From acbf46de735eaec3cd31fffe39d05995845cbe95 Mon Sep 17 00:00:00 2001 From: donSchoe Date: Mon, 27 Jan 2014 01:19:23 +0100 Subject: [PATCH] added p2pool for vertcoin --- .gitignore | 8 + COPYING | 674 +++++ Makefile | 99 + README.md | 97 +- SOAPpy/Client.py | 565 +++++ SOAPpy/Config.py | 211 ++ SOAPpy/Errors.py | 79 + SOAPpy/GSIServer.py | 143 ++ SOAPpy/NS.py | 104 + SOAPpy/Parser.py | 1092 +++++++++ SOAPpy/SOAP.py | 40 + SOAPpy/SOAPBuilder.py | 648 +++++ SOAPpy/Server.py | 706 ++++++ SOAPpy/Types.py | 1747 +++++++++++++ SOAPpy/URLopener.py | 23 + SOAPpy/Utilities.py | 176 ++ SOAPpy/WSDL.py | 137 ++ SOAPpy/__init__.py | 15 + SOAPpy/version.py | 2 + conf/requirements.development.pip | 3 + conf/requirements.production.pip | 3 + conf/requirements.testing.pip | 3 + configure | 9 + dev/CLEAN | 1 + dev/COUNT | 1 + dev/COVERAGE_REPORT | 1 + dev/COVERAGE_TEST | 1 + dev/FIND | 1 + dev/LINT | 1 + dev/TEST | 5 + dev/readme | 7 + fpconst.py | 178 ++ nattraverso/__init__.py | 15 + nattraverso/ipdiscover.py | 138 ++ nattraverso/portmapper.py | 118 + nattraverso/pynupnp/__init__.py | 33 + nattraverso/pynupnp/soap.py | 104 + nattraverso/pynupnp/upnp.py | 530 ++++ nattraverso/pynupnp/upnpxml.py | 89 + nattraverso/utils.py | 56 + p2pool/__init__.py | 49 + p2pool/bitcoin/__init__.py | 0 p2pool/bitcoin/data.py | 312 +++ p2pool/bitcoin/getwork.py | 78 + p2pool/bitcoin/height_tracker.py | 113 + p2pool/bitcoin/helper.py | 87 + p2pool/bitcoin/networks.py | 206 ++ p2pool/bitcoin/p2p.py | 180 ++ p2pool/bitcoin/script.py | 80 + p2pool/bitcoin/sha256.py | 75 + p2pool/bitcoin/stratum.py | 90 + p2pool/bitcoin/worker_interface.py | 142 ++ p2pool/data.py | 730 ++++++ p2pool/main.py | 578 +++++ p2pool/networks.py | 147 ++ p2pool/node.py | 357 +++ p2pool/p2p.py | 681 ++++++ p2pool/test/__init__.py | 0 p2pool/test/bitcoin/__init__.py | 0 p2pool/test/bitcoin/test_data.py | 78 + p2pool/test/bitcoin/test_getwork.py | 69 + p2pool/test/bitcoin/test_p2p.py | 20 + p2pool/test/bitcoin/test_script.py | 12 + p2pool/test/bitcoin/test_sha256.py | 37 + p2pool/test/test_data.py | 41 + p2pool/test/test_node.py | 280 +++ p2pool/test/test_p2p.py | 79 + p2pool/test/util/__init__.py | 0 p2pool/test/util/test_datachunker.py | 27 + p2pool/test/util/test_deferral.py | 17 + p2pool/test/util/test_expiring_dict.py | 32 + p2pool/test/util/test_forest.py | 194 ++ p2pool/test/util/test_graph.py | 9 + p2pool/test/util/test_math.py | 38 + p2pool/test/util/test_pack.py | 11 + p2pool/test/util/test_skiplist.py | 22 + p2pool/util/__init__.py | 0 p2pool/util/datachunker.py | 50 + p2pool/util/deferral.py | 293 +++ p2pool/util/deferred_resource.py | 25 + p2pool/util/expiring_dict.py | 180 ++ p2pool/util/fixargparse.py | 43 + p2pool/util/forest.py | 361 +++ p2pool/util/graph.py | 153 ++ p2pool/util/jsonrpc.py | 164 ++ p2pool/util/logging.py | 103 + p2pool/util/math.py | 243 ++ p2pool/util/memoize.py | 67 + p2pool/util/memory.py | 19 + p2pool/util/p2protocol.py | 104 + p2pool/util/pack.py | 328 +++ p2pool/util/skiplist.py | 59 + p2pool/util/switchprotocol.py | 29 + p2pool/util/variable.py | 85 + p2pool/web.py | 448 ++++ p2pool/work.py | 431 ++++ run_p2pool.py | 5 + setup.py | 70 + wstools/.cvsignore | 1 + wstools/MIMEAttachment.py | 110 + wstools/Namespaces.py | 214 ++ wstools/TimeoutSocket.py | 179 ++ wstools/UserTuple.py | 99 + wstools/Utility.py | 1382 +++++++++++ wstools/WSDLTools.py | 1668 +++++++++++++ wstools/XMLSchema.py | 3116 ++++++++++++++++++++++++ wstools/XMLname.py | 90 + wstools/__init__.py | 9 + wstools/c14n.py | 433 ++++ wstools/logging.py | 274 +++ wstools/tests/.cvsignore | 1 + wstools/tests/README | 52 + wstools/tests/__init__.py | 1 + wstools/tests/config.txt | 362 +++ wstools/tests/schema.tar.gz | Bin 0 -> 68874 bytes wstools/tests/test_t1.py | 20 + wstools/tests/test_wsdl.py | 164 ++ wstools/tests/test_wstools.py | 37 + wstools/tests/test_wstools_net.py | 20 + wstools/tests/xmethods.tar.gz | Bin 0 -> 15209 bytes 120 files changed, 24223 insertions(+), 3 deletions(-) create mode 100644 .gitignore create mode 100644 COPYING create mode 100644 Makefile create mode 100644 SOAPpy/Client.py create mode 100644 SOAPpy/Config.py create mode 100644 SOAPpy/Errors.py create mode 100644 SOAPpy/GSIServer.py create mode 100644 SOAPpy/NS.py create mode 100644 SOAPpy/Parser.py create mode 100644 SOAPpy/SOAP.py create mode 100755 SOAPpy/SOAPBuilder.py create mode 100644 SOAPpy/Server.py create mode 100644 SOAPpy/Types.py create mode 100644 SOAPpy/URLopener.py create mode 100644 SOAPpy/Utilities.py create mode 100644 SOAPpy/WSDL.py create mode 100644 SOAPpy/__init__.py create mode 100644 SOAPpy/version.py create mode 100644 conf/requirements.development.pip create mode 100644 conf/requirements.production.pip create mode 100644 conf/requirements.testing.pip create mode 100755 configure create mode 100644 dev/CLEAN create mode 100644 dev/COUNT create mode 100644 dev/COVERAGE_REPORT create mode 100644 dev/COVERAGE_TEST create mode 100644 dev/FIND create mode 100644 dev/LINT create mode 100644 dev/TEST create mode 100644 dev/readme create mode 100644 fpconst.py create mode 100644 nattraverso/__init__.py create mode 100644 nattraverso/ipdiscover.py create mode 100644 nattraverso/portmapper.py create mode 100644 nattraverso/pynupnp/__init__.py create mode 100644 nattraverso/pynupnp/soap.py create mode 100644 nattraverso/pynupnp/upnp.py create mode 100644 nattraverso/pynupnp/upnpxml.py create mode 100644 nattraverso/utils.py create mode 100644 p2pool/__init__.py create mode 100644 p2pool/bitcoin/__init__.py create mode 100644 p2pool/bitcoin/data.py create mode 100644 p2pool/bitcoin/getwork.py create mode 100644 p2pool/bitcoin/height_tracker.py create mode 100644 p2pool/bitcoin/helper.py create mode 100644 p2pool/bitcoin/networks.py create mode 100644 p2pool/bitcoin/p2p.py create mode 100644 p2pool/bitcoin/script.py create mode 100644 p2pool/bitcoin/sha256.py create mode 100644 p2pool/bitcoin/stratum.py create mode 100644 p2pool/bitcoin/worker_interface.py create mode 100644 p2pool/data.py create mode 100644 p2pool/main.py create mode 100644 p2pool/networks.py create mode 100644 p2pool/node.py create mode 100644 p2pool/p2p.py create mode 100644 p2pool/test/__init__.py create mode 100644 p2pool/test/bitcoin/__init__.py create mode 100644 p2pool/test/bitcoin/test_data.py create mode 100644 p2pool/test/bitcoin/test_getwork.py create mode 100644 p2pool/test/bitcoin/test_p2p.py create mode 100644 p2pool/test/bitcoin/test_script.py create mode 100644 p2pool/test/bitcoin/test_sha256.py create mode 100644 p2pool/test/test_data.py create mode 100644 p2pool/test/test_node.py create mode 100644 p2pool/test/test_p2p.py create mode 100644 p2pool/test/util/__init__.py create mode 100644 p2pool/test/util/test_datachunker.py create mode 100644 p2pool/test/util/test_deferral.py create mode 100644 p2pool/test/util/test_expiring_dict.py create mode 100644 p2pool/test/util/test_forest.py create mode 100644 p2pool/test/util/test_graph.py create mode 100644 p2pool/test/util/test_math.py create mode 100644 p2pool/test/util/test_pack.py create mode 100644 p2pool/test/util/test_skiplist.py create mode 100644 p2pool/util/__init__.py create mode 100644 p2pool/util/datachunker.py create mode 100644 p2pool/util/deferral.py create mode 100644 p2pool/util/deferred_resource.py create mode 100644 p2pool/util/expiring_dict.py create mode 100644 p2pool/util/fixargparse.py create mode 100644 p2pool/util/forest.py create mode 100644 p2pool/util/graph.py create mode 100644 p2pool/util/jsonrpc.py create mode 100644 p2pool/util/logging.py create mode 100644 p2pool/util/math.py create mode 100644 p2pool/util/memoize.py create mode 100644 p2pool/util/memory.py create mode 100644 p2pool/util/p2protocol.py create mode 100644 p2pool/util/pack.py create mode 100644 p2pool/util/skiplist.py create mode 100644 p2pool/util/switchprotocol.py create mode 100644 p2pool/util/variable.py create mode 100644 p2pool/web.py create mode 100644 p2pool/work.py create mode 100755 run_p2pool.py create mode 100644 setup.py create mode 100644 wstools/.cvsignore create mode 100644 wstools/MIMEAttachment.py create mode 100755 wstools/Namespaces.py create mode 100755 wstools/TimeoutSocket.py create mode 100644 wstools/UserTuple.py create mode 100755 wstools/Utility.py create mode 100755 wstools/WSDLTools.py create mode 100755 wstools/XMLSchema.py create mode 100644 wstools/XMLname.py create mode 100644 wstools/__init__.py create mode 100755 wstools/c14n.py create mode 100644 wstools/logging.py create mode 100644 wstools/tests/.cvsignore create mode 100644 wstools/tests/README create mode 100644 wstools/tests/__init__.py create mode 100644 wstools/tests/config.txt create mode 100644 wstools/tests/schema.tar.gz create mode 100644 wstools/tests/test_t1.py create mode 100644 wstools/tests/test_wsdl.py create mode 100644 wstools/tests/test_wstools.py create mode 100644 wstools/tests/test_wstools_net.py create mode 100644 wstools/tests/xmethods.tar.gz diff --git a/.gitignore b/.gitignore new file mode 100644 index 00000000..a2647238 --- /dev/null +++ b/.gitignore @@ -0,0 +1,8 @@ +*.o +*.so +*.pyc +data/* +vertcoin_scrypt/build/* +p2pool-scanner/index.html +p2pool-scanner/node_modules/* +p2pool-scanner/p2pool-vertcoin-public.json diff --git a/COPYING b/COPYING new file mode 100644 index 00000000..94a9ed02 --- /dev/null +++ b/COPYING @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + + Copyright (C) + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see . + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + Copyright (C) + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +. diff --git a/Makefile b/Makefile new file mode 100644 index 00000000..ab784f77 --- /dev/null +++ b/Makefile @@ -0,0 +1,99 @@ +# === makefile ------------------------------------------------------------=== + +ROOT=$(shell pwd) +CACHE_ROOT=${ROOT}/.cache +PKG_ROOT=${ROOT}/.pkg + +-include Makefile.local + +.PHONY: all +all: ${PKG_ROOT}/.stamp-h + +.PHONY: check +check: all + "${PKG_ROOT}"/bin/coverage run "${PKG_ROOT}"/bin/trial p2pool + "${PKG_ROOT}"/bin/coverage xml -o build/report/coverage.xml + +.PHONY: run +run: all + "${PKG_ROOT}"/bin/python run_p2pool.py + +.PHONY: shell +shell: all + "${PKG_ROOT}"/bin/ipython + +.PHONY: mostlyclean +mostlyclean: + -rm -rf build + -rm -rf .coverage + +.PHONY: clean +clean: mostlyclean + -rm -rf "${PKG_ROOT}" + +.PHONY: distclean +distclean: clean + -rm -rf "${CACHE_ROOT}" + +.PHONY: maintainer-clean +maintainer-clean: distclean + @echo 'This command is intended for maintainers to use; it' + @echo 'deletes files that may need special tools to rebuild.' + +.PHONY: dist +dist: + +# ===--------------------------------------------------------------------=== + +${CACHE_ROOT}/virtualenv/virtualenv-1.10.1.tar.gz: + mkdir -p ${CACHE_ROOT}/virtualenv + sh -c "cd ${CACHE_ROOT}/virtualenv && curl -O https://pypi.python.org/packages/source/v/virtualenv/virtualenv-1.10.1.tar.gz" + +${PKG_ROOT}/.stamp-h: conf/requirements*.pip ${CACHE_ROOT}/virtualenv/virtualenv-1.10.1.tar.gz + # Because build and run-time dependencies are not thoroughly tracked, + # it is entirely possible that rebuilding the development environment + # on top of an existing one could result in a broken build. For the + # sake of consistency and preventing unnecessary, difficult-to-debug + # problems, the entire development environment is rebuilt from scratch + # everytime this make target is selected. + ${MAKE} clean + + # The ``${PKG_ROOT}`` directory, if it exists, is removed by the + # ``clean`` target. The PyPI cache is nonexistant if this is a freshly + # checked-out repository, or if the ``distclean`` target has been run. + # This might cause problems with build scripts executed later which + # assume their existence, so they are created now if they don't + # already exist. + mkdir -p "${PKG_ROOT}" + mkdir -p "${CACHE_ROOT}"/pypi + + # ``virtualenv`` is used to create a separate Python installation for + # this project in ``${PKG_ROOT}``. + tar \ + -C "${CACHE_ROOT}"/virtualenv --gzip \ + -xf "${CACHE_ROOT}"/virtualenv/virtualenv-1.10.1.tar.gz + python "${CACHE_ROOT}"/virtualenv/virtualenv-1.10.1/virtualenv.py \ + --clear \ + --distribute \ + --never-download \ + --prompt="(p2pool) " \ + "${PKG_ROOT}" + -rm -rf "${CACHE_ROOT}"/virtualenv/virtualenv-1.10.1 + + # readline is installed here to get around a bug on Mac OS X which is + # causing readline to not build properly if installed from pip. + "${PKG_ROOT}"/bin/easy_install readline + + # pip is used to install Python dependencies for this project. + for reqfile in conf/requirements*.pip; do \ + "${PKG_ROOT}"/bin/python "${PKG_ROOT}"/bin/pip install \ + --download-cache="${CACHE_ROOT}"/pypi \ + -r $$reqfile; \ + done + + # All done! + touch "${PKG_ROOT}"/.stamp-h + +# ===--------------------------------------------------------------------=== +# End of File +# ===--------------------------------------------------------------------=== diff --git a/README.md b/README.md index 8f46f811..9ff43b7c 100644 --- a/README.md +++ b/README.md @@ -1,4 +1,95 @@ -p2pool-vtc -========== +Requirements: +------------------------- +Generic: +* Vertcoin >=0.8.5 +* Python >=2.6 +* Twisted >=10.0.0 +* python-argparse (for Python =2.6) + +Linux: +* sudo apt-get install python-zope.interface python-twisted python-twisted-web +* sudo apt-get install python-argparse # if on Python 2.6 + +Windows: +* Install Python 2.7: http://www.python.org/getit/ +* Install Twisted: http://twistedmatrix.com/trac/wiki/Downloads +* Install Zope.Interface: http://pypi.python.org/pypi/zope.interface/3.8.0 +* Install python win32 api: http://sourceforge.net/projects/pywin32/files/pywin32/Build%20218/ +* Install python win32 api wmi wrapper: https://pypi.python.org/pypi/WMI/#downloads +* Unzip the files into C:\Python27\Lib\site-packages + +Running P2Pool: +------------------------- +To use P2Pool, you must be running your own local bitcoind. For standard +configurations, using P2Pool should be as simple as: + + python run_p2pool.py + +Then run your miner program, connecting to 127.0.0.1 on port 9332 with any +username and password. + +If you are behind a NAT, you should enable TCP port forwarding on your +router. Forward port 9333 to the host running P2Pool. + +Run for additional options. + + python run_p2pool.py --help + +Donations towards further development: +------------------------- + 1HNeqi3pJRNvXybNX4FKzZgYJsdTSqJTbk + +Official wiki : +------------------------- +https://en.bitcoin.it/wiki/P2Pool + +Alternate web front end : +------------------------- +* https://github.com/hardcpp/P2PoolExtendedFrontEnd + +Notes for Vertcoin: +========================= +Requirements: +------------------------- +In order to run P2Pool with the Vertcoin network, you would need to build and install the +ltc_scrypt module that includes the scrypt proof of work code that Vertcoin uses for hashes. + +Linux: + + cd vertcoin_scrypt + sudo python setup.py install + +Windows (mingw): +* Install MinGW: http://www.mingw.org/wiki/Getting_Started +* Install Python 2.7: http://www.python.org/getit/ + +In bash type this: + + cd vertcoin_scrypt + C:\Python27\python.exe setup.py build --compile=mingw32 install + +Windows (microsoft visual c++) +* Open visual studio console + +In bash type this: + + SET VS90COMNTOOLS=%VS110COMNTOOLS% # For visual c++ 2012 + SET VS90COMNTOOLS=%VS100COMNTOOLS% # For visual c++ 2010 + cd vertcoin_scrypt + C:\Python27\python.exe setup.py build --compile=mingw32 install + +If you run into an error with unrecognized command line option '-mno-cygwin', see this: +http://stackoverflow.com/questions/6034390/compiling-with-cython-and-mingw-produces-gcc-error-unrecognized-command-line-o + +Running P2Pool: +------------------------- +Run P2Pool with the "--net vertcoin" option. +Run your miner program, connecting to 127.0.0.1 on port 9171. + +Sponsors: +------------------------- + +Thanks to: +* The Bitcoin Foundation for its generous support of P2Pool +* The Litecoin Project for its generous donations to P2Pool -P2Pool node for Vertcoin including node scanner diff --git a/SOAPpy/Client.py b/SOAPpy/Client.py new file mode 100644 index 00000000..37498795 --- /dev/null +++ b/SOAPpy/Client.py @@ -0,0 +1,565 @@ +from __future__ import nested_scopes + +""" +################################################################################ +# +# SOAPpy - Cayce Ullman (cayce@actzero.com) +# Brian Matthews (blm@actzero.com) +# Gregory Warnes (Gregory.R.Warnes@Pfizer.com) +# Christopher Blunck (blunck@gst.com) +# +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" +ident = '$Id: Client.py 1496 2010-03-04 23:46:17Z pooryorick $' + +from version import __version__ + +#import xml.sax +import urllib +from types import * +import re +import base64 +import socket, httplib +from httplib import HTTPConnection, HTTP +import Cookie + +# SOAPpy modules +from Errors import * +from Config import Config +from Parser import parseSOAPRPC +from SOAPBuilder import buildSOAP +from Utilities import * +from Types import faultType, simplify + +################################################################################ +# Client +################################################################################ + + +def SOAPUserAgent(): + return "SOAPpy " + __version__ + " (pywebsvcs.sf.net)" + + +class SOAPAddress: + def __init__(self, url, config = Config): + proto, uri = urllib.splittype(url) + + # apply some defaults + if uri[0:2] != '//': + if proto != None: + uri = proto + ':' + uri + + uri = '//' + uri + proto = 'http' + + host, path = urllib.splithost(uri) + + try: + int(host) + host = 'localhost:' + host + except: + pass + + if not path: + path = '/' + + if proto not in ('http', 'https', 'httpg'): + raise IOError, "unsupported SOAP protocol" + if proto == 'httpg' and not config.GSIclient: + raise AttributeError, \ + "GSI client not supported by this Python installation" + if proto == 'https' and not config.SSLclient: + raise AttributeError, \ + "SSL client not supported by this Python installation" + + self.user,host = urllib.splituser(host) + self.proto = proto + self.host = host + self.path = path + + def __str__(self): + return "%(proto)s://%(host)s%(path)s" % self.__dict__ + + __repr__ = __str__ + +class SOAPTimeoutError(socket.timeout): + '''This exception is raised when a timeout occurs in SOAP operations''' + pass + +class HTTPConnectionWithTimeout(HTTPConnection): + '''Extend HTTPConnection for timeout support''' + + def __init__(self, host, port=None, strict=None, timeout=None): + HTTPConnection.__init__(self, host, port, strict) + self._timeout = timeout + + def connect(self): + HTTPConnection.connect(self) + if self.sock and self._timeout: + self.sock.settimeout(self._timeout) + + +class HTTPWithTimeout(HTTP): + + _connection_class = HTTPConnectionWithTimeout + + ## this __init__ copied from httplib.HTML class + def __init__(self, host='', port=None, strict=None, timeout=None): + "Provide a default host, since the superclass requires one." + + # some joker passed 0 explicitly, meaning default port + if port == 0: + port = None + + # Note that we may pass an empty string as the host; this will throw + # an error when we attempt to connect. Presumably, the client code + # will call connect before then, with a proper host. + self._setup(self._connection_class(host, port, strict, timeout)) + +class HTTPTransport: + + + def __init__(self): + self.cookies = Cookie.SimpleCookie(); + + def getNS(self, original_namespace, data): + """Extract the (possibly extended) namespace from the returned + SOAP message.""" + + if type(original_namespace) == StringType: + pattern="xmlns:\w+=['\"](" + original_namespace + "[^'\"]*)['\"]" + match = re.search(pattern, data) + if match: + return match.group(1) + else: + return original_namespace + else: + return original_namespace + + def __addcookies(self, r): + '''Add cookies from self.cookies to request r + ''' + for cname, morsel in self.cookies.items(): + attrs = [] + value = morsel.get('version', '') + if value != '' and value != '0': + attrs.append('$Version=%s' % value) + attrs.append('%s=%s' % (cname, morsel.coded_value)) + value = morsel.get('path') + if value: + attrs.append('$Path=%s' % value) + value = morsel.get('domain') + if value: + attrs.append('$Domain=%s' % value) + r.putheader('Cookie', "; ".join(attrs)) + + def call(self, addr, data, namespace, soapaction = None, encoding = None, + http_proxy = None, config = Config, timeout=None): + + if not isinstance(addr, SOAPAddress): + addr = SOAPAddress(addr, config) + + # Build a request + if http_proxy: + real_addr = http_proxy + real_path = addr.proto + "://" + addr.host + addr.path + else: + real_addr = addr.host + real_path = addr.path + + if addr.proto == 'httpg': + from pyGlobus.io import GSIHTTP + r = GSIHTTP(real_addr, tcpAttr = config.tcpAttr) + elif addr.proto == 'https': + r = httplib.HTTPS(real_addr, key_file=config.SSL.key_file, cert_file=config.SSL.cert_file) + else: + r = HTTPWithTimeout(real_addr, timeout=timeout) + + r.putrequest("POST", real_path) + + r.putheader("Host", addr.host) + r.putheader("User-agent", SOAPUserAgent()) + t = 'text/xml'; + if encoding != None: + t += '; charset=%s' % encoding + r.putheader("Content-type", t) + r.putheader("Content-length", str(len(data))) + self.__addcookies(r); + + # if user is not a user:passwd format + # we'll receive a failure from the server. . .I guess (??) + if addr.user != None: + val = base64.encodestring(addr.user) + r.putheader('Authorization','Basic ' + val.replace('\012','')) + + # This fixes sending either "" or "None" + if soapaction == None or len(soapaction) == 0: + r.putheader("SOAPAction", "") + else: + r.putheader("SOAPAction", '"%s"' % soapaction) + + if config.dumpHeadersOut: + s = 'Outgoing HTTP headers' + debugHeader(s) + print "POST %s %s" % (real_path, r._http_vsn_str) + print "Host:", addr.host + print "User-agent: SOAPpy " + __version__ + " (http://pywebsvcs.sf.net)" + print "Content-type:", t + print "Content-length:", len(data) + print 'SOAPAction: "%s"' % soapaction + debugFooter(s) + + r.endheaders() + + if config.dumpSOAPOut: + s = 'Outgoing SOAP' + debugHeader(s) + print data, + if data[-1] != '\n': + print + debugFooter(s) + + # send the payload + r.send(data) + + # read response line + code, msg, headers = r.getreply() + + self.cookies = Cookie.SimpleCookie(); + if headers: + content_type = headers.get("content-type","text/xml") + content_length = headers.get("Content-length") + + for cookie in headers.getallmatchingheaders("Set-Cookie"): + self.cookies.load(cookie); + + else: + content_type=None + content_length=None + + # work around OC4J bug which does ', ' for some reaason + if content_length: + comma=content_length.find(',') + if comma>0: + content_length = content_length[:comma] + + # attempt to extract integer message size + try: + message_len = int(content_length) + except: + message_len = -1 + + if message_len < 0: + # Content-Length missing or invalid; just read the whole socket + # This won't work with HTTP/1.1 chunked encoding + data = r.getfile().read() + message_len = len(data) + else: + data = r.getfile().read(message_len) + + if(config.debug): + print "code=",code + print "msg=", msg + print "headers=", headers + print "content-type=", content_type + print "data=", data + + if config.dumpHeadersIn: + s = 'Incoming HTTP headers' + debugHeader(s) + if headers.headers: + print "HTTP/1.? %d %s" % (code, msg) + print "\n".join(map (lambda x: x.strip(), headers.headers)) + else: + print "HTTP/0.9 %d %s" % (code, msg) + debugFooter(s) + + def startswith(string, val): + return string[0:len(val)] == val + + if code == 500 and not \ + ( startswith(content_type, "text/xml") and message_len > 0 ): + raise HTTPError(code, msg) + + if config.dumpSOAPIn: + s = 'Incoming SOAP' + debugHeader(s) + print data, + if (len(data)>0) and (data[-1] != '\n'): + print + debugFooter(s) + + if code not in (200, 500): + raise HTTPError(code, msg) + + + # get the new namespace + if namespace is None: + new_ns = None + else: + new_ns = self.getNS(namespace, data) + + # return response payload + return data, new_ns + +################################################################################ +# SOAP Proxy +################################################################################ +class SOAPProxy: + def __init__(self, proxy, namespace = None, soapaction = None, + header = None, methodattrs = None, transport = HTTPTransport, + encoding = 'UTF-8', throw_faults = 1, unwrap_results = None, + http_proxy=None, config = Config, noroot = 0, + simplify_objects=None, timeout=None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + # get default values for unwrap_results and simplify_objects + # from config + if unwrap_results is None: + self.unwrap_results=config.unwrap_results + else: + self.unwrap_results=unwrap_results + + if simplify_objects is None: + self.simplify_objects=config.simplify_objects + else: + self.simplify_objects=simplify_objects + + self.proxy = SOAPAddress(proxy, config) + self.namespace = namespace + self.soapaction = soapaction + self.header = header + self.methodattrs = methodattrs + self.transport = transport() + self.encoding = encoding + self.throw_faults = throw_faults + self.http_proxy = http_proxy + self.config = config + self.noroot = noroot + self.timeout = timeout + + # GSI Additions + if hasattr(config, "channel_mode") and \ + hasattr(config, "delegation_mode"): + self.channel_mode = config.channel_mode + self.delegation_mode = config.delegation_mode + #end GSI Additions + + def invoke(self, method, args): + return self.__call(method, args, {}) + + def __call(self, name, args, kw, ns = None, sa = None, hd = None, + ma = None): + + ns = ns or self.namespace + ma = ma or self.methodattrs + + if sa: # Get soapaction + if type(sa) == TupleType: + sa = sa[0] + else: + if self.soapaction: + sa = self.soapaction + else: + sa = name + + if hd: # Get header + if type(hd) == TupleType: + hd = hd[0] + else: + hd = self.header + + hd = hd or self.header + + if ma: # Get methodattrs + if type(ma) == TupleType: ma = ma[0] + else: + ma = self.methodattrs + ma = ma or self.methodattrs + + m = buildSOAP(args = args, kw = kw, method = name, namespace = ns, + header = hd, methodattrs = ma, encoding = self.encoding, + config = self.config, noroot = self.noroot) + + + call_retry = 0 + try: + r, self.namespace = self.transport.call(self.proxy, m, ns, sa, + encoding = self.encoding, + http_proxy = self.http_proxy, + config = self.config, + timeout = self.timeout) + + except socket.timeout: + raise SOAPTimeoutError + + except Exception, ex: + # + # Call failed. + # + # See if we have a fault handling vector installed in our + # config. If we do, invoke it. If it returns a true value, + # retry the call. + # + # In any circumstance other than the fault handler returning + # true, reraise the exception. This keeps the semantics of this + # code the same as without the faultHandler code. + # + + if hasattr(self.config, "faultHandler"): + if callable(self.config.faultHandler): + call_retry = self.config.faultHandler(self.proxy, ex) + if not call_retry: + raise + else: + raise + else: + raise + + if call_retry: + try: + r, self.namespace = self.transport.call(self.proxy, m, ns, sa, + encoding = self.encoding, + http_proxy = self.http_proxy, + config = self.config, + timeout = self.timeout) + except socket.timeout: + raise SOAPTimeoutError + + + p, attrs = parseSOAPRPC(r, attrs = 1) + + try: + throw_struct = self.throw_faults and \ + isinstance (p, faultType) + except: + throw_struct = 0 + + if throw_struct: + if Config.debug: + print p + raise p + + # If unwrap_results=1 and there is only element in the struct, + # SOAPProxy will assume that this element is the result + # and return it rather than the struct containing it. + # Otherwise SOAPproxy will return the struct with all the + # elements as attributes. + if self.unwrap_results: + try: + count = 0 + for i in p.__dict__.keys(): + if i[0] != "_": # don't count the private stuff + count += 1 + t = getattr(p, i) + if count == 1: # Only one piece of data, bubble it up + p = t + except: + pass + + # Automatically simplfy SOAP complex types into the + # corresponding python types. (structType --> dict, + # arrayType --> array, etc.) + if self.simplify_objects: + p = simplify(p) + + if self.config.returnAllAttrs: + return p, attrs + return p + + def _callWithBody(self, body): + return self.__call(None, body, {}) + + def __getattr__(self, name): # hook to catch method calls + if name in ( '__del__', '__getinitargs__', '__getnewargs__', + '__getstate__', '__setstate__', '__reduce__', '__reduce_ex__'): + raise AttributeError, name + return self.__Method(self.__call, name, config = self.config) + + # To handle attribute weirdness + class __Method: + # Some magic to bind a SOAP method to an RPC server. + # Supports "nested" methods (e.g. examples.getStateName) -- concept + # borrowed from xmlrpc/soaplib -- www.pythonware.com + # Altered (improved?) to let you inline namespaces on a per call + # basis ala SOAP::LITE -- www.soaplite.com + + def __init__(self, call, name, ns = None, sa = None, hd = None, + ma = None, config = Config): + + self.__call = call + self.__name = name + self.__ns = ns + self.__sa = sa + self.__hd = hd + self.__ma = ma + self.__config = config + return + + def __call__(self, *args, **kw): + if self.__name[0] == "_": + if self.__name in ["__repr__","__str__"]: + return self.__repr__() + else: + return self.__f_call(*args, **kw) + else: + return self.__r_call(*args, **kw) + + def __getattr__(self, name): + if name == '__del__': + raise AttributeError, name + if self.__name[0] == "_": + # Don't nest method if it is a directive + return self.__class__(self.__call, name, self.__ns, + self.__sa, self.__hd, self.__ma) + + return self.__class__(self.__call, "%s.%s" % (self.__name, name), + self.__ns, self.__sa, self.__hd, self.__ma) + + def __f_call(self, *args, **kw): + if self.__name == "_ns": self.__ns = args + elif self.__name == "_sa": self.__sa = args + elif self.__name == "_hd": self.__hd = args + elif self.__name == "_ma": self.__ma = args + return self + + def __r_call(self, *args, **kw): + return self.__call(self.__name, args, kw, self.__ns, self.__sa, + self.__hd, self.__ma) + + def __repr__(self): + return "<%s at %d>" % (self.__class__, id(self)) diff --git a/SOAPpy/Config.py b/SOAPpy/Config.py new file mode 100644 index 00000000..deafa597 --- /dev/null +++ b/SOAPpy/Config.py @@ -0,0 +1,211 @@ +""" +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: Config.py 1298 2006-11-07 00:54:15Z sanxiyn $' +from version import __version__ + +import socket +from types import * + +from NS import NS + +################################################################################ +# Configuration class +################################################################################ + + +class SOAPConfig: + __readonly = ('SSLserver', 'SSLclient', 'GSIserver', 'GSIclient') + class SSLconfig: + __slots__ = ('key_file', 'cert_file') + key_file = None + cert_file = None + + def __init__(self, config = None, **kw): + d = self.__dict__ + + if config: + if not isinstance(config, SOAPConfig): + raise AttributeError, \ + "initializer must be SOAPConfig instance" + + s = config.__dict__ + + for k, v in s.items(): + if k[0] != '_': + d[k] = v + else: + # Setting debug also sets returnFaultInfo, + # dumpHeadersIn, dumpHeadersOut, dumpSOAPIn, and dumpSOAPOut + self.debug = 0 + self.dumpFaultInfo = 1 + # Setting namespaceStyle sets typesNamespace, typesNamespaceURI, + # schemaNamespace, and schemaNamespaceURI + self.namespaceStyle = '1999' + self.strictNamespaces = 0 + self.typed = 1 + self.buildWithNamespacePrefix = 1 + self.returnAllAttrs = 0 + + # Strict checking of range for floats and doubles + self.strict_range = 0 + + # Default encoding for dictionary keys + self.dict_encoding = 'ascii' + + # New argument name handling mechanism. See + # README.MethodParameterNaming for details + self.specialArgs = 1 + + # If unwrap_results=1 and there is only element in the struct, + # SOAPProxy will assume that this element is the result + # and return it rather than the struct containing it. + # Otherwise SOAPproxy will return the struct with all the + # elements as attributes. + self.unwrap_results = 1 + + # Automatically convert SOAP complex types, and + # (recursively) public contents into the corresponding + # python types. (Private subobjects have names that start + # with '_'.) + # + # Conversions: + # - faultType --> raise python exception + # - arrayType --> array + # - compoundType --> dictionary + # + self.simplify_objects = 0 + + # Per-class authorization method. If this is set, before + # calling a any class method, the specified authorization + # method will be called. If it returns 1, the method call + # will proceed, otherwise the call will throw with an + # authorization error. + self.authMethod = None + + # Globus Support if pyGlobus.io available + try: + from pyGlobus import io; + d['GSIserver'] = 1 + d['GSIclient'] = 1 + except: + d['GSIserver'] = 0 + d['GSIclient'] = 0 + + + # Server SSL support if M2Crypto.SSL available + try: + from M2Crypto import SSL + d['SSLserver'] = 1 + except: + d['SSLserver'] = 0 + + # Client SSL support if socket.ssl available + try: + from socket import ssl + d['SSLclient'] = 1 + except: + d['SSLclient'] = 0 + + # Cert support + if d['SSLclient'] or d['SSLserver']: + d['SSL'] = self.SSLconfig() + + for k, v in kw.items(): + if k[0] != '_': + setattr(self, k, v) + + def __setattr__(self, name, value): + if name in self.__readonly: + raise AttributeError, "readonly configuration setting" + + d = self.__dict__ + + if name in ('typesNamespace', 'typesNamespaceURI', + 'schemaNamespace', 'schemaNamespaceURI'): + + if name[-3:] == 'URI': + base, uri = name[:-3], 1 + else: + base, uri = name, 0 + + if type(value) == StringType: + if NS.NSMAP.has_key(value): + n = (value, NS.NSMAP[value]) + elif NS.NSMAP_R.has_key(value): + n = (NS.NSMAP_R[value], value) + else: + raise AttributeError, "unknown namespace" + elif type(value) in (ListType, TupleType): + if uri: + n = (value[1], value[0]) + else: + n = (value[0], value[1]) + else: + raise AttributeError, "unknown namespace type" + + d[base], d[base + 'URI'] = n + + try: + d['namespaceStyle'] = \ + NS.STMAP_R[(d['typesNamespace'], d['schemaNamespace'])] + except: + d['namespaceStyle'] = '' + + elif name == 'namespaceStyle': + value = str(value) + + if not NS.STMAP.has_key(value): + raise AttributeError, "unknown namespace style" + + d[name] = value + n = d['typesNamespace'] = NS.STMAP[value][0] + d['typesNamespaceURI'] = NS.NSMAP[n] + n = d['schemaNamespace'] = NS.STMAP[value][1] + d['schemaNamespaceURI'] = NS.NSMAP[n] + + elif name == 'debug': + d[name] = \ + d['returnFaultInfo'] = \ + d['dumpHeadersIn'] = \ + d['dumpHeadersOut'] = \ + d['dumpSOAPIn'] = \ + d['dumpSOAPOut'] = value + + else: + d[name] = value + + +Config = SOAPConfig() diff --git a/SOAPpy/Errors.py b/SOAPpy/Errors.py new file mode 100644 index 00000000..1a81f91d --- /dev/null +++ b/SOAPpy/Errors.py @@ -0,0 +1,79 @@ +""" +################################################################################ +# +# SOAPpy - Cayce Ullman (cayce@actzero.com) +# Brian Matthews (blm@actzero.com) +# Gregory Warnes (Gregory.R.Warnes@Pfizer.com) +# Christopher Blunck (blunck@gst.com) +# +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: Errors.py 921 2005-02-15 16:32:23Z warnes $' +from version import __version__ + +import exceptions + +################################################################################ +# Exceptions +################################################################################ +class Error(exceptions.Exception): + def __init__(self, msg): + self.msg = msg + def __str__(self): + return "" % self.msg + __repr__ = __str__ + def __call__(self): + return (msg,) + +class RecursionError(Error): + pass + +class UnknownTypeError(Error): + pass + +class HTTPError(Error): + # indicates an HTTP protocol error + def __init__(self, code, msg): + self.code = code + self.msg = msg + def __str__(self): + return "" % (self.code, self.msg) + __repr__ = __str__ + def __call___(self): + return (self.code, self.msg, ) + +class UnderflowError(exceptions.ArithmeticError): + pass + diff --git a/SOAPpy/GSIServer.py b/SOAPpy/GSIServer.py new file mode 100644 index 00000000..39f836c1 --- /dev/null +++ b/SOAPpy/GSIServer.py @@ -0,0 +1,143 @@ +from __future__ import nested_scopes + +""" +GSIServer - Contributed by Ivan R. Judson + + +################################################################################ +# +# SOAPpy - Cayce Ullman (cayce@actzero.com) +# Brian Matthews (blm@actzero.com) +# Gregory Warnes (Gregory.R.Warnes@Pfizer.com) +# Christopher Blunck (blunck@gst.com) +# +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: GSIServer.py 1468 2008-05-24 01:55:33Z warnes $' +from version import __version__ + +#import xml.sax +import re +import socket +import sys +import SocketServer +from types import * +import BaseHTTPServer + +# SOAPpy modules +from Parser import parseSOAPRPC +from Config import SOAPConfig +from Types import faultType, voidType, simplify +from NS import NS +from SOAPBuilder import buildSOAP +from Utilities import debugHeader, debugFooter + +try: from M2Crypto import SSL +except: pass + +##### + +from Server import * + +from pyGlobus.io import GSITCPSocketServer, ThreadingGSITCPSocketServer +from pyGlobus import ioc + +def GSIConfig(): + config = SOAPConfig() + config.channel_mode = ioc.GLOBUS_IO_SECURE_CHANNEL_MODE_GSI_WRAP + config.delegation_mode = ioc.GLOBUS_IO_SECURE_DELEGATION_MODE_FULL_PROXY + config.tcpAttr = None + config.authMethod = "_authorize" + return config + +Config = GSIConfig() + +class GSISOAPServer(GSITCPSocketServer, SOAPServerBase): + def __init__(self, addr = ('localhost', 8000), + RequestHandler = SOAPRequestHandler, log = 0, + encoding = 'UTF-8', config = Config, namespace = None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + self.namespace = namespace + self.objmap = {} + self.funcmap = {} + self.encoding = encoding + self.config = config + self.log = log + + self.allow_reuse_address= 1 + + GSITCPSocketServer.__init__(self, addr, RequestHandler, + self.config.channel_mode, + self.config.delegation_mode, + tcpAttr = self.config.tcpAttr) + + def get_request(self): + sock, addr = GSITCPSocketServer.get_request(self) + + return sock, addr + +class ThreadingGSISOAPServer(ThreadingGSITCPSocketServer, SOAPServerBase): + + def __init__(self, addr = ('localhost', 8000), + RequestHandler = SOAPRequestHandler, log = 0, + encoding = 'UTF-8', config = Config, namespace = None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + self.namespace = namespace + self.objmap = {} + self.funcmap = {} + self.encoding = encoding + self.config = config + self.log = log + + self.allow_reuse_address= 1 + + ThreadingGSITCPSocketServer.__init__(self, addr, RequestHandler, + self.config.channel_mode, + self.config.delegation_mode, + tcpAttr = self.config.tcpAttr) + + def get_request(self): + sock, addr = ThreadingGSITCPSocketServer.get_request(self) + + return sock, addr + diff --git a/SOAPpy/NS.py b/SOAPpy/NS.py new file mode 100644 index 00000000..124dad05 --- /dev/null +++ b/SOAPpy/NS.py @@ -0,0 +1,104 @@ +from __future__ import nested_scopes + +""" +################################################################################ +# +# SOAPpy - Cayce Ullman (cayce@actzero.com) +# Brian Matthews (blm@actzero.com) +# Gregory Warnes (Gregory.R.Warnes@Pfizer.com) +# Christopher Blunck (blunck@gst.com) +# +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: NS.py 1468 2008-05-24 01:55:33Z warnes $' +from version import __version__ + +############################################################################## +# Namespace Class +################################################################################ +def invertDict(dict): + d = {} + + for k, v in dict.items(): + d[v] = k + + return d + +class NS: + XML = "http://www.w3.org/XML/1998/namespace" + + ENV = "http://schemas.xmlsoap.org/soap/envelope/" + ENC = "http://schemas.xmlsoap.org/soap/encoding/" + + XSD = "http://www.w3.org/1999/XMLSchema" + XSD2 = "http://www.w3.org/2000/10/XMLSchema" + XSD3 = "http://www.w3.org/2001/XMLSchema" + + XSD_L = [XSD, XSD2, XSD3] + EXSD_L= [ENC, XSD, XSD2, XSD3] + + XSI = "http://www.w3.org/1999/XMLSchema-instance" + XSI2 = "http://www.w3.org/2000/10/XMLSchema-instance" + XSI3 = "http://www.w3.org/2001/XMLSchema-instance" + XSI_L = [XSI, XSI2, XSI3] + + URN = "http://soapinterop.org/xsd" + + # For generated messages + XML_T = "xml" + ENV_T = "SOAP-ENV" + ENC_T = "SOAP-ENC" + XSD_T = "xsd" + XSD2_T= "xsd2" + XSD3_T= "xsd3" + XSI_T = "xsi" + XSI2_T= "xsi2" + XSI3_T= "xsi3" + URN_T = "urn" + + NSMAP = {ENV_T: ENV, ENC_T: ENC, XSD_T: XSD, XSD2_T: XSD2, + XSD3_T: XSD3, XSI_T: XSI, XSI2_T: XSI2, XSI3_T: XSI3, + URN_T: URN} + NSMAP_R = invertDict(NSMAP) + + STMAP = {'1999': (XSD_T, XSI_T), '2000': (XSD2_T, XSI2_T), + '2001': (XSD3_T, XSI3_T)} + STMAP_R = invertDict(STMAP) + + def __init__(self): + raise Error, "Don't instantiate this" + + + diff --git a/SOAPpy/Parser.py b/SOAPpy/Parser.py new file mode 100644 index 00000000..93da26e7 --- /dev/null +++ b/SOAPpy/Parser.py @@ -0,0 +1,1092 @@ +# SOAPpy modules +from Config import Config +from Types import * +from NS import NS +from Utilities import * + +import string +import fpconst +import xml.sax +from wstools.XMLname import fromXMLname + +try: from M2Crypto import SSL +except: pass + +ident = '$Id: Parser.py 1497 2010-03-08 06:06:52Z pooryorick $' +from version import __version__ + + +################################################################################ +# SOAP Parser +################################################################################ +class RefHolder: + def __init__(self, name, frame): + self.name = name + self.parent = frame + self.pos = len(frame) + self.subpos = frame.namecounts.get(name, 0) + + def __repr__(self): + return "<%s %s at %d>" % (self.__class__, self.name, id(self)) + + def __str__(self): + return "<%s %s at %d>" % (self.__class__, self.name, id(self)) + +class SOAPParser(xml.sax.handler.ContentHandler): + class Frame: + def __init__(self, name, kind = None, attrs = {}, rules = {}): + self.name = name + self.kind = kind + self.attrs = attrs + self.rules = rules + + self.contents = [] + self.names = [] + self.namecounts = {} + self.subattrs = [] + + def append(self, name, data, attrs): + self.names.append(name) + self.contents.append(data) + self.subattrs.append(attrs) + + if self.namecounts.has_key(name): + self.namecounts[name] += 1 + else: + self.namecounts[name] = 1 + + def _placeItem(self, name, value, pos, subpos = 0, attrs = None): + self.contents[pos] = value + + if attrs: + self.attrs.update(attrs) + + def __len__(self): + return len(self.contents) + + def __repr__(self): + return "<%s %s at %d>" % (self.__class__, self.name, id(self)) + + def __init__(self, rules = None): + xml.sax.handler.ContentHandler.__init__(self) + self.body = None + self.header = None + self.attrs = {} + self._data = None + self._next = "E" # Keeping state for message validity + self._stack = [self.Frame('SOAP')] + + # Make two dictionaries to store the prefix <-> URI mappings, and + # initialize them with the default + self._prem = {NS.XML_T: NS.XML} + self._prem_r = {NS.XML: NS.XML_T} + self._ids = {} + self._refs = {} + self._rules = rules + + def startElementNS(self, name, qname, attrs): + + def toStr( name ): + prefix = name[0] + tag = name[1] + if self._prem_r.has_key(prefix): + tag = self._prem_r[name[0]] + ':' + name[1] + elif prefix: + tag = prefix + ":" + tag + return tag + + # Workaround two sax bugs + if name[0] == None and name[1][0] == ' ': + name = (None, name[1][1:]) + else: + name = tuple(name) + + # First some checking of the layout of the message + + if self._next == "E": + if name[1] != 'Envelope': + raise Error, "expected `SOAP-ENV:Envelope', " \ + "got `%s'" % toStr( name ) + if name[0] != NS.ENV: + raise faultType, ("%s:VersionMismatch" % NS.ENV_T, + "Don't understand version `%s' Envelope" % name[0]) + else: + self._next = "HorB" + elif self._next == "HorB": + if name[0] == NS.ENV and name[1] in ("Header", "Body"): + self._next = None + else: + raise Error, \ + "expected `SOAP-ENV:Header' or `SOAP-ENV:Body', " \ + "got `%s'" % toStr( name ) + elif self._next == "B": + if name == (NS.ENV, "Body"): + self._next = None + else: + raise Error, "expected `SOAP-ENV:Body', " \ + "got `%s'" % toStr( name ) + elif self._next == "": + raise Error, "expected nothing, " \ + "got `%s'" % toStr( name ) + + + if len(self._stack) == 2: + rules = self._rules + else: + try: + rules = self._stack[-1].rules[name[1]] + except: + rules = None + + if type(rules) not in (NoneType, DictType): + kind = rules + else: + kind = attrs.get((NS.ENC, 'arrayType')) + + if kind != None: + del attrs._attrs[(NS.ENC, 'arrayType')] + + i = kind.find(':') + if i >= 0: + try: + kind = (self._prem[kind[:i]], kind[i + 1:]) + except: + kind = None + else: + kind = None + + self.pushFrame(self.Frame(name[1], kind, attrs._attrs, rules)) + + self._data = [] # Start accumulating + + def pushFrame(self, frame): + self._stack.append(frame) + + def popFrame(self): + return self._stack.pop() + + def endElementNS(self, name, qname): + # Workaround two sax bugs + if name[0] == None and name[1][0] == ' ': + ns, name = None, name[1][1:] + else: + ns, name = tuple(name) + + name = fromXMLname(name) # convert to SOAP 1.2 XML name encoding + + if self._next == "E": + raise Error, "didn't get SOAP-ENV:Envelope" + if self._next in ("HorB", "B"): + raise Error, "didn't get SOAP-ENV:Body" + + cur = self.popFrame() + attrs = cur.attrs + + idval = None + + if attrs.has_key((None, 'id')): + idval = attrs[(None, 'id')] + + if self._ids.has_key(idval): + raise Error, "duplicate id `%s'" % idval + + del attrs[(None, 'id')] + + root = 1 + + if len(self._stack) == 3: + if attrs.has_key((NS.ENC, 'root')): + root = int(attrs[(NS.ENC, 'root')]) + + # Do some preliminary checks. First, if root="0" is present, + # the element must have an id. Next, if root="n" is present, + # n something other than 0 or 1, raise an exception. + + if root == 0: + if idval == None: + raise Error, "non-root element must have an id" + elif root != 1: + raise Error, "SOAP-ENC:root must be `0' or `1'" + + del attrs[(NS.ENC, 'root')] + + while 1: + href = attrs.get((None, 'href')) + if href: + if href[0] != '#': + raise Error, "Non-local hrefs are not yet suppported." + if self._data != None and \ + string.join(self._data, "").strip() != '': + raise Error, "hrefs can't have data" + + href = href[1:] + + if self._ids.has_key(href): + data = self._ids[href] + else: + data = RefHolder(name, self._stack[-1]) + + if self._refs.has_key(href): + self._refs[href].append(data) + else: + self._refs[href] = [data] + + del attrs[(None, 'href')] + + break + + kind = None + + if attrs: + for i in NS.XSI_L: + if attrs.has_key((i, 'type')): + kind = attrs[(i, 'type')] + del attrs[(i, 'type')] + + if kind != None: + i = kind.find(':') + if i >= 0: + try: + kind = (self._prem[kind[:i]], kind[i + 1:]) + except: + kind = (None, kind) + else: +# XXX What to do here? (None, kind) is just going to fail in convertType + #print "Kind with no NS:", kind + kind = (None, kind) + + null = 0 + + if attrs: + for i in (NS.XSI, NS.XSI2): + if attrs.has_key((i, 'null')): + null = attrs[(i, 'null')] + del attrs[(i, 'null')] + + if attrs.has_key((NS.XSI3, 'nil')): + null = attrs[(NS.XSI3, 'nil')] + del attrs[(NS.XSI3, 'nil')] + + + ## Check for nil + + # check for nil='true' + if type(null) in (StringType, UnicodeType): + if null.lower() == 'true': + null = 1 + + # check for nil=1, but watch out for string values + try: + null = int(null) + except ValueError, e: + if not e[0].startswith("invalid literal for int()"): + raise e + null = 0 + + if null: + if len(cur) or \ + (self._data != None and string.join(self._data, "").strip() != ''): + raise Error, "nils can't have data" + + data = None + + break + + if len(self._stack) == 2: + if (ns, name) == (NS.ENV, "Header"): + self.header = data = headerType(attrs = attrs) + self._next = "B" + break + elif (ns, name) == (NS.ENV, "Body"): + self.body = data = bodyType(attrs = attrs) + self._next = "" + break + elif len(self._stack) == 3 and self._next == None: + if (ns, name) == (NS.ENV, "Fault"): + data = faultType() + self._next = None # allow followons + break + + #print "\n" + #print "data=", self._data + #print "kind=", kind + #print "cur.kind=", cur.kind + #print "cur.rules=", cur.rules + #print "\n" + + + if cur.rules != None: + rule = cur.rules + + if type(rule) in (StringType, UnicodeType): + rule = (None, rule) # none flags special handling + elif type(rule) == ListType: + rule = tuple(rule) + + #print "kind=",kind + #print "rule=",rule + + +# XXX What if rule != kind? + if callable(rule): + data = rule(string.join(self._data, "")) + elif type(rule) == DictType: + data = structType(name = (ns, name), attrs = attrs) + elif rule[1][:9] == 'arrayType': + data = self.convertType(cur.contents, + rule, attrs) + else: + data = self.convertType(string.join(self._data, ""), + rule, attrs) + + break + + #print "No rules, using kind or cur.kind..." + + if (kind == None and cur.kind != None) or \ + (kind == (NS.ENC, 'Array')): + kind = cur.kind + + if kind == None: + kind = 'ur-type[%d]' % len(cur) + else: + kind = kind[1] + + if len(cur.namecounts) == 1: + elemsname = cur.names[0] + else: + elemsname = None + + data = self.startArray((ns, name), kind, attrs, elemsname) + + break + + if len(self._stack) == 3 and kind == None and \ + len(cur) == 0 and \ + (self._data == None or string.join(self._data, "").strip() == ''): + data = structType(name = (ns, name), attrs = attrs) + break + + if len(cur) == 0 and ns != NS.URN: + # Nothing's been added to the current frame so it must be a + # simple type. + +# print "cur:", cur +# print "ns:", ns +# print "attrs:", attrs +# print "kind:", kind + + + if kind == None: + # If the current item's container is an array, it will + # have a kind. If so, get the bit before the first [, + # which is the type of the array, therefore the type of + # the current item. + + kind = self._stack[-1].kind + + if kind != None: + i = kind[1].find('[') + if i >= 0: + kind = (kind[0], kind[1][:i]) + elif ns != None: + kind = (ns, name) + + if kind != None: + try: + data = self.convertType(string.join(self._data, ""), + kind, attrs) + except UnknownTypeError: + data = None + else: + data = None + + if data == None: + if self._data == None: + data = '' + else: + data = string.join(self._data, "") + + if len(attrs) == 0: + try: data = str(data) + except: pass + + break + + data = structType(name = (ns, name), attrs = attrs) + + break + + if isinstance(data, compoundType): + for i in range(len(cur)): + v = cur.contents[i] + data._addItem(cur.names[i], v, cur.subattrs[i]) + + if isinstance(v, RefHolder): + v.parent = data + + if root: + self._stack[-1].append(name, data, attrs) + + if idval != None: + self._ids[idval] = data + + if self._refs.has_key(idval): + for i in self._refs[idval]: + i.parent._placeItem(i.name, data, i.pos, i.subpos, attrs) + + del self._refs[idval] + + self.attrs[id(data)] = attrs + + if isinstance(data, anyType): + data._setAttrs(attrs) + + self._data = None # Stop accumulating + + def endDocument(self): + if len(self._refs) == 1: + raise Error, \ + "unresolved reference " + self._refs.keys()[0] + elif len(self._refs) > 1: + raise Error, \ + "unresolved references " + ', '.join(self._refs.keys()) + + def startPrefixMapping(self, prefix, uri): + self._prem[prefix] = uri + self._prem_r[uri] = prefix + + def endPrefixMapping(self, prefix): + try: + del self._prem_r[self._prem[prefix]] + del self._prem[prefix] + except: + pass + + def characters(self, c): + if self._data != None: + self._data.append(c) + + arrayre = '^(?:(?P[^:]*):)?' \ + '(?P[^[]+)' \ + '(?:\[(?P,*)\])?' \ + '(?:\[(?P\d+(?:,\d+)*)?\])$' + + def startArray(self, name, kind, attrs, elemsname): + if type(self.arrayre) == StringType: + self.arrayre = re.compile (self.arrayre) + + offset = attrs.get((NS.ENC, "offset")) + + if offset != None: + del attrs[(NS.ENC, "offset")] + + try: + if offset[0] == '[' and offset[-1] == ']': + offset = int(offset[1:-1]) + if offset < 0: + raise Exception + else: + raise Exception + except: + raise AttributeError, "invalid Array offset" + else: + offset = 0 + + try: + m = self.arrayre.search(kind) + + if m == None: + raise Exception + + t = m.group('type') + + if t == 'ur-type': + return arrayType(None, name, attrs, offset, m.group('rank'), + m.group('asize'), elemsname) + elif m.group('ns') != None: + return typedArrayType(None, name, + (self._prem[m.group('ns')], t), attrs, offset, + m.group('rank'), m.group('asize'), elemsname) + else: + return typedArrayType(None, name, (None, t), attrs, offset, + m.group('rank'), m.group('asize'), elemsname) + except: + raise AttributeError, "invalid Array type `%s'" % kind + + # Conversion + + class DATETIMECONSTS: + SIGNre = '(?P-?)' + CENTURYre = '(?P\d{2,})' + YEARre = '(?P\d{2})' + MONTHre = '(?P\d{2})' + DAYre = '(?P\d{2})' + HOURre = '(?P\d{2})' + MINUTEre = '(?P\d{2})' + SECONDre = '(?P\d{2}(?:\.\d*)?)' + TIMEZONEre = '(?PZ)|(?P[-+])(?P\d{2}):' \ + '(?P\d{2})' + BOSre = '^\s*' + EOSre = '\s*$' + + __allres = {'sign': SIGNre, 'century': CENTURYre, 'year': YEARre, + 'month': MONTHre, 'day': DAYre, 'hour': HOURre, + 'minute': MINUTEre, 'second': SECONDre, 'timezone': TIMEZONEre, + 'b': BOSre, 'e': EOSre} + + dateTime = '%(b)s%(sign)s%(century)s%(year)s-%(month)s-%(day)sT' \ + '%(hour)s:%(minute)s:%(second)s(%(timezone)s)?%(e)s' % __allres + timeInstant = dateTime + timePeriod = dateTime + time = '%(b)s%(hour)s:%(minute)s:%(second)s(%(timezone)s)?%(e)s' % \ + __allres + date = '%(b)s%(sign)s%(century)s%(year)s-%(month)s-%(day)s' \ + '(%(timezone)s)?%(e)s' % __allres + century = '%(b)s%(sign)s%(century)s(%(timezone)s)?%(e)s' % __allres + gYearMonth = '%(b)s%(sign)s%(century)s%(year)s-%(month)s' \ + '(%(timezone)s)?%(e)s' % __allres + gYear = '%(b)s%(sign)s%(century)s%(year)s(%(timezone)s)?%(e)s' % \ + __allres + year = gYear + gMonthDay = '%(b)s--%(month)s-%(day)s(%(timezone)s)?%(e)s' % __allres + recurringDate = gMonthDay + gDay = '%(b)s---%(day)s(%(timezone)s)?%(e)s' % __allres + recurringDay = gDay + gMonth = '%(b)s--%(month)s--(%(timezone)s)?%(e)s' % __allres + month = gMonth + + recurringInstant = '%(b)s%(sign)s(%(century)s|-)(%(year)s|-)-' \ + '(%(month)s|-)-(%(day)s|-)T' \ + '(%(hour)s|-):(%(minute)s|-):(%(second)s|-)' \ + '(%(timezone)s)?%(e)s' % __allres + + duration = '%(b)s%(sign)sP' \ + '((?P\d+)Y)?' \ + '((?P\d+)M)?' \ + '((?P\d+)D)?' \ + '((?PT)' \ + '((?P\d+)H)?' \ + '((?P\d+)M)?' \ + '((?P\d*(?:\.\d*)?)S)?)?%(e)s' % \ + __allres + + timeDuration = duration + + # The extra 31 on the front is: + # - so the tuple is 1-based + # - so months[month-1] is December's days if month is 1 + + months = (31, 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31) + + def convertDateTime(self, value, kind): + def getZoneOffset(d): + zoffs = 0 + + try: + if d['zulu'] == None: + zoffs = 60 * int(d['tzhour']) + int(d['tzminute']) + if d['tzsign'] != '-': + zoffs = -zoffs + except TypeError: + pass + + return zoffs + + def applyZoneOffset(months, zoffs, date, minfield, posday = 1): + if zoffs == 0 and (minfield > 4 or 0 <= date[5] < 60): + return date + + if minfield > 5: date[5] = 0 + if minfield > 4: date[4] = 0 + + if date[5] < 0: + date[4] += int(date[5]) / 60 + date[5] %= 60 + + date[4] += zoffs + + if minfield > 3 or 0 <= date[4] < 60: return date + + date[3] += date[4] / 60 + date[4] %= 60 + + if minfield > 2 or 0 <= date[3] < 24: return date + + date[2] += date[3] / 24 + date[3] %= 24 + + if minfield > 1: + if posday and date[2] <= 0: + date[2] += 31 # zoffs is at most 99:59, so the + # day will never be less than -3 + return date + + while 1: + # The date[1] == 3 (instead of == 2) is because we're + # going back a month, so we need to know if the previous + # month is February, so we test if this month is March. + + leap = minfield == 0 and date[1] == 3 and \ + date[0] % 4 == 0 and \ + (date[0] % 100 != 0 or date[0] % 400 == 0) + + if 0 < date[2] <= months[date[1]] + leap: break + + date[2] += months[date[1] - 1] + leap + + date[1] -= 1 + + if date[1] > 0: break + + date[1] = 12 + + if minfield > 0: break + + date[0] -= 1 + + return date + + try: + exp = getattr(self.DATETIMECONSTS, kind) + except AttributeError: + return None + + if type(exp) == StringType: + exp = re.compile(exp) + setattr (self.DATETIMECONSTS, kind, exp) + + m = exp.search(value) + + try: + if m == None: + raise Exception + + d = m.groupdict() + f = ('century', 'year', 'month', 'day', + 'hour', 'minute', 'second') + fn = len(f) # Index of first non-None value + r = [] + + if kind in ('duration', 'timeDuration'): + if d['sep'] != None and d['hour'] == None and \ + d['minute'] == None and d['second'] == None: + raise Exception + + f = f[1:] + + for i in range(len(f)): + s = d[f[i]] + + if s != None: + if f[i] == 'second': + s = float(s) + else: + try: s = int(s) + except ValueError: s = long(s) + + if i < fn: fn = i + + r.append(s) + + if fn > len(r): # Any non-Nones? + raise Exception + + if d['sign'] == '-': + r[fn] = -r[fn] + + return tuple(r) + + if kind == 'recurringInstant': + for i in range(len(f)): + s = d[f[i]] + + if s == None or s == '-': + if i > fn: + raise Exception + s = None + else: + if i < fn: + fn = i + + if f[i] == 'second': + s = float(s) + else: + try: + s = int(s) + except ValueError: + s = long(s) + + r.append(s) + + s = r.pop(0) + + if fn == 0: + r[0] += s * 100 + else: + fn -= 1 + + if fn < len(r) and d['sign'] == '-': + r[fn] = -r[fn] + + cleanDate(r, fn) + + return tuple(applyZoneOffset(self.DATETIMECONSTS.months, + getZoneOffset(d), r, fn, 0)) + + r = [0, 0, 1, 1, 0, 0, 0] + + for i in range(len(f)): + field = f[i] + + s = d.get(field) + + if s != None: + if field == 'second': + s = float(s) + else: + try: + s = int(s) + except ValueError: + s = long(s) + + if i < fn: + fn = i + + r[i] = s + + if fn > len(r): # Any non-Nones? + raise Exception + + s = r.pop(0) + + if fn == 0: + r[0] += s * 100 + else: + fn -= 1 + + if d.get('sign') == '-': + r[fn] = -r[fn] + + cleanDate(r, fn) + + zoffs = getZoneOffset(d) + + if zoffs: + r = applyZoneOffset(self.DATETIMECONSTS.months, zoffs, r, fn) + + if kind == 'century': + return r[0] / 100 + + s = [] + + for i in range(1, len(f)): + if d.has_key(f[i]): + s.append(r[i - 1]) + + if len(s) == 1: + return s[0] + return tuple(s) + except Exception, e: + raise Error, "invalid %s value `%s' - %s" % (kind, value, e) + + intlimits = \ + { + 'nonPositiveInteger': (0, None, 0), + 'non-positive-integer': (0, None, 0), + 'negativeInteger': (0, None, -1), + 'negative-integer': (0, None, -1), + 'long': (1, -9223372036854775808L, + 9223372036854775807L), + 'int': (0, -2147483648L, 2147483647L), + 'short': (0, -32768, 32767), + 'byte': (0, -128, 127), + 'nonNegativeInteger': (0, 0, None), + 'non-negative-integer': (0, 0, None), + 'positiveInteger': (0, 1, None), + 'positive-integer': (0, 1, None), + 'unsignedLong': (1, 0, 18446744073709551615L), + 'unsignedInt': (0, 0, 4294967295L), + 'unsignedShort': (0, 0, 65535), + 'unsignedByte': (0, 0, 255), + } + floatlimits = \ + { + 'float': (7.0064923216240861E-46, -3.4028234663852886E+38, + 3.4028234663852886E+38), + 'double': (2.4703282292062327E-324, -1.7976931348623158E+308, + 1.7976931348623157E+308), + } + zerofloatre = '[1-9]' + + + def convertType(self, d, t, attrs, config=Config): + if t[0] is None and t[1] is not None: + type = t[1].strip() + if type[:9] == 'arrayType': + index_eq = type.find('=') + index_obr = type.find('[') + index_cbr = type.find(']') + elemtype = type[index_eq+1:index_obr] + elemnum = type[index_obr+1:index_cbr] + if elemtype=="ur-type": + return(d) + else: + newarr = map( lambda(di): + self.convertToBasicTypes(d=di, + t = ( NS.XSD, elemtype), + attrs=attrs, + config=config), + d) + return newarr + else: + t = (NS.XSD, t[1]) + + return self.convertToBasicTypes(d, t, attrs, config) + + + def convertToSOAPpyTypes(self, d, t, attrs, config=Config): + pass + + + def convertToBasicTypes(self, d, t, attrs, config=Config): + dnn = d or '' + + #if Config.debug: + #print "convertToBasicTypes:" + #print " requested_type=", t + #print " data=", d + + +# print "convertToBasicTypes:" +# print " requested_type=", t +# print " data=", d +# print " attrs=", attrs +# print " t[0]=", t[0] +# print " t[1]=", t[1] + +# print " in?", t[0] in NS.EXSD_L + + if t[0] in NS.EXSD_L: + if t[1]=="integer": # unbounded integer type + try: + d = int(d) + if len(attrs): + d = long(d) + except: + d = long(d) + return d + if self.intlimits.has_key (t[1]): # range-bounded integer types + l = self.intlimits[t[1]] + try: d = int(d) + except: d = long(d) + + if l[1] != None and d < l[1]: + raise UnderflowError, "%s too small" % d + if l[2] != None and d > l[2]: + raise OverflowError, "%s too large" % d + + if l[0] or len(attrs): + return long(d) + return d + if t[1] == "string": + if len(attrs): + return unicode(dnn) + try: + return str(dnn) + except: + return dnn + if t[1] in ("bool", "boolean"): + d = d.strip().lower() + if d in ('0', 'false'): + return False + if d in ('1', 'true'): + return True + raise AttributeError, "invalid boolean value" + if t[1] in ('double','float'): + l = self.floatlimits[t[1]] + s = d.strip().lower() + + # Explicitly check for NaN and Infinities + if s == "nan": + d = fpconst.NaN + elif s[0:2]=="inf" or s[0:3]=="+inf": + d = fpconst.PosInf + elif s[0:3] == "-inf": + d = fpconst.NegInf + else : + d = float(s) + + if config.strict_range: + if fpconst.isNaN(d): + if s[0:2] != 'nan': + raise ValueError, "invalid %s: %s" % (t[1], s) + elif fpconst.isNegInf(d): + if s[0:3] != '-inf': + raise UnderflowError, "%s too small: %s" % (t[1], s) + elif fpconst.isPosInf(d): + if s[0:2] != 'inf' and s[0:3] != '+inf': + raise OverflowError, "%s too large: %s" % (t[1], s) + elif d < 0 and d < l[1]: + raise UnderflowError, "%s too small: %s" % (t[1], s) + elif d > 0 and ( d < l[0] or d > l[2] ): + raise OverflowError, "%s too large: %s" % (t[1], s) + elif d == 0: + if type(self.zerofloatre) == StringType: + self.zerofloatre = re.compile(self.zerofloatre) + + if self.zerofloatre.search(s): + raise UnderflowError, "invalid %s: %s" % (t[1], s) + return d + + if t[1] in ("dateTime", "date", "timeInstant", "time"): + return self.convertDateTime(d, t[1]) + if t[1] == "decimal": + return float(d) + if t[1] in ("language", "QName", "NOTATION", "NMTOKEN", "Name", + "NCName", "ID", "IDREF", "ENTITY"): + return collapseWhiteSpace(d) + if t[1] in ("IDREFS", "ENTITIES", "NMTOKENS"): + d = collapseWhiteSpace(d) + return d.split() + if t[0] in NS.XSD_L: + if t[1] in ("base64", "base64Binary"): + if d: + return base64.decodestring(d) + else: + return '' + if t[1] == "hexBinary": + if d: + return decodeHexString(d) + else: + return + if t[1] == "anyURI": + return urllib.unquote(collapseWhiteSpace(d)) + if t[1] in ("normalizedString", "token"): + return collapseWhiteSpace(d) + if t[0] == NS.ENC: + if t[1] == "base64": + if d: + return base64.decodestring(d) + else: + return '' + if t[0] == NS.XSD: + if t[1] == "binary": + try: + e = attrs[(None, 'encoding')] + + if d: + if e == 'hex': + return decodeHexString(d) + elif e == 'base64': + return base64.decodestring(d) + else: + return '' + except: + pass + + raise Error, "unknown or missing binary encoding" + if t[1] == "uri": + return urllib.unquote(collapseWhiteSpace(d)) + if t[1] == "recurringInstant": + return self.convertDateTime(d, t[1]) + if t[0] in (NS.XSD2, NS.ENC): + if t[1] == "uriReference": + return urllib.unquote(collapseWhiteSpace(d)) + if t[1] == "timePeriod": + return self.convertDateTime(d, t[1]) + if t[1] in ("century", "year"): + return self.convertDateTime(d, t[1]) + if t[0] in (NS.XSD, NS.XSD2, NS.ENC): + if t[1] == "timeDuration": + return self.convertDateTime(d, t[1]) + if t[0] == NS.XSD3: + if t[1] == "anyURI": + return urllib.unquote(collapseWhiteSpace(d)) + if t[1] in ("gYearMonth", "gMonthDay"): + return self.convertDateTime(d, t[1]) + if t[1] == "gYear": + return self.convertDateTime(d, t[1]) + if t[1] == "gMonth": + return self.convertDateTime(d, t[1]) + if t[1] == "gDay": + return self.convertDateTime(d, t[1]) + if t[1] == "duration": + return self.convertDateTime(d, t[1]) + if t[0] in (NS.XSD2, NS.XSD3): + if t[1] == "token": + return collapseWhiteSpace(d) + if t[1] == "recurringDate": + return self.convertDateTime(d, t[1]) + if t[1] == "month": + return self.convertDateTime(d, t[1]) + if t[1] == "recurringDay": + return self.convertDateTime(d, t[1]) + if t[0] == NS.XSD2: + if t[1] == "CDATA": + return collapseWhiteSpace(d) + + raise UnknownTypeError, "unknown type `%s'" % (str(t[0]) + ':' + t[1]) + + +################################################################################ +# call to SOAPParser that keeps all of the info +################################################################################ +def _parseSOAP(xml_str, rules = None): + try: + from cStringIO import StringIO + except ImportError: + from StringIO import StringIO + + parser = xml.sax.make_parser() + t = SOAPParser(rules = rules) + parser.setContentHandler(t) + e = xml.sax.handler.ErrorHandler() + parser.setErrorHandler(e) + + inpsrc = xml.sax.xmlreader.InputSource() + inpsrc.setByteStream(StringIO(xml_str)) + + # turn on namespace mangeling + parser.setFeature(xml.sax.handler.feature_namespaces,1) + + try: + parser.parse(inpsrc) + except xml.sax.SAXParseException, e: + parser._parser = None + raise e + + return t + +################################################################################ +# SOAPParser's more public interface +################################################################################ +def parseSOAP(xml_str, attrs = 0): + t = _parseSOAP(xml_str) + + if attrs: + return t.body, t.attrs + return t.body + + +def parseSOAPRPC(xml_str, header = 0, body = 0, attrs = 0, rules = None): + + t = _parseSOAP(xml_str, rules = rules) + p = t.body[0] + + # Empty string, for RPC this translates into a void + if type(p) in (type(''), type(u'')) and p in ('', u''): + name = "Response" + for k in t.body.__dict__.keys(): + if k[0] != "_": + name = k + p = structType(name) + + if header or body or attrs: + ret = (p,) + if header : ret += (t.header,) + if body: ret += (t.body,) + if attrs: ret += (t.attrs,) + return ret + else: + return p diff --git a/SOAPpy/SOAP.py b/SOAPpy/SOAP.py new file mode 100644 index 00000000..b1975075 --- /dev/null +++ b/SOAPpy/SOAP.py @@ -0,0 +1,40 @@ +"""This file is here for backward compatibility with versions <= 0.9.9 + +Delete when 1.0.0 is released! +""" + +ident = '$Id: SOAP.py 541 2004-01-31 04:20:06Z warnes $' +from version import __version__ + +from Client import * +from Config import * +from Errors import * +from NS import * +from Parser import * +from SOAPBuilder import * +from Server import * +from Types import * +from Utilities import * +import wstools +import WSDL + +from warnings import warn + +warn(""" + +The sub-module SOAPpy.SOAP is deprecated and is only +provided for short-term backward compatibility. Objects are now +available directly within the SOAPpy module. Thus, instead of + + from SOAPpy import SOAP + ... + SOAP.SOAPProxy(...) + +use + + from SOAPpy import SOAPProxy + ... + SOAPProxy(...) + +instead. +""", DeprecationWarning) diff --git a/SOAPpy/SOAPBuilder.py b/SOAPpy/SOAPBuilder.py new file mode 100755 index 00000000..f2eaee2d --- /dev/null +++ b/SOAPpy/SOAPBuilder.py @@ -0,0 +1,648 @@ +""" +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: SOAPBuilder.py 1498 2010-03-12 02:13:19Z pooryorick $' +from version import __version__ + +import cgi +from wstools.XMLname import toXMLname, fromXMLname +import fpconst + +# SOAPpy modules +from Config import Config +from NS import NS +from Types import * + +# Test whether this Python version has Types.BooleanType +# If it doesn't have it, then False and True are serialized as integers +try: + BooleanType + pythonHasBooleanType = 1 +except NameError: + pythonHasBooleanType = 0 + +################################################################################ +# SOAP Builder +################################################################################ +class SOAPBuilder: + _xml_top = '\n' + _xml_enc_top = '\n' + _env_top = ( '%(ENV_T)s:Envelope\n' + \ + ' %(ENV_T)s:encodingStyle="%(ENC)s"\n' ) % \ + NS.__dict__ + _env_bot = '\n' % NS.__dict__ + + # Namespaces potentially defined in the Envelope tag. + + _env_ns = {NS.ENC: NS.ENC_T, NS.ENV: NS.ENV_T, + NS.XSD: NS.XSD_T, NS.XSD2: NS.XSD2_T, NS.XSD3: NS.XSD3_T, + NS.XSI: NS.XSI_T, NS.XSI2: NS.XSI2_T, NS.XSI3: NS.XSI3_T} + + def __init__(self, args = (), kw = {}, method = None, namespace = None, + header = None, methodattrs = None, envelope = 1, encoding = 'UTF-8', + use_refs = 0, config = Config, noroot = 0): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + self.args = args + self.kw = kw + self.envelope = envelope + self.encoding = encoding + self.method = method + self.namespace = namespace + self.header = header + self.methodattrs= methodattrs + self.use_refs = use_refs + self.config = config + self.out = [] + self.tcounter = 0 + self.ncounter = 1 + self.icounter = 1 + self.envns = {} + self.ids = {} + self.depth = 0 + self.multirefs = [] + self.multis = 0 + self.body = not isinstance(args, bodyType) + self.noroot = noroot + + def build(self): + if Config.debug: print "In build." + ns_map = {} + + # Cache whether typing is on or not + typed = self.config.typed + + if self.header: + # Create a header. + self.dump(self.header, "Header", typed = typed) + #self.header = None # Wipe it out so no one is using it. + + if self.body: + # Call genns to record that we've used SOAP-ENV. + self.depth += 1 + body_ns = self.genns(ns_map, NS.ENV)[0] + self.out.append("<%sBody>\n" % body_ns) + + if self.method: + # Save the NS map so that it can be restored when we + # fall out of the scope of the method definition + save_ns_map = ns_map.copy() + self.depth += 1 + a = '' + if self.methodattrs: + for (k, v) in self.methodattrs.items(): + a += ' %s="%s"' % (k, v) + + if self.namespace: # Use the namespace info handed to us + methodns, n = self.genns(ns_map, self.namespace) + else: + methodns, n = '', '' + + self.out.append('<%s%s%s%s%s>\n' % ( + methodns, self.method, n, a, self.genroot(ns_map))) + + try: + if type(self.args) != TupleType: + args = (self.args,) + else: + args = self.args + + for i in args: + self.dump(i, typed = typed, ns_map = ns_map) + + if hasattr(self.config, "argsOrdering") and self.config.argsOrdering.has_key(self.method): + for k in self.config.argsOrdering.get(self.method): + self.dump(self.kw.get(k), k, typed = typed, ns_map = ns_map) + else: + for (k, v) in self.kw.items(): + self.dump(v, k, typed = typed, ns_map = ns_map) + + except RecursionError: + if self.use_refs == 0: + # restart + b = SOAPBuilder(args = self.args, kw = self.kw, + method = self.method, namespace = self.namespace, + header = self.header, methodattrs = self.methodattrs, + envelope = self.envelope, encoding = self.encoding, + use_refs = 1, config = self.config) + return b.build() + raise + + if self.method: + self.out.append("\n" % (methodns, self.method)) + # End of the method definition; drop any local namespaces + ns_map = save_ns_map + self.depth -= 1 + + if self.body: + # dump may add to self.multirefs, but the for loop will keep + # going until it has used all of self.multirefs, even those + # entries added while in the loop. + + self.multis = 1 + + for obj, tag in self.multirefs: + self.dump(obj, tag, typed = typed, ns_map = ns_map) + + self.out.append("\n" % body_ns) + self.depth -= 1 + + if self.envelope: + e = map (lambda ns: ' xmlns:%s="%s"\n' % (ns[1], ns[0]), + self.envns.items()) + + self.out = ['<', self._env_top] + e + ['>\n'] + \ + self.out + \ + [self._env_bot] + + if self.encoding != None: + self.out.insert(0, self._xml_enc_top % self.encoding) + return ''.join(self.out).encode(self.encoding) + + self.out.insert(0, self._xml_top) + return ''.join(self.out) + + def gentag(self): + if Config.debug: print "In gentag." + self.tcounter += 1 + return "v%d" % self.tcounter + + def genns(self, ns_map, nsURI): + if nsURI == None: + return ('', '') + + if type(nsURI) == TupleType: # already a tuple + if len(nsURI) == 2: + ns, nsURI = nsURI + else: + ns, nsURI = None, nsURI[0] + else: + ns = None + + if ns_map.has_key(nsURI): + return (ns_map[nsURI] + ':', '') + + if self._env_ns.has_key(nsURI): + ns = self.envns[nsURI] = ns_map[nsURI] = self._env_ns[nsURI] + return (ns + ':', '') + + if not ns: + ns = "ns%d" % self.ncounter + self.ncounter += 1 + ns_map[nsURI] = ns + if self.config.buildWithNamespacePrefix: + return (ns + ':', ' xmlns:%s="%s"' % (ns, nsURI)) + else: + return ('', ' xmlns="%s"' % (nsURI)) + + def genroot(self, ns_map): + if self.noroot: + return '' + + if self.depth != 2: + return '' + + ns, n = self.genns(ns_map, NS.ENC) + return ' %sroot="%d"%s' % (ns, not self.multis, n) + + # checkref checks an element to see if it needs to be encoded as a + # multi-reference element or not. If it returns None, the element has + # been handled and the caller can continue with subsequent elements. + # If it returns a string, the string should be included in the opening + # tag of the marshaled element. + + def checkref(self, obj, tag, ns_map): + if self.depth < 2: + return '' + + if not self.ids.has_key(id(obj)): + n = self.ids[id(obj)] = self.icounter + self.icounter = n + 1 + + if self.use_refs == 0: + return '' + + if self.depth == 2: + return ' id="i%d"' % n + + self.multirefs.append((obj, tag)) + else: + if self.use_refs == 0: + raise RecursionError, "Cannot serialize recursive object" + + n = self.ids[id(obj)] + + if self.multis and self.depth == 2: + return ' id="i%d"' % n + + self.out.append('<%s href="#i%d"%s/>\n' % + (tag, n, self.genroot(ns_map))) + return None + + # dumpers + + def dump(self, obj, tag = None, typed = 1, ns_map = {}): + if Config.debug: print "In dump.", "obj=", obj + ns_map = ns_map.copy() + self.depth += 1 + + if type(tag) not in (NoneType, StringType, UnicodeType): + raise KeyError, "tag must be a string or None" + + self.dump_dispatch(obj, tag, typed, ns_map) + self.depth -= 1 + + # generic dumper + def dumper(self, nsURI, obj_type, obj, tag, typed = 1, ns_map = {}, + rootattr = '', id = '', + xml = '<%(tag)s%(type)s%(id)s%(attrs)s%(root)s>%(data)s\n'): + if Config.debug: print "In dumper." + + if nsURI == None: + nsURI = self.config.typesNamespaceURI + + tag = tag or self.gentag() + + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + + a = n = t = '' + if typed and obj_type: + ns, n = self.genns(ns_map, nsURI) + ins = self.genns(ns_map, self.config.schemaNamespaceURI)[0] + t = ' %stype="%s%s"%s' % (ins, ns, obj_type, n) + + try: a = obj._marshalAttrs(ns_map, self) + except: pass + + try: data = obj._marshalData() + except: + if (obj_type != "string"): # strings are already encoded + data = cgi.escape(str(obj)) + else: + data = obj + + + + return xml % {"tag": tag, "type": t, "data": data, "root": rootattr, + "id": id, "attrs": a} + + def dump_float(self, obj, tag, typed = 1, ns_map = {}): + if Config.debug: print "In dump_float." + tag = tag or self.gentag() + + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + + if Config.strict_range: + doubleType(obj) + + if fpconst.isPosInf(obj): + obj = "INF" + elif fpconst.isNegInf(obj): + obj = "-INF" + elif fpconst.isNaN(obj): + obj = "NaN" + else: + obj = repr(obj) + + # Note: python 'float' is actually a SOAP 'double'. + self.out.append(self.dumper( + None, "double", obj, tag, typed, ns_map, self.genroot(ns_map))) + + def dump_int(self, obj, tag, typed = 1, ns_map = {}): + if Config.debug: print "In dump_int." + self.out.append(self.dumper(None, 'integer', obj, tag, typed, + ns_map, self.genroot(ns_map))) + + def dump_bool(self, obj, tag, typed = 1, ns_map = {}): + if Config.debug: print "In dump_bool." + self.out.append(self.dumper(None, 'boolean', obj, tag, typed, + ns_map, self.genroot(ns_map))) + + def dump_string(self, obj, tag, typed = 0, ns_map = {}): + if Config.debug: print "In dump_string." + tag = tag or self.gentag() + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + + id = self.checkref(obj, tag, ns_map) + if id == None: + return + + try: data = obj._marshalData() + except: data = obj + + self.out.append(self.dumper(None, "string", cgi.escape(data), tag, + typed, ns_map, self.genroot(ns_map), id)) + + dump_str = dump_string # For Python 2.2+ + dump_unicode = dump_string + + def dump_None(self, obj, tag, typed = 0, ns_map = {}): + if Config.debug: print "In dump_None." + tag = tag or self.gentag() + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + ns = self.genns(ns_map, self.config.schemaNamespaceURI)[0] + + self.out.append('<%s %snull="1"%s/>\n' % + (tag, ns, self.genroot(ns_map))) + + dump_NoneType = dump_None # For Python 2.2+ + + def dump_list(self, obj, tag, typed = 1, ns_map = {}): + if Config.debug: print "In dump_list.", "obj=", obj + tag = tag or self.gentag() + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + + if type(obj) == InstanceType: + data = obj.data + else: + data = obj + + if typed: + id = self.checkref(obj, tag, ns_map) + if id == None: + return + + try: + sample = data[0] + empty = 0 + except: + # preserve type if present + if getattr(obj,"_typed",None) and getattr(obj,"_type",None): + if getattr(obj, "_complexType", None): + sample = typedArrayType(typed=obj._type, + complexType = obj._complexType) + sample._typename = obj._type + if not getattr(obj,"_ns",None): obj._ns = NS.URN + else: + sample = typedArrayType(typed=obj._type) + else: + sample = structType() + empty = 1 + + # First scan list to see if all are the same type + same_type = 1 + + if not empty: + for i in data[1:]: + if type(sample) != type(i) or \ + (type(sample) == InstanceType and \ + sample.__class__ != i.__class__): + same_type = 0 + break + + ndecl = '' + if same_type: + if (isinstance(sample, structType)) or \ + type(sample) == DictType or \ + (isinstance(sample, anyType) and \ + (getattr(sample, "_complexType", None) and \ + sample._complexType)): # force to urn struct + try: + tns = obj._ns or NS.URN + except: + tns = NS.URN + + ns, ndecl = self.genns(ns_map, tns) + + try: + typename = sample._typename + except: + typename = "SOAPStruct" + + t = ns + typename + + elif isinstance(sample, anyType): + ns = sample._validNamespaceURI(self.config.typesNamespaceURI, + self.config.strictNamespaces) + if ns: + ns, ndecl = self.genns(ns_map, ns) + t = ns + str(sample._type) + else: + t = 'ur-type' + else: + typename = type(sample).__name__ + + # For Python 2.2+ + if type(sample) == StringType: typename = 'string' + + # HACK: unicode is a SOAP string + if type(sample) == UnicodeType: typename = 'string' + + # HACK: python 'float' is actually a SOAP 'double'. + if typename=="float": typename="double" + t = self.genns( + ns_map, self.config.typesNamespaceURI)[0] + typename + + else: + t = self.genns(ns_map, self.config.typesNamespaceURI)[0] + \ + "ur-type" + + try: a = obj._marshalAttrs(ns_map, self) + except: a = '' + + ens, edecl = self.genns(ns_map, NS.ENC) + ins, idecl = self.genns(ns_map, self.config.schemaNamespaceURI) + + if typed: + self.out.append( + '<%s %sarrayType="%s[%d]" %stype="%sArray"%s%s%s%s%s%s>\n' % + (tag, ens, t, len(data), ins, ens, ndecl, edecl, idecl, + self.genroot(ns_map), id, a)) + + if typed: + try: elemsname = obj._elemsname + except: elemsname = "item" + else: + elemsname = tag + + if isinstance(data, (list, tuple, arrayType)): + should_drill = True + else: + should_drill = not same_type + + for i in data: + self.dump(i, elemsname, should_drill, ns_map) + + if typed: self.out.append('\n' % tag) + + dump_tuple = dump_list + + def dump_exception(self, obj, tag, typed = 0, ns_map = {}): + if isinstance(obj, faultType): # Fault + cns, cdecl = self.genns(ns_map, NS.ENC) + vns, vdecl = self.genns(ns_map, NS.ENV) + self.out.append('<%sFault %sroot="1"%s%s>' % (vns, cns, vdecl, cdecl)) + self.dump(obj.faultcode, "faultcode", typed, ns_map) + self.dump(obj.faultstring, "faultstring", typed, ns_map) + if hasattr(obj, "detail"): + self.dump(obj.detail, "detail", typed, ns_map) + self.out.append("\n" % vns) + + def dump_dictionary(self, obj, tag, typed = 1, ns_map = {}): + if Config.debug: print "In dump_dictionary." + tag = tag or self.gentag() + tag = toXMLname(tag) # convert from SOAP 1.2 XML name encoding + + id = self.checkref(obj, tag, ns_map) + if id == None: + return + + try: a = obj._marshalAttrs(ns_map, self) + except: a = '' + + self.out.append('<%s%s%s%s>\n' % + (tag, id, a, self.genroot(ns_map))) + + for (k, v) in obj.items(): + if k[0] != "_": + self.dump(v, k, 1, ns_map) + + self.out.append('\n' % tag) + + dump_dict = dump_dictionary # For Python 2.2+ + + def dump_dispatch(self, obj, tag, typed = 1, ns_map = {}): + if not tag: + # If it has a name use it. + if isinstance(obj, anyType) and obj._name: + tag = obj._name + else: + tag = self.gentag() + + # watch out for order! + dumpmap = ( + (Exception, self.dump_exception), + (arrayType, self.dump_list), + (basestring, self.dump_string), + (NoneType, self.dump_None), + (bool, self.dump_bool), + (int, self.dump_int), + (long, self.dump_int), + (list, self.dump_list), + (tuple, self.dump_list), + (dict, self.dump_dictionary), + (float, self.dump_float), + ) + for dtype, func in dumpmap: + if isinstance(obj, dtype): + func(obj, tag, typed, ns_map) + return + + r = self.genroot(ns_map) + + try: a = obj._marshalAttrs(ns_map, self) + except: a = '' + + if isinstance(obj, voidType): # void + self.out.append("<%s%s%s>\n" % (tag, a, r, tag)) + else: + id = self.checkref(obj, tag, ns_map) + if id == None: + return + + if isinstance(obj, structType): + # Check for namespace + ndecl = '' + ns = obj._validNamespaceURI(self.config.typesNamespaceURI, + self.config.strictNamespaces) + if ns: + ns, ndecl = self.genns(ns_map, ns) + tag = ns + tag + self.out.append("<%s%s%s%s%s>\n" % (tag, ndecl, id, a, r)) + + keylist = obj.__dict__.keys() + + # first write out items with order information + if hasattr(obj, '_keyord'): + for i in range(len(obj._keyord)): + self.dump(obj._aslist(i), obj._keyord[i], 1, ns_map) + keylist.remove(obj._keyord[i]) + + # now write out the rest + for k in keylist: + if (k[0] != "_"): + self.dump(getattr(obj,k), k, 1, ns_map) + + if isinstance(obj, bodyType): + self.multis = 1 + + for v, k in self.multirefs: + self.dump(v, k, typed = typed, ns_map = ns_map) + + self.out.append('\n' % tag) + + elif isinstance(obj, anyType): + t = '' + + if typed: + ns = obj._validNamespaceURI(self.config.typesNamespaceURI, + self.config.strictNamespaces) + if ns: + ons, ondecl = self.genns(ns_map, ns) + ins, indecl = self.genns(ns_map, + self.config.schemaNamespaceURI) + t = ' %stype="%s%s"%s%s' % \ + (ins, ons, obj._type, ondecl, indecl) + + self.out.append('<%s%s%s%s%s>%s\n' % + (tag, t, id, a, r, obj._marshalData(), tag)) + + else: # Some Class + self.out.append('<%s%s%s>\n' % (tag, id, r)) + + d1 = getattr(obj, '__dict__', None) + if d1 is not None: + for (k, v) in d1: + if k[0] != "_": + self.dump(v, k, 1, ns_map) + + self.out.append('\n' % tag) + + + +################################################################################ +# SOAPBuilder's more public interface +################################################################################ + +def buildSOAP(args=(), kw={}, method=None, namespace=None, + header=None, methodattrs=None, envelope=1, encoding='UTF-8', + config=Config, noroot = 0): + t = SOAPBuilder(args=args, kw=kw, method=method, namespace=namespace, + header=header, methodattrs=methodattrs,envelope=envelope, + encoding=encoding, config=config,noroot=noroot) + return t.build() diff --git a/SOAPpy/Server.py b/SOAPpy/Server.py new file mode 100644 index 00000000..a01a1055 --- /dev/null +++ b/SOAPpy/Server.py @@ -0,0 +1,706 @@ +from __future__ import nested_scopes + +""" +################################################################################ +# +# SOAPpy - Cayce Ullman (cayce@actzero.com) +# Brian Matthews (blm@actzero.com) +# Gregory Warnes (Gregory.R.Warnes@Pfizer.com) +# Christopher Blunck (blunck@gst.com) +# +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: Server.py 1468 2008-05-24 01:55:33Z warnes $' +from version import __version__ + +#import xml.sax +import socket +import sys +import SocketServer +from types import * +import BaseHTTPServer +import thread + +# SOAPpy modules +from Parser import parseSOAPRPC +from Config import Config +from Types import faultType, voidType, simplify +from NS import NS +from SOAPBuilder import buildSOAP +from Utilities import debugHeader, debugFooter + +try: from M2Crypto import SSL +except: pass + +ident = '$Id: Server.py 1468 2008-05-24 01:55:33Z warnes $' + +from version import __version__ + +################################################################################ +# Call context dictionary +################################################################################ + +_contexts = dict() + +def GetSOAPContext(): + global _contexts + return _contexts[thread.get_ident()] + +################################################################################ +# Server +################################################################################ + +# Method Signature class for adding extra info to registered funcs, right now +# used just to indicate it should be called with keywords, instead of ordered +# params. +class MethodSig: + def __init__(self, func, keywords=0, context=0): + self.func = func + self.keywords = keywords + self.context = context + self.__name__ = func.__name__ + + def __call__(self, *args, **kw): + return apply(self.func,args,kw) + +class SOAPContext: + def __init__(self, header, body, attrs, xmldata, connection, httpheaders, + soapaction): + + self.header = header + self.body = body + self.attrs = attrs + self.xmldata = xmldata + self.connection = connection + self.httpheaders= httpheaders + self.soapaction = soapaction + +# A class to describe how header messages are handled +class HeaderHandler: + # Initially fail out if there are any problems. + def __init__(self, header, attrs): + for i in header.__dict__.keys(): + if i[0] == "_": + continue + + d = getattr(header, i) + + try: + fault = int(attrs[id(d)][(NS.ENV, 'mustUnderstand')]) + except: + fault = 0 + + if fault: + raise faultType, ("%s:MustUnderstand" % NS.ENV_T, + "Required Header Misunderstood", + "%s" % i) + +################################################################################ +# SOAP Server +################################################################################ +class SOAPServerBase: + + def get_request(self): + sock, addr = SocketServer.TCPServer.get_request(self) + + if self.ssl_context: + sock = SSL.Connection(self.ssl_context, sock) + sock._setup_ssl(addr) + if sock.accept_ssl() != 1: + raise socket.error, "Couldn't accept SSL connection" + + return sock, addr + + def registerObject(self, object, namespace = '', path = ''): + if namespace == '' and path == '': namespace = self.namespace + if namespace == '' and path != '': + namespace = path.replace("/", ":") + if namespace[0] == ":": namespace = namespace[1:] + self.objmap[namespace] = object + + def registerFunction(self, function, namespace = '', funcName = None, + path = ''): + if not funcName : funcName = function.__name__ + if namespace == '' and path == '': namespace = self.namespace + if namespace == '' and path != '': + namespace = path.replace("/", ":") + if namespace[0] == ":": namespace = namespace[1:] + if self.funcmap.has_key(namespace): + self.funcmap[namespace][funcName] = function + else: + self.funcmap[namespace] = {funcName : function} + + def registerKWObject(self, object, namespace = '', path = ''): + if namespace == '' and path == '': namespace = self.namespace + if namespace == '' and path != '': + namespace = path.replace("/", ":") + if namespace[0] == ":": namespace = namespace[1:] + for i in dir(object.__class__): + if i[0] != "_" and callable(getattr(object, i)): + self.registerKWFunction(getattr(object,i), namespace) + + # convenience - wraps your func for you. + def registerKWFunction(self, function, namespace = '', funcName = None, + path = ''): + if namespace == '' and path == '': namespace = self.namespace + if namespace == '' and path != '': + namespace = path.replace("/", ":") + if namespace[0] == ":": namespace = namespace[1:] + self.registerFunction(MethodSig(function,keywords=1), namespace, + funcName) + + def unregisterObject(self, object, namespace = '', path = ''): + if namespace == '' and path == '': namespace = self.namespace + if namespace == '' and path != '': + namespace = path.replace("/", ":") + if namespace[0] == ":": namespace = namespace[1:] + + del self.objmap[namespace] + +class SOAPRequestHandler(BaseHTTPServer.BaseHTTPRequestHandler): + def version_string(self): + return '' + \ + 'SOAPpy ' + __version__ + ' (Python ' + \ + sys.version.split()[0] + ')' + + def date_time_string(self): + self.__last_date_time_string = \ + BaseHTTPServer.BaseHTTPRequestHandler.\ + date_time_string(self) + + return self.__last_date_time_string + + def do_POST(self): + global _contexts + + status = 500 + try: + if self.server.config.dumpHeadersIn: + s = 'Incoming HTTP headers' + debugHeader(s) + print self.raw_requestline.strip() + print "\n".join(map (lambda x: x.strip(), + self.headers.headers)) + debugFooter(s) + + data = self.rfile.read(int(self.headers["Content-length"])) + + if self.server.config.dumpSOAPIn: + s = 'Incoming SOAP' + debugHeader(s) + print data, + if data[-1] != '\n': + print + debugFooter(s) + + (r, header, body, attrs) = \ + parseSOAPRPC(data, header = 1, body = 1, attrs = 1) + + method = r._name + args = r._aslist() + kw = r._asdict() + + if Config.simplify_objects: + args = simplify(args) + kw = simplify(kw) + + # Handle mixed named and unnamed arguments by assuming + # that all arguments with names of the form "v[0-9]+" + # are unnamed and should be passed in numeric order, + # other arguments are named and should be passed using + # this name. + + # This is a non-standard exension to the SOAP protocol, + # but is supported by Apache AXIS. + + # It is enabled by default. To disable, set + # Config.specialArgs to False. + + + ordered_args = {} + named_args = {} + + if Config.specialArgs: + + for (k,v) in kw.items(): + + if k[0]=="v": + try: + i = int(k[1:]) + ordered_args[i] = v + except ValueError: + named_args[str(k)] = v + + else: + named_args[str(k)] = v + + # We have to decide namespace precedence + # I'm happy with the following scenario + # if r._ns is specified use it, if not check for + # a path, if it's specified convert it and use it as the + # namespace. If both are specified, use r._ns. + + ns = r._ns + + if len(self.path) > 1 and not ns: + ns = self.path.replace("/", ":") + if ns[0] == ":": ns = ns[1:] + + # authorization method + a = None + + keylist = ordered_args.keys() + keylist.sort() + + # create list in proper order w/o names + tmp = map( lambda x: ordered_args[x], keylist) + ordered_args = tmp + + #print '<-> Argument Matching Yielded:' + #print '<-> Ordered Arguments:' + str(ordered_args) + #print '<-> Named Arguments :' + str(named_args) + + resp = "" + + # For fault messages + if ns: + nsmethod = "%s:%s" % (ns, method) + else: + nsmethod = method + + try: + # First look for registered functions + if self.server.funcmap.has_key(ns) and \ + self.server.funcmap[ns].has_key(method): + f = self.server.funcmap[ns][method] + + # look for the authorization method + if self.server.config.authMethod != None: + authmethod = self.server.config.authMethod + if self.server.funcmap.has_key(ns) and \ + self.server.funcmap[ns].has_key(authmethod): + a = self.server.funcmap[ns][authmethod] + else: + # Now look at registered objects + # Check for nested attributes. This works even if + # there are none, because the split will return + # [method] + f = self.server.objmap[ns] + + # Look for the authorization method + if self.server.config.authMethod != None: + authmethod = self.server.config.authMethod + if hasattr(f, authmethod): + a = getattr(f, authmethod) + + # then continue looking for the method + l = method.split(".") + for i in l: + f = getattr(f, i) + except: + info = sys.exc_info() + try: + resp = buildSOAP(faultType("%s:Client" % NS.ENV_T, + "Method Not Found", + "%s : %s %s %s" % (nsmethod, + info[0], + info[1], + info[2])), + encoding = self.server.encoding, + config = self.server.config) + finally: + del info + status = 500 + else: + try: + if header: + x = HeaderHandler(header, attrs) + + fr = 1 + + # call context book keeping + # We're stuffing the method into the soapaction if there + # isn't one, someday, we'll set that on the client + # and it won't be necessary here + # for now we're doing both + + if "SOAPAction".lower() not in self.headers.keys() or \ + self.headers["SOAPAction"] == "\"\"": + self.headers["SOAPAction"] = method + + thread_id = thread.get_ident() + _contexts[thread_id] = SOAPContext(header, body, + attrs, data, + self.connection, + self.headers, + self.headers["SOAPAction"]) + + # Do an authorization check + if a != None: + if not apply(a, (), {"_SOAPContext" : + _contexts[thread_id] }): + raise faultType("%s:Server" % NS.ENV_T, + "Authorization failed.", + "%s" % nsmethod) + + # If it's wrapped, some special action may be needed + if isinstance(f, MethodSig): + c = None + + if f.context: # retrieve context object + c = _contexts[thread_id] + + if Config.specialArgs: + if c: + named_args["_SOAPContext"] = c + fr = apply(f, ordered_args, named_args) + elif f.keywords: + # This is lame, but have to de-unicode + # keywords + + strkw = {} + + for (k, v) in kw.items(): + strkw[str(k)] = v + if c: + strkw["_SOAPContext"] = c + fr = apply(f, (), strkw) + elif c: + fr = apply(f, args, {'_SOAPContext':c}) + else: + fr = apply(f, args, {}) + + else: + if Config.specialArgs: + fr = apply(f, ordered_args, named_args) + else: + fr = apply(f, args, {}) + + + if type(fr) == type(self) and \ + isinstance(fr, voidType): + resp = buildSOAP(kw = {'%sResponse' % method: fr}, + encoding = self.server.encoding, + config = self.server.config) + else: + resp = buildSOAP(kw = + {'%sResponse' % method: {'Result': fr}}, + encoding = self.server.encoding, + config = self.server.config) + + # Clean up _contexts + if _contexts.has_key(thread_id): + del _contexts[thread_id] + + except Exception, e: + import traceback + info = sys.exc_info() + + try: + if self.server.config.dumpFaultInfo: + s = 'Method %s exception' % nsmethod + debugHeader(s) + traceback.print_exception(info[0], info[1], + info[2]) + debugFooter(s) + + if isinstance(e, faultType): + f = e + else: + f = faultType("%s:Server" % NS.ENV_T, + "Method Failed", + "%s" % nsmethod) + + if self.server.config.returnFaultInfo: + f._setDetail("".join(traceback.format_exception( + info[0], info[1], info[2]))) + elif not hasattr(f, 'detail'): + f._setDetail("%s %s" % (info[0], info[1])) + finally: + del info + + resp = buildSOAP(f, encoding = self.server.encoding, + config = self.server.config) + status = 500 + else: + status = 200 + except faultType, e: + import traceback + info = sys.exc_info() + try: + if self.server.config.dumpFaultInfo: + s = 'Received fault exception' + debugHeader(s) + traceback.print_exception(info[0], info[1], + info[2]) + debugFooter(s) + + if self.server.config.returnFaultInfo: + e._setDetail("".join(traceback.format_exception( + info[0], info[1], info[2]))) + elif not hasattr(e, 'detail'): + e._setDetail("%s %s" % (info[0], info[1])) + finally: + del info + + resp = buildSOAP(e, encoding = self.server.encoding, + config = self.server.config) + status = 500 + except Exception, e: + # internal error, report as HTTP server error + + if self.server.config.dumpFaultInfo: + s = 'Internal exception %s' % e + import traceback + debugHeader(s) + info = sys.exc_info() + try: + traceback.print_exception(info[0], info[1], info[2]) + finally: + del info + + debugFooter(s) + + self.send_response(500) + self.end_headers() + + if self.server.config.dumpHeadersOut and \ + self.request_version != 'HTTP/0.9': + s = 'Outgoing HTTP headers' + debugHeader(s) + if self.responses.has_key(status): + s = ' ' + self.responses[status][0] + else: + s = '' + print "%s %d%s" % (self.protocol_version, 500, s) + print "Server:", self.version_string() + print "Date:", self.__last_date_time_string + debugFooter(s) + else: + # got a valid SOAP response + self.send_response(status) + + t = 'text/xml'; + if self.server.encoding != None: + t += '; charset=%s' % self.server.encoding + self.send_header("Content-type", t) + self.send_header("Content-length", str(len(resp))) + self.end_headers() + + if self.server.config.dumpHeadersOut and \ + self.request_version != 'HTTP/0.9': + s = 'Outgoing HTTP headers' + debugHeader(s) + if self.responses.has_key(status): + s = ' ' + self.responses[status][0] + else: + s = '' + print "%s %d%s" % (self.protocol_version, status, s) + print "Server:", self.version_string() + print "Date:", self.__last_date_time_string + print "Content-type:", t + print "Content-length:", len(resp) + debugFooter(s) + + if self.server.config.dumpSOAPOut: + s = 'Outgoing SOAP' + debugHeader(s) + print resp, + if resp[-1] != '\n': + print + debugFooter(s) + + self.wfile.write(resp) + self.wfile.flush() + + # We should be able to shut down both a regular and an SSL + # connection, but under Python 2.1, calling shutdown on an + # SSL connections drops the output, so this work-around. + # This should be investigated more someday. + + if self.server.config.SSLserver and \ + isinstance(self.connection, SSL.Connection): + self.connection.set_shutdown(SSL.SSL_SENT_SHUTDOWN | + SSL.SSL_RECEIVED_SHUTDOWN) + else: + self.connection.shutdown(1) + + def do_GET(self): + + #print 'command ', self.command + #print 'path ', self.path + #print 'request_version', self.request_version + #print 'headers' + #print ' type ', self.headers.type + #print ' maintype', self.headers.maintype + #print ' subtype ', self.headers.subtype + #print ' params ', self.headers.plist + + path = self.path.lower() + if path.endswith('wsdl'): + method = 'wsdl' + function = namespace = None + if self.server.funcmap.has_key(namespace) \ + and self.server.funcmap[namespace].has_key(method): + function = self.server.funcmap[namespace][method] + else: + if namespace in self.server.objmap.keys(): + function = self.server.objmap[namespace] + l = method.split(".") + for i in l: + function = getattr(function, i) + + if function: + self.send_response(200) + self.send_header("Content-type", 'text/plain') + self.end_headers() + response = apply(function, ()) + self.wfile.write(str(response)) + return + + # return error + self.send_response(200) + self.send_header("Content-type", 'text/html') + self.end_headers() + self.wfile.write('''\ + +<head>Error!</head> + + + +

Oops!

