ field = fieldRef.fieldName
+
+ documentsWithField[field] || (documentsWithField[field] = 0)
+ documentsWithField[field] += 1
+
+ accumulator[field] || (accumulator[field] = 0)
+ accumulator[field] += this.fieldLengths[fieldRef]
+ }
+
+ var fields = Object.keys(this._fields)
+
+ for (var i = 0; i < fields.length; i++) {
+ var fieldName = fields[i]
+ accumulator[fieldName] = accumulator[fieldName] / documentsWithField[fieldName]
+ }
+
+ this.averageFieldLength = accumulator
+}
+
+/**
+ * Builds a vector space model of every document using lunr.Vector
+ *
+ * @private
+ */
+lunr.Builder.prototype.createFieldVectors = function () {
+ var fieldVectors = {},
+ fieldRefs = Object.keys(this.fieldTermFrequencies),
+ fieldRefsLength = fieldRefs.length,
+ termIdfCache = Object.create(null)
+
+ for (var i = 0; i < fieldRefsLength; i++) {
+ var fieldRef = lunr.FieldRef.fromString(fieldRefs[i]),
+ fieldName = fieldRef.fieldName,
+ fieldLength = this.fieldLengths[fieldRef],
+ fieldVector = new lunr.Vector,
+ termFrequencies = this.fieldTermFrequencies[fieldRef],
+ terms = Object.keys(termFrequencies),
+ termsLength = terms.length
+
+
+ var fieldBoost = this._fields[fieldName].boost || 1,
+ docBoost = this._documents[fieldRef.docRef].boost || 1
+
+ for (var j = 0; j < termsLength; j++) {
+ var term = terms[j],
+ tf = termFrequencies[term],
+ termIndex = this.invertedIndex[term]._index,
+ idf, score, scoreWithPrecision
+
+ if (termIdfCache[term] === undefined) {
+ idf = lunr.idf(this.invertedIndex[term], this.documentCount)
+ termIdfCache[term] = idf
+ } else {
+ idf = termIdfCache[term]
+ }
+
+ score = idf * ((this._k1 + 1) * tf) / (this._k1 * (1 - this._b + this._b * (fieldLength / this.averageFieldLength[fieldName])) + tf)
+ score *= fieldBoost
+ score *= docBoost
+ scoreWithPrecision = Math.round(score * 1000) / 1000
+ // Converts 1.23456789 to 1.234.
+ // Reducing the precision so that the vectors take up less
+ // space when serialised. Doing it now so that they behave
+ // the same before and after serialisation. Also, this is
+ // the fastest approach to reducing a number's precision in
+ // JavaScript.
+
+ fieldVector.insert(termIndex, scoreWithPrecision)
+ }
+
+ fieldVectors[fieldRef] = fieldVector
+ }
+
+ this.fieldVectors = fieldVectors
+}
+
+/**
+ * Creates a token set of all tokens in the index using lunr.TokenSet
+ *
+ * @private
+ */
+lunr.Builder.prototype.createTokenSet = function () {
+ this.tokenSet = lunr.TokenSet.fromArray(
+ Object.keys(this.invertedIndex).sort()
+ )
+}
+
+/**
+ * Builds the index, creating an instance of lunr.Index.
+ *
+ * This completes the indexing process and should only be called
+ * once all documents have been added to the index.
+ *
+ * @returns {lunr.Index}
+ */
+lunr.Builder.prototype.build = function () {
+ this.calculateAverageFieldLengths()
+ this.createFieldVectors()
+ this.createTokenSet()
+
+ return new lunr.Index({
+ invertedIndex: this.invertedIndex,
+ fieldVectors: this.fieldVectors,
+ tokenSet: this.tokenSet,
+ fields: Object.keys(this._fields),
+ pipeline: this.searchPipeline
+ })
+}
+
+/**
+ * Applies a plugin to the index builder.
+ *
+ * A plugin is a function that is called with the index builder as its context.
+ * Plugins can be used to customise or extend the behaviour of the index
+ * in some way. A plugin is just a function, that encapsulated the custom
+ * behaviour that should be applied when building the index.
+ *
+ * The plugin function will be called with the index builder as its argument, additional
+ * arguments can also be passed when calling use. The function will be called
+ * with the index builder as its context.
+ *
+ * @param {Function} plugin The plugin to apply.
+ */
+lunr.Builder.prototype.use = function (fn) {
+ var args = Array.prototype.slice.call(arguments, 1)
+ args.unshift(this)
+ fn.apply(this, args)
+}
+/**
+ * Contains and collects metadata about a matching document.
+ * A single instance of lunr.MatchData is returned as part of every
+ * lunr.Index~Result.
+ *
+ * @constructor
+ * @param {string} term - The term this match data is associated with
+ * @param {string} field - The field in which the term was found
+ * @param {object} metadata - The metadata recorded about this term in this field
+ * @property {object} metadata - A cloned collection of metadata associated with this document.
+ * @see {@link lunr.Index~Result}
+ */
+lunr.MatchData = function (term, field, metadata) {
+ var clonedMetadata = Object.create(null),
+ metadataKeys = Object.keys(metadata || {})
+
+ // Cloning the metadata to prevent the original
+ // being mutated during match data combination.
+ // Metadata is kept in an array within the inverted
+ // index so cloning the data can be done with
+ // Array#slice
+ for (var i = 0; i < metadataKeys.length; i++) {
+ var key = metadataKeys[i]
+ clonedMetadata[key] = metadata[key].slice()
+ }
+
+ this.metadata = Object.create(null)
+
+ if (term !== undefined) {
+ this.metadata[term] = Object.create(null)
+ this.metadata[term][field] = clonedMetadata
+ }
+}
+
+/**
+ * An instance of lunr.MatchData will be created for every term that matches a
+ * document. However only one instance is required in a lunr.Index~Result. This
+ * method combines metadata from another instance of lunr.MatchData with this
+ * objects metadata.
+ *
+ * @param {lunr.MatchData} otherMatchData - Another instance of match data to merge with this one.
+ * @see {@link lunr.Index~Result}
+ */
+lunr.MatchData.prototype.combine = function (otherMatchData) {
+ var terms = Object.keys(otherMatchData.metadata)
+
+ for (var i = 0; i < terms.length; i++) {
+ var term = terms[i],
+ fields = Object.keys(otherMatchData.metadata[term])
+
+ if (this.metadata[term] == undefined) {
+ this.metadata[term] = Object.create(null)
+ }
+
+ for (var j = 0; j < fields.length; j++) {
+ var field = fields[j],
+ keys = Object.keys(otherMatchData.metadata[term][field])
+
+ if (this.metadata[term][field] == undefined) {
+ this.metadata[term][field] = Object.create(null)
+ }
+
+ for (var k = 0; k < keys.length; k++) {
+ var key = keys[k]
+
+ if (this.metadata[term][field][key] == undefined) {
+ this.metadata[term][field][key] = otherMatchData.metadata[term][field][key]
+ } else {
+ this.metadata[term][field][key] = this.metadata[term][field][key].concat(otherMatchData.metadata[term][field][key])
+ }
+
+ }
+ }
+ }
+}
+
+/**
+ * Add metadata for a term/field pair to this instance of match data.
+ *
+ * @param {string} term - The term this match data is associated with
+ * @param {string} field - The field in which the term was found
+ * @param {object} metadata - The metadata recorded about this term in this field
+ */
+lunr.MatchData.prototype.add = function (term, field, metadata) {
+ if (!(term in this.metadata)) {
+ this.metadata[term] = Object.create(null)
+ this.metadata[term][field] = metadata
+ return
+ }
+
+ if (!(field in this.metadata[term])) {
+ this.metadata[term][field] = metadata
+ return
+ }
+
+ var metadataKeys = Object.keys(metadata)
+
+ for (var i = 0; i < metadataKeys.length; i++) {
+ var key = metadataKeys[i]
+
+ if (key in this.metadata[term][field]) {
+ this.metadata[term][field][key] = this.metadata[term][field][key].concat(metadata[key])
+ } else {
+ this.metadata[term][field][key] = metadata[key]
+ }
+ }
+}
+/**
+ * A lunr.Query provides a programmatic way of defining queries to be performed
+ * against a {@link lunr.Index}.
+ *
+ * Prefer constructing a lunr.Query using the {@link lunr.Index#query} method
+ * so the query object is pre-initialized with the right index fields.
+ *
+ * @constructor
+ * @property {lunr.Query~Clause[]} clauses - An array of query clauses.
+ * @property {string[]} allFields - An array of all available fields in a lunr.Index.
+ */
+lunr.Query = function (allFields) {
+ this.clauses = []
+ this.allFields = allFields
+}
+
+/**
+ * Constants for indicating what kind of automatic wildcard insertion will be used when constructing a query clause.
+ *
+ * This allows wildcards to be added to the beginning and end of a term without having to manually do any string
+ * concatenation.
+ *
+ * The wildcard constants can be bitwise combined to select both leading and trailing wildcards.
+ *
+ * @constant
+ * @default
+ * @property {number} wildcard.NONE - The term will have no wildcards inserted, this is the default behaviour
+ * @property {number} wildcard.LEADING - Prepend the term with a wildcard, unless a leading wildcard already exists
+ * @property {number} wildcard.TRAILING - Append a wildcard to the term, unless a trailing wildcard already exists
+ * @see lunr.Query~Clause
+ * @see lunr.Query#clause
+ * @see lunr.Query#term
+ * @example
+ * query.term('foo', {
+ * wildcard: lunr.Query.wildcard.LEADING | lunr.Query.wildcard.TRAILING
+ * })
+ */
+
+lunr.Query.wildcard = new String ("*")
+lunr.Query.wildcard.NONE = 0
+lunr.Query.wildcard.LEADING = 1
+lunr.Query.wildcard.TRAILING = 2
+
+/**
+ * Constants for indicating what kind of presence a term must have in matching documents.
+ *
+ * @constant
+ * @enum {number}
+ * @see lunr.Query~Clause
+ * @see lunr.Query#clause
+ * @see lunr.Query#term
+ * @example
query term with required presence
+ * query.term('foo', { presence: lunr.Query.presence.REQUIRED })
+ */
+lunr.Query.presence = {
+ /**
+ * Term's presence in a document is optional, this is the default value.
+ */
+ OPTIONAL: 1,
+
+ /**
+ * Term's presence in a document is required, documents that do not contain
+ * this term will not be returned.
+ */
+ REQUIRED: 2,
+
+ /**
+ * Term's presence in a document is prohibited, documents that do contain
+ * this term will not be returned.
+ */
+ PROHIBITED: 3
+}
+
+/**
+ * A single clause in a {@link lunr.Query} contains a term and details on how to
+ * match that term against a {@link lunr.Index}.
+ *
+ * @typedef {Object} lunr.Query~Clause
+ * @property {string[]} fields - The fields in an index this clause should be matched against.
+ * @property {number} [boost=1] - Any boost that should be applied when matching this clause.
+ * @property {number} [editDistance] - Whether the term should have fuzzy matching applied, and how fuzzy the match should be.
+ * @property {boolean} [usePipeline] - Whether the term should be passed through the search pipeline.
+ * @property {number} [wildcard=lunr.Query.wildcard.NONE] - Whether the term should have wildcards appended or prepended.
+ * @property {number} [presence=lunr.Query.presence.OPTIONAL] - The terms presence in any matching documents.
+ */
+
+/**
+ * Adds a {@link lunr.Query~Clause} to this query.
+ *
+ * Unless the clause contains the fields to be matched all fields will be matched. In addition
+ * a default boost of 1 is applied to the clause.
+ *
+ * @param {lunr.Query~Clause} clause - The clause to add to this query.
+ * @see lunr.Query~Clause
+ * @returns {lunr.Query}
+ */
+lunr.Query.prototype.clause = function (clause) {
+ if (!('fields' in clause)) {
+ clause.fields = this.allFields
+ }
+
+ if (!('boost' in clause)) {
+ clause.boost = 1
+ }
+
+ if (!('usePipeline' in clause)) {
+ clause.usePipeline = true
+ }
+
+ if (!('wildcard' in clause)) {
+ clause.wildcard = lunr.Query.wildcard.NONE
+ }
+
+ if ((clause.wildcard & lunr.Query.wildcard.LEADING) && (clause.term.charAt(0) != lunr.Query.wildcard)) {
+ clause.term = "*" + clause.term
+ }
+
+ if ((clause.wildcard & lunr.Query.wildcard.TRAILING) && (clause.term.slice(-1) != lunr.Query.wildcard)) {
+ clause.term = "" + clause.term + "*"
+ }
+
+ if (!('presence' in clause)) {
+ clause.presence = lunr.Query.presence.OPTIONAL
+ }
+
+ this.clauses.push(clause)
+
+ return this
+}
+
+/**
+ * A negated query is one in which every clause has a presence of
+ * prohibited. These queries require some special processing to return
+ * the expected results.
+ *
+ * @returns boolean
+ */
+lunr.Query.prototype.isNegated = function () {
+ for (var i = 0; i < this.clauses.length; i++) {
+ if (this.clauses[i].presence != lunr.Query.presence.PROHIBITED) {
+ return false
+ }
+ }
+
+ return true
+}
+
+/**
+ * Adds a term to the current query, under the covers this will create a {@link lunr.Query~Clause}
+ * to the list of clauses that make up this query.
+ *
+ * The term is used as is, i.e. no tokenization will be performed by this method. Instead conversion
+ * to a token or token-like string should be done before calling this method.
+ *
+ * The term will be converted to a string by calling `toString`. Multiple terms can be passed as an
+ * array, each term in the array will share the same options.
+ *
+ * @param {object|object[]} term - The term(s) to add to the query.
+ * @param {object} [options] - Any additional properties to add to the query clause.