+ +

+ This server supports HTTP GET requests only for the the purpose of + obtaining Web Services Description Language (WSDL) for a specific + service. + + Either you requested an URL that does not end in "wsdl" or this + server does not implement a wsdl method. +

+ + +''') + + + def log_message(self, format, *args): + if self.server.log: + BaseHTTPServer.BaseHTTPRequestHandler.\ + log_message (self, format, *args) + + + +class SOAPServer(SOAPServerBase, SocketServer.TCPServer): + + def __init__(self, addr = ('localhost', 8000), + RequestHandler = SOAPRequestHandler, log = 0, encoding = 'UTF-8', + config = Config, namespace = None, ssl_context = None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + if ssl_context != None and not config.SSLserver: + raise AttributeError, \ + "SSL server not supported by this Python installation" + + self.namespace = namespace + self.objmap = {} + self.funcmap = {} + self.ssl_context = ssl_context + self.encoding = encoding + self.config = config + self.log = log + + self.allow_reuse_address= 1 + + SocketServer.TCPServer.__init__(self, addr, RequestHandler) + + +class ThreadingSOAPServer(SOAPServerBase, SocketServer.ThreadingTCPServer): + + def __init__(self, addr = ('localhost', 8000), + RequestHandler = SOAPRequestHandler, log = 0, encoding = 'UTF-8', + config = Config, namespace = None, ssl_context = None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + if ssl_context != None and not config.SSLserver: + raise AttributeError, \ + "SSL server not supported by this Python installation" + + self.namespace = namespace + self.objmap = {} + self.funcmap = {} + self.ssl_context = ssl_context + self.encoding = encoding + self.config = config + self.log = log + + self.allow_reuse_address= 1 + + SocketServer.ThreadingTCPServer.__init__(self, addr, RequestHandler) + +# only define class if Unix domain sockets are available +if hasattr(socket, "AF_UNIX"): + + class SOAPUnixSocketServer(SOAPServerBase, SocketServer.UnixStreamServer): + + def __init__(self, addr = 8000, + RequestHandler = SOAPRequestHandler, log = 0, encoding = 'UTF-8', + config = Config, namespace = None, ssl_context = None): + + # Test the encoding, raising an exception if it's not known + if encoding != None: + ''.encode(encoding) + + if ssl_context != None and not config.SSLserver: + raise AttributeError, \ + "SSL server not supported by this Python installation" + + self.namespace = namespace + self.objmap = {} + self.funcmap = {} + self.ssl_context = ssl_context + self.encoding = encoding + self.config = config + self.log = log + + self.allow_reuse_address= 1 + + SocketServer.UnixStreamServer.__init__(self, str(addr), RequestHandler) + diff --git a/SOAPpy/Types.py b/SOAPpy/Types.py new file mode 100644 index 00000000..8cfee53b --- /dev/null +++ b/SOAPpy/Types.py @@ -0,0 +1,1747 @@ +from __future__ import nested_scopes + +""" +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: Types.py 1496 2010-03-04 23:46:17Z pooryorick $' +from version import __version__ + +import UserList +import base64 +import cgi +import urllib +import copy +import re +import time +from types import * + +# SOAPpy modules +from Errors import * +from NS import NS +from Utilities import encodeHexString, cleanDate +from Config import Config + +############################################################################### +# Utility functions +############################################################################### + +def isPrivate(name): return name[0]=='_' +def isPublic(name): return name[0]!='_' + +############################################################################### +# Types and Wrappers +############################################################################### + +class anyType: + _validURIs = (NS.XSD, NS.XSD2, NS.XSD3, NS.ENC) + + def __init__(self, data = None, name = None, typed = 1, attrs = None): + if self.__class__ == anyType: + raise Error, "anyType can't be instantiated directly" + + if type(name) in (ListType, TupleType): + self._ns, self._name = name + else: + self._ns = self._validURIs[0] + self._name = name + + self._typed = typed + self._attrs = {} + + self._cache = None + self._type = self._typeName() + + self._data = self._checkValueSpace(data) + + if attrs != None: + self._setAttrs(attrs) + + def __str__(self): + if hasattr(self,'_name') and self._name: + return "<%s %s at %d>" % (self.__class__, self._name, id(self)) + return "<%s at %d>" % (self.__class__, id(self)) + + __repr__ = __str__ + + def _checkValueSpace(self, data): + return data + + def _marshalData(self): + return str(self._data) + + def _marshalAttrs(self, ns_map, builder): + a = '' + + for attr, value in self._attrs.items(): + ns, n = builder.genns(ns_map, attr[0]) + a += n + ' %s%s="%s"' % \ + (ns, attr[1], cgi.escape(str(value), 1)) + + return a + + def _fixAttr(self, attr): + if type(attr) in (StringType, UnicodeType): + attr = (None, attr) + elif type(attr) == ListType: + attr = tuple(attr) + elif type(attr) != TupleType: + raise AttributeError, "invalid attribute type" + + if len(attr) != 2: + raise AttributeError, "invalid attribute length" + + if type(attr[0]) not in (NoneType, StringType, UnicodeType): + raise AttributeError, "invalid attribute namespace URI type" + + return attr + + def _getAttr(self, attr): + attr = self._fixAttr(attr) + + try: + return self._attrs[attr] + except: + return None + + def _setAttr(self, attr, value): + attr = self._fixAttr(attr) + + if type(value) is StringType: + value = unicode(value) + + self._attrs[attr] = value + + + def _setAttrs(self, attrs): + if type(attrs) in (ListType, TupleType): + for i in range(0, len(attrs), 2): + self._setAttr(attrs[i], attrs[i + 1]) + + return + + if type(attrs) == DictType: + d = attrs + elif isinstance(attrs, anyType): + d = attrs._attrs + else: + raise AttributeError, "invalid attribute type" + + for attr, value in d.items(): + self._setAttr(attr, value) + + def _setMustUnderstand(self, val): + self._setAttr((NS.ENV, "mustUnderstand"), val) + + def _getMustUnderstand(self): + return self._getAttr((NS.ENV, "mustUnderstand")) + + def _setActor(self, val): + self._setAttr((NS.ENV, "actor"), val) + + def _getActor(self): + return self._getAttr((NS.ENV, "actor")) + + def _typeName(self): + return self.__class__.__name__[:-4] + + def _validNamespaceURI(self, URI, strict): + if not hasattr(self, '_typed') or not self._typed: + return None + if URI in self._validURIs: + return URI + if not strict: + return self._ns + raise AttributeError, \ + "not a valid namespace for type %s" % self._type + +class voidType(anyType): + pass + +class stringType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type:" % self._type + + return data + + def _marshalData(self): + return self._data + + +class untypedType(stringType): + def __init__(self, data = None, name = None, attrs = None): + stringType.__init__(self, data, name, 0, attrs) + +class IDType(stringType): pass +class NCNameType(stringType): pass +class NameType(stringType): pass +class ENTITYType(stringType): pass +class IDREFType(stringType): pass +class languageType(stringType): pass +class NMTOKENType(stringType): pass +class QNameType(stringType): pass + +class tokenType(anyType): + _validURIs = (NS.XSD2, NS.XSD3) + __invalidre = '[\n\t]|^ | $| ' + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + if type(self.__invalidre) == StringType: + self.__invalidre = re.compile(self.__invalidre) + + if self.__invalidre.search(data): + raise ValueError, "invalid %s value" % self._type + + return data + +class normalizedStringType(anyType): + _validURIs = (NS.XSD3,) + __invalidre = '[\n\r\t]' + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + if type(self.__invalidre) == StringType: + self.__invalidre = re.compile(self.__invalidre) + + if self.__invalidre.search(data): + raise ValueError, "invalid %s value" % self._type + + return data + +class CDATAType(normalizedStringType): + _validURIs = (NS.XSD2,) + +class booleanType(anyType): + def __int__(self): + return self._data + + __nonzero__ = __int__ + + def _marshalData(self): + return ['false', 'true'][self._data] + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if data in (0, '0', 'false', ''): + return 0 + if data in (1, '1', 'true'): + return 1 + raise ValueError, "invalid %s value" % self._type + +class decimalType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType, FloatType): + raise Error, "invalid %s value" % self._type + + return data + +class floatType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType, FloatType) or \ + data < -3.4028234663852886E+38 or \ + data > 3.4028234663852886E+38: + raise ValueError, "invalid %s value: %s" % (self._type, repr(data)) + + return data + + def _marshalData(self): + return "%.18g" % self._data # More precision + +class doubleType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType, FloatType) or \ + data < -1.7976931348623158E+308 or \ + data > 1.7976931348623157E+308: + raise ValueError, "invalid %s value: %s" % (self._type, repr(data)) + + return data + + def _marshalData(self): + return "%.18g" % self._data # More precision + +class durationType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + try: + # A tuple or a scalar is OK, but make them into a list + + if type(data) == TupleType: + data = list(data) + elif type(data) != ListType: + data = [data] + + if len(data) > 6: + raise Exception, "too many values" + + # Now check the types of all the components, and find + # the first nonzero element along the way. + + f = -1 + + for i in range(len(data)): + if data[i] == None: + data[i] = 0 + continue + + if type(data[i]) not in \ + (IntType, LongType, FloatType): + raise Exception, "element %d a bad type" % i + + if data[i] and f == -1: + f = i + + # If they're all 0, just use zero seconds. + + if f == -1: + self._cache = 'PT0S' + + return (0,) * 6 + + # Make sure only the last nonzero element has a decimal fraction + # and only the first element is negative. + + d = -1 + + for i in range(f, len(data)): + if data[i]: + if d != -1: + raise Exception, \ + "all except the last nonzero element must be " \ + "integers" + if data[i] < 0 and i > f: + raise Exception, \ + "only the first nonzero element can be negative" + elif data[i] != long(data[i]): + d = i + + # Pad the list on the left if necessary. + + if len(data) < 6: + n = 6 - len(data) + f += n + d += n + data = [0] * n + data + + # Save index of the first nonzero element and the decimal + # element for _marshalData. + + self.__firstnonzero = f + self.__decimal = d + + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + t = 0 + + if d[self.__firstnonzero] < 0: + s = '-P' + else: + s = 'P' + + t = 0 + + for i in range(self.__firstnonzero, len(d)): + if d[i]: + if i > 2 and not t: + s += 'T' + t = 1 + if self.__decimal == i: + s += "%g" % abs(d[i]) + else: + s += "%d" % long(abs(d[i])) + s += ['Y', 'M', 'D', 'H', 'M', 'S'][i] + + self._cache = s + + return self._cache + +class timeDurationType(durationType): + _validURIs = (NS.XSD, NS.XSD2, NS.ENC) + +class dateTimeType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.time() + + if (type(data) in (IntType, LongType)): + data = list(time.gmtime(data)[:6]) + elif (type(data) == FloatType): + f = data - int(data) + data = list(time.gmtime(int(data))[:6]) + data[5] += f + elif type(data) in (ListType, TupleType): + if len(data) < 6: + raise Exception, "not enough values" + if len(data) > 9: + raise Exception, "too many values" + + data = list(data[:6]) + + cleanDate(data) + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + s = "%04d-%02d-%02dT%02d:%02d:%02d" % ((abs(d[0]),) + d[1:]) + if d[0] < 0: + s = '-' + s + f = d[5] - int(d[5]) + if f != 0: + s += ("%g" % f)[1:] + s += 'Z' + + self._cache = s + + return self._cache + +class recurringInstantType(anyType): + _validURIs = (NS.XSD,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = list(time.gmtime(time.time())[:6]) + if (type(data) in (IntType, LongType)): + data = list(time.gmtime(data)[:6]) + elif (type(data) == FloatType): + f = data - int(data) + data = list(time.gmtime(int(data))[:6]) + data[5] += f + elif type(data) in (ListType, TupleType): + if len(data) < 1: + raise Exception, "not enough values" + if len(data) > 9: + raise Exception, "too many values" + + data = list(data[:6]) + + if len(data) < 6: + data += [0] * (6 - len(data)) + + f = len(data) + + for i in range(f): + if data[i] == None: + if f < i: + raise Exception, \ + "only leftmost elements can be none" + else: + f = i + break + + cleanDate(data, f) + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + e = list(d) + neg = '' + + if not e[0]: + e[0] = '--' + else: + if e[0] < 0: + neg = '-' + e[0] = abs(e[0]) + if e[0] < 100: + e[0] = '-' + "%02d" % e[0] + else: + e[0] = "%04d" % e[0] + + for i in range(1, len(e)): + if e[i] == None or (i < 3 and e[i] == 0): + e[i] = '-' + else: + if e[i] < 0: + neg = '-' + e[i] = abs(e[i]) + + e[i] = "%02d" % e[i] + + if d[5]: + f = abs(d[5] - int(d[5])) + + if f: + e[5] += ("%g" % f)[1:] + + s = "%s%s-%s-%sT%s:%s:%sZ" % ((neg,) + tuple(e)) + + self._cache = s + + return self._cache + +class timeInstantType(dateTimeType): + _validURIs = (NS.XSD, NS.XSD2, NS.ENC) + +class timePeriodType(dateTimeType): + _validURIs = (NS.XSD2, NS.ENC) + +class timeType(anyType): + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[3:6] + elif (type(data) == FloatType): + f = data - int(data) + data = list(time.gmtime(int(data))[3:6]) + data[2] += f + elif type(data) in (IntType, LongType): + data = time.gmtime(data)[3:6] + elif type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[3:6] + elif len(data) > 3: + raise Exception, "too many values" + + data = [None, None, None] + list(data) + + if len(data) < 6: + data += [0] * (6 - len(data)) + + cleanDate(data, 3) + + data = data[3:] + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + #s = '' + # + #s = time.strftime("%H:%M:%S", (0, 0, 0) + d + (0, 0, -1)) + s = "%02d:%02d:%02d" % d + f = d[2] - int(d[2]) + if f != 0: + s += ("%g" % f)[1:] + s += 'Z' + + self._cache = s + + return self._cache + +class dateType(anyType): + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[0:3] + elif type(data) in (IntType, LongType, FloatType): + data = time.gmtime(data)[0:3] + elif type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[0:3] + elif len(data) > 3: + raise Exception, "too many values" + + data = list(data) + + if len(data) < 3: + data += [1, 1, 1][len(data):] + + data += [0, 0, 0] + + cleanDate(data) + + data = data[:3] + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + s = "%04d-%02d-%02dZ" % ((abs(d[0]),) + d[1:]) + if d[0] < 0: + s = '-' + s + + self._cache = s + + return self._cache + +class gYearMonthType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[0:2] + elif type(data) in (IntType, LongType, FloatType): + data = time.gmtime(data)[0:2] + elif type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[0:2] + elif len(data) > 2: + raise Exception, "too many values" + + data = list(data) + + if len(data) < 2: + data += [1, 1][len(data):] + + data += [1, 0, 0, 0] + + cleanDate(data) + + data = data[:2] + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + d = self._data + s = "%04d-%02dZ" % ((abs(d[0]),) + d[1:]) + if d[0] < 0: + s = '-' + s + + self._cache = s + + return self._cache + +class gYearType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[0:1] + elif type(data) in (IntType, LongType, FloatType): + data = [data] + + if type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[0:1] + elif len(data) < 1: + raise Exception, "too few values" + elif len(data) > 1: + raise Exception, "too many values" + + if type(data[0]) == FloatType: + try: s = int(data[0]) + except: s = long(data[0]) + + if s != data[0]: + raise Exception, "not integral" + + data = [s] + elif type(data[0]) not in (IntType, LongType): + raise Exception, "bad type" + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return data[0] + + def _marshalData(self): + if self._cache == None: + d = self._data + s = "%04dZ" % abs(d) + if d < 0: + s = '-' + s + + self._cache = s + + return self._cache + +class centuryType(anyType): + _validURIs = (NS.XSD2, NS.ENC) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[0:1] / 100 + elif type(data) in (IntType, LongType, FloatType): + data = [data] + + if type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[0:1] / 100 + elif len(data) < 1: + raise Exception, "too few values" + elif len(data) > 1: + raise Exception, "too many values" + + if type(data[0]) == FloatType: + try: s = int(data[0]) + except: s = long(data[0]) + + if s != data[0]: + raise Exception, "not integral" + + data = [s] + elif type(data[0]) not in (IntType, LongType): + raise Exception, "bad type" + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return data[0] + + def _marshalData(self): + if self._cache == None: + d = self._data + s = "%02dZ" % abs(d) + if d < 0: + s = '-' + s + + self._cache = s + + return self._cache + +class yearType(gYearType): + _validURIs = (NS.XSD2, NS.ENC) + +class gMonthDayType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[1:3] + elif type(data) in (IntType, LongType, FloatType): + data = time.gmtime(data)[1:3] + elif type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[0:2] + elif len(data) > 2: + raise Exception, "too many values" + + data = list(data) + + if len(data) < 2: + data += [1, 1][len(data):] + + data = [0] + data + [0, 0, 0] + + cleanDate(data, 1) + + data = data[1:3] + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return tuple(data) + + def _marshalData(self): + if self._cache == None: + self._cache = "--%02d-%02dZ" % self._data + + return self._cache + +class recurringDateType(gMonthDayType): + _validURIs = (NS.XSD2, NS.ENC) + +class gMonthType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[1:2] + elif type(data) in (IntType, LongType, FloatType): + data = [data] + + if type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[1:2] + elif len(data) < 1: + raise Exception, "too few values" + elif len(data) > 1: + raise Exception, "too many values" + + if type(data[0]) == FloatType: + try: s = int(data[0]) + except: s = long(data[0]) + + if s != data[0]: + raise Exception, "not integral" + + data = [s] + elif type(data[0]) not in (IntType, LongType): + raise Exception, "bad type" + + if data[0] < 1 or data[0] > 12: + raise Exception, "bad value" + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return data[0] + + def _marshalData(self): + if self._cache == None: + self._cache = "--%02d--Z" % self._data + + return self._cache + +class monthType(gMonthType): + _validURIs = (NS.XSD2, NS.ENC) + +class gDayType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + try: + if data == None: + data = time.gmtime(time.time())[2:3] + elif type(data) in (IntType, LongType, FloatType): + data = [data] + + if type(data) in (ListType, TupleType): + if len(data) == 9: + data = data[2:3] + elif len(data) < 1: + raise Exception, "too few values" + elif len(data) > 1: + raise Exception, "too many values" + + if type(data[0]) == FloatType: + try: s = int(data[0]) + except: s = long(data[0]) + + if s != data[0]: + raise Exception, "not integral" + + data = [s] + elif type(data[0]) not in (IntType, LongType): + raise Exception, "bad type" + + if data[0] < 1 or data[0] > 31: + raise Exception, "bad value" + else: + raise Exception, "invalid type" + except Exception, e: + raise ValueError, "invalid %s value - %s" % (self._type, e) + + return data[0] + + def _marshalData(self): + if self._cache == None: + self._cache = "---%02dZ" % self._data + + return self._cache + +class recurringDayType(gDayType): + _validURIs = (NS.XSD2, NS.ENC) + +class hexBinaryType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + return data + + def _marshalData(self): + if self._cache == None: + self._cache = encodeHexString(self._data) + + return self._cache + +class base64BinaryType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + return data + + def _marshalData(self): + if self._cache == None: + self._cache = base64.encodestring(self._data) + + return self._cache + +class base64Type(base64BinaryType): + _validURIs = (NS.ENC,) + +class binaryType(anyType): + _validURIs = (NS.XSD, NS.ENC) + + def __init__(self, data, name = None, typed = 1, encoding = 'base64', + attrs = None): + + anyType.__init__(self, data, name, typed, attrs) + + self._setAttr('encoding', encoding) + + def _marshalData(self): + if self._cache == None: + if self._getAttr((None, 'encoding')) == 'base64': + self._cache = base64.encodestring(self._data) + else: + self._cache = encodeHexString(self._data) + + return self._cache + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + return data + + def _setAttr(self, attr, value): + attr = self._fixAttr(attr) + + if attr[1] == 'encoding': + if attr[0] != None or value not in ('base64', 'hex'): + raise AttributeError, "invalid encoding" + + self._cache = None + + anyType._setAttr(self, attr, value) + + +class anyURIType(anyType): + _validURIs = (NS.XSD3,) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (StringType, UnicodeType): + raise AttributeError, "invalid %s type" % self._type + + return data + + def _marshalData(self): + if self._cache == None: + self._cache = urllib.quote(self._data) + + return self._cache + +class uriType(anyURIType): + _validURIs = (NS.XSD,) + +class uriReferenceType(anyURIType): + _validURIs = (NS.XSD2,) + +class NOTATIONType(anyType): + def __init__(self, data, name = None, typed = 1, attrs = None): + + if self.__class__ == NOTATIONType: + raise Error, "a NOTATION can't be instantiated directly" + + anyType.__init__(self, data, name, typed, attrs) + +class ENTITIESType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) in (StringType, UnicodeType): + return (data,) + + if type(data) not in (ListType, TupleType) or \ + filter (lambda x: type(x) not in (StringType, UnicodeType), data): + raise AttributeError, "invalid %s type" % self._type + + return data + + def _marshalData(self): + return ' '.join(self._data) + +class IDREFSType(ENTITIESType): pass +class NMTOKENSType(ENTITIESType): pass + +class integerType(anyType): + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType): + raise ValueError, "invalid %s value" % self._type + + return data + +class nonPositiveIntegerType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or data > 0: + raise ValueError, "invalid %s value" % self._type + + return data + +class non_Positive_IntegerType(nonPositiveIntegerType): + _validURIs = (NS.XSD,) + + def _typeName(self): + return 'non-positive-integer' + +class negativeIntegerType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or data >= 0: + raise ValueError, "invalid %s value" % self._type + + return data + +class negative_IntegerType(negativeIntegerType): + _validURIs = (NS.XSD,) + + def _typeName(self): + return 'negative-integer' + +class longType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < -9223372036854775808L or \ + data > 9223372036854775807L: + raise ValueError, "invalid %s value" % self._type + + return data + +class intType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < -2147483648L or \ + data > 2147483647L: + raise ValueError, "invalid %s value" % self._type + + return data + +class shortType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < -32768 or \ + data > 32767: + raise ValueError, "invalid %s value" % self._type + + return data + +class byteType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < -128 or \ + data > 127: + raise ValueError, "invalid %s value" % self._type + + return data + +class nonNegativeIntegerType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or data < 0: + raise ValueError, "invalid %s value" % self._type + + return data + +class non_Negative_IntegerType(nonNegativeIntegerType): + _validURIs = (NS.XSD,) + + def _typeName(self): + return 'non-negative-integer' + +class unsignedLongType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < 0 or \ + data > 18446744073709551615L: + raise ValueError, "invalid %s value" % self._type + + return data + +class unsignedIntType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < 0 or \ + data > 4294967295L: + raise ValueError, "invalid %s value" % self._type + + return data + +class unsignedShortType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < 0 or \ + data > 65535: + raise ValueError, "invalid %s value" % self._type + + return data + +class unsignedByteType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or \ + data < 0 or \ + data > 255: + raise ValueError, "invalid %s value" % self._type + + return data + +class positiveIntegerType(anyType): + _validURIs = (NS.XSD2, NS.XSD3, NS.ENC) + + def _checkValueSpace(self, data): + if data == None: + raise ValueError, "must supply initial %s value" % self._type + + if type(data) not in (IntType, LongType) or data <= 0: + raise ValueError, "invalid %s value" % self._type + + return data + +class positive_IntegerType(positiveIntegerType): + _validURIs = (NS.XSD,) + + def _typeName(self): + return 'positive-integer' + +# Now compound types + +class compoundType(anyType): + def __init__(self, data = None, name = None, typed = 1, attrs = None): + if self.__class__ == compoundType: + raise Error, "a compound can't be instantiated directly" + + anyType.__init__(self, data, name, typed, attrs) + self._keyord = [] + + if type(data) == DictType: + self.__dict__.update(data) + + def _aslist(self, item=None): + if item is not None: + return self.__dict__[self._keyord[item]] + else: + return map( lambda x: self.__dict__[x], self._keyord) + + def _asdict(self, item=None, encoding=Config.dict_encoding): + if item is not None: + if type(item) in (UnicodeType,StringType): + item = item.encode(encoding) + return self.__dict__[item] + else: + retval = {} + def fun(x): retval[x.encode(encoding)] = self.__dict__[x] + + if hasattr(self, '_keyord'): + map( fun, self._keyord) + else: + for name in dir(self): + if isPublic(name): + retval[name] = getattr(self,name) + return retval + + + def __getitem__(self, item): + if type(item) == IntType: + return self.__dict__[self._keyord[item]] + else: + return getattr(self, item) + + def __len__(self): + return len(self._keyord) + + def __nonzero__(self): + return 1 + + def _keys(self): + return filter(lambda x: x[0] != '_', self.__dict__.keys()) + + def _addItem(self, name, value, attrs = None): + + if name in self._keyord: + if type(self.__dict__[name]) != ListType: + self.__dict__[name] = [self.__dict__[name]] + self.__dict__[name].append(value) + else: + self.__dict__[name] = value + self._keyord.append(name) + + def _placeItem(self, name, value, pos, subpos = 0, attrs = None): + + if subpos == 0 and type(self.__dict__[name]) != ListType: + self.__dict__[name] = value + else: + self.__dict__[name][subpos] = value + + # only add to key order list if it does not already + # exist in list + if not (name in self._keyord): + if pos < len(x): + self._keyord[pos] = name + else: + self._keyord.append(name) + + + def _getItemAsList(self, name, default = []): + try: + d = self.__dict__[name] + except: + return default + + if type(d) == ListType: + return d + return [d] + + def __str__(self): + return anyType.__str__(self) + ": " + str(self._asdict()) + + def __repr__(self): + return self.__str__() + +class structType(compoundType): + pass + +class headerType(structType): + _validURIs = (NS.ENV,) + + def __init__(self, data = None, typed = 1, attrs = None): + structType.__init__(self, data, "Header", typed, attrs) + +class bodyType(structType): + _validURIs = (NS.ENV,) + + def __init__(self, data = None, typed = 1, attrs = None): + structType.__init__(self, data, "Body", typed, attrs) + +class arrayType(UserList.UserList, compoundType): + def __init__(self, data = None, name = None, attrs = None, + offset = 0, rank = None, asize = 0, elemsname = None): + + if data: + if type(data) not in (ListType, TupleType): + raise Error, "Data must be a sequence" + + UserList.UserList.__init__(self, data) + compoundType.__init__(self, data, name, 0, attrs) + + self._elemsname = elemsname or "item" + + if data == None: + self._rank = rank + + # According to 5.4.2.2 in the SOAP spec, each element in a + # sparse array must have a position. _posstate keeps track of + # whether we've seen a position or not. It's possible values + # are: + # -1 No elements have been added, so the state is indeterminate + # 0 An element without a position has been added, so no + # elements can have positions + # 1 An element with a position has been added, so all elements + # must have positions + + self._posstate = -1 + + self._full = 0 + + if asize in ('', None): + asize = '0' + + self._dims = map (lambda x: int(x), str(asize).split(',')) + self._dims.reverse() # It's easier to work with this way + self._poss = [0] * len(self._dims) # This will end up + # reversed too + + for i in range(len(self._dims)): + if self._dims[i] < 0 or \ + self._dims[i] == 0 and len(self._dims) > 1: + raise TypeError, "invalid Array dimensions" + + if offset > 0: + self._poss[i] = offset % self._dims[i] + offset = int(offset / self._dims[i]) + + # Don't break out of the loop if offset is 0 so we test all the + # dimensions for > 0. + if offset: + raise AttributeError, "invalid Array offset" + + a = [None] * self._dims[0] + + for i in range(1, len(self._dims)): + b = [] + + for j in range(self._dims[i]): + b.append(copy.deepcopy(a)) + + a = b + + self.data = a + + + def _aslist(self, item=None): + if item is not None: + return self.data[int(item)] + else: + return self.data + + def _asdict(self, item=None, encoding=Config.dict_encoding): + if item is not None: + if type(item) in (UnicodeType,StringType): + item = item.encode(encoding) + return self.data[int(item)] + else: + retval = {} + def fun(x): retval[str(x).encode(encoding)] = self.data[x] + + map( fun, range(len(self.data)) ) + return retval + + def __getitem__(self, item): + try: + return self.data[int(item)] + except ValueError: + return getattr(self, item) + + def __len__(self): + return len(self.data) + + def __nonzero__(self): + return 1 + + def __str__(self): + return anyType.__str__(self) + ": " + str(self._aslist()) + + def _keys(self): + return filter(lambda x: x[0] != '_', self.__dict__.keys()) + + def _addItem(self, name, value, attrs): + if self._full: + raise ValueError, "Array is full" + + pos = attrs.get((NS.ENC, 'position')) + + if pos != None: + if self._posstate == 0: + raise AttributeError, \ + "all elements in a sparse Array must have a " \ + "position attribute" + + self._posstate = 1 + + try: + if pos[0] == '[' and pos[-1] == ']': + pos = map (lambda x: int(x), pos[1:-1].split(',')) + pos.reverse() + + if len(pos) == 1: + pos = pos[0] + + curpos = [0] * len(self._dims) + + for i in range(len(self._dims)): + curpos[i] = pos % self._dims[i] + pos = int(pos / self._dims[i]) + + if pos == 0: + break + + if pos: + raise Exception + elif len(pos) != len(self._dims): + raise Exception + else: + for i in range(len(self._dims)): + if pos[i] >= self._dims[i]: + raise Exception + + curpos = pos + else: + raise Exception + except: + raise AttributeError, \ + "invalid Array element position %s" % str(pos) + else: + if self._posstate == 1: + raise AttributeError, \ + "only elements in a sparse Array may have a " \ + "position attribute" + + self._posstate = 0 + + curpos = self._poss + + a = self.data + + for i in range(len(self._dims) - 1, 0, -1): + a = a[curpos[i]] + + if curpos[0] >= len(a): + a += [None] * (len(a) - curpos[0] + 1) + + a[curpos[0]] = value + + if pos == None: + self._poss[0] += 1 + + for i in range(len(self._dims) - 1): + if self._poss[i] < self._dims[i]: + break + + self._poss[i] = 0 + self._poss[i + 1] += 1 + + if self._dims[-1] and self._poss[-1] >= self._dims[-1]: + #self._full = 1 + #FIXME: why is this occuring? + pass + + def _placeItem(self, name, value, pos, subpos, attrs = None): + curpos = [0] * len(self._dims) + + for i in range(len(self._dims)): + if self._dims[i] == 0: + curpos[0] = pos + break + + curpos[i] = pos % self._dims[i] + pos = int(pos / self._dims[i]) + + if pos == 0: + break + + if self._dims[i] != 0 and pos: + raise Error, "array index out of range" + + a = self.data + + for i in range(len(self._dims) - 1, 0, -1): + a = a[curpos[i]] + + if curpos[0] >= len(a): + a += [None] * (len(a) - curpos[0] + 1) + + a[curpos[0]] = value + +class typedArrayType(arrayType): + def __init__(self, data = None, name = None, typed = None, attrs = None, + offset = 0, rank = None, asize = 0, elemsname = None, complexType = 0): + + arrayType.__init__(self, data, name, attrs, offset, rank, asize, + elemsname) + + self._typed = 1 + self._type = typed + self._complexType = complexType + +class faultType(structType, Error): + def __init__(self, faultcode = "", faultstring = "", detail = None): + self.faultcode = faultcode + self.faultstring = faultstring + if detail != None: + self.detail = detail + + structType.__init__(self, None, 0) + + def _setDetail(self, detail = None): + if detail != None: + self.detail = detail + else: + try: del self.detail + except AttributeError: pass + + def __repr__(self): + if getattr(self, 'detail', None) != None: + return "" % (self.faultcode, + self.faultstring, + self.detail) + else: + return "" % (self.faultcode, self.faultstring) + + __str__ = __repr__ + + def __call__(self): + return (self.faultcode, self.faultstring, self.detail) + +class SOAPException(Exception): + def __init__(self, code="", string="", detail=None): + self.value = ("SOAPpy SOAP Exception", code, string, detail) + self.code = code + self.string = string + self.detail = detail + + def __str__(self): + return repr(self.value) + +class RequiredHeaderMismatch(Exception): + def __init__(self, value): + self.value = value + + def __str__(self): + return repr(self.value) + +class MethodNotFound(Exception): + def __init__(self, value): + (val, detail) = value.split(":") + self.value = val + self.detail = detail + + def __str__(self): + return repr(self.value, self.detail) + +class AuthorizationFailed(Exception): + def __init__(self, value): + self.value = value + + def __str__(self): + return repr(self.value) + +class MethodFailed(Exception): + def __init__(self, value): + self.value = value + + def __str__(self): + return repr(self.value) + +####### +# Convert complex SOAPpy objects to native python equivalents +####### + +def simplify(object, level=0): + """ + Convert the SOAPpy objects and their contents to simple python types. + + This function recursively converts the passed 'container' object, + and all public subobjects. (Private subobjects have names that + start with '_'.) + + Conversions: + - faultType --> raise python exception + - arrayType --> array + - compoundType --> dictionary + """ + + if level > 10: + return object + + if isinstance( object, faultType ): + if object.faultstring == "Required Header Misunderstood": + raise RequiredHeaderMismatch(object.detail) + elif object.faultstring == "Method Not Found": + raise MethodNotFound(object.detail) + elif object.faultstring == "Authorization Failed": + raise AuthorizationFailed(object.detail) + elif object.faultstring == "Method Failed": + raise MethodFailed(object.detail) + else: + se = SOAPException(object.faultcode, object.faultstring, + object.detail) + raise se + elif isinstance( object, arrayType ): + data = object._aslist() + for k in range(len(data)): + data[k] = simplify(data[k], level=level+1) + return data + elif isinstance( object, compoundType ) or isinstance(object, structType): + data = object._asdict() + for k in data.keys(): + if isPublic(k): + data[k] = simplify(data[k], level=level+1) + return data + elif type(object)==DictType: + for k in object.keys(): + if isPublic(k): + object[k] = simplify(object[k]) + return object + elif type(object)==list: + for k in range(len(object)): + object[k] = simplify(object[k]) + return object + else: + return object + + +def simplify_contents(object, level=0): + """ + Convert the contents of SOAPpy objects to simple python types. + + This function recursively converts the sub-objects contained in a + 'container' object to simple python types. + + Conversions: + - faultType --> raise python exception + - arrayType --> array + - compoundType --> dictionary + """ + + if level>10: return object + + if isinstance( object, faultType ): + for k in object._keys(): + if isPublic(k): + setattr(object, k, simplify(object[k], level=level+1)) + raise object + elif isinstance( object, arrayType ): + data = object._aslist() + for k in range(len(data)): + object[k] = simplify(data[k], level=level+1) + elif isinstance(object, structType): + data = object._asdict() + for k in data.keys(): + if isPublic(k): + setattr(object, k, simplify(data[k], level=level+1)) + elif isinstance( object, compoundType ) : + data = object._asdict() + for k in data.keys(): + if isPublic(k): + object[k] = simplify(data[k], level=level+1) + elif type(object)==DictType: + for k in object.keys(): + if isPublic(k): + object[k] = simplify(object[k]) + elif type(object)==list: + for k in range(len(object)): + object[k] = simplify(object[k]) + + return object + + diff --git a/SOAPpy/URLopener.py b/SOAPpy/URLopener.py new file mode 100644 index 00000000..2c04c868 --- /dev/null +++ b/SOAPpy/URLopener.py @@ -0,0 +1,23 @@ +"""Provide a class for loading data from URL's that handles basic +authentication""" + +ident = '$Id: URLopener.py 541 2004-01-31 04:20:06Z warnes $' +from version import __version__ + +from Config import Config +from urllib import FancyURLopener + +class URLopener(FancyURLopener): + + username = None + passwd = None + + + def __init__(self, username=None, passwd=None, *args, **kw): + FancyURLopener.__init__( self, *args, **kw) + self.username = username + self.passwd = passwd + + + def prompt_user_passwd(self, host, realm): + return self.username, self.passwd diff --git a/SOAPpy/Utilities.py b/SOAPpy/Utilities.py new file mode 100644 index 00000000..1b163dec --- /dev/null +++ b/SOAPpy/Utilities.py @@ -0,0 +1,176 @@ +""" +################################################################################ +# Copyright (c) 2003, Pfizer +# Copyright (c) 2001, Cayce Ullman. +# Copyright (c) 2001, Brian Matthews. +# +# All rights reserved. +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# Neither the name of actzero, inc. nor the names of its contributors may +# be used to endorse or promote products derived from this software without +# specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE +# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR +# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES +# (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; +# LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND +# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +# SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +################################################################################ +""" + +ident = '$Id: Utilities.py 1298 2006-11-07 00:54:15Z sanxiyn $' +from version import __version__ + +import re +import string +import sys +from types import * + +# SOAPpy modules +from Errors import * + +################################################################################ +# Utility infielders +################################################################################ +def collapseWhiteSpace(s): + return re.sub('\s+', ' ', s).strip() + +def decodeHexString(data): + conv = { + '0': 0x0, '1': 0x1, '2': 0x2, '3': 0x3, '4': 0x4, + '5': 0x5, '6': 0x6, '7': 0x7, '8': 0x8, '9': 0x9, + + 'a': 0xa, 'b': 0xb, 'c': 0xc, 'd': 0xd, 'e': 0xe, + 'f': 0xf, + + 'A': 0xa, 'B': 0xb, 'C': 0xc, 'D': 0xd, 'E': 0xe, + 'F': 0xf, + } + + ws = string.whitespace + + bin = '' + + i = 0 + + while i < len(data): + if data[i] not in ws: + break + i += 1 + + low = 0 + + while i < len(data): + c = data[i] + + if c in string.whitespace: + break + + try: + c = conv[c] + except KeyError: + raise ValueError, \ + "invalid hex string character `%s'" % c + + if low: + bin += chr(high * 16 + c) + low = 0 + else: + high = c + low = 1 + + i += 1 + + if low: + raise ValueError, "invalid hex string length" + + while i < len(data): + if data[i] not in string.whitespace: + raise ValueError, \ + "invalid hex string character `%s'" % c + + i += 1 + + return bin + +def encodeHexString(data): + h = '' + + for i in data: + h += "%02X" % ord(i) + + return h + +def leapMonth(year, month): + return month == 2 and \ + year % 4 == 0 and \ + (year % 100 != 0 or year % 400 == 0) + +def cleanDate(d, first = 0): + ranges = (None, (1, 12), (1, 31), (0, 23), (0, 59), (0, 61)) + months = (0, 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31) + names = ('year', 'month', 'day', 'hours', 'minutes', 'seconds') + + if len(d) != 6: + raise ValueError, "date must have 6 elements" + + for i in range(first, 6): + s = d[i] + + if type(s) == FloatType: + if i < 5: + try: + s = int(s) + except OverflowError: + if i > 0: + raise + s = long(s) + + if s != d[i]: + raise ValueError, "%s must be integral" % names[i] + + d[i] = s + elif type(s) == LongType: + try: s = int(s) + except: pass + elif type(s) != IntType: + raise TypeError, "%s isn't a valid type" % names[i] + + if i == first and s < 0: + continue + + if ranges[i] != None and \ + (s < ranges[i][0] or ranges[i][1] < s): + raise ValueError, "%s out of range" % names[i] + + if first < 6 and d[5] >= 61: + raise ValueError, "seconds out of range" + + if first < 2: + leap = first < 1 and leapMonth(d[0], d[1]) + + if d[2] > months[d[1]] + leap: + raise ValueError, "day out of range" + +def debugHeader(title): + s = '*** ' + title + ' ' + print s + ('*' * (72 - len(s))) + +def debugFooter(title): + print '*' * 72 + sys.stdout.flush() diff --git a/SOAPpy/WSDL.py b/SOAPpy/WSDL.py new file mode 100644 index 00000000..84f7d3f5 --- /dev/null +++ b/SOAPpy/WSDL.py @@ -0,0 +1,137 @@ +"""Parse web services description language to get SOAP methods. + +Rudimentary support.""" + +ident = '$Id: WSDL.py 1467 2008-05-16 23:32:51Z warnes $' +from version import __version__ + +import wstools +import xml +from Errors import Error +from Client import SOAPProxy, SOAPAddress +from Config import Config +import urllib + +class Proxy: + """WSDL Proxy. + + SOAPProxy wrapper that parses method names, namespaces, soap actions from + the web service description language (WSDL) file passed into the + constructor. The WSDL reference can be passed in as a stream, an url, a + file name, or a string. + + Loads info into self.methods, a dictionary with methodname keys and values + of WSDLTools.SOAPCallinfo. + + For example, + + url = 'http://www.xmethods.org/sd/2001/TemperatureService.wsdl' + wsdl = WSDL.Proxy(url) + print len(wsdl.methods) # 1 + print wsdl.methods.keys() # getTemp + + + See WSDLTools.SOAPCallinfo for more info on each method's attributes. + """ + + def __init__(self, wsdlsource, config=Config, **kw ): + + reader = wstools.WSDLTools.WSDLReader() + self.wsdl = None + + # From Mark Pilgrim's "Dive Into Python" toolkit.py--open anything. + if self.wsdl is None and hasattr(wsdlsource, "read"): + print 'stream:', wsdlsource + try: + self.wsdl = reader.loadFromStream(wsdlsource) + except xml.parsers.expat.ExpatError, e: + newstream = urllib.URLopener(key_file=config.SSL.key_file, cert_file=config.SSL.cert_file).open(wsdlsource) + buf = newstream.readlines() + raise Error, "Unable to parse WSDL file at %s: \n\t%s" % \ + (wsdlsource, "\t".join(buf)) + + + # NOT TESTED (as of April 17, 2003) + #if self.wsdl is None and wsdlsource == '-': + # import sys + # self.wsdl = reader.loadFromStream(sys.stdin) + # print 'stdin' + + if self.wsdl is None: + try: + file(wsdlsource) + self.wsdl = reader.loadFromFile(wsdlsource) + #print 'file' + except (IOError, OSError): pass + except xml.parsers.expat.ExpatError, e: + newstream = urllib.urlopen(wsdlsource) + buf = newstream.readlines() + raise Error, "Unable to parse WSDL file at %s: \n\t%s" % \ + (wsdlsource, "\t".join(buf)) + + if self.wsdl is None: + try: + stream = urllib.URLopener(key_file=config.SSL.key_file, cert_file=config.SSL.cert_file).open(wsdlsource) + self.wsdl = reader.loadFromStream(stream, wsdlsource) + except (IOError, OSError): pass + except xml.parsers.expat.ExpatError, e: + newstream = urllib.urlopen(wsdlsource) + buf = newstream.readlines() + raise Error, "Unable to parse WSDL file at %s: \n\t%s" % \ + (wsdlsource, "\t".join(buf)) + + if self.wsdl is None: + import StringIO + self.wsdl = reader.loadFromString(str(wsdlsource)) + #print 'string' + + # Package wsdl info as a dictionary of remote methods, with method name + # as key (based on ServiceProxy.__init__ in ZSI library). + self.methods = {} + service = self.wsdl.services[0] + port = service.ports[0] + name = service.name + binding = port.getBinding() + portType = binding.getPortType() + for operation in portType.operations: + callinfo = wstools.WSDLTools.callInfoFromWSDL(port, operation.name) + self.methods[callinfo.methodName] = callinfo + + self.soapproxy = SOAPProxy('http://localhost/dummy.webservice', + config=config, **kw) + + def __str__(self): + s = '' + for method in self.methods.values(): + s += str(method) + return s + + def __getattr__(self, name): + """Set up environment then let parent class handle call. + + Raises AttributeError is method name is not found.""" + + if not self.methods.has_key(name): raise AttributeError, name + + callinfo = self.methods[name] + self.soapproxy.proxy = SOAPAddress(callinfo.location) + self.soapproxy.namespace = callinfo.namespace + self.soapproxy.soapaction = callinfo.soapAction + return self.soapproxy.__getattr__(name) + + def show_methods(self): + for key in self.methods.keys(): + method = self.methods[key] + print "Method Name:", key.ljust(15) + print + inps = method.inparams + for parm in range(len(inps)): + details = inps[parm] + print " In #%d: %s (%s)" % (parm, details.name, details.type) + print + outps = method.outparams + for parm in range(len(outps)): + details = outps[parm] + print " Out #%d: %s (%s)" % (parm, details.name, details.type) + print + diff --git a/SOAPpy/__init__.py b/SOAPpy/__init__.py new file mode 100644 index 00000000..f5f5419f --- /dev/null +++ b/SOAPpy/__init__.py @@ -0,0 +1,15 @@ + +ident = '$Id: __init__.py 541 2004-01-31 04:20:06Z warnes $' +from version import __version__ + +from Client import * +from Config import * +from Errors import * +from NS import * +from Parser import * +from SOAPBuilder import * +from Server import * +from Types import * +from Utilities import * +import wstools +import WSDL diff --git a/SOAPpy/version.py b/SOAPpy/version.py new file mode 100644 index 00000000..dd00d455 --- /dev/null +++ b/SOAPpy/version.py @@ -0,0 +1,2 @@ +__version__="0.12.5" + diff --git a/conf/requirements.development.pip b/conf/requirements.development.pip new file mode 100644 index 00000000..a2db122b --- /dev/null +++ b/conf/requirements.development.pip @@ -0,0 +1,3 @@ +ipdb==0.7 +ipython==0.13.1 +readline>=6.2.4.1 diff --git a/conf/requirements.production.pip b/conf/requirements.production.pip new file mode 100644 index 00000000..87abcb64 --- /dev/null +++ b/conf/requirements.production.pip @@ -0,0 +1,3 @@ +Twisted>=12.2.0 +argparse>=1.2.1 +pyOpenSSL>=0.13 diff --git a/conf/requirements.testing.pip b/conf/requirements.testing.pip new file mode 100644 index 00000000..d04ace95 --- /dev/null +++ b/conf/requirements.testing.pip @@ -0,0 +1,3 @@ +coverage==3.5.3 +unittest-xml-reporting==1.4.1 +unittest2==0.5.1 diff --git a/configure b/configure new file mode 100755 index 00000000..0e8f6adc --- /dev/null +++ b/configure @@ -0,0 +1,9 @@ +#!/bin/sh + +# === configure -----------------------------------------------------------=== + +touch Makefile.local + +# ===--------------------------------------------------------------------=== +# End of File +# ===--------------------------------------------------------------------=== diff --git a/dev/CLEAN b/dev/CLEAN new file mode 100644 index 00000000..3d13b838 --- /dev/null +++ b/dev/CLEAN @@ -0,0 +1 @@ +find p2pool/ -iname '*.py' | xargs pycl diff --git a/dev/COUNT b/dev/COUNT new file mode 100644 index 00000000..04c88353 --- /dev/null +++ b/dev/COUNT @@ -0,0 +1 @@ +find p2pool/ -not -path 'p2pool/test/*' -path '*.py' | xargs wc | sort -n diff --git a/dev/COVERAGE_REPORT b/dev/COVERAGE_REPORT new file mode 100644 index 00000000..2b019c53 --- /dev/null +++ b/dev/COVERAGE_REPORT @@ -0,0 +1 @@ +python -m coverage report --include='p2pool/*' --omit='p2pool/test/*' -m | sort -k 3 -n diff --git a/dev/COVERAGE_TEST b/dev/COVERAGE_TEST new file mode 100644 index 00000000..e9a63d95 --- /dev/null +++ b/dev/COVERAGE_TEST @@ -0,0 +1 @@ +python -m coverage run `which trial` p2pool p2pool.main diff --git a/dev/FIND b/dev/FIND new file mode 100644 index 00000000..89a4b37c --- /dev/null +++ b/dev/FIND @@ -0,0 +1 @@ +find p2pool/ -iname '*py' | xargs grep "$@" diff --git a/dev/LINT b/dev/LINT new file mode 100644 index 00000000..d5e9baa9 --- /dev/null +++ b/dev/LINT @@ -0,0 +1 @@ +pylint p2pool/ -E | grep -v reactor | grep -v hashlib | grep -v 'Yield outside function' | grep -v 'function already defined' diff --git a/dev/TEST b/dev/TEST new file mode 100644 index 00000000..21066949 --- /dev/null +++ b/dev/TEST @@ -0,0 +1,5 @@ +while true ; do + find -iname '*.pyc' | xargs rm + trial p2pool + git checkout HEAD^ +done diff --git a/dev/readme b/dev/readme new file mode 100644 index 00000000..b24adc33 --- /dev/null +++ b/dev/readme @@ -0,0 +1,7 @@ +Release procedure: +* Update network version +* Tag+sign last commit +* Upload Windows build +* Make forum post +* Update first post with links +* Send email to mailing list if necessary diff --git a/fpconst.py b/fpconst.py new file mode 100644 index 00000000..d33650a8 --- /dev/null +++ b/fpconst.py @@ -0,0 +1,178 @@ +"""Utilities for handling IEEE 754 floating point special values + +This python module implements constants and functions for working with +IEEE754 double-precision special values. It provides constants for +Not-a-Number (NaN), Positive Infinity (PosInf), and Negative Infinity +(NegInf), as well as functions to test for these values. + +The code is implemented in pure python by taking advantage of the +'struct' standard module. Care has been taken to generate proper +results on both big-endian and little-endian machines. Some efficiency +could be gained by translating the core routines into C. + +See +for reference material on the IEEE 754 floating point standard. + +Further information on this package is available at +. + +------------------------------------------------------------------ +Author: Gregory R. Warnes +Date: 2005-02-24 +Version: 0.7.2 +Copyright: (c) 2003-2005 Pfizer, Licensed to PSF under a Contributor Agreement +License: Licensed under the Apache License, Version 2.0 (the"License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in + writing, software distributed under the License is + distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR + CONDITIONS OF ANY KIND, either express or implied. See + the License for the specific language governing + permissions and limitations under the License. +------------------------------------------------------------------ +""" + +__version__ = "0.7.2" +ident = "$Id: fpconst.py,v 1.16 2005/02/24 17:42:03 warnes Exp $" + +import struct, operator + +# check endianess +_big_endian = struct.pack('i',1)[0] != '\x01' + +# and define appropriate constants +if(_big_endian): + NaN = struct.unpack('d', '\x7F\xF8\x00\x00\x00\x00\x00\x00')[0] + PosInf = struct.unpack('d', '\x7F\xF0\x00\x00\x00\x00\x00\x00')[0] + NegInf = -PosInf +else: + NaN = struct.unpack('d', '\x00\x00\x00\x00\x00\x00\xf8\xff')[0] + PosInf = struct.unpack('d', '\x00\x00\x00\x00\x00\x00\xf0\x7f')[0] + NegInf = -PosInf + +def _double_as_bytes(dval): + "Use struct.unpack to decode a double precision float into eight bytes" + tmp = list(struct.unpack('8B',struct.pack('d', dval))) + if not _big_endian: + tmp.reverse() + return tmp + +## +## Functions to extract components of the IEEE 754 floating point format +## + +def _sign(dval): + "Extract the sign bit from a double-precision floating point value" + bb = _double_as_bytes(dval) + return bb[0] >> 7 & 0x01 + +def _exponent(dval): + """Extract the exponentent bits from a double-precision floating + point value. + + Note that for normalized values, the exponent bits have an offset + of 1023. As a consequence, the actual exponentent is obtained + by subtracting 1023 from the value returned by this function + """ + bb = _double_as_bytes(dval) + return (bb[0] << 4 | bb[1] >> 4) & 0x7ff + +def _mantissa(dval): + """Extract the _mantissa bits from a double-precision floating + point value.""" + + bb = _double_as_bytes(dval) + mantissa = bb[1] & 0x0f << 48 + mantissa += bb[2] << 40 + mantissa += bb[3] << 32 + mantissa += bb[4] + return mantissa + +def _zero_mantissa(dval): + """Determine whether the mantissa bits of the given double are all + zero.""" + bb = _double_as_bytes(dval) + return ((bb[1] & 0x0f) | reduce(operator.or_, bb[2:])) == 0 + +## +## Functions to test for IEEE 754 special values +## + +def isNaN(value): + "Determine if the argument is a IEEE 754 NaN (Not a Number) value." + return (_exponent(value)==0x7ff and not _zero_mantissa(value)) + +def isInf(value): + """Determine if the argument is an infinite IEEE 754 value (positive + or negative inifinity)""" + return (_exponent(value)==0x7ff and _zero_mantissa(value)) + +def isFinite(value): + """Determine if the argument is an finite IEEE 754 value (i.e., is + not NaN, positive or negative inifinity)""" + return (_exponent(value)!=0x7ff) + +def isPosInf(value): + "Determine if the argument is a IEEE 754 positive infinity value" + return (_sign(value)==0 and _exponent(value)==0x7ff and \ + _zero_mantissa(value)) + +def isNegInf(value): + "Determine if the argument is a IEEE 754 negative infinity value" + return (_sign(value)==1 and _exponent(value)==0x7ff and \ + _zero_mantissa(value)) + +## +## Functions to test public functions. +## + +def test_isNaN(): + assert( not isNaN(PosInf) ) + assert( not isNaN(NegInf) ) + assert( isNaN(NaN ) ) + assert( not isNaN( 1.0) ) + assert( not isNaN( -1.0) ) + +def test_isInf(): + assert( isInf(PosInf) ) + assert( isInf(NegInf) ) + assert( not isInf(NaN ) ) + assert( not isInf( 1.0) ) + assert( not isInf( -1.0) ) + +def test_isFinite(): + assert( not isFinite(PosInf) ) + assert( not isFinite(NegInf) ) + assert( not isFinite(NaN ) ) + assert( isFinite( 1.0) ) + assert( isFinite( -1.0) ) + +def test_isPosInf(): + assert( isPosInf(PosInf) ) + assert( not isPosInf(NegInf) ) + assert( not isPosInf(NaN ) ) + assert( not isPosInf( 1.0) ) + assert( not isPosInf( -1.0) ) + +def test_isNegInf(): + assert( not isNegInf(PosInf) ) + assert( isNegInf(NegInf) ) + assert( not isNegInf(NaN ) ) + assert( not isNegInf( 1.0) ) + assert( not isNegInf( -1.0) ) + +# overall test +def test(): + test_isNaN() + test_isInf() + test_isFinite() + test_isPosInf() + test_isNegInf() + +if __name__ == "__main__": + test() + diff --git a/nattraverso/__init__.py b/nattraverso/__init__.py new file mode 100644 index 00000000..fe3df53b --- /dev/null +++ b/nattraverso/__init__.py @@ -0,0 +1,15 @@ +""" +This package offers ways to retreive ip addresses of the machine, and map ports +through various protocols. + +Currently only UPnP is implemented and available, in the pynupnp module. + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" + +__revision__ = "$id" +__version__ = "0.1.0" diff --git a/nattraverso/ipdiscover.py b/nattraverso/ipdiscover.py new file mode 100644 index 00000000..5c12ef38 --- /dev/null +++ b/nattraverso/ipdiscover.py @@ -0,0 +1,138 @@ +""" +Generic methods to retreive the IP address of the local machine. + +TODO: Example + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" + +__revision__ = "$id" + +import random, socket, logging, itertools + +from twisted.internet import defer, reactor + +from twisted.internet.protocol import DatagramProtocol +from twisted.internet.error import CannotListenError + +from nattraverso.utils import is_rfc1918_ip, is_bogus_ip + +@defer.inlineCallbacks +def get_local_ip(): + """ + Returns a deferred which will be called with a + 2-uple (lan_flag, ip_address) : + - lan_flag: + - True if it's a local network (RFC1918) + - False if it's a WAN address + + - ip_address is the actual ip address + + @return: A deferred called with the above defined tuple + @rtype: L{twisted.internet.defer.Deferred} + """ + # first we try a connected udp socket, then via multicast + logging.debug("Resolving dns to get udp ip") + try: + ipaddr = yield reactor.resolve('A.ROOT-SERVERS.NET') + except: + pass + else: + udpprot = DatagramProtocol() + port = reactor.listenUDP(0, udpprot) + udpprot.transport.connect(ipaddr, 7) + localip = udpprot.transport.getHost().host + port.stopListening() + + if is_bogus_ip(localip): + raise RuntimeError, "Invalid IP address returned" + else: + defer.returnValue((is_rfc1918_ip(localip), localip)) + + logging.debug("Multicast ping to retrieve local IP") + ipaddr = yield _discover_multicast() + defer.returnValue((is_rfc1918_ip(ipaddr), ipaddr)) + +@defer.inlineCallbacks +def get_external_ip(): + """ + Returns a deferred which will be called with a + 2-uple (wan_flag, ip_address): + - wan_flag: + - True if it's a WAN address + - False if it's a LAN address + - None if it's a localhost (127.0.0.1) address + - ip_address: the most accessible ip address of this machine + + @return: A deferred called with the above defined tuple + @rtype: L{twisted.internet.defer.Deferred} + """ + + try: + local, ipaddr = yield get_local_ip() + except: + defer.returnValue((None, "127.0.0.1")) + if not local: + defer.returnValue((True, ipaddr)) + logging.debug("Got local ip, trying to use upnp to get WAN ip") + import nattraverso.pynupnp + try: + ipaddr2 = yield nattraverso.pynupnp.get_external_ip() + except: + defer.returnValue((False, ipaddr)) + else: + defer.returnValue((True, ipaddr2)) + +class _LocalNetworkMulticast(DatagramProtocol): + def __init__(self, nonce): + from p2pool.util import variable + + self.nonce = nonce + self.address_received = variable.Event() + + def datagramReceived(self, dgram, addr): + """Datagram received, we callback the IP address.""" + logging.debug("Received multicast pong: %s; addr:%r", dgram, addr) + if dgram != self.nonce: + return + self.address_received.happened(addr[0]) + +@defer.inlineCallbacks +def _discover_multicast(): + """ + Local IP discovery protocol via multicast: + - Broadcast 3 ping multicast packet with "ping" in it + - Wait for an answer + - Retrieve the ip address from the returning packet, which is ours + """ + + nonce = str(random.randrange(2**64)) + p = _LocalNetworkMulticast(nonce) + + for attempt in itertools.count(): + port = 11000 + random.randint(0, 5000) + try: + mcast = reactor.listenMulticast(port, p) + except CannotListenError: + if attempt >= 10: + raise + continue + else: + break + + try: + yield mcast.joinGroup('239.255.255.250', socket.INADDR_ANY) + + logging.debug("Sending multicast ping") + for i in xrange(3): + p.transport.write(nonce, ('239.255.255.250', port)) + + address, = yield p.address_received.get_deferred(5) + finally: + mcast.stopListening() + + defer.returnValue(address) diff --git a/nattraverso/portmapper.py b/nattraverso/portmapper.py new file mode 100644 index 00000000..d026b012 --- /dev/null +++ b/nattraverso/portmapper.py @@ -0,0 +1,118 @@ +""" +Generic NAT Port mapping interface. + +TODO: Example + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" + +__revision__ = "$id" + +from twisted.internet.base import BasePort + +# Public API +def get_port_mapper(proto="TCP"): + """ + Returns a L{NATMapper} instance, suited to map a port for + the given protocol. Defaults to TCP. + + For the moment, only upnp mapper is available. It accepts both UDP and TCP. + + @param proto: The protocol: 'TCP' or 'UDP' + @type proto: string + @return: A deferred called with a L{NATMapper} instance + @rtype: L{twisted.internet.defer.Deferred} + """ + import nattraverso.pynupnp + return nattraverso.pynupnp.get_port_mapper() + +class NATMapper: + """ + Define methods to map port objects (as returned by twisted's listenXX). + This allows NAT to be traversed from incoming packets. + + Currently the only implementation of this class is the UPnP Mapper, which + can map UDP and TCP ports, if an UPnP Device exists. + """ + def __init__(self): + raise NotImplementedError("Cannot instantiate the class") + + def map(self, port): + """ + Create a mapping for the given twisted's port object. + + The deferred will call back with a tuple (extaddr, extport): + - extaddr: The ip string of the external ip address of this host + - extport: the external port number used to map the given Port object + + When called multiple times with the same Port, + callback with the existing mapping. + + @param port: The port object to map + @type port: a L{twisted.internet.interfaces.IListeningPort} object + @return: A deferred called with the above defined tuple + @rtype: L{twisted.internet.defer.Deferred} + """ + raise NotImplementedError + + def info(self, port): + """ + Returns the existing mapping for the given port object. That means map() + has to be called before. + + @param port: The port object to retreive info from + @type port: a L{twisted.internet.interfaces.IListeningPort} object + @raise ValueError: When there is no such existing mapping + @return: a tuple (extaddress, extport). + @see: L{map() function} + """ + raise NotImplementedError + + def unmap(self, port): + """ + Remove an existing mapping for the given twisted's port object. + + @param port: The port object to unmap + @type port: a L{twisted.internet.interfaces.IListeningPort} object + @return: A deferred called with None + @rtype: L{twisted.internet.defer.Deferred} + @raise ValueError: When there is no such existing mapping + """ + raise NotImplementedError + + def get_port_mappings(self): + """ + Returns a deferred that will be called with a dictionnary of the + existing mappings. + + The dictionnary structure is the following: + - Keys: tuple (protocol, external_port) + - protocol is "TCP" or "UDP". + - external_port is the external port number, as see on the + WAN side. + - Values:tuple (internal_ip, internal_port) + - internal_ip is the LAN ip address of the host. + - internal_port is the internal port number mapped + to external_port. + + @return: A deferred called with the above defined dictionnary + @rtype: L{twisted.internet.defer.Deferred} + """ + raise NotImplementedError + + def _check_valid_port(self, port): + """Various Port object validity checks. Raise a ValueError.""" + if not isinstance(port, BasePort): + raise ValueError("expected a Port, got %r"%(port)) + + if not port.connected: + raise ValueError("Port %r is not listening"%(port)) + + loc_addr = port.getHost() + if loc_addr.port == 0: + raise ValueError("Port %r has port number of 0"%(port)) + diff --git a/nattraverso/pynupnp/__init__.py b/nattraverso/pynupnp/__init__.py new file mode 100644 index 00000000..7c90af81 --- /dev/null +++ b/nattraverso/pynupnp/__init__.py @@ -0,0 +1,33 @@ +""" +This package offers ways to retreive ip addresses of the machine, and map ports +through UPnP devices. + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" +__revision__ = "$id" + +from nattraverso.pynupnp.upnp import search_upnp_device, UPnPMapper + +def get_external_ip(): + """ + Returns a deferred which will be called with the WAN ip address + retreived through UPnP. The ip is a string of the form "x.x.x.x" + + @return: A deferred called with the external ip address of this host + @rtype: L{twisted.internet.defer.Deferred} + """ + return search_upnp_device().addCallback(lambda x: x.get_external_ip()) + +def get_port_mapper(): + """ + Returns a deferred which will be called with a L{UPnPMapper} instance. + This is a L{nattraverso.portmapper.NATMapper} implementation. + + @return: A deferred called with the L{UPnPMapper} instance. + @rtype: L{twisted.internet.defer.Deferred} + """ + return search_upnp_device().addCallback(lambda x: UPnPMapper(x)) diff --git a/nattraverso/pynupnp/soap.py b/nattraverso/pynupnp/soap.py new file mode 100644 index 00000000..487bb88f --- /dev/null +++ b/nattraverso/pynupnp/soap.py @@ -0,0 +1,104 @@ +""" +This module is a SOAP client using twisted's deferreds. +It uses the SOAPpy package. + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" + +__revision__ = "$id" + +import SOAPpy, logging +from SOAPpy.Config import Config +from twisted.web import client, error + +#General config +Config.typed = False + +class SoapError(Exception): + """ + This is a SOAP error message, not an HTTP error message. + + The content of this error is a SOAPpy structure representing the + SOAP error message. + """ + pass + +class SoapProxy: + """ + Proxy for an url to which we send SOAP rpc calls. + """ + def __init__(self, url, prefix): + """ + Init the proxy, it will connect to the given url, using the + given soap namespace. + + @param url: The url of the remote host to call + @param prefix: The namespace prefix to use, eg. + 'urn:schemas-upnp-org:service:WANIPConnection:1' + """ + logging.debug("Soap Proxy: '%s', prefix: '%s'", url, prefix) + self._url = url + self._prefix = prefix + + def call(self, method, **kwargs): + """ + Call the given remote method with the given arguments, as keywords. + + Returns a deferred, called with SOAPpy structure representing + the soap response. + + @param method: The method name to call, eg. 'GetExternalIP' + @param kwargs: The parameters of the call, as keywords + @return: A deferred called with the external ip address of this host + @rtype: L{twisted.internet.defer.Deferred} + """ + payload = SOAPpy.buildSOAP(method=method, config=Config, namespace=self._prefix, kw=kwargs) + # Here begins the nasty hack + payload = payload.replace( + # Upnp wants s: instead of SOAP-ENV + 'SOAP-ENV','s').replace( + # Doesn't seem to like these encoding stuff + 'xmlns:SOAP-ENC="http://schemas.xmlsoap.org/soap/encoding/"', '').replace( + 'SOAP-ENC:root="1"', '').replace( + # And it wants u: instead of ns1 namespace for arguments.. + 'ns1','u') + + logging.debug("SOAP Payload:\n%s", payload) + + return client.getPage(self._url, postdata=payload, method="POST", + headers={'content-type': 'text/xml', 'SOAPACTION': '%s#%s' % (self._prefix, method)} + ).addCallbacks(self._got_page, self._got_error) + + def _got_page(self, result): + """ + The http POST command was successful, we parse the SOAP + answer, and return it. + + @param result: the xml content + """ + parsed = SOAPpy.parseSOAPRPC(result) + + logging.debug("SOAP Answer:\n%s", result) + logging.debug("SOAP Parsed Answer: %r", parsed) + + return parsed + + def _got_error(self, res): + """ + The HTTP POST command did not succeed, depending on the error type: + - it's a SOAP error, we parse it and return a L{SoapError}. + - it's another type of error (http, other), we raise it as is + """ + logging.debug("SOAP Error:\n%s", res) + + if isinstance(res.value, error.Error): + try: + logging.debug("SOAP Error content:\n%s", res.value.response) + raise SoapError(SOAPpy.parseSOAPRPC(res.value.response)["detail"]) + except: + raise + raise Exception(res.value) diff --git a/nattraverso/pynupnp/upnp.py b/nattraverso/pynupnp/upnp.py new file mode 100644 index 00000000..c3bea759 --- /dev/null +++ b/nattraverso/pynupnp/upnp.py @@ -0,0 +1,530 @@ +""" +This module is the heart of the upnp support. Device discover, ip discovery +and port mappings are implemented here. + +@author: Raphael Slinckx +@author: Anthony Baxter +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" +__revision__ = "$id" + +import socket, random, urlparse, logging + +from twisted.internet import reactor, defer +from twisted.web import client +from twisted.internet.protocol import DatagramProtocol +from twisted.internet.error import CannotListenError +from twisted.python import failure + +from nattraverso.pynupnp.soap import SoapProxy +from nattraverso.pynupnp.upnpxml import UPnPXml +from nattraverso import ipdiscover, portmapper + +class UPnPError(Exception): + """ + A generic UPnP error, with a descriptive message as content. + """ + pass + +class UPnPMapper(portmapper.NATMapper): + """ + This is the UPnP port mapper implementing the + L{NATMapper} interface. + + @see: L{NATMapper} + """ + + def __init__(self, upnp): + """ + Creates the mapper, with the given L{UPnPDevice} instance. + + @param upnp: L{UPnPDevice} instance + """ + self._mapped = {} + self._upnp = upnp + + def map(self, port): + """ + See interface + """ + self._check_valid_port(port) + + #Port is already mapped + if port in self._mapped: + return defer.succeed(self._mapped[port]) + + #Trigger a new mapping creation, first fetch local ip. + result = ipdiscover.get_local_ip() + self._mapped[port] = result + return result.addCallback(self._map_got_local_ip, port) + + def info(self, port): + """ + See interface + """ + # If the mapping exists, everything's ok + if port in self._mapped: + return self._mapped[port] + else: + raise ValueError('Port %r is not currently mapped'%(port)) + + def unmap(self, port): + """ + See interface + """ + if port in self._mapped: + existing = self._mapped[port] + + #Pending mapping, queue an unmap,return existing deferred + if type(existing) is not tuple: + existing.addCallback(lambda x: self.unmap(port)) + return existing + + #Remove our local mapping + del self._mapped[port] + + #Ask the UPnP to remove the mapping + extaddr, extport = existing + return self._upnp.remove_port_mapping(extport, port.getHost().type) + else: + raise ValueError('Port %r is not currently mapped'%(port)) + + def get_port_mappings(self): + """ + See interface + """ + return self._upnp.get_port_mappings() + + def _map_got_local_ip(self, ip_result, port): + """ + We got the local ip address, retreive the existing port mappings + in the device. + + @param ip_result: result of L{ipdiscover.get_local_ip} + @param port: a L{twisted.internet.interfaces.IListeningPort} we + want to map + """ + local, ip = ip_result + return self._upnp.get_port_mappings().addCallback( + self._map_got_port_mappings, ip, port) + + def _map_got_port_mappings(self, mappings, ip, port): + """ + We got all the existing mappings in the device, find an unused one + and assign it for the requested port. + + @param ip: The local ip of this host "x.x.x.x" + @param port: a L{twisted.internet.interfaces.IListeningPort} we + want to map + @param mappings: result of L{UPnPDevice.get_port_mappings} + """ + + #Get the requested mapping's info + ptype = port.getHost().type + intport = port.getHost().port + + for extport in [random.randrange(1025, 65536) for val in range(20)]: + # Check if there is an existing mapping, if it does not exist, bingo + if not (ptype, extport) in mappings: + break + + if (ptype, extport) in mappings: + existing = mappings[ptype, extport] + + local_ip, local_port = existing + if local_ip == ip and local_port == intport: + # Existing binding for this host/port/proto - replace it + break + + # Triggers the creation of the mapping on the device + result = self._upnp.add_port_mapping(ip, intport, extport, 'pynupnp', ptype) + + # We also need the external IP, so we queue first an + # External IP Discovery, then we add the mapping. + return result.addCallback( + lambda x: self._upnp.get_external_ip()).addCallback( + self._port_mapping_added, extport, port) + + def _port_mapping_added(self, extaddr, extport, port): + """ + The port mapping was added in the device, this means:: + + Internet NAT LAN + | + > IP:extaddr |> IP:local ip + > Port:extport |> Port:port + | + + @param extaddr: The exernal ip address + @param extport: The external port as number + @param port: The internal port as a + L{twisted.internet.interfaces.IListeningPort} object, that has been + mapped + """ + self._mapped[port] = (extaddr, extport) + return (extaddr, extport) + +class UPnPDevice: + """ + Represents an UPnP device, with the associated infos, and remote methods. + """ + def __init__(self, soap_proxy, info): + """ + Build the device, with the given SOAP proxy, and the meta-infos. + + @param soap_proxy: an initialized L{SoapProxy} to the device + @param info: a dictionnary of various infos concerning the + device extracted with L{UPnPXml} + """ + self._soap_proxy = soap_proxy + self._info = info + + def get_external_ip(self): + """ + Triggers an external ip discovery on the upnp device. Returns + a deferred called with the external ip of this host. + + @return: A deferred called with the ip address, as "x.x.x.x" + @rtype: L{twisted.internet.defer.Deferred} + """ + result = self._soap_proxy.call('GetExternalIPAddress') + result.addCallback(self._on_external_ip) + return result + + def get_port_mappings(self): + """ + Retreive the existing port mappings + + @see: L{portmapper.NATMapper.get_port_mappings} + @return: A deferred called with the dictionnary as defined + in the interface L{portmapper.NATMapper.get_port_mappings} + @rtype: L{twisted.internet.defer.Deferred} + """ + return self._get_port_mapping() + + def add_port_mapping(self, local_ip, intport, extport, desc, proto, lease=0): + """ + Add a port mapping in the upnp device. Returns a deferred. + + @param local_ip: the LAN ip of this host as "x.x.x.x" + @param intport: the internal port number + @param extport: the external port number + @param desc: the description of this mapping (string) + @param proto: "UDP" or "TCP" + @param lease: The duration of the lease in (mili)seconds(??) + @return: A deferred called with None when the mapping is done + @rtype: L{twisted.internet.defer.Deferred} + """ + result = self._soap_proxy.call('AddPortMapping', NewRemoteHost="", + NewExternalPort=extport, + NewProtocol=proto, + NewInternalPort=intport, + NewInternalClient=local_ip, + NewEnabled=1, + NewPortMappingDescription=desc, + NewLeaseDuration=lease) + + return result.addCallbacks(self._on_port_mapping_added, + self._on_no_port_mapping_added) + + def remove_port_mapping(self, extport, proto): + """ + Remove an existing port mapping on the device. Returns a deferred + + @param extport: the external port number associated to the mapping + to be removed + @param proto: either "UDP" or "TCP" + @return: A deferred called with None when the mapping is done + @rtype: L{twisted.internet.defer.Deferred} + """ + result = self._soap_proxy.call('DeletePortMapping', NewRemoteHost="", + NewExternalPort=extport, + NewProtocol=proto) + + return result.addCallbacks(self._on_port_mapping_removed, + self._on_no_port_mapping_removed) + + # Private -------- + def _on_external_ip(self, res): + """ + Called when we received the external ip address from the device. + + @param res: the SOAPpy structure of the result + @return: the external ip string, as "x.x.x.x" + """ + logging.debug("Got external ip struct: %r", res) + return res['NewExternalIPAddress'] + + def _get_port_mapping(self, mapping_id=0, mappings=None): + """ + Fetch the existing mappings starting at index + "mapping_id" from the device. + + To retreive all the mappings call this without parameters. + + @param mapping_id: The index of the mapping to start fetching from + @param mappings: the dictionnary of already fetched mappings + @return: A deferred called with the existing mappings when all have been + retreived, see L{get_port_mappings} + @rtype: L{twisted.internet.defer.Deferred} + """ + if mappings == None: + mappings = {} + + result = self._soap_proxy.call('GetGenericPortMappingEntry', + NewPortMappingIndex=mapping_id) + return result.addCallbacks( + lambda x: self._on_port_mapping_received(x, mapping_id+1, mappings), + lambda x: self._on_no_port_mapping_received( x, mappings)) + + def _on_port_mapping_received(self, response, mapping_id, mappings): + """ + Called we we receive a single mapping from the device. + + @param response: a SOAPpy structure, representing the device's answer + @param mapping_id: The index of the next mapping in the device + @param mappings: the already fetched mappings, see L{get_port_mappings} + @return: A deferred called with the existing mappings when all have been + retreived, see L{get_port_mappings} + @rtype: L{twisted.internet.defer.Deferred} + """ + logging.debug("Got mapping struct: %r", response) + mappings[ + response['NewProtocol'], response['NewExternalPort'] + ] = (response['NewInternalClient'], response['NewInternalPort']) + return self._get_port_mapping(mapping_id, mappings) + + def _on_no_port_mapping_received(self, failure, mappings): + """ + Called when we have no more port mappings to retreive, or an + error occured while retreiving them. + + Either we have a "SpecifiedArrayIndexInvalid" SOAP error, and that's ok, + it just means we have finished. If it returns some other error, then we + fail with an UPnPError. + + @param mappings: the already retreived mappings + @param failure: the failure + @return: The existing mappings as defined in L{get_port_mappings} + @raise UPnPError: When we got any other error + than "SpecifiedArrayIndexInvalid" + """ + logging.debug("_on_no_port_mapping_received: %s", failure) + err = failure.value + message = err.args[0]["UPnPError"]["errorDescription"] + if "SpecifiedArrayIndexInvalid" == message: + return mappings + else: + return failure + + + def _on_port_mapping_added(self, response): + """ + The port mapping was successfully added, return None to the deferred. + """ + return None + + def _on_no_port_mapping_added(self, failure): + """ + Called when the port mapping could not be added. Immediately + raise an UPnPError, with the SOAPpy structure inside. + + @raise UPnPError: When the port mapping could not be added + """ + return failure + + def _on_port_mapping_removed(self, response): + """ + The port mapping was successfully removed, return None to the deferred. + """ + return None + + def _on_no_port_mapping_removed(self, failure): + """ + Called when the port mapping could not be removed. Immediately + raise an UPnPError, with the SOAPpy structure inside. + + @raise UPnPError: When the port mapping could not be deleted + """ + return failure + +# UPNP multicast address, port and request string +_UPNP_MCAST = '239.255.255.250' +_UPNP_PORT = 1900 +_UPNP_SEARCH_REQUEST = """M-SEARCH * HTTP/1.1\r +Host:%s:%s\r +ST:urn:schemas-upnp-org:device:InternetGatewayDevice:1\r +Man:"ssdp:discover"\r +MX:3\r +\r +""" % (_UPNP_MCAST, _UPNP_PORT) + +class UPnPProtocol(DatagramProtocol, object): + """ + The UPnP Device discovery udp multicast twisted protocol. + """ + + def __init__(self, *args, **kwargs): + """ + Init the protocol, no parameters needed. + """ + super(UPnPProtocol, self).__init__(*args, **kwargs) + + #Device discovery deferred + self._discovery = None + self._discovery_timeout = None + self.mcast = None + self._done = False + + # Public methods + def search_device(self): + """ + Triggers a UPnP device discovery. + + The returned deferred will be called with the L{UPnPDevice} that has + been found in the LAN. + + @return: A deferred called with the detected L{UPnPDevice} instance. + @rtype: L{twisted.internet.defer.Deferred} + """ + if self._discovery is not None: + raise ValueError('already used') + self._discovery = defer.Deferred() + self._discovery_timeout = reactor.callLater(6, self._on_discovery_timeout) + + attempt = 0 + mcast = None + while True: + try: + self.mcast = reactor.listenMulticast(1900+attempt, self) + break + except CannotListenError: + attempt = random.randint(0, 500) + + # joined multicast group, starting upnp search + self.mcast.joinGroup('239.255.255.250', socket.INADDR_ANY) + + self.transport.write(_UPNP_SEARCH_REQUEST, (_UPNP_MCAST, _UPNP_PORT)) + self.transport.write(_UPNP_SEARCH_REQUEST, (_UPNP_MCAST, _UPNP_PORT)) + self.transport.write(_UPNP_SEARCH_REQUEST, (_UPNP_MCAST, _UPNP_PORT)) + + return self._discovery + + #Private methods + def datagramReceived(self, dgram, address): + if self._done: + return + """ + This is private, handle the multicast answer from the upnp device. + """ + logging.debug("Got UPNP multicast search answer:\n%s", dgram) + + #This is an HTTP response + response, message = dgram.split('\r\n', 1) + + # Prepare status line + version, status, textstatus = response.split(None, 2) + + if not version.startswith('HTTP'): + return + if status != "200": + return + + # Launch the info fetching + def parse_discovery_response(message): + """Separate headers and body from the received http answer.""" + hdict = {} + body = '' + remaining = message + while remaining: + line, remaining = remaining.split('\r\n', 1) + line = line.strip() + if not line: + body = remaining + break + key, val = line.split(':', 1) + key = key.lower() + hdict.setdefault(key, []).append(val.strip()) + return hdict, body + + headers, body = parse_discovery_response(message) + + if not 'location' in headers: + self._on_discovery_failed( + UPnPError( + "No location header in response to M-SEARCH!: %r"%headers)) + return + + loc = headers['location'][0] + result = client.getPage(url=loc) + result.addCallback(self._on_gateway_response, loc).addErrback(self._on_discovery_failed) + + def _on_gateway_response(self, body, loc): + if self._done: + return + """ + Called with the UPnP device XML description fetched via HTTP. + + If the device has suitable services for ip discovery and port mappings, + the callback returned in L{search_device} is called with + the discovered L{UPnPDevice}. + + @raise UPnPError: When no suitable service has been + found in the description, or another error occurs. + @param body: The xml description of the device. + @param loc: the url used to retreive the xml description + """ + + # Parse answer + upnpinfo = UPnPXml(body) + + # Check if we have a base url, if not consider location as base url + urlbase = upnpinfo.urlbase + if urlbase == None: + urlbase = loc + + # Check the control url, if None, then the device cannot do what we want + controlurl = upnpinfo.controlurl + if controlurl == None: + self._on_discovery_failed(UPnPError("upnp response showed no WANConnections")) + return + + control_url2 = urlparse.urljoin(urlbase, controlurl) + soap_proxy = SoapProxy(control_url2, upnpinfo.wanservice) + self._on_discovery_succeeded(UPnPDevice(soap_proxy, upnpinfo.deviceinfos)) + + def _on_discovery_succeeded(self, res): + if self._done: + return + self._done = True + self.mcast.stopListening() + self._discovery_timeout.cancel() + self._discovery.callback(res) + + def _on_discovery_failed(self, err): + if self._done: + return + self._done = True + self.mcast.stopListening() + self._discovery_timeout.cancel() + self._discovery.errback(err) + + def _on_discovery_timeout(self): + if self._done: + return + self._done = True + self.mcast.stopListening() + self._discovery.errback(failure.Failure(defer.TimeoutError('in _on_discovery_timeout'))) + +def search_upnp_device (): + """ + Check the network for an UPnP device. Returns a deferred + with the L{UPnPDevice} instance as result, if found. + + @return: A deferred called with the L{UPnPDevice} instance + @rtype: L{twisted.internet.defer.Deferred} + """ + return defer.maybeDeferred(UPnPProtocol().search_device) diff --git a/nattraverso/pynupnp/upnpxml.py b/nattraverso/pynupnp/upnpxml.py new file mode 100644 index 00000000..75059dc1 --- /dev/null +++ b/nattraverso/pynupnp/upnpxml.py @@ -0,0 +1,89 @@ +""" +This module parse an UPnP device's XML definition in an Object. + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" + +__revision__ = "$id" + +from xml.dom import minidom +import logging + +# Allowed UPnP services to use when mapping ports/external addresses +WANSERVICES = ['urn:schemas-upnp-org:service:WANIPConnection:1', + 'urn:schemas-upnp-org:service:WANPPPConnection:1'] + +class UPnPXml: + """ + This objects parses the XML definition, and stores the useful + results in attributes. + + The device infos dictionnary may contain the following keys: + - friendlyname: A friendly name to call the device. + - manufacturer: A manufacturer name for the device. + + Here are the different attributes: + - deviceinfos: A dictionnary of device infos as defined above. + - controlurl: The control url, this is the url to use when sending SOAP + requests to the device, relative to the base url. + - wanservice: The WAN service to be used, one of the L{WANSERVICES} + - urlbase: The base url to use when talking in SOAP to the device. + + The full url to use is obtained by urljoin(urlbase, controlurl) + """ + + def __init__(self, xml): + """ + Parse the given XML string for UPnP infos. This creates the attributes + when they are found, or None if no value was found. + + @param xml: a xml string to parse + """ + logging.debug("Got UPNP Xml description:\n%s", xml) + doc = minidom.parseString(xml) + + # Fetch various device info + self.deviceinfos = {} + try: + attributes = { + 'friendlyname':'friendlyName', + 'manufacturer' : 'manufacturer' + } + device = doc.getElementsByTagName('device')[0] + for name, tag in attributes.iteritems(): + try: + self.deviceinfos[name] = device.getElementsByTagName( + tag)[0].firstChild.datas.encode('utf-8') + except: + pass + except: + pass + + # Fetch device control url + self.controlurl = None + self.wanservice = None + + for service in doc.getElementsByTagName('service'): + try: + stype = service.getElementsByTagName( + 'serviceType')[0].firstChild.data.encode('utf-8') + if stype in WANSERVICES: + self.controlurl = service.getElementsByTagName( + 'controlURL')[0].firstChild.data.encode('utf-8') + self.wanservice = stype + break + except: + pass + + # Find base url + self.urlbase = None + try: + self.urlbase = doc.getElementsByTagName( + 'URLBase')[0].firstChild.data.encode('utf-8') + except: + pass + diff --git a/nattraverso/utils.py b/nattraverso/utils.py new file mode 100644 index 00000000..1bfc6da5 --- /dev/null +++ b/nattraverso/utils.py @@ -0,0 +1,56 @@ +""" +Various utility functions used in the nattraverso package. + +@author: Raphael Slinckx +@copyright: Copyright 2005 +@license: LGPL +@contact: U{raphael@slinckx.net} +@version: 0.1.0 +""" +__revision__ = "$id" + +def is_rfc1918_ip(ip): + """ + Checks if the given ip address is a rfc1918 one. + + @param ip: The ip address to test + @type ip: a string "x.x.x.x" + @return: True if it's a LAN address, False otherwise + """ + if isinstance(ip, basestring): + ip = _ip_to_number(ip) + + for net, mask in _nets: + if ip&mask == net: + return True + + return False + +def is_bogus_ip(ip): + """ + Checks if the given ip address is bogus, i.e. 0.0.0.0 or 127.0.0.1. + + @param ip: The ip address to test + @type ip: a string "x.x.x.x" + @return: True if it's bogus, False otherwise + """ + return ip.startswith('0.') or ip.startswith('127.') + +def _ip_to_number(ipstr): + """ + Translate a string ip address to a packed number. + + @param ipstr: the ip address to transform + @type ipstr: a string "x.x.x.x" + @return: an int32 number representing the ip address + """ + net = [ int(digit) for digit in ipstr.split('.') ] + [ 0, 0, 0 ] + net = net[:4] + return ((((((0L+net[0])<<8) + net[1])<<8) + net[2])<<8) +net[3] + +# List of rfc1918 net/mask +_rfc1918_networks = [('127', 8), ('192.168', 16), ('10', 8), ('172.16', 12)] +# Machine readable form of the above +_nets = [(_ip_to_number(net), (2L**32 -1)^(2L**(32-mask)-1)) + for net, mask in _rfc1918_networks] + diff --git a/p2pool/__init__.py b/p2pool/__init__.py new file mode 100644 index 00000000..6773d6f3 --- /dev/null +++ b/p2pool/__init__.py @@ -0,0 +1,49 @@ +import os +import re +import sys +import traceback +import subprocess + +def check_output(*popenargs, **kwargs): + process = subprocess.Popen(stdout=subprocess.PIPE, *popenargs, **kwargs) + output, unused_err = process.communicate() + retcode = process.poll() + if retcode: + raise ValueError((retcode, output)) + return output + +def _get_version(): + try: + try: + return check_output(['git', 'describe', '--always', '--dirty'], cwd=os.path.dirname(os.path.abspath(sys.argv[0]))).strip() + except: + pass + try: + return check_output(['git.cmd', 'describe', '--always', '--dirty'], cwd=os.path.dirname(os.path.abspath(sys.argv[0]))).strip() + except: + pass + + root_dir = os.path.abspath(os.path.dirname(sys.argv[0])) + git_dir = os.path.join(root_dir, '.git') + if os.path.exists(git_dir): + head = open(os.path.join(git_dir, 'HEAD')).read().strip() + prefix = 'ref: ' + if head.startswith(prefix): + path = head[len(prefix):].split('/') + return open(os.path.join(git_dir, *path)).read().strip()[:7] + else: + return head[:7] + + dir_name = os.path.split(root_dir)[1] + match = re.match('p2pool-([.0-9]+)', dir_name) + if match: + return match.groups()[0] + + return 'unknown %s' % (dir_name.encode('hex'),) + except Exception, e: + traceback.print_exc() + return 'unknown %s' % (str(e).encode('hex'),) + +__version__ = _get_version() + +DEBUG = True diff --git a/p2pool/bitcoin/__init__.py b/p2pool/bitcoin/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/p2pool/bitcoin/data.py b/p2pool/bitcoin/data.py new file mode 100644 index 00000000..88e17308 --- /dev/null +++ b/p2pool/bitcoin/data.py @@ -0,0 +1,312 @@ +from __future__ import division + +import hashlib +import random +import warnings + +import p2pool +from p2pool.util import math, pack + +def hash256(data): + return pack.IntType(256).unpack(hashlib.sha256(hashlib.sha256(data).digest()).digest()) + +def hash160(data): + if data == '04ffd03de44a6e11b9917f3a29f9443283d9871c9d743ef30d5eddcd37094b64d1b3d8090496b53256786bf5c82932ec23c3b74d9f05a6f95a8b5529352656664b'.decode('hex'): + return 0x384f570ccc88ac2e7e00b026d1690a3fca63dd0 # hack for people who don't have openssl - this is the only value that p2pool ever hashes + return pack.IntType(160).unpack(hashlib.new('ripemd160', hashlib.sha256(data).digest()).digest()) + +class ChecksummedType(pack.Type): + def __init__(self, inner, checksum_func=lambda data: hashlib.sha256(hashlib.sha256(data).digest()).digest()[:4]): + self.inner = inner + self.checksum_func = checksum_func + + def read(self, file): + obj, file = self.inner.read(file) + data = self.inner.pack(obj) + + calculated_checksum = self.checksum_func(data) + checksum, file = pack.read(file, len(calculated_checksum)) + if checksum != calculated_checksum: + raise ValueError('invalid checksum') + + return obj, file + + def write(self, file, item): + data = self.inner.pack(item) + return (file, data), self.checksum_func(data) + +class FloatingInteger(object): + __slots__ = ['bits', '_target'] + + @classmethod + def from_target_upper_bound(cls, target): + n = math.natural_to_string(target) + if n and ord(n[0]) >= 128: + n = '\x00' + n + bits2 = (chr(len(n)) + (n + 3*chr(0))[:3])[::-1] + bits = pack.IntType(32).unpack(bits2) + return cls(bits) + + def __init__(self, bits, target=None): + self.bits = bits + self._target = None + if target is not None and self.target != target: + raise ValueError('target does not match') + + @property + def target(self): + res = self._target + if res is None: + res = self._target = math.shift_left(self.bits & 0x00ffffff, 8 * ((self.bits >> 24) - 3)) + return res + + def __hash__(self): + return hash(self.bits) + + def __eq__(self, other): + return self.bits == other.bits + + def __ne__(self, other): + return not (self == other) + + def __cmp__(self, other): + assert False + + def __repr__(self): + return 'FloatingInteger(bits=%s, target=%s)' % (hex(self.bits), hex(self.target)) + +class FloatingIntegerType(pack.Type): + _inner = pack.IntType(32) + + def read(self, file): + bits, file = self._inner.read(file) + return FloatingInteger(bits), file + + def write(self, file, item): + return self._inner.write(file, item.bits) + +address_type = pack.ComposedType([ + ('services', pack.IntType(64)), + ('address', pack.IPV6AddressType()), + ('port', pack.IntType(16, 'big')), +]) + +tx_type = pack.ComposedType([ + ('version', pack.IntType(32)), + ('tx_ins', pack.ListType(pack.ComposedType([ + ('previous_output', pack.PossiblyNoneType(dict(hash=0, index=2**32 - 1), pack.ComposedType([ + ('hash', pack.IntType(256)), + ('index', pack.IntType(32)), + ]))), + ('script', pack.VarStrType()), + ('sequence', pack.PossiblyNoneType(2**32 - 1, pack.IntType(32))), + ]))), + ('tx_outs', pack.ListType(pack.ComposedType([ + ('value', pack.IntType(64)), + ('script', pack.VarStrType()), + ]))), + ('lock_time', pack.IntType(32)), +]) + +merkle_link_type = pack.ComposedType([ + ('branch', pack.ListType(pack.IntType(256))), + ('index', pack.IntType(32)), +]) + +merkle_tx_type = pack.ComposedType([ + ('tx', tx_type), + ('block_hash', pack.IntType(256)), + ('merkle_link', merkle_link_type), +]) + +block_header_type = pack.ComposedType([ + ('version', pack.IntType(32)), + ('previous_block', pack.PossiblyNoneType(0, pack.IntType(256))), + ('merkle_root', pack.IntType(256)), + ('timestamp', pack.IntType(32)), + ('bits', FloatingIntegerType()), + ('nonce', pack.IntType(32)), +]) + +block_type = pack.ComposedType([ + ('header', block_header_type), + ('txs', pack.ListType(tx_type)), +]) + +# merged mining + +aux_pow_type = pack.ComposedType([ + ('merkle_tx', merkle_tx_type), + ('merkle_link', merkle_link_type), + ('parent_block_header', block_header_type), +]) + +aux_pow_coinbase_type = pack.ComposedType([ + ('merkle_root', pack.IntType(256, 'big')), + ('size', pack.IntType(32)), + ('nonce', pack.IntType(32)), +]) + +def make_auxpow_tree(chain_ids): + for size in (2**i for i in xrange(31)): + if size < len(chain_ids): + continue + res = {} + for chain_id in chain_ids: + pos = (1103515245 * chain_id + 1103515245 * 12345 + 12345) % size + if pos in res: + break + res[pos] = chain_id + else: + return res, size + raise AssertionError() + +# merkle trees + +merkle_record_type = pack.ComposedType([ + ('left', pack.IntType(256)), + ('right', pack.IntType(256)), +]) + +def merkle_hash(hashes): + if not hashes: + return 0 + hash_list = list(hashes) + while len(hash_list) > 1: + hash_list = [hash256(merkle_record_type.pack(dict(left=left, right=right))) + for left, right in zip(hash_list[::2], hash_list[1::2] + [hash_list[::2][-1]])] + return hash_list[0] + +def calculate_merkle_link(hashes, index): + # XXX optimize this + + hash_list = [(lambda _h=h: _h, i == index, []) for i, h in enumerate(hashes)] + + while len(hash_list) > 1: + hash_list = [ + ( + lambda _left=left, _right=right: hash256(merkle_record_type.pack(dict(left=_left(), right=_right()))), + left_f or right_f, + (left_l if left_f else right_l) + [dict(side=1, hash=right) if left_f else dict(side=0, hash=left)], + ) + for (left, left_f, left_l), (right, right_f, right_l) in + zip(hash_list[::2], hash_list[1::2] + [hash_list[::2][-1]]) + ] + + res = [x['hash']() for x in hash_list[0][2]] + + assert hash_list[0][1] + if p2pool.DEBUG: + new_hashes = [random.randrange(2**256) if x is None else x + for x in hashes] + assert check_merkle_link(new_hashes[index], dict(branch=res, index=index)) == merkle_hash(new_hashes) + assert index == sum(k*2**i for i, k in enumerate([1-x['side'] for x in hash_list[0][2]])) + + return dict(branch=res, index=index) + +def check_merkle_link(tip_hash, link): + if link['index'] >= 2**len(link['branch']): + raise ValueError('index too large') + return reduce(lambda c, (i, h): hash256(merkle_record_type.pack( + dict(left=h, right=c) if (link['index'] >> i) & 1 else + dict(left=c, right=h) + )), enumerate(link['branch']), tip_hash) + +# targets + +def target_to_average_attempts(target): + assert 0 <= target and isinstance(target, (int, long)), target + if target >= 2**256: warnings.warn('target >= 2**256!') + return 2**256//(target + 1) + +def average_attempts_to_target(average_attempts): + assert average_attempts > 0 + return min(int(2**256/average_attempts - 1 + 0.5), 2**256-1) + +def target_to_difficulty(target): + assert 0 <= target and isinstance(target, (int, long)), target + if target >= 2**256: warnings.warn('target >= 2**256!') + return (0xffff0000 * 2**(256-64) + 1)/(target + 1) + +def difficulty_to_target(difficulty): + assert difficulty >= 0 + if difficulty == 0: return 2**256-1 + return min(int((0xffff0000 * 2**(256-64) + 1)/difficulty - 1 + 0.5), 2**256-1) + +# human addresses + +base58_alphabet = '123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz' + +def base58_encode(bindata): + bindata2 = bindata.lstrip(chr(0)) + return base58_alphabet[0]*(len(bindata) - len(bindata2)) + math.natural_to_string(math.string_to_natural(bindata2), base58_alphabet) + +def base58_decode(b58data): + b58data2 = b58data.lstrip(base58_alphabet[0]) + return chr(0)*(len(b58data) - len(b58data2)) + math.natural_to_string(math.string_to_natural(b58data2, base58_alphabet)) + +human_address_type = ChecksummedType(pack.ComposedType([ + ('version', pack.IntType(8)), + ('pubkey_hash', pack.IntType(160)), +])) + +def pubkey_hash_to_address(pubkey_hash, net): + return base58_encode(human_address_type.pack(dict(version=net.ADDRESS_VERSION, pubkey_hash=pubkey_hash))) + +def pubkey_to_address(pubkey, net): + return pubkey_hash_to_address(hash160(pubkey), net) + +def address_to_pubkey_hash(address, net): + x = human_address_type.unpack(base58_decode(address)) + if x['version'] != net.ADDRESS_VERSION: + raise ValueError('address not for this net!') + return x['pubkey_hash'] + +# transactions + +def pubkey_to_script2(pubkey): + assert len(pubkey) <= 75 + return (chr(len(pubkey)) + pubkey) + '\xac' + +def pubkey_hash_to_script2(pubkey_hash): + return '\x76\xa9' + ('\x14' + pack.IntType(160).pack(pubkey_hash)) + '\x88\xac' + +def script2_to_address(script2, net): + try: + pubkey = script2[1:-1] + script2_test = pubkey_to_script2(pubkey) + except: + pass + else: + if script2_test == script2: + return pubkey_to_address(pubkey, net) + + try: + pubkey_hash = pack.IntType(160).unpack(script2[3:-2]) + script2_test2 = pubkey_hash_to_script2(pubkey_hash) + except: + pass + else: + if script2_test2 == script2: + return pubkey_hash_to_address(pubkey_hash, net) + +def script2_to_human(script2, net): + try: + pubkey = script2[1:-1] + script2_test = pubkey_to_script2(pubkey) + except: + pass + else: + if script2_test == script2: + return 'Pubkey. Address: %s' % (pubkey_to_address(pubkey, net),) + + try: + pubkey_hash = pack.IntType(160).unpack(script2[3:-2]) + script2_test2 = pubkey_hash_to_script2(pubkey_hash) + except: + pass + else: + if script2_test2 == script2: + return 'Address. Address: %s' % (pubkey_hash_to_address(pubkey_hash, net),) + + return 'Unknown. Script: %s' % (script2.encode('hex'),) diff --git a/p2pool/bitcoin/getwork.py b/p2pool/bitcoin/getwork.py new file mode 100644 index 00000000..721b8ba2 --- /dev/null +++ b/p2pool/bitcoin/getwork.py @@ -0,0 +1,78 @@ +''' +Representation of a getwork request/reply +''' + +from __future__ import division + +from . import data as bitcoin_data +from . import sha256 +from p2pool.util import pack + +def _swap4(s): + if len(s) % 4: + raise ValueError() + return ''.join(s[x:x+4][::-1] for x in xrange(0, len(s), 4)) + +class BlockAttempt(object): + def __init__(self, version, previous_block, merkle_root, timestamp, bits, share_target): + self.version, self.previous_block, self.merkle_root, self.timestamp, self.bits, self.share_target = version, previous_block, merkle_root, timestamp, bits, share_target + + def __hash__(self): + return hash((self.version, self.previous_block, self.merkle_root, self.timestamp, self.bits, self.share_target)) + + def __eq__(self, other): + if not isinstance(other, BlockAttempt): + raise ValueError('comparisons only valid with other BlockAttempts') + return self.