+ * @returns {lunr.Query}
+ * @see lunr.Query#clause
+ * @see lunr.Query~Clause
+ * @example
adding a single term to a query
+ * query.term("foo")
+ * @example
adding a single term to a query and specifying search fields, term boost and automatic trailing wildcard
")),e.inlineElement=o}return h.updateStatus("ready"),h._parseMarkup(t,{},e),t}}});function N(){I&&l(document.body).removeClass(I)}function j(){N(),h.req&&h.req.abort()}var I,L="ajax";l.magnificPopup.registerModule(L,{options:{settings:null,cursor:"mfp-ajax-cur",tError:'The content could not be loaded.'},proto:{initAjax:function(){h.types.push(L),I=h.st.ajax.cursor,c(u+"."+L,j),c("BeforeChange."+L,j)},getAjax:function(r){I&&l(document.body).addClass(I),h.updateStatus("loading");var e=l.extend({url:r.src,success:function(e,t,n){n={data:e,xhr:n};d("ParseAjax",n),h.appendContent(l(n.data),L),r.finished=!0,N(),h._setFocus(),setTimeout(function(){h.wrap.addClass(w)},16),h.updateStatus("ready"),d("AjaxContentAdded")},error:function(){N(),r.finished=r.loadError=!0,h.updateStatus("error",h.st.ajax.tError.replace("%url%",r.src))}},h.st.ajax.settings);return h.req=l.ajax(e),""}}});var D;l.magnificPopup.registerModule("image",{options:{markup:'
',cursor:"mfp-zoom-out-cur",titleSrc:"title",verticalFit:!0,tError:'The image could not be loaded.'},proto:{initImage:function(){var e=h.st.image,t=".image";h.types.push("image"),c(b+t,function(){"image"===h.currItem.type&&e.cursor&&l(document.body).addClass(e.cursor)}),c(u+t,function(){e.cursor&&l(document.body).removeClass(e.cursor),C.off("resize"+x)}),c("Resize"+t,h.resizeImage),h.isLowIE&&c("AfterChange",h.resizeImage)},resizeImage:function(){var e,t=h.currItem;t&&t.img&&h.st.image.verticalFit&&(e=0,h.isLowIE&&(e=parseInt(t.img.css("padding-top"),10)+parseInt(t.img.css("padding-bottom"),10)),t.img.css("max-height",h.wH-e))},_onImageHasSize:function(e){e.img&&(e.hasSize=!0,D&&clearInterval(D),e.isCheckingImgSize=!1,d("ImageHasSize",e),e.imgHidden&&(h.content&&h.content.removeClass("mfp-loading"),e.imgHidden=!1))},findImageSize:function(t){var n=0,r=t.img[0],o=function(e){D&&clearInterval(D),D=setInterval(function(){0
',srcAction:"iframe_src",patterns:{youtube:{index:"youtube.com",id:"v=",src:"//www.youtube.com/embed/%id%?autoplay=1"},vimeo:{index:"vimeo.com/",id:"/",src:"//player.vimeo.com/video/%id%?autoplay=1"},gmaps:{index:"//maps.google.",src:"%id%&output=embed"}}},proto:{initIframe:function(){h.types.push(P),c("BeforeChange",function(e,t,n){t!==n&&(t===P?H():n===P&&H(!0))}),c(u+"."+P,function(){H()})},getIframe:function(e,t){var n=e.src,r=h.st.iframe;l.each(r.patterns,function(){if(-1',preload:[0,2],navigateByImgClick:!0,arrows:!0,tPrev:"Previous (Left arrow key)",tNext:"Next (Right arrow key)",tCounter:"%curr% of %total%"},proto:{initGallery:function(){var i=h.st.gallery,e=".mfp-gallery";if(h.direction=!0,!i||!i.enabled)return!1;g+=" mfp-gallery",c(b+e,function(){i.navigateByImgClick&&h.wrap.on("click"+e,".mfp-img",function(){if(1=h.index,h.index=e,h.updateItemHTML()},preloadNearbyImages:function(){for(var e=h.st.gallery.preload,t=Math.min(e[0],h.items.length),n=Math.min(e[1],h.items.length),r=1;r<=(h.direction?n:t);r++)h._preloadItem(h.index+r);for(r=1;r<=(h.direction?t:n);r++)h._preloadItem(h.index-r)},_preloadItem:function(e){var t;e=q(e),h.items[e].preloaded||((t=h.items[e]).parsed||(t=h.parseEl(e)),d("LazyLoad",t),"image"===t.type&&(t.img=l('').on("load.mfploader",function(){t.hasSize=!0}).on("error.mfploader",function(){t.hasSize=!0,t.loadError=!0,d("LazyLoadError",t)}).attr("src",t.src)),t.preloaded=!0)}}});var _="retina";l.magnificPopup.registerModule(_,{options:{replaceSrc:function(e){return e.src.replace(/\.\w+$/,function(e){return"@2x"+e})},ratio:1},proto:{initRetina:function(){var n,r;1t.durationMax?t.durationMax:t.durationMin&&e=u)return b.cancelScroll(!0),e=t,n=g,0===(t=r)&&document.body.focus(),n||(t.focus(),document.activeElement!==t&&(t.setAttribute("tabindex","-1"),t.focus(),t.style.outline="none"),x.scrollTo(0,e)),E("scrollStop",m,r,o),!(y=f=null)},h=function(e){var t,n,r;l+=e-(f=f||e),d=i+s*(n=d=1<(d=0===c?0:l/c)?1:d,"easeInQuad"===(t=m).easing&&(r=n*n),"easeOutQuad"===t.easing&&(r=n*(2-n)),"easeInOutQuad"===t.easing&&(r=n<.5?2*n*n:(4-2*n)*n-1),"easeInCubic"===t.easing&&(r=n*n*n),"easeOutCubic"===t.easing&&(r=--n*n*n+1),"easeInOutCubic"===t.easing&&(r=n<.5?4*n*n*n:(n-1)*(2*n-2)*(2*n-2)+1),"easeInQuart"===t.easing&&(r=n*n*n*n),"easeOutQuart"===t.easing&&(r=1- --n*n*n*n),"easeInOutQuart"===t.easing&&(r=n<.5?8*n*n*n*n:1-8*--n*n*n*n),"easeInQuint"===t.easing&&(r=n*n*n*n*n),"easeOutQuint"===t.easing&&(r=1+--n*n*n*n*n),"easeInOutQuint"===t.easing&&(r=n<.5?16*n*n*n*n*n:1+16*--n*n*n*n*n),(r=t.customEasing?t.customEasing(n):r)||n),x.scrollTo(0,Math.floor(d)),p(d,a)||(y=x.requestAnimationFrame(h),f=e)},0===x.pageYOffset&&x.scrollTo(0,0),t=r,e=m,g||history.pushState&&e.updateURL&&history.pushState({smoothScroll:JSON.stringify(e),anchor:t.id},document.title,t===document.documentElement?"#top":"#"+t.id),"matchMedia"in x&&x.matchMedia("(prefers-reduced-motion)").matches?x.scrollTo(0,Math.floor(a)):(E("scrollStart",m,r,o),b.cancelScroll(!0),x.requestAnimationFrame(h)))};function t(e){if(!e.defaultPrevented&&!(0!==e.button||e.metaKey||e.ctrlKey||e.shiftKey)&&"closest"in e.target&&(o=e.target.closest(r))&&"a"===o.tagName.toLowerCase()&&!e.target.closest(v.ignore)&&o.hostname===x.location.hostname&&o.pathname===x.location.pathname&&/#/.test(o.href)){var t,n;try{n=a(decodeURIComponent(o.hash))}catch(e){n=a(o.hash)}if("#"===n){if(!v.topOnEmptyHash)return;t=document.documentElement}else t=document.querySelector(n);(t=t||"#top"!==n?t:document.documentElement)&&(e.preventDefault(),n=v,history.replaceState&&n.updateURL&&!history.state&&(e=(e=x.location.hash)||"",history.replaceState({smoothScroll:JSON.stringify(n),anchor:e||x.pageYOffset},document.title,e||x.location.href)),b.animateScroll(t,o))}}function i(e){var t;null!==history.state&&history.state.smoothScroll&&history.state.smoothScroll===JSON.stringify(v)&&("string"==typeof(t=history.state.anchor)&&t&&!(t=document.querySelector(a(history.state.anchor)))||b.animateScroll(t,null,{updateURL:!1}))}b.destroy=function(){v&&(document.removeEventListener("click",t,!1),x.removeEventListener("popstate",i,!1),b.cancelScroll(),y=n=o=v=null)};return function(){if(!("querySelector"in document&&"addEventListener"in x&&"requestAnimationFrame"in x&&"closest"in x.Element.prototype))throw"Smooth Scroll: This browser does not support the required JavaScript methods and browser APIs.";b.destroy(),v=w(S,e||{}),n=v.header?document.querySelector(v.header):null,document.addEventListener("click",t,!1),v.updateURL&&v.popstate&&x.addEventListener("popstate",i,!1)}(),b}}),function(e,t){"function"==typeof define&&define.amd?define([],function(){return t(e)}):"object"==typeof exports?module.exports=t(e):e.Gumshoe=t(e)}("undefined"!=typeof global?global:"undefined"!=typeof window?window:this,function(c){"use strict";function f(e,t,n){n.settings.events&&(n=new CustomEvent(e,{bubbles:!0,cancelable:!0,detail:n}),t.dispatchEvent(n))}function n(e){var t=0;if(e.offsetParent)for(;e;)t+=e.offsetTop,e=e.offsetParent;return 0<=t?t:0}function d(e){e&&e.sort(function(e,t){return n(e.content)=Math.max(document.body.scrollHeight,document.documentElement.scrollHeight,document.body.offsetHeight,document.documentElement.offsetHeight,document.body.clientHeight,document.documentElement.clientHeight)}function p(e,t){var n,r,o=e[e.length-1];if(n=o,r=t,!(!s()||!a(n.content,r,!0)))return o;for(var i=e.length-1;0<=i;i--)if(a(e[i].content,t))return e[i]}function h(e,t){var n;!e||(n=e.nav.closest("li"))&&(n.classList.remove(t.navClass),e.content.classList.remove(t.contentClass),r(n,t),f("gumshoeDeactivate",n,{link:e.nav,content:e.content,settings:t}))}var m={navClass:"active",contentClass:"active",nested:!1,nestedClass:"active",offset:0,reflow:!1,events:!0},r=function(e,t){!t.nested||(e=e.parentNode.closest("li"))&&(e.classList.remove(t.nestedClass),r(e,t))},g=function(e,t){!t.nested||(e=e.parentNode.closest("li"))&&(e.classList.add(t.nestedClass),g(e,t))};return function(e,t){var n,o,i,r,a,s={setup:function(){n=document.querySelectorAll(e),o=[],Array.prototype.forEach.call(n,function(e){var t=document.getElementById(decodeURIComponent(e.hash.substr(1)));t&&o.push({nav:e,content:t})}),d(o)}};s.detect=function(){var e,t,n,r=p(o,a);r?i&&r.content===i.content||(h(i,a),t=a,!(e=r)||(n=e.nav.closest("li"))&&(n.classList.add(t.navClass),e.content.classList.add(t.contentClass),g(n,t),f("gumshoeActivate",n,{link:e.nav,content:e.content,settings:t})),i=r):i&&(h(i,a),i=null)};function u(e){r&&c.cancelAnimationFrame(r),r=c.requestAnimationFrame(s.detect)}function l(e){r&&c.cancelAnimationFrame(r),r=c.requestAnimationFrame(function(){d(o),s.detect()})}s.destroy=function(){i&&h(i,a),c.removeEventListener("scroll",u,!1),a.reflow&&c.removeEventListener("resize",l,!1),a=r=i=n=o=null};return a=function(){var n={};return Array.prototype.forEach.call(arguments,function(e){for(var t in e){if(!e.hasOwnProperty(t))return;n[t]=e[t]}}),n}(m,t||{}),s.setup(),s.detect(),c.addEventListener("scroll",u,!1),a.reflow&&c.addEventListener("resize",l,!1),s}}),$(document).ready(function(){$("#main").fitVids();function e(){(0===$(".author__urls-wrapper button").length?1024<$(window).width():!$(".author__urls-wrapper button").is(":visible"))?$(".sidebar").addClass("sticky"):$(".sidebar").removeClass("sticky")}e(),$(window).resize(function(){e()}),$(".author__urls-wrapper button").on("click",function(){$(".author__urls").toggleClass("is--visible"),$(".author__urls-wrapper button").toggleClass("open")}),$(document).keyup(function(e){27===e.keyCode&&$(".initial-content").hasClass("is--hidden")&&($(".search-content").toggleClass("is--visible"),$(".initial-content").toggleClass("is--hidden"))}),$(".search__toggle").on("click",function(){$(".search-content").toggleClass("is--visible"),$(".initial-content").toggleClass("is--hidden"),setTimeout(function(){$(".search-content input").focus()},400)});new SmoothScroll('a[href*="#"]',{offset:20,speed:400,speedAsDuration:!0,durationMax:500});0<$("nav.toc").length&&new Gumshoe("nav.toc a",{navClass:"active",contentClass:"active",nested:!1,nestedClass:"active",offset:20,reflow:!0,events:!0}),$("a[href$='.jpg'],a[href$='.jpeg'],a[href$='.JPG'],a[href$='.png'],a[href$='.gif'],a[href$='.webp']").addClass("image-popup"),$(".image-popup").magnificPopup({type:"image",tLoading:"Loading image #%curr%...",gallery:{enabled:!0,navigateByImgClick:!0,preload:[0,1]},image:{tError:'Image #%curr% could not be loaded.'},removalDelay:500,mainClass:"mfp-zoom-in",callbacks:{beforeOpen:function(){this.st.image.markup=this.st.image.markup.replace("mfp-figure","mfp-figure mfp-with-anim")}},closeOnContentClick:!0,midClick:!0}),$(".page__content").find("h1, h2, h3, h4, h5, h6").each(function(){var e,t=$(this).attr("id");t&&((e=document.createElement("a")).className="header-link",e.href="#"+t,e.innerHTML='Permalink',e.title="Permalink",$(this).append(e))})});
\ No newline at end of file
diff --git a/assets/js/plugins/bigfoot.min.js b/assets/js/plugins/bigfoot.min.js
new file mode 100644
index 000000000..35d201cea
--- /dev/null
+++ b/assets/js/plugins/bigfoot.min.js
@@ -0,0 +1,39 @@
+(function(){(function($){return $.bigfoot=function(options){var addBreakpoint,baseFontSize,bigfoot,buttonHover,calculatePixelDimension,cleanFootnoteLinks,clickButton,createPopover,defaults,deleteEmptyOrHR,escapeKeypress,footnoteInit,getSetting,makeDefaultCallbacks,popoverStates,positionTooltip,removeBackLinks,removeBreakpoint,removePopovers,replaceWithReferenceAttributes,repositionFeet,roomCalc,settings,touchClick,unhoverFeet,updateSetting,viewportDetails;bigfoot=void 0;defaults={actionOriginalFN:"hide",activateCallback:function(){},activateOnHover:!1,allowMultipleFN:!1,anchorPattern:/(fn|footnote|note)[:\-_\d]/gi,anchorParentTagname:'sup',breakpoints:{},deleteOnUnhover:!1,footnoteParentClass:'footnote',footnoteTagname:'li',hoverDelay:250,numberResetSelector:void 0,popoverDeleteDelay:300,popoverCreateDelay:100,positionContent:!0,preventPageScroll:!0,scope:!1,useFootnoteOnlyOnce:!0,contentMarkup:"",buttonMarkup:"