__dict__ == other.__dict__ + + def __ne__(self, other): + return not (self == other) + + def __repr__(self): + return 'BlockAttempt(%s)' % (', '.join('%s=%r' % (k, v) for k, v in self.__dict__.iteritems()),) + + def getwork(self, **extra): + if 'data' in extra or 'hash1' in extra or 'target' in extra or 'midstate' in extra: + raise ValueError() + + block_data = bitcoin_data.block_header_type.pack(dict( + version=self.version, + previous_block=self.previous_block, + merkle_root=self.merkle_root, + timestamp=self.timestamp, + bits=self.bits, + nonce=0, + )) + + getwork = { + 'data': _swap4(block_data).encode('hex') + '000000800000000000000000000000000000000000000000000000000000000000000000000000000000000080020000', + 'hash1': '00000000000000000000000000000000000000000000000000000000000000000000008000000000000000000000000000000000000000000000000000010000', + 'target': pack.IntType(256).pack(self.share_target).encode('hex'), + 'midstate': _swap4(sha256.process(sha256.initial_state, block_data[:64])).encode('hex'), + } + + getwork = dict(getwork) + getwork.update(extra) + + return getwork + + @classmethod + def from_getwork(cls, getwork): + attrs = decode_data(getwork['data']) + + return cls( + version=attrs['version'], + previous_block=attrs['previous_block'], + merkle_root=attrs['merkle_root'], + timestamp=attrs['timestamp'], + bits=attrs['bits'], + share_target=pack.IntType(256).unpack(getwork['target'].decode('hex')), + ) + + def update(self, **kwargs): + d = self.__dict__.copy() + d.update(kwargs) + return self.__class__(**d) + +def decode_data(data): + return bitcoin_data.block_header_type.unpack(_swap4(data.decode('hex'))[:80]) diff --git a/p2pool/bitcoin/height_tracker.py b/p2pool/bitcoin/height_tracker.py new file mode 100644 index 00000000..e5119fb8 --- /dev/null +++ b/p2pool/bitcoin/height_tracker.py @@ -0,0 +1,113 @@ +from twisted.internet import defer +from twisted.python import log + +import p2pool +from p2pool.bitcoin import data as bitcoin_data +from p2pool.util import deferral, forest, jsonrpc, variable + +class HeaderWrapper(object): + __slots__ = 'hash previous_hash'.split(' ') + + @classmethod + def from_header(cls, header): + return cls(bitcoin_data.hash256(bitcoin_data.block_header_type.pack(header)), header['previous_block']) + + def __init__(self, hash, previous_hash): + self.hash, self.previous_hash = hash, previous_hash + +class HeightTracker(object): + '''Point this at a factory and let it take care of getting block heights''' + + def __init__(self, best_block_func, factory, backlog_needed): + self._best_block_func = best_block_func + self._factory = factory + self._backlog_needed = backlog_needed + + self._tracker = forest.Tracker() + + self._watch1 = self._factory.new_headers.watch(self._heard_headers) + self._watch2 = self._factory.new_block.watch(self._request) + + self._requested = set() + self._clear_task = deferral.RobustLoopingCall(self._requested.clear) + self._clear_task.start(60) + + self._last_notified_size = 0 + + self.updated = variable.Event() + + self._think_task = deferral.RobustLoopingCall(self._think) + self._think_task.start(15) + self._think2_task = deferral.RobustLoopingCall(self._think2) + self._think2_task.start(15) + + def _think(self): + try: + highest_head = max(self._tracker.heads, key=lambda h: self._tracker.get_height_and_last(h)[0]) if self._tracker.heads else None + if highest_head is None: + return # wait for think2 + height, last = self._tracker.get_height_and_last(highest_head) + if height < self._backlog_needed: + self._request(last) + except: + log.err(None, 'Error in HeightTracker._think:') + + def _think2(self): + self._request(self._best_block_func()) + + def _heard_headers(self, headers): + changed = False + for header in headers: + hw = HeaderWrapper.from_header(header) + if hw.hash in self._tracker.items: + continue + changed = True + self._tracker.add(hw) + if changed: + self.updated.happened() + self._think() + + if len(self._tracker.items) >= self._last_notified_size + 100: + print 'Have %i/%i block headers' % (len(self._tracker.items), self._backlog_needed) + self._last_notified_size = len(self._tracker.items) + + @defer.inlineCallbacks + def _request(self, last): + if last in self._tracker.items: + return + if last in self._requested: + return + self._requested.add(last) + (yield self._factory.getProtocol()).send_getheaders(version=1, have=[], last=last) + + def get_height_rel_highest(self, block_hash): + # callers: highest height can change during yields! + best_height, best_last = self._tracker.get_height_and_last(self._best_block_func()) + height, last = self._tracker.get_height_and_last(block_hash) + if last != best_last: + return -1000000000 # XXX hack + return height - best_height + +@defer.inlineCallbacks +def get_height_rel_highest_func(bitcoind, factory, best_block_func, net): + if '\ngetblock ' in (yield deferral.retry()(bitcoind.rpc_help)()): + @deferral.DeferredCacher + @defer.inlineCallbacks + def height_cacher(block_hash): + try: + x = yield bitcoind.rpc_getblock('%x' % (block_hash,)) + except jsonrpc.Error_for_code(-5): # Block not found + if not p2pool.DEBUG: + raise deferral.RetrySilentlyException() + else: + raise + defer.returnValue(x['blockcount'] if 'blockcount' in x else x['height']) + best_height_cached = variable.Variable((yield deferral.retry()(height_cacher)(best_block_func()))) + def get_height_rel_highest(block_hash): + this_height = height_cacher.call_now(block_hash, 0) + best_height = height_cacher.call_now(best_block_func(), 0) + best_height_cached.set(max(best_height_cached.value, this_height, best_height)) + return this_height - best_height_cached.value + else: + get_height_rel_highest = HeightTracker(best_block_func, factory, 5*net.SHARE_PERIOD*net.CHAIN_LENGTH/net.PARENT.BLOCK_PERIOD).get_height_rel_highest + defer.returnValue(get_height_rel_highest) diff --git a/p2pool/bitcoin/helper.py b/p2pool/bitcoin/helper.py new file mode 100644 index 00000000..f9c459f7 --- /dev/null +++ b/p2pool/bitcoin/helper.py @@ -0,0 +1,87 @@ +import sys +import time + +from twisted.internet import defer + +import p2pool +from p2pool.bitcoin import data as bitcoin_data +from p2pool.util import deferral, jsonrpc + +@deferral.retry('Error while checking Bitcoin connection:', 1) +@defer.inlineCallbacks +def check(bitcoind, net): + if not (yield net.PARENT.RPC_CHECK(bitcoind)): + print >>sys.stderr, " Check failed! Make sure that you're connected to the right bitcoind with --bitcoind-rpc-port!" + raise deferral.RetrySilentlyException() + if not net.VERSION_CHECK((yield bitcoind.rpc_getinfo())['version']): + print >>sys.stderr, ' Bitcoin version too old! Upgrade to 0.6.4 or newer!' + raise deferral.RetrySilentlyException() + +@deferral.retry('Error getting work from bitcoind:', 3) +@defer.inlineCallbacks +def getwork(bitcoind, use_getblocktemplate=False): + def go(): + if use_getblocktemplate: + return bitcoind.rpc_getblocktemplate(dict(mode='template')) + else: + return bitcoind.rpc_getmemorypool() + try: + start = time.time() + work = yield go() + end = time.time() + except jsonrpc.Error_for_code(-32601): # Method not found + use_getblocktemplate = not use_getblocktemplate + try: + start = time.time() + work = yield go() + end = time.time() + except jsonrpc.Error_for_code(-32601): # Method not found + print >>sys.stderr, 'Error: Bitcoin version too old! Upgrade to v0.5 or newer!' + raise deferral.RetrySilentlyException() + packed_transactions = [(x['data'] if isinstance(x, dict) else x).decode('hex') for x in work['transactions']] + if 'height' not in work: + work['height'] = (yield bitcoind.rpc_getblock(work['previousblockhash']))['height'] + 1 + elif p2pool.DEBUG: + assert work['height'] == (yield bitcoind.rpc_getblock(work['previousblockhash']))['height'] + 1 + defer.returnValue(dict( + version=work['version'], + previous_block=int(work['previousblockhash'], 16), + transactions=map(bitcoin_data.tx_type.unpack, packed_transactions), + transaction_hashes=map(bitcoin_data.hash256, packed_transactions), + transaction_fees=[x.get('fee', None) if isinstance(x, dict) else None for x in work['transactions']], + subsidy=work['coinbasevalue'], + time=work['time'] if 'time' in work else work['curtime'], + bits=bitcoin_data.FloatingIntegerType().unpack(work['bits'].decode('hex')[::-1]) if isinstance(work['bits'], (str, unicode)) else bitcoin_data.FloatingInteger(work['bits']), + coinbaseflags=work['coinbaseflags'].decode('hex') if 'coinbaseflags' in work else ''.join(x.decode('hex') for x in work['coinbaseaux'].itervalues()) if 'coinbaseaux' in work else '', + height=work['height'], + last_update=time.time(), + use_getblocktemplate=use_getblocktemplate, + latency=end - start, + )) + +@deferral.retry('Error submitting primary block: (will retry)', 10, 10) +def submit_block_p2p(block, factory, net): + if factory.conn.value is None: + print >>sys.stderr, 'No bitcoind connection when block submittal attempted! %s%064x' % (net.PARENT.BLOCK_EXPLORER_URL_PREFIX, bitcoin_data.hash256(bitcoin_data.block_header_type.pack(block['header']))) + raise deferral.RetrySilentlyException() + factory.conn.value.send_block(block=block) + +@deferral.retry('Error submitting block: (will retry)', 10, 10) +@defer.inlineCallbacks +def submit_block_rpc(block, ignore_failure, bitcoind, bitcoind_work, net): + if bitcoind_work.value['use_getblocktemplate']: + try: + result = yield bitcoind.rpc_submitblock(bitcoin_data.block_type.pack(block).encode('hex')) + except jsonrpc.Error_for_code(-32601): # Method not found, for older litecoin versions + result = yield bitcoind.rpc_getblocktemplate(dict(mode='submit', data=bitcoin_data.block_type.pack(block).encode('hex'))) + success = result is None + else: + result = yield bitcoind.rpc_getmemorypool(bitcoin_data.block_type.pack(block).encode('hex')) + success = result + success_expected = net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(block['header'])) <= block['header']['bits'].target + if (not success and success_expected and not ignore_failure) or (success and not success_expected): + print >>sys.stderr, 'Block submittal result: %s (%r) Expected: %s' % (success, result, success_expected) + +def submit_block(block, ignore_failure, factory, bitcoind, bitcoind_work, net): + submit_block_p2p(block, factory, net) + submit_block_rpc(block, ignore_failure, bitcoind, bitcoind_work, net) diff --git a/p2pool/bitcoin/networks.py b/p2pool/bitcoin/networks.py new file mode 100644 index 00000000..09dbb5dd --- /dev/null +++ b/p2pool/bitcoin/networks.py @@ -0,0 +1,206 @@ +import os +import platform + +from twisted.internet import defer + +from . import data +from p2pool.util import math, pack + +nets = dict( + bitcoin=math.Object( + P2P_PREFIX='f9beb4d9'.decode('hex'), + P2P_PORT=8333, + ADDRESS_VERSION=0, + RPC_PORT=8332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'bitcoinaddress' in (yield bitcoind.rpc_help()) and + not (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//210000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=600, # s + SYMBOL='BTC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Bitcoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Bitcoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.bitcoin'), 'bitcoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='https://blockchain.info/block/', + ADDRESS_EXPLORER_URL_PREFIX='https://blockchain.info/address/', + TX_EXPLORER_URL_PREFIX='https://blockchain.info/tx/', + SANE_TARGET_RANGE=(2**256//2**32//1000 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=0.001e8, + ), + bitcoin_testnet=math.Object( + P2P_PREFIX='0b110907'.decode('hex'), + P2P_PORT=18333, + ADDRESS_VERSION=111, + RPC_PORT=18332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'bitcoinaddress' in (yield bitcoind.rpc_help()) and + (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//210000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=600, # s + SYMBOL='tBTC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Bitcoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Bitcoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.bitcoin'), 'bitcoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://blockexplorer.com/testnet/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://blockexplorer.com/testnet/address/', + TX_EXPLORER_URL_PREFIX='http://blockexplorer.com/testnet/tx/', + SANE_TARGET_RANGE=(2**256//2**32//1000 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=1e8, + ), + + namecoin=math.Object( + P2P_PREFIX='f9beb4fe'.decode('hex'), + P2P_PORT=8334, + ADDRESS_VERSION=52, + RPC_PORT=8332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'namecoinaddress' in (yield bitcoind.rpc_help()) and + not (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//210000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=600, # s + SYMBOL='NMC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Namecoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Namecoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.namecoin'), 'bitcoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://explorer.dot-bit.org/b/', + ADDRESS_EXPLORER_URL_PREFIX='http://explorer.dot-bit.org/a/', + TX_EXPLORER_URL_PREFIX='http://explorer.dot-bit.org/tx/', + SANE_TARGET_RANGE=(2**256//2**32 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=0.2e8, + ), + namecoin_testnet=math.Object( + P2P_PREFIX='fabfb5fe'.decode('hex'), + P2P_PORT=18334, + ADDRESS_VERSION=111, + RPC_PORT=8332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'namecoinaddress' in (yield bitcoind.rpc_help()) and + (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//210000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=600, # s + SYMBOL='tNMC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Namecoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Namecoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.namecoin'), 'bitcoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://testnet.explorer.dot-bit.org/b/', + ADDRESS_EXPLORER_URL_PREFIX='http://testnet.explorer.dot-bit.org/a/', + TX_EXPLORER_URL_PREFIX='http://testnet.explorer.dot-bit.org/tx/', + SANE_TARGET_RANGE=(2**256//2**32 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=1e8, + ), + + litecoin=math.Object( + P2P_PREFIX='fbc0b6db'.decode('hex'), + P2P_PORT=9333, + ADDRESS_VERSION=48, + RPC_PORT=9332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'litecoinaddress' in (yield bitcoind.rpc_help()) and + not (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//840000, + POW_FUNC=lambda data: pack.IntType(256).unpack(__import__('ltc_scrypt').getPoWHash(data)), + BLOCK_PERIOD=150, # s + SYMBOL='LTC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Litecoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Litecoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.litecoin'), 'litecoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://explorer.litecoin.net/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://explorer.litecoin.net/address/', + TX_EXPLORER_URL_PREFIX='http://explorer.litecoin.net/tx/', + SANE_TARGET_RANGE=(2**256//1000000000 - 1, 2**256//1000 - 1), + DUMB_SCRYPT_DIFF=2**16, + DUST_THRESHOLD=0.03e8, + ), + litecoin_testnet=math.Object( + P2P_PREFIX='fcc1b7dc'.decode('hex'), + P2P_PORT=19333, + ADDRESS_VERSION=111, + RPC_PORT=19332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'litecoinaddress' in (yield bitcoind.rpc_help()) and + (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//840000, + POW_FUNC=lambda data: pack.IntType(256).unpack(__import__('ltc_scrypt').getPoWHash(data)), + BLOCK_PERIOD=150, # s + SYMBOL='tLTC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Litecoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Litecoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.litecoin'), 'litecoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://nonexistent-litecoin-testnet-explorer/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://nonexistent-litecoin-testnet-explorer/address/', + TX_EXPLORER_URL_PREFIX='http://nonexistent-litecoin-testnet-explorer/tx/', + SANE_TARGET_RANGE=(2**256//1000000000 - 1, 2**256 - 1), + DUMB_SCRYPT_DIFF=2**16, + DUST_THRESHOLD=1e8, + ), + + terracoin=math.Object( + P2P_PREFIX='42babe56'.decode('hex'), + P2P_PORT=13333, + ADDRESS_VERSION=0, + RPC_PORT=13332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'terracoinaddress' in (yield bitcoind.rpc_help()) and + not (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 20*100000000 >> (height + 1)//1050000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=120, # s + SYMBOL='TRC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Terracoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Terracoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.terracoin'), 'terracoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/address/', + TX_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/tx/', + SANE_TARGET_RANGE=(2**256//2**32//1000 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=1e8, + ), + terracoin_testnet=math.Object( + P2P_PREFIX='41babe56'.decode('hex'), + P2P_PORT=23333, + ADDRESS_VERSION=111, + RPC_PORT=23332, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'terracoinaddress' in (yield bitcoind.rpc_help()) and + (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 20*100000000 >> (height + 1)//1050000, + POW_FUNC=data.hash256, + BLOCK_PERIOD=120, # s + SYMBOL='tTRC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Terracoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Terracoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.terracoin'), 'terracoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/testnet/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/testnet/address/', + TX_EXPLORER_URL_PREFIX='http://trc.cryptocoinexplorer.com/testnet/tx/', + SANE_TARGET_RANGE=(2**256//2**32//1000 - 1, 2**256//2**32 - 1), + DUMB_SCRYPT_DIFF=1, + DUST_THRESHOLD=1e8, + ), + + vertcoin=math.Object( + P2P_PREFIX='fabfb5da'.decode('hex'), + P2P_PORT=5889, + ADDRESS_VERSION=71, + RPC_PORT=5888, + RPC_CHECK=defer.inlineCallbacks(lambda bitcoind: defer.returnValue( + 'vertcoinaddress' in (yield bitcoind.rpc_help()) and + not (yield bitcoind.rpc_getinfo())['testnet'] + )), + SUBSIDY_FUNC=lambda height: 50*100000000 >> (height + 1)//840000, + POW_FUNC=lambda data: pack.IntType(256).unpack(__import__('vtc_scrypt').getPoWHash(data)), + BLOCK_PERIOD=150, # s + SYMBOL='VTC', + CONF_FILE_FUNC=lambda: os.path.join(os.path.join(os.environ['APPDATA'], 'Vertcoin') if platform.system() == 'Windows' else os.path.expanduser('~/Library/Application Support/Vertcoin/') if platform.system() == 'Darwin' else os.path.expanduser('~/.vertcoin'), 'vertcoin.conf'), + BLOCK_EXPLORER_URL_PREFIX='http://explorer.vertcoin.org/block/', + ADDRESS_EXPLORER_URL_PREFIX='http://explorer.vertcoin.org/address/', + TX_EXPLORER_URL_PREFIX='http://explorer.vertcoin.org/tx/', + SANE_TARGET_RANGE=(2**256//1000000000 - 1, 2**256//1000 - 1), + DUMB_SCRYPT_DIFF=2**16, + DUST_THRESHOLD=0.03e8, + ), + +) +for net_name, net in nets.iteritems(): + net.NAME = net_name diff --git a/p2pool/bitcoin/p2p.py b/p2pool/bitcoin/p2p.py new file mode 100644 index 00000000..d6f50c22 --- /dev/null +++ b/p2pool/bitcoin/p2p.py @@ -0,0 +1,180 @@ +''' +Implementation of Bitcoin's p2p protocol +''' + +import random +import sys +import time + +from twisted.internet import protocol + +import p2pool +from . import data as bitcoin_data +from p2pool.util import deferral, p2protocol, pack, variable + +class Protocol(p2protocol.Protocol): + def __init__(self, net): + p2protocol.Protocol.__init__(self, net.P2P_PREFIX, 1000000, ignore_trailing_payload=True) + + def connectionMade(self): + self.send_version( + version=70002, + services=1, + time=int(time.time()), + addr_to=dict( + services=1, + address=self.transport.getPeer().host, + port=self.transport.getPeer().port, + ), + addr_from=dict( + services=1, + address=self.transport.getHost().host, + port=self.transport.getHost().port, + ), + nonce=random.randrange(2**64), + sub_version_num='/P2Pool:%s/' % (p2pool.__version__,), + start_height=0, + ) + + message_version = pack.ComposedType([ + ('version', pack.IntType(32)), + ('services', pack.IntType(64)), + ('time', pack.IntType(64)), + ('addr_to', bitcoin_data.address_type), + ('addr_from', bitcoin_data.address_type), + ('nonce', pack.IntType(64)), + ('sub_version_num', pack.VarStrType()), + ('start_height', pack.IntType(32)), + ]) + def handle_version(self, version, services, time, addr_to, addr_from, nonce, sub_version_num, start_height): + self.send_verack() + + message_verack = pack.ComposedType([]) + def handle_verack(self): + self.get_block = deferral.ReplyMatcher(lambda hash: self.send_getdata(requests=[dict(type='block', hash=hash)])) + self.get_block_header = deferral.ReplyMatcher(lambda hash: self.send_getheaders(version=1, have=[], last=hash)) + + if hasattr(self.factory, 'resetDelay'): + self.factory.resetDelay() + if hasattr(self.factory, 'gotConnection'): + self.factory.gotConnection(self) + + self.pinger = deferral.RobustLoopingCall(self.send_ping, nonce=1234) + self.pinger.start(30) + + message_inv = pack.ComposedType([ + ('invs', pack.ListType(pack.ComposedType([ + ('type', pack.EnumType(pack.IntType(32), {1: 'tx', 2: 'block'})), + ('hash', pack.IntType(256)), + ]))), + ]) + def handle_inv(self, invs): + for inv in invs: + if inv['type'] == 'tx': + self.send_getdata(requests=[inv]) + elif inv['type'] == 'block': + self.factory.new_block.happened(inv['hash']) + else: + print 'Unknown inv type', inv + + message_getdata = pack.ComposedType([ + ('requests', pack.ListType(pack.ComposedType([ + ('type', pack.EnumType(pack.IntType(32), {1: 'tx', 2: 'block'})), + ('hash', pack.IntType(256)), + ]))), + ]) + message_getblocks = pack.ComposedType([ + ('version', pack.IntType(32)), + ('have', pack.ListType(pack.IntType(256))), + ('last', pack.PossiblyNoneType(0, pack.IntType(256))), + ]) + message_getheaders = pack.ComposedType([ + ('version', pack.IntType(32)), + ('have', pack.ListType(pack.IntType(256))), + ('last', pack.PossiblyNoneType(0, pack.IntType(256))), + ]) + message_getaddr = pack.ComposedType([]) + + message_addr = pack.ComposedType([ + ('addrs', pack.ListType(pack.ComposedType([ + ('timestamp', pack.IntType(32)), + ('address', bitcoin_data.address_type), + ]))), + ]) + def handle_addr(self, addrs): + for addr in addrs: + pass + + message_tx = pack.ComposedType([ + ('tx', bitcoin_data.tx_type), + ]) + def handle_tx(self, tx): + self.factory.new_tx.happened(tx) + + message_block = pack.ComposedType([ + ('block', bitcoin_data.block_type), + ]) + def handle_block(self, block): + block_hash = bitcoin_data.hash256(bitcoin_data.block_header_type.pack(block['header'])) + self.get_block.got_response(block_hash, block) + self.get_block_header.got_response(block_hash, block['header']) + + message_headers = pack.ComposedType([ + ('headers', pack.ListType(bitcoin_data.block_type)), + ]) + def handle_headers(self, headers): + for header in headers: + header = header['header'] + self.get_block_header.got_response(bitcoin_data.hash256(bitcoin_data.block_header_type.pack(header)), header) + self.factory.new_headers.happened([header['header'] for header in headers]) + + message_ping = pack.ComposedType([ + ('nonce', pack.IntType(64)), + ]) + def handle_ping(self, nonce): + self.send_pong(nonce=nonce) + + message_pong = pack.ComposedType([ + ('nonce', pack.IntType(64)), + ]) + def handle_pong(self, nonce): + pass + + message_alert = pack.ComposedType([ + ('message', pack.VarStrType()), + ('signature', pack.VarStrType()), + ]) + def handle_alert(self, message, signature): + pass # print 'ALERT:', (message, signature) + + def connectionLost(self, reason): + if hasattr(self.factory, 'gotConnection'): + self.factory.gotConnection(None) + if hasattr(self, 'pinger'): + self.pinger.stop() + if p2pool.DEBUG: + print >>sys.stderr, 'Bitcoin connection lost. Reason:', reason.getErrorMessage() + +class ClientFactory(protocol.ReconnectingClientFactory): + protocol = Protocol + + maxDelay = 1 + + def __init__(self, net): + self.net = net + self.conn = variable.Variable(None) + + self.new_block = variable.Event() + self.new_tx = variable.Event() + self.new_headers = variable.Event() + + def buildProtocol(self, addr): + p = self.protocol(self.net) + p.factory = self + return p + + def gotConnection(self, conn): + self.conn.set(conn) + + def getProtocol(self): + return self.conn.get_not_none() diff --git a/p2pool/bitcoin/script.py b/p2pool/bitcoin/script.py new file mode 100644 index 00000000..3931c92a --- /dev/null +++ b/p2pool/bitcoin/script.py @@ -0,0 +1,80 @@ +from p2pool.util import math, pack + +def reads_nothing(f): + return None, f +def protoPUSH(length): + return lambda f: pack.read(f, length) +def protoPUSHDATA(size_len): + def _(f): + length_str, f = pack.read(f, size_len) + length = math.string_to_natural(length_str[::-1].lstrip(chr(0))) + data, f = pack.read(f, length) + return data, f + return _ + +opcodes = {} +for i in xrange(256): + opcodes[i] = 'UNK_' + str(i), reads_nothing + +opcodes[0] = 'PUSH', lambda f: ('', f) +for i in xrange(1, 76): + opcodes[i] = 'PUSH', protoPUSH(i) +opcodes[76] = 'PUSH', protoPUSHDATA(1) +opcodes[77] = 'PUSH', protoPUSHDATA(2) +opcodes[78] = 'PUSH', protoPUSHDATA(4) +opcodes[79] = 'PUSH', lambda f: ('\x81', f) +for i in xrange(81, 97): + opcodes[i] = 'PUSH', lambda f, _i=i: (chr(_i - 80), f) + +opcodes[172] = 'CHECKSIG', reads_nothing +opcodes[173] = 'CHECKSIGVERIFY', reads_nothing +opcodes[174] = 'CHECKMULTISIG', reads_nothing +opcodes[175] = 'CHECKMULTISIGVERIFY', reads_nothing + +def parse(script): + f = script, 0 + while pack.size(f): + opcode_str, f = pack.read(f, 1) + opcode = ord(opcode_str) + opcode_name, read_func = opcodes[opcode] + opcode_arg, f = read_func(f) + yield opcode_name, opcode_arg + +def get_sigop_count(script): + weights = { + 'CHECKSIG': 1, + 'CHECKSIGVERIFY': 1, + 'CHECKMULTISIG': 20, + 'CHECKMULTISIGVERIFY': 20, + } + return sum(weights.get(opcode_name, 0) for opcode_name, opcode_arg in parse(script)) + +def create_push_script(datums): # datums can be ints or strs + res = [] + for datum in datums: + if isinstance(datum, (int, long)): + if datum == -1 or 1 <= datum <= 16: + res.append(chr(datum + 80)) + continue + negative = datum < 0 + datum = math.natural_to_string(abs(datum)) + if datum and ord(datum[0]) & 128: + datum = '\x00' + datum + if negative: + datum = chr(ord(datum[0]) + 128) + datum[1:] + datum = datum[::-1] + if len(datum) < 76: + res.append(chr(len(datum))) + elif len(datum) <= 0xff: + res.append(76) + res.append(chr(len(datum))) + elif len(datum) <= 0xffff: + res.append(77) + res.append(pack.IntType(16).pack(len(datum))) + elif len(datum) <= 0xffffffff: + res.append(78) + res.append(pack.IntType(32).pack(len(datum))) + else: + raise ValueError('string too long') + res.append(datum) + return ''.join(res) diff --git a/p2pool/bitcoin/sha256.py b/p2pool/bitcoin/sha256.py new file mode 100644 index 00000000..dd601e34 --- /dev/null +++ b/p2pool/bitcoin/sha256.py @@ -0,0 +1,75 @@ +from __future__ import division + +import struct + + +k = [ + 0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5, + 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174, + 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da, + 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967, + 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85, + 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070, + 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3, + 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2, +] + +def process(state, chunk): + def rightrotate(x, n): + return (x >> n) | (x << 32 - n) % 2**32 + + w = list(struct.unpack('>16I', chunk)) + for i in xrange(16, 64): + s0 = rightrotate(w[i-15], 7) ^ rightrotate(w[i-15], 18) ^ (w[i-15] >> 3) + s1 = rightrotate(w[i-2], 17) ^ rightrotate(w[i-2], 19) ^ (w[i-2] >> 10) + w.append((w[i-16] + s0 + w[i-7] + s1) % 2**32) + + a, b, c, d, e, f, g, h = start_state = struct.unpack('>8I', state) + for k_i, w_i in zip(k, w): + t1 = (h + (rightrotate(e, 6) ^ rightrotate(e, 11) ^ rightrotate(e, 25)) + ((e & f) ^ (~e & g)) + k_i + w_i) % 2**32 + + a, b, c, d, e, f, g, h = ( + (t1 + (rightrotate(a, 2) ^ rightrotate(a, 13) ^ rightrotate(a, 22)) + ((a & b) ^ (a & c) ^ (b & c))) % 2**32, + a, b, c, (d + t1) % 2**32, e, f, g, + ) + + return struct.pack('>8I', *((x + y) % 2**32 for x, y in zip(start_state, [a, b, c, d, e, f, g, h]))) + + +initial_state = struct.pack('>8I', 0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19) + +class sha256(object): + digest_size = 256//8 + block_size = 512//8 + + def __init__(self, data='', _=(initial_state, '', 0)): + self.state, self.buf, self.length = _ + self.update(data) + + def update(self, data): + state = self.state + buf = self.buf + data + + chunks = [buf[i:i + self.block_size] for i in xrange(0, len(buf) + 1, self.block_size)] + for chunk in chunks[:-1]: + state = process(state, chunk) + + self.state = state + self.buf = chunks[-1] + + self.length += 8*len(data) + + def copy(self, data=''): + return self.__class__(data, (self.state, self.buf, self.length)) + + def digest(self): + state = self.state + buf = self.buf + '\x80' + '\x00'*((self.block_size - 9 - len(self.buf)) % self.block_size) + struct.pack('>Q', self.length) + + for chunk in [buf[i:i + self.block_size] for i in xrange(0, len(buf), self.block_size)]: + state = process(state, chunk) + + return state + + def hexdigest(self): + return self.digest().encode('hex') diff --git a/p2pool/bitcoin/stratum.py b/p2pool/bitcoin/stratum.py new file mode 100644 index 00000000..ca2aa946 --- /dev/null +++ b/p2pool/bitcoin/stratum.py @@ -0,0 +1,90 @@ +import random +import sys + +from twisted.internet import protocol, reactor +from twisted.python import log + +from p2pool.bitcoin import data as bitcoin_data, getwork +from p2pool.util import expiring_dict, jsonrpc, pack + + +class StratumRPCMiningProvider(object): + def __init__(self, wb, other, transport): + self.wb = wb + self.other = other + self.transport = transport + + self.username = None + self.handler_map = expiring_dict.ExpiringDict(300) + + self.watch_id = self.wb.new_work_event.watch(self._send_work) + + def rpc_subscribe(self, miner_version=None, session_id=None): + reactor.callLater(0, self._send_work) + + return [ + ["mining.notify", "ae6812eb4cd7735a302a8a9dd95cf71f"], # subscription details + "", # extranonce1 + self.wb.COINBASE_NONCE_LENGTH, # extranonce2_size + ] + + def rpc_authorize(self, username, password): + self.username = username + + reactor.callLater(0, self._send_work) + + def _send_work(self): + try: + x, got_response = self.wb.get_work(*self.wb.preprocess_request('' if self.username is None else self.username)) + except: + log.err() + self.transport.loseConnection() + return + jobid = str(random.randrange(2**128)) + self.other.svc_mining.rpc_set_difficulty(bitcoin_data.target_to_difficulty(x['share_target'])*self.wb.net.DUMB_SCRYPT_DIFF).addErrback(lambda err: None) + self.other.svc_mining.rpc_notify( + jobid, # jobid + getwork._swap4(pack.IntType(256).pack(x['previous_block'])).encode('hex'), # prevhash + x['coinb1'].encode('hex'), # coinb1 + x['coinb2'].encode('hex'), # coinb2 + [pack.IntType(256).pack(s).encode('hex') for s in x['merkle_link']['branch']], # merkle_branch + getwork._swap4(pack.IntType(32).pack(x['version'])).encode('hex'), # version + getwork._swap4(pack.IntType(32).pack(x['bits'].bits)).encode('hex'), # nbits + getwork._swap4(pack.IntType(32).pack(x['timestamp'])).encode('hex'), # ntime + True, # clean_jobs + ).addErrback(lambda err: None) + self.handler_map[jobid] = x, got_response + + def rpc_submit(self, worker_name, job_id, extranonce2, ntime, nonce): + if job_id not in self.handler_map: + print >>sys.stderr, '''Couldn't link returned work's job id with its handler. This should only happen if this process was recently restarted!''' + return False + x, got_response = self.handler_map[job_id] + coinb_nonce = extranonce2.decode('hex') + assert len(coinb_nonce) == self.wb.COINBASE_NONCE_LENGTH + new_packed_gentx = x['coinb1'] + coinb_nonce + x['coinb2'] + header = dict( + version=x['version'], + previous_block=x['previous_block'], + merkle_root=bitcoin_data.check_merkle_link(bitcoin_data.hash256(new_packed_gentx), x['merkle_link']), + timestamp=pack.IntType(32).unpack(getwork._swap4(ntime.decode('hex'))), + bits=x['bits'], + nonce=pack.IntType(32).unpack(getwork._swap4(nonce.decode('hex'))), + ) + return got_response(header, worker_name, coinb_nonce) + + def close(self): + self.wb.new_work_event.unwatch(self.watch_id) + +class StratumProtocol(jsonrpc.LineBasedPeer): + def connectionMade(self): + self.svc_mining = StratumRPCMiningProvider(self.factory.wb, self.other, self.transport) + + def connectionLost(self, reason): + self.svc_mining.close() + +class StratumServerFactory(protocol.ServerFactory): + protocol = StratumProtocol + + def __init__(self, wb): + self.wb = wb diff --git a/p2pool/bitcoin/worker_interface.py b/p2pool/bitcoin/worker_interface.py new file mode 100644 index 00000000..7ae19511 --- /dev/null +++ b/p2pool/bitcoin/worker_interface.py @@ -0,0 +1,142 @@ +from __future__ import division + +import StringIO +import json +import random +import sys + +from twisted.internet import defer + +import p2pool +from p2pool.bitcoin import data as bitcoin_data, getwork +from p2pool.util import expiring_dict, jsonrpc, pack, variable + +class _Provider(object): + def __init__(self, parent, long_poll): + self.parent = parent + self.long_poll = long_poll + + def rpc_getwork(self, request, data=None): + return self.parent._getwork(request, data, long_poll=self.long_poll) + +class _GETableServer(jsonrpc.HTTPServer): + def __init__(self, provider, render_get_func): + jsonrpc.HTTPServer.__init__(self, provider) + self.render_GET = render_get_func + +class WorkerBridge(object): + def __init__(self): + self.new_work_event = variable.Event() + + def preprocess_request(self, request): + return request, # *args to self.compute + + def get_work(self, request): + raise NotImplementedError() + +class WorkerInterface(object): + def __init__(self, worker_bridge): + self.worker_bridge = worker_bridge + + self.worker_views = {} + + self.merkle_root_to_handler = expiring_dict.ExpiringDict(300) + + def attach_to(self, res, get_handler=None): + res.putChild('', _GETableServer(_Provider(self, long_poll=False), get_handler)) + + def repost(request): + request.content = StringIO.StringIO(json.dumps(dict(id=0, method='getwork'))) + return s.render_POST(request) + s = _GETableServer(_Provider(self, long_poll=True), repost) + res.putChild('long-polling', s) + + @defer.inlineCallbacks + def _getwork(self, request, data, long_poll): + request.setHeader('X-Long-Polling', '/long-polling') + request.setHeader('X-Roll-NTime', 'expire=100') + request.setHeader('X-Is-P2Pool', 'true') + if request.getHeader('Host') is not None: + request.setHeader('X-Stratum', 'stratum+tcp://' + request.getHeader('Host')) + + if data is not None: + header = getwork.decode_data(data) + if header['merkle_root'] not in self.merkle_root_to_handler: + print >>sys.stderr, '''Couldn't link returned work's merkle root with its handler. This should only happen if this process was recently restarted!''' + defer.returnValue(False) + defer.returnValue(self.merkle_root_to_handler[header['merkle_root']](header, request.getUser() if request.getUser() is not None else '', '\0'*self.worker_bridge.COINBASE_NONCE_LENGTH)) + + if p2pool.DEBUG: + id = random.randrange(1000, 10000) + print 'POLL %i START is_long_poll=%r user_agent=%r user=%r' % (id, long_poll, request.getHeader('User-Agent'), request.getUser()) + + if long_poll: + request_id = request.getClientIP(), request.getHeader('Authorization') + if self.worker_views.get(request_id, self.worker_bridge.new_work_event.times) != self.worker_bridge.new_work_event.times: + if p2pool.DEBUG: + print 'POLL %i PUSH' % (id,) + else: + if p2pool.DEBUG: + print 'POLL %i WAITING' % (id,) + yield self.worker_bridge.new_work_event.get_deferred() + self.worker_views[request_id] = self.worker_bridge.new_work_event.times + + x, handler = self.worker_bridge.get_work(*self.worker_bridge.preprocess_request(request.getUser() if request.getUser() is not None else '')) + res = getwork.BlockAttempt( + version=x['version'], + previous_block=x['previous_block'], + merkle_root=bitcoin_data.check_merkle_link(bitcoin_data.hash256(x['coinb1'] + '\0'*self.worker_bridge.COINBASE_NONCE_LENGTH + x['coinb2']), x['merkle_link']), + timestamp=x['timestamp'], + bits=x['bits'], + share_target=x['share_target'], + ) + assert res.merkle_root not in self.merkle_root_to_handler + + self.merkle_root_to_handler[res.merkle_root] = handler + + if p2pool.DEBUG: + print 'POLL %i END identifier=%i' % (id, self.worker_bridge.new_work_event.times) + + extra_params = {} + if request.getHeader('User-Agent') == 'Jephis PIC Miner': + # ASICMINER BE Blades apparently have a buffer overflow bug and + # can't handle much extra in the getwork response + extra_params = {} + else: + extra_params = dict(identifier=str(self.worker_bridge.new_work_event.times), submitold=True) + defer.returnValue(res.getwork(**extra_params)) + +class CachingWorkerBridge(object): + def __init__(self, inner): + self._inner = inner + self.net = self._inner.net + + self.COINBASE_NONCE_LENGTH = (inner.COINBASE_NONCE_LENGTH+1)//2 + self.new_work_event = inner.new_work_event + self.preprocess_request = inner.preprocess_request + + self._my_bits = (self._inner.COINBASE_NONCE_LENGTH - self.COINBASE_NONCE_LENGTH)*8 + + self._cache = {} + self._times = None + + def get_work(self, *args): + if self._times != self.new_work_event.times: + self._cache = {} + self._times = self.new_work_event.times + + if args not in self._cache: + x, handler = self._inner.get_work(*args) + self._cache[args] = x, handler, 0 + + x, handler, nonce = self._cache.pop(args) + + res = ( + dict(x, coinb1=x['coinb1'] + pack.IntType(self._my_bits).pack(nonce)), + lambda header, user, coinbase_nonce: handler(header, user, pack.IntType(self._my_bits).pack(nonce) + coinbase_nonce), + ) + + if nonce + 1 != 2**self._my_bits: + self._cache[args] = x, handler, nonce + 1 + + return res diff --git a/p2pool/data.py b/p2pool/data.py new file mode 100644 index 00000000..e8fe347c --- /dev/null +++ b/p2pool/data.py @@ -0,0 +1,730 @@ +from __future__ import division + +import hashlib +import os +import random +import sys +import time + +from twisted.python import log + +import p2pool +from p2pool.bitcoin import data as bitcoin_data, script, sha256 +from p2pool.util import math, forest, pack + +# hashlink + +hash_link_type = pack.ComposedType([ + ('state', pack.FixedStrType(32)), + ('extra_data', pack.FixedStrType(0)), # bit of a hack, but since the donation script is at the end, const_ending is long enough to always make this empty + ('length', pack.VarIntType()), +]) + +def prefix_to_hash_link(prefix, const_ending=''): + assert prefix.endswith(const_ending), (prefix, const_ending) + x = sha256.sha256(prefix) + return dict(state=x.state, extra_data=x.buf[:max(0, len(x.buf)-len(const_ending))], length=x.length//8) + +def check_hash_link(hash_link, data, const_ending=''): + extra_length = hash_link['length'] % (512//8) + assert len(hash_link['extra_data']) == max(0, extra_length - len(const_ending)) + extra = (hash_link['extra_data'] + const_ending)[len(hash_link['extra_data']) + len(const_ending) - extra_length:] + assert len(extra) == extra_length + return pack.IntType(256).unpack(hashlib.sha256(sha256.sha256(data, (hash_link['state'], extra, 8*hash_link['length'])).digest()).digest()) + +# shares + +share_type = pack.ComposedType([ + ('type', pack.VarIntType()), + ('contents', pack.VarStrType()), +]) + +def load_share(share, net, peer_addr): + assert peer_addr is None or isinstance(peer_addr, tuple) + if share['type'] < Share.VERSION: + from p2pool import p2p + raise p2p.PeerMisbehavingError('sent an obsolete share') + elif share['type'] == Share.VERSION: + return Share(net, peer_addr, Share.share_type.unpack(share['contents'])) + else: + raise ValueError('unknown share type: %r' % (share['type'],)) + +DONATION_SCRIPT = '4104ffd03de44a6e11b9917f3a29f9443283d9871c9d743ef30d5eddcd37094b64d1b3d8090496b53256786bf5c82932ec23c3b74d9f05a6f95a8b5529352656664bac'.decode('hex') + +class Share(object): + VERSION = 13 + VOTING_VERSION = 13 + SUCCESSOR = None + + small_block_header_type = pack.ComposedType([ + ('version', pack.VarIntType()), + ('previous_block', pack.PossiblyNoneType(0, pack.IntType(256))), + ('timestamp', pack.IntType(32)), + ('bits', bitcoin_data.FloatingIntegerType()), + ('nonce', pack.IntType(32)), + ]) + + share_info_type = pack.ComposedType([ + ('share_data', pack.ComposedType([ + ('previous_share_hash', pack.PossiblyNoneType(0, pack.IntType(256))), + ('coinbase', pack.VarStrType()), + ('nonce', pack.IntType(32)), + ('pubkey_hash', pack.IntType(160)), + ('subsidy', pack.IntType(64)), + ('donation', pack.IntType(16)), + ('stale_info', pack.EnumType(pack.IntType(8), dict((k, {0: None, 253: 'orphan', 254: 'doa'}.get(k, 'unk%i' % (k,))) for k in xrange(256)))), + ('desired_version', pack.VarIntType()), + ])), + ('new_transaction_hashes', pack.ListType(pack.IntType(256))), + ('transaction_hash_refs', pack.ListType(pack.VarIntType(), 2)), # pairs of share_count, tx_count + ('far_share_hash', pack.PossiblyNoneType(0, pack.IntType(256))), + ('max_bits', bitcoin_data.FloatingIntegerType()), + ('bits', bitcoin_data.FloatingIntegerType()), + ('timestamp', pack.IntType(32)), + ('absheight', pack.IntType(32)), + ('abswork', pack.IntType(128)), + ]) + + share_type = pack.ComposedType([ + ('min_header', small_block_header_type), + ('share_info', share_info_type), + ('ref_merkle_link', pack.ComposedType([ + ('branch', pack.ListType(pack.IntType(256))), + ('index', pack.IntType(0)), + ])), + ('last_txout_nonce', pack.IntType(64)), + ('hash_link', hash_link_type), + ('merkle_link', pack.ComposedType([ + ('branch', pack.ListType(pack.IntType(256))), + ('index', pack.IntType(0)), # it will always be 0 + ])), + ]) + + ref_type = pack.ComposedType([ + ('identifier', pack.FixedStrType(64//8)), + ('share_info', share_info_type), + ]) + + gentx_before_refhash = pack.VarStrType().pack(DONATION_SCRIPT) + pack.IntType(64).pack(0) + pack.VarStrType().pack('\x6a\x28' + pack.IntType(256).pack(0) + pack.IntType(64).pack(0))[:3] + + @classmethod + def generate_transaction(cls, tracker, share_data, block_target, desired_timestamp, desired_target, ref_merkle_link, desired_other_transaction_hashes_and_fees, net, known_txs=None, last_txout_nonce=0, base_subsidy=None): + previous_share = tracker.items[share_data['previous_share_hash']] if share_data['previous_share_hash'] is not None else None + + height, last = tracker.get_height_and_last(share_data['previous_share_hash']) + assert height >= net.REAL_CHAIN_LENGTH or last is None + if height < net.TARGET_LOOKBEHIND: + pre_target3 = net.MAX_TARGET + else: + attempts_per_second = get_pool_attempts_per_second(tracker, share_data['previous_share_hash'], net.TARGET_LOOKBEHIND, min_work=True, integer=True) + pre_target = 2**256//(net.SHARE_PERIOD*attempts_per_second) - 1 if attempts_per_second else 2**256-1 + pre_target2 = math.clip(pre_target, (previous_share.max_target*9//10, previous_share.max_target*11//10)) + pre_target3 = math.clip(pre_target2, (net.MIN_TARGET, net.MAX_TARGET)) + max_bits = bitcoin_data.FloatingInteger.from_target_upper_bound(pre_target3) + bits = bitcoin_data.FloatingInteger.from_target_upper_bound(math.clip(desired_target, (pre_target3//30, pre_target3))) + + new_transaction_hashes = [] + new_transaction_size = 0 + transaction_hash_refs = [] + other_transaction_hashes = [] + + past_shares = list(tracker.get_chain(share_data['previous_share_hash'], min(height, 100))) + tx_hash_to_this = {} + for i, share in enumerate(past_shares): + for j, tx_hash in enumerate(share.new_transaction_hashes): + if tx_hash not in tx_hash_to_this: + tx_hash_to_this[tx_hash] = [1+i, j] # share_count, tx_count + for tx_hash, fee in desired_other_transaction_hashes_and_fees: + if tx_hash in tx_hash_to_this: + this = tx_hash_to_this[tx_hash] + else: + if known_txs is not None: + this_size = bitcoin_data.tx_type.packed_size(known_txs[tx_hash]) + if new_transaction_size + this_size > 50000: # only allow 50 kB of new txns/share + break + new_transaction_size += this_size + new_transaction_hashes.append(tx_hash) + this = [0, len(new_transaction_hashes)-1] + transaction_hash_refs.extend(this) + other_transaction_hashes.append(tx_hash) + + included_transactions = set(other_transaction_hashes) + removed_fees = [fee for tx_hash, fee in desired_other_transaction_hashes_and_fees if tx_hash not in included_transactions] + definite_fees = sum(0 if fee is None else fee for tx_hash, fee in desired_other_transaction_hashes_and_fees if tx_hash in included_transactions) + if None not in removed_fees: + share_data = dict(share_data, subsidy=share_data['subsidy'] - sum(removed_fees)) + else: + assert base_subsidy is not None + share_data = dict(share_data, subsidy=base_subsidy + definite_fees) + + weights, total_weight, donation_weight = tracker.get_cumulative_weights(previous_share.share_data['previous_share_hash'] if previous_share is not None else None, + max(0, min(height, net.REAL_CHAIN_LENGTH) - 1), + 65535*net.SPREAD*bitcoin_data.target_to_average_attempts(block_target), + ) + assert total_weight == sum(weights.itervalues()) + donation_weight, (total_weight, sum(weights.itervalues()) + donation_weight) + + amounts = dict((script, share_data['subsidy']*(199*weight)//(200*total_weight)) for script, weight in weights.iteritems()) # 99.5% goes according to weights prior to this share + this_script = bitcoin_data.pubkey_hash_to_script2(share_data['pubkey_hash']) + amounts[this_script] = amounts.get(this_script, 0) + share_data['subsidy']//200 # 0.5% goes to block finder + amounts[DONATION_SCRIPT] = amounts.get(DONATION_SCRIPT, 0) + share_data['subsidy'] - sum(amounts.itervalues()) # all that's left over is the donation weight and some extra satoshis due to rounding + + if sum(amounts.itervalues()) != share_data['subsidy'] or any(x < 0 for x in amounts.itervalues()): + raise ValueError() + + dests = sorted(amounts.iterkeys(), key=lambda script: (script == DONATION_SCRIPT, amounts[script], script))[-4000:] # block length limit, unlikely to ever be hit + + share_info = dict( + share_data=share_data, + far_share_hash=None if last is None and height < 99 else tracker.get_nth_parent_hash(share_data['previous_share_hash'], 99), + max_bits=max_bits, + bits=bits, + timestamp=math.clip(desired_timestamp, ( + (previous_share.timestamp + net.SHARE_PERIOD) - (net.SHARE_PERIOD - 1), # = previous_share.timestamp + 1 + (previous_share.timestamp + net.SHARE_PERIOD) + (net.SHARE_PERIOD - 1), + )) if previous_share is not None else desired_timestamp, + new_transaction_hashes=new_transaction_hashes, + transaction_hash_refs=transaction_hash_refs, + absheight=((previous_share.absheight if previous_share is not None else 0) + 1) % 2**32, + abswork=((previous_share.abswork if previous_share is not None else 0) + bitcoin_data.target_to_average_attempts(bits.target)) % 2**128, + ) + + gentx = dict( + version=1, + tx_ins=[dict( + previous_output=None, + sequence=None, + script=share_data['coinbase'], + )], + tx_outs=[dict(value=amounts[script], script=script) for script in dests if amounts[script] or script == DONATION_SCRIPT] + [dict( + value=0, + script='\x6a\x28' + cls.get_ref_hash(net, share_info, ref_merkle_link) + pack.IntType(64).pack(last_txout_nonce), + )], + lock_time=0, + ) + + def get_share(header, last_txout_nonce=last_txout_nonce): + min_header = dict(header); del min_header['merkle_root'] + share = cls(net, None, dict( + min_header=min_header, + share_info=share_info, + ref_merkle_link=dict(branch=[], index=0), + last_txout_nonce=last_txout_nonce, + hash_link=prefix_to_hash_link(bitcoin_data.tx_type.pack(gentx)[:-32-8-4], cls.gentx_before_refhash), + merkle_link=bitcoin_data.calculate_merkle_link([None] + other_transaction_hashes, 0), + )) + assert share.header == header # checks merkle_root + return share + + return share_info, gentx, other_transaction_hashes, get_share + + @classmethod + def get_ref_hash(cls, net, share_info, ref_merkle_link): + return pack.IntType(256).pack(bitcoin_data.check_merkle_link(bitcoin_data.hash256(cls.ref_type.pack(dict( + identifier=net.IDENTIFIER, + share_info=share_info, + ))), ref_merkle_link)) + + __slots__ = 'net peer_addr contents min_header share_info hash_link merkle_link hash share_data max_target target timestamp previous_hash new_script desired_version gentx_hash header pow_hash header_hash new_transaction_hashes time_seen absheight abswork'.split(' ') + + def __init__(self, net, peer_addr, contents): + self.net = net + self.peer_addr = peer_addr + self.contents = contents + + self.min_header = contents['min_header'] + self.share_info = contents['share_info'] + self.hash_link = contents['hash_link'] + self.merkle_link = contents['merkle_link'] + + if not (2 <= len(self.share_info['share_data']['coinbase']) <= 100): + raise ValueError('''bad coinbase size! %i bytes''' % (len(self.share_info['share_data']['coinbase']),)) + + if len(self.merkle_link['branch']) > 16: + raise ValueError('merkle branch too long!') + + assert not self.hash_link['extra_data'], repr(self.hash_link['extra_data']) + + self.share_data = self.share_info['share_data'] + self.max_target = self.share_info['max_bits'].target + self.target = self.share_info['bits'].target + self.timestamp = self.share_info['timestamp'] + self.previous_hash = self.share_data['previous_share_hash'] + self.new_script = bitcoin_data.pubkey_hash_to_script2(self.share_data['pubkey_hash']) + self.desired_version = self.share_data['desired_version'] + self.absheight = self.share_info['absheight'] + self.abswork = self.share_info['abswork'] + + n = set() + for share_count, tx_count in self.iter_transaction_hash_refs(): + assert share_count < 110 + if share_count == 0: + n.add(tx_count) + assert n == set(range(len(self.share_info['new_transaction_hashes']))) + + self.gentx_hash = check_hash_link( + self.hash_link, + self.get_ref_hash(net, self.share_info, contents['ref_merkle_link']) + pack.IntType(64).pack(self.contents['last_txout_nonce']) + pack.IntType(32).pack(0), + self.gentx_before_refhash, + ) + merkle_root = bitcoin_data.check_merkle_link(self.gentx_hash, self.merkle_link) + self.header = dict(self.min_header, merkle_root=merkle_root) + self.pow_hash = net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(self.header)) + self.hash = self.header_hash = bitcoin_data.hash256(bitcoin_data.block_header_type.pack(self.header)) + + if self.target > net.MAX_TARGET: + from p2pool import p2p + raise p2p.PeerMisbehavingError('share target invalid') + + if self.pow_hash > self.target: + from p2pool import p2p + raise p2p.PeerMisbehavingError('share PoW invalid') + + self.new_transaction_hashes = self.share_info['new_transaction_hashes'] + + # XXX eww + self.time_seen = time.time() + + def __repr__(self): + return 'Share' + repr((self.net, self.peer_addr, self.contents)) + + def as_share(self): + return dict(type=self.VERSION, contents=self.share_type.pack(self.contents)) + + def iter_transaction_hash_refs(self): + return zip(self.share_info['transaction_hash_refs'][::2], self.share_info['transaction_hash_refs'][1::2]) + + def check(self, tracker): + from p2pool import p2p + if self.share_data['previous_share_hash'] is not None: + previous_share = tracker.items[self.share_data['previous_share_hash']] + if type(self) is type(previous_share): + pass + elif type(self) is type(previous_share).SUCCESSOR: + if tracker.get_height(previous_share.hash) < self.net.CHAIN_LENGTH: + from p2pool import p2p + raise p2p.PeerMisbehavingError('switch without enough history') + + # switch only valid if 85% of hashes in [self.net.CHAIN_LENGTH*9//10, self.net.CHAIN_LENGTH] for new version + counts = get_desired_version_counts(tracker, + tracker.get_nth_parent_hash(previous_share.hash, self.net.CHAIN_LENGTH*9//10), self.net.CHAIN_LENGTH//10) + if counts.get(self.VERSION, 0) < sum(counts.itervalues())*85//100: + raise p2p.PeerMisbehavingError('switch without enough hash power upgraded') + else: + raise p2p.PeerMisbehavingError('''%s can't follow %s''' % (type(self).__name__, type(previous_share).__name__)) + + other_tx_hashes = [tracker.items[tracker.get_nth_parent_hash(self.hash, share_count)].share_info['new_transaction_hashes'][tx_count] for share_count, tx_count in self.iter_transaction_hash_refs()] + + share_info, gentx, other_tx_hashes2, get_share = self.generate_transaction(tracker, self.share_info['share_data'], self.header['bits'].target, self.share_info['timestamp'], self.share_info['bits'].target, self.contents['ref_merkle_link'], [(h, None) for h in other_tx_hashes], self.net, last_txout_nonce=self.contents['last_txout_nonce']) + assert other_tx_hashes2 == other_tx_hashes + if share_info != self.share_info: + raise ValueError('share_info invalid') + if bitcoin_data.hash256(bitcoin_data.tx_type.pack(gentx)) != self.gentx_hash: + raise ValueError('''gentx doesn't match hash_link''') + + if bitcoin_data.calculate_merkle_link([None] + other_tx_hashes, 0) != self.merkle_link: + raise ValueError('merkle_link and other_tx_hashes do not match') + + return gentx # only used by as_block + + def get_other_tx_hashes(self, tracker): + parents_needed = max(share_count for share_count, tx_count in self.iter_transaction_hash_refs()) if self.share_info['transaction_hash_refs'] else 0 + parents = tracker.get_height(self.hash) - 1 + if parents < parents_needed: + return None + last_shares = list(tracker.get_chain(self.hash, parents_needed + 1)) + return [last_shares[share_count].share_info['new_transaction_hashes'][tx_count] for share_count, tx_count in self.iter_transaction_hash_refs()] + + def _get_other_txs(self, tracker, known_txs): + other_tx_hashes = self.get_other_tx_hashes(tracker) + if other_tx_hashes is None: + return None # not all parents present + + if not all(tx_hash in known_txs for tx_hash in other_tx_hashes): + return None # not all txs present + + return [known_txs[tx_hash] for tx_hash in other_tx_hashes] + + def should_punish_reason(self, previous_block, bits, tracker, known_txs): + if (self.header['previous_block'], self.header['bits']) != (previous_block, bits) and self.header_hash != previous_block and self.peer_addr is not None: + return True, 'Block-stale detected! height(%x) < height(%x) or %08x != %08x' % (self.header['previous_block'], previous_block, self.header['bits'].bits, bits.bits) + + if self.pow_hash <= self.header['bits'].target: + return -1, 'block solution' + + other_txs = self._get_other_txs(tracker, known_txs) + if other_txs is None: + pass + else: + all_txs_size = sum(bitcoin_data.tx_type.packed_size(tx) for tx in other_txs) + if all_txs_size > 1000000: + return True, 'txs over block size limit' + + new_txs_size = sum(bitcoin_data.tx_type.packed_size(known_txs[tx_hash]) for tx_hash in self.share_info['new_transaction_hashes']) + if new_txs_size > 50000: + return True, 'new txs over limit' + + return False, None + + def as_block(self, tracker, known_txs): + other_txs = self._get_other_txs(tracker, known_txs) + if other_txs is None: + return None # not all txs present + return dict(header=self.header, txs=[self.check(tracker)] + other_txs) + + +class WeightsSkipList(forest.TrackerSkipList): + # share_count, weights, total_weight + + def get_delta(self, element): + from p2pool.bitcoin import data as bitcoin_data + share = self.tracker.items[element] + att = bitcoin_data.target_to_average_attempts(share.target) + return 1, {share.new_script: att*(65535-share.share_data['donation'])}, att*65535, att*share.share_data['donation'] + + def combine_deltas(self, (share_count1, weights1, total_weight1, total_donation_weight1), (share_count2, weights2, total_weight2, total_donation_weight2)): + return share_count1 + share_count2, math.add_dicts(weights1, weights2), total_weight1 + total_weight2, total_donation_weight1 + total_donation_weight2 + + def initial_solution(self, start, (max_shares, desired_weight)): + assert desired_weight % 65535 == 0, divmod(desired_weight, 65535) + return 0, None, 0, 0 + + def apply_delta(self, (share_count1, weights_list, total_weight1, total_donation_weight1), (share_count2, weights2, total_weight2, total_donation_weight2), (max_shares, desired_weight)): + if total_weight1 + total_weight2 > desired_weight and share_count2 == 1: + assert (desired_weight - total_weight1) % 65535 == 0 + script, = weights2.iterkeys() + new_weights = {script: (desired_weight - total_weight1)//65535*weights2[script]//(total_weight2//65535)} + return share_count1 + share_count2, (weights_list, new_weights), desired_weight, total_donation_weight1 + (desired_weight - total_weight1)//65535*total_donation_weight2//(total_weight2//65535) + return share_count1 + share_count2, (weights_list, weights2), total_weight1 + total_weight2, total_donation_weight1 + total_donation_weight2 + + def judge(self, (share_count, weights_list, total_weight, total_donation_weight), (max_shares, desired_weight)): + if share_count > max_shares or total_weight > desired_weight: + return 1 + elif share_count == max_shares or total_weight == desired_weight: + return 0 + else: + return -1 + + def finalize(self, (share_count, weights_list, total_weight, total_donation_weight), (max_shares, desired_weight)): + assert share_count <= max_shares and total_weight <= desired_weight + assert share_count == max_shares or total_weight == desired_weight + return math.add_dicts(*math.flatten_linked_list(weights_list)), total_weight, total_donation_weight + +class OkayTracker(forest.Tracker): + def __init__(self, net): + forest.Tracker.__init__(self, delta_type=forest.get_attributedelta_type(dict(forest.AttributeDelta.attrs, + work=lambda share: bitcoin_data.target_to_average_attempts(share.target), + min_work=lambda share: bitcoin_data.target_to_average_attempts(share.max_target), + ))) + self.net = net + self.verified = forest.SubsetTracker(delta_type=forest.get_attributedelta_type(dict(forest.AttributeDelta.attrs, + work=lambda share: bitcoin_data.target_to_average_attempts(share.target), + )), subset_of=self) + self.get_cumulative_weights = WeightsSkipList(self) + + def attempt_verify(self, share): + if share.hash in self.verified.items: + return True + height, last = self.get_height_and_last(share.hash) + if height < self.net.CHAIN_LENGTH + 1 and last is not None: + raise AssertionError() + try: + share.check(self) + except: + log.err(None, 'Share check failed: %064x -> %064x' % (share.hash, share.previous_hash if share.previous_hash is not None else 0)) + return False + else: + self.verified.add(share) + return True + + def think(self, block_rel_height_func, previous_block, bits, known_txs): + desired = set() + bad_peer_addresses = set() + + # O(len(self.heads)) + # make 'unverified heads' set? + # for each overall head, attempt verification + # if it fails, attempt on parent, and repeat + # if no successful verification because of lack of parents, request parent + bads = [] + for head in set(self.heads) - set(self.verified.heads): + head_height, last = self.get_height_and_last(head) + + for share in self.get_chain(head, head_height if last is None else min(5, max(0, head_height - self.net.CHAIN_LENGTH))): + if self.attempt_verify(share): + break + bads.append(share.hash) + else: + if last is not None: + desired.add(( + self.items[random.choice(list(self.reverse[last]))].peer_addr, + last, + max(x.timestamp for x in self.get_chain(head, min(head_height, 5))), + min(x.target for x in self.get_chain(head, min(head_height, 5))), + )) + for bad in bads: + assert bad not in self.verified.items + #assert bad in self.heads + bad_share = self.items[bad] + if bad_share.peer_addr is not None: + bad_peer_addresses.add(bad_share.peer_addr) + if p2pool.DEBUG: + print "BAD", bad + try: + self.remove(bad) + except NotImplementedError: + pass + + # try to get at least CHAIN_LENGTH height for each verified head, requesting parents if needed + for head in list(self.verified.heads): + head_height, last_hash = self.verified.get_height_and_last(head) + last_height, last_last_hash = self.get_height_and_last(last_hash) + # XXX review boundary conditions + want = max(self.net.CHAIN_LENGTH - head_height, 0) + can = max(last_height - 1 - self.net.CHAIN_LENGTH, 0) if last_last_hash is not None else last_height + get = min(want, can) + #print 'Z', head_height, last_hash is None, last_height, last_last_hash is None, want, can, get + for share in self.get_chain(last_hash, get): + if not self.attempt_verify(share): + break + if head_height < self.net.CHAIN_LENGTH and last_last_hash is not None: + desired.add(( + self.items[random.choice(list(self.verified.reverse[last_hash]))].peer_addr, + last_last_hash, + max(x.timestamp for x in self.get_chain(head, min(head_height, 5))), + min(x.target for x in self.get_chain(head, min(head_height, 5))), + )) + + # decide best tree + decorated_tails = sorted((self.score(max(self.verified.tails[tail_hash], key=self.verified.get_work), block_rel_height_func), tail_hash) for tail_hash in self.verified.tails) + if p2pool.DEBUG: + print len(decorated_tails), 'tails:' + for score, tail_hash in decorated_tails: + print format_hash(tail_hash), score + best_tail_score, best_tail = decorated_tails[-1] if decorated_tails else (None, None) + + # decide best verified head + decorated_heads = sorted((( + self.verified.get_work(self.verified.get_nth_parent_hash(h, min(5, self.verified.get_height(h)))), + #self.items[h].peer_addr is None, + -self.items[h].should_punish_reason(previous_block, bits, self, known_txs)[0], + -self.items[h].time_seen, + ), h) for h in self.verified.tails.get(best_tail, [])) + if p2pool.DEBUG: + print len(decorated_heads), 'heads. Top 10:' + for score, head_hash in decorated_heads[-10:]: + print ' ', format_hash(head_hash), format_hash(self.items[head_hash].previous_hash), score + best_head_score, best = decorated_heads[-1] if decorated_heads else (None, None) + + if best is not None: + best_share = self.items[best] + punish, punish_reason = best_share.should_punish_reason(previous_block, bits, self, known_txs) + if punish > 0: + print 'Punishing share for %r! Jumping from %s to %s!' % (punish_reason, format_hash(best), format_hash(best_share.previous_hash)) + best = best_share.previous_hash + + timestamp_cutoff = min(int(time.time()), best_share.timestamp) - 3600 + target_cutoff = int(2**256//(self.net.SHARE_PERIOD*best_tail_score[1] + 1) * 2 + .5) if best_tail_score[1] is not None else 2**256-1 + else: + timestamp_cutoff = int(time.time()) - 24*60*60 + target_cutoff = 2**256-1 + + if p2pool.DEBUG: + print 'Desire %i shares. Cutoff: %s old diff>%.2f' % (len(desired), math.format_dt(time.time() - timestamp_cutoff), bitcoin_data.target_to_difficulty(target_cutoff)) + for peer_addr, hash, ts, targ in desired: + print ' ', None if peer_addr is None else '%s:%i' % peer_addr, format_hash(hash), math.format_dt(time.time() - ts), bitcoin_data.target_to_difficulty(targ), ts >= timestamp_cutoff, targ <= target_cutoff + + return best, [(peer_addr, hash) for peer_addr, hash, ts, targ in desired if ts >= timestamp_cutoff], decorated_heads, bad_peer_addresses + + def score(self, share_hash, block_rel_height_func): + # returns approximate lower bound on chain's hashrate in the last self.net.CHAIN_LENGTH*15//16*self.net.SHARE_PERIOD time + + head_height = self.verified.get_height(share_hash) + if head_height < self.net.CHAIN_LENGTH: + return head_height, None + + end_point = self.verified.get_nth_parent_hash(share_hash, self.net.CHAIN_LENGTH*15//16) + + block_height = max(block_rel_height_func(share.header['previous_block']) for share in + self.verified.get_chain(end_point, self.net.CHAIN_LENGTH//16)) + + return self.net.CHAIN_LENGTH, self.verified.get_delta(share_hash, end_point).work/((0 - block_height + 1)*self.net.PARENT.BLOCK_PERIOD) + +def get_pool_attempts_per_second(tracker, previous_share_hash, dist, min_work=False, integer=False): + assert dist >= 2 + near = tracker.items[previous_share_hash] + far = tracker.items[tracker.get_nth_parent_hash(previous_share_hash, dist - 1)] + attempts = tracker.get_delta(near.hash, far.hash).work if not min_work else tracker.get_delta(near.hash, far.hash).min_work + time = near.timestamp - far.timestamp + if time <= 0: + time = 1 + if integer: + return attempts//time + return attempts/time + +def get_average_stale_prop(tracker, share_hash, lookbehind): + stales = sum(1 for share in tracker.get_chain(share_hash, lookbehind) if share.share_data['stale_info'] is not None) + return stales/(lookbehind + stales) + +def get_stale_counts(tracker, share_hash, lookbehind, rates=False): + res = {} + for share in tracker.get_chain(share_hash, lookbehind - 1): + res['good'] = res.get('good', 0) + bitcoin_data.target_to_average_attempts(share.target) + s = share.share_data['stale_info'] + if s is not None: + res[s] = res.get(s, 0) + bitcoin_data.target_to_average_attempts(share.target) + if rates: + dt = tracker.items[share_hash].timestamp - tracker.items[tracker.get_nth_parent_hash(share_hash, lookbehind - 1)].timestamp + res = dict((k, v/dt) for k, v in res.iteritems()) + return res + +def get_user_stale_props(tracker, share_hash, lookbehind): + res = {} + for share in tracker.get_chain(share_hash, lookbehind - 1): + stale, total = res.get(share.share_data['pubkey_hash'], (0, 0)) + total += 1 + if share.share_data['stale_info'] is not None: + stale += 1 + total += 1 + res[share.share_data['pubkey_hash']] = stale, total + return dict((pubkey_hash, stale/total) for pubkey_hash, (stale, total) in res.iteritems()) + +def get_expected_payouts(tracker, best_share_hash, block_target, subsidy, net): + weights, total_weight, donation_weight = tracker.get_cumulative_weights(best_share_hash, min(tracker.get_height(best_share_hash), net.REAL_CHAIN_LENGTH), 65535*net.SPREAD*bitcoin_data.target_to_average_attempts(block_target)) + res = dict((script, subsidy*weight//total_weight) for script, weight in weights.iteritems()) + res[DONATION_SCRIPT] = res.get(DONATION_SCRIPT, 0) + subsidy - sum(res.itervalues()) + return res + +def get_desired_version_counts(tracker, best_share_hash, dist): + res = {} + for share in tracker.get_chain(best_share_hash, dist): + res[share.desired_version] = res.get(share.desired_version, 0) + bitcoin_data.target_to_average_attempts(share.target) + return res + +def get_warnings(tracker, best_share, net, bitcoind_getinfo, bitcoind_work_value): + res = [] + + desired_version_counts = get_desired_version_counts(tracker, best_share, + min(net.CHAIN_LENGTH, 60*60//net.SHARE_PERIOD, tracker.get_height(best_share))) + majority_desired_version = max(desired_version_counts, key=lambda k: desired_version_counts[k]) + if majority_desired_version > (Share.SUCCESSOR if Share.SUCCESSOR is not None else Share).VOTING_VERSION and desired_version_counts[majority_desired_version] > sum(desired_version_counts.itervalues())/2: + res.append('A MAJORITY OF SHARES CONTAIN A VOTE FOR AN UNSUPPORTED SHARE IMPLEMENTATION! (v%i with %i%% support)\n' + 'An upgrade is likely necessary. Check http://p2pool.forre.st/ for more information.' % ( + majority_desired_version, 100*desired_version_counts[majority_desired_version]/sum(desired_version_counts.itervalues()))) + + if bitcoind_getinfo['errors'] != '': + if 'This is a pre-release test build' not in bitcoind_getinfo['errors']: + res.append('(from bitcoind) %s' % (bitcoind_getinfo['errors'],)) + + version_warning = getattr(net, 'VERSION_WARNING', lambda v: None)(bitcoind_getinfo['version']) + if version_warning is not None: + res.append(version_warning) + + if time.time() > bitcoind_work_value['last_update'] + 60: + res.append('''LOST CONTACT WITH BITCOIND for %s! Check that it isn't frozen or dead!''' % (math.format_dt(time.time() - bitcoind_work_value['last_update']),)) + + return res + +def format_hash(x): + if x is None: + return 'xxxxxxxx' + return '%08x' % (x % 2**32) + +class ShareStore(object): + def __init__(self, prefix, net, share_cb, verified_hash_cb): + self.dirname = os.path.dirname(os.path.abspath(prefix)) + self.filename = os.path.basename(os.path.abspath(prefix)) + self.net = net + + known = {} + filenames, next = self.get_filenames_and_next() + for filename in filenames: + share_hashes, verified_hashes = known.setdefault(filename, (set(), set())) + with open(filename, 'rb') as f: + for line in f: + try: + type_id_str, data_hex = line.strip().split(' ') + type_id = int(type_id_str) + if type_id == 0: + pass + elif type_id == 1: + pass + elif type_id == 2: + verified_hash = int(data_hex, 16) + verified_hash_cb(verified_hash) + verified_hashes.add(verified_hash) + elif type_id == 5: + raw_share = share_type.unpack(data_hex.decode('hex')) + if raw_share['type'] < Share.VERSION: + continue + share = load_share(raw_share, self.net, None) + share_cb(share) + share_hashes.add(share.hash) + else: + raise NotImplementedError("share type %i" % (type_id,)) + except Exception: + log.err(None, "HARMLESS error while reading saved shares, continuing where left off:") + + self.known = known # filename -> (set of share hashes, set of verified hashes) + self.known_desired = dict((k, (set(a), set(b))) for k, (a, b) in known.iteritems()) + + def _add_line(self, line): + filenames, next = self.get_filenames_and_next() + if filenames and os.path.getsize(filenames[-1]) < 10e6: + filename = filenames[-1] + else: + filename = next + + with open(filename, 'ab') as f: + f.write(line + '\n') + + return filename + + def add_share(self, share): + for filename, (share_hashes, verified_hashes) in self.known.iteritems(): + if share.hash in share_hashes: + break + else: + filename = self._add_line("%i %s" % (5, share_type.pack(share.as_share()).encode('hex'))) + share_hashes, verified_hashes = self.known.setdefault(filename, (set(), set())) + share_hashes.add(share.hash) + share_hashes, verified_hashes = self.known_desired.setdefault(filename, (set(), set())) + share_hashes.add(share.hash) + + def add_verified_hash(self, share_hash): + for filename, (share_hashes, verified_hashes) in self.known.iteritems(): + if share_hash in verified_hashes: + break + else: + filename = self._add_line("%i %x" % (2, share_hash)) + share_hashes, verified_hashes = self.known.setdefault(filename, (set(), set())) + verified_hashes.add(share_hash) + share_hashes, verified_hashes = self.known_desired.setdefault(filename, (set(), set())) + verified_hashes.add(share_hash) + + def get_filenames_and_next(self): + suffixes = sorted(int(x[len(self.filename):]) for x in os.listdir(self.dirname) if x.startswith(self.filename) and x[len(self.filename):].isdigit()) + return [os.path.join(self.dirname, self.filename + str(suffix)) for suffix in suffixes], os.path.join(self.dirname, self.filename + (str(suffixes[-1] + 1) if suffixes else str(0))) + + def forget_share(self, share_hash): + for filename, (share_hashes, verified_hashes) in self.known_desired.iteritems(): + if share_hash in share_hashes: + share_hashes.remove(share_hash) + self.check_remove() + + def forget_verified_share(self, share_hash): + for filename, (share_hashes, verified_hashes) in self.known_desired.iteritems(): + if share_hash in verified_hashes: + verified_hashes.remove(share_hash) + self.check_remove() + + def check_remove(self): + to_remove = set() + for filename, (share_hashes, verified_hashes) in self.known_desired.iteritems(): + #print filename, len(share_hashes) + len(verified_hashes) + if not share_hashes and not verified_hashes: + to_remove.add(filename) + for filename in to_remove: + self.known.pop(filename) + self.known_desired.pop(filename) + os.remove(filename) + print "REMOVED", filename diff --git a/p2pool/main.py b/p2pool/main.py new file mode 100644 index 00000000..42635f12 --- /dev/null +++ b/p2pool/main.py @@ -0,0 +1,578 @@ +from __future__ import division + +import base64 +import gc +import json +import os +import random +import sys +import time +import signal +import traceback +import urlparse + +if '--iocp' in sys.argv: + from twisted.internet import iocpreactor + iocpreactor.install() +from twisted.internet import defer, reactor, protocol, tcp +from twisted.web import server +from twisted.python import log +from nattraverso import portmapper, ipdiscover + +import bitcoin.p2p as bitcoin_p2p, bitcoin.data as bitcoin_data +from bitcoin import stratum, worker_interface, helper +from util import fixargparse, jsonrpc, variable, deferral, math, logging, switchprotocol +from . import networks, web, work +import p2pool, p2pool.data as p2pool_data, p2pool.node as p2pool_node + +@defer.inlineCallbacks +def main(args, net, datadir_path, merged_urls, worker_endpoint): + try: + print 'p2pool (version %s)' % (p2pool.__version__,) + print + + @defer.inlineCallbacks + def connect_p2p(): + # connect to bitcoind over bitcoin-p2p + print '''Testing bitcoind P2P connection to '%s:%s'...''' % (args.bitcoind_address, args.bitcoind_p2p_port) + factory = bitcoin_p2p.ClientFactory(net.PARENT) + reactor.connectTCP(args.bitcoind_address, args.bitcoind_p2p_port, factory) + def long(): + print ''' ...taking a while. Common reasons for this include all of bitcoind's connection slots being used...''' + long_dc = reactor.callLater(5, long) + yield factory.getProtocol() # waits until handshake is successful + if not long_dc.called: long_dc.cancel() + print ' ...success!' + print + defer.returnValue(factory) + + if args.testnet: # establish p2p connection first if testnet so bitcoind can work without connections + factory = yield connect_p2p() + + # connect to bitcoind over JSON-RPC and do initial getmemorypool + url = '%s://%s:%i/' % ('https' if args.bitcoind_rpc_ssl else 'http', args.bitcoind_address, args.bitcoind_rpc_port) + print '''Testing bitcoind RPC connection to '%s' with username '%s'...''' % (url, args.bitcoind_rpc_username) + bitcoind = jsonrpc.HTTPProxy(url, dict(Authorization='Basic ' + base64.b64encode(args.bitcoind_rpc_username + ':' + args.bitcoind_rpc_password)), timeout=30) + yield helper.check(bitcoind, net) + temp_work = yield helper.getwork(bitcoind) + + bitcoind_getinfo_var = variable.Variable(None) + @defer.inlineCallbacks + def poll_warnings(): + bitcoind_getinfo_var.set((yield deferral.retry('Error while calling getinfo:')(bitcoind.rpc_getinfo)())) + yield poll_warnings() + deferral.RobustLoopingCall(poll_warnings).start(20*60) + + print ' ...success!' + print ' Current block hash: %x' % (temp_work['previous_block'],) + print ' Current block height: %i' % (temp_work['height'] - 1,) + print + + if not args.testnet: + factory = yield connect_p2p() + + print 'Determining payout address...' + if args.pubkey_hash is None: + address_path = os.path.join(datadir_path, 'cached_payout_address') + + if os.path.exists(address_path): + with open(address_path, 'rb') as f: + address = f.read().strip('\r\n') + print ' Loaded cached address: %s...' % (address,) + else: + address = None + + if address is not None: + res = yield deferral.retry('Error validating cached address:', 5)(lambda: bitcoind.rpc_validateaddress(address))() + if not res['isvalid'] or not res['ismine']: + print ' Cached address is either invalid or not controlled by local bitcoind!' + address = None + + if address is None: + print ' Getting payout address from bitcoind...' + address = yield deferral.retry('Error getting payout address from bitcoind:', 5)(lambda: bitcoind.rpc_getaccountaddress('p2pool'))() + + with open(address_path, 'wb') as f: + f.write(address) + + my_pubkey_hash = bitcoin_data.address_to_pubkey_hash(address, net.PARENT) + else: + my_pubkey_hash = args.pubkey_hash + print ' ...success! Payout address:', bitcoin_data.pubkey_hash_to_address(my_pubkey_hash, net.PARENT) + print + + print "Loading shares..." + shares = {} + known_verified = set() + def share_cb(share): + share.time_seen = 0 # XXX + shares[share.hash] = share + if len(shares) % 1000 == 0 and shares: + print " %i" % (len(shares),) + ss = p2pool_data.ShareStore(os.path.join(datadir_path, 'shares.'), net, share_cb, known_verified.add) + print " ...done loading %i shares (%i verified)!" % (len(shares), len(known_verified)) + print + + + print 'Initializing work...' + + node = p2pool_node.Node(factory, bitcoind, shares.values(), known_verified, net) + yield node.start() + + for share_hash in shares: + if share_hash not in node.tracker.items: + ss.forget_share(share_hash) + for share_hash in known_verified: + if share_hash not in node.tracker.verified.items: + ss.forget_verified_share(share_hash) + node.tracker.removed.watch(lambda share: ss.forget_share(share.hash)) + node.tracker.verified.removed.watch(lambda share: ss.forget_verified_share(share.hash)) + + def save_shares(): + for share in node.tracker.get_chain(node.best_share_var.value, min(node.tracker.get_height(node.best_share_var.value), 2*net.CHAIN_LENGTH)): + ss.add_share(share) + if share.hash in node.tracker.verified.items: + ss.add_verified_hash(share.hash) + deferral.RobustLoopingCall(save_shares).start(60) + + print ' ...success!' + print + + + print 'Joining p2pool network using port %i...' % (args.p2pool_port,) + + @defer.inlineCallbacks + def parse(host): + port = net.P2P_PORT + if ':' in host: + host, port_str = host.split(':') + port = int(port_str) + defer.returnValue(((yield reactor.resolve(host)), port)) + + addrs = {} + if os.path.exists(os.path.join(datadir_path, 'addrs')): + try: + with open(os.path.join(datadir_path, 'addrs'), 'rb') as f: + addrs.update(dict((tuple(k), v) for k, v in json.loads(f.read()))) + except: + print >>sys.stderr, 'error parsing addrs' + for addr_df in map(parse, net.BOOTSTRAP_ADDRS): + try: + addr = yield addr_df + if addr not in addrs: + addrs[addr] = (0, time.time(), time.time()) + except: + log.err() + + connect_addrs = set() + for addr_df in map(parse, args.p2pool_nodes): + try: + connect_addrs.add((yield addr_df)) + except: + log.err() + + node.p2p_node = p2pool_node.P2PNode(node, + port=args.p2pool_port, + max_incoming_conns=args.p2pool_conns, + addr_store=addrs, + connect_addrs=connect_addrs, + desired_outgoing_conns=args.p2pool_outgoing_conns, + advertise_ip=args.advertise_ip, + ) + node.p2p_node.start() + + def save_addrs(): + with open(os.path.join(datadir_path, 'addrs'), 'wb') as f: + f.write(json.dumps(node.p2p_node.addr_store.items())) + deferral.RobustLoopingCall(save_addrs).start(60) + + print ' ...success!' + print + + if args.upnp: + @defer.inlineCallbacks + def upnp_thread(): + while True: + try: + is_lan, lan_ip = yield ipdiscover.get_local_ip() + if is_lan: + pm = yield portmapper.get_port_mapper() + yield pm._upnp.add_port_mapping(lan_ip, args.p2pool_port, args.p2pool_port, 'p2pool', 'TCP') + except defer.TimeoutError: + pass + except: + if p2pool.DEBUG: + log.err(None, 'UPnP error:') + yield deferral.sleep(random.expovariate(1/120)) + upnp_thread() + + # start listening for workers with a JSON-RPC server + + print 'Listening for workers on %r port %i...' % (worker_endpoint[0], worker_endpoint[1]) + + wb = work.WorkerBridge(node, my_pubkey_hash, args.donation_percentage, merged_urls, args.worker_fee) + web_root = web.get_web_root(wb, datadir_path, bitcoind_getinfo_var) + caching_wb = worker_interface.CachingWorkerBridge(wb) + worker_interface.WorkerInterface(caching_wb).attach_to(web_root, get_handler=lambda request: request.redirect('static/')) + web_serverfactory = server.Site(web_root) + + + serverfactory = switchprotocol.FirstByteSwitchFactory({'{': stratum.StratumServerFactory(caching_wb)}, web_serverfactory) + deferral.retry('Error binding to worker port:', traceback=False)(reactor.listenTCP)(worker_endpoint[1], serverfactory, interface=worker_endpoint[0]) + + with open(os.path.join(os.path.join(datadir_path, 'ready_flag')), 'wb') as f: + pass + + print ' ...success!' + print + + + # done! + print 'Started successfully!' + print 'Go to http://127.0.0.1:%i/ to view graphs and statistics!' % (worker_endpoint[1],) + if args.donation_percentage > 1.1: + print '''Donating %.1f%% of work towards P2Pool's development. Thanks for the tip!''' % (args.donation_percentage,) + elif args.donation_percentage < .9: + print '''Donating %.1f%% of work towards P2Pool's development. Please donate to encourage further development of P2Pool!''' % (args.donation_percentage,) + else: + print '''Donating %.1f%% of work towards P2Pool's development. Thank you!''' % (args.donation_percentage,) + print 'You can increase this amount with --give-author argument! (or decrease it, if you must)' + print + + + if hasattr(signal, 'SIGALRM'): + signal.signal(signal.SIGALRM, lambda signum, frame: reactor.callFromThread( + sys.stderr.write, 'Watchdog timer went off at:\n' + ''.join(traceback.format_stack()) + )) + signal.siginterrupt(signal.SIGALRM, False) + deferral.RobustLoopingCall(signal.alarm, 30).start(1) + + if args.irc_announce: + from twisted.words.protocols import irc + class IRCClient(irc.IRCClient): + nickname = 'p2pool%02i' % (random.randrange(100),) + channel = net.ANNOUNCE_CHANNEL + def lineReceived(self, line): + if p2pool.DEBUG: + print repr(line) + irc.IRCClient.lineReceived(self, line) + def signedOn(self): + self.in_channel = False + irc.IRCClient.signedOn(self) + self.factory.resetDelay() + self.join(self.channel) + @defer.inlineCallbacks + def new_share(share): + if not self.in_channel: + return + if share.pow_hash <= share.header['bits'].target and abs(share.timestamp - time.time()) < 10*60: + yield deferral.sleep(random.expovariate(1/60)) + message = '\x02%s BLOCK FOUND by %s! %s%064x' % (net.NAME.upper(), bitcoin_data.script2_to_address(share.new_script, net.PARENT), net.PARENT.BLOCK_EXPLORER_URL_PREFIX, share.header_hash) + if all('%x' % (share.header_hash,) not in old_message for old_message in self.recent_messages): + self.say(self.channel, message) + self._remember_message(message) + self.watch_id = node.tracker.verified.added.watch(new_share) + self.recent_messages = [] + def joined(self, channel): + self.in_channel = True + def left(self, channel): + self.in_channel = False + def _remember_message(self, message): + self.recent_messages.append(message) + while len(self.recent_messages) > 100: + self.recent_messages.pop(0) + def privmsg(self, user, channel, message): + if channel == self.channel: + self._remember_message(message) + def connectionLost(self, reason): + node.tracker.verified.added.unwatch(self.watch_id) + print 'IRC connection lost:', reason.getErrorMessage() + class IRCClientFactory(protocol.ReconnectingClientFactory): + protocol = IRCClient + reactor.connectTCP("irc.freenode.net", 6667, IRCClientFactory()) + + @defer.inlineCallbacks + def status_thread(): + last_str = None + last_time = 0 + while True: + yield deferral.sleep(3) + try: + height = node.tracker.get_height(node.best_share_var.value) + this_str = 'P2Pool: %i shares in chain (%i verified/%i total) Peers: %i (%i incoming)' % ( + height, + len(node.tracker.verified.items), + len(node.tracker.items), + len(node.p2p_node.peers), + sum(1 for peer in node.p2p_node.peers.itervalues() if peer.incoming), + ) + (' FDs: %i R/%i W' % (len(reactor.getReaders()), len(reactor.getWriters())) if p2pool.DEBUG else '') + + datums, dt = wb.local_rate_monitor.get_datums_in_last() + my_att_s = sum(datum['work']/dt for datum in datums) + my_shares_per_s = sum(datum['work']/dt/bitcoin_data.target_to_average_attempts(datum['share_target']) for datum in datums) + this_str += '\n Local: %sH/s in last %s Local dead on arrival: %s Expected time to share: %s' % ( + math.format(int(my_att_s)), + math.format_dt(dt), + math.format_binomial_conf(sum(1 for datum in datums if datum['dead']), len(datums), 0.95), + math.format_dt(1/my_shares_per_s) if my_shares_per_s else '???', + ) + + if height > 2: + (stale_orphan_shares, stale_doa_shares), shares, _ = wb.get_stale_counts() + stale_prop = p2pool_data.get_average_stale_prop(node.tracker, node.best_share_var.value, min(60*60//net.SHARE_PERIOD, height)) + real_att_s = p2pool_data.get_pool_attempts_per_second(node.tracker, node.best_share_var.value, min(height - 1, 60*60//net.SHARE_PERIOD)) / (1 - stale_prop) + + this_str += '\n Shares: %i (%i orphan, %i dead) Stale rate: %s Efficiency: %s Current payout: %.4f %s' % ( + shares, stale_orphan_shares, stale_doa_shares, + math.format_binomial_conf(stale_orphan_shares + stale_doa_shares, shares, 0.95), + math.format_binomial_conf(stale_orphan_shares + stale_doa_shares, shares, 0.95, lambda x: (1 - x)/(1 - stale_prop)), + node.get_current_txouts().get(bitcoin_data.pubkey_hash_to_script2(my_pubkey_hash), 0)*1e-8, net.PARENT.SYMBOL, + ) + this_str += '\n Pool: %sH/s Stale rate: %.1f%% Expected time to block: %s' % ( + math.format(int(real_att_s)), + 100*stale_prop, + math.format_dt(2**256 / node.bitcoind_work.value['bits'].target / real_att_s), + ) + + for warning in p2pool_data.get_warnings(node.tracker, node.best_share_var.value, net, bitcoind_getinfo_var.value, node.bitcoind_work.value): + print >>sys.stderr, '#'*40 + print >>sys.stderr, '>>> Warning: ' + warning + print >>sys.stderr, '#'*40 + + if gc.garbage: + print '%i pieces of uncollectable cyclic garbage! Types: %r' % (len(gc.garbage), map(type, gc.garbage)) + + if this_str != last_str or time.time() > last_time + 15: + print this_str + last_str = this_str + last_time = time.time() + except: + log.err() + status_thread() + except: + reactor.stop() + log.err(None, 'Fatal error:') + +def run(): + if not hasattr(tcp.Client, 'abortConnection'): + print "Twisted doesn't have abortConnection! Upgrade to a newer version of Twisted to avoid memory leaks!" + print 'Pausing for 3 seconds...' + time.sleep(3) + + realnets = dict((name, net) for name, net in networks.nets.iteritems() if '_testnet' not in name) + + parser = fixargparse.FixedArgumentParser(description='p2pool (version %s)' % (p2pool.__version__,), fromfile_prefix_chars='@') + parser.add_argument('--version', action='version', version=p2pool.__version__) + parser.add_argument('--net', + help='use specified network (default: bitcoin)', + action='store', choices=sorted(realnets), default='bitcoin', dest='net_name') + parser.add_argument('--testnet', + help='''use the network's testnet''', + action='store_const', const=True, default=False, dest='testnet') + parser.add_argument('--debug', + help='enable debugging mode', + action='store_const', const=True, default=False, dest='debug') + parser.add_argument('-a', '--address', + help='generate payouts to this address (default:
)', + type=str, action='store', default=None, dest='address') + parser.add_argument('--datadir', + help='store data in this directory (default: /data)', + type=str, action='store', default=None, dest='datadir') + parser.add_argument('--logfile', + help='''log to this file (default: data//log)''', + type=str, action='store', default=None, dest='logfile') + parser.add_argument('--merged', + help='call getauxblock on this url to get work for merged mining (example: http://ncuser:ncpass@127.0.0.1:10332/)', + type=str, action='append', default=[], dest='merged_urls') + parser.add_argument('--give-author', metavar='DONATION_PERCENTAGE', + help='donate this percentage of work towards the development of p2pool (default: 1.0)', + type=float, action='store', default=1.0, dest='donation_percentage') + parser.add_argument('--iocp', + help='use Windows IOCP API in order to avoid errors due to large number of sockets being open', + action='store_true', default=False, dest='iocp') + parser.add_argument('--irc-announce', + help='announce any blocks found on irc://irc.freenode.net/#p2pool', + action='store_true', default=False, dest='irc_announce') + parser.add_argument('--no-bugreport', + help='disable submitting caught exceptions to the author', + action='store_true', default=False, dest='no_bugreport') + + p2pool_group = parser.add_argument_group('p2pool interface') + p2pool_group.add_argument('--p2pool-port', metavar='PORT', + help='use port PORT to listen for connections (forward this port from your router!) (default: %s)' % ', '.join('%s:%i' % (name, net.P2P_PORT) for name, net in sorted(realnets.items())), + type=int, action='store', default=None, dest='p2pool_port') + p2pool_group.add_argument('-n', '--p2pool-node', metavar='ADDR[:PORT]', + help='connect to existing p2pool node at ADDR listening on port PORT (defaults to default p2pool P2P port) in addition to builtin addresses', + type=str, action='append', default=[], dest='p2pool_nodes') + parser.add_argument('--disable-upnp', + help='''don't attempt to use UPnP to forward p2pool's P2P port from the Internet to this computer''', + action='store_false', default=True, dest='upnp') + p2pool_group.add_argument('--max-conns', metavar='CONNS', + help='maximum incoming connections (default: 40)', + type=int, action='store', default=40, dest='p2pool_conns') + p2pool_group.add_argument('--outgoing-conns', metavar='CONNS', + help='outgoing connections (default: 6)', + type=int, action='store', default=6, dest='p2pool_outgoing_conns') + parser.add_argument('--disable-advertise', + help='''don't advertise local IP address as being available for incoming connections. useful for running a dark node, along with multiple -n ADDR's and --outgoing-conns 0''', + action='store_false', default=True, dest='advertise_ip') + + worker_group = parser.add_argument_group('worker interface') + worker_group.add_argument('-w', '--worker-port', metavar='PORT or ADDR:PORT', + help='listen on PORT on interface with ADDR for RPC connections from miners (default: all interfaces, %s)' % ', '.join('%s:%i' % (name, net.WORKER_PORT) for name, net in sorted(realnets.items())), + type=str, action='store', default=None, dest='worker_endpoint') + worker_group.add_argument('-f', '--fee', metavar='FEE_PERCENTAGE', + help='''charge workers mining to their own bitcoin address (by setting their miner's username to a bitcoin address) this percentage fee to mine on your p2pool instance. Amount displayed at http://127.0.0.1:WORKER_PORT/fee (default: 0)''', + type=float, action='store', default=0, dest='worker_fee') + + bitcoind_group = parser.add_argument_group('bitcoind interface') + bitcoind_group.add_argument('--bitcoind-address', metavar='BITCOIND_ADDRESS', + help='connect to this address (default: 127.0.0.1)', + type=str, action='store', default='127.0.0.1', dest='bitcoind_address') + bitcoind_group.add_argument('--bitcoind-rpc-port', metavar='BITCOIND_RPC_PORT', + help='''connect to JSON-RPC interface at this port (default: %s )''' % ', '.join('%s:%i' % (name, net.PARENT.RPC_PORT) for name, net in sorted(realnets.items())), + type=int, action='store', default=None, dest='bitcoind_rpc_port') + bitcoind_group.add_argument('--bitcoind-rpc-ssl', + help='connect to JSON-RPC interface using SSL', + action='store_true', default=False, dest='bitcoind_rpc_ssl') + bitcoind_group.add_argument('--bitcoind-p2p-port', metavar='BITCOIND_P2P_PORT', + help='''connect to P2P interface at this port (default: %s )''' % ', '.join('%s:%i' % (name, net.PARENT.P2P_PORT) for name, net in sorted(realnets.items())), + type=int, action='store', default=None, dest='bitcoind_p2p_port') + + bitcoind_group.add_argument(metavar='BITCOIND_RPCUSERPASS', + help='bitcoind RPC interface username, then password, space-separated (only one being provided will cause the username to default to being empty, and none will cause P2Pool to read them from bitcoin.conf)', + type=str, action='store', default=[], nargs='*', dest='bitcoind_rpc_userpass') + + args = parser.parse_args() + + if args.debug: + p2pool.DEBUG = True + defer.setDebugging(True) + else: + p2pool.DEBUG = False + + net_name = args.net_name + ('_testnet' if args.testnet else '') + net = networks.nets[net_name] + + datadir_path = os.path.join((os.path.join(os.path.dirname(sys.argv[0]), 'data') if args.datadir is None else args.datadir), net_name) + if not os.path.exists(datadir_path): + os.makedirs(datadir_path) + + if len(args.bitcoind_rpc_userpass) > 2: + parser.error('a maximum of two arguments are allowed') + args.bitcoind_rpc_username, args.bitcoind_rpc_password = ([None, None] + args.bitcoind_rpc_userpass)[-2:] + + if args.bitcoind_rpc_password is None: + conf_path = net.PARENT.CONF_FILE_FUNC() + if not os.path.exists(conf_path): + parser.error('''Bitcoin configuration file not found. Manually enter your RPC password.\r\n''' + '''If you actually haven't created a configuration file, you should create one at %s with the text:\r\n''' + '''\r\n''' + '''server=1\r\n''' + '''rpcpassword=%x\r\n''' + '''\r\n''' + '''Keep that password secret! After creating the file, restart Bitcoin.''' % (conf_path, random.randrange(2**128))) + conf = open(conf_path, 'rb').read() + contents = {} + for line in conf.splitlines(True): + if '#' in line: + line = line[:line.index('#')] + if '=' not in line: + continue + k, v = line.split('=', 1) + contents[k.strip()] = v.strip() + for conf_name, var_name, var_type in [ + ('rpcuser', 'bitcoind_rpc_username', str), + ('rpcpassword', 'bitcoind_rpc_password', str), + ('rpcport', 'bitcoind_rpc_port', int), + ('port', 'bitcoind_p2p_port', int), + ]: + if getattr(args, var_name) is None and conf_name in contents: + setattr(args, var_name, var_type(contents[conf_name])) + if args.bitcoind_rpc_password is None: + parser.error('''Bitcoin configuration file didn't contain an rpcpassword= line! Add one!''') + + if args.bitcoind_rpc_username is None: + args.bitcoind_rpc_username = '' + + if args.bitcoind_rpc_port is None: + args.bitcoind_rpc_port = net.PARENT.RPC_PORT + + if args.bitcoind_p2p_port is None: + args.bitcoind_p2p_port = net.PARENT.P2P_PORT + + if args.p2pool_port is None: + args.p2pool_port = net.P2P_PORT + + if args.p2pool_outgoing_conns > 10: + parser.error('''--outgoing-conns can't be more than 10''') + + if args.worker_endpoint is None: + worker_endpoint = '', net.WORKER_PORT + elif ':' not in args.worker_endpoint: + worker_endpoint = '', int(args.worker_endpoint) + else: + addr, port = args.worker_endpoint.rsplit(':', 1) + worker_endpoint = addr, int(port) + + if args.address is not None: + try: + args.pubkey_hash = bitcoin_data.address_to_pubkey_hash(args.address, net.PARENT) + except Exception, e: + parser.error('error parsing address: ' + repr(e)) + else: + args.pubkey_hash = None + + def separate_url(url): + s = urlparse.urlsplit(url) + if '@' not in s.netloc: + parser.error('merged url netloc must contain an "@"') + userpass, new_netloc = s.netloc.rsplit('@', 1) + return urlparse.urlunsplit(s._replace(netloc=new_netloc)), userpass + merged_urls = map(separate_url, args.merged_urls) + + if args.logfile is None: + args.logfile = os.path.join(datadir_path, 'log') + + logfile = logging.LogFile(args.logfile) + pipe = logging.TimestampingPipe(logging.TeePipe([logging.EncodeReplacerPipe(sys.stderr), logfile])) + sys.stdout = logging.AbortPipe(pipe) + sys.stderr = log.DefaultObserver.stderr = logging.AbortPipe(logging.PrefixPipe(pipe, '> ')) + if hasattr(signal, "SIGUSR1"): + def sigusr1(signum, frame): + print 'Caught SIGUSR1, closing %r...' % (args.logfile,) + logfile.reopen() + print '...and reopened %r after catching SIGUSR1.' % (args.logfile,) + signal.signal(signal.SIGUSR1, sigusr1) + deferral.RobustLoopingCall(logfile.reopen).start(5) + + class ErrorReporter(object): + def __init__(self): + self.last_sent = None + + def emit(self, eventDict): + if not eventDict["isError"]: + return + + if self.last_sent is not None and time.time() < self.last_sent + 5: + return + self.last_sent = time.time() + + if 'failure' in eventDict: + text = ((eventDict.get('why') or 'Unhandled Error') + + '\n' + eventDict['failure'].getTraceback()) + else: + text = " ".join([str(m) for m in eventDict["message"]]) + "\n" + + from twisted.web import client + client.getPage( + url='http://u.forre.st/p2pool_error.cgi', + method='POST', + postdata=p2pool.__version__ + ' ' + net.NAME + '\n' + text, + timeout=15, + ).addBoth(lambda x: None) + if not args.no_bugreport: + log.addObserver(ErrorReporter().emit) + + reactor.callWhenRunning(main, args, net, datadir_path, merged_urls, worker_endpoint) + reactor.run() diff --git a/p2pool/networks.py b/p2pool/networks.py new file mode 100644 index 00000000..8017af1d --- /dev/null +++ b/p2pool/networks.py @@ -0,0 +1,147 @@ +from p2pool.bitcoin import networks +from p2pool.util import math + +# CHAIN_LENGTH = number of shares back client keeps +# REAL_CHAIN_LENGTH = maximum number of shares back client uses to compute payout +# REAL_CHAIN_LENGTH must always be <= CHAIN_LENGTH +# REAL_CHAIN_LENGTH must be changed in sync with all other clients +# changes can be done by changing one, then the other + +nets = dict( + bitcoin=math.Object( + PARENT=networks.nets['bitcoin'], + SHARE_PERIOD=30, # seconds + CHAIN_LENGTH=24*60*60//10, # shares + REAL_CHAIN_LENGTH=24*60*60//10, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='fc70035c7a81bc6f'.decode('hex'), + PREFIX='2472ef181efcd37b'.decode('hex'), + P2P_PORT=9333, + MIN_TARGET=0, + MAX_TARGET=2**256//2**32 - 1, + PERSIST=True, + WORKER_PORT=9332, + BOOTSTRAP_ADDRS='forre.st vps.forre.st portals94.ns01.us 54.227.25.14 119.1.96.99 204.10.105.113 76.104.150.248 89.71.151.9 76.114.13.54 72.201.24.106 79.160.2.128 207.244.175.195 168.7.116.243 94.23.215.27 218.54.45.177 5.9.157.150 78.155.217.76 91.154.90.163 173.52.43.124 78.225.49.209 220.135.57.230 169.237.101.193:8335 98.236.74.28 204.19.23.19 98.122.165.84:8338 71.90.88.222 67.168.132.228 193.6.148.18 80.218.174.253 50.43.56.102 68.13.4.106 24.246.31.2 176.31.208.222 1.202.128.218 86.155.135.31 204.237.15.51 5.12.158.126:38007 202.60.68.242 94.19.53.147 65.130.126.82 184.56.21.182 213.112.114.73 218.242.51.246 86.173.200.160 204.15.85.157 37.59.15.50 62.217.124.203 80.87.240.47 198.61.137.12 108.161.134.32 198.154.60.183:10333 71.39.52.34:9335 46.23.72.52:9343 83.143.42.177 192.95.61.149 144.76.17.34 46.65.68.119 188.227.176.66:9336 75.142.155.245:9336 213.67.135.99 76.115.224.177 50.148.193.245 64.53.185.79 80.65.30.137 109.126.14.42 76.84.63.146'.split(' '), + ANNOUNCE_CHANNEL='#p2pool', + VERSION_CHECK=lambda v: 50700 <= v < 60000 or 60010 <= v < 60100 or 60400 <= v, + VERSION_WARNING=lambda v: 'Upgrade Bitcoin to >=0.8.5!' if v < 80500 else None, + ), + bitcoin_testnet=math.Object( + PARENT=networks.nets['bitcoin_testnet'], + SHARE_PERIOD=30, # seconds + CHAIN_LENGTH=60*60//10, # shares + REAL_CHAIN_LENGTH=60*60//10, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='5fc2be2d4f0d6bfb'.decode('hex'), + PREFIX='3f6057a15036f441'.decode('hex'), + P2P_PORT=19333, + MIN_TARGET=0, + MAX_TARGET=2**256//2**32 - 1, + PERSIST=False, + WORKER_PORT=19332, + BOOTSTRAP_ADDRS='forre.st vps.forre.st liteco.in'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-alt', + VERSION_CHECK=lambda v: 50700 <= v < 60000 or 60010 <= v < 60100 or 60400 <= v, + ), + + litecoin=math.Object( + PARENT=networks.nets['litecoin'], + SHARE_PERIOD=15, # seconds + CHAIN_LENGTH=24*60*60//10, # shares + REAL_CHAIN_LENGTH=24*60*60//10, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='e037d5b8c6923410'.decode('hex'), + PREFIX='7208c1a53ef629b0'.decode('hex'), + P2P_PORT=9338, + MIN_TARGET=0, + MAX_TARGET=2**256//2**20 - 1, + PERSIST=True, + WORKER_PORT=9327, + BOOTSTRAP_ADDRS='forre.st vps.forre.st liteco.in 95.211.21.103 37.229.117.57 66.228.48.21 180.169.60.179 112.84.181.102 74.214.62.115 209.141.46.154 78.27.191.182 66.187.70.88 88.190.223.96 78.47.242.59 158.182.39.43 180.177.114.80 216.230.232.35 94.231.56.87 62.38.194.17 82.67.167.12 183.129.157.220 71.19.240.182 216.177.81.88 109.106.0.130 113.10.168.210 218.22.102.12 85.69.35.7:54396 201.52.162.167 95.66.173.110:8331 109.65.171.93 95.243.237.90 208.68.17.67 87.103.197.163 101.1.25.211 144.76.17.34 209.99.52.72 198.23.245.250 46.151.21.226 66.43.209.193 59.127.188.231 178.194.42.169 85.10.35.90 110.175.53.212 98.232.129.196 116.228.192.46 94.251.42.75 195.216.115.94 24.49.138.81 61.158.7.36 213.168.187.27 37.59.10.166 72.44.88.49 98.221.44.200 178.19.104.251 87.198.219.221 85.237.59.130:9310 218.16.251.86 151.236.11.119 94.23.215.27 60.190.203.228 176.31.208.222 46.163.105.201 198.84.186.74 199.175.50.102 188.142.102.15 202.191.108.46 125.65.108.19 15.185.107.232 108.161.131.248 188.116.33.39 78.142.148.62 69.42.217.130 213.110.14.23 185.10.51.18 74.71.113.207 77.89.41.253 69.171.153.219 58.210.42.10 174.107.165.198 50.53.105.6 116.213.73.50 83.150.90.211 210.28.136.11 86.58.41.122 70.63.34.88 78.155.217.76 68.193.128.182 198.199.73.40 193.6.148.18 188.177.188.189 83.109.6.82 204.10.105.113 64.91.214.180 46.4.74.44 98.234.11.149 71.189.207.226'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-ltc', + VERSION_CHECK=lambda v: True, + VERSION_WARNING=lambda v: 'Upgrade Litecoin to >=0.8.5.1!' if v < 80501 else None, + ), + litecoin_testnet=math.Object( + PARENT=networks.nets['litecoin_testnet'], + SHARE_PERIOD=4, # seconds + CHAIN_LENGTH=20*60//3, # shares + REAL_CHAIN_LENGTH=20*60//3, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='cca5e24ec6408b1e'.decode('hex'), + PREFIX='ad9614f6466a39cf'.decode('hex'), + P2P_PORT=19338, + MIN_TARGET=2**256//50 - 1, + MAX_TARGET=2**256//50 - 1, + PERSIST=False, + WORKER_PORT=19327, + BOOTSTRAP_ADDRS='forre.st vps.forre.st'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-alt', + VERSION_CHECK=lambda v: True, + ), + + terracoin=math.Object( + PARENT=networks.nets['terracoin'], + SHARE_PERIOD=30, # seconds + CHAIN_LENGTH=24*60*60//30, # shares + REAL_CHAIN_LENGTH=24*60*60//30, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=15, # blocks + IDENTIFIER='a41b2356a1b7d46e'.decode('hex'), + PREFIX='5623b62178d2b9b3'.decode('hex'), + P2P_PORT=9323, + MIN_TARGET=0, + MAX_TARGET=2**256//2**32 - 1, + PERSIST=True, + WORKER_PORT=9322, + BOOTSTRAP_ADDRS='seed1.p2pool.terracoin.org seed2.p2pool.terracoin.org forre.st vps.forre.st 93.97.192.93 66.90.73.83 67.83.108.0 219.84.64.174 24.167.17.248 109.74.195.142 83.211.86.49 94.23.34.145 168.7.116.243 94.174.40.189:9344 89.79.79.195 portals94.ns01.us'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-alt', + VERSION_CHECK=lambda v: 80002 <= v, + VERSION_WARNING=lambda v: 'Upgrade Terracoin to >= 0.8.0.2!' if v < 80002 else None, + ), + terracoin_testnet=math.Object( + PARENT=networks.nets['terracoin_testnet'], + SHARE_PERIOD=30, # seconds + CHAIN_LENGTH=60*60//30, # shares + REAL_CHAIN_LENGTH=60*60//30, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=15, # blocks + IDENTIFIER='b41b2356a5b7d35d'.decode('hex'), + PREFIX='1623b92172d2b8a2'.decode('hex'), + P2P_PORT=19323, + MIN_TARGET=0, + MAX_TARGET=2**256//2**32 - 1, + PERSIST=False, + WORKER_PORT=19322, + BOOTSTRAP_ADDRS='seed1.p2pool.terracoin.org seed2.p2pool.terracoin.org forre.st vps.forre.st'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-alt', + VERSION_CHECK=lambda v: True, + VERSION_WARNING=lambda v: 'Upgrade Terracoin to >= 0.8.0.1!' if v < 80001 else None, + ), + + vertcoin=math.Object( + PARENT=networks.nets['vertcoin'], + SHARE_PERIOD=15, # seconds + CHAIN_LENGTH=24*60*60//10, # shares + REAL_CHAIN_LENGTH=24*60*60//10, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='b58492a125f1d8ae'.decode('hex'), + PREFIX='fdd6f9c5005b2deb'.decode('hex'), + P2P_PORT=9346, + MIN_TARGET=0, + MAX_TARGET=2**256//2**20 - 1, + PERSIST=False, + WORKER_PORT=9171, + BOOTSTRAP_ADDRS='178.63.15.130 P2POOL.ETYD.ORG'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-vtc', + VERSION_CHECK=lambda v: True, + ), + +) +for net_name, net in nets.iteritems(): + net.NAME = net_name diff --git a/p2pool/node.py b/p2pool/node.py new file mode 100644 index 00000000..4a91620d --- /dev/null +++ b/p2pool/node.py @@ -0,0 +1,357 @@ +import random +import sys +import time + +from twisted.internet import defer, reactor +from twisted.python import log + +from p2pool import data as p2pool_data, p2p +from p2pool.bitcoin import data as bitcoin_data, helper, height_tracker +from p2pool.util import deferral, variable + + +class P2PNode(p2p.Node): + def __init__(self, node, **kwargs): + self.node = node + p2p.Node.__init__(self, + best_share_hash_func=lambda: node.best_share_var.value, + net=node.net, + known_txs_var=node.known_txs_var, + mining_txs_var=node.mining_txs_var, + **kwargs) + + def handle_shares(self, shares, peer): + if len(shares) > 5: + print 'Processing %i shares from %s...' % (len(shares), '%s:%i' % peer.addr if peer is not None else None) + + new_count = 0 + all_new_txs = {} + for share, new_txs in shares: + if new_txs is not None: + all_new_txs.update((bitcoin_data.hash256(bitcoin_data.tx_type.pack(new_tx)), new_tx) for new_tx in new_txs) + + if share.hash in self.node.tracker.items: + #print 'Got duplicate share, ignoring. Hash: %s' % (p2pool_data.format_hash(share.hash),) + continue + + new_count += 1 + + #print 'Received share %s from %r' % (p2pool_data.format_hash(share.hash), share.peer_addr) + + self.node.tracker.add(share) + + new_known_txs = dict(self.node.known_txs_var.value) + new_known_txs.update(all_new_txs) + self.node.known_txs_var.set(new_known_txs) + + if new_count: + self.node.set_best_share() + + if len(shares) > 5: + print '... done processing %i shares. New: %i Have: %i/~%i' % (len(shares), new_count, len(self.node.tracker.items), 2*self.node.net.CHAIN_LENGTH) + + @defer.inlineCallbacks + def handle_share_hashes(self, hashes, peer): + new_hashes = [x for x in hashes if x not in self.node.tracker.items] + if not new_hashes: + return + try: + shares = yield peer.get_shares( + hashes=new_hashes, + parents=0, + stops=[], + ) + except: + log.err(None, 'in handle_share_hashes:') + else: + self.handle_shares([(share, []) for share in shares], peer) + + def handle_get_shares(self, hashes, parents, stops, peer): + parents = min(parents, 1000//len(hashes)) + stops = set(stops) + shares = [] + for share_hash in hashes: + for share in self.node.tracker.get_chain(share_hash, min(parents + 1, self.node.tracker.get_height(share_hash))): + if share.hash in stops: + break + shares.append(share) + if len(shares) > 0: + print 'Sending %i shares to %s:%i' % (len(shares), peer.addr[0], peer.addr[1]) + return shares + + def handle_bestblock(self, header, peer): + if self.node.net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(header)) > header['bits'].target: + raise p2p.PeerMisbehavingError('received block header fails PoW test') + self.node.handle_header(header) + + def broadcast_share(self, share_hash): + shares = [] + for share in self.node.tracker.get_chain(share_hash, min(5, self.node.tracker.get_height(share_hash))): + if share.hash in self.shared_share_hashes: + break + self.shared_share_hashes.add(share.hash) + shares.append(share) + + for peer in self.peers.itervalues(): + peer.sendShares([share for share in shares if share.peer_addr != peer.addr], self.node.tracker, self.node.known_txs_var.value, include_txs_with=[share_hash]) + + def start(self): + p2p.Node.start(self) + + self.shared_share_hashes = set(self.node.tracker.items) + self.node.tracker.removed.watch_weakref(self, lambda self, share: self.shared_share_hashes.discard(share.hash)) + + @apply + @defer.inlineCallbacks + def download_shares(): + while True: + desired = yield self.node.desired_var.get_when_satisfies(lambda val: len(val) != 0) + peer_addr, share_hash = random.choice(desired) + + if len(self.peers) == 0: + yield deferral.sleep(1) + continue + peer = random.choice(self.peers.values()) + + print 'Requesting parent share %s from %s' % (p2pool_data.format_hash(share_hash), '%s:%i' % peer.addr) + try: + shares = yield peer.get_shares( + hashes=[share_hash], + parents=random.randrange(500), # randomize parents so that we eventually get past a too large block of shares + stops=list(set(self.node.tracker.heads) | set( + self.node.tracker.get_nth_parent_hash(head, min(max(0, self.node.tracker.get_height_and_last(head)[0] - 1), 10)) for head in self.node.tracker.heads + ))[:100], + ) + except defer.TimeoutError: + print 'Share request timed out!' + continue + except: + log.err(None, 'in download_shares:') + continue + + if not shares: + yield deferral.sleep(1) # sleep so we don't keep rerequesting the same share nobody has + continue + self.handle_shares([(share, []) for share in shares], peer) + + + @self.node.best_block_header.changed.watch + def _(header): + for peer in self.peers.itervalues(): + peer.send_bestblock(header=header) + + # send share when the chain changes to their chain + self.node.best_share_var.changed.watch(self.broadcast_share) + + @self.node.tracker.verified.added.watch + def _(share): + if not (share.pow_hash <= share.header['bits'].target): + return + + def spread(): + if (self.node.get_height_rel_highest(share.header['previous_block']) > -5 or + self.node.bitcoind_work.value['previous_block'] in [share.header['previous_block'], share.header_hash]): + self.broadcast_share(share.hash) + spread() + reactor.callLater(5, spread) # so get_height_rel_highest can update + + +class Node(object): + def __init__(self, factory, bitcoind, shares, known_verified_share_hashes, net): + self.factory = factory + self.bitcoind = bitcoind + self.net = net + + self.tracker = p2pool_data.OkayTracker(self.net) + + for share in shares: + self.tracker.add(share) + + for share_hash in known_verified_share_hashes: + if share_hash in self.tracker.items: + self.tracker.verified.add(self.tracker.items[share_hash]) + + self.p2p_node = None # overwritten externally + + @defer.inlineCallbacks + def start(self): + stop_signal = variable.Event() + self.stop = stop_signal.happened + + # BITCOIND WORK + + self.bitcoind_work = variable.Variable((yield helper.getwork(self.bitcoind))) + @defer.inlineCallbacks + def work_poller(): + while stop_signal.times == 0: + flag = self.factory.new_block.get_deferred() + try: + self.bitcoind_work.set((yield helper.getwork(self.bitcoind, self.bitcoind_work.value['use_getblocktemplate']))) + except: + log.err() + yield defer.DeferredList([flag, deferral.sleep(15)], fireOnOneCallback=True) + work_poller() + + # PEER WORK + + self.best_block_header = variable.Variable(None) + def handle_header(new_header): + # check that header matches current target + if not (self.net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(new_header)) <= self.bitcoind_work.value['bits'].target): + return + bitcoind_best_block = self.bitcoind_work.value['previous_block'] + if (self.best_block_header.value is None + or ( + new_header['previous_block'] == bitcoind_best_block and + bitcoin_data.hash256(bitcoin_data.block_header_type.pack(self.best_block_header.value)) == bitcoind_best_block + ) # new is child of current and previous is current + or ( + bitcoin_data.hash256(bitcoin_data.block_header_type.pack(new_header)) == bitcoind_best_block and + self.best_block_header.value['previous_block'] != bitcoind_best_block + )): # new is current and previous is not a child of current + self.best_block_header.set(new_header) + self.handle_header = handle_header + @defer.inlineCallbacks + def poll_header(): + if self.factory.conn.value is None: + return + handle_header((yield self.factory.conn.value.get_block_header(self.bitcoind_work.value['previous_block']))) + self.bitcoind_work.changed.watch(lambda _: poll_header()) + yield deferral.retry('Error while requesting best block header:')(poll_header)() + + # BEST SHARE + + self.known_txs_var = variable.Variable({}) # hash -> tx + self.mining_txs_var = variable.Variable({}) # hash -> tx + self.get_height_rel_highest = yield height_tracker.get_height_rel_highest_func(self.bitcoind, self.factory, lambda: self.bitcoind_work.value['previous_block'], self.net) + + self.best_share_var = variable.Variable(None) + self.desired_var = variable.Variable(None) + self.bitcoind_work.changed.watch(lambda _: self.set_best_share()) + self.set_best_share() + + # setup p2p logic and join p2pool network + + # update mining_txs according to getwork results + @self.bitcoind_work.changed.run_and_watch + def _(_=None): + new_mining_txs = {} + new_known_txs = dict(self.known_txs_var.value) + for tx_hash, tx in zip(self.bitcoind_work.value['transaction_hashes'], self.bitcoind_work.value['transactions']): + new_mining_txs[tx_hash] = tx + new_known_txs[tx_hash] = tx + self.mining_txs_var.set(new_mining_txs) + self.known_txs_var.set(new_known_txs) + # add p2p transactions from bitcoind to known_txs + @self.factory.new_tx.watch + def _(tx): + new_known_txs = dict(self.known_txs_var.value) + new_known_txs[bitcoin_data.hash256(bitcoin_data.tx_type.pack(tx))] = tx + self.known_txs_var.set(new_known_txs) + # forward transactions seen to bitcoind + @self.known_txs_var.transitioned.watch + @defer.inlineCallbacks + def _(before, after): + yield deferral.sleep(random.expovariate(1/1)) + if self.factory.conn.value is None: + return + for tx_hash in set(after) - set(before): + self.factory.conn.value.send_tx(tx=after[tx_hash]) + + @self.tracker.verified.added.watch + def _(share): + if not (share.pow_hash <= share.header['bits'].target): + return + + block = share.as_block(self.tracker, self.known_txs_var.value) + if block is None: + print >>sys.stderr, 'GOT INCOMPLETE BLOCK FROM PEER! %s bitcoin: %s%064x' % (p2pool_data.format_hash(share.hash), self.net.PARENT.BLOCK_EXPLORER_URL_PREFIX, share.header_hash) + return + helper.submit_block(block, True, self.factory, self.bitcoind, self.bitcoind_work, self.net) + print + print 'GOT BLOCK FROM PEER! Passing to bitcoind! %s bitcoin: %s%064x' % (p2pool_data.format_hash(share.hash), self.net.PARENT.BLOCK_EXPLORER_URL_PREFIX, share.header_hash) + print + + def forget_old_txs(): + new_known_txs = {} + if self.p2p_node is not None: + for peer in self.p2p_node.peers.itervalues(): + new_known_txs.update(peer.remembered_txs) + new_known_txs.update(self.mining_txs_var.value) + for share in self.tracker.get_chain(self.best_share_var.value, min(120, self.tracker.get_height(self.best_share_var.value))): + for tx_hash in share.new_transaction_hashes: + if tx_hash in self.known_txs_var.value: + new_known_txs[tx_hash] = self.known_txs_var.value[tx_hash] + self.known_txs_var.set(new_known_txs) + t = deferral.RobustLoopingCall(forget_old_txs) + t.start(10) + stop_signal.watch(t.stop) + + t = deferral.RobustLoopingCall(self.clean_tracker) + t.start(5) + stop_signal.watch(t.stop) + + def set_best_share(self): + best, desired, decorated_heads, bad_peer_addresses = self.tracker.think(self.get_height_rel_highest, self.bitcoind_work.value['previous_block'], self.bitcoind_work.value['bits'], self.known_txs_var.value) + + self.best_share_var.set(best) + self.desired_var.set(desired) + if self.p2p_node is not None: + for bad_peer_address in bad_peer_addresses: + # XXX O(n) + for peer in self.p2p_node.peers.itervalues(): + if peer.addr == bad_peer_address: + peer.badPeerHappened() + break + + def get_current_txouts(self): + return p2pool_data.get_expected_payouts(self.tracker, self.best_share_var.value, self.bitcoind_work.value['bits'].target, self.bitcoind_work.value['subsidy'], self.net) + + def clean_tracker(self): + best, desired, decorated_heads, bad_peer_addresses = self.tracker.think(self.get_height_rel_highest, self.bitcoind_work.value['previous_block'], self.bitcoind_work.value['bits'], self.known_txs_var.value) + + # eat away at heads + if decorated_heads: + for i in xrange(1000): + to_remove = set() + for share_hash, tail in self.tracker.heads.iteritems(): + if share_hash in [head_hash for score, head_hash in decorated_heads[-5:]]: + #print 1 + continue + if self.tracker.items[share_hash].time_seen > time.time() - 300: + #print 2 + continue + if share_hash not in self.tracker.verified.items and max(self.tracker.items[after_tail_hash].time_seen for after_tail_hash in self.tracker.reverse.get(tail)) > time.time() - 120: # XXX stupid + #print 3 + continue + to_remove.add(share_hash) + if not to_remove: + break + for share_hash in to_remove: + if share_hash in self.tracker.verified.items: + self.tracker.verified.remove(share_hash) + self.tracker.remove(share_hash) + #print "_________", to_remove + + # drop tails + for i in xrange(1000): + to_remove = set() + for tail, heads in self.tracker.tails.iteritems(): + if min(self.tracker.get_height(head) for head in heads) < 2*self.tracker.net.CHAIN_LENGTH + 10: + continue + to_remove.update(self.tracker.reverse.get(tail, set())) + if not to_remove: + break + # if removed from this, it must be removed from verified + #start = time.time() + for aftertail in to_remove: + if self.tracker.items[aftertail].previous_hash not in self.tracker.tails: + print "erk", aftertail, self.tracker.items[aftertail].previous_hash + continue + if aftertail in self.tracker.verified.items: + self.tracker.verified.remove(aftertail) + self.tracker.remove(aftertail) + #end = time.time() + #print "removed! %i %f" % (len(to_remove), (end - start)/len(to_remove)) + + self.set_best_share() diff --git a/p2pool/p2p.py b/p2pool/p2p.py new file mode 100644 index 00000000..94db4425 --- /dev/null +++ b/p2pool/p2p.py @@ -0,0 +1,681 @@ +from __future__ import division + +import math +import random +import sys +import time + +from twisted.internet import defer, protocol, reactor +from twisted.python import failure, log + +import p2pool +from p2pool import data as p2pool_data +from p2pool.bitcoin import data as bitcoin_data +from p2pool.util import deferral, p2protocol, pack, variable + +class PeerMisbehavingError(Exception): + pass + + +def fragment(f, **kwargs): + try: + f(**kwargs) + except p2protocol.TooLong: + fragment(f, **dict((k, v[:len(v)//2]) for k, v in kwargs.iteritems())) + fragment(f, **dict((k, v[len(v)//2:]) for k, v in kwargs.iteritems())) + +class Protocol(p2protocol.Protocol): + VERSION = 1300 + + max_remembered_txs_size = 2500000 + + def __init__(self, node, incoming): + p2protocol.Protocol.__init__(self, node.net.PREFIX, 1000000, node.traffic_happened) + self.node = node + self.incoming = incoming + + self.other_version = None + self.connected2 = False + + def connectionMade(self): + self.factory.proto_made_connection(self) + + self.connection_lost_event = variable.Event() + + self.addr = self.transport.getPeer().host, self.transport.getPeer().port + + self.send_version( + version=self.VERSION, + services=0, + addr_to=dict( + services=0, + address=self.transport.getPeer().host, + port=self.transport.getPeer().port, + ), + addr_from=dict( + services=0, + address=self.transport.getHost().host, + port=self.transport.getHost().port, + ), + nonce=self.node.nonce, + sub_version=p2pool.__version__, + mode=1, + best_share_hash=self.node.best_share_hash_func(), + ) + + self.timeout_delayed = reactor.callLater(10, self._connect_timeout) + + self.get_shares = deferral.GenericDeferrer( + max_id=2**256, + func=lambda id, hashes, parents, stops: self.send_sharereq(id=id, hashes=hashes, parents=parents, stops=stops), + timeout=15, + on_timeout=self.disconnect, + ) + + self.remote_tx_hashes = set() # view of peer's known_txs # not actually initially empty, but sending txs instead of tx hashes won't hurt + self.remote_remembered_txs_size = 0 + + self.remembered_txs = {} # view of peer's mining_txs + self.remembered_txs_size = 0 + self.known_txs_cache = {} + + def _connect_timeout(self): + self.timeout_delayed = None + print 'Handshake timed out, disconnecting from %s:%i' % self.addr + self.disconnect() + + def packetReceived(self, command, payload2): + try: + if command != 'version' and not self.connected2: + raise PeerMisbehavingError('first message was not version message') + p2protocol.Protocol.packetReceived(self, command, payload2) + except PeerMisbehavingError, e: + print 'Peer %s:%i misbehaving, will drop and ban. Reason:' % self.addr, e.message + self.badPeerHappened() + + def badPeerHappened(self): + print "Bad peer banned:", self.addr + self.disconnect() + if self.transport.getPeer().host != '127.0.0.1': # never ban localhost + self.node.bans[self.transport.getPeer().host] = time.time() + 60*60 + + def _timeout(self): + self.timeout_delayed = None + print 'Connection timed out, disconnecting from %s:%i' % self.addr + self.disconnect() + + message_version = pack.ComposedType([ + ('version', pack.IntType(32)), + ('services', pack.IntType(64)), + ('addr_to', bitcoin_data.address_type), + ('addr_from', bitcoin_data.address_type), + ('nonce', pack.IntType(64)), + ('sub_version', pack.VarStrType()), + ('mode', pack.IntType(32)), # always 1 for legacy compatibility + ('best_share_hash', pack.PossiblyNoneType(0, pack.IntType(256))), + ]) + def handle_version(self, version, services, addr_to, addr_from, nonce, sub_version, mode, best_share_hash): + if self.other_version is not None: + raise PeerMisbehavingError('more than one version message') + if version < 1300: + raise PeerMisbehavingError('peer too old') + + self.other_version = version + self.other_sub_version = sub_version[:512] + self.other_services = services + + if nonce == self.node.nonce: + raise PeerMisbehavingError('was connected to self') + if nonce in self.node.peers: + if p2pool.DEBUG: + print 'Detected duplicate connection, disconnecting from %s:%i' % self.addr + self.disconnect() + return + + self.nonce = nonce + self.connected2 = True + + self.timeout_delayed.cancel() + self.timeout_delayed = reactor.callLater(100, self._timeout) + + old_dataReceived = self.dataReceived + def new_dataReceived(data): + if self.timeout_delayed is not None: + self.timeout_delayed.reset(100) + old_dataReceived(data) + self.dataReceived = new_dataReceived + + self.factory.proto_connected(self) + + self._stop_thread = deferral.run_repeatedly(lambda: [ + self.send_ping(), + random.expovariate(1/100)][-1]) + + if self.node.advertise_ip: + self._stop_thread2 = deferral.run_repeatedly(lambda: [ + self.send_addrme(port=self.node.serverfactory.listen_port.getHost().port) if self.node.serverfactory.listen_port is not None else None, + random.expovariate(1/(100*len(self.node.peers) + 1))][-1]) + + if best_share_hash is not None: + self.node.handle_share_hashes([best_share_hash], self) + + def update_remote_view_of_my_known_txs(before, after): + added = set(after) - set(before) + removed = set(before) - set(after) + if added: + self.send_have_tx(tx_hashes=list(added)) + if removed: + self.send_losing_tx(tx_hashes=list(removed)) + + # cache forgotten txs here for a little while so latency of "losing_tx" packets doesn't cause problems + key = max(self.known_txs_cache) + 1 if self.known_txs_cache else 0 + self.known_txs_cache[key] = dict((h, before[h]) for h in removed) + reactor.callLater(20, self.known_txs_cache.pop, key) + watch_id = self.node.known_txs_var.transitioned.watch(update_remote_view_of_my_known_txs) + self.connection_lost_event.watch(lambda: self.node.known_txs_var.transitioned.unwatch(watch_id)) + + self.send_have_tx(tx_hashes=self.node.known_txs_var.value.keys()) + + def update_remote_view_of_my_mining_txs(before, after): + added = set(after) - set(before) + removed = set(before) - set(after) + if added: + self.remote_remembered_txs_size += sum(100 + bitcoin_data.tx_type.packed_size(after[x]) for x in added) + assert self.remote_remembered_txs_size <= self.max_remembered_txs_size + fragment(self.send_remember_tx, tx_hashes=[x for x in added if x in self.remote_tx_hashes], txs=[after[x] for x in added if x not in self.remote_tx_hashes]) + if removed: + self.send_forget_tx(tx_hashes=list(removed)) + self.remote_remembered_txs_size -= sum(100 + bitcoin_data.tx_type.packed_size(before[x]) for x in removed) + watch_id2 = self.node.mining_txs_var.transitioned.watch(update_remote_view_of_my_mining_txs) + self.connection_lost_event.watch(lambda: self.node.mining_txs_var.transitioned.unwatch(watch_id2)) + + self.remote_remembered_txs_size += sum(100 + bitcoin_data.tx_type.packed_size(x) for x in self.node.mining_txs_var.value.values()) + assert self.remote_remembered_txs_size <= self.max_remembered_txs_size + fragment(self.send_remember_tx, tx_hashes=[], txs=self.node.mining_txs_var.value.values()) + + message_ping = pack.ComposedType([]) + def handle_ping(self): + pass + + message_addrme = pack.ComposedType([ + ('port', pack.IntType(16)), + ]) + def handle_addrme(self, port): + host = self.transport.getPeer().host + #print 'addrme from', host, port + if host == '127.0.0.1': + if random.random() < .8 and self.node.peers: + random.choice(self.node.peers.values()).send_addrme(port=port) # services... + else: + self.node.got_addr((self.transport.getPeer().host, port), self.other_services, int(time.time())) + if random.random() < .8 and self.node.peers: + random.choice(self.node.peers.values()).send_addrs(addrs=[ + dict( + address=dict( + services=self.other_services, + address=host, + port=port, + ), + timestamp=int(time.time()), + ), + ]) + + message_addrs = pack.ComposedType([ + ('addrs', pack.ListType(pack.ComposedType([ + ('timestamp', pack.IntType(64)), + ('address', bitcoin_data.address_type), + ]))), + ]) + def handle_addrs(self, addrs): + for addr_record in addrs: + self.node.got_addr((addr_record['address']['address'], addr_record['address']['port']), addr_record['address']['services'], min(int(time.time()), addr_record['timestamp'])) + if random.random() < .8 and self.node.peers: + random.choice(self.node.peers.values()).send_addrs(addrs=[addr_record]) + + message_getaddrs = pack.ComposedType([ + ('count', pack.IntType(32)), + ]) + def handle_getaddrs(self, count): + if count > 100: + count = 100 + self.send_addrs(addrs=[ + dict( + timestamp=int(self.node.addr_store[host, port][2]), + address=dict( + services=self.node.addr_store[host, port][0], + address=host, + port=port, + ), + ) for host, port in + self.node.get_good_peers(count) + ]) + + message_shares = pack.ComposedType([ + ('shares', pack.ListType(p2pool_data.share_type)), + ]) + def handle_shares(self, shares): + result = [] + for wrappedshare in shares: + if wrappedshare['type'] < p2pool_data.Share.VERSION: continue + share = p2pool_data.load_share(wrappedshare, self.node.net, self.addr) + if wrappedshare['type'] >= 13: + txs = [] + for tx_hash in share.share_info['new_transaction_hashes']: + if tx_hash in self.node.known_txs_var.value: + tx = self.node.known_txs_var.value[tx_hash] + else: + for cache in self.known_txs_cache.itervalues(): + if tx_hash in cache: + tx = cache[tx_hash] + print 'Transaction %064x rescued from peer latency cache!' % (tx_hash,) + break + else: + print >>sys.stderr, 'Peer referenced unknown transaction %064x, disconnecting' % (tx_hash,) + self.disconnect() + return + txs.append(tx) + else: + txs = None + + result.append((share, txs)) + + self.node.handle_shares(result, self) + + def sendShares(self, shares, tracker, known_txs, include_txs_with=[]): + tx_hashes = set() + for share in shares: + if share.VERSION >= 13: + # send full transaction for every new_transaction_hash that peer does not know + for tx_hash in share.share_info['new_transaction_hashes']: + assert tx_hash in known_txs, 'tried to broadcast share without knowing all its new transactions' + if tx_hash not in self.remote_tx_hashes: + tx_hashes.add(tx_hash) + continue + if share.hash in include_txs_with: + x = share.get_other_tx_hashes(tracker) + if x is not None: + tx_hashes.update(x) + + hashes_to_send = [x for x in tx_hashes if x not in self.node.mining_txs_var.value and x in known_txs] + + new_remote_remembered_txs_size = self.remote_remembered_txs_size + sum(100 + bitcoin_data.tx_type.packed_size(known_txs[x]) for x in hashes_to_send) + if new_remote_remembered_txs_size > self.max_remembered_txs_size: + raise ValueError('shares have too many txs') + self.remote_remembered_txs_size = new_remote_remembered_txs_size + + fragment(self.send_remember_tx, tx_hashes=[x for x in hashes_to_send if x in self.remote_tx_hashes], txs=[known_txs[x] for x in hashes_to_send if x not in self.remote_tx_hashes]) + + fragment(self.send_shares, shares=[share.as_share() for share in shares]) + + self.send_forget_tx(tx_hashes=hashes_to_send) + + self.remote_remembered_txs_size -= sum(100 + bitcoin_data.tx_type.packed_size(known_txs[x]) for x in hashes_to_send) + + + message_sharereq = pack.ComposedType([ + ('id', pack.IntType(256)), + ('hashes', pack.ListType(pack.IntType(256))), + ('parents', pack.VarIntType()), + ('stops', pack.ListType(pack.IntType(256))), + ]) + def handle_sharereq(self, id, hashes, parents, stops): + shares = self.node.handle_get_shares(hashes, parents, stops, self) + try: + self.send_sharereply(id=id, result='good', shares=[share.as_share() for share in shares]) + except p2protocol.TooLong: + self.send_sharereply(id=id, result='too long', shares=[]) + + message_sharereply = pack.ComposedType([ + ('id', pack.IntType(256)), + ('result', pack.EnumType(pack.VarIntType(), {0: 'good', 1: 'too long', 2: 'unk2', 3: 'unk3', 4: 'unk4', 5: 'unk5', 6: 'unk6'})), + ('shares', pack.ListType(p2pool_data.share_type)), + ]) + class ShareReplyError(Exception): pass + def handle_sharereply(self, id, result, shares): + if result == 'good': + res = [p2pool_data.load_share(share, self.node.net, self.addr) for share in shares if share['type'] >= p2pool_data.Share.VERSION] + else: + res = failure.Failure(self.ShareReplyError(result)) + self.get_shares.got_response(id, res) + + + message_bestblock = pack.ComposedType([ + ('header', bitcoin_data.block_header_type), + ]) + def handle_bestblock(self, header): + self.node.handle_bestblock(header, self) + + + message_have_tx = pack.ComposedType([ + ('tx_hashes', pack.ListType(pack.IntType(256))), + ]) + def handle_have_tx(self, tx_hashes): + #assert self.remote_tx_hashes.isdisjoint(tx_hashes) + self.remote_tx_hashes.update(tx_hashes) + while len(self.remote_tx_hashes) > 10000: + self.remote_tx_hashes.pop() + message_losing_tx = pack.ComposedType([ + ('tx_hashes', pack.ListType(pack.IntType(256))), + ]) + def handle_losing_tx(self, tx_hashes): + #assert self.remote_tx_hashes.issuperset(tx_hashes) + self.remote_tx_hashes.difference_update(tx_hashes) + + + message_remember_tx = pack.ComposedType([ + ('tx_hashes', pack.ListType(pack.IntType(256))), + ('txs', pack.ListType(bitcoin_data.tx_type)), + ]) + def handle_remember_tx(self, tx_hashes, txs): + for tx_hash in tx_hashes: + if tx_hash in self.remembered_txs: + print >>sys.stderr, 'Peer referenced transaction twice, disconnecting' + self.disconnect() + return + + if tx_hash in self.node.known_txs_var.value: + tx = self.node.known_txs_var.value[tx_hash] + else: + for cache in self.known_txs_cache.itervalues(): + if tx_hash in cache: + tx = cache[tx_hash] + print 'Transaction %064x rescued from peer latency cache!' % (tx_hash,) + break + else: + print >>sys.stderr, 'Peer referenced unknown transaction %064x, disconnecting' % (tx_hash,) + self.disconnect() + return + + self.remembered_txs[tx_hash] = tx + self.remembered_txs_size += 100 + bitcoin_data.tx_type.packed_size(tx) + new_known_txs = dict(self.node.known_txs_var.value) + warned = False + for tx in txs: + tx_hash = bitcoin_data.hash256(bitcoin_data.tx_type.pack(tx)) + if tx_hash in self.remembered_txs: + print >>sys.stderr, 'Peer referenced transaction twice, disconnecting' + self.disconnect() + return + + if tx_hash in self.node.known_txs_var.value and not warned: + print 'Peer sent entire transaction %064x that was already received' % (tx_hash,) + warned = True + + self.remembered_txs[tx_hash] = tx + self.remembered_txs_size += 100 + bitcoin_data.tx_type.packed_size(tx) + new_known_txs[tx_hash] = tx + self.node.known_txs_var.set(new_known_txs) + if self.remembered_txs_size >= self.max_remembered_txs_size: + raise PeerMisbehavingError('too much transaction data stored') + message_forget_tx = pack.ComposedType([ + ('tx_hashes', pack.ListType(pack.IntType(256))), + ]) + def handle_forget_tx(self, tx_hashes): + for tx_hash in tx_hashes: + self.remembered_txs_size -= 100 + bitcoin_data.tx_type.packed_size(self.remembered_txs[tx_hash]) + assert self.remembered_txs_size >= 0 + del self.remembered_txs[tx_hash] + + + def connectionLost(self, reason): + self.connection_lost_event.happened() + if self.timeout_delayed is not None: + self.timeout_delayed.cancel() + if self.connected2: + self.factory.proto_disconnected(self, reason) + self._stop_thread() + if self.node.advertise_ip: + self._stop_thread2() + self.connected2 = False + self.factory.proto_lost_connection(self, reason) + if p2pool.DEBUG: + print "Peer connection lost:", self.addr, reason + self.get_shares.respond_all(reason) + + @defer.inlineCallbacks + def do_ping(self): + start = reactor.seconds() + yield self.get_shares(hashes=[0], parents=0, stops=[]) + end = reactor.seconds() + defer.returnValue(end - start) + +class ServerFactory(protocol.ServerFactory): + def __init__(self, node, max_conns): + self.node = node + self.max_conns = max_conns + + self.conns = {} + self.running = False + self.listen_port = None + + def buildProtocol(self, addr): + if sum(self.conns.itervalues()) >= self.max_conns or self.conns.get(self._host_to_ident(addr.host), 0) >= 3: + return None + if addr.host in self.node.bans and self.node.bans[addr.host] > time.time(): + return None + p = Protocol(self.node, True) + p.factory = self + if p2pool.DEBUG: + print "Got peer connection from:", addr + return p + + def _host_to_ident(self, host): + a, b, c, d = host.split('.') + return a, b + + def proto_made_connection(self, proto): + ident = self._host_to_ident(proto.transport.getPeer().host) + self.conns[ident] = self.conns.get(ident, 0) + 1 + def proto_lost_connection(self, proto, reason): + ident = self._host_to_ident(proto.transport.getPeer().host) + self.conns[ident] -= 1 + if not self.conns[ident]: + del self.conns[ident] + + def proto_connected(self, proto): + self.node.got_conn(proto) + def proto_disconnected(self, proto, reason): + self.node.lost_conn(proto, reason) + + def start(self): + assert not self.running + self.running = True + + def attempt_listen(): + if self.running: + self.listen_port = reactor.listenTCP(self.node.port, self) + deferral.retry('Error binding to P2P port:', traceback=False)(attempt_listen)() + + def stop(self): + assert self.running + self.running = False + + return self.listen_port.stopListening() + +class ClientFactory(protocol.ClientFactory): + def __init__(self, node, desired_conns, max_attempts): + self.node = node + self.desired_conns = desired_conns + self.max_attempts = max_attempts + + self.attempts = set() + self.conns = set() + self.running = False + + def _host_to_ident(self, host): + a, b, c, d = host.split('.') + return a, b + + def buildProtocol(self, addr): + p = Protocol(self.node, False) + p.factory = self + return p + + def startedConnecting(self, connector): + ident = self._host_to_ident(connector.getDestination().host) + if ident in self.attempts: + raise AssertionError('already have attempt') + self.attempts.add(ident) + + def clientConnectionFailed(self, connector, reason): + self.attempts.remove(self._host_to_ident(connector.getDestination().host)) + + def clientConnectionLost(self, connector, reason): + self.attempts.remove(self._host_to_ident(connector.getDestination().host)) + + def proto_made_connection(self, proto): + pass + def proto_lost_connection(self, proto, reason): + pass + + def proto_connected(self, proto): + self.conns.add(proto) + self.node.got_conn(proto) + def proto_disconnected(self, proto, reason): + self.conns.remove(proto) + self.node.lost_conn(proto, reason) + + def start(self): + assert not self.running + self.running = True + self._stop_thinking = deferral.run_repeatedly(self._think) + def stop(self): + assert self.running + self.running = False + self._stop_thinking() + + def _think(self): + try: + if len(self.conns) < self.desired_conns and len(self.attempts) < self.max_attempts and self.node.addr_store: + (host, port), = self.node.get_good_peers(1) + + if self._host_to_ident(host) in self.attempts: + pass + elif host in self.node.bans and self.node.bans[host] > time.time(): + pass + else: + #print 'Trying to connect to', host, port + reactor.connectTCP(host, port, self, timeout=5) + except: + log.err() + + return random.expovariate(1/1) + +class SingleClientFactory(protocol.ReconnectingClientFactory): + def __init__(self, node): + self.node = node + + def buildProtocol(self, addr): + p = Protocol(self.node, incoming=False) + p.factory = self + return p + + def proto_made_connection(self, proto): + pass + def proto_lost_connection(self, proto, reason): + pass + + def proto_connected(self, proto): + self.resetDelay() + self.node.got_conn(proto) + def proto_disconnected(self, proto, reason): + self.node.lost_conn(proto, reason) + +class Node(object): + def __init__(self, best_share_hash_func, port, net, addr_store={}, connect_addrs=set(), desired_outgoing_conns=10, max_outgoing_attempts=30, max_incoming_conns=50, preferred_storage=1000, known_txs_var=variable.Variable({}), mining_txs_var=variable.Variable({}), advertise_ip=True): + self.best_share_hash_func = best_share_hash_func + self.port = port + self.net = net + self.addr_store = dict(addr_store) + self.connect_addrs = connect_addrs + self.preferred_storage = preferred_storage + self.known_txs_var = known_txs_var + self.mining_txs_var = mining_txs_var + self.advertise_ip = advertise_ip + + self.traffic_happened = variable.Event() + self.nonce = random.randrange(2**64) + self.peers = {} + self.bans = {} # address -> end_time + self.clientfactory = ClientFactory(self, desired_outgoing_conns, max_outgoing_attempts) + self.serverfactory = ServerFactory(self, max_incoming_conns) + self.running = False + + def start(self): + if self.running: + raise ValueError('already running') + + self.clientfactory.start() + self.serverfactory.start() + self.singleclientconnectors = [reactor.connectTCP(addr, port, SingleClientFactory(self)) for addr, port in self.connect_addrs] + + self.running = True + + self._stop_thinking = deferral.run_repeatedly(self._think) + + def _think(self): + try: + if len(self.addr_store) < self.preferred_storage and self.peers: + random.choice(self.peers.values()).send_getaddrs(count=8) + except: + log.err() + + return random.expovariate(1/20) + + @defer.inlineCallbacks + def stop(self): + if not self.running: + raise ValueError('already stopped') + + self.running = False + + self._stop_thinking() + yield self.clientfactory.stop() + yield self.serverfactory.stop() + for singleclientconnector in self.singleclientconnectors: + yield singleclientconnector.factory.stopTrying() + yield singleclientconnector.disconnect() + del self.singleclientconnectors + + def got_conn(self, conn): + if conn.nonce in self.peers: + raise ValueError('already have peer') + self.peers[conn.nonce] = conn + + print '%s connection to peer %s:%i established. p2pool version: %i %r' % ('Incoming' if conn.incoming else 'Outgoing', conn.addr[0], conn.addr[1], conn.other_version, conn.other_sub_version) + + def lost_conn(self, conn, reason): + if conn.nonce not in self.peers: + raise ValueError('''don't have peer''') + if conn is not self.peers[conn.nonce]: + raise ValueError('wrong conn') + del self.peers[conn.nonce] + + print 'Lost peer %s:%i - %s' % (conn.addr[0], conn.addr[1], reason.getErrorMessage()) + + + def got_addr(self, (host, port), services, timestamp): + if (host, port) in self.addr_store: + old_services, old_first_seen, old_last_seen = self.addr_store[host, port] + self.addr_store[host, port] = services, old_first_seen, max(old_last_seen, timestamp) + else: + if len(self.addr_store) < 10000: + self.addr_store[host, port] = services, timestamp, timestamp + + def handle_shares(self, shares, peer): + print 'handle_shares', (shares, peer) + + def handle_share_hashes(self, hashes, peer): + print 'handle_share_hashes', (hashes, peer) + + def handle_get_shares(self, hashes, parents, stops, peer): + print 'handle_get_shares', (hashes, parents, stops, peer) + + def handle_bestblock(self, header, peer): + print 'handle_bestblock', header + + def get_good_peers(self, max_count): + t = time.time() + return [x[0] for x in sorted(self.addr_store.iteritems(), key=lambda (k, (services, first_seen, last_seen)): + -math.log(max(3600, last_seen - first_seen))/math.log(max(3600, t - last_seen))*random.expovariate(1) + )][:max_count] diff --git a/p2pool/test/__init__.py b/p2pool/test/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/p2pool/test/bitcoin/__init__.py b/p2pool/test/bitcoin/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/p2pool/test/bitcoin/test_data.py b/p2pool/test/bitcoin/test_data.py new file mode 100644 index 00000000..74d5dee2 --- /dev/null +++ b/p2pool/test/bitcoin/test_data.py @@ -0,0 +1,78 @@ +import unittest + +from p2pool.bitcoin import data, networks +from p2pool.util import pack + + +class Test(unittest.TestCase): + def test_header_hash(self): + assert data.hash256(data.block_header_type.pack(dict( + version=1, + previous_block=0x000000000000038a2a86b72387f93c51298298a732079b3b686df3603d2f6282, + merkle_root=0x37a43a3b812e4eb665975f46393b4360008824aab180f27d642de8c28073bc44, + timestamp=1323752685, + bits=data.FloatingInteger(437159528), + nonce=3658685446, + ))) == 0x000000000000003aaaf7638f9f9c0d0c60e8b0eb817dcdb55fd2b1964efc5175 + + def test_header_hash_litecoin(self): + assert networks.nets['litecoin'].POW_FUNC(data.block_header_type.pack(dict( + version=1, + previous_block=0xd928d3066613d1c9dd424d5810cdd21bfeef3c698977e81ec1640e1084950073, + merkle_root=0x03f4b646b58a66594a182b02e425e7b3a93c8a52b600aa468f1bc5549f395f16, + timestamp=1327807194, + bits=data.FloatingInteger(0x1d01b56f), + nonce=20736, + ))) < 2**256//2**30 + + def test_tx_hash(self): + assert data.hash256(data.tx_type.pack(dict( + version=1, + tx_ins=[dict( + previous_output=None, + sequence=None, + script='70736a0468860e1a0452389500522cfabe6d6d2b2f33cf8f6291b184f1b291d24d82229463fcec239afea0ee34b4bfc622f62401000000000000004d696e656420627920425443204775696c6420ac1eeeed88'.decode('hex'), + )], + tx_outs=[dict( + value=5003880250, + script=data.pubkey_hash_to_script2(pack.IntType(160).unpack('ca975b00a8c203b8692f5a18d92dc5c2d2ebc57b'.decode('hex'))), + )], + lock_time=0, + ))) == 0xb53802b2333e828d6532059f46ecf6b313a42d79f97925e457fbbfda45367e5c + + def test_address_to_pubkey_hash(self): + assert data.address_to_pubkey_hash('1KUCp7YP5FP8ViRxhfszSUJCTAajK6viGy', networks.nets['bitcoin']) == pack.IntType(160).unpack('ca975b00a8c203b8692f5a18d92dc5c2d2ebc57b'.decode('hex')) + + def test_merkle_hash(self): + assert data.merkle_hash([ + 0xb53802b2333e828d6532059f46ecf6b313a42d79f97925e457fbbfda45367e5c, + 0x326dfe222def9cf571af37a511ccda282d83bedcc01dabf8aa2340d342398cf0, + 0x5d2e0541c0f735bac85fa84bfd3367100a3907b939a0c13e558d28c6ffd1aea4, + 0x8443faf58aa0079760750afe7f08b759091118046fe42794d3aca2aa0ff69da2, + 0x4d8d1c65ede6c8eab843212e05c7b380acb82914eef7c7376a214a109dc91b9d, + 0x1d750bc0fa276f89db7e6ed16eb1cf26986795121f67c03712210143b0cb0125, + 0x5179349931d714d3102dfc004400f52ef1fed3b116280187ca85d1d638a80176, + 0xa8b3f6d2d566a9239c9ad9ae2ed5178dee4a11560a8dd1d9b608fd6bf8c1e75, + 0xab4d07cd97f9c0c4129cff332873a44efdcd33bdbfc7574fe094df1d379e772f, + 0xf54a7514b1de8b5d9c2a114d95fba1e694b6e3e4a771fda3f0333515477d685b, + 0x894e972d8a2fc6c486da33469b14137a7f89004ae07b95e63923a3032df32089, + 0x86cdde1704f53fce33ab2d4f5bc40c029782011866d0e07316d695c41e32b1a0, + 0xf7cf4eae5e497be8215778204a86f1db790d9c27fe6a5b9f745df5f3862f8a85, + 0x2e72f7ddf157d64f538ec72562a820e90150e8c54afc4d55e0d6e3dbd8ca50a, + 0x9f27471dfbc6ce3cbfcf1c8b25d44b8d1b9d89ea5255e9d6109e0f9fd662f75c, + 0x995f4c9f78c5b75a0c19f0a32387e9fa75adaa3d62fba041790e06e02ae9d86d, + 0xb11ec2ad2049aa32b4760d458ee9effddf7100d73c4752ea497e54e2c58ba727, + 0xa439f288fbc5a3b08e5ffd2c4e2d87c19ac2d5e4dfc19fabfa33c7416819e1ec, + 0x3aa33f886f1357b4bbe81784ec1cf05873b7c5930ab912ee684cc6e4f06e4c34, + 0xcab9a1213037922d94b6dcd9c567aa132f16360e213c202ee59f16dde3642ac7, + 0xa2d7a3d2715eb6b094946c6e3e46a88acfb37068546cabe40dbf6cd01a625640, + 0x3d02764f24816aaa441a8d472f58e0f8314a70d5b44f8a6f88cc8c7af373b24e, + 0xcc5adf077c969ebd78acebc3eb4416474aff61a828368113d27f72ad823214d0, + 0xf2d8049d1971f02575eb37d3a732d46927b6be59a18f1bd0c7f8ed123e8a58a, + 0x94ffe8d46a1accd797351894f1774995ed7df3982c9a5222765f44d9c3151dbb, + 0x82268fa74a878636261815d4b8b1b01298a8bffc87336c0d6f13ef6f0373f1f0, + 0x73f441f8763dd1869fe5c2e9d298b88dc62dc8c75af709fccb3622a4c69e2d55, + 0xeb78fc63d4ebcdd27ed618fd5025dc61de6575f39b2d98e3be3eb482b210c0a0, + 0x13375a426de15631af9afdf00c490e87cc5aab823c327b9856004d0b198d72db, + 0x67d76a64fa9b6c5d39fde87356282ef507b3dec1eead4b54e739c74e02e81db4, + ]) == 0x37a43a3b812e4eb665975f46393b4360008824aab180f27d642de8c28073bc44 diff --git a/p2pool/test/bitcoin/test_getwork.py b/p2pool/test/bitcoin/test_getwork.py new file mode 100644 index 00000000..58776f95 --- /dev/null +++ b/p2pool/test/bitcoin/test_getwork.py @@ -0,0 +1,69 @@ +import unittest + +from p2pool.bitcoin import getwork, data as bitcoin_data + +class Test(unittest.TestCase): + def test_all(self): + cases = [ + { + 'target': '0000000000000000000000000000000000000000000000f2b944000000000000', + 'midstate': '5982f893102dec03e374b472647c4f19b1b6d21ae4b2ac624f3d2f41b9719404', + 'hash1': '00000000000000000000000000000000000000000000000000000000000000000000008000000000000000000000000000000000000000000000000000010000', + 'data': '0000000163930d52a5ffca79b29b95a659a302cd4e1654194780499000002274000000002e133d9e51f45bc0886d05252038e421e82bff18b67dc14b90d9c3c2f422cd5c4dd4598e1a44b9f200000000000000800000000000000000000000000000000000000000000000000000000000000000000000000000000080020000' + }, + { + 'midstate' : 'f4a9b048c0cb9791bc94b13ee0eec21e713963d524fd140b58bb754dd7b0955f', + 'data' : '000000019a1d7342fb62090bda686b22d90f9f73d0f5c418b9c980cd0000011a00000000680b07c8a2f97ecd831f951806857e09f98a3b81cdef1fa71982934fef8dc3444e18585d1a0abbcf00000000000000800000000000000000000000000000000000000000000000000000000000000000000000000000000080020000', + 'hash1' : '00000000000000000000000000000000000000000000000000000000000000000000008000000000000000000000000000000000000000000000000000010000', + 'target' : '0000000000000000000000000000000000000000000000cfbb0a000000000000', + 'extrathing': 'hi!', + }, + { + 'data' : '000000019a1d7342fb62090bda686b22d90f9f73d0f5c418b9c980cd0000011a00000000680b07c8a2f97ecd831f951806857e09f98a3b81cdef1fa71982934fef8dc3444e18585d1a0abbcf00000000000000800000000000000000000000000000000000000000000000000000000000000000000000000000000080020000', + 'hash1' : '00000000000000000000000000000000000000000000000000000000000000000000008000000000000000000000000000000000000000000000000000010000', + 'target' : '0000000000000000000000000000000000000000000000cfbb0a000000000000', + 'extrathing': 'hi!', + }, + ] + for case in cases: + ba = getwork.BlockAttempt.from_getwork(case) + + extra = dict(case) + del extra['data'], extra['hash1'], extra['target'] + extra.pop('midstate', None) + + getwork_check = ba.getwork(**extra) + assert getwork_check == case or dict((k, v) for k, v in getwork_check.iteritems() if k != 'midstate') == case + + case2s = [ + getwork.BlockAttempt( + 1, + 0x148135e10208db85abb62754341a392eab1f186aab077a831cf7, + 0x534ea08be1ab529f484369344b6d5423ef5a0767db9b3ebb4e182bbb67962520, + 1305759879, + bitcoin_data.FloatingInteger.from_target_upper_bound(0x44b9f20000000000000000000000000000000000000000000000), + 0x44b9f20000000000000000000000000000000000000000000000, + ), + getwork.BlockAttempt( + 1, + 0x148135e10208db85abb62754341a392eab1f186aab077a831cf7, + 0x534ea08be1ab529f484369344b6d5423ef5a0767db9b3ebb4e182bbb67962520, + 1305759879, + bitcoin_data.FloatingInteger.from_target_upper_bound(0x44b9f20000000000000000000000000000000000000000000000), + 432*2**230, + ), + getwork.BlockAttempt( + 1, + 0x148135e10208db85abb62754341a392eab1f186aab077a831cf7, + 0x534ea08be1ab529f484369344b6d5423ef5a0767db9b3ebb4e182bbb67962520, + 1305759879, + bitcoin_data.FloatingInteger.from_target_upper_bound(0x44b9f20000000000000000000000000000000000000000000000), + 7*2**240, + ) + ] + for case2 in case2s: + assert getwork.BlockAttempt.from_getwork(case2.getwork()) == case2 + assert getwork.BlockAttempt.from_getwork(case2.getwork(ident='hi')) == case2 + case2 = case2.update(previous_block=case2.previous_block - 10) + assert getwork.BlockAttempt.from_getwork(case2.getwork()) == case2 + assert getwork.BlockAttempt.from_getwork(case2.getwork(ident='hi')) == case2 diff --git a/p2pool/test/bitcoin/test_p2p.py b/p2pool/test/bitcoin/test_p2p.py new file mode 100644 index 00000000..a564dadc --- /dev/null +++ b/p2pool/test/bitcoin/test_p2p.py @@ -0,0 +1,20 @@ +from twisted.internet import defer, reactor +from twisted.trial import unittest + +from p2pool.bitcoin import data, networks, p2p +from p2pool.util import deferral + + +class Test(unittest.TestCase): + @defer.inlineCallbacks + def test_get_block(self): + factory = p2p.ClientFactory(networks.nets['bitcoin']) + c = reactor.connectTCP('127.0.0.1', 8333, factory) + try: + h = 0x000000000000046acff93b0e76cd10490551bf871ce9ac9fad62e67a07ff1d1e + block = yield deferral.retry()(defer.inlineCallbacks(lambda: defer.returnValue((yield (yield factory.getProtocol()).get_block(h)))))() + assert data.merkle_hash(map(data.hash256, map(data.tx_type.pack, block['txs']))) == block['header']['merkle_root'] + assert data.hash256(data.block_header_type.pack(block['header'])) == h + finally: + factory.stopTrying() + c.disconnect() diff --git a/p2pool/test/bitcoin/test_script.py b/p2pool/test/bitcoin/test_script.py new file mode 100644 index 00000000..15be06cc --- /dev/null +++ b/p2pool/test/bitcoin/test_script.py @@ -0,0 +1,12 @@ +import unittest + +from p2pool.bitcoin import script + +class Test(unittest.TestCase): + def test_all(self): + data = '76 A9 14 89 AB CD EF AB BA AB BA AB BA AB BA AB BA AB BA AB BA AB BA 88 AC'.replace(' ', '').decode('hex') + self.assertEquals( + list(script.parse(data)), + [('UNK_118', None), ('UNK_169', None), ('PUSH', '\x89\xab\xcd\xef\xab\xba\xab\xba\xab\xba\xab\xba\xab\xba\xab\xba\xab\xba\xab\xba'), ('UNK_136', None), ('CHECKSIG', None)], + ) + self.assertEquals(script.get_sigop_count(data), 1) diff --git a/p2pool/test/bitcoin/test_sha256.py b/p2pool/test/bitcoin/test_sha256.py new file mode 100644 index 00000000..57d3b088 --- /dev/null +++ b/p2pool/test/bitcoin/test_sha256.py @@ -0,0 +1,37 @@ +from __future__ import division + +import unittest +import hashlib +import random + +from p2pool.bitcoin import sha256 + +class Test(unittest.TestCase): + def test_all(self): + for test in ['', 'a', 'b', 'abc', 'abc'*50, 'hello world']: + #print test + #print sha256.sha256(test).hexdigest() + #print hashlib.sha256(test).hexdigest() + #print + assert sha256.sha256(test).hexdigest() == hashlib.sha256(test).hexdigest() + def random_str(l): + return ''.join(chr(random.randrange(256)) for i in xrange(l)) + for length in xrange(150): + test = random_str(length) + a = sha256.sha256(test).hexdigest() + b = hashlib.sha256(test).hexdigest() + assert a == b + for i in xrange(100): + test = random_str(int(random.expovariate(1/100))) + test2 = random_str(int(random.expovariate(1/100))) + + a = sha256.sha256(test) + a = a.copy() + a.update(test2) + a = a.hexdigest() + + b = hashlib.sha256(test) + b = b.copy() + b.update(test2) + b = b.hexdigest() + assert a == b diff --git a/p2pool/test/test_data.py b/p2pool/test/test_data.py new file mode 100644 index 00000000..c9f35277 --- /dev/null +++ b/p2pool/test/test_data.py @@ -0,0 +1,41 @@ +import random +import unittest + +from p2pool import data +from p2pool.bitcoin import data as bitcoin_data +from p2pool.test.util import test_forest +from p2pool.util import forest + +def random_bytes(length): + return ''.join(chr(random.randrange(2**8)) for i in xrange(length)) + +class Test(unittest.TestCase): + def test_hashlink1(self): + for i in xrange(100): + d = random_bytes(random.randrange(2048)) + x = data.prefix_to_hash_link(d) + assert data.check_hash_link(x, '') == bitcoin_data.hash256(d) + + def test_hashlink2(self): + for i in xrange(100): + d = random_bytes(random.randrange(2048)) + d2 = random_bytes(random.randrange(2048)) + x = data.prefix_to_hash_link(d) + assert data.check_hash_link(x, d2) == bitcoin_data.hash256(d + d2) + + def test_hashlink3(self): + for i in xrange(100): + d = random_bytes(random.randrange(2048)) + d2 = random_bytes(random.randrange(200)) + d3 = random_bytes(random.randrange(2048)) + x = data.prefix_to_hash_link(d + d2, d2) + assert data.check_hash_link(x, d3, d2) == bitcoin_data.hash256(d + d2 + d3) + + def test_skiplist(self): + t = forest.Tracker() + d = data.WeightsSkipList(t) + for i in xrange(200): + t.add(test_forest.FakeShare(hash=i, previous_hash=i - 1 if i > 0 else None, new_script=i, share_data=dict(donation=1234), target=2**249)) + for i in xrange(200): + a = random.randrange(200) + d(a, random.randrange(a + 1), 1000000*65535)[1] diff --git a/p2pool/test/test_node.py b/p2pool/test/test_node.py new file mode 100644 index 00000000..f09dd421 --- /dev/null +++ b/p2pool/test/test_node.py @@ -0,0 +1,280 @@ +from __future__ import division + +import base64 +import random +import tempfile + +from twisted.internet import defer, reactor +from twisted.python import failure +from twisted.trial import unittest +from twisted.web import client, resource, server + +from p2pool import data, node, work +from p2pool.bitcoin import data as bitcoin_data, networks, worker_interface +from p2pool.util import deferral, jsonrpc, math, variable + +class bitcoind(object): # can be used as p2p factory, p2p protocol, or rpc jsonrpc proxy + def __init__(self): + self.blocks = [0x000000000000016c169477c25421250ec5d32cf9c6d38538b5de970a2355fd89] + self.headers = {0x16c169477c25421250ec5d32cf9c6d38538b5de970a2355fd89: { + 'nonce': 1853158954, + 'timestamp': 1351658517, + 'merkle_root': 2282849479936278423916707524932131168473430114569971665822757638339486597658L, + 'version': 1, + 'previous_block': 1048610514577342396345362905164852351970507722694242579238530L, + 'bits': bitcoin_data.FloatingInteger(bits=0x1a0513c5, target=0x513c50000000000000000000000000000000000000000000000L), + }} + + self.conn = variable.Variable(self) + self.new_headers = variable.Event() + self.new_block = variable.Event() + self.new_tx = variable.Event() + + # p2p factory + + def getProtocol(self): + return self + + # p2p protocol + + def send_block(self, block): + pass + + def send_tx(self, tx): + pass + + def get_block_header(self, block_hash): + return self.headers[block_hash] + + # rpc jsonrpc proxy + + def rpc_help(self): + return '\ngetblock ' + + def rpc_getblock(self, block_hash_hex): + block_hash = int(block_hash_hex, 16) + return dict(height=self.blocks.index(block_hash)) + + def __getattr__(self, name): + if name.startswith('rpc_'): + return lambda *args, **kwargs: failure.Failure(jsonrpc.Error_for_code(-32601)('Method not found')) + + def rpc_getblocktemplate(self, param): + if param['mode'] == 'template': + pass + elif param['mode'] == 'submit': + result = param['data'] + block = bitcoin_data.block_type.unpack(result.decode('hex')) + if sum(tx_out['value'] for tx_out in block['txs'][0]['tx_outs']) != sum(tx['tx_outs'][0]['value'] for tx in block['txs'][1:]) + 5000000000: + print 'invalid fee' + if block['header']['previous_block'] != self.blocks[-1]: + return False + if bitcoin_data.hash256(result.decode('hex')) > block['header']['bits'].target: + return False + header_hash = bitcoin_data.hash256(bitcoin_data.block_header_type.pack(block['header'])) + self.blocks.append(header_hash) + self.headers[header_hash] = block['header'] + reactor.callLater(0, self.new_block.happened) + return True + else: + raise jsonrpc.Error_for_code(-1)('invalid request') + + txs = [] + for i in xrange(100): + fee = i + txs.append(dict( + data=bitcoin_data.tx_type.pack(dict(version=1, tx_ins=[], tx_outs=[dict(value=fee, script='hello!'*100)], lock_time=0)).encode('hex'), + fee=fee, + )) + return { + "version" : 2, + "previousblockhash" : '%064x' % (self.blocks[-1],), + "transactions" : txs, + "coinbaseaux" : { + "flags" : "062f503253482f" + }, + "coinbasevalue" : 5000000000 + sum(tx['fee'] for tx in txs), + "target" : "0000000000000513c50000000000000000000000000000000000000000000000", + "mintime" : 1351655621, + "mutable" : [ + "time", + "transactions", + "prevblock" + ], + "noncerange" : "00000000ffffffff", + "sigoplimit" : 20000, + "sizelimit" : 1000000, + "curtime" : 1351659940, + "bits" : "21008000", + "height" : len(self.blocks), + } + +@apply +class mm_provider(object): + def __getattr__(self, name): + print '>>>>>>>', name + def rpc_getauxblock(self, request, result1=None, result2=None): + if result1 is not None: + print result1, result2 + return True + return { + "target" : "aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa", # 2**256*2/3 + "hash" : "2756ea0315d46dc3d8d974f34380873fc88863845ac01a658ef11bc3b368af52", + "chainid" : 1 + } + +mynet = math.Object( + NAME='mynet', + PARENT=networks.nets['litecoin_testnet'], + SHARE_PERIOD=5, # seconds + CHAIN_LENGTH=20*60//3, # shares + REAL_CHAIN_LENGTH=20*60//3, # shares + TARGET_LOOKBEHIND=200, # shares + SPREAD=3, # blocks + IDENTIFIER='cca5e24ec6408b1e'.decode('hex'), + PREFIX='ad9614f6466a39cf'.decode('hex'), + P2P_PORT=19338, + MIN_TARGET=2**256 - 1, + MAX_TARGET=2**256 - 1, + PERSIST=False, + WORKER_PORT=19327, + BOOTSTRAP_ADDRS='72.14.191.28'.split(' '), + ANNOUNCE_CHANNEL='#p2pool-alt', + VERSION_CHECK=lambda v: True, +) + +class MiniNode(object): + @classmethod + @defer.inlineCallbacks + def start(cls, net, factory, bitcoind, peer_ports, merged_urls): + self = cls() + + self.n = node.Node(factory, bitcoind, [], [], net) + yield self.n.start() + + self.n.p2p_node = node.P2PNode(self.n, port=0, max_incoming_conns=1000000, addr_store={}, connect_addrs=[('127.0.0.1', peer_port) for peer_port in peer_ports]) + self.n.p2p_node.start() + + wb = work.WorkerBridge(node=self.n, my_pubkey_hash=random.randrange(2**160), donation_percentage=random.uniform(0, 10), merged_urls=merged_urls, worker_fee=3) + self.wb = wb + web_root = resource.Resource() + worker_interface.WorkerInterface(wb).attach_to(web_root) + self.web_port = reactor.listenTCP(0, server.Site(web_root)) + + defer.returnValue(self) + + @defer.inlineCallbacks + def stop(self): + yield self.web_port.stopListening() + yield self.n.p2p_node.stop() + yield self.n.stop() + del self.web_port, self.n + +class Test(unittest.TestCase): + @defer.inlineCallbacks + def test_node(self): + bitd = bitcoind() + + mm_root = resource.Resource() + mm_root.putChild('', jsonrpc.HTTPServer(mm_provider)) + mm_port = reactor.listenTCP(0, server.Site(mm_root)) + + n = node.Node(bitd, bitd, [], [], mynet) + yield n.start() + + wb = work.WorkerBridge(node=n, my_pubkey_hash=42, donation_percentage=2, merged_urls=[('http://127.0.0.1:%i' % (mm_port.getHost().port,), '')], worker_fee=3) + web_root = resource.Resource() + worker_interface.WorkerInterface(wb).attach_to(web_root) + port = reactor.listenTCP(0, server.Site(web_root)) + + proxy = jsonrpc.HTTPProxy('http://127.0.0.1:' + str(port.getHost().port), + headers=dict(Authorization='Basic ' + base64.b64encode('user/0:password'))) + + yield deferral.sleep(3) + + for i in xrange(100): + blah = yield proxy.rpc_getwork() + yield proxy.rpc_getwork(blah['data']) + + + yield deferral.sleep(3) + + assert len(n.tracker.items) == 100 + assert n.tracker.verified.get_height(n.best_share_var.value) == 100 + + wb.stop() + n.stop() + + yield port.stopListening() + del n, wb, web_root, port, proxy + import gc + gc.collect() + gc.collect() + gc.collect() + + yield deferral.sleep(20) # waiting for work_poller to exit + yield mm_port.stopListening() + #test_node.timeout = 15 + + @defer.inlineCallbacks + def test_nodes(self): + N = 3 + SHARES = 600 + + bitd = bitcoind() + + nodes = [] + for i in xrange(N): + nodes.append((yield MiniNode.start(mynet, bitd, bitd, [mn.n.p2p_node.serverfactory.listen_port.getHost().port for mn in nodes], []))) + + yield deferral.sleep(3) + + for i in xrange(SHARES): + proxy = jsonrpc.HTTPProxy('http://127.0.0.1:' + str(random.choice(nodes).web_port.getHost().port), + headers=dict(Authorization='Basic ' + base64.b64encode('user/0:password'))) + blah = yield proxy.rpc_getwork() + yield proxy.rpc_getwork(blah['data']) + yield deferral.sleep(.05) + print i + print type(nodes[0].n.tracker.items[nodes[0].n.best_share_var.value]) + + # crawl web pages + from p2pool import web + stop_event = variable.Event() + web2_root = web.get_web_root(nodes[0].wb, tempfile.mkdtemp(), variable.Variable(None), stop_event) + web2_port = reactor.listenTCP(0, server.Site(web2_root)) + for name in web2_root.listNames() + ['web/' + x for x in web2_root.getChildWithDefault('web', None).listNames()]: + if name in ['web/graph_data', 'web/share', 'web/share_data']: continue + print + print name + try: + res = yield client.getPage('http://127.0.0.1:%i/%s' % (web2_port.getHost().port, name)) + except: + import traceback + traceback.print_exc() + else: + print repr(res)[:100] + print + yield web2_port.stopListening() + stop_event.happened() + del web2_root + + yield deferral.sleep(3) + + for i, n in enumerate(nodes): + assert len(n.n.tracker.items) == SHARES, (i, len(n.n.tracker.items)) + assert n.n.tracker.verified.get_height(n.n.best_share_var.value) == SHARES, (i, n.n.tracker.verified.get_height(n.n.best_share_var.value)) + assert type(n.n.tracker.items[nodes[0].n.best_share_var.value]) is (data.Share.SUCCESSOR if data.Share.SUCCESSOR is not None else data.Share) + assert type(n.n.tracker.items[n.n.tracker.get_nth_parent_hash(nodes[0].n.best_share_var.value, SHARES - 5)]) is data.Share + + for n in nodes: + yield n.stop() + + del nodes, n + import gc + gc.collect() + gc.collect() + gc.collect() + + yield deferral.sleep(20) # waiting for work_poller to exit + test_nodes.timeout = 300 diff --git a/p2pool/test/test_p2p.py b/p2pool/test/test_p2p.py new file mode 100644 index 00000000..4cf39010 --- /dev/null +++ b/p2pool/test/test_p2p.py @@ -0,0 +1,79 @@ +import random + +from twisted.internet import defer, endpoints, protocol, reactor +from twisted.trial import unittest + +from p2pool import networks, p2p +from p2pool.bitcoin import data as bitcoin_data +from p2pool.util import deferral + + +class Test(unittest.TestCase): + @defer.inlineCallbacks + def test_sharereq(self): + class MyNode(p2p.Node): + def __init__(self, df): + p2p.Node.__init__(self, lambda: None, 29333, networks.nets['bitcoin'], {}, set([('127.0.0.1', 9333)]), 0, 0, 0, 0) + + self.df = df + + def handle_share_hashes(self, hashes, peer): + peer.get_shares( + hashes=[hashes[0]], + parents=5, + stops=[], + ).chainDeferred(self.df) + + df = defer.Deferred() + n = MyNode(df) + n.start() + try: + yield df + finally: + yield n.stop() + + @defer.inlineCallbacks + def test_tx_limit(self): + class MyNode(p2p.Node): + def __init__(self, df): + p2p.Node.__init__(self, lambda: None, 29333, networks.nets['bitcoin'], {}, set([('127.0.0.1', 9333)]), 0, 0, 0, 0) + + self.df = df + self.sent_time = 0 + + @defer.inlineCallbacks + def got_conn(self, conn): + p2p.Node.got_conn(self, conn) + + yield deferral.sleep(.5) + + new_mining_txs = dict(self.mining_txs_var.value) + for i in xrange(3): + huge_tx = dict( + version=0, + tx_ins=[], + tx_outs=[dict( + value=0, + script='x'*900000, + )], + lock_time=i, + ) + new_mining_txs[bitcoin_data.hash256(bitcoin_data.tx_type.pack(huge_tx))] = huge_tx + self.mining_txs_var.set(new_mining_txs) + + self.sent_time = reactor.seconds() + + def lost_conn(self, conn, reason): + self.df.callback(None) + try: + p2p.Protocol.max_remembered_txs_size *= 10 + + df = defer.Deferred() + n = MyNode(df) + n.start() + yield df + if not (n.sent_time <= reactor.seconds() <= n.sent_time + 1): + raise ValueError('node did not disconnect within 1 seconds of receiving too much tx data') + yield n.stop() + finally: + p2p.Protocol.max_remembered_txs_size //= 10 diff --git a/p2pool/test/util/__init__.py b/p2pool/test/util/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/p2pool/test/util/test_datachunker.py b/p2pool/test/util/test_datachunker.py new file mode 100644 index 00000000..beb4f4a3 --- /dev/null +++ b/p2pool/test/util/test_datachunker.py @@ -0,0 +1,27 @@ +import random +import unittest + +from p2pool.util import datachunker + +def random_bytes(length): + return ''.join(chr(random.randrange(2**8)) for i in xrange(length)) + +class Test(unittest.TestCase): + def test_stringbuffer(self): + for i in xrange(100): + sb = datachunker.StringBuffer() + + r = random_bytes(random.randrange(1000)) + + amount_inserted = 0 + while amount_inserted < len(r): + x = random.randrange(10) + sb.add(r[amount_inserted:amount_inserted+x]) + amount_inserted += x + + amount_removed = 0 + while amount_removed < len(r): + x = random.randrange(min(10, len(r) - amount_removed) + 1) + this = sb.get(x) + assert r[amount_removed:amount_removed+x] == this + amount_removed += x diff --git a/p2pool/test/util/test_deferral.py b/p2pool/test/util/test_deferral.py new file mode 100644 index 00000000..02e69c95 --- /dev/null +++ b/p2pool/test/util/test_deferral.py @@ -0,0 +1,17 @@ +import random +import time + +from twisted.internet import defer +from twisted.trial import unittest + +from p2pool.util import deferral + +class Test(unittest.TestCase): + @defer.inlineCallbacks + def test_sleep(self): + for i in xrange(10): + length = random.expovariate(1/0.1) + start = time.time() + yield deferral.sleep(length) + end = time.time() + assert length <= end - start <= length + 0.1 diff --git a/p2pool/test/util/test_expiring_dict.py b/p2pool/test/util/test_expiring_dict.py new file mode 100644 index 00000000..b9e29044 --- /dev/null +++ b/p2pool/test/util/test_expiring_dict.py @@ -0,0 +1,32 @@ +from twisted.internet import defer +from twisted.trial import unittest + +from p2pool.util import deferral, expiring_dict + +class Test(unittest.TestCase): + @defer.inlineCallbacks + def test_expiring_dict1(self): + e = expiring_dict.ExpiringDict(3, get_touches=True) + e[1] = 2 + yield deferral.sleep(1.5) + assert 1 in e + yield deferral.sleep(3) + assert 1 not in e + + @defer.inlineCallbacks + def test_expiring_dict2(self): + e = expiring_dict.ExpiringDict(3, get_touches=True) + e[1] = 2 + yield deferral.sleep(2.25) + e[1] + yield deferral.sleep(2.25) + assert 1 in e + + @defer.inlineCallbacks + def test_expiring_dict3(self): + e = expiring_dict.ExpiringDict(3, get_touches=False) + e[1] = 2 + yield deferral.sleep(2.25) + e[1] + yield deferral.sleep(2.25) + assert 1 not in e diff --git a/p2pool/test/util/test_forest.py b/p2pool/test/util/test_forest.py new file mode 100644 index 00000000..3b641874 --- /dev/null +++ b/p2pool/test/util/test_forest.py @@ -0,0 +1,194 @@ +import random +import unittest + +from p2pool.util import forest, math + +class DumbTracker(object): + def __init__(self, items=[]): + self.items = {} # hash -> item + self.reverse = {} # previous_hash -> set of item_hashes + + for item in items: + self.add(item) + + def add(self, item): + if item.hash in self.items: + raise ValueError('item already present') + self.items[item.hash] = item + self.reverse.setdefault(item.previous_hash, set()).add(item.hash) + + def remove(self, item_hash): + item = self.items[item_hash] + del item_hash + + self.items.pop(item.hash) + self.reverse[item.previous_hash].remove(item.hash) + if not self.reverse[item.previous_hash]: + self.reverse.pop(item.previous_hash) + + @property + def heads(self): + return dict((x, self.get_last(x)) for x in self.items if x not in self.reverse) + + @property + def tails(self): + return dict((x, set(y for y in self.items if self.get_last(y) == x and y not in self.reverse)) for x in self.reverse if x not in self.items) + + def get_nth_parent_hash(self, item_hash, n): + for i in xrange(n): + item_hash = self.items[item_hash].previous_hash + return item_hash + + def get_height(self, item_hash): + height, last = self.get_height_and_last(item_hash) + return height + + def get_last(self, item_hash): + height, last = self.get_height_and_last(item_hash) + return last + + def get_height_and_last(self, item_hash): + height = 0 + while item_hash in self.items: + item_hash = self.items[item_hash].previous_hash + height += 1 + return height, item_hash + + def get_chain(self, start_hash, length): + # same implementation :/ + assert length <= self.get_height(start_hash) + for i in xrange(length): + yield self.items[start_hash] + start_hash = self.items[start_hash].previous_hash + + def is_child_of(self, item_hash, possible_child_hash): + if self.get_last(item_hash) != self.get_last(possible_child_hash): + return None + while True: + if possible_child_hash == item_hash: + return True + if possible_child_hash not in self.items: + return False + possible_child_hash = self.items[possible_child_hash].previous_hash + +class FakeShare(object): + def __init__(self, **kwargs): + for k, v in kwargs.iteritems(): + setattr(self, k, v) + self._attrs = kwargs + +def test_tracker(self): + t = DumbTracker(self.items.itervalues()) + + assert self.items == t.items, (self.items, t.items) + assert self.reverse == t.reverse, (self.reverse, t.reverse) + assert self.heads == t.heads, (self.heads, t.heads) + assert self.tails == t.tails, (self.tails, t.tails) + + if random.random() < 0.9: + return + + for start in self.items: + a, b = self.get_height_and_last(start), t.get_height_and_last(start) + assert a == b, (a, b) + + other = random.choice(self.items.keys()) + assert self.is_child_of(start, other) == t.is_child_of(start, other) + assert self.is_child_of(other, start) == t.is_child_of(other, start) + + length = random.randrange(a[0]) + assert list(self.get_chain(start, length)) == list(t.get_chain(start, length)) + +def generate_tracker_simple(n): + t = forest.Tracker(math.shuffled(FakeShare(hash=i, previous_hash=i - 1 if i > 0 else None) for i in xrange(n))) + test_tracker(t) + return t + +def generate_tracker_random(n): + items = [] + for i in xrange(n): + x = random.choice(items + [FakeShare(hash=None), FakeShare(hash=random.randrange(1000000, 2000000))]).hash + items.append(FakeShare(hash=i, previous_hash=x)) + t = forest.Tracker(math.shuffled(items)) + test_tracker(t) + return t + +class Test(unittest.TestCase): + def test_tracker(self): + t = generate_tracker_simple(100) + + assert t.heads == {99: None} + assert t.tails == {None: set([99])} + + assert t.get_nth_parent_hash(90, 50) == 90 - 50 + assert t.get_nth_parent_hash(91, 42) == 91 - 42 + + def test_get_nth_parent_hash(self): + t = generate_tracker_simple(200) + + for i in xrange(1000): + a = random.randrange(200) + b = random.randrange(a + 1) + res = t.get_nth_parent_hash(a, b) + assert res == a - b, (a, b, res) + + def test_tracker2(self): + for ii in xrange(20): + t = generate_tracker_random(random.randrange(100)) + #print "--start--" + while t.items: + while True: + try: + t.remove(random.choice(list(t.items))) + except NotImplementedError: + pass # print "aborted", x + else: + break + test_tracker(t) + + def test_tracker3(self): + for ii in xrange(10): + items = [] + for i in xrange(random.randrange(100)): + x = random.choice(items + [FakeShare(hash=None), FakeShare(hash=random.randrange(1000000, 2000000))]).hash + items.append(FakeShare(hash=i, previous_hash=x)) + + t = forest.Tracker() + test_tracker(t) + + for item in math.shuffled(items): + t.add(item) + test_tracker(t) + if random.randrange(3) == 0: + while True: + try: + t.remove(random.choice(list(t.items))) + except NotImplementedError: + pass + else: + break + test_tracker(t) + + for item in math.shuffled(items): + if item.hash not in t.items: + t.add(item) + test_tracker(t) + if random.randrange(3) == 0: + while True: + try: + t.remove(random.choice(list(t.items))) + except NotImplementedError: + pass + else: + break + test_tracker(t) + + while t.items: + while True: + try: + t.remove(random.choice(list(t.items))) + except NotImplementedError: + pass + else: + break + test_tracker(t) diff --git a/p2pool/test/util/test_graph.py b/p2pool/test/util/test_graph.py new file mode 100644 index 00000000..0b4dd0f4 --- /dev/null +++ b/p2pool/test/util/test_graph.py @@ -0,0 +1,9 @@ +import unittest + +from p2pool.util import graph + +class Test(unittest.TestCase): + def test_keep_largest(self): + b = dict(a=1, b=3, c=5, d=7, e=9) + assert graph.keep_largest(3, 'squashed')(b) == {'squashed': 9, 'd': 7, 'e': 9} + assert graph.keep_largest(3)(b) == {'c': 5, 'd': 7, 'e': 9} diff --git a/p2pool/test/util/test_math.py b/p2pool/test/util/test_math.py new file mode 100644 index 00000000..226b8e5a --- /dev/null +++ b/p2pool/test/util/test_math.py @@ -0,0 +1,38 @@ +from __future__ import division + +import random +import unittest + +from p2pool.util import math + +def generate_alphabet(): + if random.randrange(2): + return None + else: + a = map(chr, xrange(256)) + random.shuffle(a) + return a[:random.randrange(2, len(a))] + +class Test(unittest.TestCase): + def test_add_tuples(self): + assert math.add_tuples((1, 2, 3), (4, 5, 6)) == (5, 7, 9) + + def test_bases(self): + for i in xrange(10): + alphabet = generate_alphabet() + for i in xrange(100): + n = random.choice([ + random.randrange(3), + random.randrange(300), + random.randrange(100000000000000000000000000000), + ]) + s = math.natural_to_string(n, alphabet) + n2 = math.string_to_natural(s, alphabet) + #print n, s.encode('hex'), n2 + self.assertEquals(n, n2) + + def test_binom(self): + for n in xrange(1, 100): + for x in xrange(n + 1): + left, right = math.binomial_conf_interval(x, n) + assert 0 <= left <= x/n <= right <= 1, (left, right, x, n) diff --git a/p2pool/test/util/test_pack.py b/p2pool/test/util/test_pack.py new file mode 100644 index 00000000..07fad9b5 --- /dev/null +++ b/p2pool/test/util/test_pack.py @@ -0,0 +1,11 @@ +import unittest + +from p2pool.util import pack + +class Test(unittest.TestCase): + def test_VarInt(self): + t = pack.VarIntType() + for i in xrange(2**20): + assert t.unpack(t.pack(i)) == i + for i in xrange(2**36, 2**36+25): + assert t.unpack(t.pack(i)) == i diff --git a/p2pool/test/util/test_skiplist.py b/p2pool/test/util/test_skiplist.py new file mode 100644 index 00000000..e09f6695 --- /dev/null +++ b/p2pool/test/util/test_skiplist.py @@ -0,0 +1,22 @@ +from p2pool.util import skiplist + +class NotSkipList(object): + def __call__(self, start, *args): + pos = start + sol = self.initial_solution(start, args) + while True: + decision = self.judge(sol, args) + if decision > 0: + raise AssertionError() + elif decision == 0: + return self.finalize(sol) + + delta = self.get_delta(pos) + sol = self.apply_delta(sol, delta, args) + + pos = self.previous(pos) + + def finalize(self, sol): + return sol + +skiplist.SkipList diff --git a/p2pool/util/__init__.py b/p2pool/util/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/p2pool/util/datachunker.py b/p2pool/util/datachunker.py new file mode 100644 index 00000000..c627a209 --- /dev/null +++ b/p2pool/util/datachunker.py @@ -0,0 +1,50 @@ +import collections + +class StringBuffer(object): + 'Buffer manager with great worst-case behavior' + + def __init__(self, data=''): + self.buf = collections.deque([data]) + self.buf_len = len(data) + self.pos = 0 + + def __len__(self): + return self.buf_len - self.pos + + def add(self, data): + self.buf.append(data) + self.buf_len += len(data) + + def get(self, wants): + if self.buf_len - self.pos < wants: + raise IndexError('not enough data') + data = [] + while wants: + seg = self.buf[0][self.pos:self.pos+wants] + self.pos += len(seg) + while self.buf and self.pos >= len(self.buf[0]): + x = self.buf.popleft() + self.buf_len -= len(x) + self.pos -= len(x) + + data.append(seg) + wants -= len(seg) + return ''.join(data) + +def _DataChunker(receiver): + wants = receiver.next() + buf = StringBuffer() + + while True: + if len(buf) >= wants: + wants = receiver.send(buf.get(wants)) + else: + buf.add((yield)) +def DataChunker(receiver): + ''' + Produces a function that accepts data that is input into a generator + (receiver) in response to the receiver yielding the size of data to wait on + ''' + x = _DataChunker(receiver) + x.next() + return x.send diff --git a/p2pool/util/deferral.py b/p2pool/util/deferral.py new file mode 100644 index 00000000..4d2ea472 --- /dev/null +++ b/p2pool/util/deferral.py @@ -0,0 +1,293 @@ +from __future__ import division + +import itertools +import random +import sys + +from twisted.internet import defer, reactor +from twisted.python import failure, log + +def sleep(t): + d = defer.Deferred(canceller=lambda d_: dc.cancel()) + dc = reactor.callLater(t, d.callback, None) + return d + +def run_repeatedly(f, *args, **kwargs): + current_dc = [None] + def step(): + delay = f(*args, **kwargs) + current_dc[0] = reactor.callLater(delay, step) + step() + def stop(): + current_dc[0].cancel() + return stop + +class RetrySilentlyException(Exception): + pass + +def retry(message='Error:', delay=3, max_retries=None, traceback=True): + ''' + @retry('Error getting block:', 1) + @defer.inlineCallbacks + def get_block(hash): + ... + ''' + + def retry2(func): + @defer.inlineCallbacks + def f(*args, **kwargs): + for i in itertools.count(): + try: + result = yield func(*args, **kwargs) + except Exception, e: + if i == max_retries: + raise + if not isinstance(e, RetrySilentlyException): + if traceback: + log.err(None, message) + else: + print >>sys.stderr, message, e + yield sleep(delay) + else: + defer.returnValue(result) + return f + return retry2 + +class ReplyMatcher(object): + ''' + Converts request/got response interface to deferred interface + ''' + + def __init__(self, func, timeout=5): + self.func = func + self.timeout = timeout + self.map = {} + + def __call__(self, id): + if id not in self.map: + self.func(id) + df = defer.Deferred() + def timeout(): + self.map[id].remove((df, timer)) + if not self.map[id]: + del self.map[id] + df.errback(failure.Failure(defer.TimeoutError('in ReplyMatcher'))) + timer = reactor.callLater(self.timeout, timeout) + self.map.setdefault(id, set()).add((df, timer)) + return df + + def got_response(self, id, resp): + if id not in self.map: + return + for df, timer in self.map.pop(id): + df.callback(resp) + timer.cancel() + +class GenericDeferrer(object): + ''' + Converts query with identifier/got response interface to deferred interface + ''' + + def __init__(self, max_id, func, timeout=5, on_timeout=lambda: None): + self.max_id = max_id + self.func = func + self.timeout = timeout + self.on_timeout = on_timeout + self.map = {} + + def __call__(self, *args, **kwargs): + while True: + id = random.randrange(self.max_id) + if id not in self.map: + break + def cancel(df): + df, timer = self.map.pop(id) + timer.cancel() + try: + df = defer.Deferred(cancel) + except TypeError: + df = defer.Deferred() # handle older versions of Twisted + def timeout(): + self.map.pop(id) + df.errback(failure.Failure(defer.TimeoutError('in GenericDeferrer'))) + self.on_timeout() + timer = reactor.callLater(self.timeout, timeout) + self.map[id] = df, timer + self.func(id, *args, **kwargs) + return df + + def got_response(self, id, resp): + if id not in self.map: + return + df, timer = self.map.pop(id) + timer.cancel() + df.callback(resp) + + def respond_all(self, resp): + while self.map: + id, (df, timer) = self.map.popitem() + timer.cancel() + df.errback(resp) + +class NotNowError(Exception): + pass + +class DeferredCacher(object): + ''' + like memoize, but for functions that return Deferreds + + @DeferredCacher + def f(x): + ... + return df + + @DeferredCacher.with_backing(bsddb.hashopen(...)) + def f(x): + ... + return df + ''' + + @classmethod + def with_backing(cls, backing): + return lambda func: cls(func, backing) + + def __init__(self, func, backing=None): + if backing is None: + backing = {} + + self.func = func + self.backing = backing + self.waiting = {} + + @defer.inlineCallbacks + def __call__(self, key): + if key in self.waiting: + yield self.waiting[key] + + if key in self.backing: + defer.returnValue(self.backing[key]) + else: + self.waiting[key] = defer.Deferred() + try: + value = yield self.func(key) + finally: + self.waiting.pop(key).callback(None) + + self.backing[key] = value + defer.returnValue(value) + + _nothing = object() + def call_now(self, key, default=_nothing): + if key in self.backing: + return self.backing[key] + if key not in self.waiting: + self.waiting[key] = defer.Deferred() + def cb(value): + self.backing[key] = value + self.waiting.pop(key).callback(None) + def eb(fail): + self.waiting.pop(key).callback(None) + if fail.check(RetrySilentlyException): + return + print + print 'Error when requesting noncached value:' + fail.printTraceback() + print + self.func(key).addCallback(cb).addErrback(eb) + if default is not self._nothing: + return default + raise NotNowError(key) + +def deferred_has_been_called(df): + still_running = True + res2 = [] + def cb(res): + if still_running: + res2[:] = [res] + else: + return res + df.addBoth(cb) + still_running = False + if res2: + return True, res2[0] + return False, None +def inlineCallbacks(f): + from functools import wraps + @wraps(f) + def _(*args, **kwargs): + gen = f(*args, **kwargs) + stop_running = [False] + def cancelled(df_): + assert df_ is df + stop_running[0] = True + if currently_waiting_on: + currently_waiting_on[0].cancel() + df = defer.Deferred(cancelled) + currently_waiting_on = [] + def it(cur): + while True: + try: + if isinstance(cur, failure.Failure): + res = cur.throwExceptionIntoGenerator(gen) # external code is run here + else: + res = gen.send(cur) # external code is run here + if stop_running[0]: + return + except StopIteration: + df.callback(None) + except defer._DefGen_Return as e: + # XXX should make sure direct child threw + df.callback(e.value) + except: + df.errback() + else: + if isinstance(res, defer.Deferred): + called, res2 = deferred_has_been_called(res) + if called: + cur = res2 + continue + else: + currently_waiting_on[:] = [res] + def gotResult(res2): + assert currently_waiting_on[0] is res + currently_waiting_on[:] = [] + if stop_running[0]: + return + it(res2) + res.addBoth(gotResult) # external code is run between this and gotResult + else: + cur = res + continue + break + it(None) + return df + return _ + + + +class RobustLoopingCall(object): + def __init__(self, func, *args, **kwargs): + self.func, self.args, self.kwargs = func, args, kwargs + + self.running = False + + def start(self, period): + assert not self.running + self.running = True + self._df = self._worker(period).addErrback(lambda fail: fail.trap(defer.CancelledError)) + + @inlineCallbacks + def _worker(self, period): + assert self.running + while self.running: + try: + self.func(*self.args, **self.kwargs) + except: + log.err() + yield sleep(period) + + def stop(self): + assert self.running + self.running = False + self._df.cancel() + return self._df diff --git a/p2pool/util/deferred_resource.py b/p2pool/util/deferred_resource.py new file mode 100644 index 00000000..a5537b86 --- /dev/null +++ b/p2pool/util/deferred_resource.py @@ -0,0 +1,25 @@ +from __future__ import division + +from twisted.internet import defer +from twisted.web import resource, server +from twisted.python import log + +class DeferredResource(resource.Resource): + def render(self, request): + def finish(x): + if request.channel is None: # disconnected + return + if x is not None: + request.write(x) + request.finish() + + def finish_error(fail): + if request.channel is None: # disconnected + return + request.setResponseCode(500) # won't do anything if already written to + request.write('---ERROR---') + request.finish() + log.err(fail, "Error in DeferredResource handler:") + + defer.maybeDeferred(resource.Resource.render, self, request).addCallbacks(finish, finish_error) + return server.NOT_DONE_YET diff --git a/p2pool/util/expiring_dict.py b/p2pool/util/expiring_dict.py new file mode 100644 index 00000000..8a3c9eed --- /dev/null +++ b/p2pool/util/expiring_dict.py @@ -0,0 +1,180 @@ +from __future__ import division + +import time +import weakref + +from p2pool.util import deferral + +class Node(object): + def __init__(self, contents, prev=None, next=None): + self.contents, self.prev, self.next = contents, prev, next + + def insert_before(self, contents): + self.prev.next = self.prev = node = Node(contents, self.prev, self) + return node + + def insert_after(self, contents): + self.next.prev = self.next = node = Node(contents, self, self.next) + return node + + @staticmethod + def connect(prev, next): + if prev.next is not None or next.prev is not None: + raise ValueError('node already connected') + prev.next, next.prev = next, prev + + def replace(self, contents): + self.contents = contents + + def delete(self): + if self.prev.next is None or self.next.prev is None: + raise ValueError('node not connected') + self.prev.next, self.next.prev = self.next, self.prev + self.next = self.prev = None + + +class LinkedList(object): + def __init__(self, iterable=[]): + self.start, self.end = Node(None), Node(None) + Node.connect(self.start, self.end) + + for item in iterable: + self.append(item) + + def __repr__(self): + return 'LinkedList(%r)' % (list(self),) + + def __len__(self): + return sum(1 for x in self) + + def __iter__(self): + cur = self.start.next + while cur is not self.end: + cur2 = cur + cur = cur.next + yield cur2 # in case cur is deleted, but items inserted after are ignored + + def __reversed__(self): + cur = self.end.prev + while cur is not self.start: + cur2 = cur + cur = cur.prev + yield cur2 + + def __getitem__(self, index): + if index < 0: + cur = self.end + for i in xrange(-index): + cur = cur.prev + if cur is self.start: + raise IndexError('index out of range') + else: + cur = self.start + for i in xrange(index + 1): + cur = cur.next + if cur is self.end: + raise IndexError('index out of range') + return cur + + def appendleft(self, item): + return self.start.insert_after(item) + + def append(self, item): + return self.end.insert_before(item) + + def popleft(self): + node = self.start.next + if node is self.end: + raise IndexError('popleft from empty') + node.delete() + return node.contents + + def pop(self): + node = self.end.prev + if node is self.start: + raise IndexError('pop from empty') + node.delete() + return node.contents + + +class ExpiringDict(object): + def __init__(self, expiry_time, get_touches=True): + self.expiry_time = expiry_time + self.get_touches = get_touches + + self.expiry_deque = LinkedList() + self.d = dict() # key -> node, value + + self_ref = weakref.ref(self, lambda _: expire_loop.stop() if expire_loop.running else None) + self._expire_loop = expire_loop = deferral.RobustLoopingCall(lambda: self_ref().expire()) + expire_loop.start(1) + + def stop(self): + self._expire_loop.stop() + + def __repr__(self): + return 'ExpiringDict' + repr(self.