"}
+footnoteButton=settings.buttonMarkup.replace(/\{\{FOOTNOTENUM\}\}/g,footnoteNum).replace(/\{\{FOOTNOTEID\}\}/g,footnoteIDNum).replace(/\{\{FOOTNOTECONTENT\}\}/g,footnoteContent);footnoteButton=replaceWithReferenceAttributes(footnoteButton,"SUP",$relevantFNLink);footnoteButton=replaceWithReferenceAttributes(footnoteButton,"FN",$relevantFootnote);$footnoteButton=$(footnoteButton).insertBefore($relevantFNLink);$parent=$relevantFootnote.parent();switch(settings.actionOriginalFN.toLowerCase()){case "hide":$relevantFNLink.addClass("footnote-print-only");$relevantFootnote.addClass("footnote-print-only");_results.push(deleteEmptyOrHR($parent));break;case "delete":$relevantFNLink.remove();$relevantFootnote.remove();_results.push(deleteEmptyOrHR($parent));break;default:_results.push($relevantFNLink.addClass("footnote-print-only"))}}
+return _results};cleanFootnoteLinks=function($footnoteAnchors,footnoteLinks){var $parent,$supChild,linkHREF,linkID;if(footnoteLinks==null){footnoteLinks=[]}
+$parent=void 0;$supChild=void 0;linkHREF=void 0;linkID=void 0;$footnoteAnchors.each(function(){var $child,$this;$this=$(this);linkHREF="#"+($this.attr("href")).split("#")[1];$parent=$this.closest(settings.anchorParentTagname);$child=$this.find(settings.anchorParentTagname);if($parent.length>0){linkID=($parent.attr("id")||"")+($this.attr("id")||"");return footnoteLinks.push($parent.attr({"data-footnote-backlink-ref":linkID,"data-footnote-ref":linkHREF}))}else if($child.length>0){linkID=($child.attr("id")||"")+($this.attr("id")||"");return footnoteLinks.push($this.attr({"data-footnote-backlink-ref":linkID,"data-footnote-ref":linkHREF}))}else{linkID=$this.attr("id")||"";return footnoteLinks.push($this.attr({"data-footnote-backlink-ref":linkID,"data-footnote-ref":linkHREF}))}})};deleteEmptyOrHR=function($el){var $parent;$parent=void 0;if($el.is(":empty")||$el.children(":not(.footnote-print-only)").length===0){$parent=$el.parent();if(settings.actionOriginalFN.toLowerCase()==="delete"){$el.remove()}else{$el.addClass("footnote-print-only")}
+return deleteEmptyOrHR($parent)}else if($el.children(":not(.footnote-print-only)").length===$el.children("hr:not(.footnote-print-only)").length){$parent=$el.parent();if(settings.actionOriginalFN.toLowerCase()==="delete"){$el.remove()}else{$el.children("hr").addClass("footnote-print-only");$el.addClass("footnote-print-only")}
+return deleteEmptyOrHR($parent)}};removeBackLinks=function(footnoteHTML,backlinkID){var regex;if(backlinkID.indexOf(' ')>=0){backlinkID=backlinkID.trim().replace(/\s+/g,"|").replace(/(.*)/g,"($1)")}
+regex=new RegExp("(\\s| )*<\\s*a[^#<]*#"+backlinkID+"[^>]*>(.*?)<\\s*/\\s*a>","g");return footnoteHTML.replace(regex,"").replace("[]","")};replaceWithReferenceAttributes=function(string,referenceKeyword,$referenceElement){var refMatches,refRegex,refReplaceRegex,refReplaceText;refRegex=new RegExp("\\{\\{"+referenceKeyword+":([^\\}]*)\\}\\}","g");refMatches=void 0;refReplaceText=void 0;refReplaceRegex=void 0;refMatches=refRegex.exec(string);while(refMatches){if(refMatches[1]){refReplaceText=$referenceElement.attr(refMatches[1])||"";string=string.replace("{{"+referenceKeyword+":"+refMatches[1]+"}}",refReplaceText)}
+refMatches=refRegex.exec(string)}
+return string};buttonHover=function(event){var $buttonHovered,dataIdentifier,otherPopoverSelector;if(settings.activateOnHover){$buttonHovered=$(event.target).closest(".bigfoot-footnote__button");dataIdentifier="[data-footnote-identifier='"+($buttonHovered.attr("data-footnote-identifier"))+"']";if($buttonHovered.hasClass("is-active")){return}
+$buttonHovered.addClass("is-hover-instantiated");if(!settings.allowMultipleFN){otherPopoverSelector=".bigfoot-footnote:not("+dataIdentifier+")";removePopovers(otherPopoverSelector)}
+createPopover(".bigfoot-footnote__button"+dataIdentifier).addClass("is-hover-instantiated")}};touchClick=function(event){var $nearButton,$nearFootnote,$target;$target=$(event.target);$nearButton=$target.closest(".bigfoot-footnote__button");$nearFootnote=$target.closest(".bigfoot-footnote");if($nearButton.length>0){event.preventDefault();clickButton($nearButton)}else if($nearFootnote.length<1){if($(".bigfoot-footnote").length>0){removePopovers()}}};clickButton=function($button){var dataIdentifier;$button.blur();dataIdentifier="data-footnote-identifier='"+($button.attr("data-footnote-identifier"))+"'";if($button.hasClass("changing")){return}else if(!$button.hasClass("is-active")){$button.addClass("changing");setTimeout((function(){return $button.removeClass("changing")}),settings.popoverCreateDelay);createPopover(".bigfoot-footnote__button["+dataIdentifier+"]");$button.addClass("is-click-instantiated");if(!settings.allowMultipleFN){removePopovers(".bigfoot-footnote:not(["+dataIdentifier+"])")}}else{if(!settings.allowMultipleFN){removePopovers()}else{removePopovers(".bigfoot-footnote["+dataIdentifier+"]")}}};createPopover=function(selector){var $buttons,$popoversCreated;$buttons=void 0;if(typeof selector!=="string"&&settings.allowMultipleFN){$buttons=selector}else if(typeof selector!=="string"){$buttons=selector.first()}else if(settings.allowMultipleFN){$buttons=$(selector).closest(".bigfoot-footnote__button")}else{$buttons=$(selector+":first").closest(".bigfoot-footnote__button")}
+$popoversCreated=$();$buttons.each(function(){var $content,$contentContainer,$this,content;$this=$(this);content=void 0;try{content=settings.contentMarkup.replace(/\{\{FOOTNOTENUM\}\}/g,$this.attr("data-footnote-number")).replace(/\{\{FOOTNOTEID\}\}/g,$this.attr("data-footnote-identifier")).replace(/\{\{FOOTNOTECONTENT\}\}/g,$this.attr("data-bigfoot-footnote")).replace(/\>sym\;/g,">").replace(/\<sym\;/g,"<");return content=replaceWithReferenceAttributes(content,"BUTTON",$this)}finally{$content=$(content);try{settings.activateCallback($content,$this)}catch(_error){}
+$content.insertAfter($buttons);popoverStates[$this.attr("data-footnote-identifier")]="init";$content.attr("bigfoot-max-width",calculatePixelDimension($content.css("max-width"),$content));$content.css("max-width",10000);$contentContainer=$content.find(".bigfoot-footnote__content");$content.attr("data-bigfoot-max-height",calculatePixelDimension($contentContainer.css("max-height"),$contentContainer));repositionFeet();$this.addClass("is-active");$content.find(".bigfoot-footnote__content").bindScrollHandler();$popoversCreated=$popoversCreated.add($content)}});setTimeout((function(){return $popoversCreated.addClass("is-active")}),settings.popoverCreateDelay);return $popoversCreated};baseFontSize=function(){var el,size;el=document.createElement("div");el.style.cssText="display:inline-block;padding:0;line-height:1;position:absolute;visibility:hidden;font-size:1em;";el.appendChild(document.createElement("M"));document.body.appendChild(el);size=el.offsetHeight;document.body.removeChild(el);return size};calculatePixelDimension=function(dim,$el){if(dim==="none"){dim=10000}else if(dim.indexOf("rem")>=0){dim=parseFloat(dim)*baseFontSize()}else if(dim.indexOf("em")>=0){dim=parseFloat(dim)*parseFloat($el.css("font-size"))}else if(dim.indexOf("px")>=0){dim=parseFloat(dim);if(dim<=60){dim=dim/parseFloat($el.parent().css("width"))}}else if(dim.indexOf("%")>=0){dim=parseFloat(dim)/100}
+return dim};$.fn.bindScrollHandler=function(){if(!settings.preventPageScroll){return $(this)}
+$(this).on("DOMMouseScroll mousewheel",function(event){var $popover,$this,delta,height,prevent,scrollHeight,scrollTop,up;$this=$(this);scrollTop=$this.scrollTop();scrollHeight=$this[0].scrollHeight;height=parseInt($this.css("height"));$popover=$this.closest(".bigfoot-footnote");if($this.scrollTop()>0&&$this.scrollTop()<10){$popover.addClass("is-scrollable")}
+if(!$popover.hasClass("is-scrollable")){return}
+delta=event.type==="DOMMouseScroll"?event.originalEvent.detail*-40:event.originalEvent.wheelDelta;up=delta>0;prevent=function(){event.stopPropagation();event.preventDefault();event.returnValue=!1;return!1};if(!up&&-delta>scrollHeight-height-scrollTop){$this.scrollTop(scrollHeight);$popover.addClass("is-fully-scrolled");return prevent()}else if(up&&delta>scrollTop){$this.scrollTop(0);$popover.removeClass("is-fully-scrolled");return prevent()}else{return $popover.removeClass("is-fully-scrolled")}});return $(this)};unhoverFeet=function(e){if(settings.deleteOnUnhover&&settings.activateOnHover){return setTimeout((function(){var $target;$target=$(e.target).closest(".bigfoot-footnote, .bigfoot-footnote__button");if($(".bigfoot-footnote__button:hover, .bigfoot-footnote:hover").length<1){return removePopovers()}}),settings.hoverDelay)}};escapeKeypress=function(event){if(event.keyCode===27){return removePopovers()}};removePopovers=function(footnotes,timeout){var $buttonsClosed,$linkedButton,$this,footnoteID;if(footnotes==null){footnotes=".bigfoot-footnote"}
+if(timeout==null){timeout=settings.popoverDeleteDelay}
+$buttonsClosed=$();footnoteID=void 0;$linkedButton=void 0;$this=void 0;$(footnotes).each(function(){$this=$(this);footnoteID=$this.attr("data-footnote-identifier");$linkedButton=$(".bigfoot-footnote__button[data-footnote-identifier='"+footnoteID+"']");if(!$linkedButton.hasClass("changing")){$buttonsClosed=$buttonsClosed.add($linkedButton);$linkedButton.removeClass("is-active is-hover-instantiated is-click-instantiated").addClass("changing");$this.removeClass("is-active").addClass("disapearing");return setTimeout((function(){$this.remove();delete popoverStates[footnoteID];return $linkedButton.removeClass("changing")}),timeout)}});return $buttonsClosed};repositionFeet=function(e){var type;if(settings.positionContent){type=e?e.type:"resize";$(".bigfoot-footnote").each(function(){var $button,$contentWrapper,$mainWrap,$this,dataIdentifier,identifier,lastState,marginSize,maxHeightInCSS,maxHeightOnScreen,maxWidth,maxWidthInCSS,positionOnTop,relativeToWidth,roomLeft,totalHeight;$this=$(this);identifier=$this.attr("data-footnote-identifier");dataIdentifier="data-footnote-identifier='"+identifier+"'";$contentWrapper=$this.find(".bigfoot-footnote__content");$button=$this.siblings(".bigfoot-footnote__button");roomLeft=roomCalc($button);marginSize=parseFloat($this.css("margin-top"));maxHeightInCSS=+($this.attr("data-bigfoot-max-height"));totalHeight=2*marginSize+$this.outerHeight();maxHeightOnScreen=10000;positionOnTop=roomLeft.bottomRoomroomLeft.bottomRoom;lastState=popoverStates[identifier];if(positionOnTop){if(lastState!=="top"){popoverStates[identifier]="top";$this.addClass("is-positioned-top").removeClass("is-positioned-bottom");$this.css("transform-origin",(roomLeft.leftRelative*100)+"% 100%")}
+maxHeightOnScreen=roomLeft.topRoom-marginSize-15}else{if(lastState!=="bottom"||lastState==="init"){popoverStates[identifier]="bottom";$this.removeClass("is-positioned-top").addClass("is-positioned-bottom");$this.css("transform-origin",(roomLeft.leftRelative*100)+"% 0%")}
+maxHeightOnScreen=roomLeft.bottomRoom-marginSize-15}
+$this.find(".bigfoot-footnote__content").css({"max-height":Math.min(maxHeightOnScreen,maxHeightInCSS)+"px"});if(type==="resize"){maxWidthInCSS=parseFloat($this.attr("bigfoot-max-width"));$mainWrap=$this.find(".bigfoot-footnote__wrapper");maxWidth=maxWidthInCSS;if(maxWidthInCSS<=1){relativeToWidth=(function(){var jq,userSpecifiedRelativeElWidth;userSpecifiedRelativeElWidth=10000;if(settings.maxWidthRelativeTo){jq=$(settings.maxWidthRelativeTo);if(jq.length>0){userSpecifiedRelativeElWidth=jq.outerWidth()}}
+return Math.min(window.innerWidth,userSpecifiedRelativeElWidth)})();maxWidth=relativeToWidth*maxWidthInCSS}
+maxWidth=Math.min(maxWidth,$this.find(".bigfoot-footnote__content").outerWidth()+1);$mainWrap.css("max-width",maxWidth+"px");$this.css({left:(-roomLeft.leftRelative*maxWidth+parseFloat($button.css("margin-left"))+$button.outerWidth()/2)+"px"});positionTooltip($this,roomLeft.leftRelative)}
+if(parseInt($this.outerHeight())<$this.find(".bigfoot-footnote__content")[0].scrollHeight){return $this.addClass("is-scrollable")}})}};positionTooltip=function($popover,leftRelative){var $tooltip;if(leftRelative==null){leftRelative=0.5}
+$tooltip=$popover.find(".bigfoot-footnote__tooltip");if($tooltip.length>0){$tooltip.css("left",""+(leftRelative*100)+"%")}};roomCalc=function($el){var elHeight,elLeftMargin,elWidth,leftRoom,topRoom,w;elLeftMargin=parseFloat($el.css("margin-left"));elWidth=parseFloat($el.outerWidth())-elLeftMargin;elHeight=parseFloat($el.outerHeight());w=viewportDetails();topRoom=$el.offset().top-w.scrollY+elHeight/2;leftRoom=$el.offset().left-w.scrollX+elWidth/2;return{topRoom:topRoom,bottomRoom:w.height-topRoom,leftRoom:leftRoom,rightRoom:w.width-leftRoom,leftRelative:leftRoom/w.width,topRelative:topRoom/w.height}};viewportDetails=function(){var $window;$window=$(window);return{width:window.innerWidth,height:window.innerHeight,scrollX:$window.scrollLeft(),scrollY:$window.scrollTop()}};addBreakpoint=function(size,trueCallback,falseCallback,deleteDelay,removeOpen){var falseDefaultPositionSetting,minMax,mqListener,mql,query,s,trueDefaultPositionSetting;if(deleteDelay==null){deleteDelay=settings.popoverDeleteDelay}
+if(removeOpen==null){removeOpen=!0}
+mql=void 0;minMax=void 0;s=void 0;if(typeof size==="string"){s=size.toLowerCase()==="iphone"?"<320px":size.toLowerCase()==="ipad"?"<768px":size;minMax=s.charAt(0)===">"?"min":s.charAt(0)==="<"?"max":null;query=minMax?"("+minMax+"-width: "+(s.substring(1))+")":s;mql=window.matchMedia(query)}else{mql=size}
+if(mql.media&&mql.media==="invalid"){return{added:!1,mq:mql,listener:null}}
+trueDefaultPositionSetting=minMax==="min";falseDefaultPositionSetting=minMax==="max";trueCallback=trueCallback||makeDefaultCallbacks(removeOpen,deleteDelay,trueDefaultPositionSetting,function($popover){return $popover.addClass("is-bottom-fixed")});falseCallback=falseCallback||makeDefaultCallbacks(removeOpen,deleteDelay,falseDefaultPositionSetting,function(){});mqListener=function(mq){if(mq.matches){trueCallback(removeOpen,bigfoot)}else{falseCallback(removeOpen,bigfoot)}};mql.addListener(mqListener);mqListener(mql);settings.breakpoints[size]={added:!0,mq:mql,listener:mqListener};return settings.breakpoints[size]};makeDefaultCallbacks=function(removeOpen,deleteDelay,position,callback){return function(removeOpen,bigfoot){var $closedPopovers;$closedPopovers=void 0;if(removeOpen){$closedPopovers=bigfoot.close();bigfoot.updateSetting("activateCallback",callback)}
+return setTimeout((function(){bigfoot.updateSetting("positionContent",position);if(removeOpen){return bigfoot.activate($closedPopovers)}}),deleteDelay)}};removeBreakpoint=function(target,callback){var b,breakpoint,mq,mqFound;mq=null;b=void 0;mqFound=!1;if(typeof target==="string"){mqFound=settings.breakpoints[target]!==undefined}else{for(b in settings.breakpoints){if(settings.breakpoints.hasOwnProperty(b)&&settings.breakpoints[b].mq===target){mqFound=!0}}}
+if(mqFound){breakpoint=settings.breakpoints[b||target];if(callback){callback({matches:!1})}else{breakpoint.listener({matches:!1})}
+breakpoint.mq.removeListener(breakpoint.listener);delete settings.breakpoints[b||target]}
+return mqFound};updateSetting=function(newSettings,value){var oldValue,prop;oldValue=void 0;if(typeof newSettings==="string"){oldValue=settings[newSettings];settings[newSettings]=value}else{oldValue={};for(prop in newSettings){if(newSettings.hasOwnProperty(prop)){oldValue[prop]=settings[prop];settings[prop]=newSettings[prop]}}}
+return oldValue};getSetting=function(setting){return settings[setting]};$(document).ready(function(){footnoteInit();$(document).on("mouseenter",".bigfoot-footnote__button",buttonHover);$(document).on("touchend click",touchClick);$(document).on("mouseout",".is-hover-instantiated",unhoverFeet);$(document).on("keyup",escapeKeypress);$(window).on("scroll resize",repositionFeet);return $(document).on("gestureend",function(){return repositionFeet()})});bigfoot={removePopovers:removePopovers,close:removePopovers,createPopover:createPopover,activate:createPopover,repositionFeet:repositionFeet,reposition:repositionFeet,addBreakpoint:addBreakpoint,removeBreakpoint:removeBreakpoint,getSetting:getSetting,updateSetting:updateSetting};return bigfoot}})(jQuery)}).call(this)
\ No newline at end of file
diff --git a/assets/js/plugins/gumshoe.js b/assets/js/plugins/gumshoe.js
new file mode 100644
index 000000000..713b6eb30
--- /dev/null
+++ b/assets/js/plugins/gumshoe.js
@@ -0,0 +1,484 @@
+/*!
+ * gumshoejs v5.1.1
+ * A simple, framework-agnostic scrollspy script.
+ * (c) 2019 Chris Ferdinandi
+ * MIT License
+ * http://github.com/cferdinandi/gumshoe
+ */
+
+(function (root, factory) {
+ if ( typeof define === 'function' && define.amd ) {
+ define([], (function () {
+ return factory(root);
+ }));
+ } else if ( typeof exports === 'object' ) {
+ module.exports = factory(root);
+ } else {
+ root.Gumshoe = factory(root);
+ }
+})(typeof global !== 'undefined' ? global : typeof window !== 'undefined' ? window : this, (function (window) {
+
+ 'use strict';
+
+ //
+ // Defaults
+ //
+
+ var defaults = {
+
+ // Active classes
+ navClass: 'active',
+ contentClass: 'active',
+
+ // Nested navigation
+ nested: false,
+ nestedClass: 'active',
+
+ // Offset & reflow
+ offset: 0,
+ reflow: false,
+
+ // Event support
+ events: true
+
+ };
+
+
+ //
+ // Methods
+ //
+
+ /**
+ * Merge two or more objects together.
+ * @param {Object} objects The objects to merge together
+ * @returns {Object} Merged values of defaults and options
+ */
+ var extend = function () {
+ var merged = {};
+ Array.prototype.forEach.call(arguments, (function (obj) {
+ for (var key in obj) {
+ if (!obj.hasOwnProperty(key)) return;
+ merged[key] = obj[key];
+ }
+ }));
+ return merged;
+ };
+
+ /**
+ * Emit a custom event
+ * @param {String} type The event type
+ * @param {Node} elem The element to attach the event to
+ * @param {Object} detail Any details to pass along with the event
+ */
+ var emitEvent = function (type, elem, detail) {
+
+ // Make sure events are enabled
+ if (!detail.settings.events) return;
+
+ // Create a new event
+ var event = new CustomEvent(type, {
+ bubbles: true,
+ cancelable: true,
+ detail: detail
+ });
+
+ // Dispatch the event
+ elem.dispatchEvent(event);
+
+ };
+
+ /**
+ * Get an element's distance from the top of the Document.
+ * @param {Node} elem The element
+ * @return {Number} Distance from the top in pixels
+ */
+ var getOffsetTop = function (elem) {
+ var location = 0;
+ if (elem.offsetParent) {
+ while (elem) {
+ location += elem.offsetTop;
+ elem = elem.offsetParent;
+ }
+ }
+ return location >= 0 ? location : 0;
+ };
+
+ /**
+ * Sort content from first to last in the DOM
+ * @param {Array} contents The content areas
+ */
+ var sortContents = function (contents) {
+ if(contents) {
+ contents.sort((function (item1, item2) {
+ var offset1 = getOffsetTop(item1.content);
+ var offset2 = getOffsetTop(item2.content);
+ if (offset1 < offset2) return -1;
+ return 1;
+ }));
+ }
+ };
+
+ /**
+ * Get the offset to use for calculating position
+ * @param {Object} settings The settings for this instantiation
+ * @return {Float} The number of pixels to offset the calculations
+ */
+ var getOffset = function (settings) {
+
+ // if the offset is a function run it
+ if (typeof settings.offset === 'function') {
+ return parseFloat(settings.offset());
+ }
+
+ // Otherwise, return it as-is
+ return parseFloat(settings.offset);
+
+ };
+
+ /**
+ * Get the document element's height
+ * @private
+ * @returns {Number}
+ */
+ var getDocumentHeight = function () {
+ return Math.max(
+ document.body.scrollHeight, document.documentElement.scrollHeight,
+ document.body.offsetHeight, document.documentElement.offsetHeight,
+ document.body.clientHeight, document.documentElement.clientHeight
+ );
+ };
+
+ /**
+ * Determine if an element is in view
+ * @param {Node} elem The element
+ * @param {Object} settings The settings for this instantiation
+ * @param {Boolean} bottom If true, check if element is above bottom of viewport instead
+ * @return {Boolean} Returns true if element is in the viewport
+ */
+ var isInView = function (elem, settings, bottom) {
+ var bounds = elem.getBoundingClientRect();
+ var offset = getOffset(settings);
+ if (bottom) {
+ return parseInt(bounds.bottom, 10) < (window.innerHeight || document.documentElement.clientHeight);
+ }
+ return parseInt(bounds.top, 10) <= offset;
+ };
+
+ /**
+ * Check if at the bottom of the viewport
+ * @return {Boolean} If true, page is at the bottom of the viewport
+ */
+ var isAtBottom = function () {
+ if (window.innerHeight + window.pageYOffset >= getDocumentHeight()) return true;
+ return false;
+ };
+
+ /**
+ * Check if the last item should be used (even if not at the top of the page)
+ * @param {Object} item The last item
+ * @param {Object} settings The settings for this instantiation
+ * @return {Boolean} If true, use the last item
+ */
+ var useLastItem = function (item, settings) {
+ if (isAtBottom() && isInView(item.content, settings, true)) return true;
+ return false;
+ };
+
+ /**
+ * Get the active content
+ * @param {Array} contents The content areas
+ * @param {Object} settings The settings for this instantiation
+ * @return {Object} The content area and matching navigation link
+ */
+ var getActive = function (contents, settings) {
+ var last = contents[contents.length-1];
+ if (useLastItem(last, settings)) return last;
+ for (var i = contents.length - 1; i >= 0; i--) {
+ if (isInView(contents[i].content, settings)) return contents[i];
+ }
+ };
+
+ /**
+ * Deactivate parent navs in a nested navigation
+ * @param {Node} nav The starting navigation element
+ * @param {Object} settings The settings for this instantiation
+ */
+ var deactivateNested = function (nav, settings) {
+
+ // If nesting isn't activated, bail
+ if (!settings.nested) return;
+
+ // Get the parent navigation
+ var li = nav.parentNode.closest('li');
+ if (!li) return;
+
+ // Remove the active class
+ li.classList.remove(settings.nestedClass);
+
+ // Apply recursively to any parent navigation elements
+ deactivateNested(li, settings);
+
+ };
+
+ /**
+ * Deactivate a nav and content area
+ * @param {Object} items The nav item and content to deactivate
+ * @param {Object} settings The settings for this instantiation
+ */
+ var deactivate = function (items, settings) {
+
+ // Make sure their are items to deactivate
+ if (!items) return;
+
+ // Get the parent list item
+ var li = items.nav.closest('li');
+ if (!li) return;
+
+ // Remove the active class from the nav and content
+ li.classList.remove(settings.navClass);
+ items.content.classList.remove(settings.contentClass);
+
+ // Deactivate any parent navs in a nested navigation
+ deactivateNested(li, settings);
+
+ // Emit a custom event
+ emitEvent('gumshoeDeactivate', li, {
+ link: items.nav,
+ content: items.content,
+ settings: settings
+ });
+
+ };
+
+
+ /**
+ * Activate parent navs in a nested navigation
+ * @param {Node} nav The starting navigation element
+ * @param {Object} settings The settings for this instantiation
+ */
+ var activateNested = function (nav, settings) {
+
+ // If nesting isn't activated, bail
+ if (!settings.nested) return;
+
+ // Get the parent navigation
+ var li = nav.parentNode.closest('li');
+ if (!li) return;
+
+ // Add the active class
+ li.classList.add(settings.nestedClass);
+
+ // Apply recursively to any parent navigation elements
+ activateNested(li, settings);
+
+ };
+
+ /**
+ * Activate a nav and content area
+ * @param {Object} items The nav item and content to activate
+ * @param {Object} settings The settings for this instantiation
+ */
+ var activate = function (items, settings) {
+
+ // Make sure their are items to activate