__dict__) + + def __len__(self): + return len(self.d) + + _nothing = object() + def touch(self, key, value=_nothing): + 'Updates expiry node, optionally replacing value, returning new value' + if value is self._nothing or key in self.d: + node, old_value = self.d[key] + node.delete() + + new_value = old_value if value is self._nothing else value + self.d[key] = self.expiry_deque.append((time.time() + self.expiry_time, key)), new_value + return new_value + + def expire(self): + t = time.time() + for node in self.expiry_deque: + timestamp, key = node.contents + if timestamp > t: + break + del self.d[key] + node.delete() + + def __contains__(self, key): + return key in self.d + + def __getitem__(self, key): + if self.get_touches: + value = self.touch(key) + else: + node, value = self.d[key] + return value + + def __setitem__(self, key, value): + self.touch(key, value) + + def __delitem__(self, key): + node, value = self.d.pop(key) + node.delete() + + def get(self, key, default_value=None): + if key in self.d: + res = self[key] + else: + res = default_value + return res + + def setdefault(self, key, default_value): + if key in self.d: + return self[key] + else: + self[key] = default_value + return default_value + + def keys(self): + return self.d.keys() + + def values(self): + return [value for node, value in self.d.itervalues()] + + def itervalues(self): + for node, value in self.d.itervalues(): + yield value diff --git a/p2pool/util/fixargparse.py b/p2pool/util/fixargparse.py new file mode 100644 index 00000000..582f17eb --- /dev/null +++ b/p2pool/util/fixargparse.py @@ -0,0 +1,43 @@ +from __future__ import absolute_import + +import argparse +import sys + + +class FixedArgumentParser(argparse.ArgumentParser): + ''' + fixes argparse's handling of empty string arguments +and changes @filename behaviour to accept multiple arguments on each line + ''' + + def _read_args_from_files(self, arg_strings): + # expand arguments referencing files + new_arg_strings = [] + for arg_string in arg_strings: + + # for regular arguments, just add them back into the list + if not arg_string or arg_string[0] not in self.fromfile_prefix_chars: + new_arg_strings.append(arg_string) + + # replace arguments referencing files with the file content + else: + try: + args_file = open(arg_string[1:]) + try: + arg_strings = [] + for arg_line in args_file.read().splitlines(): + for arg in self.convert_arg_line_to_args(arg_line): + arg_strings.append(arg) + arg_strings = self._read_args_from_files(arg_strings) + new_arg_strings.extend(arg_strings) + finally: + args_file.close() + except IOError: + err = sys.exc_info()[1] + self.error(str(err)) + + # return the modified argument list + return new_arg_strings + + def convert_arg_line_to_args(self, arg_line): + return [arg for arg in arg_line.split() if arg.strip()] diff --git a/p2pool/util/forest.py b/p2pool/util/forest.py new file mode 100644 index 00000000..057c6b8b --- /dev/null +++ b/p2pool/util/forest.py @@ -0,0 +1,361 @@ +''' +forest data structure +''' + +import itertools + +from p2pool.util import skiplist, variable + + +class TrackerSkipList(skiplist.SkipList): + def __init__(self, tracker): + skiplist.SkipList.__init__(self) + self.tracker = tracker + + self.tracker.removed.watch_weakref(self, lambda self, item: self.forget_item(item.hash)) + + def previous(self, element): + return self.tracker._delta_type.from_element(self.tracker.items[element]).tail + + +class DistanceSkipList(TrackerSkipList): + def get_delta(self, element): + return element, 1, self.previous(element) + + def combine_deltas(self, (from_hash1, dist1, to_hash1), (from_hash2, dist2, to_hash2)): + if to_hash1 != from_hash2: + raise AssertionError() + return from_hash1, dist1 + dist2, to_hash2 + + def initial_solution(self, start, (n,)): + return 0, start + + def apply_delta(self, (dist1, to_hash1), (from_hash2, dist2, to_hash2), (n,)): + if to_hash1 != from_hash2: + raise AssertionError() + return dist1 + dist2, to_hash2 + + def judge(self, (dist, hash), (n,)): + if dist > n: + return 1 + elif dist == n: + return 0 + else: + return -1 + + def finalize(self, (dist, hash), (n,)): + assert dist == n + return hash + +def get_attributedelta_type(attrs): # attrs: {name: func} + class ProtoAttributeDelta(object): + __slots__ = ['head', 'tail'] + attrs.keys() + + @classmethod + def get_none(cls, element_id): + return cls(element_id, element_id, **dict((k, 0) for k in attrs)) + + @classmethod + def from_element(cls, item): + return cls(item.hash, item.previous_hash, **dict((k, v(item)) for k, v in attrs.iteritems())) + + @staticmethod + def get_head(item): + return item.hash + + @staticmethod + def get_tail(item): + return item.previous_hash + + def __init__(self, head, tail, **kwargs): + self.head, self.tail = head, tail + for k, v in kwargs.iteritems(): + setattr(self, k, v) + + def __add__(self, other): + assert self.tail == other.head + return self.__class__(self.head, other.tail, **dict((k, getattr(self, k) + getattr(other, k)) for k in attrs)) + + def __sub__(self, other): + if self.head == other.head: + return self.__class__(other.tail, self.tail, **dict((k, getattr(self, k) - getattr(other, k)) for k in attrs)) + elif self.tail == other.tail: + return self.__class__(self.head, other.head, **dict((k, getattr(self, k) - getattr(other, k)) for k in attrs)) + else: + raise AssertionError() + + def __repr__(self): + return '%s(%r, %r%s)' % (self.__class__, self.head, self.tail, ''.join(', %s=%r' % (k, getattr(self, k)) for k in attrs)) + ProtoAttributeDelta.attrs = attrs + return ProtoAttributeDelta + +AttributeDelta = get_attributedelta_type(dict( + height=lambda item: 1, +)) + +class TrackerView(object): + def __init__(self, tracker, delta_type): + self._tracker = tracker + self._delta_type = delta_type + + self._deltas = {} # item_hash -> delta, ref + self._reverse_deltas = {} # ref -> set of item_hashes + + self._ref_generator = itertools.count() + self._delta_refs = {} # ref -> delta + self._reverse_delta_refs = {} # delta.tail -> ref + + self._tracker.remove_special.watch_weakref(self, lambda self, item: self._handle_remove_special(item)) + self._tracker.remove_special2.watch_weakref(self, lambda self, item: self._handle_remove_special2(item)) + self._tracker.removed.watch_weakref(self, lambda self, item: self._handle_removed(item)) + + def _handle_remove_special(self, item): + delta = self._delta_type.from_element(item) + + if delta.tail not in self._reverse_delta_refs: + return + + # move delta refs referencing children down to this, so they can be moved up in one step + for x in list(self._reverse_deltas.get(self._reverse_delta_refs.get(delta.head, object()), set())): + self.get_last(x) + + assert delta.head not in self._reverse_delta_refs, list(self._reverse_deltas.get(self._reverse_delta_refs.get(delta.head, object()), set())) + + if delta.tail not in self._reverse_delta_refs: + return + + # move ref pointing to this up + + ref = self._reverse_delta_refs[delta.tail] + cur_delta = self._delta_refs[ref] + assert cur_delta.tail == delta.tail + self._delta_refs[ref] = cur_delta - delta + assert self._delta_refs[ref].tail == delta.head + del self._reverse_delta_refs[delta.tail] + self._reverse_delta_refs[delta.head] = ref + + def _handle_remove_special2(self, item): + delta = self._delta_type.from_element(item) + + if delta.tail not in self._reverse_delta_refs: + return + + ref = self._reverse_delta_refs.pop(delta.tail) + del self._delta_refs[ref] + + for x in self._reverse_deltas.pop(ref): + del self._deltas[x] + + def _handle_removed(self, item): + delta = self._delta_type.from_element(item) + + # delete delta entry and ref if it is empty + if delta.head in self._deltas: + delta1, ref = self._deltas.pop(delta.head) + self._reverse_deltas[ref].remove(delta.head) + if not self._reverse_deltas[ref]: + del self._reverse_deltas[ref] + delta2 = self._delta_refs.pop(ref) + del self._reverse_delta_refs[delta2.tail] + + + def get_height(self, item_hash): + return self.get_delta_to_last(item_hash).height + + def get_work(self, item_hash): + return self.get_delta_to_last(item_hash).work + + def get_last(self, item_hash): + return self.get_delta_to_last(item_hash).tail + + def get_height_and_last(self, item_hash): + delta = self.get_delta_to_last(item_hash) + return delta.height, delta.tail + + def _get_delta(self, item_hash): + if item_hash in self._deltas: + delta1, ref = self._deltas[item_hash] + delta2 = self._delta_refs[ref] + res = delta1 + delta2 + else: + res = self._delta_type.from_element(self._tracker.items[item_hash]) + assert res.head == item_hash + return res + + def _set_delta(self, item_hash, delta): + other_item_hash = delta.tail + if other_item_hash not in self._reverse_delta_refs: + ref = self._ref_generator.next() + assert ref not in self._delta_refs + self._delta_refs[ref] = self._delta_type.get_none(other_item_hash) + self._reverse_delta_refs[other_item_hash] = ref + del ref + + ref = self._reverse_delta_refs[other_item_hash] + ref_delta = self._delta_refs[ref] + assert ref_delta.tail == other_item_hash + + if item_hash in self._deltas: + prev_ref = self._deltas[item_hash][1] + self._reverse_deltas[prev_ref].remove(item_hash) + if not self._reverse_deltas[prev_ref] and prev_ref != ref: + self._reverse_deltas.pop(prev_ref) + x = self._delta_refs.pop(prev_ref) + self._reverse_delta_refs.pop(x.tail) + self._deltas[item_hash] = delta - ref_delta, ref + self._reverse_deltas.setdefault(ref, set()).add(item_hash) + + def get_delta_to_last(self, item_hash): + assert isinstance(item_hash, (int, long, type(None))) + delta = self._delta_type.get_none(item_hash) + updates = [] + while delta.tail in self._tracker.items: + updates.append((delta.tail, delta)) + this_delta = self._get_delta(delta.tail) + delta += this_delta + for update_hash, delta_then in updates: + self._set_delta(update_hash, delta - delta_then) + return delta + + def get_delta(self, item, ancestor): + assert self._tracker.is_child_of(ancestor, item) + return self.get_delta_to_last(item) - self.get_delta_to_last(ancestor) + +class Tracker(object): + def __init__(self, items=[], delta_type=AttributeDelta): + self.items = {} # hash -> item + self.reverse = {} # delta.tail -> set of item_hashes + + self.heads = {} # head hash -> tail_hash + self.tails = {} # tail hash -> set of head hashes + + self.added = variable.Event() + self.remove_special = variable.Event() + self.remove_special2 = variable.Event() + self.removed = variable.Event() + + self.get_nth_parent_hash = DistanceSkipList(self) + + self._delta_type = delta_type + self._default_view = TrackerView(self, delta_type) + + for item in items: + self.add(item) + + def __getattr__(self, name): + attr = getattr(self._default_view, name) + setattr(self, name, attr) + return attr + + def add(self, item): + assert not isinstance(item, (int, long, type(None))) + delta = self._delta_type.from_element(item) + + if delta.head in self.items: + raise ValueError('item already present') + + if delta.head in self.tails: + heads = self.tails.pop(delta.head) + else: + heads = set([delta.head]) + + if delta.tail in self.heads: + tail = self.heads.pop(delta.tail) + else: + tail = self.get_last(delta.tail) + + self.items[delta.head] = item + self.reverse.setdefault(delta.tail, set()).add(delta.head) + + self.tails.setdefault(tail, set()).update(heads) + if delta.tail in self.tails[tail]: + self.tails[tail].remove(delta.tail) + + for head in heads: + self.heads[head] = tail + + self.added.happened(item) + + def remove(self, item_hash): + assert isinstance(item_hash, (int, long, type(None))) + if item_hash not in self.items: + raise KeyError() + + item = self.items[item_hash] + del item_hash + + delta = self._delta_type.from_element(item) + + children = self.reverse.get(delta.head, set()) + + if delta.head in self.heads and delta.tail in self.tails: + tail = self.heads.pop(delta.head) + self.tails[tail].remove(delta.head) + if not self.tails[delta.tail]: + self.tails.pop(delta.tail) + elif delta.head in self.heads: + tail = self.heads.pop(delta.head) + self.tails[tail].remove(delta.head) + if self.reverse[delta.tail] != set([delta.head]): + pass # has sibling + else: + self.tails[tail].add(delta.tail) + self.heads[delta.tail] = tail + elif delta.tail in self.tails and len(self.reverse[delta.tail]) <= 1: + heads = self.tails.pop(delta.tail) + for head in heads: + self.heads[head] = delta.head + self.tails[delta.head] = set(heads) + + self.remove_special.happened(item) + elif delta.tail in self.tails and len(self.reverse[delta.tail]) > 1: + heads = [x for x in self.tails[delta.tail] if self.is_child_of(delta.head, x)] + self.tails[delta.tail] -= set(heads) + if not self.tails[delta.tail]: + self.tails.pop(delta.tail) + for head in heads: + self.heads[head] = delta.head + assert delta.head not in self.tails + self.tails[delta.head] = set(heads) + + self.remove_special2.happened(item) + else: + raise NotImplementedError() + + self.items.pop(delta.head) + self.reverse[delta.tail].remove(delta.head) + if not self.reverse[delta.tail]: + self.reverse.pop(delta.tail) + + self.removed.happened(item) + + def get_chain(self, start_hash, length): + assert length <= self.get_height(start_hash) + for i in xrange(length): + item = self.items[start_hash] + yield item + start_hash = self._delta_type.get_tail(item) + + def is_child_of(self, item_hash, possible_child_hash): + height, last = self.get_height_and_last(item_hash) + child_height, child_last = self.get_height_and_last(possible_child_hash) + if child_last != last: + return None # not connected, so can't be determined + height_up = child_height - height + return height_up >= 0 and self.get_nth_parent_hash(possible_child_hash, height_up) == item_hash + +class SubsetTracker(Tracker): + def __init__(self, subset_of, **kwargs): + Tracker.__init__(self, **kwargs) + self.get_nth_parent_hash = subset_of.get_nth_parent_hash # overwrites Tracker.__init__'s + self._subset_of = subset_of + + def add(self, item): + if self._subset_of is not None: + assert self._delta_type.get_head(item) in self._subset_of.items + Tracker.add(self, item) + + def remove(self, item_hash): + if self._subset_of is not None: + assert item_hash in self._subset_of.items + Tracker.remove(self, item_hash) diff --git a/p2pool/util/graph.py b/p2pool/util/graph.py new file mode 100644 index 00000000..0c3adfca --- /dev/null +++ b/p2pool/util/graph.py @@ -0,0 +1,153 @@ +from __future__ import absolute_import +from __future__ import division + +import math + +from p2pool.util import math as math2 + + +class DataViewDescription(object): + def __init__(self, bin_count, total_width): + self.bin_count = bin_count + self.bin_width = total_width/bin_count + +def _shift(x, shift, pad_item): + left_pad = math2.clip(shift, (0, len(x))) + right_pad = math2.clip(-shift, (0, len(x))) + return [pad_item]*left_pad + x[right_pad:-left_pad if left_pad else None] + [pad_item]*right_pad + +combine_bins = math2.add_dicts_ext(lambda (a1, b1), (a2, b2): (a1+a2, b1+b2), (0, 0)) + +nothing = object() +def keep_largest(n, squash_key=nothing, key=lambda x: x, add_func=lambda a, b: a+b): + def _(d): + items = sorted(d.iteritems(), key=lambda (k, v): (k != squash_key, key(v)), reverse=True) + while len(items) > n: + k, v = items.pop() + if squash_key is not nothing: + items[-1] = squash_key, add_func(items[-1][1], v) + return dict(items) + return _ + +def _shift_bins_so_t_is_not_past_end(bins, last_bin_end, bin_width, t): + # returns new_bins, new_last_bin_end + shift = max(0, int(math.ceil((t - last_bin_end)/bin_width))) + return _shift(bins, shift, {}), last_bin_end + shift*bin_width + +class DataView(object): + def __init__(self, desc, ds_desc, last_bin_end, bins): + assert len(bins) == desc.bin_count + + self.desc = desc + self.ds_desc = ds_desc + self.last_bin_end = last_bin_end + self.bins = bins + + def _add_datum(self, t, value): + if not self.ds_desc.multivalues: + value = {'null': value} + elif self.ds_desc.multivalue_undefined_means_0 and 'null' not in value: + value = dict(value, null=0) # use null to hold sample counter + self.bins, self.last_bin_end = _shift_bins_so_t_is_not_past_end(self.bins, self.last_bin_end, self.desc.bin_width, t) + + bin = int(math.floor((self.last_bin_end - t)/self.desc.bin_width)) + assert bin >= 0 + if bin < self.desc.bin_count: + self.bins[bin] = self.ds_desc.keep_largest_func(combine_bins(self.bins[bin], dict((k, (v, 1)) for k, v in value.iteritems()))) + + def get_data(self, t): + bins, last_bin_end = _shift_bins_so_t_is_not_past_end(self.bins, self.last_bin_end, self.desc.bin_width, t) + assert last_bin_end - self.desc.bin_width <= t <= last_bin_end + + def _((i, bin)): + left, right = last_bin_end - self.desc.bin_width*(i + 1), min(t, last_bin_end - self.desc.bin_width*i) + center, width = (left+right)/2, right-left + if self.ds_desc.is_gauge and self.ds_desc.multivalue_undefined_means_0: + real_count = max([0] + [count for total, count in bin.itervalues()]) + if real_count == 0: + val = None + else: + val = dict((k, total/real_count) for k, (total, count) in bin.iteritems()) + default = 0 + elif self.ds_desc.is_gauge and not self.ds_desc.multivalue_undefined_means_0: + val = dict((k, total/count) for k, (total, count) in bin.iteritems()) + default = None + else: + val = dict((k, total/width) for k, (total, count) in bin.iteritems()) + default = 0 + if not self.ds_desc.multivalues: + val = None if val is None else val.get('null', default) + return center, val, width, default + return map(_, enumerate(bins)) + + +class DataStreamDescription(object): + def __init__(self, dataview_descriptions, is_gauge=True, multivalues=False, multivalues_keep=20, multivalues_squash_key=None, multivalue_undefined_means_0=False, default_func=None): + self.dataview_descriptions = dataview_descriptions + self.is_gauge = is_gauge + self.multivalues = multivalues + self.keep_largest_func = keep_largest(multivalues_keep, multivalues_squash_key, key=lambda (t, c): t/c if self.is_gauge else t, add_func=lambda (a1, b1), (a2, b2): (a1+a2, b1+b2)) + self.multivalue_undefined_means_0 = multivalue_undefined_means_0 + self.default_func = default_func + +class DataStream(object): + def __init__(self, desc, dataviews): + self.desc = desc + self.dataviews = dataviews + + def add_datum(self, t, value=1): + for dv_name, dv in self.dataviews.iteritems(): + dv._add_datum(t, value) + + +class HistoryDatabase(object): + @classmethod + def from_obj(cls, datastream_descriptions, obj={}): + def convert_bin(bin): + if isinstance(bin, dict): + return bin + total, count = bin + if not isinstance(total, dict): + total = {'null': total} + return dict((k, (v, count)) for k, v in total.iteritems()) if count else {} + def get_dataview(ds_name, ds_desc, dv_name, dv_desc): + if ds_name in obj: + ds_data = obj[ds_name] + if dv_name in ds_data: + dv_data = ds_data[dv_name] + if dv_data['bin_width'] == dv_desc.bin_width and len(dv_data['bins']) == dv_desc.bin_count: + return DataView(dv_desc, ds_desc, dv_data['last_bin_end'], map(convert_bin, dv_data['bins'])) + elif ds_desc.default_func is None: + return DataView(dv_desc, ds_desc, 0, dv_desc.bin_count*[{}]) + else: + return ds_desc.default_func(ds_name, ds_desc, dv_name, dv_desc, obj) + return cls(dict( + (ds_name, DataStream(ds_desc, dict( + (dv_name, get_dataview(ds_name, ds_desc, dv_name, dv_desc)) + for dv_name, dv_desc in ds_desc.dataview_descriptions.iteritems() + ))) + for ds_name, ds_desc in datastream_descriptions.iteritems() + )) + + def __init__(self, datastreams): + self.datastreams = datastreams + + def to_obj(self): + return dict((ds_name, dict((dv_name, dict(last_bin_end=dv.last_bin_end, bin_width=dv.desc.bin_width, bins=dv.bins)) + for dv_name, dv in ds.dataviews.iteritems())) for ds_name, ds in self.datastreams.iteritems()) + + +def make_multivalue_migrator(multivalue_keys, post_func=lambda bins: bins): + def _(ds_name, ds_desc, dv_name, dv_desc, obj): + if not obj: + last_bin_end = 0 + bins = dv_desc.bin_count*[{}] + else: + inputs = dict((k, obj.get(v, {dv_name: dict(bins=[{}]*dv_desc.bin_count, last_bin_end=0)})[dv_name]) for k, v in multivalue_keys.iteritems()) + last_bin_end = max(inp['last_bin_end'] for inp in inputs.itervalues()) if inputs else 0 + assert all(len(inp['bins']) == dv_desc.bin_count for inp in inputs.itervalues()) + inputs = dict((k, dict(zip(['bins', 'last_bin_end'], _shift_bins_so_t_is_not_past_end(v['bins'], v['last_bin_end'], dv_desc.bin_width, last_bin_end)))) for k, v in inputs.iteritems()) + assert len(set(inp['last_bin_end'] for inp in inputs.itervalues())) <= 1 + bins = post_func([dict((k, v['bins'][i]['null']) for k, v in inputs.iteritems() if 'null' in v['bins'][i]) for i in xrange(dv_desc.bin_count)]) + return DataView(dv_desc, ds_desc, last_bin_end, bins) + return _ diff --git a/p2pool/util/jsonrpc.py b/p2pool/util/jsonrpc.py new file mode 100644 index 00000000..d810adaa --- /dev/null +++ b/p2pool/util/jsonrpc.py @@ -0,0 +1,164 @@ +from __future__ import division + +import json +import weakref + +from twisted.internet import defer +from twisted.protocols import basic +from twisted.python import failure, log +from twisted.web import client, error + +from p2pool.util import deferral, deferred_resource, memoize + +class Error(Exception): + def __init__(self, code, message, data=None): + if type(self) is Error: + raise TypeError("can't directly instantiate Error class; use Error_for_code") + if not isinstance(code, int): + raise TypeError('code must be an int') + #if not isinstance(message, unicode): + # raise TypeError('message must be a unicode') + self.code, self.message, self.data = code, message, data + def __str__(self): + return '%i %s' % (self.code, self.message) + (' %r' % (self.data, ) if self.data is not None else '') + def _to_obj(self): + return { + 'code': self.code, + 'message': self.message, + 'data': self.data, + } + +@memoize.memoize_with_backing(weakref.WeakValueDictionary()) +def Error_for_code(code): + class NarrowError(Error): + def __init__(self, *args, **kwargs): + Error.__init__(self, code, *args, **kwargs) + return NarrowError + + +class Proxy(object): + def __init__(self, func, services=[]): + self._func = func + self._services = services + + def __getattr__(self, attr): + if attr.startswith('rpc_'): + return lambda *params: self._func('.'.join(self._services + [attr[len('rpc_'):]]), params) + elif attr.startswith('svc_'): + return Proxy(self._func, self._services + [attr[len('svc_'):]]) + else: + raise AttributeError('%r object has no attribute %r' % (self.__class__.__name__, attr)) + +@defer.inlineCallbacks +def _handle(data, provider, preargs=(), response_handler=None): + id_ = None + + try: + try: + try: + req = json.loads(data) + except Exception: + raise Error_for_code(-32700)(u'Parse error') + + if 'result' in req or 'error' in req: + response_handler(req['id'], req['result'] if 'error' not in req or req['error'] is None else + failure.Failure(Error_for_code(req['error']['code'])(req['error']['message'], req['error'].get('data', None)))) + defer.returnValue(None) + + id_ = req.get('id', None) + method = req.get('method', None) + if not isinstance(method, basestring): + raise Error_for_code(-32600)(u'Invalid Request') + params = req.get('params', []) + if not isinstance(params, list): + raise Error_for_code(-32600)(u'Invalid Request') + + for service_name in method.split('.')[:-1]: + provider = getattr(provider, 'svc_' + service_name, None) + if provider is None: + raise Error_for_code(-32601)(u'Service not found') + + method_meth = getattr(provider, 'rpc_' + method.split('.')[-1], None) + if method_meth is None: + raise Error_for_code(-32601)(u'Method not found') + + result = yield method_meth(*list(preargs) + list(params)) + error = None + except Error: + raise + except Exception: + log.err(None, 'Squelched JSON error:') + raise Error_for_code(-32099)(u'Unknown error') + except Error, e: + result = None + error = e._to_obj() + + defer.returnValue(json.dumps(dict( + jsonrpc='2.0', + id=id_, + result=result, + error=error, + ))) + +# HTTP + +@defer.inlineCallbacks +def _http_do(url, headers, timeout, method, params): + id_ = 0 + + try: + data = yield client.getPage( + url=url, + method='POST', + headers=dict(headers, **{'Content-Type': 'application/json'}), + postdata=json.dumps({ + 'jsonrpc': '2.0', + 'method': method, + 'params': params, + 'id': id_, + }), + timeout=timeout, + ) + except error.Error, e: + try: + resp = json.loads(e.response) + except: + raise e + else: + resp = json.loads(data) + + if resp['id'] != id_: + raise ValueError('invalid id') + if 'error' in resp and resp['error'] is not None: + raise Error_for_code(resp['error']['code'])(resp['error']['message'], resp['error'].get('data', None)) + defer.returnValue(resp['result']) +HTTPProxy = lambda url, headers={}, timeout=5: Proxy(lambda method, params: _http_do(url, headers, timeout, method, params)) + +class HTTPServer(deferred_resource.DeferredResource): + def __init__(self, provider): + deferred_resource.DeferredResource.__init__(self) + self._provider = provider + + @defer.inlineCallbacks + def render_POST(self, request): + data = yield _handle(request.content.read(), self._provider, preargs=[request]) + assert data is not None + request.setHeader('Content-Type', 'application/json') + request.setHeader('Content-Length', len(data)) + request.write(data) + +class LineBasedPeer(basic.LineOnlyReceiver): + delimiter = '\n' + + def __init__(self): + #basic.LineOnlyReceiver.__init__(self) + self._matcher = deferral.GenericDeferrer(max_id=2**30, func=lambda id, method, params: self.sendLine(json.dumps({ + 'jsonrpc': '2.0', + 'method': method, + 'params': params, + 'id': id, + }))) + self.other = Proxy(self._matcher) + + def lineReceived(self, line): + _handle(line, self, response_handler=self._matcher.got_response).addCallback(lambda line2: self.sendLine(line2) if line2 is not None else None) diff --git a/p2pool/util/logging.py b/p2pool/util/logging.py new file mode 100644 index 00000000..698a39de --- /dev/null +++ b/p2pool/util/logging.py @@ -0,0 +1,103 @@ +import codecs +import datetime +import os +import sys + +from twisted.python import log + +class EncodeReplacerPipe(object): + def __init__(self, inner_file): + self.inner_file = inner_file + self.softspace = 0 + def write(self, data): + if isinstance(data, unicode): + try: + data = data.encode(self.inner_file.encoding, 'replace') + except: + data = data.encode('ascii', 'replace') + self.inner_file.write(data) + def flush(self): + self.inner_file.flush() + +class LogFile(object): + def __init__(self, filename): + self.filename = filename + self.inner_file = None + self.reopen() + def reopen(self): + if self.inner_file is not None: + self.inner_file.close() + open(self.filename, 'a').close() + f = open(self.filename, 'rb') + f.seek(0, os.SEEK_END) + length = f.tell() + if length > 100*1000*1000: + f.seek(-1000*1000, os.SEEK_END) + while True: + if f.read(1) in ('', '\n'): + break + data = f.read() + f.close() + f = open(self.filename, 'wb') + f.write(data) + f.close() + self.inner_file = codecs.open(self.filename, 'a', 'utf-8') + def write(self, data): + self.inner_file.write(data) + def flush(self): + self.inner_file.flush() + +class TeePipe(object): + def __init__(self, outputs): + self.outputs = outputs + def write(self, data): + for output in self.outputs: + output.write(data) + def flush(self): + for output in self.outputs: + output.flush() + +class TimestampingPipe(object): + def __init__(self, inner_file): + self.inner_file = inner_file + self.buf = '' + self.softspace = 0 + def write(self, data): + buf = self.buf + data + lines = buf.split('\n') + for line in lines[:-1]: + self.inner_file.write('%s %s\n' % (datetime.datetime.now(), line)) + self.inner_file.flush() + self.buf = lines[-1] + def flush(self): + pass + +class AbortPipe(object): + def __init__(self, inner_file): + self.inner_file = inner_file + self.softspace = 0 + def write(self, data): + try: + self.inner_file.write(data) + except: + sys.stdout = sys.__stdout__ + log.DefaultObserver.stderr = sys.stderr = sys.__stderr__ + raise + def flush(self): + self.inner_file.flush() + +class PrefixPipe(object): + def __init__(self, inner_file, prefix): + self.inner_file = inner_file + self.prefix = prefix + self.buf = '' + self.softspace = 0 + def write(self, data): + buf = self.buf + data + lines = buf.split('\n') + for line in lines[:-1]: + self.inner_file.write(self.prefix + line + '\n') + self.inner_file.flush() + self.buf = lines[-1] + def flush(self): + pass diff --git a/p2pool/util/math.py b/p2pool/util/math.py new file mode 100644 index 00000000..71b5dec5 --- /dev/null +++ b/p2pool/util/math.py @@ -0,0 +1,243 @@ +from __future__ import absolute_import, division + +import __builtin__ +import math +import random +import time + +def median(x, use_float=True): + # there exist better algorithms... + y = sorted(x) + if not y: + raise ValueError('empty sequence!') + left = (len(y) - 1)//2 + right = len(y)//2 + sum = y[left] + y[right] + if use_float: + return sum/2 + else: + return sum//2 + +def mean(x): + total = 0 + count = 0 + for y in x: + total += y + count += 1 + return total/count + +def shuffled(x): + x = list(x) + random.shuffle(x) + return x + +def shift_left(n, m): + # python: :( + if m >= 0: + return n << m + return n >> -m + +def clip(x, (low, high)): + if x < low: + return low + elif x > high: + return high + else: + return x + +add_to_range = lambda x, (low, high): (min(low, x), max(high, x)) + +def nth(i, n=0): + i = iter(i) + for _ in xrange(n): + i.next() + return i.next() + +def geometric(p): + if p <= 0 or p > 1: + raise ValueError('p must be in the interval (0.0, 1.0]') + if p == 1: + return 1 + return int(math.log1p(-random.random()) / math.log1p(-p)) + 1 + +def add_dicts_ext(add_func=lambda a, b: a+b, zero=0): + def add_dicts(*dicts): + res = {} + for d in dicts: + for k, v in d.iteritems(): + res[k] = add_func(res.get(k, zero), v) + return dict((k, v) for k, v in res.iteritems() if v != zero) + return add_dicts +add_dicts = add_dicts_ext() + +mult_dict = lambda c, x: dict((k, c*v) for k, v in x.iteritems()) + +def format(x): + prefixes = 'kMGTPEZY' + count = 0 + while x >= 100000 and count < len(prefixes) - 2: + x = x//1000 + count += 1 + s = '' if count == 0 else prefixes[count - 1] + return '%i' % (x,) + s + +def format_dt(dt): + for value, name in [ + (365.2425*60*60*24, 'years'), + (60*60*24, 'days'), + (60*60, 'hours'), + (60, 'minutes'), + (1, 'seconds'), + ]: + if dt > value: + break + return '%.01f %s' % (dt/value, name) + +perfect_round = lambda x: int(x + random.random()) + +def erf(x): + # save the sign of x + sign = 1 + if x < 0: + sign = -1 + x = abs(x) + + # constants + a1 = 0.254829592 + a2 = -0.284496736 + a3 = 1.421413741 + a4 = -1.453152027 + a5 = 1.061405429 + p = 0.3275911 + + # A&S formula 7.1.26 + t = 1.0/(1.0 + p*x) + y = 1.0 - (((((a5*t + a4)*t) + a3)*t + a2)*t + a1)*t*math.exp(-x*x) + return sign*y # erf(-x) = -erf(x) + +def find_root(y_over_dy, start, steps=10, bounds=(None, None)): + guess = start + for i in xrange(steps): + prev, guess = guess, guess - y_over_dy(guess) + if bounds[0] is not None and guess < bounds[0]: guess = bounds[0] + if bounds[1] is not None and guess > bounds[1]: guess = bounds[1] + if guess == prev: + break + return guess + +def ierf(z): + return find_root(lambda x: (erf(x) - z)/(2*math.e**(-x**2)/math.sqrt(math.pi)), 0) + +def binomial_conf_interval(x, n, conf=0.95): + assert 0 <= x <= n and 0 <= conf < 1 + if n == 0: + left = random.random()*(1 - conf) + return left, left + conf + # approximate - Wilson score interval + z = math.sqrt(2)*ierf(conf) + p = x/n + topa = p + z**2/2/n + topb = z * math.sqrt(p*(1-p)/n + z**2/4/n**2) + bottom = 1 + z**2/n + return [clip(x, (0, 1)) for x in add_to_range(x/n, [(topa - topb)/bottom, (topa + topb)/bottom])] + +minmax = lambda x: (min(x), max(x)) + +def format_binomial_conf(x, n, conf=0.95, f=lambda x: x): + if n == 0: + return '???' + left, right = minmax(map(f, binomial_conf_interval(x, n, conf))) + return '~%.1f%% (%.f-%.f%%)' % (100*f(x/n), math.floor(100*left), math.ceil(100*right)) + +def reversed(x): + try: + return __builtin__.reversed(x) + except TypeError: + return reversed(list(x)) + +class Object(object): + def __init__(self, **kwargs): + for k, v in kwargs.iteritems(): + setattr(self, k, v) + +def add_tuples(res, *tuples): + for t in tuples: + if len(t) != len(res): + raise ValueError('tuples must all be the same length') + res = tuple(a + b for a, b in zip(res, t)) + return res + +def flatten_linked_list(x): + while x is not None: + x, cur = x + yield cur + +def weighted_choice(choices): + choices = list((item, weight) for item, weight in choices) + target = random.randrange(sum(weight for item, weight in choices)) + for item, weight in choices: + if weight > target: + return item + target -= weight + raise AssertionError() + +def natural_to_string(n, alphabet=None): + if n < 0: + raise TypeError('n must be a natural') + if alphabet is None: + s = ('%x' % (n,)).lstrip('0') + if len(s) % 2: + s = '0' + s + return s.decode('hex') + else: + assert len(set(alphabet)) == len(alphabet) + res = [] + while n: + n, x = divmod(n, len(alphabet)) + res.append(alphabet[x]) + res.reverse() + return ''.join(res) + +def string_to_natural(s, alphabet=None): + if alphabet is None: + assert not s.startswith('\x00') + return int(s.encode('hex'), 16) if s else 0 + else: + assert len(set(alphabet)) == len(alphabet) + assert not s.startswith(alphabet[0]) + return sum(alphabet.index(char) * len(alphabet)**i for i, char in enumerate(reversed(s))) + +class RateMonitor(object): + def __init__(self, max_lookback_time): + self.max_lookback_time = max_lookback_time + + self.datums = [] + self.first_timestamp = None + + def _prune(self): + start_time = time.time() - self.max_lookback_time + for i, (ts, datum) in enumerate(self.datums): + if ts > start_time: + self.datums[:] = self.datums[i:] + return + + def get_datums_in_last(self, dt=None): + if dt is None: + dt = self.max_lookback_time + assert dt <= self.max_lookback_time + self._prune() + now = time.time() + return [datum for ts, datum in self.datums if ts > now - dt], min(dt, now - self.first_timestamp) if self.first_timestamp is not None else 0 + + def add_datum(self, datum): + self._prune() + t = time.time() + if self.first_timestamp is None: + self.first_timestamp = t + else: + self.datums.append((t, datum)) + +def merge_dicts(*dicts): + res = {} + for d in dicts: res.update(d) + return res diff --git a/p2pool/util/memoize.py b/p2pool/util/memoize.py new file mode 100644 index 00000000..bf0fafc1 --- /dev/null +++ b/p2pool/util/memoize.py @@ -0,0 +1,67 @@ +import itertools + +class LRUDict(object): + def __init__(self, n): + self.n = n + self.inner = {} + self.counter = itertools.count() + def get(self, key, default=None): + if key in self.inner: + x, value = self.inner[key] + self.inner[key] = self.counter.next(), value + return value + return default + def __setitem__(self, key, value): + self.inner[key] = self.counter.next(), value + while len(self.inner) > self.n: + self.inner.pop(min(self.inner, key=lambda k: self.inner[k][0])) + +_nothing = object() + +def memoize_with_backing(backing, has_inverses=set()): + def a(f): + def b(*args): + res = backing.get((f, args), _nothing) + if res is not _nothing: + return res + + res = f(*args) + + backing[(f, args)] = res + for inverse in has_inverses: + backing[(inverse, args[:-1] + (res,))] = args[-1] + + return res + return b + return a + +def memoize(f): + return memoize_with_backing({})(f) + + +class cdict(dict): + def __init__(self, func): + dict.__init__(self) + self._func = func + + def __missing__(self, key): + value = self._func(key) + self[key] = value + return value + +def fast_memoize_single_arg(func): + return cdict(func).__getitem__ + +class cdict2(dict): + def __init__(self, func): + dict.__init__(self) + self._func = func + + def __missing__(self, key): + value = self._func(*key) + self[key] = value + return value + +def fast_memoize_multiple_args(func): + f = cdict2(func).__getitem__ + return lambda *args: f(args) diff --git a/p2pool/util/memory.py b/p2pool/util/memory.py new file mode 100644 index 00000000..ef2ce8cd --- /dev/null +++ b/p2pool/util/memory.py @@ -0,0 +1,19 @@ +import os +import platform + +_scale = {'kB': 1024, 'mB': 1024*1024, + 'KB': 1024, 'MB': 1024*1024} + +def resident(): + if platform.system() == 'Windows': + from wmi import WMI + w = WMI('.') + result = w.query("SELECT WorkingSet FROM Win32_PerfRawData_PerfProc_Process WHERE IDProcess=%d" % os.getpid()) + return int(result[0].WorkingSet) + else: + with open('/proc/%d/status' % os.getpid()) as f: + v = f.read() + i = v.index('VmRSS:') + v = v[i:].split(None, 3) + #assert len(v) == 3, v + return float(v[1]) * _scale[v[2]] diff --git a/p2pool/util/p2protocol.py b/p2pool/util/p2protocol.py new file mode 100644 index 00000000..6e8634e6 --- /dev/null +++ b/p2pool/util/p2protocol.py @@ -0,0 +1,104 @@ +''' +Generic message-based protocol used by Bitcoin and P2Pool for P2P communication +''' + +import hashlib +import struct + +from twisted.internet import protocol +from twisted.python import log + +import p2pool +from p2pool.util import datachunker, variable + +class TooLong(Exception): + pass + +class Protocol(protocol.Protocol): + def __init__(self, message_prefix, max_payload_length, traffic_happened=variable.Event(), ignore_trailing_payload=False): + self._message_prefix = message_prefix + self._max_payload_length = max_payload_length + self.dataReceived2 = datachunker.DataChunker(self.dataReceiver()) + self.traffic_happened = traffic_happened + self.ignore_trailing_payload = ignore_trailing_payload + + def dataReceived(self, data): + self.traffic_happened.happened('p2p/in', len(data)) + self.dataReceived2(data) + + def dataReceiver(self): + while True: + start = '' + while start != self._message_prefix: + start = (start + (yield 1))[-len(self._message_prefix):] + + command = (yield 12).rstrip('\0') + length, = struct.unpack(' self._max_payload_length: + print 'length too large' + continue + checksum = yield 4 + payload = yield length + + if hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4] != checksum: + print 'invalid hash for', self.transport.getPeer().host, repr(command), length, checksum.encode('hex') + if p2pool.DEBUG: + print hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4].encode('hex'), payload.encode('hex') + self.badPeerHappened() + continue + + type_ = getattr(self, 'message_' + command, None) + if type_ is None: + if p2pool.DEBUG: + print 'no type for', repr(command) + continue + + try: + self.packetReceived(command, type_.unpack(payload, self.ignore_trailing_payload)) + except: + print 'RECV', command, payload[:100].encode('hex') + ('...' if len(payload) > 100 else '') + log.err(None, 'Error handling message: (see RECV line)') + self.disconnect() + + def packetReceived(self, command, payload2): + handler = getattr(self, 'handle_' + command, None) + if handler is None: + if p2pool.DEBUG: + print 'no handler for', repr(command) + return + + if getattr(self, 'connected', True) and not getattr(self, 'disconnecting', False): + handler(**payload2) + + def disconnect(self): + if hasattr(self.transport, 'abortConnection'): + # Available since Twisted 11.1 + self.transport.abortConnection() + else: + # This doesn't always close timed out connections! warned about in main + self.transport.loseConnection() + + def badPeerHappened(self): + self.disconnect() + + def sendPacket(self, command, payload2): + if len(command) >= 12: + raise ValueError('command too long') + type_ = getattr(self, 'message_' + command, None) + if type_ is None: + raise ValueError('invalid command') + #print 'SEND', command, repr(payload2)[:500] + payload = type_.pack(payload2) + if len(payload) > self._max_payload_length: + raise TooLong('payload too long') + data = self._message_prefix + struct.pack('<12sI', command, len(payload)) + hashlib.sha256(hashlib.sha256(payload).digest()).digest()[:4] + payload + self.traffic_happened.happened('p2p/out', len(data)) + self.transport.write(data) + + def __getattr__(self, attr): + prefix = 'send_' + if attr.startswith(prefix): + command = attr[len(prefix):] + return lambda **payload2: self.sendPacket(command, payload2) + #return protocol.Protocol.__getattr__(self, attr) + raise AttributeError(attr) diff --git a/p2pool/util/pack.py b/p2pool/util/pack.py new file mode 100644 index 00000000..b2fd6da1 --- /dev/null +++ b/p2pool/util/pack.py @@ -0,0 +1,328 @@ +import binascii +import struct + +import p2pool +from p2pool.util import memoize + +class EarlyEnd(Exception): + pass + +class LateEnd(Exception): + pass + +def read((data, pos), length): + data2 = data[pos:pos + length] + if len(data2) != length: + raise EarlyEnd() + return data2, (data, pos + length) + +def size((data, pos)): + return len(data) - pos + +class Type(object): + __slots__ = [] + + def __hash__(self): + rval = getattr(self, '_hash', None) + if rval is None: + try: + rval = self._hash = hash((type(self), frozenset(self.__dict__.items()))) + except: + print self.__dict__ + raise + return rval + + def __eq__(self, other): + return type(other) is type(self) and other.__dict__ == self.__dict__ + + def __ne__(self, other): + return not (self == other) + + def _unpack(self, data, ignore_trailing=False): + obj, (data2, pos) = self.read((data, 0)) + + assert data2 is data + + if pos != len(data) and not ignore_trailing: + raise LateEnd() + + return obj + + def _pack(self, obj): + f = self.write(None, obj) + + res = [] + while f is not None: + res.append(f[1]) + f = f[0] + res.reverse() + return ''.join(res) + + + def unpack(self, data, ignore_trailing=False): + obj = self._unpack(data, ignore_trailing) + + if p2pool.DEBUG: + packed = self._pack(obj) + good = data.startswith(packed) if ignore_trailing else data == packed + if not good: + raise AssertionError() + + return obj + + def pack(self, obj): + data = self._pack(obj) + + if p2pool.DEBUG: + if self._unpack(data) != obj: + raise AssertionError((self._unpack(data), obj)) + + return data + + def packed_size(self, obj): + if hasattr(obj, '_packed_size') and obj._packed_size is not None: + type_obj, packed_size = obj._packed_size + if type_obj is self: + return packed_size + + packed_size = len(self.pack(obj)) + + if hasattr(obj, '_packed_size'): + obj._packed_size = self, packed_size + + return packed_size + +class VarIntType(Type): + def read(self, file): + data, file = read(file, 1) + first = ord(data) + if first < 0xfd: + return first, file + if first == 0xfd: + desc, length, minimum = '') + {8: 'B', 16: 'H', 32: 'I', 64: 'Q'}[bits]) + else: + return Type.__new__(cls, bits, endianness) + + def __init__(self, bits, endianness='little'): + assert bits % 8 == 0 + assert endianness in ['little', 'big'] + self.bytes = bits//8 + self.step = -1 if endianness == 'little' else 1 + self.format_str = '%%0%ix' % (2*self.bytes) + self.max = 2**bits + + def read(self, file, b2a_hex=binascii.b2a_hex): + if self.bytes == 0: + return 0, file + data, file = read(file, self.bytes) + return int(b2a_hex(data[::self.step]), 16), file + + def write(self, file, item, a2b_hex=binascii.a2b_hex): + if self.bytes == 0: + return file + if not 0 <= item < self.max: + raise ValueError('invalid int value - %r' % (item,)) + return file, a2b_hex(self.format_str % (item,))[::self.step] + +class IPV6AddressType(Type): + def read(self, file): + data, file = read(file, 16) + if data[:12] == '00000000000000000000ffff'.decode('hex'): + return '.'.join(str(ord(x)) for x in data[12:]), file + return ':'.join(data[i*2:(i+1)*2].encode('hex') for i in xrange(8)), file + + def write(self, file, item): + if ':' in item: + data = ''.join(item.replace(':', '')).decode('hex') + else: + bits = map(int, item.split('.')) + if len(bits) != 4: + raise ValueError('invalid address: %r' % (bits,)) + data = '00000000000000000000ffff'.decode('hex') + ''.join(chr(x) for x in bits) + assert len(data) == 16, len(data) + return file, data + +_record_types = {} + +def get_record(fields): + fields = tuple(sorted(fields)) + if 'keys' in fields or '_packed_size' in fields: + raise ValueError() + if fields not in _record_types: + class _Record(object): + __slots__ = fields + ('_packed_size',) + def __init__(self): + self._packed_size = None + def __repr__(self): + return repr(dict(self)) + def __getitem__(self, key): + return getattr(self, key) + def __setitem__(self, key, value): + setattr(self, key, value) + #def __iter__(self): + # for field in fields: + # yield field, getattr(self, field) + def keys(self): + return fields + def get(self, key, default=None): + return getattr(self, key, default) + def __eq__(self, other): + if isinstance(other, dict): + return dict(self) == other + elif isinstance(other, _Record): + for k in fields: + if getattr(self, k) != getattr(other, k): + return False + return True + elif other is None: + return False + raise TypeError() + def __ne__(self, other): + return not (self == other) + _record_types[fields] = _Record + return _record_types[fields] + +class ComposedType(Type): + def __init__(self, fields): + self.fields = list(fields) + self.field_names = set(k for k, v in fields) + self.record_type = get_record(k for k, v in self.fields) + + def read(self, file): + item = self.record_type() + for key, type_ in self.fields: + item[key], file = type_.read(file) + return item, file + + def write(self, file, item): + assert set(item.keys()) == self.field_names, (set(item.keys()) - self.field_names, self.field_names - set(item.keys())) + for key, type_ in self.fields: + file = type_.write(file, item[key]) + return file + +class PossiblyNoneType(Type): + def __init__(self, none_value, inner): + self.none_value = none_value + self.inner = inner + + def read(self, file): + value, file = self.inner.read(file) + return None if value == self.none_value else value, file + + def write(self, file, item): + if item == self.none_value: + raise ValueError('none_value used') + return self.inner.write(file, self.none_value if item is None else item) + +class FixedStrType(Type): + def __init__(self, length): + self.length = length + + def read(self, file): + return read(file, self.length) + + def write(self, file, item): + if len(item) != self.length: + raise ValueError('incorrect length item!') + return file, item diff --git a/p2pool/util/skiplist.py b/p2pool/util/skiplist.py new file mode 100644 index 00000000..e9e36c20 --- /dev/null +++ b/p2pool/util/skiplist.py @@ -0,0 +1,59 @@ +from p2pool.util import math, memoize + +class SkipList(object): + def __init__(self, p=0.5): + self.p = p + + self.skips = {} + + def forget_item(self, item): + self.skips.pop(item, None) + + @memoize.memoize_with_backing(memoize.LRUDict(5)) + def __call__(self, start, *args): + updates = {} + pos = start + sol = self.initial_solution(start, args) + if self.judge(sol, args) == 0: + return self.finalize(sol, args) + while True: + if pos not in self.skips: + self.skips[pos] = math.geometric(self.p), [(self.previous(pos), self.get_delta(pos))] + skip_length, skip = self.skips[pos] + + # fill previous updates + for i in xrange(skip_length): + if i in updates: + that_hash, delta = updates.pop(i) + x, y = self.skips[that_hash] + assert len(y) == i + y.append((pos, delta)) + + # put desired skip nodes in updates + for i in xrange(len(skip), skip_length): + updates[i] = pos, None + + #if skip_length + 1 in updates: + # updates[skip_length + 1] = self.combine(updates[skip_length + 1], updates[skip_length]) + + for jump, delta in reversed(skip): + sol_if = self.apply_delta(sol, delta, args) + decision = self.judge(sol_if, args) + #print pos, sol, jump, delta, sol_if, decision + if decision == 0: + return self.finalize(sol_if, args) + elif decision < 0: + sol = sol_if + break + else: + raise AssertionError() + + sol = sol_if + pos = jump + + # XXX could be better by combining updates + for x in updates: + updates[x] = updates[x][0], self.combine_deltas(updates[x][1], delta) if updates[x][1] is not None else delta + + def finalize(self, sol, args): + return sol diff --git a/p2pool/util/switchprotocol.py b/p2pool/util/switchprotocol.py new file mode 100644 index 00000000..29d05e6a --- /dev/null +++ b/p2pool/util/switchprotocol.py @@ -0,0 +1,29 @@ +from twisted.internet import protocol + +class FirstByteSwitchProtocol(protocol.Protocol): + p = None + def dataReceived(self, data): + if self.p is None: + if not data: return + serverfactory = self.factory.first_byte_to_serverfactory.get(data[0], self.factory.default_serverfactory) + self.p = serverfactory.buildProtocol(self.transport.getPeer()) + self.p.makeConnection(self.transport) + self.p.dataReceived(data) + def connectionLost(self, reason): + if self.p is not None: + self.p.connectionLost(reason) + +class FirstByteSwitchFactory(protocol.ServerFactory): + protocol = FirstByteSwitchProtocol + + def __init__(self, first_byte_to_serverfactory, default_serverfactory): + self.first_byte_to_serverfactory = first_byte_to_serverfactory + self.default_serverfactory = default_serverfactory + + def startFactory(self): + for f in list(self.first_byte_to_serverfactory.values()) + [self.default_serverfactory]: + f.doStart() + + def stopFactory(self): + for f in list(self.first_byte_to_serverfactory.values()) + [self.default_serverfactory]: + f.doStop() diff --git a/p2pool/util/variable.py b/p2pool/util/variable.py new file mode 100644 index 00000000..0050b0d3 --- /dev/null +++ b/p2pool/util/variable.py @@ -0,0 +1,85 @@ +import itertools +import weakref + +from twisted.internet import defer, reactor +from twisted.python import failure, log + +class Event(object): + def __init__(self): + self.observers = {} + self.id_generator = itertools.count() + self._once = None + self.times = 0 + + def run_and_watch(self, func): + func() + return self.watch(func) + def watch_weakref(self, obj, func): + # func must not contain a reference to obj! + watch_id = self.watch(lambda *args: func(obj_ref(), *args)) + obj_ref = weakref.ref(obj, lambda _: self.unwatch(watch_id)) + def watch(self, func): + id = self.id_generator.next() + self.observers[id] = func + return id + def unwatch(self, id): + self.observers.pop(id) + + @property + def once(self): + res = self._once + if res is None: + res = self._once = Event() + return res + + def happened(self, *event): + self.times += 1 + + once, self._once = self._once, None + + for id, func in sorted(self.observers.iteritems()): + try: + func(*event) + except: + log.err(None, "Error while processing Event callbacks:") + + if once is not None: + once.happened(*event) + + def get_deferred(self, timeout=None): + once = self.once + df = defer.Deferred() + id1 = once.watch(lambda *event: df.callback(event)) + if timeout is not None: + def do_timeout(): + df.errback(failure.Failure(defer.TimeoutError('in Event.get_deferred'))) + once.unwatch(id1) + once.unwatch(x) + delay = reactor.callLater(timeout, do_timeout) + x = once.watch(lambda *event: delay.cancel()) + return df + +class Variable(object): + def __init__(self, value): + self.value = value + self.changed = Event() + self.transitioned = Event() + + def set(self, value): + if value == self.value: + return + + oldvalue = self.value + self.value = value + self.changed.happened(value) + self.transitioned.happened(oldvalue, value) + + @defer.inlineCallbacks + def get_when_satisfies(self, func): + while True: + if func(self.value): + defer.returnValue(self.value) + yield self.changed.once.get_deferred() + + def get_not_none(self): + return self.get_when_satisfies(lambda val: val is not None) diff --git a/p2pool/web.py b/p2pool/web.py new file mode 100644 index 00000000..034baa53 --- /dev/null +++ b/p2pool/web.py @@ -0,0 +1,448 @@ +from __future__ import division + +import errno +import json +import os +import sys +import time +import traceback + +from twisted.internet import defer, reactor +from twisted.python import log +from twisted.web import resource, static + +import p2pool +from bitcoin import data as bitcoin_data +from . import data as p2pool_data, p2p +from util import deferral, deferred_resource, graph, math, memory, pack, variable + +def _atomic_read(filename): + try: + with open(filename, 'rb') as f: + return f.read() + except IOError, e: + if e.errno != errno.ENOENT: + raise + try: + with open(filename + '.new', 'rb') as f: + return f.read() + except IOError, e: + if e.errno != errno.ENOENT: + raise + return None + +def _atomic_write(filename, data): + with open(filename + '.new', 'wb') as f: + f.write(data) + f.flush() + try: + os.fsync(f.fileno()) + except: + pass + try: + os.rename(filename + '.new', filename) + except: # XXX windows can't overwrite + os.remove(filename) + os.rename(filename + '.new', filename) + +def get_web_root(wb, datadir_path, bitcoind_getinfo_var, stop_event=variable.Event()): + node = wb.node + start_time = time.time() + + web_root = resource.Resource() + + def get_users(): + height, last = node.tracker.get_height_and_last(node.best_share_var.value) + weights, total_weight, donation_weight = node.tracker.get_cumulative_weights(node.best_share_var.value, min(height, 720), 65535*2**256) + res = {} + for script in sorted(weights, key=lambda s: weights[s]): + res[bitcoin_data.script2_to_address(script, node.net.PARENT)] = weights[script]/total_weight + return res + + def get_current_scaled_txouts(scale, trunc=0): + txouts = node.get_current_txouts() + total = sum(txouts.itervalues()) + results = dict((script, value*scale//total) for script, value in txouts.iteritems()) + if trunc > 0: + total_random = 0 + random_set = set() + for s in sorted(results, key=results.__getitem__): + if results[s] >= trunc: + break + total_random += results[s] + random_set.add(s) + if total_random: + winner = math.weighted_choice((script, results[script]) for script in random_set) + for script in random_set: + del results[script] + results[winner] = total_random + if sum(results.itervalues()) < int(scale): + results[math.weighted_choice(results.iteritems())] += int(scale) - sum(results.itervalues()) + return results + + def get_patron_sendmany(total=None, trunc='0.01'): + if total is None: + return 'need total argument. go to patron_sendmany/' + total = int(float(total)*1e8) + trunc = int(float(trunc)*1e8) + return json.dumps(dict( + (bitcoin_data.script2_to_address(script, node.net.PARENT), value/1e8) + for script, value in get_current_scaled_txouts(total, trunc).iteritems() + if bitcoin_data.script2_to_address(script, node.net.PARENT) is not None + )) + + def get_global_stats(): + # averaged over last hour + if node.tracker.get_height(node.best_share_var.value) < 10: + return None + lookbehind = min(node.tracker.get_height(node.best_share_var.value), 3600//node.net.SHARE_PERIOD) + + nonstale_hash_rate = p2pool_data.get_pool_attempts_per_second(node.tracker, node.best_share_var.value, lookbehind) + stale_prop = p2pool_data.get_average_stale_prop(node.tracker, node.best_share_var.value, lookbehind) + return dict( + pool_nonstale_hash_rate=nonstale_hash_rate, + pool_hash_rate=nonstale_hash_rate/(1 - stale_prop), + pool_stale_prop=stale_prop, + min_difficulty=bitcoin_data.target_to_difficulty(node.tracker.items[node.best_share_var.value].max_target), + ) + + def get_local_stats(): + if node.tracker.get_height(node.best_share_var.value) < 10: + return None + lookbehind = min(node.tracker.get_height(node.best_share_var.value), 3600//node.net.SHARE_PERIOD) + + global_stale_prop = p2pool_data.get_average_stale_prop(node.tracker, node.best_share_var.value, lookbehind) + + my_unstale_count = sum(1 for share in node.tracker.get_chain(node.best_share_var.value, lookbehind) if share.hash in wb.my_share_hashes) + my_orphan_count = sum(1 for share in node.tracker.get_chain(node.best_share_var.value, lookbehind) if share.hash in wb.my_share_hashes and share.share_data['stale_info'] == 'orphan') + my_doa_count = sum(1 for share in node.tracker.get_chain(node.best_share_var.value, lookbehind) if share.hash in wb.my_share_hashes and share.share_data['stale_info'] == 'doa') + my_share_count = my_unstale_count + my_orphan_count + my_doa_count + my_stale_count = my_orphan_count + my_doa_count + + my_stale_prop = my_stale_count/my_share_count if my_share_count != 0 else None + + my_work = sum(bitcoin_data.target_to_average_attempts(share.target) + for share in node.tracker.get_chain(node.best_share_var.value, lookbehind - 1) + if share.hash in wb.my_share_hashes) + actual_time = (node.tracker.items[node.best_share_var.value].timestamp - + node.tracker.items[node.tracker.get_nth_parent_hash(node.best_share_var.value, lookbehind - 1)].timestamp) + share_att_s = my_work / actual_time + + miner_hash_rates, miner_dead_hash_rates = wb.get_local_rates() + (stale_orphan_shares, stale_doa_shares), shares, _ = wb.get_stale_counts() + + return dict( + my_hash_rates_in_last_hour=dict( + note="DEPRECATED", + nonstale=share_att_s, + rewarded=share_att_s/(1 - global_stale_prop), + actual=share_att_s/(1 - my_stale_prop) if my_stale_prop is not None else 0, # 0 because we don't have any shares anyway + ), + my_share_counts_in_last_hour=dict( + shares=my_share_count, + unstale_shares=my_unstale_count, + stale_shares=my_stale_count, + orphan_stale_shares=my_orphan_count, + doa_stale_shares=my_doa_count, + ), + my_stale_proportions_in_last_hour=dict( + stale=my_stale_prop, + orphan_stale=my_orphan_count/my_share_count if my_share_count != 0 else None, + dead_stale=my_doa_count/my_share_count if my_share_count != 0 else None, + ), + miner_hash_rates=miner_hash_rates, + miner_dead_hash_rates=miner_dead_hash_rates, + efficiency_if_miner_perfect=(1 - stale_orphan_shares/shares)/(1 - global_stale_prop) if shares else None, # ignores dead shares because those are miner's fault and indicated by pseudoshare rejection + efficiency=(1 - (stale_orphan_shares+stale_doa_shares)/shares)/(1 - global_stale_prop) if shares else None, + peers=dict( + incoming=sum(1 for peer in node.p2p_node.peers.itervalues() if peer.incoming), + outgoing=sum(1 for peer in node.p2p_node.peers.itervalues() if not peer.incoming), + ), + shares=dict( + total=shares, + orphan=stale_orphan_shares, + dead=stale_doa_shares, + ), + uptime=time.time() - start_time, + attempts_to_share=bitcoin_data.target_to_average_attempts(node.tracker.items[node.best_share_var.value].max_target), + attempts_to_block=bitcoin_data.target_to_average_attempts(node.bitcoind_work.value['bits'].target), + block_value=node.bitcoind_work.value['subsidy']*1e-8, + warnings=p2pool_data.get_warnings(node.tracker, node.best_share_var.value, node.net, bitcoind_getinfo_var.value, node.bitcoind_work.value), + donation_proportion=wb.donation_percentage/100, + version=p2pool.__version__, + protocol_version=p2p.Protocol.VERSION, + fee=wb.worker_fee, + ) + + class WebInterface(deferred_resource.DeferredResource): + def __init__(self, func, mime_type='application/json', args=()): + deferred_resource.DeferredResource.__init__(self) + self.func, self.mime_type, self.args = func, mime_type, args + + def getChild(self, child, request): + return WebInterface(self.func, self.mime_type, self.args + (child,)) + + @defer.inlineCallbacks + def render_GET(self, request): + request.setHeader('Content-Type', self.mime_type) + request.setHeader('Access-Control-Allow-Origin', '*') + res = yield self.func(*self.args) + defer.returnValue(json.dumps(res) if self.mime_type == 'application/json' else res) + + def decent_height(): + return min(node.tracker.get_height(node.best_share_var.value), 720) + web_root.putChild('rate', WebInterface(lambda: p2pool_data.get_pool_attempts_per_second(node.tracker, node.best_share_var.value, decent_height())/(1-p2pool_data.get_average_stale_prop(node.tracker, node.best_share_var.value, decent_height())))) + web_root.putChild('difficulty', WebInterface(lambda: bitcoin_data.target_to_difficulty(node.tracker.items[node.best_share_var.value].max_target))) + web_root.putChild('users', WebInterface(get_users)) + web_root.putChild('user_stales', WebInterface(lambda: dict((bitcoin_data.pubkey_hash_to_address(ph, node.net.PARENT), prop) for ph, prop in + p2pool_data.get_user_stale_props(node.tracker, node.best_share_var.value, node.tracker.get_height(node.best_share_var.value)).iteritems()))) + web_root.putChild('fee', WebInterface(lambda: wb.worker_fee)) + web_root.putChild('current_payouts', WebInterface(lambda: dict((bitcoin_data.script2_to_address(script, node.net.PARENT), value/1e8) for script, value in node.get_current_txouts().iteritems()))) + web_root.putChild('patron_sendmany', WebInterface(get_patron_sendmany, 'text/plain')) + web_root.putChild('global_stats', WebInterface(get_global_stats)) + web_root.putChild('local_stats', WebInterface(get_local_stats)) + web_root.putChild('peer_addresses', WebInterface(lambda: ' '.join('%s%s' % (peer.transport.getPeer().host, ':'+str(peer.transport.getPeer().port) if peer.transport.getPeer().port != node.net.P2P_PORT else '') for peer in node.p2p_node.peers.itervalues()))) + web_root.putChild('peer_txpool_sizes', WebInterface(lambda: dict(('%s:%i' % (peer.transport.getPeer().host, peer.transport.getPeer().port), peer.remembered_txs_size) for peer in node.p2p_node.peers.itervalues()))) + web_root.putChild('pings', WebInterface(defer.inlineCallbacks(lambda: defer.returnValue( + dict([(a, (yield b)) for a, b in + [( + '%s:%i' % (peer.transport.getPeer().host, peer.transport.getPeer().port), + defer.inlineCallbacks(lambda peer=peer: defer.returnValue( + min([(yield peer.do_ping().addCallback(lambda x: x/0.001).addErrback(lambda fail: None)) for i in xrange(3)]) + ))() + ) for peer in list(node.p2p_node.peers.itervalues())] + ]) + )))) + web_root.putChild('peer_versions', WebInterface(lambda: dict(('%s:%i' % peer.addr, peer.other_sub_version) for peer in node.p2p_node.peers.itervalues()))) + web_root.putChild('payout_addr', WebInterface(lambda: bitcoin_data.pubkey_hash_to_address(wb.my_pubkey_hash, node.net.PARENT))) + web_root.putChild('recent_blocks', WebInterface(lambda: [dict( + ts=s.timestamp, + hash='%064x' % s.header_hash, + number=pack.IntType(24).unpack(s.share_data['coinbase'][1:4]) if len(s.share_data['coinbase']) >= 4 else None, + share='%064x' % s.hash, + ) for s in node.tracker.get_chain(node.best_share_var.value, min(node.tracker.get_height(node.best_share_var.value), 24*60*60//node.net.SHARE_PERIOD)) if s.pow_hash <= s.header['bits'].target])) + web_root.putChild('uptime', WebInterface(lambda: time.time() - start_time)) + web_root.putChild('stale_rates', WebInterface(lambda: p2pool_data.get_stale_counts(node.tracker, node.best_share_var.value, decent_height(), rates=True))) + + new_root = resource.Resource() + web_root.putChild('web', new_root) + + stat_log = [] + if os.path.exists(os.path.join(datadir_path, 'stats')): + try: + with open(os.path.join(datadir_path, 'stats'), 'rb') as f: + stat_log = json.loads(f.read()) + except: + log.err(None, 'Error loading stats:') + def update_stat_log(): + while stat_log and stat_log[0]['time'] < time.time() - 24*60*60: + stat_log.pop(0) + + lookbehind = 3600//node.net.SHARE_PERIOD + if node.tracker.get_height(node.best_share_var.value) < lookbehind: + return None + + global_stale_prop = p2pool_data.get_average_stale_prop(node.tracker, node.best_share_var.value, lookbehind) + (stale_orphan_shares, stale_doa_shares), shares, _ = wb.get_stale_counts() + miner_hash_rates, miner_dead_hash_rates = wb.get_local_rates() + + stat_log.append(dict( + time=time.time(), + pool_hash_rate=p2pool_data.get_pool_attempts_per_second(node.tracker, node.best_share_var.value, lookbehind)/(1-global_stale_prop), + pool_stale_prop=global_stale_prop, + local_hash_rates=miner_hash_rates, + local_dead_hash_rates=miner_dead_hash_rates, + shares=shares, + stale_shares=stale_orphan_shares + stale_doa_shares, + stale_shares_breakdown=dict(orphan=stale_orphan_shares, doa=stale_doa_shares), + current_payout=node.get_current_txouts().get(bitcoin_data.pubkey_hash_to_script2(wb.my_pubkey_hash), 0)*1e-8, + peers=dict( + incoming=sum(1 for peer in node.p2p_node.peers.itervalues() if peer.incoming), + outgoing=sum(1 for peer in node.p2p_node.peers.itervalues() if not peer.incoming), + ), + attempts_to_share=bitcoin_data.target_to_average_attempts(node.tracker.items[node.best_share_var.value].max_target), + attempts_to_block=bitcoin_data.target_to_average_attempts(node.bitcoind_work.value['bits'].target), + block_value=node.bitcoind_work.value['subsidy']*1e-8, + )) + + with open(os.path.join(datadir_path, 'stats'), 'wb') as f: + f.write(json.dumps(stat_log)) + x = deferral.RobustLoopingCall(update_stat_log) + x.start(5*60) + stop_event.watch(x.stop) + new_root.putChild('log', WebInterface(lambda: stat_log)) + + def get_share(share_hash_str): + if int(share_hash_str, 16) not in node.tracker.items: + return None + share = node.tracker.items[int(share_hash_str, 16)] + + return dict( + parent='%064x' % share.previous_hash, + children=['%064x' % x for x in sorted(node.tracker.reverse.get(share.hash, set()), key=lambda sh: -len(node.tracker.reverse.get(sh, set())))], # sorted from most children to least children + type_name=type(share).__name__, + local=dict( + verified=share.hash in node.tracker.verified.items, + time_first_seen=start_time if share.time_seen == 0 else share.time_seen, + peer_first_received_from=share.peer_addr, + ), + share_data=dict( + timestamp=share.timestamp, + target=share.target, + max_target=share.max_target, + payout_address=bitcoin_data.script2_to_address(share.new_script, node.net.PARENT), + donation=share.share_data['donation']/65535, + stale_info=share.share_data['stale_info'], + nonce=share.share_data['nonce'], + desired_version=share.share_data['desired_version'], + absheight=share.absheight, + abswork=share.abswork, + ), + block=dict( + hash='%064x' % share.header_hash, + header=dict( + version=share.header['version'], + previous_block='%064x' % share.header['previous_block'], + merkle_root='%064x' % share.header['merkle_root'], + timestamp=share.header['timestamp'], + target=share.header['bits'].target, + nonce=share.header['nonce'], + ), + gentx=dict( + hash='%064x' % share.gentx_hash, + coinbase=share.share_data['coinbase'].ljust(2, '\x00').encode('hex'), + value=share.share_data['subsidy']*1e-8, + last_txout_nonce='%016x' % share.contents['last_txout_nonce'], + ), + other_transaction_hashes=['%064x' % x for x in share.get_other_tx_hashes(node.tracker)], + ), + ) + new_root.putChild('share', WebInterface(lambda share_hash_str: get_share(share_hash_str))) + new_root.putChild('heads', WebInterface(lambda: ['%064x' % x for x in node.tracker.heads])) + new_root.putChild('verified_heads', WebInterface(lambda: ['%064x' % x for x in node.tracker.verified.heads])) + new_root.putChild('tails', WebInterface(lambda: ['%064x' % x for t in node.tracker.tails for x in node.tracker.reverse.get(t, set())])) + new_root.putChild('verified_tails', WebInterface(lambda: ['%064x' % x for t in node.tracker.verified.tails for x in node.tracker.verified.reverse.get(t, set())])) + new_root.putChild('best_share_hash', WebInterface(lambda: '%064x' % node.best_share_var.value)) + new_root.putChild('my_share_hashes', WebInterface(lambda: ['%064x' % my_share_hash for my_share_hash in wb.my_share_hashes])) + def get_share_data(share_hash_str): + if int(share_hash_str, 16) not in node.tracker.items: + return '' + share = node.tracker.items[int(share_hash_str, 16)] + return p2pool_data.share_type.pack(share.as_share1a()) + new_root.putChild('share_data', WebInterface(lambda share_hash_str: get_share_data(share_hash_str), 'application/octet-stream')) + new_root.putChild('currency_info', WebInterface(lambda: dict( + symbol=node.net.PARENT.SYMBOL, + block_explorer_url_prefix=node.net.PARENT.BLOCK_EXPLORER_URL_PREFIX, + address_explorer_url_prefix=node.net.PARENT.ADDRESS_EXPLORER_URL_PREFIX, + tx_explorer_url_prefix=node.net.PARENT.TX_EXPLORER_URL_PREFIX, + ))) + new_root.putChild('version', WebInterface(lambda: p2pool.__version__)) + + hd_path = os.path.join(datadir_path, 'graph_db') + hd_data = _atomic_read(hd_path) + hd_obj = {} + if hd_data is not None: + try: + hd_obj = json.loads(hd_data) + except Exception: + log.err(None, 'Error reading graph database:') + dataview_descriptions = { + 'last_hour': graph.DataViewDescription(150, 60*60), + 'last_day': graph.DataViewDescription(300, 60*60*24), + 'last_week': graph.DataViewDescription(300, 60*60*24*7), + 'last_month': graph.DataViewDescription(300, 60*60*24*30), + 'last_year': graph.DataViewDescription(300, 60*60*24*365.25), + } + hd = graph.HistoryDatabase.from_obj({ + 'local_hash_rate': graph.DataStreamDescription(dataview_descriptions, is_gauge=False), + 'local_dead_hash_rate': graph.DataStreamDescription(dataview_descriptions, is_gauge=False), + 'local_share_hash_rates': graph.DataStreamDescription(dataview_descriptions, is_gauge=False, + multivalues=True, multivalue_undefined_means_0=True, + default_func=graph.make_multivalue_migrator(dict(good='local_share_hash_rate', dead='local_dead_share_hash_rate', orphan='local_orphan_share_hash_rate'), + post_func=lambda bins: [dict((k, (v[0] - (sum(bin.get(rem_k, (0, 0))[0] for rem_k in ['dead', 'orphan']) if k == 'good' else 0), v[1])) for k, v in bin.iteritems()) for bin in bins])), + 'pool_rates': graph.DataStreamDescription(dataview_descriptions, multivalues=True, + multivalue_undefined_means_0=True), + 'current_payout': graph.DataStreamDescription(dataview_descriptions), + 'current_payouts': graph.DataStreamDescription(dataview_descriptions, multivalues=True), + 'peers': graph.DataStreamDescription(dataview_descriptions, multivalues=True, default_func=graph.make_multivalue_migrator(dict(incoming='incoming_peers', outgoing='outgoing_peers'))), + 'miner_hash_rates': graph.DataStreamDescription(dataview_descriptions, is_gauge=False, multivalues=True), + 'miner_dead_hash_rates': graph.DataStreamDescription(dataview_descriptions, is_gauge=False, multivalues=True), + 'desired_version_rates': graph.DataStreamDescription(dataview_descriptions, multivalues=True, + multivalue_undefined_means_0=True), + 'traffic_rate': graph.DataStreamDescription(dataview_descriptions, is_gauge=False, multivalues=True), + 'getwork_latency': graph.DataStreamDescription(dataview_descriptions), + 'memory_usage': graph.DataStreamDescription(dataview_descriptions), + }, hd_obj) + x = deferral.RobustLoopingCall(lambda: _atomic_write(hd_path, json.dumps(hd.to_obj()))) + x.start(100) + stop_event.watch(x.stop) + @wb.pseudoshare_received.watch + def _(work, dead, user): + t = time.time() + hd.datastreams['local_hash_rate'].add_datum(t, work) + if dead: + hd.datastreams['local_dead_hash_rate'].add_datum(t, work) + if user is not None: + hd.datastreams['miner_hash_rates'].add_datum(t, {user: work}) + if dead: + hd.datastreams['miner_dead_hash_rates'].add_datum(t, {user: work}) + @wb.share_received.watch + def _(work, dead, share_hash): + t = time.time() + if not dead: + hd.datastreams['local_share_hash_rates'].add_datum(t, dict(good=work)) + else: + hd.datastreams['local_share_hash_rates'].add_datum(t, dict(dead=work)) + def later(): + res = node.tracker.is_child_of(share_hash, node.best_share_var.value) + if res is None: res = False # share isn't connected to sharechain? assume orphaned + if res and dead: # share was DOA, but is now in sharechain + # move from dead to good + hd.datastreams['local_share_hash_rates'].add_datum(t, dict(dead=-work, good=work)) + elif not res and not dead: # share wasn't DOA, and isn't in sharechain + # move from good to orphan + hd.datastreams['local_share_hash_rates'].add_datum(t, dict(good=-work, orphan=work)) + reactor.callLater(200, later) + @node.p2p_node.traffic_happened.watch + def _(name, bytes): + hd.datastreams['traffic_rate'].add_datum(time.time(), {name: bytes}) + def add_point(): + if node.tracker.get_height(node.best_share_var.value) < 10: + return None + lookbehind = min(node.net.CHAIN_LENGTH, 60*60//node.net.SHARE_PERIOD, node.tracker.get_height(node.best_share_var.value)) + t = time.time() + + pool_rates = p2pool_data.get_stale_counts(node.tracker, node.best_share_var.value, lookbehind, rates=True) + pool_total = sum(pool_rates.itervalues()) + hd.datastreams['pool_rates'].add_datum(t, pool_rates) + + current_txouts = node.get_current_txouts() + hd.datastreams['current_payout'].add_datum(t, current_txouts.get(bitcoin_data.pubkey_hash_to_script2(wb.my_pubkey_hash), 0)*1e-8) + miner_hash_rates, miner_dead_hash_rates = wb.get_local_rates() + current_txouts_by_address = dict((bitcoin_data.script2_to_address(script, node.net.PARENT), amount) for script, amount in current_txouts.iteritems()) + hd.datastreams['current_payouts'].add_datum(t, dict((user, current_txouts_by_address[user]*1e-8) for user in miner_hash_rates if user in current_txouts_by_address)) + + hd.datastreams['peers'].add_datum(t, dict( + incoming=sum(1 for peer in node.p2p_node.peers.itervalues() if peer.incoming), + outgoing=sum(1 for peer in node.p2p_node.peers.itervalues() if not peer.incoming), + )) + + vs = p2pool_data.get_desired_version_counts(node.tracker, node.best_share_var.value, lookbehind) + vs_total = sum(vs.itervalues()) + hd.datastreams['desired_version_rates'].add_datum(t, dict((str(k), v/vs_total*pool_total) for k, v in vs.iteritems())) + try: + hd.datastreams['memory_usage'].add_datum(t, memory.resident()) + except: + if p2pool.DEBUG: + traceback.print_exc() + x = deferral.RobustLoopingCall(add_point) + x.start(5) + stop_event.watch(x.stop) + @node.bitcoind_work.changed.watch + def _(new_work): + hd.datastreams['getwork_latency'].add_datum(time.time(), new_work['latency']) + new_root.putChild('graph_data', WebInterface(lambda source, view: hd.datastreams[source].dataviews[view].get_data(time.time()))) + + web_root.putChild('static', static.File(os.path.join(os.path.dirname(os.path.abspath(sys.argv[0])), 'web-static'))) + + return web_root diff --git a/p2pool/work.py b/p2pool/work.py new file mode 100644 index 00000000..e1c677d1 --- /dev/null +++ b/p2pool/work.py @@ -0,0 +1,431 @@ +from __future__ import division + +import base64 +import random +import re +import sys +import time + +from twisted.internet import defer +from twisted.python import log + +import bitcoin.getwork as bitcoin_getwork, bitcoin.data as bitcoin_data +from bitcoin import helper, script, worker_interface +from util import forest, jsonrpc, variable, deferral, math, pack +import p2pool, p2pool.data as p2pool_data + +class WorkerBridge(worker_interface.WorkerBridge): + COINBASE_NONCE_LENGTH = 8 + + def __init__(self, node, my_pubkey_hash, donation_percentage, merged_urls, worker_fee): + worker_interface.WorkerBridge.__init__(self) + self.recent_shares_ts_work = [] + + self.node = node + self.my_pubkey_hash = my_pubkey_hash + self.donation_percentage = donation_percentage + self.worker_fee = worker_fee + + self.net = self.node.net.PARENT + self.running = True + self.pseudoshare_received = variable.Event() + self.share_received = variable.Event() + self.local_rate_monitor = math.RateMonitor(10*60) + self.local_addr_rate_monitor = math.RateMonitor(10*60) + + self.removed_unstales_var = variable.Variable((0, 0, 0)) + self.removed_doa_unstales_var = variable.Variable(0) + + + self.my_share_hashes = set() + self.my_doa_share_hashes = set() + + self.tracker_view = forest.TrackerView(self.node.tracker, forest.get_attributedelta_type(dict(forest.AttributeDelta.attrs, + my_count=lambda share: 1 if share.hash in self.my_share_hashes else 0, + my_doa_count=lambda share: 1 if share.hash in self.my_doa_share_hashes else 0, + my_orphan_announce_count=lambda share: 1 if share.hash in self.my_share_hashes and share.share_data['stale_info'] == 'orphan' else 0, + my_dead_announce_count=lambda share: 1 if share.hash in self.my_share_hashes and share.share_data['stale_info'] == 'doa' else 0, + ))) + + @self.node.tracker.verified.removed.watch + def _(share): + if share.hash in self.my_share_hashes and self.node.tracker.is_child_of(share.hash, self.node.best_share_var.value): + assert share.share_data['stale_info'] in [None, 'orphan', 'doa'] # we made these shares in this instance + self.removed_unstales_var.set(( + self.removed_unstales_var.value[0] + 1, + self.removed_unstales_var.value[1] + (1 if share.share_data['stale_info'] == 'orphan' else 0), + self.removed_unstales_var.value[2] + (1 if share.share_data['stale_info'] == 'doa' else 0), + )) + if share.hash in self.my_doa_share_hashes and self.node.tracker.is_child_of(share.hash, self.node.best_share_var.value): + self.removed_doa_unstales_var.set(self.removed_doa_unstales_var.value + 1) + + # MERGED WORK + + self.merged_work = variable.Variable({}) + + @defer.inlineCallbacks + def set_merged_work(merged_url, merged_userpass): + merged_proxy = jsonrpc.HTTPProxy(merged_url, dict(Authorization='Basic ' + base64.b64encode(merged_userpass))) + while self.running: + auxblock = yield deferral.retry('Error while calling merged getauxblock on %s:' % (merged_url,), 30)(merged_proxy.rpc_getauxblock)() + self.merged_work.set(math.merge_dicts(self.merged_work.value, {auxblock['chainid']: dict( + hash=int(auxblock['hash'], 16), + target='p2pool' if auxblock['target'] == 'p2pool' else pack.IntType(256).unpack(auxblock['target'].decode('hex')), + merged_proxy=merged_proxy, + )})) + yield deferral.sleep(1) + for merged_url, merged_userpass in merged_urls: + set_merged_work(merged_url, merged_userpass) + + @self.merged_work.changed.watch + def _(new_merged_work): + print 'Got new merged mining work!' + + # COMBINE WORK + + self.current_work = variable.Variable(None) + def compute_work(): + t = self.node.bitcoind_work.value + bb = self.node.best_block_header.value + if bb is not None and bb['previous_block'] == t['previous_block'] and self.node.net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(bb)) <= t['bits'].target: + print 'Skipping from block %x to block %x!' % (bb['previous_block'], + bitcoin_data.hash256(bitcoin_data.block_header_type.pack(bb))) + t = dict( + version=bb['version'], + previous_block=bitcoin_data.hash256(bitcoin_data.block_header_type.pack(bb)), + bits=bb['bits'], # not always true + coinbaseflags='', + height=t['height'] + 1, + time=bb['timestamp'] + 600, # better way? + transactions=[], + transaction_fees=[], + merkle_link=bitcoin_data.calculate_merkle_link([None], 0), + subsidy=self.node.net.PARENT.SUBSIDY_FUNC(self.node.bitcoind_work.value['height']), + last_update=self.node.bitcoind_work.value['last_update'], + ) + + self.current_work.set(t) + self.node.bitcoind_work.changed.watch(lambda _: compute_work()) + self.node.best_block_header.changed.watch(lambda _: compute_work()) + compute_work() + + self.new_work_event = variable.Event() + @self.current_work.transitioned.watch + def _(before, after): + # trigger LP if version/previous_block/bits changed or transactions changed from nothing + if any(before[x] != after[x] for x in ['version', 'previous_block', 'bits']) or (not before['transactions'] and after['transactions']): + self.new_work_event.happened() + self.merged_work.changed.watch(lambda _: self.new_work_event.happened()) + self.node.best_share_var.changed.watch(lambda _: self.new_work_event.happened()) + + def stop(self): + self.running = False + + def get_stale_counts(self): + '''Returns (orphans, doas), total, (orphans_recorded_in_chain, doas_recorded_in_chain)''' + my_shares = len(self.my_share_hashes) + my_doa_shares = len(self.my_doa_share_hashes) + delta = self.tracker_view.get_delta_to_last(self.node.best_share_var.value) + my_shares_in_chain = delta.my_count + self.removed_unstales_var.value[0] + my_doa_shares_in_chain = delta.my_doa_count + self.removed_doa_unstales_var.value + orphans_recorded_in_chain = delta.my_orphan_announce_count + self.removed_unstales_var.value[1] + doas_recorded_in_chain = delta.my_dead_announce_count + self.removed_unstales_var.value[2] + + my_shares_not_in_chain = my_shares - my_shares_in_chain + my_doa_shares_not_in_chain = my_doa_shares - my_doa_shares_in_chain + + return (my_shares_not_in_chain - my_doa_shares_not_in_chain, my_doa_shares_not_in_chain), my_shares, (orphans_recorded_in_chain, doas_recorded_in_chain) + + def get_user_details(self, username): + contents = re.split('([+/])', username) + assert len(contents) % 2 == 1 + + user, contents2 = contents[0], contents[1:] + + desired_pseudoshare_target = None + desired_share_target = None + for symbol, parameter in zip(contents2[::2], contents2[1::2]): + if symbol == '+': + try: + desired_pseudoshare_target = bitcoin_data.difficulty_to_target(float(parameter)) + except: + if p2pool.DEBUG: + log.err() + elif symbol == '/': + try: + desired_share_target = bitcoin_data.difficulty_to_target(float(parameter)) + except: + if p2pool.DEBUG: + log.err() + + if random.uniform(0, 100) < self.worker_fee: + pubkey_hash = self.my_pubkey_hash + else: + try: + pubkey_hash = bitcoin_data.address_to_pubkey_hash(user, self.node.net.PARENT) + except: # XXX blah + pubkey_hash = self.my_pubkey_hash + + return user, pubkey_hash, desired_share_target, desired_pseudoshare_target + + def preprocess_request(self, user): + if (self.node.p2p_node is None or len(self.node.p2p_node.peers) == 0) and self.node.net.PERSIST: + raise jsonrpc.Error_for_code(-12345)(u'p2pool is not connected to any peers') + if time.time() > self.current_work.value['last_update'] + 60: + raise jsonrpc.Error_for_code(-12345)(u'lost contact with bitcoind') + user, pubkey_hash, desired_share_target, desired_pseudoshare_target = self.get_user_details(user) + return pubkey_hash, desired_share_target, desired_pseudoshare_target + + def _estimate_local_hash_rate(self): + if len(self.recent_shares_ts_work) == 50: + hash_rate = sum(work for ts, work in self.recent_shares_ts_work[1:])//(self.recent_shares_ts_work[-1][0] - self.recent_shares_ts_work[0][0]) + if hash_rate: + return hash_rate + return None + + def get_local_rates(self): + miner_hash_rates = {} + miner_dead_hash_rates = {} + datums, dt = self.local_rate_monitor.get_datums_in_last() + for datum in datums: + miner_hash_rates[datum['user']] = miner_hash_rates.get(datum['user'], 0) + datum['work']/dt + if datum['dead']: + miner_dead_hash_rates[datum['user']] = miner_dead_hash_rates.get(datum['user'], 0) + datum['work']/dt + return miner_hash_rates, miner_dead_hash_rates + + def get_local_addr_rates(self): + addr_hash_rates = {} + datums, dt = self.local_addr_rate_monitor.get_datums_in_last() + for datum in datums: + addr_hash_rates[datum['pubkey_hash']] = addr_hash_rates.get(datum['pubkey_hash'], 0) + datum['work']/dt + return addr_hash_rates + + def get_work(self, pubkey_hash, desired_share_target, desired_pseudoshare_target): + if self.node.best_share_var.value is None and self.node.net.PERSIST: + raise jsonrpc.Error_for_code(-12345)(u'p2pool is downloading shares') + + if self.merged_work.value: + tree, size = bitcoin_data.make_auxpow_tree(self.merged_work.value) + mm_hashes = [self.merged_work.value.get(tree.get(i), dict(hash=0))['hash'] for i in xrange(size)] + mm_data = '\xfa\xbemm' + bitcoin_data.aux_pow_coinbase_type.pack(dict( + merkle_root=bitcoin_data.merkle_hash(mm_hashes), + size=size, + nonce=0, + )) + mm_later = [(aux_work, mm_hashes.index(aux_work['hash']), mm_hashes) for chain_id, aux_work in self.merged_work.value.iteritems()] + else: + mm_data = '' + mm_later = [] + + tx_hashes = [bitcoin_data.hash256(bitcoin_data.tx_type.pack(tx)) for tx in self.current_work.value['transactions']] + tx_map = dict(zip(tx_hashes, self.current_work.value['transactions'])) + + previous_share = self.node.tracker.items[self.node.best_share_var.value] if self.node.best_share_var.value is not None else None + if previous_share is None: + share_type = p2pool_data.Share + else: + previous_share_type = type(previous_share) + + if previous_share_type.SUCCESSOR is None or self.node.tracker.get_height(previous_share.hash) < self.node.net.CHAIN_LENGTH: + share_type = previous_share_type + else: + successor_type = previous_share_type.SUCCESSOR + + counts = p2pool_data.get_desired_version_counts(self.node.tracker, + self.node.tracker.get_nth_parent_hash(previous_share.hash, self.node.net.CHAIN_LENGTH*9//10), self.node.net.CHAIN_LENGTH//10) + upgraded = counts.get(successor_type.VERSION, 0)/sum(counts.itervalues()) + if upgraded > .65: + print 'Switchover imminent. Upgraded: %.3f%% Threshold: %.3f%%' % (upgraded*100, 95) + print + # Share -> NewShare only valid if 95% of hashes in [net.CHAIN_LENGTH*9//10, net.CHAIN_LENGTH] for new version + if counts.get(successor_type.VERSION, 0) > sum(counts.itervalues())*95//100: + share_type = successor_type + else: + share_type = previous_share_type + + if desired_share_target is None: + desired_share_target = 2**256-1 + local_hash_rate = self._estimate_local_hash_rate() + if local_hash_rate is not None: + desired_share_target = min(desired_share_target, + bitcoin_data.average_attempts_to_target(local_hash_rate * self.node.net.SHARE_PERIOD / 0.0167)) # limit to 1.67% of pool shares by modulating share difficulty + + local_addr_rates = self.get_local_addr_rates() + lookbehind = 3600//self.node.net.SHARE_PERIOD + block_subsidy = self.node.bitcoind_work.value['subsidy'] + if previous_share is not None and self.node.tracker.get_height(previous_share.hash) > lookbehind: + expected_payout_per_block = local_addr_rates.get(pubkey_hash, 0)/p2pool_data.get_pool_attempts_per_second(self.node.tracker, self.node.best_share_var.value, lookbehind) \ + * block_subsidy*(1-self.donation_percentage/100) # XXX doesn't use global stale rate to compute pool hash + if expected_payout_per_block < self.node.net.PARENT.DUST_THRESHOLD: + desired_share_target = min(desired_share_target, + bitcoin_data.average_attempts_to_target((bitcoin_data.target_to_average_attempts(self.node.bitcoind_work.value['bits'].target)*self.node.net.SPREAD)*self.node.net.PARENT.DUST_THRESHOLD/block_subsidy) + ) + + if True: + share_info, gentx, other_transaction_hashes, get_share = share_type.generate_transaction( + tracker=self.node.tracker, + share_data=dict( + previous_share_hash=self.node.best_share_var.value, + coinbase=(script.create_push_script([ + self.current_work.value['height'], + ] + ([mm_data] if mm_data else []) + [ + ]) + self.current_work.value['coinbaseflags'])[:100], + nonce=random.randrange(2**32), + pubkey_hash=pubkey_hash, + subsidy=self.current_work.value['subsidy'], + donation=math.perfect_round(65535*self.donation_percentage/100), + stale_info=(lambda (orphans, doas), total, (orphans_recorded_in_chain, doas_recorded_in_chain): + 'orphan' if orphans > orphans_recorded_in_chain else + 'doa' if doas > doas_recorded_in_chain else + None + )(*self.get_stale_counts()), + desired_version=(share_type.SUCCESSOR if share_type.SUCCESSOR is not None else share_type).VOTING_VERSION, + ), + block_target=self.current_work.value['bits'].target, + desired_timestamp=int(time.time() + 0.5), + desired_target=desired_share_target, + ref_merkle_link=dict(branch=[], index=0), + desired_other_transaction_hashes_and_fees=zip(tx_hashes, self.current_work.value['transaction_fees']), + net=self.node.net, + known_txs=tx_map, + base_subsidy=self.node.net.PARENT.SUBSIDY_FUNC(self.current_work.value['height']), + ) + + packed_gentx = bitcoin_data.tx_type.pack(gentx) + other_transactions = [tx_map[tx_hash] for tx_hash in other_transaction_hashes] + + mm_later = [(dict(aux_work, target=aux_work['target'] if aux_work['target'] != 'p2pool' else share_info['bits'].target), index, hashes) for aux_work, index, hashes in mm_later] + + if desired_pseudoshare_target is None: + target = 2**256-1 + local_hash_rate = self._estimate_local_hash_rate() + if local_hash_rate is not None: + target = min(target, + bitcoin_data.average_attempts_to_target(local_hash_rate * 1)) # limit to 1 share response every second by modulating pseudoshare difficulty + else: + target = desired_pseudoshare_target + target = max(target, share_info['bits'].target) + for aux_work, index, hashes in mm_later: + target = max(target, aux_work['target']) + target = math.clip(target, self.node.net.PARENT.SANE_TARGET_RANGE) + + getwork_time = time.time() + lp_count = self.new_work_event.times + merkle_link = bitcoin_data.calculate_merkle_link([None] + other_transaction_hashes, 0) + + print 'New work for worker! Difficulty: %.06f Share difficulty: %.06f Total block value: %.6f %s including %i transactions' % ( + bitcoin_data.target_to_difficulty(target), + bitcoin_data.target_to_difficulty(share_info['bits'].target), + self.current_work.value['subsidy']*1e-8, self.node.net.PARENT.SYMBOL, + len(self.current_work.value['transactions']), + ) + + ba = dict( + version=min(self.current_work.value['version'], 2), + previous_block=self.current_work.value['previous_block'], + merkle_link=merkle_link, + coinb1=packed_gentx[:-self.COINBASE_NONCE_LENGTH-4], + coinb2=packed_gentx[-4:], + timestamp=self.current_work.value['time'], + bits=self.current_work.value['bits'], + share_target=target, + ) + + received_header_hashes = set() + + def got_response(header, user, coinbase_nonce): + assert len(coinbase_nonce) == self.COINBASE_NONCE_LENGTH + new_packed_gentx = packed_gentx[:-self.COINBASE_NONCE_LENGTH-4] + coinbase_nonce + packed_gentx[-4:] if coinbase_nonce != '\0'*self.COINBASE_NONCE_LENGTH else packed_gentx + new_gentx = bitcoin_data.tx_type.unpack(new_packed_gentx) if coinbase_nonce != '\0'*self.COINBASE_NONCE_LENGTH else gentx + + header_hash = bitcoin_data.hash256(bitcoin_data.block_header_type.pack(header)) + pow_hash = self.node.net.PARENT.POW_FUNC(bitcoin_data.block_header_type.pack(header)) + try: + if pow_hash <= header['bits'].target or p2pool.DEBUG: + helper.submit_block(dict(header=header, txs=[new_gentx] + other_transactions), False, self.node.factory, self.node.bitcoind, self.node.bitcoind_work, self.node.net) + if pow_hash <= header['bits'].target: + print + print 'GOT BLOCK FROM MINER! Passing to bitcoind! %s%064x' % (self.node.net.PARENT.BLOCK_EXPLORER_URL_PREFIX, header_hash) + print + except: + log.err(None, 'Error while processing potential block:') + + user, _, _, _ = self.get_user_details(user) + assert header['previous_block'] == ba['previous_block'] + assert header['merkle_root'] == bitcoin_data.check_merkle_link(bitcoin_data.hash256(new_packed_gentx), merkle_link) + assert header['bits'] == ba['bits'] + + on_time = self.new_work_event.times == lp_count + + for aux_work, index, hashes in mm_later: + try: + if pow_hash <= aux_work['target'] or p2pool.DEBUG: + df = deferral.retry('Error submitting merged block: (will retry)', 10, 10)(aux_work['merged_proxy'].rpc_getauxblock)( + pack.IntType(256, 'big').pack(aux_work['hash']).encode('hex'), + bitcoin_data.aux_pow_type.pack(dict( + merkle_tx=dict( + tx=new_gentx, + block_hash=header_hash, + merkle_link=merkle_link, + ), + merkle_link=bitcoin_data.calculate_merkle_link(hashes, index), + parent_block_header=header, + )).encode('hex'), + ) + @df.addCallback + def _(result, aux_work=aux_work): + if result != (pow_hash <= aux_work['target']): + print >>sys.stderr, 'Merged block submittal result: %s Expected: %s' % (result, pow_hash <= aux_work['target']) + else: + print 'Merged block submittal result: %s' % (result,) + @df.addErrback + def _(err): + log.err(err, 'Error submitting merged block:') + except: + log.err(None, 'Error while processing merged mining POW:') + + if pow_hash <= share_info['bits'].target and header_hash not in received_header_hashes: + last_txout_nonce = pack.IntType(8*self.COINBASE_NONCE_LENGTH).unpack(coinbase_nonce) + share = get_share(header, last_txout_nonce) + + print 'GOT SHARE! %s %s prev %s age %.2fs%s' % ( + user, + p2pool_data.format_hash(share.hash), + p2pool_data.format_hash(share.previous_hash), + time.time() - getwork_time, + ' DEAD ON ARRIVAL' if not on_time else '', + ) + self.my_share_hashes.add(share.hash) + if not on_time: + self.my_doa_share_hashes.add(share.hash) + + self.node.tracker.add(share) + self.node.set_best_share() + + try: + if (pow_hash <= header['bits'].target or p2pool.DEBUG) and self.node.p2p_node is not None: + self.node.p2p_node.broadcast_share(share.hash) + except: + log.err(None, 'Error forwarding block solution:') + + self.share_received.happened(bitcoin_data.target_to_average_attempts(share.target), not on_time, share.hash) + + if pow_hash > target: + print 'Worker %s submitted share with hash > target:' % (user,) + print ' Hash: %56x' % (pow_hash,) + print ' Target: %56x' % (target,) + elif header_hash in received_header_hashes: + print >>sys.stderr, 'Worker %s submitted share more than once!' % (user,) + else: + received_header_hashes.add(header_hash) + + self.pseudoshare_received.happened(bitcoin_data.target_to_average_attempts(target), not on_time, user) + self.recent_shares_ts_work.append((time.time(), bitcoin_data.target_to_average_attempts(target))) + while len(self.recent_shares_ts_work) > 50: + self.recent_shares_ts_work.pop(0) + self.local_rate_monitor.add_datum(dict(work=bitcoin_data.target_to_average_attempts(target), dead=not on_time, user=user, share_target=share_info['bits'].target)) + self.local_addr_rate_monitor.add_datum(dict(work=bitcoin_data.target_to_average_attempts(target), pubkey_hash=pubkey_hash)) + + return on_time + + return ba, got_response diff --git a/run_p2pool.py b/run_p2pool.py new file mode 100755 index 00000000..3b6524e0 --- /dev/null +++ b/run_p2pool.py @@ -0,0 +1,5 @@ +#!/usr/bin/env python + +from p2pool import main + +main.run() diff --git a/setup.py b/setup.py new file mode 100644 index 00000000..95547831 --- /dev/null +++ b/setup.py @@ -0,0 +1,70 @@ +import os +import shutil +import sys +import zipfile +import platform + +from distutils.core import setup +from distutils.sysconfig import get_python_lib +import py2exe + +version = __import__('p2pool').__version__ +im64 = '64' in platform.architecture()[0] + +if os.path.exists('INITBAK'): + os.remove('INITBAK') +os.rename(os.path.join('p2pool', '__init__.py'), 'INITBAK') +try: + open(os.path.join('p2pool', '__init__.py'), 'wb').write('__version__ = %r%s%sDEBUG = False%s' % (version, os.linesep, os.linesep, os.linesep)) + mfcdir = get_python_lib() + '\pythonwin\\' + mfcfiles = [os.path.join(mfcdir, i) for i in ["mfc90.dll", "mfc90u.dll", "mfcm90.dll", "mfcm90u.dll", "Microsoft.VC90.MFC.manifest"]] + bundle = 1 + if im64: + bundle = bundle + 2 + sys.argv[1:] = ['py2exe'] + setup(name='p2pool', + version=version, + description='Peer-to-peer Bitcoin mining pool', + author='Forrest Voight', + author_email='forrest@forre.st', + url='http://p2pool.forre.st/', + data_files=[ + ('', ['README.md']), + ("Microsoft.VC90.MFC", mfcfiles), + ('web-static', [ + 'web-static/d3.v2.min.js', + 'web-static/favicon.ico', + 'web-static/graphs.html', + 'web-static/index.html', + 'web-static/share.html', + ]), + ], + + console=['run_p2pool.py'], + options=dict(py2exe=dict( + bundle_files=bundle, + dll_excludes=['w9xpopen.exe', "mswsock.dll", "MSWSOCK.dll"], + includes=['twisted.web.resource', 'ltc_scrypt'], + )), + zipfile=None, + ) +finally: + os.remove(os.path.join('p2pool', '__init__.py')) + os.rename('INITBAK', os.path.join('p2pool', '__init__.py')) + +win = '32' +if im64: + win = '64' + +dir_name = 'p2pool_win' + win + '_' + version + +if os.path.exists(dir_name): + shutil.rmtree(dir_name) +os.rename('dist', dir_name) + +with zipfile.ZipFile(dir_name + '.zip', 'w', zipfile.ZIP_DEFLATED) as zf: + for dirpath, dirnames, filenames in os.walk(dir_name): + for filename in filenames: + zf.write(os.path.join(dirpath, filename)) + +print dir_name diff --git a/wstools/.cvsignore b/wstools/.cvsignore new file mode 100644 index 00000000..0d20b648 --- /dev/null +++ b/wstools/.cvsignore @@ -0,0 +1 @@ +*.pyc diff --git a/wstools/MIMEAttachment.py b/wstools/MIMEAttachment.py new file mode 100644 index 00000000..2376cc83 --- /dev/null +++ b/wstools/MIMEAttachment.py @@ -0,0 +1,110 @@ +#TODO add the license +#I had to rewrite this class because the python MIME email.mime (version 2.5) +#are buggy, they use \n instead \r\n for new line which is not compliant +#to standard! +# http://bugs.python.org/issue5525 + +#TODO do not load all the message in memory stream it from the disk + +import re +import random +import sys + + +#new line +NL='\r\n' + +_width = len(repr(sys.maxint-1)) +_fmt = '%%0%dd' % _width + +class MIMEMessage: + + def __init__(self): + self._files = [] + self._xmlMessage = "" + self._startCID = "" + self._boundary = "" + + def makeBoundary(self): + #create the boundary + msgparts = [] + msgparts.append(self._xmlMessage) + for i in self._files: + msgparts.append(i.read()) + #this sucks, all in memory + alltext = NL.join(msgparts) + self._boundary = _make_boundary(alltext) + #maybe I can save some memory + del alltext + del msgparts + self._startCID = "<" + (_fmt % random.randrange(sys.maxint)) + (_fmt % random.randrange(sys.maxint)) + ">" + + + def toString(self): + '''it return a string with the MIME message''' + if len(self._boundary) == 0: + #the makeBoundary hasn't been called yet + self.makeBoundary() + #ok we have everything let's start to spit the message out + #first the XML + returnstr = NL + "--" + self._boundary + NL + returnstr += "Content-Type: text/xml; charset=\"us-ascii\"" + NL + returnstr += "Content-Transfer-Encoding: 7bit" + NL + returnstr += "Content-Id: " + self._startCID + NL + NL + returnstr += self._xmlMessage + NL + #then the files + for file in self._files: + returnstr += "--" + self._boundary + NL + returnstr += "Content-Type: application/octet-stream" + NL + returnstr += "Content-Transfer-Encoding: binary" + NL + returnstr += "Content-Id: <" + str(id(file)) + ">" + NL + NL + file.seek(0) + returnstr += file.read() + NL + #closing boundary + returnstr += "--" + self._boundary + "--" + NL + return returnstr + + def attachFile(self, file): + ''' + it adds a file to this attachment + ''' + self._files.append(file) + + def addXMLMessage(self, xmlMessage): + ''' + it adds the XML message. we can have only one XML SOAP message + ''' + self._xmlMessage = xmlMessage + + def getBoundary(self): + ''' + this function returns the string used in the mime message as a + boundary. First the write method as to be called + ''' + return self._boundary + + def getStartCID(self): + ''' + This function returns the CID of the XML message + ''' + return self._startCID + + +def _make_boundary(text=None): + #some code taken from python stdlib + # Craft a random boundary. If text is given, ensure that the chosen + # boundary doesn't appear in the text. + token = random.randrange(sys.maxint) + boundary = ('=' * 10) + (_fmt % token) + '==' + if text is None: + return boundary + b = boundary + counter = 0 + while True: + cre = re.compile('^--' + re.escape(b) + '(--)?$', re.MULTILINE) + if not cre.search(text): + break + b = boundary + '.' + str(counter) + counter += 1 + return b + diff --git a/wstools/Namespaces.py b/wstools/Namespaces.py new file mode 100755 index 00000000..46a8b05d --- /dev/null +++ b/wstools/Namespaces.py @@ -0,0 +1,214 @@ +# Copyright (c) 2001 Zope Corporation and Contributors. All Rights Reserved. +# +# This software is subject to the provisions of the Zope Public License, +# Version 2.0 (ZPL). A copy of the ZPL should accompany this distribution. +# THIS SOFTWARE IS PROVIDED "AS IS" AND ANY AND ALL EXPRESS OR IMPLIED +# WARRANTIES ARE DISCLAIMED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +# WARRANTIES OF TITLE, MERCHANTABILITY, AGAINST INFRINGEMENT, AND FITNESS +# FOR A PARTICULAR PURPOSE. +"""Namespace module, so you don't need PyXML +""" + +ident = "$Id$" +try: + from xml.ns import SOAP, SCHEMA, WSDL, XMLNS, DSIG, ENCRYPTION + DSIG.C14N = "http://www.w3.org/TR/2001/REC-xml-c14n-20010315" + +except: + class SOAP: + ENV = "http://schemas.xmlsoap.org/soap/envelope/" + ENC = "http://schemas.xmlsoap.org/soap/encoding/" + ACTOR_NEXT = "http://schemas.xmlsoap.org/soap/actor/next" + + class SCHEMA: + XSD1 = "http://www.w3.org/1999/XMLSchema" + XSD2 = "http://www.w3.org/2000/10/XMLSchema" + XSD3 = "http://www.w3.org/2001/XMLSchema" + XSD_LIST = [ XSD1, XSD2, XSD3] + XSI1 = "http://www.w3.org/1999/XMLSchema-instance" + XSI2 = "http://www.w3.org/2000/10/XMLSchema-instance" + XSI3 = "http://www.w3.org/2001/XMLSchema-instance" + XSI_LIST = [ XSI1, XSI2, XSI3 ] + BASE = XSD3 + + class WSDL: + BASE = "http://schemas.xmlsoap.org/wsdl/" + BIND_HTTP = "http://schemas.xmlsoap.org/wsdl/http/" + BIND_MIME = "http://schemas.xmlsoap.org/wsdl/mime/" + BIND_SOAP = "http://schemas.xmlsoap.org/wsdl/soap/" + BIND_SOAP12 = "http://schemas.xmlsoap.org/wsdl/soap12/" + + class XMLNS: + BASE = "http://www.w3.org/2000/xmlns/" + XML = "http://www.w3.org/XML/1998/namespace" + HTML = "http://www.w3.org/TR/REC-html40" + + class DSIG: + BASE = "http://www.w3.org/2000/09/xmldsig#" + C14N = "http://www.w3.org/TR/2001/REC-xml-c14n-20010315" + C14N_COMM = "http://www.w3.org/TR/2000/CR-xml-c14n-20010315#WithComments" + C14N_EXCL = "http://www.w3.org/2001/10/xml-exc-c14n#" + DIGEST_MD2 = "http://www.w3.org/2000/09/xmldsig#md2" + DIGEST_MD5 = "http://www.w3.org/2000/09/xmldsig#md5" + DIGEST_SHA1 = "http://www.w3.org/2000/09/xmldsig#sha1" + ENC_BASE64 = "http://www.w3.org/2000/09/xmldsig#base64" + ENVELOPED = "http://www.w3.org/2000/09/xmldsig#enveloped-signature" + HMAC_SHA1 = "http://www.w3.org/2000/09/xmldsig#hmac-sha1" + SIG_DSA_SHA1 = "http://www.w3.org/2000/09/xmldsig#dsa-sha1" + SIG_RSA_SHA1 = "http://www.w3.org/2000/09/xmldsig#rsa-sha1" + XPATH = "http://www.w3.org/TR/1999/REC-xpath-19991116" + XSLT = "http://www.w3.org/TR/1999/REC-xslt-19991116" + + class ENCRYPTION: + BASE = "http://www.w3.org/2001/04/xmlenc#" + BLOCK_3DES = "http://www.w3.org/2001/04/xmlenc#des-cbc" + BLOCK_AES128 = "http://www.w3.org/2001/04/xmlenc#aes128-cbc" + BLOCK_AES192 = "http://www.w3.org/2001/04/xmlenc#aes192-cbc" + BLOCK_AES256 = "http://www.w3.org/2001/04/xmlenc#aes256-cbc" + DIGEST_RIPEMD160 = "http://www.w3.org/2001/04/xmlenc#ripemd160" + DIGEST_SHA256 = "http://www.w3.org/2001/04/xmlenc#sha256" + DIGEST_SHA512 = "http://www.w3.org/2001/04/xmlenc#sha512" + KA_DH = "http://www.w3.org/2001/04/xmlenc#dh" + KT_RSA_1_5 = "http://www.w3.org/2001/04/xmlenc#rsa-1_5" + KT_RSA_OAEP = "http://www.w3.org/2001/04/xmlenc#rsa-oaep-mgf1p" + STREAM_ARCFOUR = "http://www.w3.org/2001/04/xmlenc#arcfour" + WRAP_3DES = "http://www.w3.org/2001/04/xmlenc#kw-3des" + WRAP_AES128 = "http://www.w3.org/2001/04/xmlenc#kw-aes128" + WRAP_AES192 = "http://www.w3.org/2001/04/xmlenc#kw-aes192" + WRAP_AES256 = "http://www.w3.org/2001/04/xmlenc#kw-aes256" + + +class WSRF_V1_2: + '''OASIS WSRF Specifications Version 1.2 + ''' + class LIFETIME: + XSD_DRAFT1 = "http://docs.oasis-open.org/wsrf/2004/06/wsrf-WS-ResourceLifetime-1.2-draft-01.xsd" + XSD_DRAFT4 = "http://docs.oasis-open.org/wsrf/2004/11/wsrf-WS-ResourceLifetime-1.2-draft-04.xsd" + + WSDL_DRAFT1 = "http://docs.oasis-open.org/wsrf/2004/06/wsrf-WS-ResourceLifetime-1.2-draft-01.wsdl" + WSDL_DRAFT4 = "http://docs.oasis-open.org/wsrf/2004/11/wsrf-WS-ResourceLifetime-1.2-draft-04.wsdl" + LATEST = WSDL_DRAFT4 + WSDL_LIST = (WSDL_DRAFT1, WSDL_DRAFT4) + XSD_LIST = (XSD_DRAFT1, XSD_DRAFT4) + + class PROPERTIES: + XSD_DRAFT1 = "http://docs.oasis-open.org/wsrf/2004/06/wsrf-WS-ResourceProperties-1.2-draft-01.xsd" + XSD_DRAFT5 = "http://docs.oasis-open.org/wsrf/2004/11/wsrf-WS-ResourceProperties-1.2-draft-05.xsd" + + WSDL_DRAFT1 = "http://docs.oasis-open.org/wsrf/2004/06/wsrf-WS-ResourceProperties-1.2-draft-01.wsdl" + WSDL_DRAFT5 = "http://docs.oasis-open.org/wsrf/2004/11/wsrf-WS-ResourceProperties-1.2-draft-05.wsdl" + LATEST = WSDL_DRAFT5 + WSDL_LIST = (WSDL_DRAFT1, WSDL_DRAFT5) + XSD_LIST = (XSD_DRAFT1, XSD_DRAFT5) + + class BASENOTIFICATION: + XSD_DRAFT1 = "http://docs.oasis-open.org/wsn/2004/06/wsn-WS-BaseNotification-1.2-draft-01.xsd" + + WSDL_DRAFT1 = "http://docs.oasis-open.org/wsn/2004/06/wsn-WS-BaseNotification-1.2-draft-01.wsdl" + LATEST = WSDL_DRAFT1 + WSDL_LIST = (WSDL_DRAFT1,) + XSD_LIST = (XSD_DRAFT1,) + + class BASEFAULTS: + XSD_DRAFT1 = "http://docs.oasis-open.org/wsrf/2004/06/wsrf-WS-BaseFaults-1.2-draft-01.xsd" + XSD_DRAFT3 = "http://docs.oasis-open.org/wsrf/2004/11/wsrf-WS-BaseFaults-1.2-draft-03.xsd" + #LATEST = DRAFT3 + #WSDL_LIST = (WSDL_DRAFT1, WSDL_DRAFT3) + XSD_LIST = (XSD_DRAFT1, XSD_DRAFT3) + +WSRF = WSRF_V1_2 +WSRFLIST = (WSRF_V1_2,) + + +class OASIS: + '''URLs for Oasis specifications + ''' + WSSE = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-wssecurity-secext-1.0.xsd" + UTILITY = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-wssecurity-utility-1.0.xsd" + + class X509TOKEN: + Base64Binary = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-soap-message-security-1.0#Base64Binary" + STRTransform = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-soap-message-security-1.0" + PKCS7 = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-x509-token-profile-1.0#PKCS7" + X509 = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-x509-token-profile-1.0#X509" + X509PKIPathv1 = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-x509-token-profile-1.0#X509PKIPathv1" + X509v3SubjectKeyIdentifier = "http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-x509-token-profile-1.0#X509v3SubjectKeyIdentifier" + + LIFETIME = WSRF_V1_2.LIFETIME.XSD_DRAFT1 + PROPERTIES = WSRF_V1_2.PROPERTIES.XSD_DRAFT1 + BASENOTIFICATION = WSRF_V1_2.BASENOTIFICATION.XSD_DRAFT1 + BASEFAULTS = WSRF_V1_2.BASEFAULTS.XSD_DRAFT1 + + +class APACHE: + '''This name space is defined by AXIS and it is used for the TC in TCapache.py, + Map and file attachment (DataHandler) + ''' + AXIS_NS = "http://xml.apache.org/xml-soap" + + +class WSTRUST: + BASE = "http://schemas.xmlsoap.org/ws/2004/04/trust" + ISSUE = "http://schemas.xmlsoap.org/ws/2004/04/trust/Issue" + +class WSSE: + BASE = "http://schemas.xmlsoap.org/ws/2002/04/secext" + TRUST = WSTRUST.BASE + + +class WSU: + BASE = "http://schemas.xmlsoap.org/ws/2002/04/utility" + UTILITY = "http://schemas.xmlsoap.org/ws/2002/07/utility" + + +class WSR: + PROPERTIES = "http://www.ibm.com/xmlns/stdwip/web-services/WS-ResourceProperties" + LIFETIME = "http://www.ibm.com/xmlns/stdwip/web-services/WS-ResourceLifetime" + + +class WSA200508: + ADDRESS = "http://www.w3.org/2005/08/addressing" + ANONYMOUS = "%s/anonymous" %ADDRESS + FAULT = "%s/fault" %ADDRESS + +class WSA200408: + ADDRESS = "http://schemas.xmlsoap.org/ws/2004/08/addressing" + ANONYMOUS = "%s/role/anonymous" %ADDRESS + FAULT = "%s/fault" %ADDRESS + +class WSA200403: + ADDRESS = "http://schemas.xmlsoap.org/ws/2004/03/addressing" + ANONYMOUS = "%s/role/anonymous" %ADDRESS + FAULT = "%s/fault" %ADDRESS + +class WSA200303: + ADDRESS = "http://schemas.xmlsoap.org/ws/2003/03/addressing" + ANONYMOUS = "%s/role/anonymous" %ADDRESS + FAULT = None + + +WSA = WSA200408 +WSA_LIST = (WSA200508, WSA200408, WSA200403, WSA200303) + +class _WSAW(str): + """ Define ADDRESS attribute to be compatible with WSA* layout """ + ADDRESS = property(lambda s: s) + +WSAW200605 = _WSAW("http://www.w3.org/2006/05/addressing/wsdl") + +WSAW_LIST = (WSAW200605,) + +class WSP: + POLICY = "http://schemas.xmlsoap.org/ws/2002/12/policy" + +class BEA: + SECCONV = "http://schemas.xmlsoap.org/ws/2004/04/sc" + SCTOKEN = "http://schemas.xmlsoap.org/ws/2004/04/security/sc/sct" + +class GLOBUS: + SECCONV = "http://wsrf.globus.org/core/2004/07/security/secconv" + CORE = "http://www.globus.org/namespaces/2004/06/core" + SIG = "http://www.globus.org/2002/04/xmlenc#gssapi-sign" + TOKEN = "http://www.globus.org/ws/2004/09/security/sc#GSSAPI_GSI_TOKEN" + +ZSI_SCHEMA_URI = 'http://www.zolera.com/schemas/ZSI/' diff --git a/wstools/TimeoutSocket.py b/wstools/TimeoutSocket.py new file mode 100755 index 00000000..48b898d8 --- /dev/null +++ b/wstools/TimeoutSocket.py @@ -0,0 +1,179 @@ +"""Based on code from timeout_socket.py, with some tweaks for compatibility. + These tweaks should really be rolled back into timeout_socket, but it's + not totally clear who is maintaining it at this point. In the meantime, + we'll use a different module name for our tweaked version to avoid any + confusion. + + The original timeout_socket is by: + + Scott Cotton + Lloyd Zusman + Phil Mayes + Piers Lauder + Radovan Garabik +""" + +ident = "$Id$" + +import string, socket, select, errno + +WSAEINVAL = getattr(errno, 'WSAEINVAL', 10022) + + +class TimeoutSocket: + """A socket imposter that supports timeout limits.""" + + def __init__(self, timeout=20, sock=None): + self.timeout = float(timeout) + self.inbuf = '' + if sock is None: + sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) + self.sock = sock + self.sock.setblocking(0) + self._rbuf = '' + self._wbuf = '' + + def __getattr__(self, name): + # Delegate to real socket attributes. + return getattr(self.sock, name) + + def connect(self, *addr): + timeout = self.timeout + sock = self.sock + try: + # Non-blocking mode + sock.setblocking(0) + apply(sock.connect, addr) + sock.setblocking(timeout != 0) + return 1 + except socket.error,why: + if not timeout: + raise + sock.setblocking(1) + if len(why.args) == 1: + code = 0 + else: + code, why = why + if code not in ( + errno.EINPROGRESS, errno.EALREADY, errno.EWOULDBLOCK + ): + raise + r,w,e = select.select([],[sock],[],timeout) + if w: + try: + apply(sock.connect, addr) + return 1 + except socket.error,why: + if len(why.args) == 1: + code = 0 + else: + code, why = why + if code in (errno.EISCONN, WSAEINVAL): + return 1 + raise + raise TimeoutError('socket connect() timeout.') + + def send(self, data, flags=0): + total = len(data) + next = 0 + while 1: + r, w, e = select.select([],[self.sock], [], self.timeout) + if w: + buff = data[next:next + 8192] + sent = self.sock.send(buff, flags) + next = next + sent + if next == total: + return total + continue + raise TimeoutError('socket send() timeout.') + + def recv(self, amt, flags=0): + if select.select([self.sock], [], [], self.timeout)[0]: + return self.sock.recv(amt, flags) + raise TimeoutError('socket recv() timeout.') + + buffsize = 4096 + handles = 1 + + def makefile(self, mode="r", buffsize=-1): + self.handles = self.handles + 1 + self.mode = mode + return self + + def close(self): + self.handles = self.handles - 1 + if self.handles == 0 and self.sock.fileno() >= 0: + self.sock.close() + + def read(self, n=-1): + if not isinstance(n, type(1)): + n = -1 + if n >= 0: + k = len(self._rbuf) + if n <= k: + data = self._rbuf[:n] + self._rbuf = self._rbuf[n:] + return data + n = n - k + L = [self._rbuf] + self._rbuf = "" + while n > 0: + new = self.recv(max(n, self.buffsize)) + if not new: break + k = len(new) + if k > n: + L.append(new[:n]) + self._rbuf = new[n:] + break + L.append(new) + n = n - k + return "".join(L) + k = max(4096, self.buffsize) + L = [self._rbuf] + self._rbuf = "" + while 1: + new = self.recv(k) + if not new: break + L.append(new) + k = min(k*2, 1024**2) + return "".join(L) + + def readline(self, limit=-1): + data = "" + i = self._rbuf.find('\n') + while i < 0 and not (0 < limit <= len(self._rbuf)): + new = self.recv(self.buffsize) + if not new: break + i = new.find('\n') + if i >= 0: i = i + len(self._rbuf) + self._rbuf = self._rbuf + new + if i < 0: i = len(self._rbuf) + else: i = i+1 + if 0 <= limit < len(self._rbuf): i = limit + data, self._rbuf = self._rbuf[:i], self._rbuf[i:] + return data + + def readlines(self, sizehint = 0): + total = 0 + list = [] + while 1: + line = self.readline() + if not line: break + list.append(line) + total += len(line) + if sizehint and total >= sizehint: + break + return list + + def writelines(self, list): + self.send(''.join(list)) + + def write(self, data): + self.send(data) + + def flush(self): + pass + + +class TimeoutError(Exception): + pass diff --git a/wstools/UserTuple.py b/wstools/UserTuple.py new file mode 100644 index 00000000..b8c36539 --- /dev/null +++ b/wstools/UserTuple.py @@ -0,0 +1,99 @@ +""" +A more or less complete user-defined wrapper around tuple objects. +Adapted version of the standard library's UserList. + +Taken from Stefan Schwarzer's ftputil library, available at +, and used under this license: + + + + +Copyright (C) 1999, Stefan Schwarzer +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + +- Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +- Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +- Neither the name of the above author nor the names of the + contributors to the software may be used to endorse or promote + products derived from this software without specific prior written + permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +""" + + + + +# $Id$ + +#XXX tuple instances (in Python 2.2) contain also: +# __class__, __delattr__, __getattribute__, __hash__, __new__, +# __reduce__, __setattr__, __str__ +# What about these? + +class UserTuple: + def __init__(self, inittuple=None): + self.data = () + if inittuple is not None: + # XXX should this accept an arbitrary sequence? + if type(inittuple) == type(self.data): + self.data = inittuple + elif isinstance(inittuple, UserTuple): + # this results in + # self.data is inittuple.data + # but that's ok for tuples because they are + # immutable. (Builtin tuples behave the same.) + self.data = inittuple.data[:] + else: + # the same applies here; (t is tuple(t)) == 1 + self.data = tuple(inittuple) + def __repr__(self): return repr(self.data) + def __lt__(self, other): return self.data < self.__cast(other) + def __le__(self, other): return self.data <= self.__cast(other) + def __eq__(self, other): return self.data == self.__cast(other) + def __ne__(self, other): return self.data != self.__cast(other) + def __gt__(self, other): return self.data > self.__cast(other) + def __ge__(self, other): return self.data >= self.__cast(other) + def __cast(self, other): + if isinstance(other, UserTuple): return other.data + else: return other + def __cmp__(self, other): + return cmp(self.data, self.__cast(other)) + def __contains__(self, item): return item in self.data + def __len__(self): return len(self.data) + def __getitem__(self, i): return self.data[i] + def __getslice__(self, i, j): + i = max(i, 0); j = max(j, 0) + return self.__class__(self.data[i:j]) + def __add__(self, other): + if isinstance(other, UserTuple): + return self.__class__(self.data + other.data) + elif isinstance(other, type(self.data)): + return self.__class__(self.data + other) + else: + return self.__class__(self.data + tuple(other)) + # dir( () ) contains no __radd__ (at least in Python 2.2) + def __mul__(self, n): + return self.__class__(self.data*n) + __rmul__ = __mul__ + diff --git a/wstools/Utility.py b/wstools/Utility.py new file mode 100755 index 00000000..df536b9f --- /dev/null +++ b/wstools/Utility.py @@ -0,0 +1,1382 @@ +# Copyright (c) 2003, The Regents of the University of California, +# through Lawrence Berkeley National Laboratory (subject to receipt of +# any required approvals from the U.S. Dept. of Energy). All rights +# reserved. +# +# Copyright (c) 2001 Zope Corporation and Contributors. All Rights Reserved. +# +# This software is subject to the provisions of the Zope Public License, +# Version 2.0 (ZPL). A copy of the ZPL should accompany this distribution. +# THIS SOFTWARE IS PROVIDED "AS IS" AND ANY AND ALL EXPRESS OR IMPLIED +# WARRANTIES ARE DISCLAIMED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +# WARRANTIES OF TITLE, MERCHANTABILITY, AGAINST INFRINGEMENT, AND FITNESS +# FOR A PARTICULAR PURPOSE. + +ident = "$Id$" + +import sys, types, httplib, urllib, socket, weakref +from os.path import isfile +from string import join, strip, split +from UserDict import UserDict +from cStringIO import StringIO +from TimeoutSocket import TimeoutSocket, TimeoutError +from urlparse import urlparse +from httplib import HTTPConnection, HTTPSConnection +from exceptions import Exception +try: + from ZSI import _get_idstr +except: + def _get_idstr(pyobj): + '''Python 2.3.x generates a FutureWarning for negative IDs, so + we use a different prefix character to ensure uniqueness, and + call abs() to avoid the warning.''' + x = id(pyobj) + if x < 0: + return 'x%x' % abs(x) + return 'o%x' % x + +import xml.dom.minidom +from xml.dom import Node + +import logging +from c14n import Canonicalize +from Namespaces import SCHEMA, SOAP, XMLNS, ZSI_SCHEMA_URI + + +try: + from xml.dom.ext import SplitQName +except: + def SplitQName(qname): + '''SplitQName(qname) -> (string, string) + + Split Qualified Name into a tuple of len 2, consisting + of the prefix and the local name. + + (prefix, localName) + + Special Cases: + xmlns -- (localName, 'xmlns') + None -- (None, localName) + ''' + + l = qname.split(':') + if len(l) == 1: + l.insert(0, None) + elif len(l) == 2: + if l[0] == 'xmlns': + l.reverse() + else: + return + return tuple(l) + +# +# python2.3 urllib.basejoin does not remove current directory ./ +# from path and this causes problems on subsequent basejoins. +# +basejoin = urllib.basejoin +if sys.version_info[0:2] < (2, 4, 0, 'final', 0)[0:2]: + #basejoin = lambda base,url: urllib.basejoin(base,url.lstrip('./')) + token = './' + def basejoin(base, url): + if url.startswith(token) is True: + return urllib.basejoin(base,url[2:]) + return urllib.basejoin(base,url) + +class NamespaceError(Exception): + """Used to indicate a Namespace Error.""" + + +class RecursionError(Exception): + """Used to indicate a HTTP redirect recursion.""" + + +class ParseError(Exception): + """Used to indicate a XML parsing error.""" + + +class DOMException(Exception): + """Used to indicate a problem processing DOM.""" + + +class Base: + """Base class for instance level Logging""" + def __init__(self, module=__name__): + self.logger = logging.getLogger('%s-%s(%s)' %(module, self.__class__, _get_idstr(self))) + + +class HTTPResponse: + """Captures the information in an HTTP response message.""" + + def __init__(self, response): + self.status = response.status + self.reason = response.reason + self.headers = response.msg + self.body = response.read() or None + response.close() + +class TimeoutHTTP(HTTPConnection): + """A custom http connection object that supports socket timeout.""" + def __init__(self, host, port=None, timeout=20): + HTTPConnection.__init__(self, host, port) + self.timeout = timeout + + def connect(self): + self.sock = TimeoutSocket(self.timeout) + self.sock.connect((self.host, self.port)) + + +class TimeoutHTTPS(HTTPSConnection): + """A custom https object that supports socket timeout. Note that this + is not really complete. The builtin SSL support in the Python socket + module requires a real socket (type) to be passed in to be hooked to + SSL. That means our fake socket won't work and our timeout hacks are + bypassed for send and recv calls. Since our hack _is_ in place at + connect() time, it should at least provide some timeout protection.""" + def __init__(self, host, port=None, timeout=20, **kwargs): + HTTPSConnection.__init__(self, str(host), port, **kwargs) + self.timeout = timeout + + def connect(self): + sock = TimeoutSocket(self.timeout) + sock.connect((self.host, self.port)) + realsock = getattr(sock.sock, '_sock', sock.sock) + ssl = socket.ssl(realsock, self.key_file, self.cert_file) + self.sock = httplib.FakeSocket(sock, ssl) + + +def urlopen(url, timeout=20, redirects=None): + """A minimal urlopen replacement hack that supports timeouts for http. + Note that this supports GET only.""" + scheme, host, path, params, query, frag = urlparse(url) + + if not scheme in ('http', 'https'): + return urllib.urlopen(url) + if params: path = '%s;%s' % (path, params) + if query: path = '%s?%s' % (path, query) + if frag: path = '%s#%s' % (path, frag) + + if scheme == 'https': + # If ssl is not compiled into Python, you will not get an exception + # until a conn.endheaders() call. We need to know sooner, so use + # getattr. + try: + import M2Crypto + except ImportError: + if not hasattr(socket, 'ssl'): + raise RuntimeError, 'no built-in SSL Support' + + conn = TimeoutHTTPS(host, None, timeout) + else: + ctx = M2Crypto.SSL.Context() + ctx.set_session_timeout(timeout) + conn = M2Crypto.httpslib.HTTPSConnection(host, ssl_context=ctx) + conn.set_debuglevel(1) + + else: + conn = TimeoutHTTP(host, None, timeout) + + conn.putrequest('GET', path) + conn.putheader('Connection', 'close') + conn.endheaders() + response = None + while 1: + response = conn.getresponse() + if response.status != 100: + break + conn._HTTPConnection__state = httplib._CS_REQ_SENT + conn._HTTPConnection__response = None + + status = response.status + + # If we get an HTTP redirect, we will follow it automatically. + if status >= 300 and status < 400: + location = response.msg.getheader('location') + if location is not None: + response.close() + if redirects is not None and redirects.has_key(location): + raise RecursionError( + 'Circular HTTP redirection detected.' + ) + if redirects is None: + redirects = {} + redirects[location] = 1 + return urlopen(location, timeout, redirects) + raise HTTPResponse(response) + + if not (status >= 200 and status < 300): + raise HTTPResponse(response) + + body = StringIO(response.read()) + response.close() + return body + +class DOM: + """The DOM singleton defines a number of XML related constants and + provides a number of utility methods for DOM related tasks. It + also provides some basic abstractions so that the rest of the + package need not care about actual DOM implementation in use.""" + + # Namespace stuff related to the SOAP specification. + + NS_SOAP_ENV_1_1 = 'http://schemas.xmlsoap.org/soap/envelope/' + NS_SOAP_ENC_1_1 = 'http://schemas.xmlsoap.org/soap/encoding/' + + NS_SOAP_ENV_1_2 = 'http://www.w3.org/2001/06/soap-envelope' + NS_SOAP_ENC_1_2 = 'http://www.w3.org/2001/06/soap-encoding' + + NS_SOAP_ENV_ALL = (NS_SOAP_ENV_1_1, NS_SOAP_ENV_1_2) + NS_SOAP_ENC_ALL = (NS_SOAP_ENC_1_1, NS_SOAP_ENC_1_2) + + NS_SOAP_ENV = NS_SOAP_ENV_1_1 + NS_SOAP_ENC = NS_SOAP_ENC_1_1 + + _soap_uri_mapping = { + NS_SOAP_ENV_1_1 : '1.1', + NS_SOAP_ENV_1_2 : '1.2', + } + + SOAP_ACTOR_NEXT_1_1 = 'http://schemas.xmlsoap.org/soap/actor/next' + SOAP_ACTOR_NEXT_1_2 = 'http://www.w3.org/2001/06/soap-envelope/actor/next' + SOAP_ACTOR_NEXT_ALL = (SOAP_ACTOR_NEXT_1_1, SOAP_ACTOR_NEXT_1_2) + + def SOAPUriToVersion(self, uri): + """Return the SOAP version related to an envelope uri.""" + value = self._soap_uri_mapping.get(uri) + if value is not None: + return value + raise ValueError( + 'Unsupported SOAP envelope uri: %s' % uri + ) + + def GetSOAPEnvUri(self, version): + """Return the appropriate SOAP envelope uri for a given + human-friendly SOAP version string (e.g. '1.1').""" + attrname = 'NS_SOAP_ENV_%s' % join(split(version, '.'), '_') + value = getattr(self, attrname, None) + if value is not None: + return value + raise ValueError( + 'Unsupported SOAP version: %s' % version + ) + + def GetSOAPEncUri(self, version): + """Return the appropriate SOAP encoding uri for a given + human-friendly SOAP version string (e.g. '1.1').""" + attrname = 'NS_SOAP_ENC_%s' % join(split(version, '.'), '_') + value = getattr(self, attrname, None) + if value is not None: + return value + raise ValueError( + 'Unsupported SOAP version: %s' % version + ) + + def GetSOAPActorNextUri(self, version): + """Return the right special next-actor uri for a given + human-friendly SOAP version string (e.g. '1.1').""" + attrname = 'SOAP_ACTOR_NEXT_%s' % join(split(version, '.'), '_') + value = getattr(self, attrname, None) + if value is not None: + return value + raise ValueError( + 'Unsupported SOAP version: %s' % version + ) + + + # Namespace stuff related to XML Schema. + + NS_XSD_99 = 'http://www.w3.org/1999/XMLSchema' + NS_XSI_99 = 'http://www.w3.org/1999/XMLSchema-instance' + + NS_XSD_00 = 'http://www.w3.org/2000/10/XMLSchema' + NS_XSI_00 = 'http://www.w3.org/2000/10/XMLSchema-instance' + + NS_XSD_01 = 'http://www.w3.org/2001/XMLSchema' + NS_XSI_01 = 'http://www.w3.org/2001/XMLSchema-instance' + + NS_XSD_ALL = (NS_XSD_99, NS_XSD_00, NS_XSD_01) + NS_XSI_ALL = (NS_XSI_99, NS_XSI_00, NS_XSI_01) + + NS_XSD = NS_XSD_01 + NS_XSI = NS_XSI_01 + + _xsd_uri_mapping = { + NS_XSD_99 : NS_XSI_99, + NS_XSD_00 : NS_XSI_00, + NS_XSD_01 : NS_XSI_01, + } + + for key, value in _xsd_uri_mapping.items(): + _xsd_uri_mapping[value] = key + + + def InstanceUriForSchemaUri(self, uri): + """Return the appropriate matching XML Schema instance uri for + the given XML Schema namespace uri.""" + return self._xsd_uri_mapping.get(uri) + + def SchemaUriForInstanceUri(self, uri): + """Return the appropriate matching XML Schema namespace uri for + the given XML Schema instance namespace uri.""" + return self._xsd_uri_mapping.get(uri) + + + # Namespace stuff related to WSDL. + + NS_WSDL_1_1 = 'http://schemas.xmlsoap.org/wsdl/' + NS_WSDL_ALL = (NS_WSDL_1_1,) + NS_WSDL = NS_WSDL_1_1 + + NS_SOAP_BINDING_1_1 = 'http://schemas.xmlsoap.org/wsdl/soap/' + NS_HTTP_BINDING_1_1 = 'http://schemas.xmlsoap.org/wsdl/http/' + NS_MIME_BINDING_1_1 = 'http://schemas.xmlsoap.org/wsdl/mime/' + + NS_SOAP_BINDING_ALL = (NS_SOAP_BINDING_1_1,) + NS_HTTP_BINDING_ALL = (NS_HTTP_BINDING_1_1,) + NS_MIME_BINDING_ALL = (NS_MIME_BINDING_1_1,) + + NS_SOAP_BINDING = NS_SOAP_BINDING_1_1 + NS_HTTP_BINDING = NS_HTTP_BINDING_1_1 + NS_MIME_BINDING = NS_MIME_BINDING_1_1 + + NS_SOAP_HTTP_1_1 = 'http://schemas.xmlsoap.org/soap/http' + NS_SOAP_HTTP_ALL = (NS_SOAP_HTTP_1_1,) + NS_SOAP_HTTP = NS_SOAP_HTTP_1_1 + + + _wsdl_uri_mapping = { + NS_WSDL_1_1 : '1.1', + } + + def WSDLUriToVersion(self, uri): + """Return the WSDL version related to a WSDL namespace uri.""" + value = self._wsdl_uri_mapping.get(uri) + if value is not None: + return value + raise ValueError( + 'Unsupported SOAP envelope uri: %s' % uri + ) + + def GetWSDLUri(self, version): + attr = 'NS_WSDL_%s' % join(split(version, '.'), '_') + value = getattr(self, attr, None) + if value is not None: + return value + raise ValueError( + 'Unsupported WSDL version: %s' % version + ) + + def GetWSDLSoapBindingUri(self, version): + attr = 'NS_SOAP_BINDING_%s' % join(split(version, '.'), '_') + value = getattr(self, attr, None) + if value is not None: + return value + raise ValueError( + 'Unsupported WSDL version: %s' % version + ) + + def GetWSDLHttpBindingUri(self, version): + attr = 'NS_HTTP_BINDING_%s' % join(split(version, '.'), '_') + value = getattr(self, attr, None) + if value is not None: + return value + raise ValueError( + 'Unsupported WSDL version: %s' % version + ) + + def GetWSDLMimeBindingUri(self, version): + attr = 'NS_MIME_BINDING_%s' % join(split(version, '.'), '_') + value = getattr(self, attr, None) + if value is not None: + return value + raise ValueError( + 'Unsupported WSDL version: %s' % version + ) + + def GetWSDLHttpTransportUri(self, version): + attr = 'NS_SOAP_HTTP_%s' % join(split(version, '.'), '_') + value = getattr(self, attr, None) + if value is not None: + return value + raise ValueError( + 'Unsupported WSDL version: %s' % version + ) + + + # Other xml namespace constants. + NS_XMLNS = 'http://www.w3.org/2000/xmlns/' + + + + def isElement(self, node, name, nsuri=None): + """Return true if the given node is an element with the given + name and optional namespace uri.""" + if node.nodeType != node.ELEMENT_NODE: + return 0 + return node.localName == name and \ + (nsuri is None or self.nsUriMatch(node.namespaceURI, nsuri)) + + def getElement(self, node, name, nsuri=None, default=join): + """Return the first child of node with a matching name and + namespace uri, or the default if one is provided.""" + nsmatch = self.nsUriMatch + ELEMENT_NODE = node.ELEMENT_NODE + for child in node.childNodes: + if child.nodeType == ELEMENT_NODE: + if ((child.localName == name or name is None) and + (nsuri is None or nsmatch(child.namespaceURI, nsuri)) + ): + return child + if default is not join: + return default + raise KeyError, name + + def getElementById(self, node, id, default=join): + """Return the first child of node matching an id reference.""" + attrget = self.getAttr + ELEMENT_NODE = node.ELEMENT_NODE + for child in node.childNodes: + if child.nodeType == ELEMENT_NODE: + if attrget(child, 'id') == id: + return child + if default is not join: + return default + raise KeyError, name + + def getMappingById(self, document, depth=None, element=None, + mapping=None, level=1): + """Create an id -> element mapping of those elements within a + document that define an id attribute. The depth of the search + may be controlled by using the (1-based) depth argument.""" + if document is not None: + element = document.documentElement + mapping = {} + attr = element._attrs.get('id', None) + if attr is not None: + mapping[attr.value] = element + if depth is None or depth > level: + level = level + 1 + ELEMENT_NODE = element.ELEMENT_NODE + for child in element.childNodes: + if child.nodeType == ELEMENT_NODE: + self.getMappingById(None, depth, child, mapping, level) + return mapping + + def getElements(self, node, name, nsuri=None): + """Return a sequence of the child elements of the given node that + match the given name and optional namespace uri.""" + nsmatch = self.nsUriMatch + result = [] + ELEMENT_NODE = node.ELEMENT_NODE + for child in node.childNodes: + if child.nodeType == ELEMENT_NODE: + if ((child.localName == name or name is None) and ( + (nsuri is None) or nsmatch(child.namespaceURI, nsuri))): + result.append(child) + return result + + def hasAttr(self, node, name, nsuri=None): + """Return true if element has attribute with the given name and + optional nsuri. If nsuri is not specified, returns true if an + attribute exists with the given name with any namespace.""" + if nsuri is None: + if node.hasAttribute(name): + return True + return False + return node.hasAttributeNS(nsuri, name) + + def getAttr(self, node, name, nsuri=None, default=join): + """Return the value of the attribute named 'name' with the + optional nsuri, or the default if one is specified. If + nsuri is not specified, an attribute that matches the + given name will be returned regardless of namespace.""" + if nsuri is None: + result = node._attrs.get(name, None) + if result is None: + for item in node._attrsNS.keys(): + if item[1] == name: + result = node._attrsNS[item] + break + else: + result = node._attrsNS.get((nsuri, name), None) + if result is not None: + return result.value + if default is not join: + return default + return '' + + def getAttrs(self, node): + """Return a Collection of all attributes + """ + attrs = {} + for k,v in node._attrs.items(): + attrs[k] = v.value + return attrs + + def getElementText(self, node, preserve_ws=None): + """Return the text value of an xml element node. Leading and trailing + whitespace is stripped from the value unless the preserve_ws flag + is passed with a true value.""" + result = [] + for child in node.childNodes: + nodetype = child.nodeType + if nodetype == child.TEXT_NODE or \ + nodetype == child.CDATA_SECTION_NODE: + result.append(child.nodeValue) + value = join(result, '') + if preserve_ws is None: + value = strip(value) + return value + + def findNamespaceURI(self, prefix, node): + """Find a namespace uri given a prefix and a context node.""" + attrkey = (self.NS_XMLNS, prefix) + DOCUMENT_NODE = node.DOCUMENT_NODE + ELEMENT_NODE = node.ELEMENT_NODE + while 1: + if node is None: + raise DOMException('Value for prefix %s not found.' % prefix) + if node.nodeType != ELEMENT_NODE: + node = node.parentNode + continue + result = node._attrsNS.get(attrkey, None) + if result is not None: + return result.value + if hasattr(node, '__imported__'): + raise DOMException('Value for prefix %s not found.' % prefix) + node = node.parentNode + if node.nodeType == DOCUMENT_NODE: + raise DOMException('Value for prefix %s not found.' % prefix) + + def findDefaultNS(self, node): + """Return the current default namespace uri for the given node.""" + attrkey = (self.NS_XMLNS, 'xmlns') + DOCUMENT_NODE = node.DOCUMENT_NODE + ELEMENT_NODE = node.ELEMENT_NODE + while 1: + if node.nodeType != ELEMENT_NODE: + node = node.parentNode + continue + result = node._attrsNS.get(attrkey, None) + if result is not None: + return result.value + if hasattr(node, '__imported__'): + raise DOMException('Cannot determine default namespace.') + node = node.parentNode + if node.nodeType == DOCUMENT_NODE: + raise DOMException('Cannot determine default namespace.') + + def findTargetNS(self, node): + """Return the defined target namespace uri for the given node.""" + attrget = self.getAttr + attrkey = (self.NS_XMLNS, 'xmlns') + DOCUMENT_NODE = node.DOCUMENT_NODE + ELEMENT_NODE = node.ELEMENT_NODE + while 1: + if node.nodeType != ELEMENT_NODE: + node = node.parentNode + continue + result = attrget(node, 'targetNamespace', default=None) + if result is not None: + return result + node = node.parentNode + if node.nodeType == DOCUMENT_NODE: + raise DOMException('Cannot determine target namespace.') + + def getTypeRef(self, element): + """Return (namespaceURI, name) for a type attribue of the given + element, or None if the element does not have a type attribute.""" + typeattr = self.getAttr(element, 'type', default=None) + if typeattr is None: + return None + parts = typeattr.split(':', 1) + if len(parts) == 2: + nsuri = self.findNamespaceURI(parts[0], element) + else: + nsuri = self.findDefaultNS(element) + return (nsuri, parts[1]) + + def importNode(self, document, node, deep=0): + """Implements (well enough for our purposes) DOM node import.""" + nodetype = node.nodeType + if nodetype in (node.DOCUMENT_NODE, node.DOCUMENT_TYPE_NODE): + raise DOMException('Illegal node type for importNode') + if nodetype == node.ENTITY_REFERENCE_NODE: + deep = 0 + clone = node.cloneNode(deep) + self._setOwnerDoc(document, clone) + clone.__imported__ = 1 + return clone + + def _setOwnerDoc(self, document, node): + node.ownerDocument = document + for child in node.childNodes: + self._setOwnerDoc(document, child) + + def nsUriMatch(self, value, wanted, strict=0, tt=type(())): + """Return a true value if two namespace uri values match.""" + if value == wanted or (type(wanted) is tt) and value in wanted: + return 1 + if not strict and value is not None: + wanted = type(wanted) is tt and wanted or (wanted,) + value = value[-1:] != '/' and value or value[:-1] + for item in wanted: + if item == value or item[:-1] == value: + return 1 + return 0 + + def createDocument(self, nsuri, qname, doctype=None): + """Create a new writable DOM document object.""" + impl = xml.dom.minidom.getDOMImplementation() + return impl.createDocument(nsuri, qname, doctype) + + def loadDocument(self, data): + """Load an xml file from a file-like object and return a DOM + document instance.""" + return xml.dom.minidom.parse(data) + + def loadFromURL(self, url): + """Load an xml file from a URL and return a DOM document.""" + if isfile(url) is True: + file = open(url, 'r') + else: + file = urlopen(url) + + try: + result = self.loadDocument(file) + except Exception, ex: + file.close() + raise ParseError(('Failed to load document %s' %url,) + ex.args) + else: + file.close() + return result + +DOM = DOM() + + +class MessageInterface: + '''Higher Level Interface, delegates to DOM singleton, must + be subclassed and implement all methods that throw NotImplementedError. + ''' + def __init__(self, sw): + '''Constructor, May be extended, do not override. + sw -- soapWriter instance + ''' + self.sw = None + if type(sw) != weakref.ReferenceType and sw is not None: + self.sw = weakref.ref(sw) + else: + self.sw = sw + + def AddCallback(self, func, *arglist): + self.sw().AddCallback(func, *arglist) + + def Known(self, obj): + return self.sw().Known(obj) + + def Forget(self, obj): + return self.sw().Forget(obj) + + def canonicalize(self): + '''canonicalize the underlying DOM, and return as string. + ''' + raise NotImplementedError, '' + + def createDocument(self, namespaceURI=SOAP.ENV, localName='Envelope'): + '''create Document + ''' + raise NotImplementedError, '' + + def createAppendElement(self, namespaceURI, localName): + '''create and append element(namespaceURI,localName), and return + the node. + ''' + raise NotImplementedError, '' + + def findNamespaceURI(self, qualifiedName): + raise NotImplementedError, '' + + def resolvePrefix(self, prefix): + raise NotImplementedError, '' + + def setAttributeNS(self, namespaceURI, localName, value): + '''set attribute (namespaceURI, localName)=value + ''' + raise NotImplementedError, '' + + def setAttributeType(self, namespaceURI, localName): + '''set attribute xsi:type=(namespaceURI, localName) + ''' + raise NotImplementedError, '' + + def setNamespaceAttribute(self, namespaceURI, prefix): + '''set namespace attribute xmlns:prefix=namespaceURI + ''' + raise NotImplementedError, '' + + +class ElementProxy(Base, MessageInterface): + ''' + ''' + _soap_env_prefix = 'SOAP-ENV' + _soap_enc_prefix = 'SOAP-ENC' + _zsi_prefix = 'ZSI' + _xsd_prefix = 'xsd' + _xsi_prefix = 'xsi' + _xml_prefix = 'xml' + _xmlns_prefix = 'xmlns' + + _soap_env_nsuri = SOAP.ENV + _soap_enc_nsuri = SOAP.ENC + _zsi_nsuri = ZSI_SCHEMA_URI + _xsd_nsuri = SCHEMA.XSD3 + _xsi_nsuri = SCHEMA.XSI3 + _xml_nsuri = XMLNS.XML + _xmlns_nsuri = XMLNS.BASE + + standard_ns = {\ + _xml_prefix:_xml_nsuri, + _xmlns_prefix:_xmlns_nsuri + } + reserved_ns = {\ + _soap_env_prefix:_soap_env_nsuri, + _soap_enc_prefix:_soap_enc_nsuri, + _zsi_prefix:_zsi_nsuri, + _xsd_prefix:_xsd_nsuri, + _xsi_prefix:_xsi_nsuri, + } + name = None + namespaceURI = None + + def __init__(self, sw, message=None): + '''Initialize. + sw -- SoapWriter + ''' + self._indx = 0 + MessageInterface.__init__(self, sw) + Base.__init__(self) + self._dom = DOM + self.node = None + if type(message) in (types.StringType,types.UnicodeType): + self.loadFromString(message) + elif isinstance(message, ElementProxy): + self.node = message._getNode() + else: + self.node = message + self.processorNss = self.standard_ns.copy() + self.processorNss.update(self.reserved_ns) + + def __str__(self): + return self.toString() + + def evaluate(self, expression, processorNss=None): + '''expression -- XPath compiled expression + ''' + from Ft.Xml import XPath + if not processorNss: + context = XPath.Context.Context(self.node, processorNss=self.processorNss) + else: + context = XPath.Context.Context(self.node, processorNss=processorNss) + nodes = expression.evaluate(context) + return map(lambda node: ElementProxy(self.sw,node), nodes) + + ############################################# + # Methods for checking/setting the + # classes (namespaceURI,name) node. + ############################################# + def checkNode(self, namespaceURI=None, localName=None): + ''' + namespaceURI -- namespace of element + localName -- local name of element + ''' + namespaceURI = namespaceURI or self.namespaceURI + localName = localName or self.name + check = False + if localName and self.node: + check = self._dom.isElement(self.node, localName, namespaceURI) + if not check: + raise NamespaceError, 'unexpected node type %s, expecting %s' %(self.node, localName) + + def setNode(self, node=None): + if node: + if isinstance(node, ElementProxy): + self.node = node._getNode() + else: + self.node = node + elif self.node: + node = self._dom.getElement(self.node, self.name, self.namespaceURI, default=None) + if not node: + raise NamespaceError, 'cant find element (%s,%s)' %(self.namespaceURI,self.name) + self.node = node + else: + #self.node = self._dom.create(self.node, self.name, self.namespaceURI, default=None) + self.createDocument(self.namespaceURI, localName=self.name, doctype=None) + + self.checkNode() + + ############################################# + # Wrapper Methods for direct DOM Element Node access + ############################################# + def _getNode(self): + return self.node + + def _getElements(self): + return self._dom.getElements(self.node, name=None) + + def _getOwnerDocument(self): + return self.node.ownerDocument or self.node + + def _getUniquePrefix(self): + '''I guess we need to resolve all potential prefixes + because when the current node is attached it copies the + namespaces into the parent node. + ''' + while 1: + self._indx += 1 + prefix = 'ns%d' %self._indx + try: + self._dom.findNamespaceURI(prefix, self._getNode()) + except DOMException, ex: + break + return prefix + + def _getPrefix(self, node, nsuri): + ''' + Keyword arguments: + node -- DOM Element Node + nsuri -- namespace of attribute value + ''' + try: + if node and (node.nodeType == node.ELEMENT_NODE) and \ + (nsuri == self._dom.findDefaultNS(node)): + return None + except DOMException, ex: + pass + if nsuri == XMLNS.XML: + return self._xml_prefix + if node.nodeType == Node.ELEMENT_NODE: + for attr in node.attributes.values(): + if attr.namespaceURI == XMLNS.BASE \ + and nsuri == attr.value: + return attr.localName + else: + if node.parentNode: + return self._getPrefix(node.parentNode, nsuri) + raise NamespaceError, 'namespaceURI "%s" is not defined' %nsuri + + def _appendChild(self, node): + ''' + Keyword arguments: + node -- DOM Element Node + ''' + if node is None: + raise TypeError, 'node is None' + self.node.appendChild(node) + + def _insertBefore(self, newChild, refChild): + ''' + Keyword arguments: + child -- DOM Element Node to insert + refChild -- DOM Element Node + ''' + self.node.insertBefore(newChild, refChild) + + def _setAttributeNS(self, namespaceURI, qualifiedName, value): + ''' + Keyword arguments: + namespaceURI -- namespace of attribute + qualifiedName -- qualified name of new attribute value + value -- value of attribute + ''' + self.node.setAttributeNS(namespaceURI, qualifiedName, value) + + ############################################# + #General Methods + ############################################# + def isFault(self): + '''check to see if this is a soap:fault message. + ''' + return False + + def getPrefix(self, namespaceURI): + try: + prefix = self._getPrefix(node=self.node, nsuri=namespaceURI) + except NamespaceError, ex: + prefix = self._getUniquePrefix() + self.setNamespaceAttribute(prefix, namespaceURI) + return prefix + + def getDocument(self): + return self._getOwnerDocument() + + def setDocument(self, document): + self.node = document + + def importFromString(self, xmlString): + doc = self._dom.loadDocument(StringIO(xmlString)) + node = self._dom.getElement(doc, name=None) + clone = self.importNode(node) + self._appendChild(clone) + + def importNode(self, node): + if isinstance(node, ElementProxy): + node = node._getNode() + return self._dom.importNode(self._getOwnerDocument(), node, deep=1) + + def loadFromString(self, data): + self.node = self._dom.loadDocument(StringIO(data)) + + def canonicalize(self): + return Canonicalize(self.node) + + def toString(self): + return self.canonicalize() + + def createDocument(self, namespaceURI, localName, doctype=None): + '''If specified must be a SOAP envelope, else may contruct an empty document. + ''' + prefix = self._soap_env_prefix + + if namespaceURI == self.reserved_ns[prefix]: + qualifiedName = '%s:%s' %(prefix,localName) + elif namespaceURI is localName is None: + self.node = self._dom.createDocument(None,None,None) + return + else: + raise KeyError, 'only support creation of document in %s' %self.reserved_ns[prefix] + + document = self._dom.createDocument(nsuri=namespaceURI, qname=qualifiedName, doctype=doctype) + self.node = document.childNodes[0] + + #set up reserved namespace attributes + for prefix,nsuri in self.reserved_ns.items(): + self._setAttributeNS(namespaceURI=self._xmlns_nsuri, + qualifiedName='%s:%s' %(self._xmlns_prefix,prefix), + value=nsuri) + + ############################################# + #Methods for attributes + ############################################# + def hasAttribute(self, namespaceURI, localName): + return self._dom.hasAttr(self._getNode(), name=localName, nsuri=namespaceURI) + + def setAttributeType(self, namespaceURI, localName): + '''set xsi:type + Keyword arguments: + namespaceURI -- namespace of attribute value + localName -- name of new attribute value + + ''' + self.logger.debug('setAttributeType: (%s,%s)', namespaceURI, localName) + value = localName + if namespaceURI: + value = '%s:%s' %(self.getPrefix(namespaceURI),localName) + + xsi_prefix = self.getPrefix(self._xsi_nsuri) + self._setAttributeNS(self._xsi_nsuri, '%s:type' %xsi_prefix, value) + + def createAttributeNS(self, namespace, name, value): + document = self._getOwnerDocument() + ##this function doesn't exist!! it has only two arguments + attrNode = document.createAttributeNS(namespace, name, value) + + def setAttributeNS(self, namespaceURI, localName, value): + ''' + Keyword arguments: + namespaceURI -- namespace of attribute to create, None is for + attributes in no namespace. + localName -- local name of new attribute + value -- value of new attribute + ''' + prefix = None + if namespaceURI: + try: + prefix = self.getPrefix(namespaceURI) + except KeyError, ex: + prefix = 'ns2' + self.setNamespaceAttribute(prefix, namespaceURI) + qualifiedName = localName + if prefix: + qualifiedName = '%s:%s' %(prefix, localName) + self._setAttributeNS(namespaceURI, qualifiedName, value) + + def setNamespaceAttribute(self, prefix, namespaceURI): + ''' + Keyword arguments: + prefix -- xmlns prefix + namespaceURI -- value of prefix + ''' + self._setAttributeNS(XMLNS.BASE, 'xmlns:%s' %prefix, namespaceURI) + + ############################################# + #Methods for elements + ############################################# + def createElementNS(self, namespace, qname): + ''' + Keyword arguments: + namespace -- namespace of element to create + qname -- qualified name of new element + ''' + document = self._getOwnerDocument() + node = document.createElementNS(namespace, qname) + return ElementProxy(self.sw, node) + + def createAppendSetElement(self, namespaceURI, localName, prefix=None): + '''Create a new element (namespaceURI,name), append it + to current node, then set it to be the current node. + Keyword arguments: + namespaceURI -- namespace of element to create + localName -- local name of new element + prefix -- if namespaceURI is not defined, declare prefix. defaults + to 'ns1' if left unspecified. + ''' + node = self.createAppendElement(namespaceURI, localName, prefix=None) + node=node._getNode() + self._setNode(node._getNode()) + + def createAppendElement(self, namespaceURI, localName, prefix=None): + '''Create a new element (namespaceURI,name), append it + to current node, and return the newly created node. + Keyword arguments: + namespaceURI -- namespace of element to create + localName -- local name of new element + prefix -- if namespaceURI is not defined, declare prefix. defaults + to 'ns1' if left unspecified. + ''' + declare = False + qualifiedName = localName + if namespaceURI: + try: + prefix = self.getPrefix(namespaceURI) + except: + declare = True + prefix = prefix or self._getUniquePrefix() + if prefix: + qualifiedName = '%s:%s' %(prefix, localName) + node = self.createElementNS(namespaceURI, qualifiedName) + if declare: + node._setAttributeNS(XMLNS.BASE, 'xmlns:%s' %prefix, namespaceURI) + self._appendChild(node=node._getNode()) + return node + + def createInsertBefore(self, namespaceURI, localName, refChild): + qualifiedName = localName + prefix = self.getPrefix(namespaceURI) + if prefix: + qualifiedName = '%s:%s' %(prefix, localName) + node = self.createElementNS(namespaceURI, qualifiedName) + self._insertBefore(newChild=node._getNode(), refChild=refChild._getNode()) + return node + + def getElement(self, namespaceURI, localName): + ''' + Keyword arguments: + namespaceURI -- namespace of element + localName -- local name of element + ''' + node = self._dom.getElement(self.node, localName, namespaceURI, default=None) + if node: + return ElementProxy(self.sw, node) + return None + + def getAttributeValue(self, namespaceURI, localName): + ''' + Keyword arguments: + namespaceURI -- namespace of attribute + localName -- local name of attribute + ''' + if self.hasAttribute(namespaceURI, localName): + attr = self.node.getAttributeNodeNS(namespaceURI,localName) + return attr.value + return None + + def getValue(self): + return self._dom.getElementText(self.node, preserve_ws=True) + + ############################################# + #Methods for text nodes + ############################################# + def createAppendTextNode(self, pyobj): + node = self.createTextNode(pyobj) + self._appendChild(node=node._getNode()) + return node + + def createTextNode(self, pyobj): + document = self._getOwnerDocument() + node = document.createTextNode(pyobj) + return ElementProxy(self.sw, node) + + ############################################# + #Methods for retrieving namespaceURI's + ############################################# + def findNamespaceURI(self, qualifiedName): + parts = SplitQName(qualifiedName) + element = self._getNode() + if len(parts) == 1: + return (self._dom.findTargetNS(element), value) + return self._dom.findNamespaceURI(parts[0], element) + + def resolvePrefix(self, prefix): + element = self._getNode() + return self._dom.findNamespaceURI(prefix, element) + + def getSOAPEnvURI(self): + return self._soap_env_nsuri + + def isEmpty(self): + return not self.node + + + +class Collection(UserDict): + """Helper class for maintaining ordered named collections.""" + default = lambda self,k: k.name + def __init__(self, parent, key=None): + UserDict.__init__(self) + self.parent = weakref.ref(parent) + self.list = [] + self._func = key or self.default + + def __getitem__(self, key): + if type(key) is type(1): + return self.list[key] + return self.data[key] + + def __setitem__(self, key, item): + item.parent = weakref.ref(self) + self.list.append(item) + self.data[key] = item + + def keys(self): + return map(lambda i: self._func(i), self.list) + + def items(self): + return map(lambda i: (self._func(i), i), self.list) + + def values(self): + return self.list + + +class CollectionNS(UserDict): + """Helper class for maintaining ordered named collections.""" + default = lambda self,k: k.name + def __init__(self, parent, key=None): + UserDict.__init__(self) + self.parent = weakref.ref(parent) + self.targetNamespace = None + self.list = [] + self._func = key or self.default + + def __getitem__(self, key): + self.targetNamespace = self.parent().targetNamespace + if type(key) is types.IntType: + return self.list[key] + elif self.__isSequence(key): + nsuri,name = key + return self.data[nsuri][name] + return self.data[self.parent().targetNamespace][key] + + def __setitem__(self, key, item): + item.parent = weakref.ref(self) + self.list.append(item) + targetNamespace = getattr(item, 'targetNamespace', self.parent().targetNamespace) + if not self.data.has_key(targetNamespace): + self.data[targetNamespace] = {} + self.data[targetNamespace][key] = item + + def __isSequence(self, key): + return (type(key) in (types.TupleType,types.ListType) and len(key) == 2) + + def keys(self): + keys = [] + for tns in self.data.keys(): + keys.append(map(lambda i: (tns,self._func(i)), self.data[tns].values())) + return keys + + def items(self): + return map(lambda i: (self._func(i), i), self.list) + + def values(self): + return self.list + + + +# This is a runtime guerilla patch for pulldom (used by minidom) so +# that xml namespace declaration attributes are not lost in parsing. +# We need them to do correct QName linking for XML Schema and WSDL. +# The patch has been submitted to SF for the next Python version. + +from xml.dom.pulldom import PullDOM, START_ELEMENT +if 1: + def startPrefixMapping(self, prefix, uri): + if not hasattr(self, '_xmlns_attrs'): + self._xmlns_attrs = [] + self._xmlns_attrs.append((prefix or 'xmlns', uri)) + self._ns_contexts.append(self._current_context.copy()) + self._current_context[uri] = prefix or '' + + PullDOM.startPrefixMapping = startPrefixMapping + + def startElementNS(self, name, tagName , attrs): + # Retrieve xml namespace declaration attributes. + xmlns_uri = 'http://www.w3.org/2000/xmlns/' + xmlns_attrs = getattr(self, '_xmlns_attrs', None) + if xmlns_attrs is not None: + for aname, value in xmlns_attrs: + attrs._attrs[(xmlns_uri, aname)] = value + self._xmlns_attrs = [] + uri, localname = name + if uri: + # When using namespaces, the reader may or may not + # provide us with the original name. If not, create + # *a* valid tagName from the current context. + if tagName is None: + prefix = self._current_context[uri] + if prefix: + tagName = prefix + ":" + localname + else: + tagName = localname + if self.document: + node = self.document.createElementNS(uri, tagName) + else: + node = self.buildDocument(uri, tagName) + else: + # When the tagname is not prefixed, it just appears as + # localname + if self.document: + node = self.document.createElement(localname) + else: + node = self.buildDocument(None, localname) + + for aname,value in attrs.items(): + a_uri, a_localname = aname + if a_uri == xmlns_uri: + if a_localname == 'xmlns': + qname = a_localname + else: + qname = 'xmlns:' + a_localname + attr = self.document.createAttributeNS(a_uri, qname) + node.setAttributeNodeNS(attr) + elif a_uri: + prefix = self._current_context[a_uri] + if prefix: + qname = prefix + ":" + a_localname + else: + qname = a_localname + attr = self.document.createAttributeNS(a_uri, qname) + node.setAttributeNodeNS(attr) + else: + attr = self.document.createAttribute(a_localname) + node.setAttributeNode(attr) + attr.value = value + + self.lastEvent[1] = [(START_ELEMENT, node), None] + self.lastEvent = self.lastEvent[1] + self.push(node) + + PullDOM.startElementNS = startElementNS + +# +# This is a runtime guerilla patch for minidom so +# that xmlns prefixed attributes dont raise AttributeErrors +# during cloning. +# +# Namespace declarations can appear in any start-tag, must look for xmlns +# prefixed attribute names during cloning. +# +# key (attr.namespaceURI, tag) +# ('http://www.w3.org/2000/xmlns/', u'xsd') +# ('http://www.w3.org/2000/xmlns/', 'xmlns') +# +# xml.dom.minidom.Attr.nodeName = xmlns:xsd +# xml.dom.minidom.Attr.value = = http://www.w3.org/2001/XMLSchema + +if 1: + def _clone_node(node, deep, newOwnerDocument): + """ + Clone a node and give it the new owner document. + Called by Node.cloneNode and Document.importNode + """ + if node.ownerDocument.isSameNode(newOwnerDocument): + operation = xml.dom.UserDataHandler.NODE_CLONED + else: + operation = xml.dom.UserDataHandler.NODE_IMPORTED + if node.nodeType == xml.dom.minidom.Node.ELEMENT_NODE: + clone = newOwnerDocument.createElementNS(node.namespaceURI, + node.nodeName) + for attr in node.attributes.values(): + clone.setAttributeNS(attr.namespaceURI, attr.nodeName, attr.value) + + prefix, tag = xml.dom.minidom._nssplit(attr.nodeName) + if prefix == 'xmlns': + a = clone.getAttributeNodeNS(attr.namespaceURI, tag) + elif prefix: + a = clone.getAttributeNodeNS(attr.namespaceURI, tag) + else: + a = clone.getAttributeNodeNS(attr.namespaceURI, attr.nodeName) + a.specified = attr.specified + + if deep: + for child in node.childNodes: + c = xml.dom.minidom._clone_node(child, deep, newOwnerDocument) + clone.appendChild(c) + elif node.nodeType == xml.dom.minidom.Node.DOCUMENT_FRAGMENT_NODE: + clone = newOwnerDocument.createDocumentFragment() + if deep: + for child in node.childNodes: + c = xml.dom.minidom._clone_node(child, deep, newOwnerDocument) + clone.appendChild(c) + + elif node.nodeType == xml.dom.minidom.Node.TEXT_NODE: + clone = newOwnerDocument.createTextNode(node.data) + elif node.nodeType == xml.dom.minidom.Node.CDATA_SECTION_NODE: + clone = newOwnerDocument.createCDATASection(node.data) + elif node.nodeType == xml.dom.minidom.Node.PROCESSING_INSTRUCTION_NODE: + clone = newOwnerDocument.createProcessingInstruction(node.target, + node.data) + elif node.nodeType == xml.dom.minidom.Node.COMMENT_NODE: + clone = newOwnerDocument.createComment(node.data) + elif node.nodeType == xml.dom.minidom.Node.ATTRIBUTE_NODE: + clone = newOwnerDocument.createAttributeNS(node.namespaceURI, + node.nodeName) + clone.specified = True + clone.value = node.value + elif node.nodeType == xml.dom.minidom.Node.DOCUMENT_TYPE_NODE: + assert node.ownerDocument is not newOwnerDocument + operation = xml.dom.UserDataHandler.NODE_IMPORTED + clone = newOwnerDocument.implementation.createDocumentType( + node.name, node.publicId, node.systemId) + clone.ownerDocument = newOwnerDocument + if deep: + clone.entities._seq = [] + clone.notations._seq = [] + for n in node.notations._seq: + notation = xml.dom.minidom.Notation(n.nodeName, n.publicId, n.systemId) + notation.ownerDocument = newOwnerDocument + clone.notations._seq.append(notation) + if hasattr(n, '_call_user_data_handler'): + n._call_user_data_handler(operation, n, notation) + for e in node.entities._seq: + entity = xml.dom.minidom.Entity(e.nodeName, e.publicId, e.systemId, + e.notationName) + entity.actualEncoding = e.actualEncoding + entity.encoding = e.encoding + entity.version = e.version + entity.ownerDocument = newOwnerDocument + clone.entities._seq.append(entity) + if hasattr(e, '_call_user_data_handler'): + e._call_user_data_handler(operation, n, entity) + else: + # Note the cloning of Document and DocumentType nodes is + # implemenetation specific. minidom handles those cases + # directly in the cloneNode() methods. + raise xml.dom.NotSupportedErr("Cannot clone node %s" % repr(node)) + + # Check for _call_user_data_handler() since this could conceivably + # used with other DOM implementations (one of the FourThought + # DOMs, perhaps?). + if hasattr(node, '_call_user_data_handler'): + node._call_user_data_handler(operation, node, clone) + return clone + + xml.dom.minidom._clone_node = _clone_node + diff --git a/wstools/WSDLTools.py b/wstools/WSDLTools.py new file mode 100755 index 00000000..3dd651a5 --- /dev/null +++ b/wstools/WSDLTools.py @@ -0,0 +1,1668 @@ +# Copyright (c) 2001 Zope Corporation and Contributors. All Rights Reserved. +# +# This software is subject to the provisions of the Zope Public License, +# Version 2.0 (ZPL). A copy of the ZPL should accompany this distribution. +# THIS SOFTWARE IS PROVIDED "AS IS" AND ANY AND ALL EXPRESS OR IMPLIED +# WARRANTIES ARE DISCLAIMED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +# WARRANTIES OF TITLE, MERCHANTABILITY, AGAINST INFRINGEMENT, AND FITNESS +# FOR A PARTICULAR PURPOSE. + +ident = "$Id$" + +import weakref +from cStringIO import StringIO +from Namespaces import OASIS, XMLNS, WSA, WSA_LIST, WSAW_LIST, WSRF_V1_2, WSRF +from Utility import Collection, CollectionNS, DOM, ElementProxy, basejoin +from XMLSchema import XMLSchema, SchemaReader, WSDLToolsAdapter + + +class WSDLReader: + """A WSDLReader creates WSDL instances from urls and xml data.""" + + # Custom subclasses of WSDLReader may wish to implement a caching + # strategy or other optimizations. Because application needs vary + # so widely, we don't try to provide any caching by default. + + def loadFromStream(self, stream, name=None): + """Return a WSDL instance loaded from a stream object.""" + document = DOM.loadDocument(stream) + wsdl = WSDL() + if name: + wsdl.location = name + elif hasattr(stream, 'name'): + wsdl.location = stream.name + wsdl.load(document) + return wsdl + + def loadFromURL(self, url): + """Return a WSDL instance loaded from the given url.""" + document = DOM.loadFromURL(url) + wsdl = WSDL() + wsdl.location = url + wsdl.load(document) + return wsdl + + def loadFromString(self, data): + """Return a WSDL instance loaded from an xml string.""" + return self.loadFromStream(StringIO(data)) + + def loadFromFile(self, filename): + """Return a WSDL instance loaded from the given file.""" + file = open(filename, 'rb') + try: + wsdl = self.loadFromStream(file) + finally: + file.close() + return wsdl + +class WSDL: + """A WSDL object models a WSDL service description. WSDL objects + may be created manually or loaded from an xml representation + using a WSDLReader instance.""" + + def __init__(self, targetNamespace=None, strict=1): + self.targetNamespace = targetNamespace or 'urn:this-document.wsdl' + self.documentation = '' + self.location = None + self.document = None + self.name = None + self.services = CollectionNS(self) + self.messages = CollectionNS(self) + self.portTypes = CollectionNS(self) + self.bindings = CollectionNS(self) + self.imports = Collection(self) + self.types = Types(self) + self.extensions = [] + self.strict = strict + + def __del__(self): + if self.document is not None: + self.document.unlink() + + version = '1.1' + + def addService(self, name, documentation='', targetNamespace=None): + if self.services.has_key(name): + raise WSDLError( + 'Duplicate service element: %s' % name + ) + item = Service(name, documentation) + if targetNamespace: + item.targetNamespace = targetNamespace + self.services[name] = item + return item + + def addMessage(self, name, documentation='', targetNamespace=None): + if self.messages.has_key(name): + raise WSDLError( + 'Duplicate message element: %s.' % name + ) + item = Message(name, documentation) + if targetNamespace: + item.targetNamespace = targetNamespace + self.messages[name] = item + return item + + def addPortType(self, name, documentation='', targetNamespace=None): + if self.portTypes.has_key(name): + raise WSDLError( + 'Duplicate portType element: name' + ) + item = PortType(name, documentation) + if targetNamespace: + item.targetNamespace = targetNamespace + self.portTypes[name] = item + return item + + def addBinding(self, name, type, documentation='', targetNamespace=None): + if self.bindings.has_key(name): + raise WSDLError( + 'Duplicate binding element: %s' % name + ) + item = Binding(name, type, documentation) + if targetNamespace: + item.targetNamespace = targetNamespace + self.bindings[name] = item + return item + + def addImport(self, namespace, location): + item = ImportElement(namespace, location) + self.imports[namespace] = item + return item + + def toDom(self): + """ Generate a DOM representation of the WSDL instance. + Not dealing with generating XML Schema, thus the targetNamespace + of all XML Schema elements or types used by WSDL message parts + needs to be specified via import information items. + """ + namespaceURI = DOM.GetWSDLUri(self.version) + self.document = DOM.createDocument(namespaceURI ,'wsdl:definitions') + + # Set up a couple prefixes for easy reading. + child = DOM.getElement(self.document, None) + child.setAttributeNS(None, 'targetNamespace', self.targetNamespace) + child.setAttributeNS(XMLNS.BASE, 'xmlns:wsdl', namespaceURI) + child.setAttributeNS(XMLNS.BASE, 'xmlns:xsd', 'http://www.w3.org/1999/XMLSchema') + child.setAttributeNS(XMLNS.BASE, 'xmlns:soap', 'http://schemas.xmlsoap.org/wsdl/soap/') + child.setAttributeNS(XMLNS.BASE, 'xmlns:tns', self.targetNamespace) + + if self.name: + child.setAttributeNS(None, 'name', self.name) + + # wsdl:import + for item in self.imports: + item.toDom() + # wsdl:message + for item in self.messages: + item.toDom() + # wsdl:portType + for item in self.portTypes: + item.toDom() + # wsdl:binding + for item in self.bindings: + item.toDom() + # wsdl:service + for item in self.services: + item.toDom() + + def load(self, document): + # We save a reference to the DOM document to ensure that elements + # saved as "extensions" will continue to have a meaningful context + # for things like namespace references. The lifetime of the DOM + # document is bound to the lifetime of the WSDL instance. + self.document = document + + definitions = DOM.getElement(document, 'definitions', None, None) + if definitions is None: + raise WSDLError( + 'Missing element.' + ) + self.version = DOM.WSDLUriToVersion(definitions.namespaceURI) + NS_WSDL = DOM.GetWSDLUri(self.version) + + self.targetNamespace = DOM.getAttr(definitions, 'targetNamespace', + None, None) + self.name = DOM.getAttr(definitions, 'name', None, None) + self.documentation = GetDocumentation(definitions) + + # + # Retrieve all 's, append all children of imported + # document to main document. First iteration grab all original + # 's from document, second iteration grab all + # "imported" from document, etc break out when + # no more 's. + # + imported = [] + base_location = self.location + do_it = True + while do_it: + do_it = False + for element in DOM.getElements(definitions, 'import', NS_WSDL): + location = DOM.getAttr(element, 'location') + + if base_location is not None: + location = basejoin(base_location, location) + + if location not in imported: + do_it = True + self._import(document, element, base_location) + imported.append(location) + else: + definitions.removeChild(element) + + base_location = None + + # + # No more 's, now load up all other + # WSDL information items. + # + for element in DOM.getElements(definitions, None, None): + targetNamespace = DOM.getAttr(element, 'targetNamespace') + localName = element.localName + + if not DOM.nsUriMatch(element.namespaceURI, NS_WSDL): + if localName == 'schema': + tns = DOM.getAttr(element, 'targetNamespace') + reader = SchemaReader(base_url=self.imports[tns].location) + schema = reader.loadFromNode(WSDLToolsAdapter(self), + element) +# schema.setBaseUrl(self.location) + self.types.addSchema(schema) + else: + self.extensions.append(element) + continue + + elif localName == 'message': + name = DOM.getAttr(element, 'name') + docs = GetDocumentation(element) + message = self.addMessage(name, docs, targetNamespace) + parts = DOM.getElements(element, 'part', NS_WSDL) + message.load(parts) + continue + + elif localName == 'portType': + name = DOM.getAttr(element, 'name') + docs = GetDocumentation(element) + ptype = self.addPortType(name, docs, targetNamespace) + #operations = DOM.getElements(element, 'operation', NS_WSDL) + #ptype.load(operations) + ptype.load(element) + continue + + elif localName == 'binding': + name = DOM.getAttr(element, 'name') + type = DOM.getAttr(element, 'type', default=None) + if type is None: + raise WSDLError( + 'Missing type attribute for binding %s.' % name + ) + type = ParseQName(type, element) + docs = GetDocumentation(element) + binding = self.addBinding(name, type, docs, targetNamespace) + operations = DOM.getElements(element, 'operation', NS_WSDL) + binding.load(operations) + binding.load_ex(GetExtensions(element)) + continue + + elif localName == 'service': + name = DOM.getAttr(element, 'name') + docs = GetDocumentation(element) + service = self.addService(name, docs, targetNamespace) + ports = DOM.getElements(element, 'port', NS_WSDL) + service.load(ports) + service.load_ex(GetExtensions(element)) + continue + + elif localName == 'types': + self.types.documentation = GetDocumentation(element) + base_location = DOM.getAttr(element, 'base-location') + if base_location: + element.removeAttribute('base-location') + base_location = base_location or self.location + reader = SchemaReader(base_url=base_location) + for item in DOM.getElements(element, None, None): + if item.localName == 'schema': + schema = reader.loadFromNode(WSDLToolsAdapter(self), item) + # XXX could have been imported + #schema.setBaseUrl(self.location) + schema.setBaseUrl(base_location) + self.types.addSchema(schema) + else: + self.types.addExtension(item) + # XXX remove the attribute + # element.removeAttribute('base-location') + continue + + def _import(self, document, element, base_location=None): + '''Algo take element's children, clone them, + and add them to the main document. Support for relative + locations is a bit complicated. The orig document context + is lost, so we need to store base location in DOM elements + representing , by creating a special temporary + "base-location" attribute, and , by resolving + the relative "location" and storing it as "location". + + document -- document we are loading + element -- DOM Element representing + base_location -- location of document from which this + was gleaned. + ''' + namespace = DOM.getAttr(element, 'namespace', default=None) + location = DOM.getAttr(element, 'location', default=None) + if namespace is None or location is None: + raise WSDLError( + 'Invalid import element (missing namespace or location).' + ) + if base_location: + location = basejoin(base_location, location) + element.setAttributeNS(None, 'location', location) + + obimport = self.addImport(namespace, location) + obimport._loaded = 1 + + importdoc = DOM.loadFromURL(location) + try: + if location.find('#') > -1: + idref = location.split('#')[-1] + imported = DOM.getElementById(importdoc, idref) + else: + imported = importdoc.documentElement + if imported is None: + raise WSDLError( + 'Import target element not found for: %s' % location + ) + + imported_tns = DOM.findTargetNS(imported) + if imported_tns != namespace: + return + + if imported.localName == 'definitions': + imported_nodes = imported.childNodes + else: + imported_nodes = [imported] + parent = element.parentNode + + parent.removeChild(element) + + for node in imported_nodes: + if node.nodeType != node.ELEMENT_NODE: + continue + child = DOM.importNode(document, node, 1) + parent.appendChild(child) + child.setAttribute('targetNamespace', namespace) + attrsNS = imported._attrsNS + for attrkey in attrsNS.keys(): + if attrkey[0] == DOM.NS_XMLNS: + attr = attrsNS[attrkey].cloneNode(1) + child.setAttributeNode(attr) + + #XXX Quick Hack, should be in WSDL Namespace. + if child.localName == 'import': + rlocation = child.getAttributeNS(None, 'location') + alocation = basejoin(location, rlocation) + child.setAttribute('location', alocation) + elif child.localName == 'types': + child.setAttribute('base-location', location) + + finally: + importdoc.unlink() + return location + +class Element: + """A class that provides common functions for WSDL element classes.""" + def __init__(self, name=None, documentation=''): + self.name = name + self.documentation = documentation + self.extensions = [] + + def addExtension(self, item): + item.parent = weakref.ref(self) + self.extensions.append(item) + + def getWSDL(self): + """Return the WSDL object that contains this information item.""" + parent = self + while 1: + # skip any collections + if isinstance(parent, WSDL): + return parent + try: parent = parent.parent() + except: break + + return None + + +class ImportElement(Element): + def __init__(self, namespace, location): + self.namespace = namespace + self.location = location + +# def getWSDL(self): +# """Return the WSDL object that contains this Message Part.""" +# return self.parent().parent() + + def toDom(self): + wsdl = self.getWSDL() + ep = ElementProxy(None, DOM.getElement(wsdl.document, None)) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'import') + epc.setAttributeNS(None, 'namespace', self.namespace) + epc.setAttributeNS(None, 'location', self.location) + + _loaded = None + + +class Types(Collection): + default = lambda self,k: k.targetNamespace + def __init__(self, parent): + Collection.__init__(self, parent) + self.documentation = '' + self.extensions = [] + + def addSchema(self, schema): + name = schema.targetNamespace + self[name] = schema + return schema + + def addExtension(self, item): + self.extensions.append(item) + + +class Message(Element): + def __init__(self, name, documentation=''): + Element.__init__(self, name, documentation) + self.parts = Collection(self) + + def addPart(self, name, type=None, element=None): + if self.parts.has_key(name): + raise WSDLError( + 'Duplicate message part element: %s' % name + ) + if type is None and element is None: + raise WSDLError( + 'Missing type or element attribute for part: %s' % name + ) + item = MessagePart(name) + item.element = element + item.type = type + self.parts[name] = item + return item + + def load(self, elements): + for element in elements: + name = DOM.getAttr(element, 'name') + part = MessagePart(name) + self.parts[name] = part + elemref = DOM.getAttr(element, 'element', default=None) + typeref = DOM.getAttr(element, 'type', default=None) + if typeref is None and elemref is None: + raise WSDLError( + 'No type or element attribute for part: %s' % name + ) + if typeref is not None: + part.type = ParseTypeRef(typeref, element) + if elemref is not None: + part.element = ParseTypeRef(elemref, element) + +# def getElementDeclaration(self): +# """Return the XMLSchema.ElementDeclaration instance or None""" +# element = None +# if self.element: +# nsuri,name = self.element +# wsdl = self.getWSDL() +# if wsdl.types.has_key(nsuri) and wsdl.types[nsuri].elements.has_key(name): +# element = wsdl.types[nsuri].elements[name] +# return element +# +# def getTypeDefinition(self): +# """Return the XMLSchema.TypeDefinition instance or None""" +# type = None +# if self.type: +# nsuri,name = self.type +# wsdl = self.getWSDL() +# if wsdl.types.has_key(nsuri) and wsdl.types[nsuri].types.has_key(name): +# type = wsdl.types[nsuri].types[name] +# return type + +# def getWSDL(self): +# """Return the WSDL object that contains this Message Part.""" +# return self.parent().parent() + + def toDom(self): + wsdl = self.getWSDL() + ep = ElementProxy(None, DOM.getElement(wsdl.document, None)) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'message') + epc.setAttributeNS(None, 'name', self.name) + + for part in self.parts: + part.toDom(epc._getNode()) + + +class MessagePart(Element): + def __init__(self, name): + Element.__init__(self, name, '') + self.element = None + self.type = None + +# def getWSDL(self): +# """Return the WSDL object that contains this Message Part.""" +# return self.parent().parent().parent().parent() + + def getTypeDefinition(self): + wsdl = self.getWSDL() + nsuri,name = self.type + schema = wsdl.types.get(nsuri, {}) + return schema.get(name) + + def getElementDeclaration(self): + wsdl = self.getWSDL() + nsuri,name = self.element + schema = wsdl.types.get(nsuri, {}) + return schema.get(name) + + def toDom(self, node): + """node -- node representing message""" + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'part') + epc.setAttributeNS(None, 'name', self.name) + + if self.element is not None: + ns,name = self.element + prefix = epc.getPrefix(ns) + epc.setAttributeNS(None, 'element', '%s:%s'%(prefix,name)) + elif self.type is not None: + ns,name = self.type + prefix = epc.getPrefix(ns) + epc.setAttributeNS(None, 'type', '%s:%s'%(prefix,name)) + + +class PortType(Element): + '''PortType has a anyAttribute, thus must provide for an extensible + mechanism for supporting such attributes. ResourceProperties is + specified in WS-ResourceProperties. wsa:Action is specified in + WS-Address. + + Instance Data: + name -- name attribute + resourceProperties -- optional. wsr:ResourceProperties attribute, + value is a QName this is Parsed into a (namespaceURI, name) + that represents a Global Element Declaration. + operations + ''' + + def __init__(self, name, documentation=''): + Element.__init__(self, name, documentation) + self.operations = Collection(self) + self.resourceProperties = None + +# def getWSDL(self): +# return self.parent().parent() + + def getTargetNamespace(self): + return self.targetNamespace or self.getWSDL().targetNamespace + + def getResourceProperties(self): + return self.resourceProperties + + def addOperation(self, name, documentation='', parameterOrder=None): + item = Operation(name, documentation, parameterOrder) + self.operations[name] = item + return item + + def load(self, element): + self.name = DOM.getAttr(element, 'name') + self.documentation = GetDocumentation(element) + self.targetNamespace = DOM.getAttr(element, 'targetNamespace') + + for nsuri in WSRF_V1_2.PROPERTIES.XSD_LIST: + if DOM.hasAttr(element, 'ResourceProperties', nsuri): + rpref = DOM.getAttr(element, 'ResourceProperties', nsuri) + self.resourceProperties = ParseQName(rpref, element) + + NS_WSDL = DOM.GetWSDLUri(self.getWSDL().version) + elements = DOM.getElements(element, 'operation', NS_WSDL) + for element in elements: + name = DOM.getAttr(element, 'name') + docs = GetDocumentation(element) + param_order = DOM.getAttr(element, 'parameterOrder', default=None) + if param_order is not None: + param_order = param_order.split(' ') + operation = self.addOperation(name, docs, param_order) + + item = DOM.getElement(element, 'input', None, None) + if item is not None: + name = DOM.getAttr(item, 'name') + docs = GetDocumentation(item) + msgref = DOM.getAttr(item, 'message') + message = ParseQName(msgref, item) + for WSA in WSA_LIST + WSAW_LIST: + action = DOM.getAttr(item, 'Action', WSA.ADDRESS, None) + if action: break + operation.setInput(message, name, docs, action) + + item = DOM.getElement(element, 'output', None, None) + if item is not None: + name = DOM.getAttr(item, 'name') + docs = GetDocumentation(item) + msgref = DOM.getAttr(item, 'message') + message = ParseQName(msgref, item) + for WSA in WSA_LIST + WSAW_LIST: + action = DOM.getAttr(item, 'Action', WSA.ADDRESS, None) + if action: break + operation.setOutput(message, name, docs, action) + + for item in DOM.getElements(element, 'fault', None): + name = DOM.getAttr(item, 'name') + docs = GetDocumentation(item) + msgref = DOM.getAttr(item, 'message') + message = ParseQName(msgref, item) + for WSA in WSA_LIST + WSAW_LIST: + action = DOM.getAttr(item, 'Action', WSA.ADDRESS, None) + if action: break + operation.addFault(message, name, docs, action) + + def toDom(self): + wsdl = self.getWSDL() + + ep = ElementProxy(None, DOM.getElement(wsdl.document, None)) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'portType') + epc.setAttributeNS(None, 'name', self.name) + if self.resourceProperties: + ns,name = self.resourceProperties + prefix = epc.getPrefix(ns) + epc.setAttributeNS(WSRF.PROPERTIES.LATEST, 'ResourceProperties', + '%s:%s'%(prefix,name)) + + for op in self.operations: + op.toDom(epc._getNode()) + + + +class Operation(Element): + def __init__(self, name, documentation='', parameterOrder=None): + Element.__init__(self, name, documentation) + self.parameterOrder = parameterOrder + self.faults = Collection(self) + self.input = None + self.output = None + + def getWSDL(self): + """Return the WSDL object that contains this Operation.""" + return self.parent().parent().parent().parent() + + def getPortType(self): + return self.parent().parent() + + def getInputAction(self): + """wsa:Action attribute""" + return GetWSAActionInput(self) + + def getInputMessage(self): + if self.input is None: + return None + wsdl = self.getPortType().getWSDL() + return wsdl.messages[self.input.message] + + def getOutputAction(self): + """wsa:Action attribute""" + return GetWSAActionOutput(self) + + def getOutputMessage(self): + if self.output is None: + return None + wsdl = self.getPortType().getWSDL() + return wsdl.messages[self.output.message] + + def getFaultAction(self, name): + """wsa:Action attribute""" + return GetWSAActionFault(self, name) + + def getFaultMessage(self, name): + wsdl = self.getPortType().getWSDL() + return wsdl.messages[self.faults[name].message] + + def addFault(self, message, name, documentation='', action=None): + if self.faults.has_key(name): + raise WSDLError( + 'Duplicate fault element: %s' % name + ) + item = MessageRole('fault', message, name, documentation, action) + self.faults[name] = item + return item + + def setInput(self, message, name='', documentation='', action=None): + self.input = MessageRole('input', message, name, documentation, action) + self.input.parent = weakref.ref(self) + return self.input + + def setOutput(self, message, name='', documentation='', action=None): + self.output = MessageRole('output', message, name, documentation, action) + self.output.parent = weakref.ref(self) + return self.output + + def toDom(self, node): + wsdl = self.getWSDL() + + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'operation') + epc.setAttributeNS(None, 'name', self.name) + node = epc._getNode() + if self.input: + self.input.toDom(node) + if self.output: + self.output.toDom(node) + for fault in self.faults: + fault.toDom(node) + + +class MessageRole(Element): + def __init__(self, type, message, name='', documentation='', action=None): + Element.__init__(self, name, documentation) + self.message = message + self.type = type + self.action = action + + def getWSDL(self): + """Return the WSDL object that contains this information item.""" + parent = self + while 1: + # skip any collections + if isinstance(parent, WSDL): + return parent + try: parent = parent.parent() + except: break + + return None + + def getMessage(self): + """Return the WSDL object that represents the attribute message + (namespaceURI, name) tuple + """ + wsdl = self.getWSDL() + return wsdl.messages[self.message] + + def toDom(self, node): + wsdl = self.getWSDL() + + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), self.type) + if not isinstance(self.message, basestring) and len(self.message) == 2: + ns,name = self.message + prefix = epc.getPrefix(ns) + epc.setAttributeNS(None, 'message', '%s:%s' %(prefix,name)) + else: + epc.setAttributeNS(None, 'message', self.message) + + if self.action: + epc.setAttributeNS(WSA.ADDRESS, 'Action', self.action) + + if self.name: + epc.setAttributeNS(None, 'name', self.name) + + +class Binding(Element): + def __init__(self, name, type, documentation=''): + Element.__init__(self, name, documentation) + self.operations = Collection(self) + self.type = type + +# def getWSDL(self): +# """Return the WSDL object that contains this binding.""" +# return self.parent().parent() + + def getPortType(self): + """Return the PortType object associated with this binding.""" + return self.getWSDL().portTypes[self.type] + + def findBinding(self, kind): + for item in self.extensions: + if isinstance(item, kind): + return item + return None + + def findBindings(self, kind): + return [ item for item in self.extensions if isinstance(item, kind) ] + + def addOperationBinding(self, name, documentation=''): + item = OperationBinding(name, documentation) + self.operations[name] = item + return item + + def load(self, elements): + for element in elements: + name = DOM.getAttr(element, 'name') + docs = GetDocumentation(element) + opbinding = self.addOperationBinding(name, docs) + opbinding.load_ex(GetExtensions(element)) + + item = DOM.getElement(element, 'input', None, None) + if item is not None: + #TODO: addInputBinding? + mbinding = MessageRoleBinding('input') + mbinding.documentation = GetDocumentation(item) + opbinding.input = mbinding + mbinding.load_ex(GetExtensions(item)) + mbinding.parent = weakref.ref(opbinding) + + item = DOM.getElement(element, 'output', None, None) + if item is not None: + mbinding = MessageRoleBinding('output') + mbinding.documentation = GetDocumentation(item) + opbinding.output = mbinding + mbinding.load_ex(GetExtensions(item)) + mbinding.parent = weakref.ref(opbinding) + + for item in DOM.getElements(element, 'fault', None): + name = DOM.getAttr(item, 'name') + mbinding = MessageRoleBinding('fault', name) + mbinding.documentation = GetDocumentation(item) + opbinding.faults[name] = mbinding + mbinding.load_ex(GetExtensions(item)) + mbinding.parent = weakref.ref(opbinding) + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_SOAP_BINDING_ALL and name == 'binding': + transport = DOM.getAttr(e, 'transport', default=None) + style = DOM.getAttr(e, 'style', default='document') + ob = SoapBinding(transport, style) + self.addExtension(ob) + continue + elif ns in DOM.NS_HTTP_BINDING_ALL and name == 'binding': + verb = DOM.getAttr(e, 'verb') + ob = HttpBinding(verb) + self.addExtension(ob) + continue + else: + self.addExtension(e) + + def toDom(self): + wsdl = self.getWSDL() + ep = ElementProxy(None, DOM.getElement(wsdl.document, None)) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'binding') + epc.setAttributeNS(None, 'name', self.name) + + ns,name = self.type + prefix = epc.getPrefix(ns) + epc.setAttributeNS(None, 'type', '%s:%s' %(prefix,name)) + + node = epc._getNode() + for ext in self.extensions: + ext.toDom(node) + for op_binding in self.operations: + op_binding.toDom(node) + + +class OperationBinding(Element): + def __init__(self, name, documentation=''): + Element.