+ if (!items) return;
+
+ // Get the parent list item
+ var li = items.nav.closest('li');
+ if (!li) return;
+
+ // Add the active class to the nav and content
+ li.classList.add(settings.navClass);
+ items.content.classList.add(settings.contentClass);
+
+ // Activate any parent navs in a nested navigation
+ activateNested(li, settings);
+
+ // Emit a custom event
+ emitEvent('gumshoeActivate', li, {
+ link: items.nav,
+ content: items.content,
+ settings: settings
+ });
+
+ };
+
+ /**
+ * Create the Constructor object
+ * @param {String} selector The selector to use for navigation items
+ * @param {Object} options User options and settings
+ */
+ var Constructor = function (selector, options) {
+
+ //
+ // Variables
+ //
+
+ var publicAPIs = {};
+ var navItems, contents, current, timeout, settings;
+
+
+ //
+ // Methods
+ //
+
+ /**
+ * Set variables from DOM elements
+ */
+ publicAPIs.setup = function () {
+
+ // Get all nav items
+ navItems = document.querySelectorAll(selector);
+
+ // Create contents array
+ contents = [];
+
+ // Loop through each item, get it's matching content, and push to the array
+ Array.prototype.forEach.call(navItems, (function (item) {
+
+ // Get the content for the nav item
+ var content = document.getElementById(decodeURIComponent(item.hash.substr(1)));
+ if (!content) return;
+
+ // Push to the contents array
+ contents.push({
+ nav: item,
+ content: content
+ });
+
+ }));
+
+ // Sort contents by the order they appear in the DOM
+ sortContents(contents);
+
+ };
+
+ /**
+ * Detect which content is currently active
+ */
+ publicAPIs.detect = function () {
+
+ // Get the active content
+ var active = getActive(contents, settings);
+
+ // if there's no active content, deactivate and bail
+ if (!active) {
+ if (current) {
+ deactivate(current, settings);
+ current = null;
+ }
+ return;
+ }
+
+ // If the active content is the one currently active, do nothing
+ if (current && active.content === current.content) return;
+
+ // Deactivate the current content and activate the new content
+ deactivate(current, settings);
+ activate(active, settings);
+
+ // Update the currently active content
+ current = active;
+
+ };
+
+ /**
+ * Detect the active content on scroll
+ * Debounced for performance
+ */
+ var scrollHandler = function (event) {
+
+ // If there's a timer, cancel it
+ if (timeout) {
+ window.cancelAnimationFrame(timeout);
+ }
+
+ // Setup debounce callback
+ timeout = window.requestAnimationFrame(publicAPIs.detect);
+
+ };
+
+ /**
+ * Update content sorting on resize
+ * Debounced for performance
+ */
+ var resizeHandler = function (event) {
+
+ // If there's a timer, cancel it
+ if (timeout) {
+ window.cancelAnimationFrame(timeout);
+ }
+
+ // Setup debounce callback
+ timeout = window.requestAnimationFrame((function () {
+ sortContents(contents);
+ publicAPIs.detect();
+ }));
+
+ };
+
+ /**
+ * Destroy the current instantiation
+ */
+ publicAPIs.destroy = function () {
+
+ // Undo DOM changes
+ if (current) {
+ deactivate(current, settings);
+ }
+
+ // Remove event listeners
+ window.removeEventListener('scroll', scrollHandler, false);
+ if (settings.reflow) {
+ window.removeEventListener('resize', resizeHandler, false);
+ }
+
+ // Reset variables
+ contents = null;
+ navItems = null;
+ current = null;
+ timeout = null;
+ settings = null;
+
+ };
+
+ /**
+ * Initialize the current instantiation
+ */
+ var init = function () {
+
+ // Merge user options into defaults
+ settings = extend(defaults, options || {});
+
+ // Setup variables based on the current DOM
+ publicAPIs.setup();
+
+ // Find the currently active content
+ publicAPIs.detect();
+
+ // Setup event listeners
+ window.addEventListener('scroll', scrollHandler, false);
+ if (settings.reflow) {
+ window.addEventListener('resize', resizeHandler, false);
+ }
+
+ };
+
+
+ //
+ // Initialize and return the public APIs
+ //
+
+ init();
+ return publicAPIs;
+
+ };
+
+
+ //
+ // Return the Constructor
+ //
+
+ return Constructor;
+
+}));
\ No newline at end of file
diff --git a/assets/js/plugins/jquery.ba-throttle-debounce.js b/assets/js/plugins/jquery.ba-throttle-debounce.js
new file mode 100644
index 000000000..fa30bdfff
--- /dev/null
+++ b/assets/js/plugins/jquery.ba-throttle-debounce.js
@@ -0,0 +1,252 @@
+/*!
+ * jQuery throttle / debounce - v1.1 - 3/7/2010
+ * http://benalman.com/projects/jquery-throttle-debounce-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+
+// Script: jQuery throttle / debounce: Sometimes, less is more!
+//
+// *Version: 1.1, Last updated: 3/7/2010*
+//
+// Project Home - http://benalman.com/projects/jquery-throttle-debounce-plugin/
+// GitHub - http://github.com/cowboy/jquery-throttle-debounce/
+// Source - http://github.com/cowboy/jquery-throttle-debounce/raw/master/jquery.ba-throttle-debounce.js
+// (Minified) - http://github.com/cowboy/jquery-throttle-debounce/raw/master/jquery.ba-throttle-debounce.min.js (0.7kb)
+//
+// About: License
+//
+// Copyright (c) 2010 "Cowboy" Ben Alman,
+// Dual licensed under the MIT and GPL licenses.
+// http://benalman.com/about/license/
+//
+// About: Examples
+//
+// These working examples, complete with fully commented code, illustrate a few
+// ways in which this plugin can be used.
+//
+// Throttle - http://benalman.com/code/projects/jquery-throttle-debounce/examples/throttle/
+// Debounce - http://benalman.com/code/projects/jquery-throttle-debounce/examples/debounce/
+//
+// About: Support and Testing
+//
+// Information about what version or versions of jQuery this plugin has been
+// tested with, what browsers it has been tested in, and where the unit tests
+// reside (so you can test it yourself).
+//
+// jQuery Versions - none, 1.3.2, 1.4.2
+// Browsers Tested - Internet Explorer 6-8, Firefox 2-3.6, Safari 3-4, Chrome 4-5, Opera 9.6-10.1.
+// Unit Tests - http://benalman.com/code/projects/jquery-throttle-debounce/unit/
+//
+// About: Release History
+//
+// 1.1 - (3/7/2010) Fixed a bug in where trailing callbacks
+// executed later than they should. Reworked a fair amount of internal
+// logic as well.
+// 1.0 - (3/6/2010) Initial release as a stand-alone project. Migrated over
+// from jquery-misc repo v0.4 to jquery-throttle repo v1.0, added the
+// no_trailing throttle parameter and debounce functionality.
+//
+// Topic: Note for non-jQuery users
+//
+// jQuery isn't actually required for this plugin, because nothing internal
+// uses any jQuery methods or properties. jQuery is just used as a namespace
+// under which these methods can exist.
+//
+// Since jQuery isn't actually required for this plugin, if jQuery doesn't exist
+// when this plugin is loaded, the method described below will be created in
+// the `Cowboy` namespace. Usage will be exactly the same, but instead of
+// $.method() or jQuery.method(), you'll need to use Cowboy.method().
+
+(function(window,undefined){
+ '$:nomunge'; // Used by YUI compressor.
+
+ // Since jQuery really isn't required for this plugin, use `jQuery` as the
+ // namespace only if it already exists, otherwise use the `Cowboy` namespace,
+ // creating it if necessary.
+ var $ = window.jQuery || window.Cowboy || ( window.Cowboy = {} ),
+
+ // Internal method reference.
+ jq_throttle;
+
+ // Method: jQuery.throttle
+ //
+ // Throttle execution of a function. Especially useful for rate limiting
+ // execution of handlers on events like resize and scroll. If you want to
+ // rate-limit execution of a function to a single time, see the
+ // method.
+ //
+ // In this visualization, | is a throttled-function call and X is the actual
+ // callback execution:
+ //
+ // > Throttled with `no_trailing` specified as false or unspecified:
+ // > ||||||||||||||||||||||||| (pause) |||||||||||||||||||||||||
+ // > X X X X X X X X X X X X
+ // >
+ // > Throttled with `no_trailing` specified as true:
+ // > ||||||||||||||||||||||||| (pause) |||||||||||||||||||||||||
+ // > X X X X X X X X X X
+ //
+ // Usage:
+ //
+ // > var throttled = jQuery.throttle( delay, [ no_trailing, ] callback );
+ // >
+ // > jQuery('selector').bind( 'someevent', throttled );
+ // > jQuery('selector').unbind( 'someevent', throttled );
+ //
+ // This also works in jQuery 1.4+:
+ //
+ // > jQuery('selector').bind( 'someevent', jQuery.throttle( delay, [ no_trailing, ] callback ) );
+ // > jQuery('selector').unbind( 'someevent', callback );
+ //
+ // Arguments:
+ //
+ // delay - (Number) A zero-or-greater delay in milliseconds. For event
+ // callbacks, values around 100 or 250 (or even higher) are most useful.
+ // no_trailing - (Boolean) Optional, defaults to false. If no_trailing is
+ // true, callback will only execute every `delay` milliseconds while the
+ // throttled-function is being called. If no_trailing is false or
+ // unspecified, callback will be executed one final time after the last
+ // throttled-function call. (After the throttled-function has not been
+ // called for `delay` milliseconds, the internal counter is reset)
+ // callback - (Function) A function to be executed after delay milliseconds.
+ // The `this` context and all arguments are passed through, as-is, to
+ // `callback` when the throttled-function is executed.
+ //
+ // Returns:
+ //
+ // (Function) A new, throttled, function.
+
+ $.throttle = jq_throttle = function( delay, no_trailing, callback, debounce_mode ) {
+ // After wrapper has stopped being called, this timeout ensures that
+ // `callback` is executed at the proper times in `throttle` and `end`
+ // debounce modes.
+ var timeout_id,
+
+ // Keep track of the last time `callback` was executed.
+ last_exec = 0;
+
+ // `no_trailing` defaults to falsy.
+ if ( typeof no_trailing !== 'boolean' ) {
+ debounce_mode = callback;
+ callback = no_trailing;
+ no_trailing = undefined;
+ }
+
+ // The `wrapper` function encapsulates all of the throttling / debouncing
+ // functionality and when executed will limit the rate at which `callback`
+ // is executed.
+ function wrapper() {
+ var that = this,
+ elapsed = +new Date() - last_exec,
+ args = arguments;
+
+ // Execute `callback` and update the `last_exec` timestamp.
+ function exec() {
+ last_exec = +new Date();
+ callback.apply( that, args );
+ };
+
+ // If `debounce_mode` is true (at_begin) this is used to clear the flag
+ // to allow future `callback` executions.
+ function clear() {
+ timeout_id = undefined;
+ };
+
+ if ( debounce_mode && !timeout_id ) {
+ // Since `wrapper` is being called for the first time and
+ // `debounce_mode` is true (at_begin), execute `callback`.
+ exec();
+ }
+
+ // Clear any existing timeout.
+ timeout_id && clearTimeout( timeout_id );
+
+ if ( debounce_mode === undefined && elapsed > delay ) {
+ // In throttle mode, if `delay` time has been exceeded, execute
+ // `callback`.
+ exec();
+
+ } else if ( no_trailing !== true ) {
+ // In trailing throttle mode, since `delay` time has not been
+ // exceeded, schedule `callback` to execute `delay` ms after most
+ // recent execution.
+ //
+ // If `debounce_mode` is true (at_begin), schedule `clear` to execute
+ // after `delay` ms.
+ //
+ // If `debounce_mode` is false (at end), schedule `callback` to
+ // execute after `delay` ms.
+ timeout_id = setTimeout( debounce_mode ? clear : exec, debounce_mode === undefined ? delay - elapsed : delay );
+ }
+ };
+
+ // Set the guid of `wrapper` function to the same of original callback, so
+ // it can be removed in jQuery 1.4+ .unbind or .die by using the original
+ // callback as a reference.
+ if ( $.guid ) {
+ wrapper.guid = callback.guid = callback.guid || $.guid++;
+ }
+
+ // Return the wrapper function.
+ return wrapper;
+ };
+
+ // Method: jQuery.debounce
+ //
+ // Debounce execution of a function. Debouncing, unlike throttling,
+ // guarantees that a function is only executed a single time, either at the
+ // very beginning of a series of calls, or at the very end. If you want to
+ // simply rate-limit execution of a function, see the
+ // method.