__init__(self, name, documentation) + self.input = None + self.output = None + self.faults = Collection(self) + +# def getWSDL(self): +# """Return the WSDL object that contains this binding.""" +# return self.parent().parent().parent().parent() + + + def getBinding(self): + """Return the parent Binding object of the operation binding.""" + return self.parent().parent() + + def getOperation(self): + """Return the abstract Operation associated with this binding.""" + return self.getBinding().getPortType().operations[self.name] + + def findBinding(self, kind): + for item in self.extensions: + if isinstance(item, kind): + return item + return None + + def findBindings(self, kind): + return [ item for item in self.extensions if isinstance(item, kind) ] + + def addInputBinding(self, binding): + if self.input is None: + self.input = MessageRoleBinding('input') + self.input.parent = weakref.ref(self) + self.input.addExtension(binding) + return binding + + def addOutputBinding(self, binding): + if self.output is None: + self.output = MessageRoleBinding('output') + self.output.parent = weakref.ref(self) + self.output.addExtension(binding) + return binding + + def addFaultBinding(self, name, binding): + fault = self.get(name, None) + if fault is None: + fault = MessageRoleBinding('fault', name) + fault.addExtension(binding) + return binding + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_SOAP_BINDING_ALL and name == 'operation': + soapaction = DOM.getAttr(e, 'soapAction', default=None) + style = DOM.getAttr(e, 'style', default=None) + ob = SoapOperationBinding(soapaction, style) + self.addExtension(ob) + continue + elif ns in DOM.NS_HTTP_BINDING_ALL and name == 'operation': + location = DOM.getAttr(e, 'location') + ob = HttpOperationBinding(location) + self.addExtension(ob) + continue + else: + self.addExtension(e) + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), 'operation') + epc.setAttributeNS(None, 'name', self.name) + + node = epc._getNode() + for ext in self.extensions: + ext.toDom(node) + if self.input: + self.input.toDom(node) + if self.output: + self.output.toDom(node) + for fault in self.faults: + fault.toDom(node) + + +class MessageRoleBinding(Element): + def __init__(self, type, name='', documentation=''): + Element.__init__(self, name, documentation) + self.type = type + + def findBinding(self, kind): + for item in self.extensions: + if isinstance(item, kind): + return item + return None + + def findBindings(self, kind): + return [ item for item in self.extensions if isinstance(item, kind) ] + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_SOAP_BINDING_ALL and name == 'body': + encstyle = DOM.getAttr(e, 'encodingStyle', default=None) + namespace = DOM.getAttr(e, 'namespace', default=None) + parts = DOM.getAttr(e, 'parts', default=None) + use = DOM.getAttr(e, 'use', default=None) + if use is None: + raise WSDLError( + 'Invalid soap:body binding element.' + ) + ob = SoapBodyBinding(use, namespace, encstyle, parts) + self.addExtension(ob) + continue + + elif ns in DOM.NS_SOAP_BINDING_ALL and name == 'fault': + encstyle = DOM.getAttr(e, 'encodingStyle', default=None) + namespace = DOM.getAttr(e, 'namespace', default=None) + name = DOM.getAttr(e, 'name', default=None) + use = DOM.getAttr(e, 'use', default=None) + if use is None or name is None: + raise WSDLError( + 'Invalid soap:fault binding element.' + ) + ob = SoapFaultBinding(name, use, namespace, encstyle) + self.addExtension(ob) + continue + + elif ns in DOM.NS_SOAP_BINDING_ALL and name in ( + 'header', 'headerfault' + ): + encstyle = DOM.getAttr(e, 'encodingStyle', default=None) + namespace = DOM.getAttr(e, 'namespace', default=None) + message = DOM.getAttr(e, 'message') + part = DOM.getAttr(e, 'part') + use = DOM.getAttr(e, 'use') + if name == 'header': + _class = SoapHeaderBinding + else: + _class = SoapHeaderFaultBinding + message = ParseQName(message, e) + ob = _class(message, part, use, namespace, encstyle) + self.addExtension(ob) + continue + + elif ns in DOM.NS_HTTP_BINDING_ALL and name == 'urlReplacement': + ob = HttpUrlReplacementBinding() + self.addExtension(ob) + continue + + elif ns in DOM.NS_HTTP_BINDING_ALL and name == 'urlEncoded': + ob = HttpUrlEncodedBinding() + self.addExtension(ob) + continue + + elif ns in DOM.NS_MIME_BINDING_ALL and name == 'multipartRelated': + ob = MimeMultipartRelatedBinding() + self.addExtension(ob) + ob.load_ex(GetExtensions(e)) + continue + + elif ns in DOM.NS_MIME_BINDING_ALL and name == 'content': + part = DOM.getAttr(e, 'part', default=None) + type = DOM.getAttr(e, 'type', default=None) + ob = MimeContentBinding(part, type) + self.addExtension(ob) + continue + + elif ns in DOM.NS_MIME_BINDING_ALL and name == 'mimeXml': + part = DOM.getAttr(e, 'part', default=None) + ob = MimeXmlBinding(part) + self.addExtension(ob) + continue + + else: + self.addExtension(e) + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), self.type) + + node = epc._getNode() + for item in self.extensions: + if item: item.toDom(node) + + +class Service(Element): + def __init__(self, name, documentation=''): + Element.__init__(self, name, documentation) + self.ports = Collection(self) + + def getWSDL(self): + return self.parent().parent() + + def addPort(self, name, binding, documentation=''): + item = Port(name, binding, documentation) + self.ports[name] = item + return item + + def load(self, elements): + for element in elements: + name = DOM.getAttr(element, 'name', default=None) + docs = GetDocumentation(element) + binding = DOM.getAttr(element, 'binding', default=None) + if name is None or binding is None: + raise WSDLError( + 'Invalid port element.' + ) + binding = ParseQName(binding, element) + port = self.addPort(name, binding, docs) + port.load_ex(GetExtensions(element)) + + def load_ex(self, elements): + for e in elements: + self.addExtension(e) + + def toDom(self): + wsdl = self.getWSDL() + ep = ElementProxy(None, DOM.getElement(wsdl.document, None)) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), "service") + epc.setAttributeNS(None, "name", self.name) + + node = epc._getNode() + for port in self.ports: + port.toDom(node) + + +class Port(Element): + def __init__(self, name, binding, documentation=''): + Element.__init__(self, name, documentation) + self.binding = binding + +# def getWSDL(self): +# return self.parent().parent().getWSDL() + + def getService(self): + """Return the Service object associated with this port.""" + return self.parent().parent() + + def getBinding(self): + """Return the Binding object that is referenced by this port.""" + wsdl = self.getService().getWSDL() + return wsdl.bindings[self.binding] + + def getPortType(self): + """Return the PortType object that is referenced by this port.""" + wsdl = self.getService().getWSDL() + binding = wsdl.bindings[self.binding] + return wsdl.portTypes[binding.type] + + def getAddressBinding(self): + """A convenience method to obtain the extension element used + as the address binding for the port.""" + for item in self.extensions: + if isinstance(item, SoapAddressBinding) or \ + isinstance(item, HttpAddressBinding): + return item + raise WSDLError( + 'No address binding found in port.' + ) + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_SOAP_BINDING_ALL and name == 'address': + location = DOM.getAttr(e, 'location', default=None) + ob = SoapAddressBinding(location) + self.addExtension(ob) + continue + elif ns in DOM.NS_HTTP_BINDING_ALL and name == 'address': + location = DOM.getAttr(e, 'location', default=None) + ob = HttpAddressBinding(location) + self.addExtension(ob) + continue + else: + self.addExtension(e) + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLUri(wsdl.version), "port") + epc.setAttributeNS(None, "name", self.name) + + ns,name = self.binding + prefix = epc.getPrefix(ns) + epc.setAttributeNS(None, "binding", "%s:%s" %(prefix,name)) + + node = epc._getNode() + for ext in self.extensions: + ext.toDom(node) + + +class SoapBinding: + def __init__(self, transport, style='rpc'): + self.transport = transport + self.style = style + + def getWSDL(self): + return self.parent().getWSDL() + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLSoapBindingUri(wsdl.version), 'binding') + if self.transport: + epc.setAttributeNS(None, "transport", self.transport) + if self.style: + epc.setAttributeNS(None, "style", self.style) + +class SoapAddressBinding: + def __init__(self, location): + self.location = location + + def getWSDL(self): + return self.parent().getWSDL() + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLSoapBindingUri(wsdl.version), 'address') + epc.setAttributeNS(None, "location", self.location) + + +class SoapOperationBinding: + def __init__(self, soapAction=None, style=None): + self.soapAction = soapAction + self.style = style + + def getWSDL(self): + return self.parent().getWSDL() + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLSoapBindingUri(wsdl.version), 'operation') + if self.soapAction: + epc.setAttributeNS(None, 'soapAction', self.soapAction) + if self.style: + epc.setAttributeNS(None, 'style', self.style) + + +class SoapBodyBinding: + def __init__(self, use, namespace=None, encodingStyle=None, parts=None): + if not use in ('literal', 'encoded'): + raise WSDLError( + 'Invalid use attribute value: %s' % use + ) + self.encodingStyle = encodingStyle + self.namespace = namespace + if type(parts) in (type(''), type(u'')): + parts = parts.split() + self.parts = parts + self.use = use + + def getWSDL(self): + return self.parent().getWSDL() + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLSoapBindingUri(wsdl.version), 'body') + epc.setAttributeNS(None, "use", self.use) + epc.setAttributeNS(None, "namespace", self.namespace) + + +class SoapFaultBinding: + def __init__(self, name, use, namespace=None, encodingStyle=None): + if not use in ('literal', 'encoded'): + raise WSDLError( + 'Invalid use attribute value: %s' % use + ) + self.encodingStyle = encodingStyle + self.namespace = namespace + self.name = name + self.use = use + + def getWSDL(self): + return self.parent().getWSDL() + + def toDom(self, node): + wsdl = self.getWSDL() + ep = ElementProxy(None, node) + epc = ep.createAppendElement(DOM.GetWSDLSoapBindingUri(wsdl.version), 'body') + epc.setAttributeNS(None, "use", self.use) + epc.setAttributeNS(None, "name", self.name) + if self.namespace is not None: + epc.setAttributeNS(None, "namespace", self.namespace) + if self.encodingStyle is not None: + epc.setAttributeNS(None, "encodingStyle", self.encodingStyle) + + +class SoapHeaderBinding: + def __init__(self, message, part, use, namespace=None, encodingStyle=None): + if not use in ('literal', 'encoded'): + raise WSDLError( + 'Invalid use attribute value: %s' % use + ) + self.encodingStyle = encodingStyle + self.namespace = namespace + self.message = message + self.part = part + self.use = use + + tagname = 'header' + +class SoapHeaderFaultBinding(SoapHeaderBinding): + tagname = 'headerfault' + + +class HttpBinding: + def __init__(self, verb): + self.verb = verb + +class HttpAddressBinding: + def __init__(self, location): + self.location = location + + +class HttpOperationBinding: + def __init__(self, location): + self.location = location + +class HttpUrlReplacementBinding: + pass + + +class HttpUrlEncodedBinding: + pass + + +class MimeContentBinding: + def __init__(self, part=None, type=None): + self.part = part + self.type = type + + +class MimeXmlBinding: + def __init__(self, part=None): + self.part = part + + +class MimeMultipartRelatedBinding: + def __init__(self): + self.parts = [] + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_MIME_BINDING_ALL and name == 'part': + self.parts.append(MimePartBinding()) + continue + + +class MimePartBinding: + def __init__(self): + self.items = [] + + def load_ex(self, elements): + for e in elements: + ns, name = e.namespaceURI, e.localName + if ns in DOM.NS_MIME_BINDING_ALL and name == 'content': + part = DOM.getAttr(e, 'part', default=None) + type = DOM.getAttr(e, 'type', default=None) + ob = MimeContentBinding(part, type) + self.items.append(ob) + continue + + elif ns in DOM.NS_MIME_BINDING_ALL and name == 'mimeXml': + part = DOM.getAttr(e, 'part', default=None) + ob = MimeXmlBinding(part) + self.items.append(ob) + continue + + elif ns in DOM.NS_SOAP_BINDING_ALL and name == 'body': + encstyle = DOM.getAttr(e, 'encodingStyle', default=None) + namespace = DOM.getAttr(e, 'namespace', default=None) + parts = DOM.getAttr(e, 'parts', default=None) + use = DOM.getAttr(e, 'use', default=None) + if use is None: + raise WSDLError( + 'Invalid soap:body binding element.' + ) + ob = SoapBodyBinding(use, namespace, encstyle, parts) + self.items.append(ob) + continue + + +class WSDLError(Exception): + pass + + + +def DeclareNSPrefix(writer, prefix, nsuri): + if writer.hasNSPrefix(nsuri): + return + writer.declareNSPrefix(prefix, nsuri) + +def ParseTypeRef(value, element): + parts = value.split(':', 1) + if len(parts) == 1: + return (DOM.findTargetNS(element), value) + nsuri = DOM.findNamespaceURI(parts[0], element) + return (nsuri, parts[1]) + +def ParseQName(value, element): + nameref = value.split(':', 1) + if len(nameref) == 2: + nsuri = DOM.findNamespaceURI(nameref[0], element) + name = nameref[-1] + else: + nsuri = DOM.findTargetNS(element) + name = nameref[-1] + return nsuri, name + +def GetDocumentation(element): + docnode = DOM.getElement(element, 'documentation', None, None) + if docnode is not None: + return DOM.getElementText(docnode) + return '' + +def GetExtensions(element): + return [ item for item in DOM.getElements(element, None, None) + if item.namespaceURI != DOM.NS_WSDL ] + +def GetWSAActionFault(operation, name): + """Find wsa:Action attribute, and return value or WSA.FAULT + for the default. + """ + attr = operation.faults[name].action + if attr is not None: + return attr + return WSA.FAULT + +def GetWSAActionInput(operation): + """Find wsa:Action attribute, and return value or the default.""" + attr = operation.input.action + if attr is not None: + return attr + portType = operation.getPortType() + targetNamespace = portType.getTargetNamespace() + ptName = portType.name + msgName = operation.input.name + if not msgName: + msgName = operation.name + 'Request' + if targetNamespace.endswith('/'): + return '%s%s/%s' %(targetNamespace, ptName, msgName) + return '%s/%s/%s' %(targetNamespace, ptName, msgName) + +def GetWSAActionOutput(operation): + """Find wsa:Action attribute, and return value or the default.""" + attr = operation.output.action + if attr is not None: + return attr + targetNamespace = operation.getPortType().getTargetNamespace() + ptName = operation.getPortType().name + msgName = operation.output.name + if not msgName: + msgName = operation.name + 'Response' + if targetNamespace.endswith('/'): + return '%s%s/%s' %(targetNamespace, ptName, msgName) + return '%s/%s/%s' %(targetNamespace, ptName, msgName) + +def FindExtensions(object, kind, t_type=type(())): + if isinstance(kind, t_type): + result = [] + namespaceURI, name = kind + return [ item for item in object.extensions + if hasattr(item, 'nodeType') \ + and DOM.nsUriMatch(namespaceURI, item.namespaceURI) \ + and item.name == name ] + return [ item for item in object.extensions if isinstance(item, kind) ] + +def FindExtension(object, kind, t_type=type(())): + if isinstance(kind, t_type): + namespaceURI, name = kind + for item in object.extensions: + if hasattr(item, 'nodeType') \ + and DOM.nsUriMatch(namespaceURI, item.namespaceURI) \ + and item.name == name: + return item + else: + for item in object.extensions: + if isinstance(item, kind): + return item + return None + + +class SOAPCallInfo: + """SOAPCallInfo captures the important binding information about a + SOAP operation, in a structure that is easier to work with than + raw WSDL structures.""" + + def __init__(self, methodName): + self.methodName = methodName + self.inheaders = [] + self.outheaders = [] + self.inparams = [] + self.outparams = [] + self.retval = None + + encodingStyle = DOM.NS_SOAP_ENC + documentation = '' + soapAction = None + transport = None + namespace = None + location = None + use = 'encoded' + style = 'rpc' + + def addInParameter(self, name, type, namespace=None, element_type=0): + """Add an input parameter description to the call info.""" + parameter = ParameterInfo(name, type, namespace, element_type) + self.inparams.append(parameter) + return parameter + + def addOutParameter(self, name, type, namespace=None, element_type=0): + """Add an output parameter description to the call info.""" + parameter = ParameterInfo(name, type, namespace, element_type) + self.outparams.append(parameter) + return parameter + + def setReturnParameter(self, name, type, namespace=None, element_type=0): + """Set the return parameter description for the call info.""" + parameter = ParameterInfo(name, type, namespace, element_type) + self.retval = parameter + return parameter + + def addInHeaderInfo(self, name, type, namespace, element_type=0, + mustUnderstand=0): + """Add an input SOAP header description to the call info.""" + headerinfo = HeaderInfo(name, type, namespace, element_type) + if mustUnderstand: + headerinfo.mustUnderstand = 1 + self.inheaders.append(headerinfo) + return headerinfo + + def addOutHeaderInfo(self, name, type, namespace, element_type=0, + mustUnderstand=0): + """Add an output SOAP header description to the call info.""" + headerinfo = HeaderInfo(name, type, namespace, element_type) + if mustUnderstand: + headerinfo.mustUnderstand = 1 + self.outheaders.append(headerinfo) + return headerinfo + + def getInParameters(self): + """Return a sequence of the in parameters of the method.""" + return self.inparams + + def getOutParameters(self): + """Return a sequence of the out parameters of the method.""" + return self.outparams + + def getReturnParameter(self): + """Return param info about the return value of the method.""" + return self.retval + + def getInHeaders(self): + """Return a sequence of the in headers of the method.""" + return self.inheaders + + def getOutHeaders(self): + """Return a sequence of the out headers of the method.""" + return self.outheaders + + +class ParameterInfo: + """A ParameterInfo object captures parameter binding information.""" + def __init__(self, name, type, namespace=None, element_type=0): + if element_type: + self.element_type = 1 + if namespace is not None: + self.namespace = namespace + self.name = name + self.type = type + + element_type = 0 + namespace = None + default = None + + +class HeaderInfo(ParameterInfo): + """A HeaderInfo object captures SOAP header binding information.""" + def __init__(self, name, type, namespace, element_type=None): + ParameterInfo.__init__(self, name, type, namespace, element_type) + + mustUnderstand = 0 + actor = None + + +def callInfoFromWSDL(port, name): + """Return a SOAPCallInfo given a WSDL port and operation name.""" + wsdl = port.getService().getWSDL() + binding = port.getBinding() + portType = binding.getPortType() + operation = portType.operations[name] + opbinding = binding.operations[name] + messages = wsdl.messages + callinfo = SOAPCallInfo(name) + + addrbinding = port.getAddressBinding() + if not isinstance(addrbinding, SoapAddressBinding): + raise ValueError, 'Unsupported binding type.' + callinfo.location = addrbinding.location + + soapbinding = binding.findBinding(SoapBinding) + if soapbinding is None: + raise ValueError, 'Missing soap:binding element.' + callinfo.transport = soapbinding.transport + callinfo.style = soapbinding.style or 'document' + + soap_op_binding = opbinding.findBinding(SoapOperationBinding) + if soap_op_binding is not None: + callinfo.soapAction = soap_op_binding.soapAction + callinfo.style = soap_op_binding.style or callinfo.style + + parameterOrder = operation.parameterOrder + + if operation.input is not None: + message = messages[operation.input.message] + msgrole = opbinding.input + + mime = msgrole.findBinding(MimeMultipartRelatedBinding) + if mime is not None: + raise ValueError, 'Mime bindings are not supported.' + else: + for item in msgrole.findBindings(SoapHeaderBinding): + part = messages[item.message].parts[item.part] + header = callinfo.addInHeaderInfo( + part.name, + part.element or part.type, + item.namespace, + element_type = part.element and 1 or 0 + ) + header.encodingStyle = item.encodingStyle + + body = msgrole.findBinding(SoapBodyBinding) + if body is None: + raise ValueError, 'Missing soap:body binding.' + callinfo.encodingStyle = body.encodingStyle + callinfo.namespace = body.namespace + callinfo.use = body.use + + if body.parts is not None: + parts = [] + for name in body.parts: + parts.append(message.parts[name]) + else: + parts = message.parts.values() + + for part in parts: + callinfo.addInParameter( + part.name, + part.element or part.type, + element_type = part.element and 1 or 0 + ) + + if operation.output is not None: + try: + message = messages[operation.output.message] + except KeyError: + if self.strict: + raise RuntimeError( + "Recieved message not defined in the WSDL schema: %s" % + operation.output.message) + else: + message = wsdl.addMessage(operation.output.message) + print "Warning:", \ + "Recieved message not defined in the WSDL schema.", \ + "Adding it." + print "Message:", operation.output.message + + msgrole = opbinding.output + + mime = msgrole.findBinding(MimeMultipartRelatedBinding) + if mime is not None: + raise ValueError, 'Mime bindings are not supported.' + else: + for item in msgrole.findBindings(SoapHeaderBinding): + part = messages[item.message].parts[item.part] + header = callinfo.addOutHeaderInfo( + part.name, + part.element or part.type, + item.namespace, + element_type = part.element and 1 or 0 + ) + header.encodingStyle = item.encodingStyle + + body = msgrole.findBinding(SoapBodyBinding) + if body is None: + raise ValueError, 'Missing soap:body binding.' + callinfo.encodingStyle = body.encodingStyle + callinfo.namespace = body.namespace + callinfo.use = body.use + + if body.parts is not None: + parts = [] + for name in body.parts: + parts.append(message.parts[name]) + else: + parts = message.parts.values() + + if parts: + for part in parts: + callinfo.addOutParameter( + part.name, + part.element or part.type, + element_type = part.element and 1 or 0 + ) + + return callinfo diff --git a/wstools/XMLSchema.py b/wstools/XMLSchema.py new file mode 100755 index 00000000..eb5b3fe2 --- /dev/null +++ b/wstools/XMLSchema.py @@ -0,0 +1,3116 @@ +# Copyright (c) 2003, The Regents of the University of California, +# through Lawrence Berkeley National Laboratory (subject to receipt of +# any required approvals from the U.S. Dept. of Energy). All rights +# reserved. +# +# Copyright (c) 2001 Zope Corporation and Contributors. All Rights Reserved. +# +# This software is subject to the provisions of the Zope Public License, +# Version 2.0 (ZPL). A copy of the ZPL should accompany this distribution. +# THIS SOFTWARE IS PROVIDED "AS IS" AND ANY AND ALL EXPRESS OR IMPLIED +# WARRANTIES ARE DISCLAIMED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +# WARRANTIES OF TITLE, MERCHANTABILITY, AGAINST INFRINGEMENT, AND FITNESS +# FOR A PARTICULAR PURPOSE. + +ident = "$Id$" + +import types, weakref, sys, warnings +from Namespaces import SCHEMA, XMLNS, SOAP, APACHE +from Utility import DOM, DOMException, Collection, SplitQName, basejoin +from StringIO import StringIO + +# If we have no threading, this should be a no-op +try: + from threading import RLock +except ImportError: + class RLock: + def acquire(): + pass + def release(): + pass + +# +# Collections in XMLSchema class +# +TYPES = 'types' +ATTRIBUTE_GROUPS = 'attr_groups' +ATTRIBUTES = 'attr_decl' +ELEMENTS = 'elements' +MODEL_GROUPS = 'model_groups' +BUILT_IN_NAMESPACES = [SOAP.ENC,] + SCHEMA.XSD_LIST + [APACHE.AXIS_NS] + +def GetSchema(component): + """convience function for finding the parent XMLSchema instance. + """ + parent = component + while not isinstance(parent, XMLSchema): + parent = parent._parent() + return parent + +class SchemaReader: + """A SchemaReader creates XMLSchema objects from urls and xml data. + """ + + namespaceToSchema = {} + + def __init__(self, domReader=None, base_url=None): + """domReader -- class must implement DOMAdapterInterface + base_url -- base url string + """ + self.__base_url = base_url + self.__readerClass = domReader + if not self.__readerClass: + self.__readerClass = DOMAdapter + self._includes = {} + self._imports = {} + + def __setImports(self, schema): + """Add dictionary of imports to schema instance. + schema -- XMLSchema instance + """ + for ns,val in schema.imports.items(): + if self._imports.has_key(ns): + schema.addImportSchema(self._imports[ns]) + + def __setIncludes(self, schema): + """Add dictionary of includes to schema instance. + schema -- XMLSchema instance + """ + for schemaLocation, val in schema.includes.items(): + if self._includes.has_key(schemaLocation): + schema.addIncludeSchema(schemaLocation, self._imports[schemaLocation]) + + def addSchemaByLocation(self, location, schema): + """provide reader with schema document for a location. + """ + self._includes[location] = schema + + def addSchemaByNamespace(self, schema): + """provide reader with schema document for a targetNamespace. + """ + self._imports[schema.targetNamespace] = schema + + def loadFromNode(self, parent, element): + """element -- DOM node or document + parent -- WSDLAdapter instance + """ + reader = self.__readerClass(element) + schema = XMLSchema(parent) + #HACK to keep a reference + schema.wsdl = parent + schema.setBaseUrl(self.__base_url) + schema.load(reader) + return schema + + def loadFromStream(self, file, url=None): + """Return an XMLSchema instance loaded from a file object. + file -- file object + url -- base location for resolving imports/includes. + """ + reader = self.__readerClass() + reader.loadDocument(file) + schema = XMLSchema() + if url is not None: + schema.setBaseUrl(url) + schema.load(reader) + self.__setIncludes(schema) + self.__setImports(schema) + return schema + + def loadFromString(self, data): + """Return an XMLSchema instance loaded from an XML string. + data -- XML string + """ + return self.loadFromStream(StringIO(data)) + + def loadFromURL(self, url, schema=None): + """Return an XMLSchema instance loaded from the given url. + url -- URL to dereference + schema -- Optional XMLSchema instance. + """ + reader = self.__readerClass() + if self.__base_url: + url = basejoin(self.__base_url,url) + + reader.loadFromURL(url) + schema = schema or XMLSchema() + schema.setBaseUrl(url) + schema.load(reader) + self.__setIncludes(schema) + self.__setImports(schema) + return schema + + def loadFromFile(self, filename): + """Return an XMLSchema instance loaded from the given file. + filename -- name of file to open + """ + if self.__base_url: + filename = basejoin(self.__base_url,filename) + file = open(filename, 'rb') + try: + schema = self.loadFromStream(file, filename) + finally: + file.close() + + return schema + + +class SchemaError(Exception): + pass + +class NoSchemaLocationWarning(Exception): + pass + + +########################### +# DOM Utility Adapters +########################## +class DOMAdapterInterface: + def hasattr(self, attr, ns=None): + """return true if node has attribute + attr -- attribute to check for + ns -- namespace of attribute, by default None + """ + raise NotImplementedError, 'adapter method not implemented' + + def getContentList(self, *contents): + """returns an ordered list of child nodes + *contents -- list of node names to return + """ + raise NotImplementedError, 'adapter method not implemented' + + def setAttributeDictionary(self, attributes): + """set attribute dictionary + """ + raise NotImplementedError, 'adapter method not implemented' + + def getAttributeDictionary(self): + """returns a dict of node's attributes + """ + raise NotImplementedError, 'adapter method not implemented' + + def getNamespace(self, prefix): + """returns namespace referenced by prefix. + """ + raise NotImplementedError, 'adapter method not implemented' + + def getTagName(self): + """returns tagName of node + """ + raise NotImplementedError, 'adapter method not implemented' + + + def getParentNode(self): + """returns parent element in DOMAdapter or None + """ + raise NotImplementedError, 'adapter method not implemented' + + def loadDocument(self, file): + """load a Document from a file object + file -- + """ + raise NotImplementedError, 'adapter method not implemented' + + def loadFromURL(self, url): + """load a Document from an url + url -- URL to dereference + """ + raise NotImplementedError, 'adapter method not implemented' + + +class DOMAdapter(DOMAdapterInterface): + """Adapter for ZSI.Utility.DOM + """ + def __init__(self, node=None): + """Reset all instance variables. + element -- DOM document, node, or None + """ + if hasattr(node, 'documentElement'): + self.__node = node.documentElement + else: + self.__node = node + self.__attributes = None + + def getNode(self): + return self.__node + + def hasattr(self, attr, ns=None): + """attr -- attribute + ns -- optional namespace, None means unprefixed attribute. + """ + if not self.__attributes: + self.setAttributeDictionary() + if ns: + return self.__attributes.get(ns,{}).has_key(attr) + return self.__attributes.has_key(attr) + + def getContentList(self, *contents): + nodes = [] + ELEMENT_NODE = self.__node.ELEMENT_NODE + for child in DOM.getElements(self.__node, None): + if child.nodeType == ELEMENT_NODE and\ + SplitQName(child.tagName)[1] in contents: + nodes.append(child) + return map(self.__class__, nodes) + + def setAttributeDictionary(self): + self.__attributes = {} + for v in self.__node._attrs.values(): + self.__attributes[v.nodeName] = v.nodeValue + + def getAttributeDictionary(self): + if not self.__attributes: + self.setAttributeDictionary() + return self.__attributes + + def getTagName(self): + return self.__node.tagName + + def getParentNode(self): + if self.__node.parentNode.nodeType == self.__node.ELEMENT_NODE: + return DOMAdapter(self.__node.parentNode) + return None + + def getNamespace(self, prefix): + """prefix -- deference namespace prefix in node's context. + Ascends parent nodes until found. + """ + namespace = None + if prefix == 'xmlns': + namespace = DOM.findDefaultNS(prefix, self.__node) + else: + try: + namespace = DOM.findNamespaceURI(prefix, self.__node) + except DOMException, ex: + if prefix != 'xml': + raise SchemaError, '%s namespace not declared for %s'\ + %(prefix, self.__node._get_tagName()) + namespace = XMLNS.XML + return namespace + + def loadDocument(self, file): + self.__node = DOM.loadDocument(file) + if hasattr(self.__node, 'documentElement'): + self.__node = self.__node.documentElement + + def loadFromURL(self, url): + self.__node = DOM.loadFromURL(url) + if hasattr(self.__node, 'documentElement'): + self.__node = self.__node.documentElement + + +class XMLBase: + """ These class variables are for string indentation. + """ + tag = None + __indent = 0 + __rlock = RLock() + + def __str__(self): + XMLBase.__rlock.acquire() + XMLBase.__indent += 1 + tmp = "<" + str(self.__class__) + '>\n' + for k,v in self.__dict__.items(): + tmp += "%s* %s = %s\n" %(XMLBase.__indent*' ', k, v) + XMLBase.__indent -= 1 + XMLBase.__rlock.release() + return tmp + + +"""Marker Interface: can determine something about an instances properties by using + the provided convenience functions. + +""" +class DefinitionMarker: + """marker for definitions + """ + pass + +class DeclarationMarker: + """marker for declarations + """ + pass + +class AttributeMarker: + """marker for attributes + """ + pass + +class AttributeGroupMarker: + """marker for attribute groups + """ + pass + +class WildCardMarker: + """marker for wildcards + """ + pass + +class ElementMarker: + """marker for wildcards + """ + pass + +class ReferenceMarker: + """marker for references + """ + pass + +class ModelGroupMarker: + """marker for model groups + """ + pass + +class AllMarker(ModelGroupMarker): + """marker for all model group + """ + pass + +class ChoiceMarker(ModelGroupMarker): + """marker for choice model group + """ + pass + +class SequenceMarker(ModelGroupMarker): + """marker for sequence model group + """ + pass + +class ExtensionMarker: + """marker for extensions + """ + pass + +class RestrictionMarker: + """marker for restrictions + """ + facets = ['enumeration', 'length', 'maxExclusive', 'maxInclusive',\ + 'maxLength', 'minExclusive', 'minInclusive', 'minLength',\ + 'pattern', 'fractionDigits', 'totalDigits', 'whiteSpace'] + +class SimpleMarker: + """marker for simple type information + """ + pass + +class ListMarker: + """marker for simple type list + """ + pass + +class UnionMarker: + """marker for simple type Union + """ + pass + + +class ComplexMarker: + """marker for complex type information + """ + pass + +class LocalMarker: + """marker for complex type information + """ + pass + + +class MarkerInterface: + def isDefinition(self): + return isinstance(self, DefinitionMarker) + + def isDeclaration(self): + return isinstance(self, DeclarationMarker) + + def isAttribute(self): + return isinstance(self, AttributeMarker) + + def isAttributeGroup(self): + return isinstance(self, AttributeGroupMarker) + + def isElement(self): + return isinstance(self, ElementMarker) + + def isReference(self): + return isinstance(self, ReferenceMarker) + + def isWildCard(self): + return isinstance(self, WildCardMarker) + + def isModelGroup(self): + return isinstance(self, ModelGroupMarker) + + def isAll(self): + return isinstance(self, AllMarker) + + def isChoice(self): + return isinstance(self, ChoiceMarker) + + def isSequence(self): + return isinstance(self, SequenceMarker) + + def isExtension(self): + return isinstance(self, ExtensionMarker) + + def isRestriction(self): + return isinstance(self, RestrictionMarker) + + def isSimple(self): + return isinstance(self, SimpleMarker) + + def isComplex(self): + return isinstance(self, ComplexMarker) + + def isLocal(self): + return isinstance(self, LocalMarker) + + def isList(self): + return isinstance(self, ListMarker) + + def isUnion(self): + return isinstance(self, UnionMarker) + + +########################################################## +# Schema Components +######################################################### +class XMLSchemaComponent(XMLBase, MarkerInterface): + """ + class variables: + required -- list of required attributes + attributes -- dict of default attribute values, including None. + Value can be a function for runtime dependencies. + contents -- dict of namespace keyed content lists. + 'xsd' content of xsd namespace. + xmlns_key -- key for declared xmlns namespace. + xmlns -- xmlns is special prefix for namespace dictionary + xml -- special xml prefix for xml namespace. + """ + required = [] + attributes = {} + contents = {} + xmlns_key = '' + xmlns = 'xmlns' + xml = 'xml' + + def __init__(self, parent=None): + """parent -- parent instance + instance variables: + attributes -- dictionary of node's attributes + """ + self.attributes = None + self._parent = parent + if self._parent: + self._parent = weakref.ref(parent) + + if not self.__class__ == XMLSchemaComponent\ + and not (type(self.__class__.required) == type(XMLSchemaComponent.required)\ + and type(self.__class__.attributes) == type(XMLSchemaComponent.attributes)\ + and type(self.__class__.contents) == type(XMLSchemaComponent.contents)): + raise RuntimeError, 'Bad type for a class variable in %s' %self.__class__ + + def getItemTrace(self): + """Returns a node trace up to the item. + """ + item, path, name, ref = self, [], 'name', 'ref' + while not isinstance(item,XMLSchema) and not isinstance(item,WSDLToolsAdapter): + attr = item.getAttribute(name) + if not attr: + attr = item.getAttribute(ref) + if not attr: + path.append('<%s>' %(item.tag)) + else: + path.append('<%s ref="%s">' %(item.tag, attr)) + else: + path.append('<%s name="%s">' %(item.tag,attr)) + + item = item._parent() + try: + tns = item.getTargetNamespace() + except: + tns = '' + path.append('<%s targetNamespace="%s">' %(item.tag, tns)) + path.reverse() + return ''.join(path) + + def getTargetNamespace(self): + """return targetNamespace + """ + parent = self + targetNamespace = 'targetNamespace' + tns = self.attributes.get(targetNamespace) + while not tns and parent and parent._parent is not None: + parent = parent._parent() + tns = parent.attributes.get(targetNamespace) + return tns or '' + + def getAttributeDeclaration(self, attribute): + """attribute -- attribute with a QName value (eg. type). + collection -- check types collection in parent Schema instance + """ + return self.getQNameAttribute(ATTRIBUTES, attribute) + + def getAttributeGroup(self, attribute): + """attribute -- attribute with a QName value (eg. type). + collection -- check types collection in parent Schema instance + """ + return self.getQNameAttribute(ATTRIBUTE_GROUPS, attribute) + + def getTypeDefinition(self, attribute): + """attribute -- attribute with a QName value (eg. type). + collection -- check types collection in parent Schema instance + """ + return self.getQNameAttribute(TYPES, attribute) + + def getElementDeclaration(self, attribute): + """attribute -- attribute with a QName value (eg. element). + collection -- check elements collection in parent Schema instance. + """ + return self.getQNameAttribute(ELEMENTS, attribute) + + def getModelGroup(self, attribute): + """attribute -- attribute with a QName value (eg. ref). + collection -- check model_group collection in parent Schema instance. + """ + return self.getQNameAttribute(MODEL_GROUPS, attribute) + + def getQNameAttribute(self, collection, attribute): + """returns object instance representing QName --> (namespace,name), + or if does not exist return None. + attribute -- an information item attribute, with a QName value. + collection -- collection in parent Schema instance to search. + """ + tdc = self.getAttributeQName(attribute) + if not tdc: + return + + obj = self.getSchemaItem(collection, tdc.getTargetNamespace(), tdc.getName()) + if obj: + return obj + +# raise SchemaError, 'No schema item "%s" in collection %s' %(tdc, collection) + return + + def getSchemaItem(self, collection, namespace, name): + """returns object instance representing namespace, name, + or if does not exist return None if built-in, else + raise SchemaError. + + namespace -- namespace item defined in. + name -- name of item. + collection -- collection in parent Schema instance to search. + """ + parent = GetSchema(self) + if parent.targetNamespace == namespace: + try: + obj = getattr(parent, collection)[name] + except KeyError, ex: + raise KeyError, 'targetNamespace(%s) collection(%s) has no item(%s)'\ + %(namespace, collection, name) + + return obj + + if not parent.imports.has_key(namespace): + if namespace in BUILT_IN_NAMESPACES: + # built-in just return + # WARNING: expecting import if "redefine" or add to built-in namespace. + return + + raise SchemaError, 'schema "%s" does not import namespace "%s"' %( + parent.targetNamespace, namespace) + + # Lazy Eval + schema = parent.imports[namespace] + if not isinstance(schema, XMLSchema): + schema = schema.getSchema() + if schema is not None: + parent.imports[namespace] = schema + + if schema is None: + if namespace in BUILT_IN_NAMESPACES: + # built-in just return + return + + raise SchemaError, 'no schema instance for imported namespace (%s).'\ + %(namespace) + + if not isinstance(schema, XMLSchema): + raise TypeError, 'expecting XMLSchema instance not "%r"' %schema + + try: + obj = getattr(schema, collection)[name] + except KeyError, ex: + raise KeyError, 'targetNamespace(%s) collection(%s) has no item(%s)'\ + %(namespace, collection, name) + + return obj + + def getXMLNS(self, prefix=None): + """deference prefix or by default xmlns, returns namespace. + """ + if prefix == XMLSchemaComponent.xml: + return XMLNS.XML + parent = self + ns = self.attributes[XMLSchemaComponent.xmlns].get(prefix or\ + XMLSchemaComponent.xmlns_key) + while not ns: + parent = parent._parent() + ns = parent.attributes[XMLSchemaComponent.xmlns].get(prefix or\ + XMLSchemaComponent.xmlns_key) + if not ns and isinstance(parent, WSDLToolsAdapter): + if prefix is None: + return '' + raise SchemaError, 'unknown prefix %s' %prefix + return ns + + def getAttribute(self, attribute): + """return requested attribute value or None + """ + if type(attribute) in (list, tuple): + if len(attribute) != 2: + raise LookupError, 'To access attributes must use name or (namespace,name)' + + ns_dict = self.attributes.get(attribute[0]) + if ns_dict is None: + return None + + return ns_dict.get(attribute[1]) + + return self.attributes.get(attribute) + + def getAttributeQName(self, attribute): + """return requested attribute value as (namespace,name) or None + """ + qname = self.getAttribute(attribute) + if isinstance(qname, TypeDescriptionComponent) is True: + return qname + if qname is None: + return None + + prefix,ncname = SplitQName(qname) + namespace = self.getXMLNS(prefix) + return TypeDescriptionComponent((namespace,ncname)) + + def getAttributeName(self): + """return attribute name or None + """ + return self.getAttribute('name') + + def setAttributes(self, node): + """Sets up attribute dictionary, checks for required attributes and + sets default attribute values. attr is for default attribute values + determined at runtime. + + structure of attributes dictionary + ['xmlns'][xmlns_key] -- xmlns namespace + ['xmlns'][prefix] -- declared namespace prefix + [namespace][prefix] -- attributes declared in a namespace + [attribute] -- attributes w/o prefix, default namespaces do + not directly apply to attributes, ie Name can't collide + with QName. + """ + self.attributes = {XMLSchemaComponent.xmlns:{}} + for k,v in node.getAttributeDictionary().items(): + prefix,value = SplitQName(k) + if value == XMLSchemaComponent.xmlns: + self.attributes[value][prefix or XMLSchemaComponent.xmlns_key] = v + elif prefix: + ns = node.getNamespace(prefix) + if not ns: + raise SchemaError, 'no namespace for attribute prefix %s'\ + %prefix + if not self.attributes.has_key(ns): + self.attributes[ns] = {} + elif self.attributes[ns].has_key(value): + raise SchemaError, 'attribute %s declared multiple times in %s'\ + %(value, ns) + self.attributes[ns][value] = v + elif not self.attributes.has_key(value): + self.attributes[value] = v + else: + raise SchemaError, 'attribute %s declared multiple times' %value + + if not isinstance(self, WSDLToolsAdapter): + self.__checkAttributes() + self.__setAttributeDefaults() + + #set QNames + for k in ['type', 'element', 'base', 'ref', 'substitutionGroup', 'itemType']: + if self.attributes.has_key(k): + prefix, value = SplitQName(self.attributes.get(k)) + self.attributes[k] = \ + TypeDescriptionComponent((self.getXMLNS(prefix), value)) + + #Union, memberTypes is a whitespace separated list of QNames + for k in ['memberTypes']: + if self.attributes.has_key(k): + qnames = self.attributes[k] + self.attributes[k] = [] + for qname in qnames.split(): + prefix, value = SplitQName(qname) + self.attributes['memberTypes'].append(\ + TypeDescriptionComponent(\ + (self.getXMLNS(prefix), value))) + + def getContents(self, node): + """retrieve xsd contents + """ + return node.getContentList(*self.__class__.contents['xsd']) + + def __setAttributeDefaults(self): + """Looks for default values for unset attributes. If + class variable representing attribute is None, then + it must be defined as an instance variable. + """ + for k,v in self.__class__.attributes.items(): + if v is not None and self.attributes.has_key(k) is False: + if isinstance(v, types.FunctionType): + self.attributes[k] = v(self) + else: + self.attributes[k] = v + + def __checkAttributes(self): + """Checks that required attributes have been defined, + attributes w/default cannot be required. Checks + all defined attributes are legal, attribute + references are not subject to this test. + """ + for a in self.__class__.required: + if not self.attributes.has_key(a): + raise SchemaError,\ + 'class instance %s, missing required attribute %s'\ + %(self.__class__, a) + for a,v in self.attributes.items(): + # attribute #other, ie. not in empty namespace + if type(v) is dict: + continue + + # predefined prefixes xmlns, xml + if a in (XMLSchemaComponent.xmlns, XMLNS.XML): + continue + + if (a not in self.__class__.attributes.keys()) and not\ + (self.isAttribute() and self.isReference()): + raise SchemaError, '%s, unknown attribute(%s,%s)' \ + %(self.getItemTrace(), a, self.attributes[a]) + + +class WSDLToolsAdapter(XMLSchemaComponent): + """WSDL Adapter to grab the attributes from the wsdl document node. + """ + attributes = {'name':None, 'targetNamespace':None} + tag = 'definitions' + + def __init__(self, wsdl): + XMLSchemaComponent.__init__(self, parent=wsdl) + self.setAttributes(DOMAdapter(wsdl.document)) + + def getImportSchemas(self): + """returns WSDLTools.WSDL types Collection + """ + return self._parent().types + + +class Notation(XMLSchemaComponent): + """ + parent: + schema + attributes: + id -- ID + name -- NCName, Required + public -- token, Required + system -- anyURI + contents: + annotation? + """ + required = ['name', 'public'] + attributes = {'id':None, 'name':None, 'public':None, 'system':None} + contents = {'xsd':('annotation')} + tag = 'notation' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class Annotation(XMLSchemaComponent): + """ + parent: + all,any,anyAttribute,attribute,attributeGroup,choice,complexContent, + complexType,element,extension,field,group,import,include,key,keyref, + list,notation,redefine,restriction,schema,selector,simpleContent, + simpleType,union,unique + attributes: + id -- ID + contents: + (documentation | appinfo)* + """ + attributes = {'id':None} + contents = {'xsd':('documentation', 'appinfo')} + tag = 'annotation' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'documentation': + #print_debug('class %s, documentation skipped' %self.__class__, 5) + continue + elif component == 'appinfo': + #print_debug('class %s, appinfo skipped' %self.__class__, 5) + continue + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + + class Documentation(XMLSchemaComponent): + """ + parent: + annotation + attributes: + source, anyURI + xml:lang, language + contents: + mixed, any + """ + attributes = {'source':None, 'xml:lang':None} + contents = {'xsd':('mixed', 'any')} + tag = 'documentation' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'mixed': + #print_debug('class %s, mixed skipped' %self.__class__, 5) + continue + elif component == 'any': + #print_debug('class %s, any skipped' %self.__class__, 5) + continue + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + + class Appinfo(XMLSchemaComponent): + """ + parent: + annotation + attributes: + source, anyURI + contents: + mixed, any + """ + attributes = {'source':None, 'anyURI':None} + contents = {'xsd':('mixed', 'any')} + tag = 'appinfo' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'mixed': + #print_debug('class %s, mixed skipped' %self.__class__, 5) + continue + elif component == 'any': + #print_debug('class %s, any skipped' %self.__class__, 5) + continue + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + +class XMLSchemaFake: + # This is temporary, for the benefit of WSDL until the real thing works. + def __init__(self, element): + self.targetNamespace = DOM.getAttr(element, 'targetNamespace') + self.element = element + +class XMLSchema(XMLSchemaComponent): + """A schema is a collection of schema components derived from one + or more schema documents, that is, one or more element + information items. It represents the abstract notion of a schema + rather than a single schema document (or other representation). + + + parent: + ROOT + attributes: + id -- ID + version -- token + xml:lang -- language + targetNamespace -- anyURI + attributeFormDefault -- 'qualified' | 'unqualified', 'unqualified' + elementFormDefault -- 'qualified' | 'unqualified', 'unqualified' + blockDefault -- '#all' | list of + ('substitution | 'extension' | 'restriction') + finalDefault -- '#all' | list of + ('extension' | 'restriction' | 'list' | 'union') + + contents: + ((include | import | redefine | annotation)*, + (attribute, attributeGroup, complexType, element, group, + notation, simpleType)*, annotation*)* + + + attributes -- schema attributes + imports -- import statements + includes -- include statements + redefines -- + types -- global simpleType, complexType definitions + elements -- global element declarations + attr_decl -- global attribute declarations + attr_groups -- attribute Groups + model_groups -- model Groups + notations -- global notations + """ + attributes = {'id':None, + 'version':None, + 'xml:lang':None, + 'targetNamespace':None, + 'attributeFormDefault':'unqualified', + 'elementFormDefault':'unqualified', + 'blockDefault':None, + 'finalDefault':None} + contents = {'xsd':('include', 'import', 'redefine', 'annotation', + 'attribute', 'attributeGroup', 'complexType', + 'element', 'group', 'notation', 'simpleType', + 'annotation')} + empty_namespace = '' + tag = 'schema' + + def __init__(self, parent=None): + """parent -- + instance variables: + targetNamespace -- schema's declared targetNamespace, or empty string. + _imported_schemas -- namespace keyed dict of schema dependencies, if + a schema is provided instance will not resolve import statement. + _included_schemas -- schemaLocation keyed dict of component schemas, + if schema is provided instance will not resolve include statement. + _base_url -- needed for relative URLs support, only works with URLs + relative to initial document. + includes -- collection of include statements + imports -- collection of import statements + elements -- collection of global element declarations + types -- collection of global type definitions + attr_decl -- collection of global attribute declarations + attr_groups -- collection of global attribute group definitions + model_groups -- collection of model group definitions + notations -- collection of notations + + """ + self.__node = None + self.targetNamespace = None + XMLSchemaComponent.__init__(self, parent) + f = lambda k: k.attributes['name'] + ns = lambda k: k.attributes['namespace'] + sl = lambda k: k.attributes['schemaLocation'] + self.includes = Collection(self, key=sl) + self.imports = Collection(self, key=ns) + self.elements = Collection(self, key=f) + self.types = Collection(self, key=f) + self.attr_decl = Collection(self, key=f) + self.attr_groups = Collection(self, key=f) + self.model_groups = Collection(self, key=f) + self.notations = Collection(self, key=f) + + self._imported_schemas = {} + self._included_schemas = {} + self._base_url = None + + def getNode(self): + """ + Interacting with the underlying DOM tree. + """ + return self.__node + + def addImportSchema(self, schema): + """for resolving import statements in Schema instance + schema -- schema instance + _imported_schemas + """ + if not isinstance(schema, XMLSchema): + raise TypeError, 'expecting a Schema instance' + if schema.targetNamespace != self.targetNamespace: + self._imported_schemas[schema.targetNamespace] = schema + else: + raise SchemaError, 'import schema bad targetNamespace' + + def addIncludeSchema(self, schemaLocation, schema): + """for resolving include statements in Schema instance + schemaLocation -- schema location + schema -- schema instance + _included_schemas + """ + if not isinstance(schema, XMLSchema): + raise TypeError, 'expecting a Schema instance' + if not schema.targetNamespace or\ + schema.targetNamespace == self.targetNamespace: + self._included_schemas[schemaLocation] = schema + else: + raise SchemaError, 'include schema bad targetNamespace' + + def setImportSchemas(self, schema_dict): + """set the import schema dictionary, which is used to + reference depedent schemas. + """ + self._imported_schemas = schema_dict + + def getImportSchemas(self): + """get the import schema dictionary, which is used to + reference depedent schemas. + """ + return self._imported_schemas + + def getSchemaNamespacesToImport(self): + """returns tuple of namespaces the schema instance has declared + itself to be depedent upon. + """ + return tuple(self.includes.keys()) + + def setIncludeSchemas(self, schema_dict): + """set the include schema dictionary, which is keyed with + schemaLocation (uri). + This is a means of providing + schemas to the current schema for content inclusion. + """ + self._included_schemas = schema_dict + + def getIncludeSchemas(self): + """get the include schema dictionary, which is keyed with + schemaLocation (uri). + """ + return self._included_schemas + + def getBaseUrl(self): + """get base url, used for normalizing all relative uri's + """ + return self._base_url + + def setBaseUrl(self, url): + """set base url, used for normalizing all relative uri's + """ + self._base_url = url + + def getElementFormDefault(self): + """return elementFormDefault attribute + """ + return self.attributes.get('elementFormDefault') + + def isElementFormDefaultQualified(self): + return self.attributes.get('elementFormDefault') == 'qualified' + + def getAttributeFormDefault(self): + """return attributeFormDefault attribute + """ + return self.attributes.get('attributeFormDefault') + + def getBlockDefault(self): + """return blockDefault attribute + """ + return self.attributes.get('blockDefault') + + def getFinalDefault(self): + """return finalDefault attribute + """ + return self.attributes.get('finalDefault') + + def load(self, node, location=None): + self.__node = node + + pnode = node.getParentNode() + if pnode: + pname = SplitQName(pnode.getTagName())[1] + if pname == 'types': + attributes = {} + self.setAttributes(pnode) + attributes.update(self.attributes) + self.setAttributes(node) + for k,v in attributes['xmlns'].items(): + if not self.attributes['xmlns'].has_key(k): + self.attributes['xmlns'][k] = v + else: + self.setAttributes(node) + else: + self.setAttributes(node) + + self.targetNamespace = self.getTargetNamespace() + for childNode in self.getContents(node): + component = SplitQName(childNode.getTagName())[1] + + if component == 'include': + tp = self.__class__.Include(self) + tp.fromDom(childNode) + + sl = tp.attributes['schemaLocation'] + schema = tp.getSchema() + + if not self.getIncludeSchemas().has_key(sl): + self.addIncludeSchema(sl, schema) + + self.includes[sl] = tp + + pn = childNode.getParentNode().getNode() + pn.removeChild(childNode.getNode()) + for child in schema.getNode().getNode().childNodes: + pn.appendChild(child.cloneNode(1)) + + for collection in ['imports','elements','types', + 'attr_decl','attr_groups','model_groups', + 'notations']: + for k,v in getattr(schema,collection).items(): + if not getattr(self,collection).has_key(k): + v._parent = weakref.ref(self) + getattr(self,collection)[k] = v + else: + warnings.warn("Not keeping schema component.") + + elif component == 'import': + slocd = SchemaReader.namespaceToSchema + tp = self.__class__.Import(self) + tp.fromDom(childNode) + import_ns = tp.getAttribute('namespace') or\ + self.__class__.empty_namespace + schema = slocd.get(import_ns) + if schema is None: + schema = XMLSchema() + slocd[import_ns] = schema + try: + tp.loadSchema(schema) + except NoSchemaLocationWarning, ex: + # Dependency declaration, hopefully implementation + # is aware of this namespace (eg. SOAP,WSDL,?) + print "IMPORT: ", import_ns + print ex + del slocd[import_ns] + continue + except SchemaError, ex: + #warnings.warn(\ + # ', %s'\ + # %(import_ns, 'failed to load schema instance') + #) + print ex + del slocd[import_ns] + class _LazyEvalImport(str): + '''Lazy evaluation of import, replace entry in self.imports.''' + #attributes = dict(namespace=import_ns) + def getSchema(namespace): + schema = slocd.get(namespace) + if schema is None: + parent = self._parent() + wstypes = parent + if isinstance(parent, WSDLToolsAdapter): + wstypes = parent.getImportSchemas() + schema = wstypes.get(namespace) + if isinstance(schema, XMLSchema): + self.imports[namespace] = schema + return schema + + return None + + self.imports[import_ns] = _LazyEvalImport(import_ns) + continue + else: + tp._schema = schema + + if self.getImportSchemas().has_key(import_ns): + warnings.warn(\ + 'Detected multiple imports of the namespace "%s" '\ + %import_ns) + + self.addImportSchema(schema) + # spec says can have multiple imports of same namespace + # but purpose of import is just dependency declaration. + self.imports[import_ns] = tp + + elif component == 'redefine': + warnings.warn('redefine is ignored') + elif component == 'annotation': + warnings.warn('annotation is ignored') + elif component == 'attribute': + tp = AttributeDeclaration(self) + tp.fromDom(childNode) + self.attr_decl[tp.getAttribute('name')] = tp + elif component == 'attributeGroup': + tp = AttributeGroupDefinition(self) + tp.fromDom(childNode) + self.attr_groups[tp.getAttribute('name')] = tp + elif component == 'element': + tp = ElementDeclaration(self) + tp.fromDom(childNode) + self.elements[tp.getAttribute('name')] = tp + elif component == 'group': + tp = ModelGroupDefinition(self) + tp.fromDom(childNode) + self.model_groups[tp.getAttribute('name')] = tp + elif component == 'notation': + tp = Notation(self) + tp.fromDom(childNode) + self.notations[tp.getAttribute('name')] = tp + elif component == 'complexType': + tp = ComplexType(self) + tp.fromDom(childNode) + self.types[tp.getAttribute('name')] = tp + elif component == 'simpleType': + tp = SimpleType(self) + tp.fromDom(childNode) + self.types[tp.getAttribute('name')] = tp + else: + break + + class Import(XMLSchemaComponent): + """ + parent: + schema + attributes: + id -- ID + namespace -- anyURI + schemaLocation -- anyURI + contents: + annotation? + """ + attributes = {'id':None, + 'namespace':None, + 'schemaLocation':None} + contents = {'xsd':['annotation']} + tag = 'import' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self._schema = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + if self.attributes['namespace'] == self.getTargetNamespace(): + raise SchemaError, 'namespace of schema and import match' + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + def getSchema(self): + """if schema is not defined, first look for a Schema class instance + in parent Schema. Else if not defined resolve schemaLocation + and create a new Schema class instance, and keep a hard reference. + """ + if not self._schema: + ns = self.attributes['namespace'] + schema = self._parent().getImportSchemas().get(ns) + if not schema and self._parent()._parent: + schema = self._parent()._parent().getImportSchemas().get(ns) + + if not schema: + url = self.attributes.get('schemaLocation') + if not url: + raise SchemaError, 'namespace(%s) is unknown' %ns + base_url = self._parent().getBaseUrl() + reader = SchemaReader(base_url=base_url) + reader._imports = self._parent().getImportSchemas() + reader._includes = self._parent().getIncludeSchemas() + self._schema = reader.loadFromURL(url) + return self._schema or schema + + def loadSchema(self, schema): + """ + """ + base_url = self._parent().getBaseUrl() + reader = SchemaReader(base_url=base_url) + reader._imports = self._parent().getImportSchemas() + reader._includes = self._parent().getIncludeSchemas() + self._schema = schema + + if not self.attributes.has_key('schemaLocation'): + raise NoSchemaLocationWarning('no schemaLocation attribute in import') + + reader.loadFromURL(self.attributes.get('schemaLocation'), schema) + + + class Include(XMLSchemaComponent): + """ + parent: + schema + attributes: + id -- ID + schemaLocation -- anyURI, required + contents: + annotation? + """ + required = ['schemaLocation'] + attributes = {'id':None, + 'schemaLocation':None} + contents = {'xsd':['annotation']} + tag = 'include' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self._schema = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + def getSchema(self): + """if schema is not defined, first look for a Schema class instance + in parent Schema. Else if not defined resolve schemaLocation + and create a new Schema class instance. + """ + if not self._schema: + schema = self._parent() + self._schema = schema.getIncludeSchemas().get(\ + self.attributes['schemaLocation'] + ) + if not self._schema: + url = self.attributes['schemaLocation'] + reader = SchemaReader(base_url=schema.getBaseUrl()) + reader._imports = schema.getImportSchemas() + reader._includes = schema.getIncludeSchemas() + + # create schema before loading so chameleon include + # will evalute targetNamespace correctly. + self._schema = XMLSchema(schema) + reader.loadFromURL(url, self._schema) + + return self._schema + + +class AttributeDeclaration(XMLSchemaComponent,\ + AttributeMarker,\ + DeclarationMarker): + """ + parent: + schema + attributes: + id -- ID + name -- NCName, required + type -- QName + default -- string + fixed -- string + contents: + annotation?, simpleType? + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'type':None, + 'default':None, + 'fixed':None} + contents = {'xsd':['annotation','simpleType']} + tag = 'attribute' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + """ No list or union support + """ + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + elif component == 'simpleType': + self.content = AnonymousSimpleType(self) + self.content.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class LocalAttributeDeclaration(AttributeDeclaration,\ + AttributeMarker,\ + LocalMarker,\ + DeclarationMarker): + """ + parent: + complexType, restriction, extension, attributeGroup + attributes: + id -- ID + name -- NCName, required + type -- QName + form -- ('qualified' | 'unqualified'), schema.attributeFormDefault + use -- ('optional' | 'prohibited' | 'required'), optional + default -- string + fixed -- string + contents: + annotation?, simpleType? + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'type':None, + 'form':lambda self: GetSchema(self).getAttributeFormDefault(), + 'use':'optional', + 'default':None, + 'fixed':None} + contents = {'xsd':['annotation','simpleType']} + + def __init__(self, parent): + AttributeDeclaration.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + elif component == 'simpleType': + self.content = AnonymousSimpleType(self) + self.content.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class AttributeWildCard(XMLSchemaComponent,\ + AttributeMarker,\ + DeclarationMarker,\ + WildCardMarker): + """ + parents: + complexType, restriction, extension, attributeGroup + attributes: + id -- ID + namespace -- '##any' | '##other' | + (anyURI* | '##targetNamespace' | '##local'), ##any + processContents -- 'lax' | 'skip' | 'strict', strict + contents: + annotation? + """ + attributes = {'id':None, + 'namespace':'##any', + 'processContents':'strict'} + contents = {'xsd':['annotation']} + tag = 'anyAttribute' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class AttributeReference(XMLSchemaComponent,\ + AttributeMarker,\ + ReferenceMarker): + """ + parents: + complexType, restriction, extension, attributeGroup + attributes: + id -- ID + ref -- QName, required + use -- ('optional' | 'prohibited' | 'required'), optional + default -- string + fixed -- string + contents: + annotation? + """ + required = ['ref'] + attributes = {'id':None, + 'ref':None, + 'use':'optional', + 'default':None, + 'fixed':None} + contents = {'xsd':['annotation']} + tag = 'attribute' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def getAttributeDeclaration(self, attribute='ref'): + return XMLSchemaComponent.getAttributeDeclaration(self, attribute) + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class AttributeGroupDefinition(XMLSchemaComponent,\ + AttributeGroupMarker,\ + DefinitionMarker): + """ + parents: + schema, redefine + attributes: + id -- ID + name -- NCName, required + contents: + annotation?, (attribute | attributeGroup)*, anyAttribute? + """ + required = ['name'] + attributes = {'id':None, + 'name':None} + contents = {'xsd':['annotation', 'attribute', 'attributeGroup', 'anyAttribute']} + tag = 'attributeGroup' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.attr_content = None + + def getAttributeContent(self): + return self.attr_content + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for indx in range(len(contents)): + component = SplitQName(contents[indx].getTagName())[1] + if (component == 'annotation') and (not indx): + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + elif component == 'attribute': + if contents[indx].hasattr('name'): + content.append(LocalAttributeDeclaration(self)) + elif contents[indx].hasattr('ref'): + content.append(AttributeReference(self)) + else: + raise SchemaError, 'Unknown attribute type' + content[-1].fromDom(contents[indx]) + elif component == 'attributeGroup': + content.append(AttributeGroupReference(self)) + content[-1].fromDom(contents[indx]) + elif component == 'anyAttribute': + if len(contents) != indx+1: + raise SchemaError, 'anyAttribute is out of order in %s' %self.getItemTrace() + content.append(AttributeWildCard(self)) + content[-1].fromDom(contents[indx]) + else: + raise SchemaError, 'Unknown component (%s)' %(contents[indx].getTagName()) + + self.attr_content = tuple(content) + +class AttributeGroupReference(XMLSchemaComponent,\ + AttributeGroupMarker,\ + ReferenceMarker): + """ + parents: + complexType, restriction, extension, attributeGroup + attributes: + id -- ID + ref -- QName, required + contents: + annotation? + """ + required = ['ref'] + attributes = {'id':None, + 'ref':None} + contents = {'xsd':['annotation']} + tag = 'attributeGroup' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def getAttributeGroup(self, attribute='ref'): + """attribute -- attribute with a QName value (eg. type). + collection -- check types collection in parent Schema instance + """ + return XMLSchemaComponent.getAttributeGroup(self, attribute) + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + + +###################################################### +# Elements +##################################################### +class IdentityConstrants(XMLSchemaComponent): + """Allow one to uniquely identify nodes in a document and ensure the + integrity of references between them. + + attributes -- dictionary of attributes + selector -- XPath to selected nodes + fields -- list of XPath to key field + """ + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.selector = None + self.fields = None + self.annotation = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + fields = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + elif component == 'selector': + self.selector = self.Selector(self) + self.selector.fromDom(i) + continue + elif component == 'field': + fields.append(self.Field(self)) + fields[-1].fromDom(i) + continue + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.fields = tuple(fields) + + + class Constraint(XMLSchemaComponent): + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + class Selector(Constraint): + """ + parent: + unique, key, keyref + attributes: + id -- ID + xpath -- XPath subset, required + contents: + annotation? + """ + required = ['xpath'] + attributes = {'id':None, + 'xpath':None} + contents = {'xsd':['annotation']} + tag = 'selector' + + class Field(Constraint): + """ + parent: + unique, key, keyref + attributes: + id -- ID + xpath -- XPath subset, required + contents: + annotation? + """ + required = ['xpath'] + attributes = {'id':None, + 'xpath':None} + contents = {'xsd':['annotation']} + tag = 'field' + + +class Unique(IdentityConstrants): + """ Enforce fields are unique w/i a specified scope. + + parent: + element + attributes: + id -- ID + name -- NCName, required + contents: + annotation?, selector, field+ + """ + required = ['name'] + attributes = {'id':None, + 'name':None} + contents = {'xsd':['annotation', 'selector', 'field']} + tag = 'unique' + + +class Key(IdentityConstrants): + """ Enforce fields are unique w/i a specified scope, and all + field values are present w/i document. Fields cannot + be nillable. + + parent: + element + attributes: + id -- ID + name -- NCName, required + contents: + annotation?, selector, field+ + """ + required = ['name'] + attributes = {'id':None, + 'name':None} + contents = {'xsd':['annotation', 'selector', 'field']} + tag = 'key' + + +class KeyRef(IdentityConstrants): + """ Ensure a match between two sets of values in an + instance. + parent: + element + attributes: + id -- ID + name -- NCName, required + refer -- QName, required + contents: + annotation?, selector, field+ + """ + required = ['name', 'refer'] + attributes = {'id':None, + 'name':None, + 'refer':None} + contents = {'xsd':['annotation', 'selector', 'field']} + tag = 'keyref' + + +class ElementDeclaration(XMLSchemaComponent,\ + ElementMarker,\ + DeclarationMarker): + """ + parents: + schema + attributes: + id -- ID + name -- NCName, required + type -- QName + default -- string + fixed -- string + nillable -- boolean, false + abstract -- boolean, false + substitutionGroup -- QName + block -- ('#all' | ('substition' | 'extension' | 'restriction')*), + schema.blockDefault + final -- ('#all' | ('extension' | 'restriction')*), + schema.finalDefault + contents: + annotation?, (simpleType,complexType)?, (key | keyref | unique)* + + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'type':None, + 'default':None, + 'fixed':None, + 'nillable':0, + 'abstract':0, + 'substitutionGroup':None, + 'block':lambda self: self._parent().getBlockDefault(), + 'final':lambda self: self._parent().getFinalDefault()} + contents = {'xsd':['annotation', 'simpleType', 'complexType', 'key',\ + 'keyref', 'unique']} + tag = 'element' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + self.constraints = () + + def isQualified(self): + """Global elements are always qualified. + """ + return True + + def getAttribute(self, attribute): + """return attribute. + If attribute is type and it's None, and no simple or complex content, + return the default type "xsd:anyType" + """ + value = XMLSchemaComponent.getAttribute(self, attribute) + if attribute != 'type' or value is not None: + return value + + if self.content is not None: + return None + + parent = self + while 1: + nsdict = parent.attributes[XMLSchemaComponent.xmlns] + for k,v in nsdict.items(): + if v not in SCHEMA.XSD_LIST: continue + return TypeDescriptionComponent((v, 'anyType')) + + if isinstance(parent, WSDLToolsAdapter)\ + or not hasattr(parent, '_parent'): + break + + parent = parent._parent() + + raise SchemaError, 'failed to locate the XSD namespace' + + def getElementDeclaration(self, attribute): + raise Warning, 'invalid operation for <%s>' %self.tag + + def getTypeDefinition(self, attribute=None): + """If attribute is None, "type" is assumed, return the corresponding + representation of the global type definition (TypeDefinition), + or the local definition if don't find "type". To maintain backwards + compat, if attribute is provided call base class method. + """ + if attribute: + return XMLSchemaComponent.getTypeDefinition(self, attribute) + gt = XMLSchemaComponent.getTypeDefinition(self, 'type') + if gt: + return gt + return self.content + + def getConstraints(self): + return self._constraints + def setConstraints(self, constraints): + self._constraints = tuple(constraints) + constraints = property(getConstraints, setConstraints, None, "tuple of key, keyref, unique constraints") + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + constraints = [] + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + elif component == 'simpleType' and not self.content: + self.content = AnonymousSimpleType(self) + self.content.fromDom(i) + elif component == 'complexType' and not self.content: + self.content = LocalComplexType(self) + self.content.fromDom(i) + elif component == 'key': + constraints.append(Key(self)) + constraints[-1].fromDom(i) + elif component == 'keyref': + constraints.append(KeyRef(self)) + constraints[-1].fromDom(i) + elif component == 'unique': + constraints.append(Unique(self)) + constraints[-1].fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + self.constraints = constraints + + +class LocalElementDeclaration(ElementDeclaration,\ + LocalMarker): + """ + parents: + all, choice, sequence + attributes: + id -- ID + name -- NCName, required + form -- ('qualified' | 'unqualified'), schema.elementFormDefault + type -- QName + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + default -- string + fixed -- string + nillable -- boolean, false + block -- ('#all' | ('extension' | 'restriction')*), schema.blockDefault + contents: + annotation?, (simpleType,complexType)?, (key | keyref | unique)* + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'form':lambda self: GetSchema(self).getElementFormDefault(), + 'type':None, + 'minOccurs':'1', + 'maxOccurs':'1', + 'default':None, + 'fixed':None, + 'nillable':0, + 'abstract':0, + 'block':lambda self: GetSchema(self).getBlockDefault()} + contents = {'xsd':['annotation', 'simpleType', 'complexType', 'key',\ + 'keyref', 'unique']} + + def isQualified(self): + """ +Local elements can be qualified or unqualifed according + to the attribute form, or the elementFormDefault. By default + local elements are unqualified. + """ + form = self.getAttribute('form') + if form == 'qualified': + return True + if form == 'unqualified': + return False + raise SchemaError, 'Bad form (%s) for element: %s' %(form, self.getItemTrace()) + + +class ElementReference(XMLSchemaComponent,\ + ElementMarker,\ + ReferenceMarker): + """ + parents: + all, choice, sequence + attributes: + id -- ID + ref -- QName, required + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + contents: + annotation? + """ + required = ['ref'] + attributes = {'id':None, + 'ref':None, + 'minOccurs':'1', + 'maxOccurs':'1'} + contents = {'xsd':['annotation']} + tag = 'element' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def getElementDeclaration(self, attribute=None): + """If attribute is None, "ref" is assumed, return the corresponding + representation of the global element declaration (ElementDeclaration), + To maintain backwards compat, if attribute is provided call base class method. + """ + if attribute: + return XMLSchemaComponent.getElementDeclaration(self, attribute) + return XMLSchemaComponent.getElementDeclaration(self, 'ref') + + def fromDom(self, node): + self.annotation = None + self.setAttributes(node) + for i in self.getContents(node): + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class ElementWildCard(LocalElementDeclaration, WildCardMarker): + """ + parents: + choice, sequence + attributes: + id -- ID + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + namespace -- '##any' | '##other' | + (anyURI* | '##targetNamespace' | '##local'), ##any + processContents -- 'lax' | 'skip' | 'strict', strict + contents: + annotation? + """ + required = [] + attributes = {'id':None, + 'minOccurs':'1', + 'maxOccurs':'1', + 'namespace':'##any', + 'processContents':'strict'} + contents = {'xsd':['annotation']} + tag = 'any' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def isQualified(self): + """ + Global elements are always qualified, but if processContents + are not strict could have dynamically generated local elements. + """ + return GetSchema(self).isElementFormDefaultQualified() + + def getAttribute(self, attribute): + """return attribute. + """ + return XMLSchemaComponent.getAttribute(self, attribute) + + def getTypeDefinition(self, attribute): + raise Warning, 'invalid operation for <%s>' % self.tag + + def fromDom(self, node): + self.annotation = None + self.setAttributes(node) + for i in self.getContents(node): + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +###################################################### +# Model Groups +##################################################### +class Sequence(XMLSchemaComponent,\ + SequenceMarker): + """ + parents: + complexType, extension, restriction, group, choice, sequence + attributes: + id -- ID + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + + contents: + annotation?, (element | group | choice | sequence | any)* + """ + attributes = {'id':None, + 'minOccurs':'1', + 'maxOccurs':'1'} + contents = {'xsd':['annotation', 'element', 'group', 'choice', 'sequence',\ + 'any']} + tag = 'sequence' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + continue + elif component == 'element': + if i.hasattr('ref'): + content.append(ElementReference(self)) + else: + content.append(LocalElementDeclaration(self)) + elif component == 'group': + content.append(ModelGroupReference(self)) + elif component == 'choice': + content.append(Choice(self)) + elif component == 'sequence': + content.append(Sequence(self)) + elif component == 'any': + content.append(ElementWildCard(self)) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + content[-1].fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + +class All(XMLSchemaComponent,\ + AllMarker): + """ + parents: + complexType, extension, restriction, group + attributes: + id -- ID + minOccurs -- '0' | '1', 1 + maxOccurs -- '1', 1 + + contents: + annotation?, element* + """ + attributes = {'id':None, + 'minOccurs':'1', + 'maxOccurs':'1'} + contents = {'xsd':['annotation', 'element']} + tag = 'all' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + continue + elif component == 'element': + if i.hasattr('ref'): + content.append(ElementReference(self)) + else: + content.append(LocalElementDeclaration(self)) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + content[-1].fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + +class Choice(XMLSchemaComponent,\ + ChoiceMarker): + """ + parents: + complexType, extension, restriction, group, choice, sequence + attributes: + id -- ID + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + + contents: + annotation?, (element | group | choice | sequence | any)* + """ + attributes = {'id':None, + 'minOccurs':'1', + 'maxOccurs':'1'} + contents = {'xsd':['annotation', 'element', 'group', 'choice', 'sequence',\ + 'any']} + tag = 'choice' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + continue + elif component == 'element': + if i.hasattr('ref'): + content.append(ElementReference(self)) + else: + content.append(LocalElementDeclaration(self)) + elif component == 'group': + content.append(ModelGroupReference(self)) + elif component == 'choice': + content.append(Choice(self)) + elif component == 'sequence': + content.append(Sequence(self)) + elif component == 'any': + content.append(ElementWildCard(self)) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + content[-1].fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + +class ModelGroupDefinition(XMLSchemaComponent,\ + ModelGroupMarker,\ + DefinitionMarker): + """ + parents: + redefine, schema + attributes: + id -- ID + name -- NCName, required + + contents: + annotation?, (all | choice | sequence)? + """ + required = ['name'] + attributes = {'id':None, + 'name':None} + contents = {'xsd':['annotation', 'all', 'choice', 'sequence']} + tag = 'group' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + continue + elif component == 'all' and not self.content: + self.content = All(self) + elif component == 'choice' and not self.content: + self.content = Choice(self) + elif component == 'sequence' and not self.content: + self.content = Sequence(self) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class ModelGroupReference(XMLSchemaComponent,\ + ModelGroupMarker,\ + ReferenceMarker): + """ + parents: + choice, complexType, extension, restriction, sequence + attributes: + id -- ID + ref -- NCName, required + minOccurs -- Whole Number, 1 + maxOccurs -- (Whole Number | 'unbounded'), 1 + + contents: + annotation? + """ + required = ['ref'] + attributes = {'id':None, + 'ref':None, + 'minOccurs':'1', + 'maxOccurs':'1'} + contents = {'xsd':['annotation']} + tag = 'group' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + + def getModelGroupReference(self): + return self.getModelGroup('ref') + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + + +class ComplexType(XMLSchemaComponent,\ + DefinitionMarker,\ + ComplexMarker): + """ + parents: + redefine, schema + attributes: + id -- ID + name -- NCName, required + mixed -- boolean, false + abstract -- boolean, false + block -- ('#all' | ('extension' | 'restriction')*), schema.blockDefault + final -- ('#all' | ('extension' | 'restriction')*), schema.finalDefault + + contents: + annotation?, (simpleContent | complexContent | + ((group | all | choice | sequence)?, (attribute | attributeGroup)*, anyAttribute?)) + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'mixed':0, + 'abstract':0, + 'block':lambda self: self._parent().getBlockDefault(), + 'final':lambda self: self._parent().getFinalDefault()} + contents = {'xsd':['annotation', 'simpleContent', 'complexContent',\ + 'group', 'all', 'choice', 'sequence', 'attribute', 'attributeGroup',\ + 'anyAttribute', 'any']} + tag = 'complexType' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + self.attr_content = None + + def isMixed(self): + m = self.getAttribute('mixed') + if m == 0 or m == False: + return False + if isinstance(m, basestring) is True: + if m in ('false', '0'): + return False + if m in ('true', '1'): + return True + + raise SchemaError, 'invalid value for attribute mixed(%s): %s'\ + %(m, self.getItemTrace()) + + def getAttributeContent(self): + return self.attr_content + + def getElementDeclaration(self, attribute): + raise Warning, 'invalid operation for <%s>' %self.tag + + def getTypeDefinition(self, attribute): + raise Warning, 'invalid operation for <%s>' %self.tag + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + indx = 0 + num = len(contents) + if not num: + return + + component = SplitQName(contents[indx].getTagName())[1] + if component == 'annotation': + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + indx += 1 + if indx < num: + component = SplitQName(contents[indx].getTagName())[1] + + self.content = None + if component == 'simpleContent': + self.content = self.__class__.SimpleContent(self) + self.content.fromDom(contents[indx]) + elif component == 'complexContent': + self.content = self.__class__.ComplexContent(self) + self.content.fromDom(contents[indx]) + else: + if component == 'all': + self.content = All(self) + elif component == 'choice': + self.content = Choice(self) + elif component == 'sequence': + self.content = Sequence(self) + elif component == 'group': + self.content = ModelGroupReference(self) + + if self.content: + self.content.fromDom(contents[indx]) + indx += 1 + + self.attr_content = [] + while indx < num: + component = SplitQName(contents[indx].getTagName())[1] + if component == 'attribute': + if contents[indx].hasattr('ref'): + self.attr_content.append(AttributeReference(self)) + else: + self.attr_content.append(LocalAttributeDeclaration(self)) + elif component == 'attributeGroup': + self.attr_content.append(AttributeGroupReference(self)) + elif component == 'anyAttribute': + self.attr_content.append(AttributeWildCard(self)) + else: + raise SchemaError, 'Unknown component (%s): %s' \ + %(contents[indx].getTagName(),self.getItemTrace()) + self.attr_content[-1].fromDom(contents[indx]) + indx += 1 + + class _DerivedType(XMLSchemaComponent): + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + # XXX remove attribute derivation, inconsistent + self.derivation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + for i in contents: + component = SplitQName(i.getTagName())[1] + if component in self.__class__.contents['xsd']: + if component == 'annotation' and not self.annotation: + self.annotation = Annotation(self) + self.annotation.fromDom(i) + continue + elif component == 'restriction' and not self.derivation: + self.derivation = self.__class__.Restriction(self) + elif component == 'extension' and not self.derivation: + self.derivation = self.__class__.Extension(self) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.derivation.fromDom(i) + self.content = self.derivation + + class ComplexContent(_DerivedType,\ + ComplexMarker): + """ + parents: + complexType + attributes: + id -- ID + mixed -- boolean, false + + contents: + annotation?, (restriction | extension) + """ + attributes = {'id':None, + 'mixed':0} + contents = {'xsd':['annotation', 'restriction', 'extension']} + tag = 'complexContent' + + def isMixed(self): + m = self.getAttribute('mixed') + if m == 0 or m == False: + return False + if isinstance(m, basestring) is True: + if m in ('false', '0'): + return False + if m in ('true', '1'): + return True + raise SchemaError, 'invalid value for attribute mixed(%s): %s'\ + %(m, self.getItemTrace()) + + class _DerivationBase(XMLSchemaComponent): + """, + parents: + complexContent + attributes: + id -- ID + base -- QName, required + + contents: + annotation?, (group | all | choice | sequence)?, + (attribute | attributeGroup)*, anyAttribute? + """ + required = ['base'] + attributes = {'id':None, + 'base':None } + contents = {'xsd':['annotation', 'group', 'all', 'choice',\ + 'sequence', 'attribute', 'attributeGroup', 'anyAttribute']} + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + self.attr_content = None + + def getAttributeContent(self): + return self.attr_content + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + indx = 0 + num = len(contents) + #XXX ugly + if not num: + return + component = SplitQName(contents[indx].getTagName())[1] + if component == 'annotation': + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + indx += 1 + component = SplitQName(contents[indx].getTagName())[1] + + if component == 'all': + self.content = All(self) + self.content.fromDom(contents[indx]) + indx += 1 + elif component == 'choice': + self.content = Choice(self) + self.content.fromDom(contents[indx]) + indx += 1 + elif component == 'sequence': + self.content = Sequence(self) + self.content.fromDom(contents[indx]) + indx += 1 + elif component == 'group': + self.content = ModelGroupReference(self) + self.content.fromDom(contents[indx]) + indx += 1 + else: + self.content = None + + self.attr_content = [] + while indx < num: + component = SplitQName(contents[indx].getTagName())[1] + if component == 'attribute': + if contents[indx].hasattr('ref'): + self.attr_content.append(AttributeReference(self)) + else: + self.attr_content.append(LocalAttributeDeclaration(self)) + elif component == 'attributeGroup': + if contents[indx].hasattr('ref'): + self.attr_content.append(AttributeGroupReference(self)) + else: + self.attr_content.append(AttributeGroupDefinition(self)) + elif component == 'anyAttribute': + self.attr_content.append(AttributeWildCard(self)) + else: + raise SchemaError, 'Unknown component (%s)' %(contents[indx].getTagName()) + self.attr_content[-1].fromDom(contents[indx]) + indx += 1 + + class Extension(_DerivationBase, + ExtensionMarker): + """ + parents: + complexContent + attributes: + id -- ID + base -- QName, required + + contents: + annotation?, (group | all | choice | sequence)?, + (attribute | attributeGroup)*, anyAttribute? + """ + tag = 'extension' + + class Restriction(_DerivationBase,\ + RestrictionMarker): + """ + parents: + complexContent + attributes: + id -- ID + base -- QName, required + + contents: + annotation?, (group | all | choice | sequence)?, + (attribute | attributeGroup)*, anyAttribute? + """ + tag = 'restriction' + + + class SimpleContent(_DerivedType,\ + SimpleMarker): + """ + parents: + complexType + attributes: + id -- ID + + contents: + annotation?, (restriction | extension) + """ + attributes = {'id':None} + contents = {'xsd':['annotation', 'restriction', 'extension']} + tag = 'simpleContent' + + class Extension(XMLSchemaComponent,\ + ExtensionMarker): + """ + parents: + simpleContent + attributes: + id -- ID + base -- QName, required + + contents: + annotation?, (attribute | attributeGroup)*, anyAttribute? + """ + required = ['base'] + attributes = {'id':None, + 'base':None } + contents = {'xsd':['annotation', 'attribute', 'attributeGroup', + 'anyAttribute']} + tag = 'extension' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.attr_content = None + + def getAttributeContent(self): + return self.attr_content + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + + indx = 0 + num = len(contents) + + if num: + component = SplitQName(contents[indx].getTagName())[1] + if component == 'annotation': + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + indx += 1 + component = SplitQName(contents[indx].getTagName())[1] + + content = [] + while indx < num: + component = SplitQName(contents[indx].getTagName())[1] + if component == 'attribute': + if contents[indx].hasattr('ref'): + content.append(AttributeReference(self)) + else: + content.append(LocalAttributeDeclaration(self)) + elif component == 'attributeGroup': + content.append(AttributeGroupReference(self)) + elif component == 'anyAttribute': + content.append(AttributeWildCard(self)) + else: + raise SchemaError, 'Unknown component (%s)'\ + %(contents[indx].getTagName()) + content[-1].fromDom(contents[indx]) + indx += 1 + self.attr_content = tuple(content) + + + class Restriction(XMLSchemaComponent,\ + RestrictionMarker): + """ + parents: + simpleContent + attributes: + id -- ID + base -- QName, required + + contents: + annotation?, simpleType?, (enumeration | length | + maxExclusive | maxInclusive | maxLength | minExclusive | + minInclusive | minLength | pattern | fractionDigits | + totalDigits | whiteSpace)*, (attribute | attributeGroup)*, + anyAttribute? + """ + required = ['base'] + attributes = {'id':None, + 'base':None } + contents = {'xsd':['annotation', 'simpleType', 'attribute',\ + 'attributeGroup', 'anyAttribute'] + RestrictionMarker.facets} + tag = 'restriction' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + self.attr_content = None + + def getAttributeContent(self): + return self.attr_content + + def fromDom(self, node): + self.content = [] + self.setAttributes(node) + contents = self.getContents(node) + + indx = 0 + num = len(contents) + component = SplitQName(contents[indx].getTagName())[1] + if component == 'annotation': + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + indx += 1 + component = SplitQName(contents[indx].getTagName())[1] + + content = [] + while indx < num: + component = SplitQName(contents[indx].getTagName())[1] + if component == 'attribute': + if contents[indx].hasattr('ref'): + content.append(AttributeReference(self)) + else: + content.append(LocalAttributeDeclaration(self)) + elif component == 'attributeGroup': + content.append(AttributeGroupReference(self)) + elif component == 'anyAttribute': + content.append(AttributeWildCard(self)) + elif component == 'simpleType': + self.content.append(AnonymousSimpleType(self)) + self.content[-1].fromDom(contents[indx]) + else: + raise SchemaError, 'Unknown component (%s)'\ + %(contents[indx].getTagName()) + content[-1].fromDom(contents[indx]) + indx += 1 + self.attr_content = tuple(content) + + +class LocalComplexType(ComplexType,\ + LocalMarker): + """ + parents: + element + attributes: + id -- ID + mixed -- boolean, false + + contents: + annotation?, (simpleContent | complexContent | + ((group | all | choice | sequence)?, (attribute | attributeGroup)*, anyAttribute?)) + """ + required = [] + attributes = {'id':None, + 'mixed':0} + tag = 'complexType' + + +class SimpleType(XMLSchemaComponent,\ + DefinitionMarker,\ + SimpleMarker): + """ + parents: + redefine, schema + attributes: + id -- ID + name -- NCName, required + final -- ('#all' | ('extension' | 'restriction' | 'list' | 'union')*), + schema.finalDefault + + contents: + annotation?, (restriction | list | union) + """ + required = ['name'] + attributes = {'id':None, + 'name':None, + 'final':lambda self: self._parent().getFinalDefault()} + contents = {'xsd':['annotation', 'restriction', 'list', 'union']} + tag = 'simpleType' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def getElementDeclaration(self, attribute): + raise Warning, 'invalid operation for <%s>' %self.tag + + def getTypeDefinition(self, attribute): + raise Warning, 'invalid operation for <%s>' %self.tag + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + for child in contents: + component = SplitQName(child.getTagName())[1] + if component == 'annotation': + self.annotation = Annotation(self) + self.annotation.fromDom(child) + continue + break + else: + return + if component == 'restriction': + self.content = self.__class__.Restriction(self) + elif component == 'list': + self.content = self.__class__.List(self) + elif component == 'union': + self.content = self.__class__.Union(self) + else: + raise SchemaError, 'Unknown component (%s)' %(component) + self.content.fromDom(child) + + class Restriction(XMLSchemaComponent,\ + RestrictionMarker): + """ + parents: + simpleType + attributes: + id -- ID + base -- QName, required or simpleType child + + contents: + annotation?, simpleType?, (enumeration | length | + maxExclusive | maxInclusive | maxLength | minExclusive | + minInclusive | minLength | pattern | fractionDigits | + totalDigits | whiteSpace)* + """ + attributes = {'id':None, + 'base':None } + contents = {'xsd':['annotation', 'simpleType']+RestrictionMarker.facets} + tag = 'restriction' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + self.facets = None + + def getAttributeBase(self): + return XMLSchemaComponent.getAttribute(self, 'base') + + def getTypeDefinition(self, attribute='base'): + return XMLSchemaComponent.getTypeDefinition(self, attribute) + + def getSimpleTypeContent(self): + for el in self.content: + if el.isSimple(): return el + return None + + def fromDom(self, node): + self.facets = [] + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for indx in range(len(contents)): + component = SplitQName(contents[indx].getTagName())[1] + if (component == 'annotation') and (not indx): + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + continue + elif (component == 'simpleType') and (not indx or indx == 1): + content.append(AnonymousSimpleType(self)) + content[-1].fromDom(contents[indx]) + elif component in RestrictionMarker.facets: + self.facets.append(contents[indx]) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + + class Union(XMLSchemaComponent, + UnionMarker): + """ + parents: + simpleType + attributes: + id -- ID + memberTypes -- list of QNames, required or simpleType child. + + contents: + annotation?, simpleType* + """ + attributes = {'id':None, + 'memberTypes':None } + contents = {'xsd':['annotation', 'simpleType']} + tag = 'union' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def fromDom(self, node): + self.setAttributes(node) + contents = self.getContents(node) + content = [] + + for indx in range(len(contents)): + component = SplitQName(contents[indx].getTagName())[1] + if (component == 'annotation') and (not indx): + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + elif (component == 'simpleType'): + content.append(AnonymousSimpleType(self)) + content[-1].fromDom(contents[indx]) + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + self.content = tuple(content) + + class List(XMLSchemaComponent, + ListMarker): + """ + parents: + simpleType + attributes: + id -- ID + itemType -- QName, required or simpleType child. + + contents: + annotation?, simpleType? + """ + attributes = {'id':None, + 'itemType':None } + contents = {'xsd':['annotation', 'simpleType']} + tag = 'list' + + def __init__(self, parent): + XMLSchemaComponent.