+ //
+ // In this visualization, | is a debounced-function call and X is the actual
+ // callback execution:
+ //
+ // > Debounced with `at_begin` specified as false or unspecified:
+ // > ||||||||||||||||||||||||| (pause) |||||||||||||||||||||||||
+ // > X X
+ // >
+ // > Debounced with `at_begin` specified as true:
+ // > ||||||||||||||||||||||||| (pause) |||||||||||||||||||||||||
+ // > X X
+ //
+ // Usage:
+ //
+ // > var debounced = jQuery.debounce( delay, [ at_begin, ] callback );
+ // >
+ // > jQuery('selector').bind( 'someevent', debounced );
+ // > jQuery('selector').unbind( 'someevent', debounced );
+ //
+ // This also works in jQuery 1.4+:
+ //
+ // > jQuery('selector').bind( 'someevent', jQuery.debounce( delay, [ at_begin, ] callback ) );
+ // > jQuery('selector').unbind( 'someevent', callback );
+ //
+ // Arguments:
+ //
+ // delay - (Number) A zero-or-greater delay in milliseconds. For event
+ // callbacks, values around 100 or 250 (or even higher) are most useful.
+ // at_begin - (Boolean) Optional, defaults to false. If at_begin is false or
+ // unspecified, callback will only be executed `delay` milliseconds after
+ // the last debounced-function call. If at_begin is true, callback will be
+ // executed only at the first debounced-function call. (After the
+ // throttled-function has not been called for `delay` milliseconds, the
+ // internal counter is reset)
+ // callback - (Function) A function to be executed after delay milliseconds.
+ // The `this` context and all arguments are passed through, as-is, to
+ // `callback` when the debounced-function is executed.
+ //
+ // Returns:
+ //
+ // (Function) A new, debounced, function.
+
+ $.debounce = function( delay, at_begin, callback ) {
+ return callback === undefined
+ ? jq_throttle( delay, at_begin, false )
+ : jq_throttle( delay, callback, at_begin !== false );
+ };
+
+})(this);
diff --git a/assets/js/plugins/jquery.fitvids.js b/assets/js/plugins/jquery.fitvids.js
new file mode 100644
index 000000000..5c2f85c99
--- /dev/null
+++ b/assets/js/plugins/jquery.fitvids.js
@@ -0,0 +1,82 @@
+/*jshint browser:true */
+/*!
+* FitVids 1.1
+*
+* Copyright 2013, Chris Coyier - http://css-tricks.com + Dave Rupert - http://daverupert.com
+* Credit to Thierry Koblentz - http://www.alistapart.com/articles/creating-intrinsic-ratios-for-video/
+* Released under the WTFPL license - http://sam.zoy.org/wtfpl/
+*
+*/
+
+;(function( $ ){
+
+ 'use strict';
+
+ $.fn.fitVids = function( options ) {
+ var settings = {
+ customSelector: null,
+ ignore: null
+ };
+
+ if(!document.getElementById('fit-vids-style')) {
+ // appendStyles: https://github.com/toddmotto/fluidvids/blob/master/dist/fluidvids.js
+ var head = document.head || document.getElementsByTagName('head')[0];
+ var css = '.fluid-width-video-wrapper{width:100%;position:relative;padding:0;}.fluid-width-video-wrapper iframe,.fluid-width-video-wrapper object,.fluid-width-video-wrapper embed {position:absolute;top:0;left:0;width:100%;height:100%;}';
+ var div = document.createElement("div");
+ div.innerHTML = '
x
';
+ head.appendChild(div.childNodes[1]);
+ }
+
+ if ( options ) {
+ $.extend( settings, options );
+ }
+
+ return this.each(function(){
+ var selectors = [
+ 'iframe[src*="player.vimeo.com"]',
+ 'iframe[src*="youtube.com"]',
+ 'iframe[src*="youtube-nocookie.com"]',
+ 'iframe[src*="kickstarter.com"][src*="video.html"]',
+ 'object',
+ 'embed'
+ ];
+
+ if (settings.customSelector) {
+ selectors.push(settings.customSelector);
+ }
+
+ var ignoreList = '.fitvidsignore';
+
+ if(settings.ignore) {
+ ignoreList = ignoreList + ', ' + settings.ignore;
+ }
+
+ var $allVideos = $(this).find(selectors.join(','));
+ $allVideos = $allVideos.not('object object'); // SwfObj conflict patch
+ $allVideos = $allVideos.not(ignoreList); // Disable FitVids on this video.
+
+ $allVideos.each(function(count){
+ var $this = $(this);
+ if($this.parents(ignoreList).length > 0) {
+ return; // Disable FitVids on this video.
+ }
+ if (this.tagName.toLowerCase() === 'embed' && $this.parent('object').length || $this.parent('.fluid-width-video-wrapper').length) { return; }
+ if ((!$this.css('height') && !$this.css('width')) && (isNaN($this.attr('height')) || isNaN($this.attr('width'))))
+ {
+ $this.attr('height', 9);
+ $this.attr('width', 16);
+ }
+ var height = ( this.tagName.toLowerCase() === 'object' || ($this.attr('height') && !isNaN(parseInt($this.attr('height'), 10))) ) ? parseInt($this.attr('height'), 10) : $this.height(),
+ width = !isNaN(parseInt($this.attr('width'), 10)) ? parseInt($this.attr('width'), 10) : $this.width(),
+ aspectRatio = height / width;
+ if(!$this.attr('id')){
+ var videoID = 'fitvid' + count;
+ $this.attr('id', videoID);
+ }
+ $this.wrap('').parent('.fluid-width-video-wrapper').css('padding-top', (aspectRatio * 100)+'%');
+ $this.removeAttr('height').removeAttr('width');
+ });
+ });
+ };
+// Works with either jQuery or Zepto
+})( window.jQuery || window.Zepto );
\ No newline at end of file
diff --git a/assets/js/plugins/jquery.greedy-navigation.js b/assets/js/plugins/jquery.greedy-navigation.js
new file mode 100644
index 000000000..d8f323788
--- /dev/null
+++ b/assets/js/plugins/jquery.greedy-navigation.js
@@ -0,0 +1,127 @@
+/*
+GreedyNav.js - http://lukejacksonn.com/actuate
+Licensed under the MIT license - http://opensource.org/licenses/MIT
+Copyright (c) 2015 Luke Jackson
+*/
+
+$(function() {
+
+ var $btn = $("nav.greedy-nav .greedy-nav__toggle");
+ var $vlinks = $("nav.greedy-nav .visible-links");
+ var $hlinks = $("nav.greedy-nav .hidden-links");
+ var $nav = $("nav.greedy-nav");
+ var $logo = $('nav.greedy-nav .site-logo');
+ var $logoImg = $('nav.greedy-nav .site-logo img');
+ var $title = $("nav.greedy-nav .site-title");
+ var $search = $('nav.greedy-nav button.search__toggle');
+
+ var numOfItems, totalSpace, closingTime, breakWidths;
+
+ // This function measures both hidden and visible links and sets the navbar breakpoints
+ // This is called the first time the script runs and everytime the "check()" function detects a change of window width that reached a different CSS width breakpoint, which affects the size of navbar Items
+ // Please note that "CSS width breakpoints" (which are only 4) !== "navbar breakpoints" (which are as many as the number of items on the navbar)
+ function measureLinks(){
+ numOfItems = 0;
+ totalSpace = 0;
+ closingTime = 1000;
+ breakWidths = [];
+
+ // Adds the width of a navItem in order to create breakpoints for the navbar
+ function addWidth(i, w) {
+ totalSpace += w;
+ numOfItems += 1;
+ breakWidths.push(totalSpace);
+ }
+
+ // Measures the width of hidden links by making a temporary clone of them and positioning under visible links
+ function hiddenWidth(obj){
+ var clone = obj.clone();
+ clone.css("visibility","hidden");
+ $vlinks.append(clone);
+ addWidth(0, clone.outerWidth());
+ clone.remove();
+ }
+ // Measure both visible and hidden links widths
+ $vlinks.children().outerWidth(addWidth);
+ $hlinks.children().each(function(){hiddenWidth($(this))});
+ }
+ // Get initial state
+ measureLinks();
+
+ var winWidth = $( window ).width();
+ // Set the last measured CSS width breakpoint: 0: <768px, 1: <1024px, 2: < 1280px, 3: >= 1280px.
+ var lastBreakpoint = winWidth < 768 ? 0 : winWidth < 1024 ? 1 : winWidth < 1280 ? 2 : 3;
+
+ var availableSpace, numOfVisibleItems, requiredSpace, timer;
+
+ function check() {
+
+ winWidth = $( window ).width();
+ // Set the current CSS width breakpoint: 0: <768px, 1: <1024px, 2: < 1280px, 3: >= 1280px.
+ var curBreakpoint = winWidth < 768 ? 0 : winWidth < 1024 ? 1 : winWidth < 1280 ? 2 : 3;
+ // If current breakpoint is different from last measured breakpoint, measureLinks again
+ if(curBreakpoint !== lastBreakpoint) measureLinks();
+ // Set the last measured CSS width breakpoint with the current breakpoint
+ lastBreakpoint = curBreakpoint;
+
+ // Get instant state
+ numOfVisibleItems = $vlinks.children().length;
+ // Decrease the width of visible elements from the nav innerWidth to find out the available space for navItems
+ availableSpace = /* nav */ $nav.innerWidth()
+ - /* logo */ ($logo.length !== 0 ? $logo.outerWidth(true) : 0)
+ - /* title */ $title.outerWidth(true)
+ - /* search */ ($search.length !== 0 ? $search.outerWidth(true) : 0)
+ - /* toggle */ (numOfVisibleItems !== breakWidths.length ? $btn.outerWidth(true) : 0);
+ requiredSpace = breakWidths[numOfVisibleItems - 1];
+
+ // There is not enought space
+ if (requiredSpace > availableSpace) {
+ $vlinks.children().last().prependTo($hlinks);
+ numOfVisibleItems -= 1;
+ check();
+ // There is more than enough space. If only one element is hidden, add the toggle width to the available space
+ } else if (availableSpace + (numOfVisibleItems === breakWidths.length - 1?$btn.outerWidth(true):0) > breakWidths[numOfVisibleItems]) {
+ $hlinks.children().first().appendTo($vlinks);
+ numOfVisibleItems += 1;
+ check();
+ }
+ // Update the button accordingly
+ $btn.attr("count", numOfItems - numOfVisibleItems);
+ if (numOfVisibleItems === numOfItems) {
+ $btn.addClass('hidden');
+ } else $btn.removeClass('hidden');
+ }
+
+ // Window listeners
+ $(window).resize(function() {
+ check();
+ });
+
+ $btn.on('click', function() {
+ $hlinks.toggleClass('hidden');
+ $(this).toggleClass('close');
+ clearTimeout(timer);
+ });
+
+ $hlinks.on('mouseleave', function() {
+ // Mouse has left, start the timer
+ timer = setTimeout(function() {
+ $hlinks.addClass('hidden');
+ }, closingTime);
+ }).on('mouseenter', function() {
+ // Mouse is back, cancel the timer
+ clearTimeout(timer);
+ })
+
+ // check if page has a logo
+ if($logoImg.length !== 0){
+ // check if logo is not loaded
+ if(!($logoImg[0].complete || $logoImg[0].naturalWidth !== 0)){
+ // if logo is not loaded wait for logo to load or fail to check
+ $logoImg.one("load error", check);
+ // if logo is already loaded just check
+ } else check();
+ // if page does not have a logo just check
+ } else check();
+
+});
diff --git a/assets/js/plugins/jquery.magnific-popup.js b/assets/js/plugins/jquery.magnific-popup.js
new file mode 100644
index 000000000..7d1d19784
--- /dev/null
+++ b/assets/js/plugins/jquery.magnific-popup.js
@@ -0,0 +1,1860 @@
+/*! Magnific Popup - v1.1.0 - 2016-02-20
+* http://dimsemenov.com/plugins/magnific-popup/
+* Copyright (c) 2016 Dmitry Semenov; */
+;(function (factory) {
+ if (typeof define === 'function' && define.amd) {
+ // AMD. Register as an anonymous module.
+ define(['jquery'], factory);
+ } else if (typeof exports === 'object') {
+ // Node/CommonJS
+ factory(require('jquery'));
+ } else {
+ // Browser globals
+ factory(window.jQuery || window.Zepto);
+ }
+ }(function($) {
+
+ /*>>core*/
+ /**
+ *
+ * Magnific Popup Core JS file
+ *
+ */
+
+
+ /**
+ * Private static constants
+ */
+ var CLOSE_EVENT = 'Close',
+ BEFORE_CLOSE_EVENT = 'BeforeClose',
+ AFTER_CLOSE_EVENT = 'AfterClose',
+ BEFORE_APPEND_EVENT = 'BeforeAppend',
+ MARKUP_PARSE_EVENT = 'MarkupParse',
+ OPEN_EVENT = 'Open',
+ CHANGE_EVENT = 'Change',
+ NS = 'mfp',
+ EVENT_NS = '.' + NS,
+ READY_CLASS = 'mfp-ready',
+ REMOVING_CLASS = 'mfp-removing',
+ PREVENT_CLOSE_CLASS = 'mfp-prevent-close';
+
+
+ /**
+ * Private vars
+ */
+ /*jshint -W079 */
+ var mfp, // As we have only one instance of MagnificPopup object, we define it locally to not to use 'this'
+ MagnificPopup = function(){},
+ _isJQ = !!(window.jQuery),
+ _prevStatus,
+ _window = $(window),
+ _document,
+ _prevContentType,
+ _wrapClasses,
+ _currPopupType;
+
+
+ /**
+ * Private functions
+ */
+ var _mfpOn = function(name, f) {
+ mfp.ev.on(NS + name + EVENT_NS, f);
+ },
+ _getEl = function(className, appendTo, html, raw) {
+ var el = document.createElement('div');
+ el.className = 'mfp-'+className;
+ if(html) {
+ el.innerHTML = html;
+ }
+ if(!raw) {
+ el = $(el);
+ if(appendTo) {
+ el.appendTo(appendTo);
+ }
+ } else if(appendTo) {
+ appendTo.appendChild(el);
+ }
+ return el;
+ },
+ _mfpTrigger = function(e, data) {
+ mfp.ev.triggerHandler(NS + e, data);
+
+ if(mfp.st.callbacks) {
+ // converts "mfpEventName" to "eventName" callback and triggers it if it's present
+ e = e.charAt(0).toLowerCase() + e.slice(1);
+ if(mfp.st.callbacks[e]) {
+ mfp.st.callbacks[e].apply(mfp, $.isArray(data) ? data : [data]);
+ }
+ }
+ },
+ _getCloseBtn = function(type) {
+ if(type !== _currPopupType || !mfp.currTemplate.closeBtn) {
+ mfp.currTemplate.closeBtn = $( mfp.st.closeMarkup.replace('%title%', mfp.st.tClose ) );
+ _currPopupType = type;
+ }
+ return mfp.currTemplate.closeBtn;
+ },
+ // Initialize Magnific Popup only when called at least once
+ _checkInstance = function() {
+ if(!$.magnificPopup.instance) {
+ /*jshint -W020 */
+ mfp = new MagnificPopup();
+ mfp.init();
+ $.magnificPopup.instance = mfp;
+ }
+ },
+ // CSS transition detection, http://stackoverflow.com/questions/7264899/detect-css-transitions-using-javascript-and-without-modernizr
+ supportsTransitions = function() {
+ var s = document.createElement('p').style, // 's' for style. better to create an element if body yet to exist
+ v = ['ms','O','Moz','Webkit']; // 'v' for vendor
+
+ if( s['transition'] !== undefined ) {
+ return true;
+ }
+
+ while( v.length ) {
+ if( v.pop() + 'Transition' in s ) {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+
+
+ /**
+ * Public functions
+ */
+ MagnificPopup.prototype = {
+
+ constructor: MagnificPopup,
+
+ /**
+ * Initializes Magnific Popup plugin.
+ * This function is triggered only once when $.fn.magnificPopup or $.magnificPopup is executed
+ */
+ init: function() {
+ var appVersion = navigator.appVersion;
+ mfp.isLowIE = mfp.isIE8 = document.all && !document.addEventListener;
+ mfp.isAndroid = (/android/gi).test(appVersion);
+ mfp.isIOS = (/iphone|ipad|ipod/gi).test(appVersion);
+ mfp.supportsTransition = supportsTransitions();
+
+ // We disable fixed positioned lightbox on devices that don't handle it nicely.
+ // If you know a better way of detecting this - let me know.
+ mfp.probablyMobile = (mfp.isAndroid || mfp.isIOS || /(Opera Mini)|Kindle|webOS|BlackBerry|(Opera Mobi)|(Windows Phone)|IEMobile/i.test(navigator.userAgent) );
+ _document = $(document);
+
+ mfp.popupsCache = {};
+ },
+
+ /**
+ * Opens popup
+ * @param data [description]
+ */
+ open: function(data) {
+
+ var i;
+
+ if(data.isObj === false) {
+ // convert jQuery collection to array to avoid conflicts later
+ mfp.items = data.items.toArray();
+
+ mfp.index = 0;
+ var items = data.items,
+ item;
+ for(i = 0; i < items.length; i++) {
+ item = items[i];
+ if(item.parsed) {
+ item = item.el[0];
+ }
+ if(item === data.el[0]) {
+ mfp.index = i;
+ break;
+ }
+ }
+ } else {
+ mfp.items = $.isArray(data.items) ? data.items : [data.items];
+ mfp.index = data.index || 0;
+ }
+
+ // if popup is already opened - we just update the content
+ if(mfp.isOpen) {
+ mfp.updateItemHTML();
+ return;
+ }
+
+ mfp.types = [];
+ _wrapClasses = '';
+ if(data.mainEl && data.mainEl.length) {
+ mfp.ev = data.mainEl.eq(0);
+ } else {
+ mfp.ev = _document;
+ }
+
+ if(data.key) {
+ if(!mfp.popupsCache[data.key]) {
+ mfp.popupsCache[data.key] = {};
+ }
+ mfp.currTemplate = mfp.popupsCache[data.key];
+ } else {
+ mfp.currTemplate = {};
+ }
+
+
+
+ mfp.st = $.extend(true, {}, $.magnificPopup.defaults, data );
+ mfp.fixedContentPos = mfp.st.fixedContentPos === 'auto' ? !mfp.probablyMobile : mfp.st.fixedContentPos;
+
+ if(mfp.st.modal) {
+ mfp.st.closeOnContentClick = false;
+ mfp.st.closeOnBgClick = false;
+ mfp.st.showCloseBtn = false;
+ mfp.st.enableEscapeKey = false;
+ }
+
+
+ // Building markup
+ // main containers are created only once
+ if(!mfp.bgOverlay) {
+
+ // Dark overlay
+ mfp.bgOverlay = _getEl('bg').on('click'+EVENT_NS, function() {
+ mfp.close();
+ });
+
+ mfp.wrap = _getEl('wrap').attr('tabindex', -1).on('click'+EVENT_NS, function(e) {
+ if(mfp._checkIfClose(e.target)) {
+ mfp.close();
+ }
+ });
+
+ mfp.container = _getEl('container', mfp.wrap);
+ }
+
+ mfp.contentContainer = _getEl('content');
+ if(mfp.st.preloader) {
+ mfp.preloader = _getEl('preloader', mfp.container, mfp.st.tLoading);
+ }
+
+
+ // Initializing modules
+ var modules = $.magnificPopup.modules;
+ for(i = 0; i < modules.length; i++) {
+ var n = modules[i];
+ n = n.charAt(0).toUpperCase() + n.slice(1);
+ mfp['init'+n].call(mfp);
+ }
+ _mfpTrigger('BeforeOpen');
+
+
+ if(mfp.st.showCloseBtn) {
+ // Close button
+ if(!mfp.st.closeBtnInside) {
+ mfp.wrap.append( _getCloseBtn() );
+ } else {
+ _mfpOn(MARKUP_PARSE_EVENT, function(e, template, values, item) {
+ values.close_replaceWith = _getCloseBtn(item.type);
+ });
+ _wrapClasses += ' mfp-close-btn-in';
+ }
+ }
+
+ if(mfp.st.alignTop) {
+ _wrapClasses += ' mfp-align-top';
+ }
+
+
+
+ if(mfp.fixedContentPos) {
+ mfp.wrap.css({
+ overflow: mfp.st.overflowY,
+ overflowX: 'hidden',
+ overflowY: mfp.st.overflowY
+ });
+ } else {
+ mfp.wrap.css({
+ top: _window.scrollTop(),
+ position: 'absolute'
+ });
+ }
+ if( mfp.st.fixedBgPos === false || (mfp.st.fixedBgPos === 'auto' && !mfp.fixedContentPos) ) {
+ mfp.bgOverlay.css({
+ height: _document.height(),
+ position: 'absolute'
+ });
+ }
+
+
+
+ if(mfp.st.enableEscapeKey) {
+ // Close on ESC key
+ _document.on('keyup' + EVENT_NS, function(e) {
+ if(e.keyCode === 27) {
+ mfp.close();
+ }
+ });
+ }
+
+ _window.on('resize' + EVENT_NS, function() {
+ mfp.updateSize();
+ });
+
+
+ if(!mfp.st.closeOnContentClick) {
+ _wrapClasses += ' mfp-auto-cursor';
+ }
+
+ if(_wrapClasses)
+ mfp.wrap.addClass(_wrapClasses);
+
+
+ // this triggers recalculation of layout, so we get it once to not to trigger twice
+ var windowHeight = mfp.wH = _window.height();
+
+
+ var windowStyles = {};
+
+ if( mfp.fixedContentPos ) {
+ if(mfp._hasScrollBar(windowHeight)){
+ var s = mfp._getScrollbarSize();
+ if(s) {
+ windowStyles.marginRight = s;
+ }
+ }
+ }
+
+ if(mfp.fixedContentPos) {
+ if(!mfp.isIE7) {
+ windowStyles.overflow = 'hidden';
+ } else {
+ // ie7 double-scroll bug
+ $('body, html').css('overflow', 'hidden');
+ }
+ }
+
+
+
+ var classesToadd = mfp.st.mainClass;
+ if(mfp.isIE7) {
+ classesToadd += ' mfp-ie7';
+ }
+ if(classesToadd) {
+ mfp._addClassToMFP( classesToadd );
+ }
+
+ // add content
+ mfp.updateItemHTML();
+
+ _mfpTrigger('BuildControls');
+
+ // remove scrollbar, add margin e.t.c
+ $('html').css(windowStyles);
+
+ // add everything to DOM
+ mfp.bgOverlay.add(mfp.wrap).prependTo( mfp.st.prependTo || $(document.body) );
+
+ // Save last focused element
+ mfp._lastFocusedEl = document.activeElement;
+
+ // Wait for next cycle to allow CSS transition
+ setTimeout(function() {
+
+ if(mfp.content) {
+ mfp._addClassToMFP(READY_CLASS);
+ mfp._setFocus();
+ } else {
+ // if content is not defined (not loaded e.t.c) we add class only for BG
+ mfp.bgOverlay.addClass(READY_CLASS);
+ }
+
+ // Trap the focus in popup
+ _document.on('focusin' + EVENT_NS, mfp._onFocusIn);
+
+ }, 16);
+
+ mfp.isOpen = true;
+ mfp.updateSize(windowHeight);
+ _mfpTrigger(OPEN_EVENT);
+
+ return data;
+ },
+
+ /**
+ * Closes the popup
+ */
+ close: function() {
+ if(!mfp.isOpen) return;
+ _mfpTrigger(BEFORE_CLOSE_EVENT);
+
+ mfp.isOpen = false;
+ // for CSS3 animation
+ if(mfp.st.removalDelay && !mfp.isLowIE && mfp.supportsTransition ) {
+ mfp._addClassToMFP(REMOVING_CLASS);
+ setTimeout(function() {
+ mfp._close();
+ }, mfp.st.removalDelay);
+ } else {
+ mfp._close();
+ }
+ },
+
+ /**
+ * Helper for close() function
+ */
+ _close: function() {
+ _mfpTrigger(CLOSE_EVENT);
+
+ var classesToRemove = REMOVING_CLASS + ' ' + READY_CLASS + ' ';
+
+ mfp.bgOverlay.detach();
+ mfp.wrap.detach();
+ mfp.container.empty();
+
+ if(mfp.st.mainClass) {
+ classesToRemove += mfp.st.mainClass + ' ';
+ }
+
+ mfp._removeClassFromMFP(classesToRemove);
+
+ if(mfp.fixedContentPos) {
+ var windowStyles = {marginRight: ''};
+ if(mfp.isIE7) {
+ $('body, html').css('overflow', '');
+ } else {
+ windowStyles.overflow = '';
+ }
+ $('html').css(windowStyles);
+ }
+
+ _document.off('keyup' + EVENT_NS + ' focusin' + EVENT_NS);
+ mfp.ev.off(EVENT_NS);
+
+ // clean up DOM elements that aren't removed
+ mfp.wrap.attr('class', 'mfp-wrap').removeAttr('style');
+ mfp.bgOverlay.attr('class', 'mfp-bg');
+ mfp.container.attr('class', 'mfp-container');
+
+ // remove close button from target element
+ if(mfp.st.showCloseBtn &&
+ (!mfp.st.closeBtnInside || mfp.currTemplate[mfp.currItem.type] === true)) {
+ if(mfp.currTemplate.closeBtn)
+ mfp.currTemplate.closeBtn.detach();
+ }
+
+
+ if(mfp.st.autoFocusLast && mfp._lastFocusedEl) {
+ $(mfp._lastFocusedEl).focus(); // put tab focus back
+ }
+ mfp.currItem = null;
+ mfp.content = null;
+ mfp.currTemplate = null;
+ mfp.prevHeight = 0;
+
+ _mfpTrigger(AFTER_CLOSE_EVENT);
+ },
+
+ updateSize: function(winHeight) {
+
+ if(mfp.isIOS) {
+ // fixes iOS nav bars https://github.com/dimsemenov/Magnific-Popup/issues/2
+ var zoomLevel = document.documentElement.clientWidth / window.innerWidth;
+ var height = window.innerHeight * zoomLevel;
+ mfp.wrap.css('height', height);
+ mfp.wH = height;
+ } else {
+ mfp.wH = winHeight || _window.height();
+ }
+ // Fixes #84: popup incorrectly positioned with position:relative on body
+ if(!mfp.fixedContentPos) {
+ mfp.wrap.css('height', mfp.wH);
+ }
+
+ _mfpTrigger('Resize');
+
+ },
+
+ /**
+ * Set content of popup based on current index
+ */
+ updateItemHTML: function() {
+ var item = mfp.items[mfp.index];
+
+ // Detach and perform modifications
+ mfp.contentContainer.detach();
+
+ if(mfp.content)
+ mfp.content.detach();
+
+ if(!item.parsed) {
+ item = mfp.parseEl( mfp.index );
+ }
+
+ var type = item.type;
+
+ _mfpTrigger('BeforeChange', [mfp.currItem ? mfp.currItem.type : '', type]);
+ // BeforeChange event works like so:
+ // _mfpOn('BeforeChange', function(e, prevType, newType) { });
+
+ mfp.currItem = item;
+
+ if(!mfp.currTemplate[type]) {
+ var markup = mfp.st[type] ? mfp.st[type].markup : false;
+
+ // allows to modify markup
+ _mfpTrigger('FirstMarkupParse', markup);
+
+ if(markup) {
+ mfp.currTemplate[type] = $(markup);
+ } else {
+ // if there is no markup found we just define that template is parsed
+ mfp.currTemplate[type] = true;
+ }
+ }
+
+ if(_prevContentType && _prevContentType !== item.type) {
+ mfp.container.removeClass('mfp-'+_prevContentType+'-holder');
+ }
+
+ var newContent = mfp['get' + type.charAt(0).toUpperCase() + type.slice(1)](item, mfp.currTemplate[type]);
+ mfp.appendContent(newContent, type);
+
+ item.preloaded = true;
+
+ _mfpTrigger(CHANGE_EVENT, item);
+ _prevContentType = item.type;
+
+ // Append container back after its content changed
+ mfp.container.prepend(mfp.contentContainer);
+
+ _mfpTrigger('AfterChange');
+ },
+
+
+ /**
+ * Set HTML content of popup
+ */
+ appendContent: function(newContent, type) {
+ mfp.content = newContent;
+
+ if(newContent) {
+ if(mfp.st.showCloseBtn && mfp.st.closeBtnInside &&
+ mfp.currTemplate[type] === true) {
+ // if there is no markup, we just append close button element inside
+ if(!mfp.content.find('.mfp-close').length) {
+ mfp.content.append(_getCloseBtn());
+ }
+ } else {
+ mfp.content = newContent;
+ }
+ } else {
+ mfp.content = '';
+ }
+
+ _mfpTrigger(BEFORE_APPEND_EVENT);
+ mfp.container.addClass('mfp-'+type+'-holder');
+
+ mfp.contentContainer.append(mfp.content);
+ },
+
+
+ /**
+ * Creates Magnific Popup data object based on given data
+ * @param {int} index Index of item to parse
+ */
+ parseEl: function(index) {
+ var item = mfp.items[index],
+ type;
+
+ if(item.tagName) {
+ item = { el: $(item) };
+ } else {
+ type = item.type;
+ item = { data: item, src: item.src };
+ }
+
+ if(item.el) {
+ var types = mfp.types;
+
+ // check for 'mfp-TYPE' class
+ for(var i = 0; i < types.length; i++) {
+ if( item.el.hasClass('mfp-'+types[i]) ) {
+ type = types[i];
+ break;
+ }
+ }
+
+ item.src = item.el.attr('data-mfp-src');
+ if(!item.src) {
+ item.src = item.el.attr('href');
+ }
+ }
+
+ item.type = type || mfp.st.type || 'inline';
+ item.index = index;
+ item.parsed = true;
+ mfp.items[index] = item;
+ _mfpTrigger('ElementParse', item);
+
+ return mfp.items[index];
+ },
+
+
+ /**
+ * Initializes single popup or a group of popups
+ */
+ addGroup: function(el, options) {
+ var eHandler = function(e) {
+ e.mfpEl = this;
+ mfp._openClick(e, el, options);
+ };
+
+ if(!options) {
+ options = {};
+ }
+
+ var eName = 'click.magnificPopup';
+ options.mainEl = el;
+
+ if(options.items) {
+ options.isObj = true;
+ el.off(eName).on(eName, eHandler);
+ } else {
+ options.isObj = false;
+ if(options.delegate) {
+ el.off(eName).on(eName, options.delegate , eHandler);
+ } else {
+ options.items = el;
+ el.off(eName).on(eName, eHandler);
+ }
+ }
+ },
+ _openClick: function(e, el, options) {
+ var midClick = options.midClick !== undefined ? options.midClick : $.magnificPopup.defaults.midClick;
+
+
+ if(!midClick && ( e.which === 2 || e.ctrlKey || e.metaKey || e.altKey || e.shiftKey ) ) {
+ return;
+ }
+
+ var disableOn = options.disableOn !== undefined ? options.disableOn : $.magnificPopup.defaults.disableOn;
+
+ if(disableOn) {
+ if($.isFunction(disableOn)) {
+ if( !disableOn.call(mfp) ) {
+ return true;
+ }
+ } else { // else it's number
+ if( _window.width() < disableOn ) {
+ return true;
+ }
+ }
+ }
+
+ if(e.type) {
+ e.preventDefault();
+
+ // This will prevent popup from closing if element is inside and popup is already opened
+ if(mfp.isOpen) {
+ e.stopPropagation();
+ }
+ }
+
+ options.el = $(e.mfpEl);
+ if(options.delegate) {
+ options.items = el.find(options.delegate);
+ }
+ mfp.open(options);
+ },
+
+
+ /**
+ * Updates text on preloader
+ */
+ updateStatus: function(status, text) {
+
+ if(mfp.preloader) {
+ if(_prevStatus !== status) {
+ mfp.container.removeClass('mfp-s-'+_prevStatus);
+ }
+
+ if(!text && status === 'loading') {
+ text = mfp.st.tLoading;
+ }
+
+ var data = {
+ status: status,
+ text: text
+ };
+ // allows to modify status
+ _mfpTrigger('UpdateStatus', data);
+
+ status = data.status;
+ text = data.text;
+
+ mfp.preloader.html(text);
+
+ mfp.preloader.find('a').on('click', function(e) {
+ e.stopImmediatePropagation();
+ });
+
+ mfp.container.addClass('mfp-s-'+status);
+ _prevStatus = status;
+ }
+ },
+
+
+ /*
+ "Private" helpers that aren't private at all
+ */
+ // Check to close popup or not
+ // "target" is an element that was clicked
+ _checkIfClose: function(target) {
+
+ if($(target).hasClass(PREVENT_CLOSE_CLASS)) {
+ return;
+ }
+
+ var closeOnContent = mfp.st.closeOnContentClick;
+ var closeOnBg = mfp.st.closeOnBgClick;
+
+ if(closeOnContent && closeOnBg) {
+ return true;
+ } else {
+
+ // We close the popup if click is on close button or on preloader. Or if there is no content.
+ if(!mfp.content || $(target).hasClass('mfp-close') || (mfp.preloader && target === mfp.preloader[0]) ) {
+ return true;
+ }
+
+ // if click is outside the content
+ if( (target !== mfp.content[0] && !$.contains(mfp.content[0], target)) ) {
+ if(closeOnBg) {
+ // last check, if the clicked element is in DOM, (in case it's removed onclick)
+ if( $.contains(document, target) ) {
+ return true;
+ }
+ }
+ } else if(closeOnContent) {
+ return true;
+ }
+
+ }
+ return false;
+ },
+ _addClassToMFP: function(cName) {
+ mfp.bgOverlay.addClass(cName);
+ mfp.wrap.addClass(cName);
+ },
+ _removeClassFromMFP: function(cName) {
+ this.bgOverlay.removeClass(cName);
+ mfp.wrap.removeClass(cName);
+ },
+ _hasScrollBar: function(winHeight) {
+ return ( (mfp.isIE7 ? _document.height() : document.body.scrollHeight) > (winHeight || _window.height()) );
+ },
+ _setFocus: function() {
+ (mfp.st.focus ? mfp.content.find(mfp.st.focus).eq(0) : mfp.wrap).focus();
+ },
+ _onFocusIn: function(e) {
+ if( e.target !== mfp.wrap[0] && !$.contains(mfp.wrap[0], e.target) ) {
+ mfp._setFocus();
+ return false;
+ }
+ },
+ _parseMarkup: function(template, values, item) {
+ var arr;
+ if(item.data) {
+ values = $.extend(item.data, values);
+ }
+ _mfpTrigger(MARKUP_PARSE_EVENT, [template, values, item] );
+
+ $.each(values, function(key, value) {
+ if(value === undefined || value === false) {
+ return true;
+ }
+ arr = key.split('_');
+ if(arr.length > 1) {
+ var el = template.find(EVENT_NS + '-'+arr[0]);
+
+ if(el.length > 0) {
+ var attr = arr[1];
+ if(attr === 'replaceWith') {
+ if(el[0] !== value[0]) {
+ el.replaceWith(value);
+ }
+ } else if(attr === 'img') {
+ if(el.is('img')) {
+ el.attr('src', value);
+ } else {
+ el.replaceWith( $('').attr('src', value).attr('class', el.attr('class')) );
+ }
+ } else {
+ el.attr(arr[1], value);
+ }
+ }
+
+ } else {
+ template.find(EVENT_NS + '-'+key).html(value);
+ }
+ });
+ },
+
+ _getScrollbarSize: function() {
+ // thx David
+ if(mfp.scrollbarSize === undefined) {
+ var scrollDiv = document.createElement("div");
+ scrollDiv.style.cssText = 'width: 99px; height: 99px; overflow: scroll; position: absolute; top: -9999px;';
+ document.body.appendChild(scrollDiv);
+ mfp.scrollbarSize = scrollDiv.offsetWidth - scrollDiv.clientWidth;
+ document.body.removeChild(scrollDiv);
+ }
+ return mfp.scrollbarSize;
+ }
+
+ }; /* MagnificPopup core prototype end */
+
+
+
+
+ /**
+ * Public static functions
+ */
+ $.magnificPopup = {
+ instance: null,
+ proto: MagnificPopup.prototype,
+ modules: [],
+
+ open: function(options, index) {
+ _checkInstance();
+
+ if(!options) {
+ options = {};
+ } else {
+ options = $.extend(true, {}, options);
+ }
+
+ options.isObj = true;
+ options.index = index || 0;
+ return this.instance.open(options);
+ },
+
+ close: function() {
+ return $.magnificPopup.instance && $.magnificPopup.instance.close();
+ },
+
+ registerModule: function(name, module) {
+ if(module.options) {
+ $.magnificPopup.defaults[name] = module.options;
+ }
+ $.extend(this.proto, module.proto);
+ this.modules.push(name);
+ },
+
+ defaults: {
+
+ // Info about options is in docs:
+ // http://dimsemenov.com/plugins/magnific-popup/documentation.html#options
+
+ disableOn: 0,
+
+ key: null,
+
+ midClick: false,
+
+ mainClass: '',
+
+ preloader: true,
+
+ focus: '', // CSS selector of input to focus after popup is opened
+
+ closeOnContentClick: false,
+
+ closeOnBgClick: true,
+
+ closeBtnInside: true,
+
+ showCloseBtn: true,
+
+ enableEscapeKey: true,
+
+ modal: false,
+
+ alignTop: false,
+
+ removalDelay: 0,
+
+ prependTo: null,
+
+ fixedContentPos: 'auto',
+
+ fixedBgPos: 'auto',
+
+ overflowY: 'auto',
+
+ closeMarkup: '',
+
+ tClose: 'Close (Esc)',
+
+ tLoading: 'Loading...',
+
+ autoFocusLast: true
+
+ }
+ };
+
+
+
+ $.fn.magnificPopup = function(options) {
+ _checkInstance();
+
+ var jqEl = $(this);
+
+ // We call some API method of first param is a string
+ if (typeof options === "string" ) {
+
+ if(options === 'open') {
+ var items,
+ itemOpts = _isJQ ? jqEl.data('magnificPopup') : jqEl[0].magnificPopup,
+ index = parseInt(arguments[1], 10) || 0;
+
+ if(itemOpts.items) {
+ items = itemOpts.items[index];
+ } else {
+ items = jqEl;
+ if(itemOpts.delegate) {
+ items = items.find(itemOpts.delegate);
+ }
+ items = items.eq( index );
+ }
+ mfp._openClick({mfpEl:items}, jqEl, itemOpts);
+ } else {
+ if(mfp.isOpen)
+ mfp[options].apply(mfp, Array.prototype.slice.call(arguments, 1));
+ }
+
+ } else {
+ // clone options obj
+ options = $.extend(true, {}, options);
+
+ /*
+ * As Zepto doesn't support .data() method for objects
+ * and it works only in normal browsers
+ * we assign "options" object directly to the DOM element. FTW!
+ */
+ if(_isJQ) {
+ jqEl.data('magnificPopup', options);
+ } else {
+ jqEl[0].magnificPopup = options;
+ }
+
+ mfp.addGroup(jqEl, options);
+
+ }
+ return jqEl;
+ };
+
+ /*>>core*/
+
+ /*>>inline*/
+
+ var INLINE_NS = 'inline',
+ _hiddenClass,
+ _inlinePlaceholder,
+ _lastInlineElement,
+ _putInlineElementsBack = function() {
+ if(_lastInlineElement) {
+ _inlinePlaceholder.after( _lastInlineElement.addClass(_hiddenClass) ).detach();
+ _lastInlineElement = null;
+ }
+ };
+
+ $.magnificPopup.registerModule(INLINE_NS, {
+ options: {
+ hiddenClass: 'hide', // will be appended with `mfp-` prefix
+ markup: '',
+ tNotFound: 'Content not found'
+ },
+ proto: {
+
+ initInline: function() {
+ mfp.types.push(INLINE_NS);
+
+ _mfpOn(CLOSE_EVENT+'.'+INLINE_NS, function() {
+ _putInlineElementsBack();
+ });
+ },
+
+ getInline: function(item, template) {
+
+ _putInlineElementsBack();
+
+ if(item.src) {
+ var inlineSt = mfp.st.inline,
+ el = $(item.src);
+
+ if(el.length) {
+
+ // If target element has parent - we replace it with placeholder and put it back after popup is closed
+ var parent = el[0].parentNode;
+ if(parent && parent.tagName) {
+ if(!_inlinePlaceholder) {
+ _hiddenClass = inlineSt.hiddenClass;
+ _inlinePlaceholder = _getEl(_hiddenClass);
+ _hiddenClass = 'mfp-'+_hiddenClass;
+ }
+ // replace target inline element with placeholder
+ _lastInlineElement = el.after(_inlinePlaceholder).detach().removeClass(_hiddenClass);
+ }
+
+ mfp.updateStatus('ready');
+ } else {
+ mfp.updateStatus('error', inlineSt.tNotFound);
+ el = $('
+ 