__init__(self, parent) + self.annotation = None + self.content = None + + def getItemType(self): + return self.attributes.get('itemType') + + def getTypeDefinition(self, attribute='itemType'): + """ + return the type refered to by itemType attribute or + the simpleType content. If returns None, then the + type refered to by itemType is primitive. + """ + tp = XMLSchemaComponent.getTypeDefinition(self, attribute) + return tp or self.content + + def fromDom(self, node): + self.annotation = None + self.content = None + self.setAttributes(node) + contents = self.getContents(node) + for indx in range(len(contents)): + component = SplitQName(contents[indx].getTagName())[1] + if (component == 'annotation') and (not indx): + self.annotation = Annotation(self) + self.annotation.fromDom(contents[indx]) + elif (component == 'simpleType'): + self.content = AnonymousSimpleType(self) + self.content.fromDom(contents[indx]) + break + else: + raise SchemaError, 'Unknown component (%s)' %(i.getTagName()) + + +class AnonymousSimpleType(SimpleType,\ + SimpleMarker,\ + LocalMarker): + """ + parents: + attribute, element, list, restriction, union + attributes: + id -- ID + + contents: + annotation?, (restriction | list | union) + """ + required = [] + attributes = {'id':None} + tag = 'simpleType' + + +class Redefine: + """ + parents: + attributes: + + contents: + """ + tag = 'redefine' + + +########################### +########################### + + +if sys.version_info[:2] >= (2, 2): + tupleClass = tuple +else: + import UserTuple + tupleClass = UserTuple.UserTuple + +class TypeDescriptionComponent(tupleClass): + """Tuple of length 2, consisting of + a namespace and unprefixed name. + """ + def __init__(self, args): + """args -- (namespace, name) + Remove the name's prefix, irrelevant. + """ + if len(args) != 2: + raise TypeError, 'expecting tuple (namespace, name), got %s' %args + elif args[1].find(':') >= 0: + args = (args[0], SplitQName(args[1])[1]) + tuple.__init__(self, args) + return + + def getTargetNamespace(self): + return self[0] + + def getName(self): + return self[1] + + diff --git a/wstools/XMLname.py b/wstools/XMLname.py new file mode 100644 index 00000000..5961160a --- /dev/null +++ b/wstools/XMLname.py @@ -0,0 +1,90 @@ +"""Translate strings to and from SOAP 1.2 XML name encoding + +Implements rules for mapping application defined name to XML names +specified by the w3 SOAP working group for SOAP version 1.2 in +Appendix A of "SOAP Version 1.2 Part 2: Adjuncts", W3C Working Draft +17, December 2001, + +Also see . + +Author: Gregory R. Warnes +Date:: 2002-04-25 +Version 0.9.0 + +""" + +ident = "$Id$" + +from re import * + + +def _NCNameChar(x): + return x.isalpha() or x.isdigit() or x=="." or x=='-' or x=="_" + + +def _NCNameStartChar(x): + return x.isalpha() or x=="_" + + +def _toUnicodeHex(x): + hexval = hex(ord(x[0]))[2:] + hexlen = len(hexval) + # Make hexval have either 4 or 8 digits by prepending 0's + if (hexlen==1): hexval = "000" + hexval + elif (hexlen==2): hexval = "00" + hexval + elif (hexlen==3): hexval = "0" + hexval + elif (hexlen==4): hexval = "" + hexval + elif (hexlen==5): hexval = "000" + hexval + elif (hexlen==6): hexval = "00" + hexval + elif (hexlen==7): hexval = "0" + hexval + elif (hexlen==8): hexval = "" + hexval + else: raise Exception, "Illegal Value returned from hex(ord(x))" + + return "_x"+ hexval + "_" + + +def _fromUnicodeHex(x): + return eval( r'u"\u'+x[2:-1]+'"' ) + + +def toXMLname(string): + """Convert string to a XML name.""" + if string.find(':') != -1 : + (prefix, localname) = string.split(':',1) + else: + prefix = None + localname = string + + T = unicode(localname) + + N = len(localname) + X = []; + for i in range(N) : + if i< N-1 and T[i]==u'_' and T[i+1]==u'x': + X.append(u'_x005F_') + elif i==0 and N >= 3 and \ + ( T[0]==u'x' or T[0]==u'X' ) and \ + ( T[1]==u'm' or T[1]==u'M' ) and \ + ( T[2]==u'l' or T[2]==u'L' ): + X.append(u'_xFFFF_' + T[0]) + elif (not _NCNameChar(T[i])) or (i==0 and not _NCNameStartChar(T[i])): + X.append(_toUnicodeHex(T[i])) + else: + X.append(T[i]) + + if prefix: + return "%s:%s" % (prefix, u''.join(X)) + return u''.join(X) + + +def fromXMLname(string): + """Convert XML name to unicode string.""" + + retval = sub(r'_xFFFF_','', string ) + + def fun( matchobj ): + return _fromUnicodeHex( matchobj.group(0) ) + + retval = sub(r'_x[0-9A-Za-z]+_', fun, retval ) + + return retval diff --git a/wstools/__init__.py b/wstools/__init__.py new file mode 100644 index 00000000..5b6f7ef0 --- /dev/null +++ b/wstools/__init__.py @@ -0,0 +1,9 @@ +#! /usr/bin/env python +"""WSDL parsing services package for Web Services for Python.""" + +ident = "$Id$" + +import WSDLTools +import XMLname +import logging + diff --git a/wstools/c14n.py b/wstools/c14n.py new file mode 100755 index 00000000..33305bf2 --- /dev/null +++ b/wstools/c14n.py @@ -0,0 +1,433 @@ +#! /usr/bin/env python +'''XML Canonicalization + +Patches Applied to xml.dom.ext.c14n: + http://sourceforge.net/projects/pyxml/ + + [ 1444526 ] c14n.py: http://www.w3.org/TR/xml-exc-c14n/ fix + -- includes [ 829905 ] c14n.py fix for bug #825115, + Date Submitted: 2003-10-24 23:43 + -- include dependent namespace declarations declared in ancestor nodes + (checking attributes and tags), + -- handle InclusiveNamespaces PrefixList parameter + +This module generates canonical XML of a document or element. + http://www.w3.org/TR/2001/REC-xml-c14n-20010315 +and includes a prototype of exclusive canonicalization + http://www.w3.org/Signature/Drafts/xml-exc-c14n + +Requires PyXML 0.7.0 or later. + +Known issues if using Ft.Lib.pDomlette: + 1. Unicode + 2. does not white space normalize attributes of type NMTOKEN and ID? + 3. seems to be include "\n" after importing external entities? + +Note, this version processes a DOM tree, and consequently it processes +namespace nodes as attributes, not from a node's namespace axis. This +permits simple document and element canonicalization without +XPath. When XPath is used, the XPath result node list is passed and used to +determine if the node is in the XPath result list, but little else. + +Authors: + "Joseph M. Reagle Jr." + "Rich Salz" + +$Date$ by $Author$ +''' + +_copyright = '''Copyright 2001, Zolera Systems Inc. All Rights Reserved. +Copyright 2001, MIT. All Rights Reserved. + +Distributed under the terms of: + Python 2.0 License or later. + http://www.python.org/2.0.1/license.html +or + W3C Software License + http://www.w3.org/Consortium/Legal/copyright-software-19980720 +''' + +import string +from xml.dom import Node +try: + from xml.ns import XMLNS +except: + class XMLNS: + BASE = "http://www.w3.org/2000/xmlns/" + XML = "http://www.w3.org/XML/1998/namespace" +try: + import cStringIO + StringIO = cStringIO +except ImportError: + import StringIO + +_attrs = lambda E: (E.attributes and E.attributes.values()) or [] +_children = lambda E: E.childNodes or [] +_IN_XML_NS = lambda n: n.name.startswith("xmlns") +_inclusive = lambda n: n.unsuppressedPrefixes == None + + +# Does a document/PI has lesser/greater document order than the +# first element? +_LesserElement, _Element, _GreaterElement = range(3) + +def _sorter(n1,n2): + '''_sorter(n1,n2) -> int + Sorting predicate for non-NS attributes.''' + + i = cmp(n1.namespaceURI, n2.namespaceURI) + if i: return i + return cmp(n1.localName, n2.localName) + + +def _sorter_ns(n1,n2): + '''_sorter_ns((n,v),(n,v)) -> int + "(an empty namespace URI is lexicographically least)."''' + + if n1[0] == 'xmlns': return -1 + if n2[0] == 'xmlns': return 1 + return cmp(n1[0], n2[0]) + +def _utilized(n, node, other_attrs, unsuppressedPrefixes): + '''_utilized(n, node, other_attrs, unsuppressedPrefixes) -> boolean + Return true if that nodespace is utilized within the node''' + if n.startswith('xmlns:'): + n = n[6:] + elif n.startswith('xmlns'): + n = n[5:] + if (n=="" and node.prefix in ["#default", None]) or \ + n == node.prefix or n in unsuppressedPrefixes: + return 1 + for attr in other_attrs: + if n == attr.prefix: return 1 + # For exclusive need to look at attributes + if unsuppressedPrefixes is not None: + for attr in _attrs(node): + if n == attr.prefix: return 1 + + return 0 + + +def _inclusiveNamespacePrefixes(node, context, unsuppressedPrefixes): + '''http://www.w3.org/TR/xml-exc-c14n/ + InclusiveNamespaces PrefixList parameter, which lists namespace prefixes that + are handled in the manner described by the Canonical XML Recommendation''' + inclusive = [] + if node.prefix: + usedPrefixes = ['xmlns:%s' %node.prefix] + else: + usedPrefixes = ['xmlns'] + + for a in _attrs(node): + if a.nodeName.startswith('xmlns') or not a.prefix: continue + usedPrefixes.append('xmlns:%s' %a.prefix) + + unused_namespace_dict = {} + for attr in context: + n = attr.nodeName + if n in unsuppressedPrefixes: + inclusive.append(attr) + elif n.startswith('xmlns:') and n[6:] in unsuppressedPrefixes: + inclusive.append(attr) + elif n.startswith('xmlns') and n[5:] in unsuppressedPrefixes: + inclusive.append(attr) + elif attr.nodeName in usedPrefixes: + inclusive.append(attr) + elif n.startswith('xmlns:'): + unused_namespace_dict[n] = attr.value + + return inclusive, unused_namespace_dict + +#_in_subset = lambda subset, node: not subset or node in subset +_in_subset = lambda subset, node: subset is None or node in subset # rich's tweak + + +class _implementation: + '''Implementation class for C14N. This accompanies a node during it's + processing and includes the parameters and processing state.''' + + # Handler for each node type; populated during module instantiation. + handlers = {} + + def __init__(self, node, write, **kw): + '''Create and run the implementation.''' + self.write = write + self.subset = kw.get('subset') + self.comments = kw.get('comments', 0) + self.unsuppressedPrefixes = kw.get('unsuppressedPrefixes') + nsdict = kw.get('nsdict', { 'xml': XMLNS.XML, 'xmlns': XMLNS.BASE }) + + # Processing state. + self.state = (nsdict, {'xml':''}, {}, {}) #0422 + + if node.nodeType == Node.DOCUMENT_NODE: + self._do_document(node) + elif node.nodeType == Node.ELEMENT_NODE: + self.documentOrder = _Element # At document element + if not _inclusive(self): + inherited,unused = _inclusiveNamespacePrefixes(node, self._inherit_context(node), + self.unsuppressedPrefixes) + self._do_element(node, inherited, unused=unused) + else: + inherited = self._inherit_context(node) + self._do_element(node, inherited) + elif node.nodeType == Node.DOCUMENT_TYPE_NODE: + pass + else: + raise TypeError, str(node) + + + def _inherit_context(self, node): + '''_inherit_context(self, node) -> list + Scan ancestors of attribute and namespace context. Used only + for single element node canonicalization, not for subset + canonicalization.''' + + # Collect the initial list of xml:foo attributes. + xmlattrs = filter(_IN_XML_NS, _attrs(node)) + + # Walk up and get all xml:XXX attributes we inherit. + inherited, parent = [], node.parentNode + while parent and parent.nodeType == Node.ELEMENT_NODE: + for a in filter(_IN_XML_NS, _attrs(parent)): + n = a.localName + if n not in xmlattrs: + xmlattrs.append(n) + inherited.append(a) + parent = parent.parentNode + return inherited + + + def _do_document(self, node): + '''_do_document(self, node) -> None + Process a document node. documentOrder holds whether the document + element has been encountered such that PIs/comments can be written + as specified.''' + + self.documentOrder = _LesserElement + for child in node.childNodes: + if child.nodeType == Node.ELEMENT_NODE: + self.documentOrder = _Element # At document element + self._do_element(child) + self.documentOrder = _GreaterElement # After document element + elif child.nodeType == Node.PROCESSING_INSTRUCTION_NODE: + self._do_pi(child) + elif child.nodeType == Node.COMMENT_NODE: + self._do_comment(child) + elif child.nodeType == Node.DOCUMENT_TYPE_NODE: + pass + else: + raise TypeError, str(child) + handlers[Node.DOCUMENT_NODE] = _do_document + + + def _do_text(self, node): + '''_do_text(self, node) -> None + Process a text or CDATA node. Render various special characters + as their C14N entity representations.''' + if not _in_subset(self.subset, node): return + s = string.replace(node.data, "&", "&") + s = string.replace(s, "<", "<") + s = string.replace(s, ">", ">") + s = string.replace(s, "\015", " ") + if s: self.write(s) + handlers[Node.TEXT_NODE] = _do_text + handlers[Node.CDATA_SECTION_NODE] = _do_text + + + def _do_pi(self, node): + '''_do_pi(self, node) -> None + Process a PI node. Render a leading or trailing #xA if the + document order of the PI is greater or lesser (respectively) + than the document element. + ''' + if not _in_subset(self.subset, node): return + W = self.write + if self.documentOrder == _GreaterElement: W('\n') + W('') + if self.documentOrder == _LesserElement: W('\n') + handlers[Node.PROCESSING_INSTRUCTION_NODE] = _do_pi + + + def _do_comment(self, node): + '''_do_comment(self, node) -> None + Process a comment node. Render a leading or trailing #xA if the + document order of the comment is greater or lesser (respectively) + than the document element. + ''' + if not _in_subset(self.subset, node): return + if self.comments: + W = self.write + if self.documentOrder == _GreaterElement: W('\n') + W('') + if self.documentOrder == _LesserElement: W('\n') + handlers[Node.COMMENT_NODE] = _do_comment + + + def _do_attr(self, n, value): + ''''_do_attr(self, node) -> None + Process an attribute.''' + + W = self.write + W(' ') + W(n) + W('="') + s = string.replace(value, "&", "&") + s = string.replace(s, "<", "<") + s = string.replace(s, '"', '"') + s = string.replace(s, '\011', ' ') + s = string.replace(s, '\012', ' ') + s = string.replace(s, '\015', ' ') + W(s) + W('"') + + + def _do_element(self, node, initial_other_attrs = [], unused = None): + '''_do_element(self, node, initial_other_attrs = [], unused = {}) -> None + Process an element (and its children).''' + + # Get state (from the stack) make local copies. + # ns_parent -- NS declarations in parent + # ns_rendered -- NS nodes rendered by ancestors + # ns_local -- NS declarations relevant to this element + # xml_attrs -- Attributes in XML namespace from parent + # xml_attrs_local -- Local attributes in XML namespace. + # ns_unused_inherited -- not rendered namespaces, used for exclusive + ns_parent, ns_rendered, xml_attrs = \ + self.state[0], self.state[1].copy(), self.state[2].copy() #0422 + + ns_unused_inherited = unused + if unused is None: + ns_unused_inherited = self.state[3].copy() + + ns_local = ns_parent.copy() + inclusive = _inclusive(self) + xml_attrs_local = {} + + # Divide attributes into NS, XML, and others. + other_attrs = [] + in_subset = _in_subset(self.subset, node) + for a in initial_other_attrs + _attrs(node): + if a.namespaceURI == XMLNS.BASE: + n = a.nodeName + if n == "xmlns:": n = "xmlns" # DOM bug workaround + ns_local[n] = a.nodeValue + elif a.namespaceURI == XMLNS.XML: + if inclusive or (in_subset and _in_subset(self.subset, a)): #020925 Test to see if attribute node in subset + xml_attrs_local[a.nodeName] = a #0426 + else: + if _in_subset(self.subset, a): #020925 Test to see if attribute node in subset + other_attrs.append(a) + +# # TODO: exclusive, might need to define xmlns:prefix here +# if not inclusive and a.prefix is not None and not ns_rendered.has_key('xmlns:%s' %a.prefix): +# ns_local['xmlns:%s' %a.prefix] = ?? + + #add local xml:foo attributes to ancestor's xml:foo attributes + xml_attrs.update(xml_attrs_local) + + # Render the node + W, name = self.write, None + if in_subset: + name = node.nodeName + if not inclusive: + if node.prefix is not None: + prefix = 'xmlns:%s' %node.prefix + else: + prefix = 'xmlns' + + if not ns_rendered.has_key(prefix) and not ns_local.has_key(prefix): + if not ns_unused_inherited.has_key(prefix): + raise RuntimeError,\ + 'For exclusive c14n, unable to map prefix "%s" in %s' %( + prefix, node) + + ns_local[prefix] = ns_unused_inherited[prefix] + del ns_unused_inherited[prefix] + + W('<') + W(name) + + # Create list of NS attributes to render. + ns_to_render = [] + for n,v in ns_local.items(): + + # If default namespace is XMLNS.BASE or empty, + # and if an ancestor was the same + if n == "xmlns" and v in [ XMLNS.BASE, '' ] \ + and ns_rendered.get('xmlns') in [ XMLNS.BASE, '', None ]: + continue + + # "omit namespace node with local name xml, which defines + # the xml prefix, if its string value is + # http://www.w3.org/XML/1998/namespace." + if n in ["xmlns:xml", "xml"] \ + and v in [ 'http://www.w3.org/XML/1998/namespace' ]: + continue + + + # If not previously rendered + # and it's inclusive or utilized + if (n,v) not in ns_rendered.items(): + if inclusive or _utilized(n, node, other_attrs, self.unsuppressedPrefixes): + ns_to_render.append((n, v)) + elif not inclusive: + ns_unused_inherited[n] = v + + # Sort and render the ns, marking what was rendered. + ns_to_render.sort(_sorter_ns) + for n,v in ns_to_render: + self._do_attr(n, v) + ns_rendered[n]=v #0417 + + # If exclusive or the parent is in the subset, add the local xml attributes + # Else, add all local and ancestor xml attributes + # Sort and render the attributes. + if not inclusive or _in_subset(self.subset,node.parentNode): #0426 + other_attrs.extend(xml_attrs_local.values()) + else: + other_attrs.extend(xml_attrs.values()) + other_attrs.sort(_sorter) + for a in other_attrs: + self._do_attr(a.nodeName, a.value) + W('>') + + # Push state, recurse, pop state. + state, self.state = self.state, (ns_local, ns_rendered, xml_attrs, ns_unused_inherited) + for c in _children(node): + _implementation.handlers[c.nodeType](self, c) + self.state = state + + if name: W('' % name) + handlers[Node.ELEMENT_NODE] = _do_element + + +def Canonicalize(node, output=None, **kw): + '''Canonicalize(node, output=None, **kw) -> UTF-8 + + Canonicalize a DOM document/element node and all descendents. + Return the text; if output is specified then output.write will + be called to output the text and None will be returned + Keyword parameters: + nsdict: a dictionary of prefix:uri namespace entries + assumed to exist in the surrounding context + comments: keep comments if non-zero (default is 0) + subset: Canonical XML subsetting resulting from XPath + (default is []) + unsuppressedPrefixes: do exclusive C14N, and this specifies the + prefixes that should be inherited. + ''' + if output: + apply(_implementation, (node, output.write), kw) + else: + s = StringIO.StringIO() + apply(_implementation, (node, s.write), kw) + return s.getvalue() diff --git a/wstools/logging.py b/wstools/logging.py new file mode 100644 index 00000000..9c33b00f --- /dev/null +++ b/wstools/logging.py @@ -0,0 +1,274 @@ +# Copyright (c) 2003, The Regents of the University of California, +# through Lawrence Berkeley National Laboratory (subject to receipt of +# any required approvals from the U.S. Dept. of Energy). All rights +# reserved. +# +"""Logging""" +ident = "$Id$" +import os, sys + +WARN = 1 +DEBUG = 2 + + +class ILogger: + '''Logger interface, by default this class + will be used and logging calls are no-ops. + ''' + level = 0 + def __init__(self, msg): + return + def warning(self, *args, **kw): + return + def debug(self, *args, **kw): + return + def error(self, *args, **kw): + return + def setLevel(cls, level): + cls.level = level + setLevel = classmethod(setLevel) + + debugOn = lambda self: self.level >= DEBUG + warnOn = lambda self: self.level >= WARN + + +class BasicLogger(ILogger): + last = '' + + def __init__(self, msg, out=sys.stdout): + self.msg, self.out = msg, out + + def warning(self, msg, *args, **kw): + if self.warnOn() is False: return + if BasicLogger.last != self.msg: + BasicLogger.last = self.msg + print >>self, "---- ", self.msg, " ----" + print >>self, " %s " %self.WARN, + print >>self, msg %args + WARN = '[WARN]' + def debug(self, msg, *args, **kw): + if self.debugOn() is False: return + if BasicLogger.last != self.msg: + BasicLogger.last = self.msg + print >>self, "---- ", self.msg, " ----" + print >>self, " %s " %self.DEBUG, + print >>self, msg %args + DEBUG = '[DEBUG]' + def error(self, msg, *args, **kw): + if BasicLogger.last != self.msg: + BasicLogger.last = self.msg + print >>self, "---- ", self.msg, " ----" + print >>self, " %s " %self.ERROR, + print >>self, msg %args + ERROR = '[ERROR]' + + def write(self, *args): + '''Write convenience function; writes strings. + ''' + for s in args: self.out.write(s) + event = ''.join(*args) + + +_LoggerClass = BasicLogger + +class GridLogger(ILogger): + def debug(self, msg, *args, **kw): + kw['component'] = self.msg + gridLog(event=msg %args, level='DEBUG', **kw) + + def warning(self, msg, *args, **kw): + kw['component'] = self.msg + gridLog(event=msg %args, level='WARNING', **kw) + + def error(self, msg, *args, **kw): + kw['component'] = self.msg + gridLog(event=msg %args, level='ERROR', **kw) + + +# +# Registry of send functions for gridLog +# +GLRegistry = {} + +class GLRecord(dict): + """Grid Logging Best Practices Record, Distributed Logging Utilities + + The following names are reserved: + + event -- log event name + Below is EBNF for the event name part of a log message. + name = ( "." )? + nodot = {RFC3896-chars except "."} + + Suffixes: + start: Immediately before the first action in a task. + end: Immediately after the last action in a task (that succeeded). + error: an error condition that does not correspond to an end event. + + ts -- timestamp + level -- logging level (see levels below) + status -- integer status code + gid -- global grid identifier + gid, cgid -- parent/child identifiers + prog -- program name + + + More info: http://www.cedps.net/wiki/index.php/LoggingBestPractices#Python + + reserved -- list of reserved names, + omitname -- list of reserved names, output only values ('ts', 'event',) + levels -- dict of levels and description + """ + reserved = ('ts', 'event', 'level', 'status', 'gid', 'prog') + omitname = () + levels = dict(FATAL='Component cannot continue, or system is unusable.', + ALERT='Action must be taken immediately.', + CRITICAL='Critical conditions (on the system).', + ERROR='Errors in the component; not errors from elsewhere.', + WARNING='Problems that are recovered from, usually.', + NOTICE='Normal but significant condition.', + INFO='Informational messages that would be useful to a deployer or administrator.', + DEBUG='Lower level information concerning program logic decisions, internal state, etc.', + TRACE='Finest granularity, similar to "stepping through" the component or system.', + ) + + def __init__(self, date=None, **kw): + kw['ts'] = date or self.GLDate() + kw['gid'] = kw.get('gid') or os.getpid() + dict.__init__(self, kw) + + def __str__(self): + """ + """ + from cStringIO import StringIO + s = StringIO(); n = " " + reserved = self.reserved; omitname = self.omitname; levels = self.levels + + for k in ( list(filter(lambda i: self.has_key(i), reserved)) + + list(filter(lambda i: i not in reserved, self.keys())) + ): + v = self[k] + if k in omitname: + s.write( "%s " %self.format[type(v)](v) ) + continue + + if k == reserved[2] and v not in levels: + pass + + s.write( "%s=%s " %(k, self.format[type(v)](v) ) ) + + s.write("\n") + return s.getvalue() + + class GLDate(str): + """Grid logging Date Format + all timestamps should all be in the same time zone (UTC). + Grid timestamp value format that is a highly readable variant of the ISO8601 time standard [1]: + + YYYY-MM-DDTHH:MM:SS.SSSSSSZ + + """ + def __new__(self, args=None): + """args -- datetime (year, month, day[, hour[, minute[, second[, microsecond[,tzinfo]]]]]) + """ + import datetime + args = args or datetime.datetime.utcnow() + l = (args.year, args.month, args.day, args.hour, args.minute, args.second, + args.microsecond, args.tzinfo or 'Z') + + return str.__new__(self, "%04d-%02d-%02dT%02d:%02d:%02d.%06d%s" %l) + + format = { int:str, float:lambda x: "%lf" % x, long:str, str:lambda x:x, + unicode:str, GLDate:str, } + + +def gridLog(**kw): + """Send GLRecord, Distributed Logging Utilities + If the scheme is passed as a keyword parameter + the value is expected to be a callable function + that takes 2 parameters: url, outputStr + + GRIDLOG_ON -- turn grid logging on + GRIDLOG_DEST -- provide URL destination + """ + import os + + if not bool( int(os.environ.get('GRIDLOG_ON', 0)) ): + return + + url = os.environ.get('GRIDLOG_DEST') + if url is None: + return + + ## NOTE: urlparse problem w/customized schemes + try: + scheme = url[:url.find('://')] + send = GLRegistry[scheme] + send( url, str(GLRecord(**kw)), ) + except Exception, ex: + print >>sys.stderr, "*** gridLog failed -- %s" %(str(kw)) + + +def sendUDP(url, outputStr): + from socket import socket, AF_INET, SOCK_DGRAM + idx1 = url.find('://') + 3; idx2 = url.find('/', idx1) + if idx2 < idx1: idx2 = len(url) + netloc = url[idx1:idx2] + host,port = (netloc.split(':')+[80])[0:2] + socket(AF_INET, SOCK_DGRAM).sendto( outputStr, (host,int(port)), ) + +def writeToFile(url, outputStr): + print >> open(url.split('://')[1], 'a+'), outputStr + +GLRegistry["gridlog-udp"] = sendUDP +GLRegistry["file"] = writeToFile + + +def setBasicLogger(): + '''Use Basic Logger. + ''' + setLoggerClass(BasicLogger) + BasicLogger.setLevel(0) + +def setGridLogger(): + '''Use GridLogger for all logging events. + ''' + setLoggerClass(GridLogger) + +def setBasicLoggerWARN(): + '''Use Basic Logger. + ''' + setLoggerClass(BasicLogger) + BasicLogger.setLevel(WARN) + +def setBasicLoggerDEBUG(): + '''Use Basic Logger. + ''' + setLoggerClass(BasicLogger) + BasicLogger.setLevel(DEBUG) + +def setLoggerClass(loggingClass): + '''Set Logging Class. + ''' + +def setLoggerClass(loggingClass): + '''Set Logging Class. + ''' + assert issubclass(loggingClass, ILogger), 'loggingClass must subclass ILogger' + global _LoggerClass + _LoggerClass = loggingClass + +def setLevel(level=0): + '''Set Global Logging Level. + ''' + ILogger.level = level + +def getLevel(): + return ILogger.level + +def getLogger(msg): + '''Return instance of Logging class. + ''' + return _LoggerClass(msg) + + diff --git a/wstools/tests/.cvsignore b/wstools/tests/.cvsignore new file mode 100644 index 00000000..0d20b648 --- /dev/null +++ b/wstools/tests/.cvsignore @@ -0,0 +1 @@ +*.pyc diff --git a/wstools/tests/README b/wstools/tests/README new file mode 100644 index 00000000..7c1097a7 --- /dev/null +++ b/wstools/tests/README @@ -0,0 +1,52 @@ +Two top level modules have been provided to run the tests. "test_wstools.py" +is used to run all of the local tests. "test_wstools_net.py" is used to run +all of the tests that require network access. + +Add the -v option for more informative feedback. + +ADDING TESTS: + 1. For Stand-Alone tests add WSDL FILE to appropriate archive file + Need to add a NEW Archive?: + config.txt [files] "archive" -- tuple of all archive files, + if you need to create a new archive append the archive + name to the 'archive' tuple. + + 2. Edit config.txt section(s): + option -- name by which service will be referenced in test case. + Need an entry under appropriate section(s), this name + must be unique within each section it appears but it may + appear in multiple sections. + + config.txt "test" sections: + Stand-Alone -- add "option" under [services_by_file] + eg. amazon = exports/AmazonWebServices.wsdl + + Network -- add "option" under [services_by_http] + eg. amazon = http://soap.amazon.com/schemas/AmazonWebServices.wsdl + + Broken -- add "option" under [broken] + + 3. Done + + +CONTENTS OF SAMPLE WSDL/XSD: + schema -- Taken from globus-3.0.1(http://www.globus.org) + xmethods -- Taken from XMethods(http://www.xmethods.com) + airport.wsdl + AmazonWebServices.wsdl + books.wsdl + Distance.wsdl + freedb.wsdl + globalweather.wsdl + IHaddock.wsdl + ip2geo.wsdl + magic.wsdl + query.wsdl + RateInfo.wsdl + SHA1Encrypt.wsdl + siteInspect.wsdl + TemperatureService.wsdl + usweather.wsdl + rtf2html.xml + SolveSystem.wsdl.xml + zip2geo.wsdl diff --git a/wstools/tests/__init__.py b/wstools/tests/__init__.py new file mode 100644 index 00000000..ee3ecd22 --- /dev/null +++ b/wstools/tests/__init__.py @@ -0,0 +1 @@ +#! /usr/bin/env python diff --git a/wstools/tests/config.txt b/wstools/tests/config.txt new file mode 100644 index 00000000..6ebbe19c --- /dev/null +++ b/wstools/tests/config.txt @@ -0,0 +1,362 @@ +############################################################################ +# Joshua R. Boverhof, David W. Robertson, LBNL +# See Copyright for copyright notice! +########################################################################### + +########################################################################### +# Config file for the unit test framework. +# Sections below. +########################################################################### + + + +########################################################################## +# SECTION [files] - archives of wsdl/xsd files. +# +########################################################################## +[files] +archives = ('xmethods.tar.gz', 'schema.tar.gz') + +########################################################################## +# SECTION [services_by_file] - all services locally available for +# testing. +########################################################################## +[services_by_file] +ogsi = schema/ogsi/ogsi_service.wsdl +airport = xmethods/airport.wsdl +distance = xmethods/Distance.wsdl +freedb = xmethods/freedb.wsdl +globalweather = xmethods/globalweather.wsdl +IHaddock = xmethods/IHaddock.wsdl +ip2geo = xmethods/ip2geo.wsdl +magic = xmethods/magic.wsdl +query = xmethods/query.wsdl +RateInfo = xmethods/RateInfo.wsdl +SHA1Encrypt = xmethods/SHA1Encrypt.wsdl +siteInsepct = xmethods/siteInspect.wsdl +TemperatureService = xmethods/TemperatureService.wsdl +usweather = xmethods/usweather.wsdl +zip2geo = xmethods/zip2geo.wsdl +SolveSystem = xmethods/SolveSystem.wsdl.xml + +########################################################################## +# SECTION [services_by_http] - +########################################################################## +[services_by_http] + +# no schemas +AbysalSendEmail = http://www.abysal.com/soap/AbysalEmail.wsdl +BNQuoteService = http://www.xmethods.net/sd/2001/BNQuoteService.wsdl +BabelFishService = http://www.xmethods.net/sd/2001/BabelFishService.wsdl +Bible = http://www.stgregorioschurchdc.org/wsdl/Bible.wsdl +Blast = http://xml.nig.ac.jp/wsdl/Blast.wsdl +CATrafficService = http://www.xmethods.net/sd/2001/CATrafficService.wsdl +Calendar = http://www.stgregorioschurchdc.org/wsdl/Calendar.wsdl +ClustalW = http://xml.nig.ac.jp/wsdl/ClustalW.wsdl +CountryInfoLookupService = http://www.cs.uga.edu/~sent/xmethods/CountryInfoLookup.wsdl +CurrencyExchangeService = http://www.xmethods.net/sd/2001/CurrencyExchangeService.wsdl +DDBJ = http://xml.nig.ac.jp/wsdl/DDBJ.wsdl +DiscordianService = http://www.compkarori.com/wsdl/discordian.wsdl +DistanceService = http://webservices.imacination.com/distance/Distance.jws?wsdl +DocServService = http://docserv.aurigalogic.com/docserv.wsdl +EMWebFunctionWS = http://www.eyemaginations.com/cgi-bin/getWSDL.pl?wsdl=WebFunction.wsdl +Fasta = http://xml.nig.ac.jp/wsdl/Fasta.wsdl +FaxService = http://oneoutbox.com/wsdl/FaxService.wsdl +FreeFaxService = http://www.OneOutBox.com/wsdl/FreeFaxService.wsdl +GetEntry = http://xml.nig.ac.jp/wsdl/GetEntry.wsdl +IBorlandBabelservice = http://ww6.borland.com/webservices/BorlandBabel/BorlandBabel.exe/wsdl/IBorlandBabel +IBorlandChessservice = http://www.danmarinescu.com/WebServices/ChessCGIServer.exe/wsdl/IBorlandChess +IDutchservice = http://www.ebob42.com/cgi-bin/NumberToWordsInDutch.exe/wsdl/IDutch +IEmailServiceservice = http://webservices.matlus.com/scripts/emailwebservice.dll/wsdl/IEmailService +IHeadLineservice = http://www.ebob42.com/cgi-bin/DrBobsClinic.exe/wsdl/IHeadline +IMapQuestservice = http://ww6.borland.com/webservices/MapQuest/MapQuest.exe/wsdl/IMapQuest +IMsSessionBrokerServiceservice = http://webservices.matlus.com/scripts/sessionservice.dll/wsdl/IMsSessionBrokerService +IODCODESPOSTAUXservice = http://www.e-naxos.com/scripts/enwscp.dll/wsdl/IODCODESPOSTAUX +IPGPKeyServerservice = http://www.marotz.se/PGPKeyServer/PGPKeyServiceX.exe/wsdl/IPGPKeyServer +IPrimeGeneratorservice = http://www.jusufdarmawan.com/wsprimegenerator.exe/wsdl/IPrimeGenerator +IRomanservice = http://www.ebob42.com/cgi-bin/Romulan.exe/wsdl/IRoman +ISMSServiceservice = http://sms.idws.com/soap/smsservice.dll/wsdl/ISMSService +ISlashdotHeadlineProviderservice = http://www.marotz.se/scripts/SlashdotHeadlines.exe/wsdl/ISlashdotHeadlineProvider +ISwedishZipInfoservice = http://www.marotz.se/scripts/zipinfo.exe/wsdl/ISwedishZipInfo +ITempConverterservice = http://developerdays.com/cgi-bin/tempconverter.exe/wsdl/ITempConverter +IWSMazeServerservice = http://www.culand.net/WebServices/bin/WSMaze_Server.dll/wsdl/IWSMazeServer +IWagAddressServerSingleservice = http://62.212.78.36/cgi-bin/WagAddressServerSingle.exe/wsdl/IWagAddressServerSingle +IWhoIsservice = http://webservices.matlus.com/scripts/whoiswebservice.dll/wsdl/IWhoIs +Ieconomicservice = http://www.suiyi.com/soap/economic.dll/wsdl/Ieconomic +IgetNumbersservice = http://reto.checkit.ch/Scripts/Lotto.dll/wsdl/IgetNumbers +Iws_Verify_NRICservice = http://www.rightsecurity.biz/NRICWebServices/NRICWebServices.dll/wsdl/Iws_Verify_NRIC +KRSS_DAML_Service = http://digilander.libero.it/mamo78/KRSS_DAML_Service.wsdl +MBWSSoapService = http://www.extensio.com:8080/ExtensioInfoServer/mbsoap/MBWSSoapServices.wsdl +SRS = http://xml.nig.ac.jp/wsdl/SRS.wsdl +ServiceSMS = http://smsserver.dotnetisp.com/servicesms.asmx?WSDL +TemperatureService = http://www.xmethods.net/sd/2001/TemperatureService.wsdl +TxSearch = http://xml.nig.ac.jp/wsdl/TxSearch.wsdl +UrduSOAP = http://www.apniurdu.com/SOAP/Urdu2.wsdl +WSFindMP3 = http://xmlrad.com/WSFindMP3Bin/WSFindMP3.dll/WSDL +WSGenerator = http://xmlrad.com/WSGeneratorBin/WSGenerator.dll/WSDL +WorldTimeService = http://ws.digiposs.com/WorldTime.jws?wsdl +XEMBL = http://www.ebi.ac.uk/xembl/XEMBL.wsdl +XMethodsFilesystemService = http://www.xmethods.net/sd/2001/XMethodsFilesystemService.wsdl +YIM Service = http://www.scdi.org/~avernet/webservice/yim.wsdl +YahooUserPingService = http://www.allesta.net:51110/webservices/wsdl/YahooUserPingService.xml +convert = http://www.cosme.nu/services/convert.php?wsdl +dns = http://www.cosme.nu/services/dns.php?wsdl +eBayWatcherService = http://www.xmethods.net/sd/2001/EBayWatcherService.wsdl +finnwords = http://www.nickhodge.com/nhodge/finnwords/finnwords.wsdl +pop = http://www.cosme.nu/services/pop.php?wsdl + + +#simple types + +ABA = http://www.webservicex.net/aba.asmx?WSDL +AmazonBox = http://www.xmlme.com/WSAmazonBox.asmx?WSDL +AustralianPostCode = http://www.webservicex.net/AustralianPostCode.asmx?WSDL +Autoloan = http://upload.eraserver.net/circle24/autoloan.asmx?wsdl +BNPrice = http://www.abundanttech.com/webservices/bnprice/bnprice.wsdl +BankCode = http://appserver.pepperzak.net/bankcode/BankCodeEJBHome/wsdl.jsp +BarCode = http://www.webservicex.net/barcode.asmx?WSDL +BibleWebservice = http://www.webservicex.net/BibleWebservice.asmx?wsdl +Braille = http://www.webservicex.net/braille.asmx?WSDL +CEqImage = http://www.quisque.com/fr/techno/eqimage/eqimage.asmx?WSDL +CFRSearch = http://www.oakleaf.ws/cfrsearchws/cfrsearchws.asmx?wsdl +CFRSect = http://www.oakleaf.ws/cfrsectws/cfrsectws.asmx?wsdl +CFRToc = http://www.oakleaf.ws/cfrtocws/cfrtocws.asmx?wsdl +CodeGenerator = http://www.esynaps.com/webservices/codegenerator.asmx?WSDL +CreditCardValidator = http://www.richsolutions.com/RichPayments/RichCardValidator.asmx?WSDL +CurrencyConvertor = http://www.webservicex.net/CurrencyConvertor.asmx?wsdl +Currencyws = http://glkev.webs.innerhost.com/glkev_ws/Currencyws.asmx?WSDL +DailyDilbert = http://www.esynaps.com/WebServices/DailyDiblert.asmx?WSDL +DotnetDailyFact = http://www.xmlme.com/WSDailyNet.asmx?WSDL +EMBLNucleotideSequenceWebService = http://www.webservicex.net/EMBLNucleotideSequenceWebService.asmx?wsdl +ElectronicProductsFinder = http://www.xmlme.com/WSElectronics.asmx?WSDL +EncryptionWS = http://test.mapfrepr.net/Encryption/Encryption.asmx?WSDL +Fax = http://ws.acrosscommunications.com/Fax.asmx?WSDL +FinanceService = http://www.webservicex.net/FinanceService.asmx?WSDL +Fortune = http://adrianr.dyndns.org/Fortune/Fortune.wsdl +GetCustomNews = http://www.xmlme.com/WSCustNews.asmx?WSDL +GetLocalTime = http://services.develop.co.za/GetLocalTime.asmx?WSDL +GlobalWeather = http://www.webservicex.net/globalweather.asmx?WSDL +HCPCS = http://www.webservicex.net/hcpcs.asmx?WSDL +IBANFunctions = http://www.bitounis.com/IBAN/IBANFuncs.asmx?WSDL +ICD10 = http://www.webservicex.net/icd10.asmx?WSDL +ICD9 = http://www.webservicex.net/icd9.asmx?WSDL +ICD9Drug = http://www.webservicex.net/icd9drug.asmx?WSDL +ICD9ToICD10 = http://www.webservicex.net/icd9toicd10.asmx?WSDL +ICQ = http://ws.acrosscommunications.com/ICQ.asmx?WSDL +ISearchSwedishPersonservice = http://www.marotz.se/scripts/searchperson.exe/wsdl/ISearchSwedishPerson +InstantMessageAlert = http://www.bindingpoint.com/ws/imalert/imalert.asmx?wsdl +LocalTime = http://www.ripedev.com/webservices/LocalTime.asmx?WSDL +MSProxy = http://www.esynaps.com/WebServices/MsProxy.asmx?WSDL +MXChecker = http://beta2.eraserver.net/webservices/mxchecker/mxchecker.asmx?WSDL +NAICS = http://www.webservicex.net/NAICS.asmx?wsdl +NFLNews = http://www.esynaps.com/WebServices/NFLNews.asmx?WSDL +NumPager = http://ws.acrosscommunications.com/NumPager.asmx?WSDL +OTNNews = http://otn.oracle.com/ws/otnnews?WSDL +Paracite = http://paracite.ecs.soton.ac.uk/paracite.wsdl +Phone = http://ws.acrosscommunications.com/Phone.asmx?WSDL +Puki = http://www.barnaland.is/dev/puki.asmx?WSDL +QueryIP = http://ws.cdyne.com/whoisforip/queryip.asmx?wsdl +Quotes = http://www.seshakiran.com/QuoteService/QuotesService.asmx?wsdl +QuranVerse = http://aspnet.lamaan.com/webservices/QuranVerse.asmx?WSDL +RSAFuncs = http://www.bitounis.com/RSAFunctions/RSAFuncs.asmx?WSDL +RSStoHTML = http://www.webservicex.net/RssToHTML.asmx?WSDL +#SMS = http://ws.acrosscommunications.com/SMS.asmx?WSDL +#SMS_1 = http://www.barnaland.is/dev/sms.asmx?WSDL +SQLDataSoap = http://www.SoapClient.com/xml/SQLDataSoap.wsdl +SecureXML = http://www.securexml.net/securexml/securexml.wsdl +SendSMSWorld = http://www.webservicex.net/sendsmsworld.asmx?WSDL +Shakespeare = http://www.xmlme.com/WSShakespeare.asmx?WSDL +SportingGoodsFinder = http://www.xmlme.com/WSSportingGoods.asmx?WSDL +StockQuote = http://www.webservicex.net/stockquote.asmx?WSDL +StockQuotes = http://www.gama-system.com/webservices/stockquotes.asmx?wsdl +TAP = http://ws.acrosscommunications.com/TAP.asmx?WSDL +UDDIBusinessFinder = http://www.webservicex.net/UDDIBusinessFinder.asmx?WSDL +UKLocation = http://www.webservicex.net/uklocation.asmx?WSDL +UNSPSCConvert = http://www.codemechanisms.co.uk/WebServices/UNSPSC.asmx?WSDL +USWeather = http://www.webservicex.net/usweather.asmx?WSDL +ValidateEmail = http://www.webservicex.net/ValidateEmail.asmx?WSDL +VideoGamesFinder = http://www.xmlme.com/WSVideoGames.asmx?WSDL +WebChart = http://www.gxchart.com/webchart.wsdl +WebSearchWS = http://www.esynaps.com/WebServices/SearchWS.asmx?WSDL +WhoIS = http://ws.cdyne.com/whoisquery/whois.asmx?wsdl +WhoIsService = http://www.esynaps.com/WebServices/WhoIsService.asmx?WSDL +XmlDailyFact = http://www.xmlme.com/WSDailyXml.asmx?WSDL +XmlTracking = http://www.baxglobal.com/xmltracking/xmltracking.asmx?wsdl +XreOnline = http://www.codecube.net/services/xreonline.asmx?WSDL +ZipCodesService = http://webservices.instantlogic.com/zipcodes.ils?wsdl +airport = http://www.webservicex.net/airport.asmx?wsdl +bork = http://www.x-ws.de/cgi-bin/bork/service.wsdl +chat = http://www.x-ws.de/cgi-bin/eliza/chat.wsdl +country = http://www.webservicex.net/country.asmx?wsdl +eSynapsFeed = http://www.esynaps.com/WebServices/eSynapsFeed.asmx?WSDL +eSynapsSerach = http://www.esynaps.com/WebServices/eSynapsSearch.asmx?WSDL +engtoarabic = http://www.dl-me.com/etoaservice/engtoarabic.asmx?WSDL +fWArticleService = http://www.framewerks.com/WebServices/fWArticleService/fwArticles.asmx?WSDL +fax = http://www.webservicex.net/fax.asmx?wsdl +foxcentral = http://www.foxcentral.net/foxcentral.wsdl +iifws = http://www.inkostar.com/wsdl/iifws/iifws.wsdl +imstatus = http://www.x-ws.de/cgi-bin/msn/imstatus.wsdl +periodictable = http://www.webservicex.net/periodictable.asmx?wsdl +piglatin = http://www.aspxpressway.com/maincontent/webservices/piglatin.asmx?wsdl +unitext = http://www.dl-me.com/webservices/unitext.asmx?wsdl +wwhelpservice = http://www.west-wind.com/wconnect/soap/wwhelpservice.wsdl +xmlserver = http://xml.redcoal.net/SMSSOAP/xmlserver.wsdl + +# complex types + +AddFinderService = http://www.lixusnet.com/lixusnet/AddFinder.jws?wsdl +AddressFinder = http://arcweb.esri.com/services/v2/AddressFinder.wsdl +AddressLookup = http://ws.cdyne.com/psaddress/addresslookup.asmx?wsdl +AmazonQuery = http://majordojo.com/amazon_query/amazon_query.wsdl +AmazonSearch = http://soap.amazon.com/schemas/AmazonWebServices.wsdl +BondService = http://www.financialwebservices.ltd.uk/axis/services/bond?wsdl +BusinessNews = http://glkev.webs.innerhost.com/glkev_ws/businessnews.asmx?WSDL +CarRentalQuotesService = http://wavendon.dsdata.co.uk/axis/services/CarRentalQuotes?wsdl +CupScores = http://scores.serviceobjects.com/CupScores.asmx?WSDL +DOTSAddressValidate = http://ws2.serviceobjects.net/av/AddressValidate.asmx?WSDL +DOTSDomainSpy = http://ws2.serviceobjects.net/ds/domainspy.asmx?WSDL +DOTSEmailValidate = http://ws2.serviceobjects.net/ev/EmailValidate.asmx?WSDL +DOTSFastQuote = http://ws2.serviceobjects.net/sq/FastQuote.asmx?WSDL +DOTSFastTax = http://ws2.serviceobjects.net/ft/FastTax.asmx?WSDL +DOTSFastWeather = http://ws2.serviceobjects.net/fw/FastWeather.asmx?WSDL +DOTSGeoCash = http://ws2.serviceobjects.net/gc/GeoCash.asmx?WSDL +DOTSGeoPhone = http://ws2.serviceobjects.net/gp/GeoPhone.asmx?WSDL +DOTSGeoPinPoint = http://ws2.serviceobjects.net/gpp/GeoPinPoint.asmx?WSDL +DOTSLotteryNumbers = http://ws2.serviceobjects.net/ln/lotterynumbers.asmx?WSDL +DOTSPackageTracking = http://ws2.serviceobjects.net/pt/PackTrack.asmx?WSDL +DOTSPatentOffice = http://ws2.serviceobjects.net/uspo/USPatentOffice.asmx?WSDL +DOTSPhoneAppend = http://ws2.serviceobjects.net/pa/phoneappend.asmx?wsdl +DOTSShippingComparison = http://ws2.serviceobjects.net/pc/packcost.asmx?WSDL +DOTSUPC = http://ws2.serviceobjects.net/upc/UPC.asmx?WSDL +DOTSYellowPages = http://ws2.serviceobjects.net/yp/YellowPages.asmx?WSDL +Dispenser = http://www.blackstoneonline.com/webservices/dispenser.xml +DocConverterService = http://telecommerce.danet.de/axis/services/DocConverterServicePort?wsdl +FOPService = http://live.capescience.com/wsdl/FOPService.wsdl +FedRoutingDirectoryService = http://demo.soapam.com/services/FedEpayDirectory/FedEpayDirectoryService.wsdl +GMChart = http://service.graphmagic.com/GMService/GraphMagic.asmx?wsdl +GeoPlaces = http://www.codebump.com/services/placelookup.asmx?wsdl +GlobalWeather = http://live.capescience.com/wsdl/GlobalWeather.wsdl +GoogleSearch = http://api.google.com/GoogleSearch.wsdl +HPcatalogService = http://www.lixusnet.com/lixusnet/HPcatalog.jws?wsdl +HTMLeMail = http://www.framewerks.com/WebServices/HTMLeMail/HTMLeMail.asmx?WSDL +HelpfulFunctions = http://www.framewerks.com/WebServices/helpfulfunctions/helpfulfunctions.asmx?WSDL +HistoricalStockQuotes = http://glkev.webs.innerhost.com/glkev_ws/HistoricalStockQuotes.asmx?WSDL +Horoscope = http://www.swanandmokashi.com/HomePage/WebServices/Horoscope.asmx?WSDL +IACHSOAPservice = http://soap.achchex.com/exec/achsoap.dll/wsdl/IACHSOAP +IP2Geo = http://ws.cdyne.com/ip2geo/ip2geo.asmx?wsdl +ISoapFindMP3service = http://www.agnisoft.com/soap/mssoapmp3search.xml +ITeeChartservice = http://www.berneda.com/scripts/TeeChartSOAP.exe/wsdl/ITeeChart +IZPOP3service = http://www.zanetti-dev.com/scripts/zpop3ws.exe/wsdl/IZPOP3 +LookyBookService = http://www.winisp.net/cheeso/books/books.asmx?WSDL +MailLocate = http://www.maillocate.com/soap/index.php?wsdl +NavBarServer = http://ws.xara.com/navbar/navbar.wsdl +Online Messenger Service = http://www.nims.nl/soap/oms.wsdl +OnlineMessengerService = http://www.nims.nl/soap/oms2.wsdl +Option_x0020_Pricing_x0020_Calculator = http://www.indobiz.com/OptionPricing.asmx?WSDL +PersonLookup = http://www.barnaland.is/dev/personlookup.asmx?WSDL +Phonebook = http://www.barnaland.is/dev/phonebook.asmx?WSDL +PopulationWS = http://www.abundanttech.com/webservices/population/population.wsdl +QueryInterfaceService = http://www.transactionalweb.com/SOAP/globalskilocator.wsdl +QuizService = http://java.rus.uni-stuttgart.de/quiz/quiz.wsdl +QuoteOfTheDay = http://www.swanandmokashi.com/HomePage/WebServices/QuoteOfTheDay.asmx?WSDL +RateInfoClass = http://www.xeeinc.com/RateInformation/RateInfo.asmx?WSDL +RateInfoClass_1 = http://www.xeeinc.com/RateInformation/Rateinfo.asmx?WSDL +RecipeService = http://icuisine.net/webservices/RecipeService.asmx?WSDL +RenderServer3D = http://ws.xara.com/graphicrender/render3d.wsdl +RichPayments = http://www.richsolutions.com/richpayments/richpay.asmx?WSDL +SBGGetAirFareQuoteService = http://wavendon.dsdata.co.uk:8080/axis/services/SBGGetAirFareQuote?wsdl +SMS = http://www.abctext.com/webservices/SMS.asmx?WSDL +SalesRankNPrice = http://www.PerfectXML.NET/WebServices/SalesRankNPrice/BookService.asmx?WSDL +SendSMS = http://www.webservicex.net/SendSMS.asmx?WSDL +Server = http://addison.ra.cwru.edu/orc/calendar_copy/server.php?wsdl +Service = http://www.ejse.com/WeatherService/Service.asmx?WSDL +SpamKillerService = http://wavendon.dsdata.co.uk/axis/services/SpamKiller?wsdl +StockQuotes = http://www.swanandmokashi.com/HomePage/WebServices/StockQuotes.asmx?WSDL +TWSFissionDotNet = http://www.sidespace.com/ws/fission/fissiondotnet.php?wsdl +TerraService = http://terraservice.net/TerraService.asmx?WSDL +Transform = http://transform.dataconcert.com/transform.wsdl +UPSTracking = http://glkev.webs.innerhost.com/glkev_ws/UPSTracking.asmx?WSDL +URLjr_Library = http://urljr.com/soap +WeatherFetcher = http://glkev.webs.innerhost.com/glkev_ws/WeatherFetcher.asmx?WSDL +WeatherService = http://www.hkwizard.com/WeatherService.asmx?wsdl +WebServiceOfTheDay = http://www.webserviceoftheday.com/ws/soap/wsotd.asmx?wsdl +WeblogsSubscriber = http://soap.4s4c.com/weblogs/subscribe.wsdl +WhoIs = http://ws2.serviceobjects.net/whi/WhoIs.asmx?WSDL +WhoisDataService = http://wavendon.dsdata.co.uk/axis/services/WhoisData?wsdl +WolframSearchService = http://webservices.wolfram.com/services/SearchServices/WolframSearch.wsdl +XMethodsQuery = http://www.xmethods.net/wsdl/query.wsdl +XigniteEdgar = http://www.xignite.com/xEdgar.asmx?WSDL +XigniteNews = http://www.xignite.com/xnews.asmx?WSDL +XigniteOptions = http://www.xignite.com/xoptions.asmx?WSDL +XigniteQuotes = http://www.xignite.com/xquotes.asmx?WSDL +XigniteRealTime = http://www.xignite.com/xrealtime.asmx?WSDL +XigniteRetirement = http://www.xignite.com/xretirement.asmx?WSDL +XigniteSecurity = http://www.xignite.com/xsecurity.asmx?WSDL +XigniteSimulation = http://www.xignite.com/xsimulation.asmx?WSDL +XigniteStatistics = http://www.xignite.com/xstatistics.asmx?WSDL +XigniteSurvey = http://www.xignite.com/xSurvey.asmx?WSDL +XigniteWorldNews = http://www.xignite.com/xworldnews.asmx?WSDL +YourHost = http://www.esynaps.com/webservices/YourHostInfo.asmx?WSDL +Zip2Geo = http://ws.cdyne.com/ziptogeo/zip2geo.asmx?wsdl +ZipCode = http://www.ripedev.com/webservices/ZipCode.asmx?WSDL +ZipCodeResolver = http://webservices.eraserver.net/zipcoderesolver/zipcoderesolver.asmx?WSDL +ZipCodes = http://www.codebump.com/services/zipcodelookup.asmx?wsdl +ZipcodeLookupService = http://www.winisp.net/cheeso/zips/ZipService.asmx?WSDL +certServices = http://soapclient.com/xml/certService.wsdl +check = http://ws.cdyne.com/SpellChecker/check.asmx?wsdl +com.systinet.demo.freedb.FreeDBService = http://soap.systinet.net/demos/FreeDB/wsdl +com.systinet.demo.ftp.FTPService = http://soap.systinet.net/demos/FTPService/wsdl +com.systinet.demo.newsfeed.version1.NewsfeedService = http://soap.systinet.net/demos/Newsfeed/wsdl +com.systinet.demo.rpmfind.RpmService = http://soap.systinet.net/demos/RpmFinder/wsdl +com.systinet.demo.search.w3c.W3CSearchService = http://soap.systinet.net/demos/W3CSearch/wsdl +com.systinet.demo.search.zvon.ZVONSearchService = http://soap.systinet.net/demos/ZVONSearch/wsdl +dic2 = http://www.dl-me.com/webservices/dic2.asmx?WSDL +eSynapsMonitor = http://www.esynaps.com/WebServices/eSynapsMonitor.wsdl +ev = http://ws.cdyne.com/emailverify/ev.asmx?wsdl +getQuakeDataService = http://webservices.tei.or.th/getQuakeData.cfc?wsdl +getSessionReport = http://sandbox.grandcentral.com/services/reports?WSDL +pwspNoCentrbankCurRates = http://server1.pointwsp.net/ws/finance/currency.asmx?WSDL +sekeywordService = http://www.aspiringgeek.com/cfc/keyword/sekeyword.cfc?wsdl +threatService = http://www.boyzoid.com/threat.cfc?wsdl +xmethods_gcd = http://samples.bowstreet.com/bowstreet5/webengine/xmethods/gcd/Action!getWSDL + + + +########################################################################## +# SECTION [reader_errors] - +# unable to load file +########################################################################## +[reader_errors] + +BusinessFinder(UDDI)-WebService = http://www.esynaps.com/WebServices/BusinessList.asmx?WSDL +ColdFusionTip-of-the-Day = http://www.forta.com/cf/tips/syndicate.cfc?wsdl +ComputerDictionarySearch = http://dotnet.cyberthink.net/computerdictionary/computerdictionary.asmx?wsdl +DynamicChartingofXMLData = http://webservices.isitedesign.com/ws/chartWS.cfc?wsdl +EmailServices = http://soap.einsteinware.com/email/emailservices.asmx?WSDL +ExpressionEvaluator = http://www.onepercentsoftware.com/axis/services/EvaluationService?wsdl +FonttoGraphic = http://ws.cdyne.com/FontToGraphic/ftg.asmx?wsdl +HolidayInformation = http://wsdl.wsdlfeeds.com/holidays.cfc?wsdl +Html2Xml = http://www.dev1.eraserver.net/REFLECTIONIT/Html2xml.asmx?WSDL +HuZip = http://www.c6.hu/ws/huzip.wsdl +HuarananetPresstechnologynews = http://www22.brinkster.com/horaciovallejo/netpress1.asmx?wsdl +InfosVille = http://www.dotnetisp.com/webservices/dotnetisp/ville.asmx?WSDL +ItalianFiscalCode = http://www.pinellus.com/cfc/Cod_fiscale.cfc?wsdl +LinearSystemsSolver = http://www.cs.fsu.edu/~engelen/lu.wsdl +LiveScoreService = http://www.freshscore.com/service/FreshScoreLiveScores.asmx?WSDL +LogFileParser = http://www.bitounis.com/W3CParser/LogFileParser.asmx?WSDL +MP3.comMusicCharts = http://webservices.mp3.com/MP3Charts.wsdl +MachNumberWebService = http://www.cgi101.com/~msmithso/wsdl/mach.wsdl +MagicSquares = http://www.cs.fsu.edu/~engelen/magic.wsdl +MysicSearchEngine = http://mysic.com/Webservices/MysicSearchEngine.asmx?WSDL +NASCARWinstonCupStatistics = http://soap.einsteinware.com/nascar/nascardataservice.asmx?WSDL +OpenDirectoryProject = http://wsdl.wsdlfeeds.com/odp.cfc?wsdl +SchemaWebWebService = http://www.schemaweb.info/webservices/soap/SchemaWebSoap.asmx?wsdl +SlashdotNewsFeed = http://webservices.isitedesign.com/ws/slashdotnews.cfc?wsdl +SpamKiller = http://soap.prowizorka.com/spam/wsdl/ISpamCheck +SpellCheck = http://www.worldwidedesktop.com/spellcheck/spellcheckservice.asmx?wsdl +SpellChecker = http://wsdl.wsdlfeeds.com/spell.cfc?wsdl +USAZipcodeInformation = http://www.webservicex.net/uszip.asmx?WSDL +WebEvents = http://www.bitounis.com/WebEvents/events.asmx?WSDL +WebRTF2HTML = http://www.infoaccelerator.net/cfc/rtf2html.cfc?WSDL +cp2ville = http://www.dotnetisp.com/webservices/dotnetisp/codepostal.asmx?WSDL +src2html = http://www.dotnetisp.com/webservices/dotnetisp/src2html.asmx?WSDL diff --git a/wstools/tests/schema.tar.gz b/wstools/tests/schema.tar.gz new file mode 100644 index 0000000000000000000000000000000000000000..d6fe7db53491d6a69b2f7bd0d971c104c2aee698 GIT binary patch literal 68874 zcmZs?b8sc!_XQeFaFdGdnM^#f?POxxwry)-+nkB*+}O5l+c)>+^L@Yf-|MRGwQHZV z&#A8N)3x^5t4X5Z;d4Hu1t6fEjV(-V4e4DBoggki>xl%C^;CauM@*QFb2bxYn7brP zbry%^rhgHjj|@~rC{M21uy=&7O^zGYnJ+Erty^e@R?=LEL$du2nA9>q<$1thK81Vu zIWIr*fHwSv!7_g$ItK^&elRnmf5T)kU-=m@0*~_F0W8H?9+lnjUO1Y+MtM(~jriES zmLC$?z5eiA$df6wV8#nix-Igf`wcx~(Dc_i}RjI6jt;D08_iYdCP~&bI$O&#E!RG5S1w zT|M`jm8cOL2X*-Uq)Uq3Uh@2by_>W~$DX}qUeDe&Wk|jTyW-yV&84Y3Q4;m+Pe8j& zS(d5QrsU_3HJlvPRn2Ccxw3;Y7p(1iWXs?!rmfyI7qxEi`!!Giv7SH~& zz8VMYe5;pCO-@(p^yVfKHd*s*pvFlq&+?YpX_bTFO(e-R({HFA8K!)2-(;RRn`D<= z$~(pxjk~1~FS8U44a@igD}uRmM8iIzSHSGvXGkV>{We4GeVL5|bwmy@3L$ZBbW*fPOUi<6f> zUeOhztq!zXayo(J=huVB z9^DbsIFhrsOj!@l!w;ccnwz<*90C+AQH#3F)=T42QIj9e#=ni$_2j%!+w1MQKAd@~ zeT_cWxx2e$&3dzb%8tS!-np_n6sATh4&3{^a_LQ&n`e0>ePG(-WDyQQ&4;+l=#Sgt z7Ca&SLa)tQIGv80LUVbblGfR5yPF>rhw0jve-{v*+SiIWnd%DMaucof5 zB`4RcN=@bdZ@%4~o2djMd?Cyf7%(SXH2;d#)?=DGe3tjkOICE7t?Rm!%XLF%Z|Ii1 zi4A;@wMCXWM4Hy73h#aXn7sP^gx6LkGUN|g;aaN3FHFW8A8gXF6ZFm3bruSOz}9=| znmUUL?-YvW^x>}6B)<&B(;ydxrBX+D-RzWFxwS#{MfOjrovIM2KGB9D5Wxhv;S$UcB|rry1^LM>BXYo-O;*I z9chDBXuHR7#J(=;!>>QV;l54M;LmXLU7h7e_YAg5yH2r1|DjLaP8RiA=Uy+6|1#1^ ztw4i^`*QS3WIFC@{r<1_iSZM7yk%5b;ut7F0S5Yw_^1lcH8L@OM(8cYV}hyuQ`F!hDfaO zj3=rWJ^#1Wn42<}2!5Wqe4lhzh0qBOHZ%5+`P14RlteFnffphF081J_M>>1QOk`Hpkg%#+9;Tg4K2wVJJ?p*Syrrq7VsiB<)u>ZJ{D^eHLxd=`s}e6|E@;z2Rk}ivzn(5ne_$3Z zKuxWyhzS2}haO}Gs)Q?4wQWTSae)M&*W$Im7IErQ=Yx-y2N^7dYhI)>iEGdI^W#9*#7?6=6DSD9*{4fMi) z*?Fcm5+nB#XT}c#!`n3=jCZbZ=|f7=?fDea&We^3R=SeXt&oOzj_HQzMZbA`^B|=i zd2Jx8toc*BltDQ%Y~m|ohxrgrk|-VI$nX&A_GvH@owYXnDtmW+x5urgXE}urLVTtG zOx6caW2le5c`-(9RR5ZNn){b^Ge~}#UjoQ|1R11$Dm=RzwsV^_xaEB4SHl`~f!rDY zggJfISTJ8)0C_xZE`e^R!0e>ng(lFFEfw$(gg zH~g;w3tT&&KkmDD*gdyh)SbAYu2EX?VM<>jzrUegDx-e%oyb|=l0|nl`Yir^jAlLs zF|q1S@XNt9u|ffttXfK&hNpeh&1}-{l-{I!MLRB|uExU9D$-zlnD4BwS=vG4qm+>{ zp?*c%;i4W^(6ONovC!z=QK`N*Q*E;@X{nfM`C{Xx#_A>O|0|VaS$GcnYRrsWb&NUY zZ86|_rDiNb5!f5imudz)ak&sR=&j%}tkSMqg_M4q|D$*KQ=AP--cxV^#O^jprq;*o79yqz zjHFOb7@DmOFjj&_CS^f`8;PW-NEo85gE$z7?8%Q7AHwAbv5rH)z|!ig^xggLj=_5o0K8;~7y%J?JAF(ns!9x3p6h z*4=tFEd8nd41uxhj#7(i_P}#~6*X?8EZgAPDZd2_U0k+xc*CS~48Q`!G(z<7eF`an zuvVEPTSfY5S0TxC%^>k_Dbs_*M-fHjU)l(rMa46yI0Cx>?lCIpDp`Cx2#$g=hy}?a zfWw|Y^ucZHNR{E8O(u!hjjiF{vWLSQLzsvi0;QfT9AyD8>2*MsI<*Q7R^No|J(n{J zhLEg~NefR_fb^PlVE$mN41L-pIyO#We&F2Jjyc1si1?5;nP0d*qz-`qDuB0cPL)%C zcSG2L=?@?f%e00RW>J(0fT|J#h?`AP-`_Bq0q}8cIXKX>)iJNjexzS|neIZh86=BH zQU$l=Jh#n*$(R430z@Oo$pfrV465M2yA}Oejh7bGNNGPg6D7P;ru=-D=61&KR{$IG zp3&ZJ7fAx6z*~dH1mI0E7Pr}GT~=e9$rG9X7gxks-g^ICW_MVK+oxX^;(g)gX(1j8 zStc6#H9jqG2=3^6cQ2dw%R4wx+4_+;cJ_bi1$+m1UZN8mzF$tl4-h9d6wIsn_>8L- z02c^d%D>@02!M7Cew_OE&3eq7`n%n>F8DX7Le!NzCj8T&U>1}&&iafays_$L2~H`o?Hjt#k}#r~4zKZPUI$laZeK7hf{DgH1ORYJk}Y8O+m$PDX1l(DHxYujZUt=E zmfx>>cpZRFEQUS%`Rl8j$aUWr)0}900o`u5+y=R1q0%chPlSpVZ{9Q4bM65A+ivp0 zZ={?`jYvOQ+jI1jp*W`@xe}DYYGySs$?b2;QbL+tU8_RAHn58AtPd{*a^8s!b^_n7 zlpM9H%|4~<$joG&Ai$Axrn&7IUeFWECXZeaNFn1m2y$26;LYdYJ22QO$?uQ(?Ine# zGer+Aj^s=am=fejbqntGz;*rb$BFX>ZG$(n8gTG@O@6hcYAW#I{fY@5iNY=<yU+uv*-PY%7}`@Ukw~zFkC9RMl{c!wfv;W`F9)hIj zH}}Fq{8estl|GAA!)IlmI?bxTIly$0X53Pc6WYURcRIEyAvV(-8uu7UiQg~efymXc;X|GyPgFW zz>Ln9b1%o#-TmC93beL^mDQw2diC)?1P3`$p3vjTff7pMR70jPaN2HtwX6!7i1f;7 z>9{n;-F$1WvI$QJXSxr0Rm;9y#*VnI*^5=@KjGt8Ck$QBdB4SGoS7?JS+-cJWUKR} z)o1L7s7w{*sY(>Ovi60RCQMNMsB5tTi#g636x9= zwy?9B8Y~}Yvamaw8Y>qiU zmv~G@X3-*MrvngKC87WR*vY7?3|P*tHU#Ft6c#MQh#Q_z23nl36}jWGNt2$Xdm#s# z86@TYbg4GkA=~ygNxSY++(pV)2{-M2cB3`)s94_R*!Di4-tI7tM8f=)_qs(SZJD1D z@FVVZi>&4~pKSX-{M%m`_8%hT7Y+S~)c=R|y*)JB?>m0?UE!&(TOz=(bKU2QWz zoP5pq&^{?5|23d;l92-2#51wi=0$;OxBGLUsh1<***%|n3X3n<_S0!xdJDoK5rR4C zy>&YS9f*t+sSoFe0YsLK)DPFYmKBNnLb{)RL|Wv2L|2k~%R-w2HPFDXPEB8(I_n>W zX#X#u@+?Djn0Y;QSmd!Qz`{i{Kb4LexvtD%$9k4WQdgbnw-WhnaJRsI7MX<&bO zzVpft;N3+-wI!*{?e^~PTQJ}~2fQqo>-_{iD-p}M$@DV_;dMUarQ{HXt$a*>B`6`l zCFb(Cfae6sT69N54Sx3N7P#w=YMp~ za>?zl+Q_EUbMzCsy$$YprP!5Hf|B^Nr0V=E<4VK|XLtqZx_#)GTi+=juOM?XKY?fQqa{hNI04dRfpW5s?=Expdg!5iCIgs z*x)1xSYxJzCnQzH{I-^o;0jCFUb-S3a0Ov)we(YmO`Y6lKJ>e{m(>mU^^Su>wl)DA zcklr$s*M6~PVOgxF`!jD$QQefJ6I}p>uhX5hcDNqb#&w6nuaDC8b|DHGCri&Et=sHRa@H4W)q>Lgt^yb1> z5h0oOWVw`KyQRjJ9?@`^)o*VrT9h@bh_cmtGbLhB1~j^T+MGSO0|?N+7KaMxx4_(< zcXsa#=c9d8wp~V=9OQ?U+i}Rqug7~MIaG9p6~{#PEYIDS>+X|f=FVBfv6r8wD7d!S zbK8h(FVU`FrjA8P9zg5K{l;QkXQEQ)!I{*mvjBNqZz)=iM>N(}#6m=M~->48}|`P(9!lo6d+*@6w7_yI1a1Octl2*Qey zWB?){ULb3$V1+l|n=xd%)Sqez`Gf>%w1WY*bYRkR*TAWU2$2UB+bw{SF-rE{rNkJo z8YNq0(GA|5;=Nq)g z2_(PxV~QUf+kvllEd9ai4+~RQ>ZeWEh~;`<8axPxPjil1&CW;=A^58=G1B2ZaQhW} zedKrtuB3)gfk|-;u+OZ8I65l-13@^ulmzh)=k&A1@nAy#wU}UHESLq$<$arQGrXaw z9SrW4U2@NL^LxUb1~VpJ`R_}vy!u}sSb{&yzh<4yOR%Z}P3gVT$a}riC4h4h`5od6 z!6?I^z+d3--PUz*herTNzQub|1?3Nw@6QW++ab9A4s1!1F`T=Xqdc|qEE0^;=@Q-_ zdJ_!CqZjFeReAp`zi*|9fJaV1s!P%t{ZXC81A0*j3oS}0KBP?>9r08J!|pz77*L0o z0acKPiHNMz!4tt*uXme+gKn}jGPq#bkCGQmHOFlwj;vSN`Zc>hxe=Jj3PfGX`eMwD zg$@2=LAyj=KRP_fU~2Pb8S1-rA!uhm#y^ASzo z`)W&@Mu#h_+-;c{8dtnMt{J8=yOKZUfA-fwM#aVuQhrUu8AhgLv^Ac&W_CQWgqJ;R z$<_k+ID9H)jP@%fHVAR;dUJSsyV$R2A$hg@cggSPar<<^wtUez9Fx|o8yFd&YYV0z z1$w;RKI-eA_WFXJmtr)1~2T4juW#Df*RSAe;u%Q)H$Oo$-m2eWJHwQ zzW(q`+HhD#jpE=~KL459^{JSc`@nE$xuaj5nsqRK#NbFXp8vM&+%Z-|;`jGa>-0ta zy6W-6s{6py-m9c3Q@<;1#8tD!3YNKVKsFehmPXby01huO0s}fefE}JbcmBOu|C(Vn z?wj?AY8z|D#%csM9DCKk6L#G+?{o}NG&L!0@um8D^3FBgnghSKl^`rG8CKs)nyEVtc;m8GP#u z&GFH^soL-qM9tRVh~oLD2)&3I%^@ruLJTP673 z*C*|}P@c3RB0Kmp-fcT{Krr%7DTisJ_o%D6&g13>YoFef^{$%M)|?b8EvhFT!`v9s zKfy8K=t}Pu`N=aw-gIyp!zPMv^kW`u{ii!GJ~HnQ{jUPZ zDKBxg0vCHgx4YJ3e_x@~kleneMBvb%c4|q_z!SFkUcEJb#jXP3)5v@k%Xx@xt`}$q z)}QD7HjNh&O~_+Wx0&NnoE3i3ZE*hI-{sLbM7+b2_>Aaq74$6QP8r2cb)vZbapidh ze4p8FO-h+^M{0NVy{>9j0*CA5Wkb>8!%VGJF7mF2M>iI2PLOLGX(SE&3Gqx4&12bUn3?&jObR|>^v;1IOn^m1l-;A7$TtECpB;?& zneX3&&xOVM>8|fBhR9z0E*Hz~V9L6Df{AjD)D%ohG=;MZFF3s4+4a);hpq3P!?M+f zzulU1G$&T#LEUxd?H8G_I1rbL2KsUOjV61pB9Ed~gDlQI&QQW-l!!UV5L!$-Cfx!2 zw7EOk?GonSQ@oA`GCu(No{N7>cl;?RRW&7og9?l1F+6Qj$Nv7aV?a*~Xf=8^u}rR2 z7qy{!yby}Ve1a1WMX$tW%)Y^$;u;~H;Y@|;g^5o?#*NTZLCSd=SS;ga&@!$|-u07_ za<&k{`}PKbBYs7F8iyfO3j91&z2zpO^2G^asVlH7sb^xRd%S~DJg-8FP}DU`!anr4R zeadgs?aJF(n->@CPV*4KOYym#1_E1t0;fJZlFI&mE(aFz;CPtWk7E(D?R(H4X4xVc zL+TR*B>(C9s8Xh$9GUjcY*ImFuD_mC#m&Mo?6m)LNt}l=1SUxJ!6X&|4aeX5B!E%E zbw9p%;`I%Ov1xXsf63*Xhg}^+-u_P?xA|Sh{!~+-<99V5*7}mAnbVOE@ z?;0l9_4rnv9o59PcI=EPc-mm9mzNh7rn2fqR?V*4^lW*1q-1#LeMjF84h}g6M=dU5 zRn4DzN58%1N$fJ7eWe+DflC75b!}v-VDPpDVW`vRvEj-q`0}8R4-8aTUD@3kv;13~ zrs*jNBWAQQ@9%N<^QC(igV*ye`#R45&RgY%hDTkAR*&KF7=!8l%izj7=n#L2sA195jAlD;x#E&8V4ujQ zph9dyJ=HKCRk&Kv!dO6)A(EJnSgjNrp2qP-H(x}L7>k2PGso3Q8QkjOr#S z3)9rd`p-z7Pb&qDX+h+e{qmAiV+sdxYr%L6R#1N-nBf`2;S>$~ENObQ(9WI_A%EOH z+&$u>k_iRFXLeJ2$cxv|#$FBb1kl9s6zA#X(ks!$miFW^E|oBN_D><|Ais8Wq&zV< zhenJB)o_XywBl{I@oSD?QLBL98zpc5T*dV!=9155R;-PY`9Id96f_0Yi$;r%vP{pT z`a9!6C)^1Lgs!C)*4d<8*T~kp=PxcsaOyF6q%c4Zcg!@|-owkR;Xk2NssO)1BuFVP z3KAY&4fxR%L+-SI^9)0`io)sCEIoE4P<=-W7nY~bHYr0j*VUn}!EAWea(MPk&PU?- zt505Cz`TcOo`QL*1dMMqWD0H@sV0g>ZXt zyMz*iCIVvs3n6Wee074U(5=$JzG2u?n)Zw1CR66U;9&6 zb^vVp*zS7bt7|a6V*p-vEuYw|<@osvfbLudt?DCAnJmFL)^>S(;`JBW-2ID_>`B|O zpR?CV`pC&qQ4b2{$E45DNO}z}tVf7|Wmjp1Ybr?jqaNQHM8Ukw_S5lz1Mzet&5()s_-6&#FoO`qtiS$en)9jv>1Yh*FR zcd0EinEc?X+AjFdYn=WMZ>li5ce{=%zV|n7Z$5m8v{%z<(mGyqEtTCjMI42Af_8XV z9V$o#-&Vl@f}&`_d~p^WPNYnGGDfe8ApMDm5N&9dm=Wxz(u}{~>Ofpdl_sf8-_=&{ zXDoH1h!Eqp?(Ep^nLtr=HaIN5-H2Kn)XQX}&lW%m{}zRNuU~#@(lV}bJ#1JEzSxNX z+}2lMrGe_$)^#Rf>XSPrTa2>F-)mK9f9A1`)#=~>3Q!fJEDZj*)ZkBKx^QTMZBilR z3>j&#Liiv8twX$tshu#7!2ycL1mSDQ;^vx@tBcPr#a zAG}#Gqh^F{&z&E?1=(iqeDdD0M_`-~Cm${Tdo@M!2@sudx|_EnXV{2Fw&fc8El{v=%4~Kq3s3QM#(@1v>iJ{KjE^ z(p7+PH&xqky^KSLg()GH2W@^g&L`(NBqG{jBLi7pwI-r=EEnOZIe`3!Y7>zc-2to5 zQQN=E8Ee@xMWCkYdctz1Tv4s%e+Er`QTcy{x}qm*En2Pk)Wn+f_qIT#1wdQNOO+@m zXI&*Z$4xsBZd$9o%VYDXzq^cO@Z60gY|@TFq$bPPLY3KTMQ+q0N)SnvjkB+^@GDmr zr?x0Ju&Tl&T+grq!~}5H$1DV5=;Ne~y!|n6WzJ@8Z`Ig7uB1myMTDd-M z^1GQ9tlAboU_T+yCArxS#P4zIu}F~Y4_>0}6h7t5{7h#PvI4QA>8T>czzsS?n6N+n zt0Ph-hsJ=7Oiw{U8aL5kL1yL<6Kxj9^&unhG`^@Tc+|G=3Bh>_i!@&loq#>75vcfb z9H<5nKd)1<^1CIKDJItci{!QYOHnW8g?ZB*!SflBy)iRZzg9;lK(h8mhL@G14#yA_ z4A)jrU0$Q>*3l_2_V1aExVx{OAPcME&UCWbjgP&BHuR@J8ZL@BY#wb*?so=yj!}F8 z;V=k9^BPjh-x!wy4nfhiyLHe56^<^fcKZ-`Tr{tabtbHJb4=W{*EYVUXWQb#L!^Wg znnOogXT=c;e;t%qlt!9eAxo3KX?+h$I;t#f4uc9i$Uv#dSsOA7{OuhI+`d;%m2lR2 z1K0I*Yi3G3B)s>3IOUe?@M_yG<4E>&*DPHg|NG+s$#uf(F`!FG2rl%O(;V^si-O}T z+>7)}XD;mW&ZkLtDlsFzGqBWYWKvUS?<{Ms{0YSL{#>|c%)Z)=SlR}6vvvq40U_?J zw*XsYm+MITahO#qc42v+Wv&2d2|P2T3~uepB_YardiuxywtTa4=nu3?hS19c`{ITg z>Q90B@kDh$pLKct?tsu88`KEQGxD1@2Ys{UZYEi!gqJ%}szGKSAT7y_Sv^AM*&@)Z zWO7Z8%O>lCg}Lh(#11Ok@8LLCDXk_K`%Zk~CLEs!?=Al&?RwYq>{?EdbhmfE!6Ek&QR8ODmH*JYnp?_ap~r8} z?R3T`-eb_#uXyA3y`l4laLwy=9Sk_p3o{~Qs%sGFDg!q1n$I>BH0tA@$8*??yY&6A z8<_X#DDQV&%lTEi)f02wA2{DRgH-A^J#ww>;<14EJs**@^1vDXUaL|f_Fc6X_`R5C3wf1HK7Y`WksqM2p_l&)tG$w4HK zl`_ebdcp=lcUidMin}44Cqn5M2Qw6(c z8CkY~TF|gn)lv=hcND^7rCxHQ%5LP=1xGvd_@gTPm|NO=`MHTnP1Ut1oG6EUg>@5v zzJ$>AnZ(!rA#i+8J~^1cZ<`DnP6kr~`VD^`gYl5WbwBg|TP9%6lF$>Z2UnXM{?Kv1 zBzL0>ta87roMS5`bT$U;ajCu=MKS{M>sL#DXRIXiYrRhJ_xC!7t78hDP-_(BfHJYP z)1%nC$NvOL!(0lxi9t3~-6H;FJFEJJ4RsYy5BpJ3NV?dqFW8qEg1rYIBe#lGU0q%{ z?K51dSZSz@Ah(rq?}-E78a^CdEBnsZh&S!JIX3IhPRYsL(x~F=&)v%8;LI!Zt$ zQp#!o8`GjwgQkD+UZy2$HG9@1l^_6COep9Ab3Ha%>Ym0>c#`riA*Nb<_T0Vbx45oK(kJPJ|Ue?M4Phs%h;3Wl`nZ z8=Q2_7S6EJSrNObrc*f4^qO_9YrMG)L5oQ1I-FovxYxGBFVLw(%Dv!q?&Ze%m4tS& z)+%2uMBOm7u47A|xolndlTW@zr@1fOk?2yDFRA1hH+X=qgHZlEXk+;jIejAR7@-ss)SX}@K&Uh6}dlvpxb)(OHe*jBGt(9M0 z>2r-c-f`R?B2%Uh9F zE^gCXl1|J3qSt7@T%{l{8WNu-`8Vzo{sxW_>aKD~K#W0q<@{DjqGi`ugX+0fiIH`R z%E!?O0rnSX#ggiM$~7vSuuJ7&*xqp>VS@aQBfmAAWz9(L%cK)WA`dq($Q{Y?4OL93 z!K~{g2k_w6{9TXEyrsfZ)u89;(#F@nfboM>|G<^S%1wxL#l~Krevg%{%RWvlkkqO& zG`TI(^+wt4pGqC#oek!uQd7vVP)73ArdMj^;y1(rEO>}ySU@Z%suWf6Z{sntQV6D9 zlcivX>NyOL;%9{IkvXVGN5gwd*Eyo{v?NL<({sS7mdgq*M+wx~(|`mjuZ1Dddd zn}tlW!{{4LYSwT_E3p-Yh^e=yK637|sZ_|?D#f9`ilnMGfQ0IiG*;;#mq)5>`%v9q zz2b)Z3<@9hDRVz8Cs*=wnhffOGu8Pyg`!td?nb=hOmlgp0S?R4!`NWqMk348sYQ{j zIyTG0ZJbo7KLF5-hGbi*sp@hQRXd9>OX-8*~VqLBeTt^Q{$#P`x=L?DzUbnttaFQ=xmk z4(T(E;{SQf?SGA(|Mrxp$Vu$-^!3S|dDAbs*Io1Pb6}3Y6fpGP82yr^RvrrUKpq@7 zEFY4iVZ@xE`84HDN4&Ij8HOu*V#uBr@SY@q=X3ErgGcO0pNhPm5Io-+B|hbajKECq zVVr{hxc{gi7C2*4^NRi{{pSwvzPaQbro-kA@Z^*@5fb16%NuJ!vDo&$?k6OHC0I|~ zkHPfBmLR<2JHD`}4-SNm$L&GrDgmChy}`aT=vu{3g7G_jPSPKSl;F!9%N?+EaV$<$ zpNWkVB(^AF;9BO0Z^-ZaWkU%AAC+k*{WjBIIe~N#(1X0lyYUfaJH|BKFrF}o0PeD# znhT*F(CPL_~+&g-vx7Atu(z9CRgk!6`RQnFQ8HGShugzS3aFh8r!)K z?{#x8)S>b~%p{Vop899u zLCHP=Eq*Qg6Cm}`gQw+k`R2gvOfXQHQ@*wEd*YbjQXvaEQiAWX|Nh3fY4RAD^Yb=J zoP!nd7^}4&z(g^^T%WXnqW=m$w;uOk)F?QfTu3DbJhCl^@WAnRb>WSKlzuwfo0bL= z|IwOXCUXYUO63W4+SQe;D|xyX=noV*KE8QI<+M@G&uuSj39|rhW0FM+z()S)tAmS+ zl&6wZFXv?bgQz_^EbFeZX30(Gg?j=xbYo;|GmP9zjzP_(nBkW~bVar7l%12ec4BZ0 zf$mvUs3>;n2D7{LqL}>Ee&cXlYT)wt`+|^mXfCwEGoaSC{m+MdcIm98@lwKiWgGip z3CkfsH-o4vn~6~$f=~~KoWWx;h1Jz`uk6*2ys|y*I<`oeDPelpW>9~=!bdMZcM_Z| z{aqz&51mPa%1R&AJq}sn;9W@EWBBU6TEu}`H(EqYmI6aFX2yaUjX9%eo|ft+8Cf!R zVUC>a_sJ`ZG)u4V8_TY-*e}-iJ%(GS=HDZ@72mje8?NtgV=sb93u~Is_r!MJzf=)B z>l1Bzsg~s{HLoMTSQ_6ZzY1r#$>28;CpOB3?DZ+?I}^T)5jOb}BoWLM)XgKET@^W^ zfhHWB>NML#DdpgPbUedIt3Gti9${w})oj5-lsiSSyl8FA{gG&Rk6p8FA9u$(U5r0o zu%E>K)PCFa)9UNwvagU$v{m*0)2aj1q>dF|kW!MybAw#WUHn|kp8*0*@WZQA5rOt-@Yq2X8WRE1EzfnJ+}l?*gS@j!LN-EUbGb+XA8U1otVV_V&)VuP83zEF zkrB?X`DG*~{r|MP$b4VgU9yEQ?QR6WU?72PodH`0S^<+SxeZy3C`WGnOmiESLndh} zdS{*b4TUlrg3xY!$qusrwDT;n) zryN_!&|DvU|1L55vdS8#A3PoJh@nz$K2ofY6i!HtQ4_TM^Ow!JRCaD7z6Ym1LdJSs z>h^ckmmdUk>70n#cDF&ee?#U`ZfN08SredD=I|s|Zs4h7y2i@)dsPS+$r|*19b^%T z_8sGr7FMMEh+4>iLk)OR{GijQRisi(pp(^aIAM#v3X8Qwld}{XzQ_{28VykjUAj?^ zth7coObq#2Ym%+npvjD6pUP`Se7aT0HAFeOVwF^G9x(y)WZrOGU75dd9lT;@Z|nBQ&$VJGs|fY&Dxz|A zDb>u=?rjV74tRwnMVxy6$QnZ7v+qjNKmsK0YT-ALx|}k1TXRJ0PEy*#F$9J;X3hsa zJeXDY&kti@VRq7HJi4$^@>XrC3+{d8k^$ z&;#%auOPr|+r2s*z9D~>V2$LVG zyDSaBTv`m4^tg*}c&18Kr+Upb%4s^)WGjZ!gXG0NLVF92-@p_oZ~CEBc>20{cMfX2Q*<_2v*IM`S#aQdUe zr3Hmw(D*71TF5duQ|Yvh$5ccrr^3G+5+jm@0`-tn9zf^f7hniYOJ; zVYN8A%|8=#vt%wHZChgQA)_uzZr%`GGhNy$q^!TjI{ke|a%ll<<3(Tgxx>mrsi;8V z%lzthht>PG&@0K)QW&UyM$CI(Y;{9ZgZvIi0qB)18d_j=@Ba$p3cdCigR@j}zf$e~ zJ^rSzKbP^2JM;mR`h0fSSoGhRG`0p?YMB46sKj(hNkML`M_*&weYhVC!WMY_d|6S5 z4tfs-{*hQjUxI_e~!48H{dhIlYIFDaS>>cr+yh13~2am;m>ye zSBKpRF7P8iI5n+DuxUFrr<0DT!$;IAt&0yA_(%_LoEOAMZxN!WwCHCoS8o(Yv`P%I zdKC3&B$R6B_I!qjX07Z(+Uc0~qlj#uUQGN8r4tk>;p?UCAF=BH(RZoh^laHiLIZhH zO4U$)YCpKn6kDww3v7VM^`@}>VtESsgT=F`J{ZTQN=wiZlGW5Yb}r8bZH83pZ}&u; zGAjR~@%Y|m5W*}_#Kf9E=90ra4%u?Atv>B>3jkP)sH)DM{hA}2qH*nYj{kh7ank8% zPoDM#47p`<7W_N+;M3m#wMWN96I{{5q^_u$P@=j%^> z-L;zV)Tb!s=wvZD7a#-Pn1(t!rl!7$#P20ns*eIT5j^q)0-Ea;A(CFJ^;(!m~xql3{%goVD_b zxb2ka*6Brz7kTORn28jA_n1$487x>&T|>R$Uy|ORP{qbThcLf6`1sh5J}frrpMu;s zh|@h3DG-)RW6g;=b_rE%cryBTfZa{D+bnJiW=uG-r{w|bzWmYhoG+IaoCot$Lkoo; zZM=MGxj;2c`jCA~$fWgIN~9{&xg^hEB_fd9#9b`de7+K)v!+lyLuDZb3-JExF_QY{ zgF-qo%upJ^Z4;xi$3fh$S#^OboEBo)faZN$67}zuC)O`Lj1F;;%o$mym81Yj!Z#X= zPN#DVi?ul6H5we@TW-n0;A`$JjW5KddNG{J2q>k<3Cc9e4+vkxW!u=P z!>odCZi;gI?WYF(m)EO+iy;!a+%aIls>-*TqO9QRYOj|C7h=ZSbnBe9)8HKQoT#E6 z>cKq7cYwu7mw%t*rT$o{p0A{Ptu0*_)xL8cfUf(fE!`N^e$lVRJJJMfYV5#=^M75L z3x#5ppGEA$kv&|25aaj}j_mRGy-3)|RMlcsjk29yaB+ZipGiS_0)z`F%YVczCt3Qy zt;!J)z+aZlm*2Xft&OuTo1v_E=~8M+6wPxvSI1zflPZ$WY^qO^2{kB;EI>!H+(~nw zDAi&t4pryQ@Ti2v;L4<8slme(uJB?^=qQ-87D~6!Y4{;?pdkWx%;##|CwkT7Vz4wX zrHVUO#o|~HueBKZeNyW?9kyg3K3zX`n~eds^t6sS>TECL9q!8^XRweocZqn53B*(Z zWlrLDl#8g{oJV}9P1lU5vC55SmzKnVoo&QOd;sf^y-K`Smy*PR9NnPH?|5o760Dzo zkCo80;K&hB=7q}bf%%-j-0+Bdi?D%%@9V{6K{sONq+~AoJ%-HrAmY zOD*vVEL$UaV7mE#*m?_~IGX5R6qkj95ZoalxVr_H;I2V~ySpp|3lQ9bLvVL@2=4Cg z?hZR|zyH1Wy}DJeYHDhxYkGFJcDDQUIX?j?pR@k~uL+LOfL&kk;(Ak1g`XVtVqW-U z?vnOLg;tYe&4=|=#5u@^{?C5PnEH#d+cBU5k?9zack8H!&e^V@VuD8#mvgTr^}F4M zPUb&W-MGJA)_=U$SE*#%QYSw-po|Lm9HF53ePZ-ILSaADSh&#Q zF`m~X1dE9?d_PRiyEx;m9~1*Fm9M}1LSgruL=v?S@CUbNC`!e18^~DTWlefpkSYBk zto^gS^{X$)tgA$`|D!@ZonX3b%o_SGUeS}wH5Y{dC1TwVv62?&=Kk`6yI=!b-5m*j zG%btm6GlC5JmwAR0-5-sU&t~HLrgl!^GYLd+Ll(XI*2;Nj3qhqF#98^$h|k8SAJtJ z-))+H!eWp6yc|+ZQe7{qZV-|iaI<1X1;$esR+5oAKc1&cf) zn+k-2*Q579G7nEx3nOu(&WWOPR#OYWU7|vwr!HetsOB)P5;^rBff4fs z@g!sV{KikYKmntZUrSjTgn#*{a}#bp7WZmwUtOv!%lqyYUHMrN3#UYCtZ|3dws3aG z?iZYc^3qR`fNVKR;`oThN*eMnrHU}(BG<62%_*y8=|ds~pkK}&(HEuzGw%WHqB zT_WXO5_k%X?MKM!(pM=B4y}dp9=Zm|C_-O1sYvJ^x*R#rE}&_zi)A3MaZ_4fT#Hz; zPcZS_xvqgPRpP4_DCpez)gRTvab7l2o8C9Ro$s85K+;>!G&LCfw2t}fcCol|Z;8luR6B@EaLaMX ziog=Chf3d7x3B@1a{QqcQ8Sg{eas7CgLG6y%HN{AVZ8Qi=7dZ-LGJYPZ8a*UNDyz#St?8%1xCQYRuE5Ehb{#5c@7%e80l*`CuP z;5Q_*XC_5?pA^7eF~5L#K&p*dzZc2XluJ;rGDca~sHqK0-%_OHvj=dheR{>Lj4w-4 zRV9_)M{Gy}d*M3*Z!a*v2i;hm*58jwYLeCval5@gL1|0vs%ldPq;#cagRTBlet+!1 zzjS3(ldHu@xLg0&%5rJ2m3uHK{N`2LWsN73`VmN!`Ma9ETT-!KI?5+QOuqG$Bp{ur ziO;h*G~^H&TW$SWYS=SS?k&9Lr2WyGtHSi(gF(xHoRBTRWs|0^eQS_AP{=GV;D$a- zvK&IZF0*?)>4oh{9(77GHFS`gXkvu8e+t^k6T7-f)d<{@Y5-vNEjB9!t2aM_^O7S1 z1(Ff|$+G+woQLx$KmPrb>q?tospgDBxAF()ofh6w%^U~P@{o&)(csTX0?%FZFM*_J zf+kb)X?O?^-)FpBXX;6+H$fA57TgxaK1t>*4FO^BZK~ZDU$(kA%y{b=5d`mAyTbC^ zF_Ll@?Sx2tJ}P(EKW^ve2AsInVOD^mnzbyr*YCMcpWwQVF^>BqxtzG<(h=uW_(JP6 zRt!YAaQ_fzADxbJ(SwR7{NBct^(SiD$;E6FI=fb!qj6z4u&I%n&Tf(yij3;Iej2d|(YR`(g#U+Q}^?mi0|;)p3z zr_8X@d!%|(3jD3N=owIYe;(^AJTpys*i9j)+W;^$CpmJ!0F^`>X zrNbN6&VTWkojO5^CR6R+EN%Q6Yuk8ghK;hQfw{4TBb_sdpmkjh*I49JP+P89HB#3v zKGV3E}MkjXtDmUGM^u-910Nj+|J;^O$Dj%OaE^eu_f~ z1A-@bBmCOJA;9+3#Cy8|8dtv6&`~#c|n(?)n+2d$Q5E2uk*( z_#`Xlu%ZFtlj<|G@#3W6aZVzOj5PFv|E&OZ-WOosFgN-f$P zpDB}(Lhw)n>Jj-}Kx>tYxRct=_|6_IKbgmr;KdbH-iTH)qLc9HbKp#U`fRuZW8UYl z%H?RU-%jaa>;yX;di>6NW_-qZoN!3Ni1h*9jj(bdK0WLBh&g1E=XH^`IaL8-WS}Oa zO0mx4pYAUrR$CuNY*tsm`gX#1Y)jzK_iK?x;0{?IvY9F9lL+*!U#Q(FFCKjUoztZVGeBld4?)+7|JA)tx=44a(p7GuNb(;;$GTfw3aU#hIsl+}^P= zNH6H!7A2_tENfg_ysShgd6oIr;p%Ptb8#amj<#B0Xwvm4Xe+Vpp9RUo~R3 zdwEBGL|8Ab?{bx_?v+K`O1hgcLb}G|lMnhepfKjYZ&D3}^!d{c0%1Y^7Qkx%u03F5 z`{=^`IL~?OReRyZaZ=JKxE89lbaByReyApQsl&Hyei=L zntQzZ)mrY2UgjZChqO`l-)z$2rh*4cjD1X+*CgoKPeLowy3xJC=CxaqEP}ZLk=Rb4 zaM@4$E{yStEQ_*H;nsLmv(Jy>Kz!dQlbhK4WDjtzfVGJL2x83MFKJ0aGa(-MlVk_L zN|Ml$&9RoQ=RBqGYx)P6nLigATw{r@_`%k&a zF}}_x-s#8G=_tr-y7AZ{s2_sX%L`3Sp-)w$o|Ic?n&7Q5j)pAdhK9_&d?b?DBzoQ( zXz+ODxg?v*(?lAj=|!xg;pMW?JU)^b4KkBWCs}~$k(W1EQlzXIVdKDBL^BH&7UsYUqR2=&4JCe$~@oL2~mBA@j|Po&8(&rM{;I4zn$VrsP$0 z%a4xAVQFdc#z7pdQVKFMex%9`?aF$)whj7*iE@8ueK{1o$`HR)oCzjjs*98kCuQAmj=FE+0p?WPf{PHOA;xy5zwX)ShYrU@Q!pm^}>o8WfLx0|^ zUgGd;lH`|%6Fd24aUp+hgzueapqtOn>1UORsnG7!(?TSzRy)d)qP*7@Mr+e!O?3 zDG@IU=Y4T?U@R1+r8yxIF1DYgR}$PW)kCQ|JTsk`VjT~DTZ?3ZztC461GNOMjJA|s zg&YMI>Q^3n{zJ)6Jm^=gJfg5SSk+&uVDpK5$+Xl~dnNPYij>aduD^`?FVU=SYQ`GF zAJjq~{tmlBO!SH%k&q??8)qoJfWnS#?FaX%YDed;99MIDG1tv#|M{!s;O**yjh*db z{lTKR(U0TWgZlxenF*#v27TdMm;QV2XO!3R_Ia@?t(d8iJJJ_6zwb*Ssqc@_m8RnO z;Gc{0U&GjUK+)Hlx`(mug@;WB5BTa0$SQfr^tVPJ8YvIT9*Hb!d2g!Ms~Md4rF~G{ zOh##UFxCA&Ux<_sSY8XV=8PtIM zV!W0_*(B$G*ptXZ7`dZy~?oBwJS+{Id$Vr z<8~EwPs-<0vn=_X{&_{tUk6ece*=2l_ny;K#A>1K)UMiX^GIo7eGqSNX`W#IjcfhH zV_5l(!&J^MHBK_X zm}gZx&XYt5Q36tP6Nz(Zdis@0ic%B2gSfV)ezo6(mggw6PbYoC1@9JKu~h912htNZ^-pVEHWjF@Pc>@0A-AvU-BVDlz|u3nA%63^{ac480nrw1OW7 zSHdz_W<%M$I?*mbbYR)RMGTLDBRnxh?U)ctFP~q*RS!N153W_O-pbEsTeYf$H^;WP zi-btgZu~Q+9L;!U5$+OaiK`PX->6ZQlZ#4$#VIk-=!Kr|j?sB|Hy&R#CW0rdZX9#P z(zm8!9~9qrNkm?krdl7A_Sq3QX}zXq=#jBg*$V9Qp&n@^_DA~Rbn8DikCdXYAL&_Z z@c({xrY{eF>Z7Z1uAgGTTP$uLx?W0R2az6PIn1cl6=znT~ z96A!X-2jSY9uR<%2CK>`=gT%12xZ>g6q^u)Zdf-_tUZTwauwSv5ktm`NvsW>9c7p z5^=a?s{8AJ`fwZ8999o2f~gS2o!TVK^=XrWtANJP3oO&zgA|+yOSKOrAPY4t6KuhS z{^<2XlUxATo|oC=&rX*V_A^BIC@k|GS_=|70T-lue@3ic4cz$Kqf}lzqkb>vu=jVc zR7NZPxeV^l3^{pG?CFWETTMY&dL&REqAUXmov#F_{;KU(aFgt=;IsG!ANnNl9t5y|3$_coous~dgkouDgjhKx>1x%+5UHEoTT-r zFsD}=hAcDdrh4aNLGS~>#OX6cTNFt+f#2OieX^4hQ`>|8ynTFEA=P`kE^cB~yZilG zpDX6;KaW7$NA3=BtK-0np0j)IcX6wOKuC}6-J_d5?XZqt9j{kF^dKo`jDX;9G04|S zbdBZ4`|Gzf_fhN%;?bjTm^i1sLNn%QVcc0l9Z%5kxRy2CVTYC<06t!gd3aDT&D&@7ADkS)8VefTX|D1EYcXhs#@ZERC zKo8tuqG>?UX6EmVtebZq|7aq(_jZ5+fJ>PPa%+o@FPkt-SRtF2pWnbDK;9ELikcMI z?04A!PEUDyo~*tJzfF>VeIbXAvgyLY&%oPa45SG#d8JFaSyy|gT0Wu9VhMEb*hBkL zw85=!!EVg5dZ2`)^s3aCzK0OE8G`4D9oU*#q2wuTTAgX1=b^{$HDb zKX(%_p9hdXzk($oZ&gFt0F>Ho?}D64$3S+weEyvQ>d05XQ}$PH zP6{xD^!XNmWD9xUfoZ^y$-PM+?(LanZ?Xz{l=k+V9V-m<@j$y94rc>dZ(cHxH?WK_ zpmcKxNI~8Vhq9l$MqeO@V2@3X^Q?>G|7%+yqtm&}V;`^j1Jb4|o4}o$D4ng#zMZ+% zVG+~alGdRLP7__?++kZ0E3vVM#oj;z8pnNnLp+KCtt1-U$FhRUK87v-oECZCmwaa8 z9ccYoND#@L#=_H2D@kUX%j1<4kt1eh57~Mt0NjavQ|ywXHFE%a+J8Q`IVGa3Rm$uS0@TCe$K zKz;h)S4g%+fx-mBqbs0C!(1fOcgOt8Q=O+g6Iov7U~-$_+sB+Afod;fb}ZshGN)tUId?Q2?L zOT(ZhuxJh)zyI!miKE(HvIV>zM1aGzht$(P?)^Hc^CJz?ql{xh1ZA0t=FwR zhl5@?`>p>sfg7Hd)Ivr-Zx-_X7XNmSvmJe#?vc7B)~o4~L_Jb&*7UO;LibeAr=eE} z#4|PPgRyInF|!41eiAWlxrWt$k4HU0-+z4>aujz){l14p3|cdaSWf)1gul*Opia>Fw?u-Ky>2LGY%wbR95xj{U8wj(bn$R_L5`5OX0a^} zc56LRb3sS&*tzy-Ff~G_=;r^S+lrtX7Q{l-KmSc)eX!A2afCxH;)ktRVY&}SeP^4sLv;QTd zynBAh4iuyn<1|3LHx@_{uX6o*cf{&N*#0;L+9rG{CLeJoHh(l{&KLnQx71U|4{$!rJI+BjBQc@D~B^o zEma-CK~-i=rH7P|;2sNC+QaOwqi%>DmydGc!(>`^vzein3P}>ZV1QSCe-loq7C!ke zSv+0Ybv3+>xV8t7hQLcg$UW}6JZ?DS0frsN8yFnA@pfeu%rDXbkYkm z3fAi>b0@NJM3hszR+yq}f9Y^R1?MP%AeU!wm4|@JQVb46sXrtdsu8n{2?21Q0vHnf zhE9mxYR^rMQCfXdF!a*#Pu+aAh=k5?+5b-^4;I`86|pEu+vROeWr=j?+v(0=;i;-k znG3G_xgkn|JuBJG!Dm7g{Xmmor5f-&M4x=1<}IUrbuwVgyPV&hM*AAk^gz+=c(&W%GxQP<*c{&|-5~Nke@oKD3>vky}N6l%;IlaKC(zI<(ld zohvUaf~|Zf6vsf@8;O055P5_r@7x#ExW`)Xrg5q>Z2R}%pEIZ-Q@cislsdV~`YW5) zzQ_lj(Kk0l?H`3~2=@26FgQ+lqHb=;f~HtUM%gxu$W1_V-%60?nitr*xHP$*!^DY>uKy}!ALQ9^u(G(cswv*wN!pC9Go(~Twb zG|{@4lmFsmpU~=LzhM%4I?(crA!{F0O466WX6~0AH{9rCZ_>uwL_IA_|18hAyVh=? zp}5jQ=2LKL;eRpESvSZDa&;N|7$l0VYxdJISuE<~2Me2@aPOiZ>y8g#hGm+JUhg^Y z?RVXtBAtBl`~iU zdxm#|i1ga>gL5XxE%DV(-var;6z@2fqvS`OAzjkZH{fv`io%!4xOl(>$NfIrxWWhVxdnY)pF1bu%SnHUa2aOrRq^o{u%SQ zD$$`R^YqL#h=g zI$O;j?HZr-&_4v!)R$DNZw3J&t@fcTLE3pc@|P=menlP+w3`EHPX#^QGu~++)`wYjunKHZapi2BLQ;797uyQU=Ty#-h*oLxZm@> z61`MM*xn8FN05nc91|`E))dZb%?I>pv|K((Z#>h#_hh}?3lC5}mzDuFLCD{M$ugz>u5~od*6snY-yaG&f}%UW6;*e6E5oUmGOTTG<0aZ{zRcXFsgU;2`+r<5$l!- zt8_Nt)%_*#HJQf)b?621#~~TFWLOVxjbR=K1HD`m1j9T8@(jZT)$5h5!<3n@%{HyY zSe)^Ij;wdN&6VeoPJAWYZ@%3as{TuZ7MOX504ywgfoCu>W-A20>^y#rPdJ?B_pCxU zEr9vr{6_w~Gz^vQTH6Ow2m`MUf38bX6g3pxgor5lC~Ey||Ey6uU^HY%OKEw`4s*wl zF(+gX+f9&V4~tmW9cz|oZDRuN`f@?!c(GS_BjW)N(^zppA6uaw%kr&Tsk5DUES|U* z_Yb-vGm7m+I=hyRwFh!6&j}~8+UM8l(4X4#Rzl^AB!ixHy5=K6vyYVNd{j|oChl+QoXLBH>gs3X6Uyy zmxUv_H+N5;k15SiSCXO(zsYafu^}7coh~DYImfbpucG4Smo35H(#qOEJKl{N=webeCX6b^^p-2!^ykE*%;Z`WD(M~&OvEan_d zFlw?&E8VIybwWAniw*jTXF7^B_8hb&v)1T?EwuUNq-Td2Lu=IPAKT{%qOnyU0^O^{ zm>tuVTfUbMIA+AwHlTmGp$eBCs;qc2pVt2=y*84rgl|=5OH($q89(4e(XEglgs_37 zx%G{a5Ds|_j^EM9yAiG^pM``ZHo$GGdk!T;{8ELY{{4M&9c{=Fhzz~sxrX2?@B`VI zf=uhc+q#~6-s9rb`-MDA*8DA=i}S+V>ei`a;x-~^m7zCsd4-`TNccl|07Nqj!KzvZ zG5D3y;@VsDL9g>=5Xt)1SxoAlk7dlY^{7e--wq5BC<0g)fM1`MA;Ki?&tQ*Rl0-;~ zFgxxSlOD8VcmMd~Zx3>W?QOgIvSK@rzE#S780u_t;RkQS_nIT@!xqV&6%U!!{~R@V z!W0O7@jJ&GOy(jv;F3Q`Lacp@b0jbatlZY6$?Q1#yEw6^Kw6GvLB!$N6*b^ z`9*^Q#h87GQwjCN7&k=asGg~YkCu6=Iai-}3gfMHewc^Py*Sn&RfIH6-V zf;X4z{WSY%n(g!b5u&#>7xrOFDx%LX6N~Y)pzIm%xKy*fHfWcd#t5sTG-nu}U*Vl& zC41X$OnK~F|KF|wC4Nv}N9&9GG|J5Z;x5+KmqjTmiqWP+gU8ofS_l|__}m=xMp)&! zs}5)Ya!w5)Wi6m7OMn<-?{(9Y_2@s$3G^qe0>PD3!B!TJ%_C_)7}?B}g(l8TD2#S# zy#8DMh|*oS1Se-}vLHhEdG-V}|4AFNu#C`kGx!tWS%4*a0z9EW6=5WmL!c&o5E*bN zgq4r=KWh+pA#<;Eb5WDD7KAX|>wRBop&sEwf2|y0Q;}ge^f!126!yrO+w?eI9lpNTy6?7S<#Yl}{)lPqyG;ZNzRuJU9uMf|JPPo5t0 zIpR)s&ox0S0rthWMb}=on0{#FY3`PniM59x3yV@-`v@cvQqWl&Ofb6cMCjrb$KGJc zCS9Q$v$=?mMQ7iuonwRC^hNWEJ|A(s!jD?Lfr?pPTcKdu;b$E9j$~gZB9yz zICzi1fKWFzkPXqk2EJssz5>iyJ_`Ww|JT4-5WrB89JCGot0B-Y4h$f%rR6U?tMWKDl2M6s0q zv3)d_GHpF%4BzLmdPC3{S$J0~K*sy>P*mvnNHPH(5X4G|4NZ8T0Quetz=9^m{(biO zrb!7+6SZE2_7?<#uh<*t3lK*S=)X5*3PRCX9Aczhd;e4b5N)D+na}er_TT9-A-z5! z(Aaz@`!BaCDK(dBa+_*iEyj&r)a{9Bay-^&lx^+x36|PkgUUFPdSr0|xDQg@p`5zx z#ET!cAH2FlKe#g(m7E^Jt zM@Y8C^q&e2V#yKIb;pzpx}-wHYL~irR(mbW+%oPE+-U zF{8!~c908?u18QG+U zN+-nKC7R#ZSW>O8zpIm?=>Jd)8S|(5o9@h4OX-jEAiq-Dd{CsY}le62_jqp ztoDn9t9()iOedEpN^BzGU zMCOdnW&0g;eBGsLa}wKJrN5DXkJIOWpXo7dS;}F1#%Wz4smb!|7SAD(aKcwjp%+!9 z;FsO=w+uOpi*La&@p`6x6QLK(JNEfBJh|JibnRQCA9VF!d%Ntn>7@hDsEpKx2Z@#p z77I;jS@2835)Pl*nkS5RVen1$Qtpl$I7~$@EMn1)3_~!J&Y;PM*Os~^)PTo_w{}@C z_coLpr3$=BeSBb2+es-+^S&Jxd>3hmh)jvaxa|=uXMt*?cP;=-(2k`2;!~^-{3E-Eq!q<4_71pD+-$ zpH#T8qd%6Q`Hz((Y2ZdQUB|7hu;=-8HdcKzB0r;_d0MIHjwpo#6iyf7X=iPYi#m6C zIJ!Bqj&jlzvy>0bsqAR$D`vv`>AeYe=GW<({JH5ur!i@O7(#Vp&vt6=fvba$jwp)w zvC~a;Hy)b)n$*cn*PD+Qc97;Ppezj|VBl?%9>_*-dt(vs5_|^26*Zz1QEC{ZLor=d z1xWA2$B^wV6}6*l!S*5kB(Q!j)b2tdne{cBLLm_z#202ub464Bw48&%y!lZ|xyH&? zl3$;27Ko}1>@AgVcS^@$>xlnkemo{&{X1jEFEZRmfBG}&@B^uo_(%RDR|d2%rk+o- z%s$VXUqQi?5R0iI0B;}YsowlA9DaZz5JkW6!ikIKC=%s{wotfYIlJA6eq#<%l|><& z712Z?Lsk37&~d-^p*MVnLNI;sU(;Xp87iUgdavAK^`Os72rWSdH=T~CZk=cux-ZMG zY3B3$@RS5X-kV#s2>)KwGcs&vj3_F<6;AUOeJL{~F7?4mbc1&kt3B?B@@1^8K8XxY zY8wg4+2v=x+4vK?_aI*P}1?v%-55pgT-&zs<$eoM!XaA7;*jq$~oo2JXLRKnKX@N)u4d zW-E%lx3_S)Y1*fu8)q18EN4?fkWEzs6$+PU9tkUp6dzzrX>9&#rPTI)y}+ybydynWF@47 zgXO{5PWUqH=pgfXeE#mPP)Xe3(spZRKmFFt&GijQa~bvXTY7AtORZPUpTUy3T3gUU zy1K4t15KcLJU$1p)@d%&9n3;rB3ODGktBy{>Tfg4?$I$9;pK=wVf$}269dD=S{93p zzT0Rv7d46TO96ZL28MW+;ePjocD?mAs8QC}@*zo~8~@5*zp{MRX7Ilttd?4ySH>0m zkOMJ{co3urmQ%y!h~(|bW%BX-_{IO*s`|^ojOixMHRo9Z0g@_-ziiY(J5M@mtZF6g zJek>5n7KrQeOX_u?^w9k5d&sIM=94b19^f5hO?YtieUTlj^?20x)U*TjW?1GEJf`I zwM)tbRoFDKG0gTeJ;AaC>sW-oQ9*TS_OK+4R{q}%L$BBXMt{YC!Ov7jV!4VG#PR#6 zv`eT5)M8dXltgH-xN*aj%A(Xi;OWQEtb-y(D_DORGaH3{H>Ft&)nQl@HL`iA2JN*f z6vJhCsFfK<@7L?wXx(DpLf=0$V@Ucd9gY~R4=8Fc4td@U(B z=d8_?YP{x!?q-MFiF9&wisJsKZ9z;1_0&)!BwjkI+yFS?txuA|Tj=5@sTnX$GFc^@ zgkGx-toW|!%9UsFM#Ica4V~Oo8Aw$H!Up%P2E_S=y4F~Kh$y&-TZo5ml8d5uJ_DJk z=1kK&Uon@c2rH767}Lq>8j2c5&eT}F~_OT@#V$akZwV$Er#3%x@_#`#gcmD5O^mY0>O#;ezy;${kcb+5+)t%OY_e%)~ggJ0DNPIeM6<;6`^on|N z0kgGYRj7~f86z)X9t1NH5Xd&m15ZS<&^N0WxRo1s&K@x-1@NNwo&X5d z*$Mb!Z&~zxa)Phg1>-COK6g{#u>1d<)DU`11Qxh#`Hjk8-iz*oADtckr!W0|w#=<4 z4OI5OCFY6c(c9tfT=y|5^nN|y+YrB%po`rv^@*rY7__@m#7Zv0Lkpt~8u30st{XTz z4lVhZ3ODW+kqc6t_W2fNtr7+&32dCtrE=~Lo+tEfXEp^G&z;kW>Pd5C$TC#|r98=Y z_StR&t)v_CxThx(Zf^a$Wefw_$(!CkNGDJ7KW3Kc-ohtO*1N|hw%+R6pgS?mYp+JW z`xk2@trV9G;H@e#HFRjNR=TI{yFaLK*s*B7<(?hPrJFPPiKI1D#;;`w6~7O5tfk-l zIqA9|bcS?69HDMh!cYu;KV(<;GOE+|`yq&((~Aw658n-&@>7Ot`ToF|m?Vg&#Fv=o zy5xsYslnt(Js0C-vX*%nsLqY?6;_xXm?U9)OAc@;2Dr0a?>F6VC{BUoHTHNh(Is^x z)(jwF+KBcLAa#Y1w|Uu4g7H8-Xs`{Kkc`^o-?i4{?`(v7{8$qXH+{2bHVYZPzG7gO z1f;6Nx*fgGhNI3wZnT)R5+86KcDdO9$Fw6k7(KA zC6govdJ~xU-4gy*($B-LceN4`r~FiUTT2l!rgo!#|LEJHM}3+S2@Q--mA-5at4-s& zOtcwKq-ek-&qY%sWw78~^SRNils6G&+tI%}iDx~SVk*F#d8{fhRU2B^Vg0d8=EJ}m zN@PA9{t+s_$r(0lkm`9;KR7$9BD2XO)+qRihvlYvWOv4e$7X1rF_q=@jfA&+FSY5m z$NnkU^U1Nm$F)LhQKnr+Li@Cn0UceT-m-bQGNqCuc?RYHZt(T(yO*QRVzQ{?n2*Y# zuMAT<GXGeZ3pP3L2R*n@W3?iqC~B+PgeqNQMK8!|sB zd4J$bD@*~8hA1WPhEK%)%<+;U$lt@2$(>e1++%3z>~M5SaLwb6O2hBttdRyYqbU{{)HDS!ksT3 z+%#60i7>x$K)Xd5q>((&>842%*HOk(O%AWqu=9X3A19KK@uGDvCBc%fD26BLthqjh zf$5-mv#CVA=fO9|*iQuE(v4$KY{p`KmJHAYZhv${U#2kxqF)QY7YoPU2~Sf%73Q;{ zK=no7Ut%GK&byj)c%M>Z;70K*q`u-Ew&cbjQTX>ESuxVDo{K^x+4_i_^4(D-c4yrw z(Dtor*rd;xp(k{GTnh6v%jG7O&JifY8&gvKhaC531pd zHrUUPHymN{pk&}Ko5A$1IX6-Uo^>NZOrAQvN`gVtXC>bHcS=A1`;t~3`EClSN{o)O zRMBS}QLNZebWA--bAeGs@kW=lWi`Z9t%#B$@?D)=9huM@O_vn7P#cDnU?I%!O4JJb zxuwHoXP=J&?qSd>c-3uZ61ln)*!1KibNkPgknL0MWX(|HMhouOmw-U4_CB%zWI zmQV)J%cj0y00iIt5zxjG?YU5~Bi6{kox62Swe>zOFY3&;L4<9v?s&90W+8=x1%=e+ zgfz_P&HQg&^&6iCLGvQ-1@ie=ek#1Cg^UCZPCCo%T0YVgb_IAuCTtV3GDNfES`Fu? z-NB-a(mlh&CUyQ`x7e7Lc&Hgs!4-phJ6=6Y{pM&ty_`HmoBr2`DI*{Vi4}PLCMuxa`I8aty}&!L24fz@o!v|yP;hBCfBqe`i?#mIzB>V_8e;wnmx51 zqkl2my4rtZ-*4IQS7`NQJgsTw*qI0>uhpG8hb=o- z#*H1Ai2Wgijwu`-g6*8ttUHe1(}wtaTa=vb26lBHY(mS=%x{|`qWP~{VdCHLSuWoO zAX9_TSf1SdT3Em<;GPETD+TEO12AZu-yCr6p=oibvDDjTpA7O~z-J6%w+EOfa+%rpu6=e5)oZG~~_;TAc)>{|JWyL?f?CG9sFZ|A#_R!3F zqZNHZCR1pel`09+0)#WRxpJ7tNa}!-+cuy&py0m#)4q)2HG02Y&k+558 z{|rqkP&*f-55?J%c6wUMGt;pTXyQfs4Ygr)p{cP9skT1}MbeE~#+dx&}BQ z9y7~e_uFoWp>z>&wI?H@pYl^j>@<0u-JrP@oqJK{iX$(2%VF5-YUlm*&dS{gtPV!q z89M=I+3pxAU_|gLWFfKOq1}Ap6J#!N9bU;_y#?a+Y=4f^pEAhplm4^15{QgQXBiIL zXY}Yo)m(MscD~BGC(M`WrTCn=k&iQGmuC7EE0DWchmCbe*nz;rk4Vrr4TJT*Uvwb@-2OXrJP7$)6lv^pytsgltz4Adw^cN>gB3ht|zNw&F!ozyw|49 zqc86V!g`mwSPO5s zbKJ80u@@2C#NQ;yoN4H&G%otvBkEkghvTF5Nfs!V0i1>(4tnZuNSX_Pt!HaV-tqXZ z28t9R5IR$)^z`WC7gywY*-%-tqI5oEo#C@xYiyQUxw*r+MNl&%iMeib!T<%dl$Z0h9n>sojYC-1K zvljkP(};}?7YtTh&^c0$CYfo6ittgGNhOCTwgn$qGzlc}^Js6GV9h>-Jf@JYX@_cQGgT?+u1<(*Q zfQZKRKgHd?^}VKmLB)rrB1u<0hC=?nh9|`mm~vzv`21DY#rX)?X=_lVB*SodX%uRU zT%$H~%h^Ud5AoI-Wl<{G3Uojm_2Bs@s0!0jc z=8Z2_D;@(yVk&vwhl&b+SS*)8oq8k@te;p%O&Qr>erHSIejk_G?ak4^Dvt=#oNT1W zOB<|F^VN2X*Ye7IN>mIZ0p1#fTL9!b$wn?IKOnn@7V0hxjisONE%@44ObRvc2w^Qp z0O7wvz)t}4c@C;dGQ4{M0BTaS&tCuI+{{HCI?_&xAdPfr*`1+$8*~&Aoeg~F$S7J8 z@h>_OgWsP{`XxdVE|Nnbv`aTN$-IM7SKpv<)vD2+5uE7IuUMY9pO|DvKxJ`Jb#%mD zD8xyKgfRHDe<{+EsK%@?m43N+3(pL??`dsV2o zNX@*qWml+>t8s>vDvmn9w(+lWkM4eE`fy|FaP$vrJ#c!I;G$PM&V>xy@Yeyo!&r8!@zb#)u2q|OR; zR=?n1*trdNm>-DB$F}iR&-)HJ_e#4H`*pm@Pk=#Qr4X?@eMs1In~^XLF+Fzp`j9dL&}s1O!9bu6ypZZclFtYL9hTqzu%>Rk?shqZJ9_acnQtuP4@%S( zy!4Mv!WA!+#KwMBj%XSw(3GP*V>L z@aTWQq%4RsH>(bH=#gSaAupx68%ch2djl#5R1^z8G+Vr=GZk9UjI#EqMM85@FIbun zZ?QL$DjQI!6y_Oa8OFjGF+@@VHm4x&FQiURBB&qzA{S zhY_4)61Ptq!cfZ2yeZB__CY*VveA*os&;JyN4ID)ae20MRL7#dib~l>53wwwYb>W# zx5E5CaIEzNFQH_=UM`uxzWo8(BlFJWb;f*l)1~yuuV?+ej(7GhQ-#f{l3(?yG*%Z$ zDp0HtIz4ewFZ?Whh4u<*p(cArQlH)-msjUjThUi1_x_B1+M7{R1xyQA8}bMT#QNJ> z317uuUpjM!cNbP`;~SqgzEa5Ju>8!k_L-%U#@9KrPX_%z0MS4$ziFPb83%8EJ^L7( zlNkkafzyH|W}M*n`R1B5O3CJ0B!N)K_TqZJn3b)IAXPy2qW2vHM_8=%X;R#e^8E@d zkgXIhh>*Mp7eZc88b7Yv^@{M_GzXS+u!z6di1g)LDy{>~8(u{zV?n%}EkvsQ3;RkS zS%r&oZ8SWTAnVr;uVMBa~Z z_7wtV@i)DHnPGlcT-7ze%V#1p>J+(G1RUFN&La#I$t^MEkr8HB2o?%@^O1N!4sS=Y<>#*G(XoFLCMA@43JlZNaoK1jFXCodk z)|WzQYJu;$)m|~p9P<*ZA2m~j&e_&ynmflm#6@INdw6SDI;8>=>ec8#iy5^emYEfM$#6xg+USJ!`a%bnBDu5$soAf9e!=TAnb3NEMOWN>53JcSE~py%Ga!I1 z$3?tN6Ld|28t_W}awX!cZeNmb>tmwqxl|$8o_H3QG>qa(P%ElqiU6~cMp427mk)*` zrerCxl81_nS%TLB3@%r zRNRbTVyz6Tt$%M1rhkJ*c5$=E!oP}D=a{I90`1H9PwF=`+-z=v1H7Gq225|>KMv?L zHBdF`y7hPf{U4 ze31w`N?ZfXb>h?f2JIz%bOwG27F!w*RO8D#ra$sz;Rh64zBVGmgHa`j?1n`gGO(p4dSQMj$BbAM~`f&m-WUF-#ZEV1H@i+#tyI?1X$ zfTGw3=|{tC!R9+XsRd2_<|!!?Wow-^v`H&bx06-i?ynQ z4CTFj#YwK%`%9b_GL%NMr?#?F?IG{&D^4~EjoOLV^Tpk-%NS?7AMtjkE1}`db}&=_ zQc;4YGbecFTb1bacD0#b&a)t=;B2*B8yuqKvQX#LXmf6IjybE^(H~6|3bb}yEx<{J zHJ0`NWZ%4|UT{Q+E07rCQMnNxkQ3hGX)i20_=Bb9yHxx*K;*0{rC zbYpepDoF;uNN^S|iwjrY*=^>JSKpUJ?Qp*Qt>)#eQ0Cvx*Nu(rt{1fusnsp5DzxQ% zo#nCndYNuw()<@Y*IKYYuV(t1S45Fs$tv4X>nvH!$&HeK+k>7UFa6M-pHMaLJf&q# zC)byJGD(f2YdvOc;W~?A5Z0E!7WL9npXJ0%UmN_JVGK8A%slq3XiZ83+JMT;`XrrG zkYNwj8i&n^bo4%6lh0&S3x`)%qBo(`qo1E;fC2b!b1qnG1q3VeJC+J)mwd-U6_?^U zPu1&@+RE;FguJ&?%|x*v1O!@2p-l5^Lqn~wr{Yk^BJS!P5pS3rnO@It^RYf`M@c440}NUPrvkUg$g%B9U_ zeV4N0a=u_U+#)~`rFaftCvwS2*es+vjUmxZ#y;hB=aN-etP#2yKO|Rk8r7M}tJW9t zn|O0^{X>EISAXBm$u&?3DSd;rGVoIUdo`)Zut}|tSnG%s3WBZVvv@Z1AUdSBB&v}h zAUd?X=C&#t`tYJASoSEW`M~zhZ><0j>*Qwj*#|-xgSe-#n`{!!?(LfWYawOko91PH zA^C~9asY03XtVN&LNCqwR~w6(jh(Kx%d~L)d?QL%Djt5-w>2We=KcG}2xB&v+Z3XN z7vgWm8AI*we}-(oW5oVO`q4N?@P+%IWX4#qS$>dzHBJ+LW9Rc!Tvp1vP$f`b#)~Rm zgceigZZmj7HrB?fmm|dmj@|3)i}q4KS5>9s-2DmzM@=VzclDvlprY$dPN|}g+!c;R zea9LKr!tBdgxb;|iZG|^7#3qdAGgBQ>MReLfysbUQklL(r<$uVdxL6P8E45<_q4Y& z2l~hCEN#&QV$ae*O7M&HHDCS)Y*Q6L?LLL?)z00OR~KCmz?~X|N>V=QJH_=?O796B z-vUJVZ6Z^&L><{N=dJTD+oQJ!t^b&xxjs_B8}dJggD8^ozmL28kGpx=ssG5N!Wu;& zQ{hGHLXcH!O*P1}NU}`|O0LIRB_fHmsVx#ImQ&@@@-A)AQ^Lo@TCsMtW*L|y&44O# zU_=vCNfN3^DNH~I1*=qDDOjD0Q0E1?iyG8i1?q>GmVajtTK|L5#-}x>t8y+0Y^eV` zm_%~@-y!+b@&8>s?);zM>%2;Hr$vByM#j_XZYu%fd!|uwU;~DM3c&_+OtBtCFR}LP z1{X#F*J@Vm?E|Y_^^hy9$=X%0R;i-Twdq+=XhL19jqb1JaOEWISZ=uNprh}-q3^@1 zAlTKue%KV*)xPd(Uw5^y4}l9EcI|8CI_9=s^wk4fs|S5z;BG|FnW1qyvKh_bMFR?H zdc|s7$(IEhM{cr5Ri3-L@`qdFxvMMxwQJxBtjBVtv^d4EF!Q zK&k&Yp7gu=&pUZ`S^pU>SnRXrvUP39@{Qb239DCGwu1{_ZkK#TXKJ1XYXPoUq)JgH z63F0@g|cAPf0wJ}+vJLD`OgUziLYoiB)O%S=|lN>RzMt<6`G+S@lD-~ESIZ;zi#Gl0rZDn)|J#%dMH;s&rY&sVEO5-;5;HFFA7 zhR^mDOO=++ruoi7X}Z)$%DHf=ahU7-j7>#P_!dP{VLHulS5n9Er?$V(75!9CQltuK z#oSj#h*R3IG`J+1AfBI3uQ1mi`;p2TinM=DvOrO<^+(9MV%O;)&*Man@w8v%xO+{1 zdsC!%%8*1FxIxZF%P!meaA7rEmeWNUFKjSgc8}(UiwqS=%F*qVPX&yTPZ$SCi5MMh zoT{pTY2Xv4AyBwPf(KG;6|f9_!ZMmd!%HKMTt}?sMuF_1A)#uaCA^b{O-NhaO2bGR z71>Zjuhcpmw6mp#ZuA>qU=IE4s-YVxqhO8j`Zy9~xZ6evn;X#wC~#x6e2oMf?&wj% zHug$%6J1dm890q+ND1D=D|jbB;TM@*0-hu#G$&r6c?Q*Hk-z~xPfB>6dF9`IsCtS7 z59p~Z=0D z>{oBGD`9jz?s1YD*@>_1$ghSP+W<|Cfkn;UL5Ql!IS&xk1RWovDz7K`=%f{@ay#Eq zl6q!EQqG5XJ--%&k_LqC#ilR;3Y;k)B%r}q9u}dSfmZ=_FlpyjH1JB@gA-4x2Cwq! z;8`JxwX#BF81$=JdT=8nq4zlQR zDOkEr{I6?D2xI<-FqGqe$5Ghn|9A21NBnP@|G{tgZ>`i1y9fuC(?Hm`u<_X+q}> zC3r4nf3QOr8YK+H9a{mC<$!3I{2|Z$P$hnF_Ic}`>Z!s1+p_;o!l9i1ft(1P|KCoY zz2N_y8Q94TY?;jgOTK{I+fJrg1NgSqMDSNHYtQnrkSm&3xjyW-b3+Tg>ZZfc&k8N{ zsZj#?4>9-TZK3ck3BGxX==;oUgw*U7`tLX6vn8##HnTa7_zhE1J3 z#$KKD#-pZA9%HYv!FX(C$#-Vfjhs9tBfXQy#IH?kGB!AQOuPy_lZihkkBQr{rgid| zoY;`Y#96@c>f|wo4B{Fmk8u+@0Pqhwsp;e~_9_>SpS59*A3GlR8j`Xy8czHe3c(yb zsCWO1*=#p{{bZodqko@0`th7TvQVl?{?n3&zajaL1fVfhP~)fokQvF9wIryN#6l&% z@p`&iahm<`CYyvcy~!qiBP1q}hosh5yyW0jxsl>6r8H7u-a#>F5Ex58l7F-ej2JFhG3GOl}^6 z!4dK@>z;jm4DtW-j%x{JN@Z?GGa&>b< zZdfd1V({cip^d3>uJM=USu!J(k(9Np%N%V$@pAi^A5^6H_tn(lFk7s=OD1;1anub)$FJB>P9SK450{10Z4oJb-9@@+`EWB$8(nJ zFz=_FxH9Uk!f)nDnkR88P*%ag(jBsKDujsn41316a^UN{CQlrE zSIvf*eJxjjF6-NC%Gqacs;M-^c0qhjH4hh?yk`47AWY0f7#vmm{Nr^J(!yl*xs#q_-&o|ek5xII_Et0HlA@E;Z&lj_@HDMwczUYA^ z;;fu)-Z(e$@Y}dJ;PQs&<~9}a6(275X(;4A3U&D*OAvZ0Xs5k$ zdKE{4PysKjNXyspa<&i&`7i7%fr=Fl%eB$)SAxG^KfH!ncTm`$MR*oPaeK6uJw_*d zs}d$?VapM#EmB}XOjIkarY>(S+B3&1e082pcV1Wt#T2(qMp2UQ%JfrlhM$S_6681Y zN)Eu5MlF1=Ss*xvuqBY}D+J8qZz`vnVSZPrqBX$Fhby!6yvmkIS{4h=dxU`^nbPzy z#LNT7c$|xrVLnc>&d)OwX-mCt$m`?=dvjY1Pzrx_4lZ$<5K>v+{cy(_z1U4am;zg( zRFrbWUS{OuCTZMFnrxsxP#H|1x*kp-+{kvEFMDkn-|UQgV7w!@CCU3y1Qa%`im2ci zh{e*PUC6O~b8{cMr9|-HCfy^G}N#@6lb0*62I2kYk zp~)P!x0DYwS*-S^ci2m1@PRSUCcvk&5f3ekMMJKz(p&@IldZjknn@GpNQAx3$2xO| zPWRTQ&im;;^krsq{R&oDbkrAT*sIZj7FB9T$idFMLJY@xEHgazlHs0Lwb5N7l$l+u z=S+NrF6kKrxi%2^T`Ls@=F6J|&1yZrqO`CAYTpFd#a9njXaFnJfWwL17&Mh2-Wn8) z7%pNW=o^qyt-rsO3iME|W>!GGB<(x^ro&RH`7ywwN)Fy&vbca_yS7A7wR4$9$gIGF zs?*5VN48c>Ial6las^a&eWWMDd@b!vNS6ixC0#Yy151Zk5D;|9!$O7(98mk3qjFRk z*G{Pj;UGa=B(1KwHuKlKv}dyi+*gfQP~NG73i##w$I1q9QiU*~IjX zgS_AZ3!8?gjz(D<)?feL9^l~y3cZHVfCXw7bif`A7uuKae;3@~5#b0j@D~hJVS4la zkwK?vgM*JsJHynG7xrK$%%Ko=XwE>ayNM5Cuk69JZ=pzeXxczXy=mImD~+cuh?3v*!vc4l?iJ&CYgAYl%T6|8{_V$M# z?y^@sXnHei^I5VnS-HWtuhR9aFBgk#%JLK9eJIu&tO#p}D57K}+v=fsYr;I4M|Ytmc`RnZ2py-*P*{nT5Qt2h4l9dNG^LGsA1?L6g2Hys0!ucx&;d0WH>D z>;R(z)&=jAmw*6442*wBH1$iwHotvIS>qUZATc@hC>IK@$ zMB_kf$7KT?v{+-M2K{`=vcC{vuw0LA=7y-q^N3d++;99v?l;pfRo~0^4#(BSLNer$ z%0BI)Knf&iqChZuvby2P8HlBe3TGd*xZmZS-DcjSsM`{^4q8Vawf`(Qx&GBL`Eom7 z;|>clKz5!QuGhp8<<%WA2q5G;6^m>ry#cgSqiLuTrYKtStuy;>)(q7S=rg$t1t6(lbWx8YID2m zAM)N#l`_Se5)kIgtEym+3gxxJ5Q}pu3y-aLN@WQk)9d+dKGuh=9A#(pb-WRiNJ??_ z6#-<&iu$W?tN=gTIjZGhqfJKd>qoC2f`TCZ)pE1G%kgc*H5id(vhf+-*J;Ag?T1DHZa+WD5+Irthk(Sq8=F8D)4rZIoO z*w7Qoo`j5f_L`R)S|RC&f`VTCeLE-j`Yg&7I%eKr%?ihi{ylrrH_0O!uHz}@O@nnS z!MRF{-RN>G?i?rate|vf?Zv&w>^|ZvVww`!n~dyZE$&+x0l*{_xs0E>##_Z7kL|b{X87Ql&!(G2~Y_V#VhD`$tVI=WFLM zAmws5&KPQc|1-Q%sxqRYMjfIDU%3C-uGPYi&~%mhkjDAKZ|r=+r+FHk=SQbKI-itg zTK)$lJ3z)9Pje-65mBT`q0UC2Zl{$8YN?sa@tn^4!F# zb)4yY-cX*D1eDx^oKO-Uj<+-d`5AdX#z zI0&I6sIXeZL^P08%ODh^m|C=KBBLrn92Q70A6#mvLrs!YLNEld0(m@}7y<(XpvYns z7-0g<5g-{7$MI#C`dXtZPX4C3%1-7r=cqWp*BFm?-*z8X@HN+uj`~NtNK$|^w|;bu z^Kngkq3B1X7j^iiuG|oIl!4fx=&PZ_1L{NJLLz{}2LxT= z^*7%X<*@W17A~5u>W0#*R)6a#nmH>O6jxH+!50=$xeh7xqPRbcHyK*2)HIxJL>$LXyJH-%(j{36q-d|80id#- zNawh62E)bOwfdpn;%uA^=8s85>hXiDMWwca`mr z9|zO9q2rj8bkG7Z?OM%Y%nCVh^Qd|-bn~DZH>hJkVTSgsQLaH<1FA8!YmFMM#VxN- z6AbQs8-tXV30RqvKoYRbYa>yEjk+*%L){^owUy@)Gyx{jnuvz%nY+hyYiJhJA%j?j z42N1If@VMnXP6-hMVHC)CT70#fUa~_=nj~>Z`Rjb6E%>#oqQoLV$S=f*a6s^7HU_X zKFk4*hH*ln1VLekSuiPjk%B-~PUcyY9zK8W8*Ga8umHs{IAMYPdjSvU83~t}3JdqI z$9z?r5d{2uD=5f=3Q!DORd=M^-l9hWR|;!K<1@ReRUUIp<*G8t8(fx2wVKG+)O~ z-6yju)7HYfbIHhuQm7>5f1N7Faw|ME3PIkmm5VWqH2tkrlQGrpc8R1Stjj@ZMoYws zgQY7(EIN9(J@x#wIu^L3lC`JCy_>Tl!#SbbA#zSplSGZ>nmG{dkctLEC=b{$VH8$) zcSDv_$c7x1myDtchM10w!BS9%Y9yAwa zG4RZK=-Z~XQC3JRH>m4X8n&UGkvF$lx9kDQH+x`QCX5r<;I7IxXM-zH{>)oB<4Qx@ zdE-WyvY~UqySpaM^Y4N}fUrS8L8!_A1`0lMAb|FUsJQlj9d|?A;U0IlH2Ua60~tK) z(a|hD@}VJL$oYSeArM!4uQy)R;f>1)22w8&2cjilD6He_pkX-13H#fLZor%NWOv>J*=BfXnv>T22>^6ybtZVOQ%8+SZCe+7O2(^a1>p~H0$JUS-?zP?^vV(m=7ALw)X=Px&lfJ}|5#t5@|+9!9- z1bp5*o)ps>r0uvI2`W+q@d(k$oq^=5NB?J){_NC#kZ^}rM_O?aLUtZPNsQR=ksL-Jw9mOBrQ6lLzsuA zpL)m7Pv_MAU=y$m$qZ}w#wiA3JLi~T&WMo`xZd;Ad`f1NKR;zKm2)?uXNq@r_U^^| zAF@`*#*yi*j*L!mL&Hj`l9j_uK1=$=;(C>CrYHTAKAm)2EPUFd^XyURpPv?AJ{KAO zeQ%Nn{3!fCCzhvIZoD3PO#GibBL5F3(Qwl7|6M%p{9j}PObb&mBT@RaKMbT7Gv3Sy zv3%+G-+!0bWyw?1UexaodgTAK!Qak){N+`Ve>DYrrU2CI_}$NEvbUA(vGrVh?Fc?a zvTauip&l6aaQ2FX+B&}}otC-q!cw(uy-p^7Adg=D=Pju2mjI*uKN?E%|8O`Obo_r8 zj~)O2208#JlfkX_7}vMvU(PoJO2+aXz<$&=t_H?ifCG5SgO?Sk!@L1`88eRsB^8Zkh|D&iM^*jE*i>DR+PbdHHzx)p@pDh0aUf$ik;DJ2~ z|IZKKPgit7Kdm_@4Chn8$p6Psw){V%lV(~SfFoC4B(3mykuTHk zejl)Y$jf2xpWpn#f~;fdg{c4p&dnc_r+hO{MElcfee+|&Ji5L={`)pw5N?>vj%l`c z>c^L{dzGQ%gHVSV`l?v!uHfTE&BBbk7aq1%bvdAzozN(E@_{SZDfR1wBSffy7a;XX zmD1m<%{9%7VOx+Es2?1_HR$8bW<5XOZi;E6S34EH)>9nhQg5?hj za;gRMO>*<`t}49V6W;AXFQ4{GFnG|GcP|9!By5x&pY}?O=L-WA29(MIRz(4w_P-+k zXGsW%;Gbn7Xz2RG9;5z0l>L9A!654R|1O?}`hPj!O{ew02d%%j2$)9@ukx4PP!;`R zgWah2I|cteJO=x(pbQcSy2coK{vY;7}AcURp^vyG%m=>W)vVl3@`$eMaHIgv_nH5Tm+P{5Qif% z%9X!6irf>5L`#4Gg^ql&oV>pSqtZj=IfaH}Un3fM{a;Jw ze}n!nA|K@VzflwpJN@4-9+P3;q=>UHuGcfFn+)kkk0n!hp};EgTt0p*7`<=iUy@m# zah(20e!X5%`-y0R25ru){bOdtwrJhUy6(tQx0 zQ&+2t3O5C6!s{8Ek8KS9D$XV9t`3bt^P7QEeV;pGknw&??#iTpS+byP zCMoHYx@-quZsW~$^=nSCWMeI6#c%(9nfp4>*^myUj!VZAxaaa`hpzLJ66v}4)uH3U zqzrdl{OZtgW*b2I&3{C@WwfA2v>xJ~zJIZ66Q6;|N%lQqn*wqP;&eQV+iI6=i zpG6AsW!6tm>70Ibm(y2IBrwJMOA==a)|uB!k$l2>NGEI;HU<~ZW$opQdeh)H?9FqYc9-57T{3*b=4zR_W> zYT%pCHP}@>khB}4r(}5?g7WVw3~ZNkGG=k|#OTSxelngoS#Rb;M**YN1Bb!xz7PiX z@RGTRwnO0={$3BOrEK4n9|HWC^Hu&Q4pqh%b4*yg+Z@f3PqpgpjGoiie%9Zw6<+L<-uhZq`hN3~D4;=kh2TjMp6w++j=sjsJd` zC+W4^eKs@F(1X>COduO(+`^0yYOOsRY%EEFX7iH{$@r$?CK40M2C#0Q=*~szOeb*d~;m|sAW7qZ)+Y8VeYTppF-qZ>`H9Yha=M*Z0zsLu8)Y3arf-o!~6eyNoQ@i z|LFaHX!bwV|EE9f>Obt{IsKAOEpmGxo;~M_)x~e6m(I8GVqx;%sX_{0&!$1y6{WjB zeGbB>!;^pt(jWGsVGy27N8{<>S#Z4xUVXU=U!pIzen-|`7uOkD$p7PjS~5<1@){AmvM>3yv|HV3Mat|Q#SDXZIioH{6pT3m zHLsf)#A|{r>K>8I=*t941l*XJ5GmExfo{IMSZrqnIs8(FlnNal_sZs2wiu2k$qM(v zXU|Tm)B(pz_sC8mB+SMuF(n}nLmz#9P6)m(E@&cvoG$5Rt9-Kprlw1SOKLmJw_)*a zOh`VtSP;C<0BLrIjQXcWdI z`%>%G7Tm5^lrr)$2&-PiU&zDJTeC^7f ziw?5Y+g!&P2hA4fzrEW0ca)JNi%Y*NCEsMoR}wWBExGGR_9lO!6h>7qG^N|5&<{@r z(yd`WE3OOV$JalK3ohn0s<+&NnS`PC<0>!sYR~b>%4Yq{Gp3Xukfj?^w!kZj0kR{L zWI_&j~vi_`UZcJ1a<=`8p>PdREXyVT_Hw%u!}WVT7tmTs(y-0w4%R z54m+OpCo4-WE+YdQLNr?uWTc)cVSG&Ta=5cX;acnuY|UQjeW{ZG=aK&JeaL4;04)& zbjLl(M@oV}q)EbdW%14P>`?h*BkapKsl*8i;yBvYw7M!XDVvt)=c*yT2-zBN(oU|P zB%<3(*1q04ya=|N%z=+m^PiX)NLS-_d%hqdDLJ2NVHG@d3MFKPfhFlIk9zt{BZc`3 zMNijkyObINr%%S=xMXe!$_V{zFOu1h$$I{o3PL&8dbQX;1kOMZF&vfbNRLWxq{gVM z06a@JyTKpQ-M38OUk87v)@i%s z;owk2Psk&!47OSQmMn{N9a$W9^DfE>qXL$cvG7#=ihU;~Kg>=SnDl#C=j^Lu(g;~d z`uF_OKA)BUMhK(sot?X?_rA>seUcB+)2x{wifDu~TbWFh$SOgqPCODPf63=Ue!1jj zH>gz^m7r-<9F>Ml`N+P`w3 zBSWc5$d(2|Z#_cWj4pFMh`^|AE=J(Zh>cK%3l*Y$#n~m-ZBYD&eYo=hS>TW|P<2Dl z3I*LG90uEz$_Hc|4k`bJiQ(pP17+Y$2-l4)i|H<-NTR$ILVxx!Zpj>VBTBs8aRuiy zLUBY~ds!;0@j;*V@_zm;`&Sl6@NebUWEa&0Cfj0#!vP|V64~kP+t-k^0n3b3+$@g~ zKnm1}fVozgj-KXNUcODPm=^st+3#00xr|OYGvAmrmm%rAvy~KWggKEu3neQdi0F+p7yYtJ9?844M?%U~BUrNtk4{R5%-TKLPU z{ZF~Jgc&u2zB9`b)0UjCHrKgrgEb@@ELl@A#~tsyivy+1%*z4ACEe0h>nhK>22;E~ ziM~nB_xCxy*xwk~*WYoc$9Ht;Qf7IwpFE-z;*XGOa#vZw6rP1CVrzMe1Jy^F$bvU0 zgj5T~9DvIuVFbxcL8W$%Qgjaaon?W3h3XldQB!mB$gSYcL1%fprx@`{EDG@jSY!k- z5xF`eH)qM316`Z}{Xr%ANmo8`CC+3K5xU?39JxSB&XapUL%<4GU}{Kv!g%n5LoQqa z$p!Y30V*5Zu2{7ixHVVY`=L8?Ja^Gwmj8+u$y@ATKSjoubk!zGgLE zsJ5bA`z7Fp2@5|U<-6NKDIh;47mG@`7O>}{R#exsq8v`pl`i(W*M61`HSq`Tbdz+3 z$XQfv1Ari93Q}!g5|BcFC5XSz7qg3aJCf-;CY!@ z*W|bI^y$;0aZf&a*q2hzhykfOlGG`wnriuGg8Ek|Z&q6yS4*4hz3N%Q+n&|PGanL~ zI17awja*b_o7^#@VjLzR^89VSSkUxe#X@I(Qw4LTranSa=kwVtS)%IZZ8E1MGPU_-AZ+B|;+ilsx|Il_q{*_#h4v=CqX?qz%xkKh zqb@0Fve{6VRI5d=a>iY?wk+OQ-liV;Q0f$w1>)6B)8I!?d&Hy`RPD!7{=!f10x z+pWLTYT0fa2ZWc4*zV@p8LIY!u*G|+bircRQ0coCFQU-(t{v|vnHCIJRfT_ZON8(N z@E$7>GS`bp+z<=R*AXKeOz`KyK(3DPW%FGwp{D@~LRLj|wlix|Ykp1T07um#3S%kzwn7OQ zR#AD&u_Z+u=78%};W~n-=dEMg3(ivfO@rdj6S`GqK{BVYsPw1vA zYRCsyi`6-yuRFF6$QH`82GGO?nYQ?bN=3AzY?$gKCvA$CpK!tS1%#_CfRg^5hlZmt zFzwyq?rAYuG6dxZH$_r{LLDwo&o<3!PX*3lFJp1d_; zEAHFLhTr|NT^fH`gerGu)r_(mSCr*^v0x#zJ_;xMZH+0#hyC=>Dct* z$8z?x`hfv`aR(!fog=p7DSA75-+Ooz`E>|i(_n^newO(LDs5{?f{v;85ika6FgU9Yx_S-`~MBujV4(twqVon_S9tX7$^hn7(wo3K=Ih!5Si%hm6- zwqARL5LysI8F(oMCddkA`3Er6;Ps=bKDbh-U`?A7~7|Uv5CV9xS$JQ<2t-eBX+=ZqH82$S)UmFCG@&c6#lb z6tGZ63XRT9tqQ)K2vpicWMX>8>vfU@zs;93n&dQV;X@YM>8UOf64>uZwb({SQ zCbUq11}wvR3c+%pNT^m#x$^3x3PWY>P&vEA5jYFTVNQcTiIcU2KQ3|2LE+5PWru!= zUwCAKXP?U;IpjPqZ;cR>g=N8a%LP}>ybQ)#rexRF^bWy%sjNi?n_F(<{f>~T+b*{u zRtq|HaN>{&v++Kzix*}0?qr@|57wS+U?epy`oW^57rd#r*h(#F&r21eo#x!2`4Bf# z=3!SaJF<&&9jD}UnFXMK0p?M*YH=n&;-Q*zk@MehN>w(Ct6GD}|sxZ8J-928}qiI&q#wCUF^(7jAxS`R9p5hwQAyKJ3B^&KOZyqZJsUAe8kW4ZJ4 zszu)sJmytu_=Fwb)l&0WLHJh&&AcodlRs=5Xa9Uc{>Mrau9i`MVECMPdSW%`zW_(O(^G@*sSNf&?2VE*=7DN!_qyTHaxd>6#G zw@JLti+BYwtvknn_*1Z19SNfrrI(ZrGcqPXEmrBgD!f#bB%)b1m(*u~vLgBAyxbU( z))#lyF0MCb-_;WuZ?QZu+^=lxESO1Wf| z0#qVWHm@Dz4pIZ~aEU_j(`mu|hFwHnh&V9JS)YY(Hzpp}==TU_mDfPZ zc6avgHa9m{ap@lSHl#kZC`@Ep?A@$bQ7NQQY3H9>T(xqH8tc|f4hGTB%A3eLir>_T z#mO%1>I*LB{h!~Hk%}VXo>&Pr-BY#{Fac>lU<{E;ShKLBxF4r6sQ#qauPoNba@+P?Q)_Rpd{`%tz2 z?&){IzXeo={7BH2HK{(8&6t!)8h-bWtT_|)gYTx_u`e*!bM~+tq0=d=*uF?tg%O-X zxU1Juu@bp@;1B;oX8y-N|KSgR$cLo={+Ic`T>K;b7yHM*{mVc8@sEG}w|{y1$3OJ! z+Wqk#|L`yW)>6-Z{KsQyrumFSDsN)ZZE)u`^IcYBDPy|XKU?Iu*#I58CG3`=qT{u0 zyf&qLi?Z1u&X8IhUVqZ{L{nKvtoq_QUS1_r?k$WF{~=?!lo1mioPQ#m^xuD1G1@-{ zZSq4KcGM%B&aUOZ{oxPg&X`XB?ce_qZu&=oao!IIhsR-6E!JNdsjB&IR|qJmk#s@sYo2&^%^{1M3@P)gWIL+ZCgiC*#Rj2 z%TFz?fT-rXXWfz|ONTqigjBAJ;tTsO(z|q%-0V(4rMNrfAX^_Q^jqiThFEv`i`nT! zPVn`gm|Xn&>|JnjGI>_(Y|#k*Wk{>hD1Li8UtX?qLs0&qoB^1@wXqQ>AB7Vka9?}2 zek^k{XU~=dsoG&%)cZ*Cs1)550Z9p_X*PL`rk%KyfZc3a#IM?29C56NzeK_tP!)Km zMdXdnng6J8+_bp2WYdzx+EvF37}#TLA9FO2!4@)sMPRKUS}j*hNn31b+JX)u>?E=! z4wZGQM?=w~)H4;yJOBC3FTq*n7nrR#tan13{)*4}q)BI4UuR^eUTn7H2szHrB<71< zewUrr5a~tze!tg0>6KkQ{gUQ66u|MS{y)5W`GipIlknNIlYSKTb)yghr_FlGJ9Hq_ z+a#|lr*I?d^ZxBB%SuY~Gz44bmX~FEiPL~OYqGSbggV!&FY}vhqU4v~6Pm)6zJHZ$ z3dc~oZtH}qzlsrR9qvlGNXijygGv?Vn0HWmf50g(ve($6K0kWYJ^S!v%h6k1rSsnJ z>1+{3bier>qaXJBl9tC~BV8G8d z-Nfr4ctriI*Vn5{texri1AR{aOxRyQrbbVr?~lW$WaE=vy`s66X+7L0ae6VIAOD%` z-hX)VB=~P$&!#~|Cx7}JgioV@@a#daKkW6xAbd6*_NSvTNaN+~dbPL-UVXU={+r;* zljp1h%5MHPc*!3-c|PcZvHdMM56+VHXL7!#!H-FLv7WOyq~H&KJNxmMKe7Y!uNk~- zaO$p3t~!~6LUzW2{62%4IpM!t-QKO|SJ#{14;O!A&#Hbd`g%!|h!TJ=SRTFLO}wF)pr8K~{D)+|3VvPA*_v$b{`fR_u~-BjD7Y!>bp1J* zJ!R!mXAc>3GxkAHdh>&M{5+y5B+?Zt-=FW!FqkN+K$AXenp z>-Q z>-!fUKE8hW>n|@p1n+h*s7_#-9DvzLE)_2vboijZ{Ld-e7> zfW?%MlTl_HDsmDcKRT@jAUkWBPQRpxn8Uq)oVTSkinJyhEMzo%EQf5EU&!Ufp9s)qaPK~ z1+X0$rjpFcdGN(sVH+qc2nKn*V`dT{f3ph#wSAu7v5bGKCB2EzU(?DQN|^-xL^kKF z1f?kJirExFdm@H&t*#)u%}|P(DvN62_*?_gc}1k3F={2L!Y=)%UIIsOo z-=;k;%U9_9DYay8Uejx5wqivI4>kpWQXfP2NJ$p~An+!=da;~Q2UtoHhmJ_L&&U=^ z<12bopY>=86#88;LI2n*dL~%>A*+D$kdXK%5q$zq^MWtVC<+22Qge*vw~Ysk*gpv< z70{e!llPA1d@Mq@4+*_3VvwF+AIoA)v2v1OXVmRFdCfu$UKdeI2ZQAEwI~rNTagTdXdD`eW>(W+%@_L(Xp8F1HxN;xyh9xMr5(>sop~- z(CjvlH}j3sRk}HFoC@e+{rw@hT~V=ePHVQQq{|;!z2dOy$Onf3UYXN0sqdzR1Wo)2LlszPL z^*kZU$l1zk6)HL&>b+b+ZA%yMqFch{-rYVNED20*b(<&QX$yCR-90GeaonzL+&v_` z^>&1@HwP}S(H?Y&E3PcJ+s(hMwj1(SYpDE*TKc{MWHO6p%ZG7(sloL)=Lf3ZRW^K6 z#jRGK_&`qLLXWtMgSf!l138CF6>R&*a6Z%n!dknBaEY%&KZ7+WSZ^(yBlk)%86nyz#m||7g2? z5V&fN7|PX{U-X=|spc|EE*8vXn0c*{7ARZe-WFZ=xbG{hX7Tcc!Zp)ViivNMJY5w_ zk(2jTG!)Vdvb+&Rvwy$jQ z=3kBYx$>kVd09S&JQMSM2)ZSLzMPzcV&x+G__0XGEDkSQY{kXFE>fxJu};*zQ*>p~ zx9%HOl2vK3ZQHi(RGd_7+ZEeM#kOtRuGqGXb=QCI{c!HN=i$8GhrZ?*y|p<;n-6QE zkMaG!)!hRWmT@B@MVxWl;uTXf$){p~$J$~5yFa`q*`f1+G}fX zLB(I1M1?23>5S5Y>y^p6_ku^DDmaTk$y)&klHJ)y8Bs|!x z5|Qbjv2YH|4Gc&tg+hG$IFAn$W@MzsxYe}P$pqOp-8#SK^91#|M<)I8KdIs~Yv3k6 zshuuJv8lBQlTSC+%Fv>flaC}AE1?SeH3>~Y$AXMW>d0^vXZ_J=ZpWaeFogh35l<~3 zmSR|vQ};F=7{avl_$e8?dfx@6R6716`cPMxM;mKFD2;vSGX$*wrnLk`X+gg2PcqhD%1hU;YR{p!Dm?T)~u#tM&BR(Gm8VV54l6^37zq z26gL~uEa26m(lfa^Qy+_VCX%nxD{N=yZ(c6AkuS6aK<)!+N3NUtO!kHgq|<+TI>!6QP@-;KuiHG_09qJ=dL!Q{7Z#b1 z?5G~+c4CvZ;r0F4)Jn+6-eMO4SQm~#+drC2oniQg^&(ikZz`) zoNH?{O$*Ib4ECK%&0Kf{U8se3P~|n&b1}Es9_fvm&1E%qh#x}Ax32aObKMC#Ei-0o zLBJ{nh^2Psg9f2IL3?w}EQGzEsc#BxiL%MFHp?0M`DuTBHGEG>FRgV(ZhsNqj`jg| zaQH{kx%MRET!e-jbT%z4E(9VBz^{b3wOju2?*HaRzd#%P-F+Aty=mt}ppCI%SR7lS@Jc*9ZT_p|KBqp-rCtHdyUPH%Q{eF#s}9Of(8Ms^ z?h#(Gn|w@aObjLKpm`?OZBW(1jnN|kq7$RY8b?;n(EXz2oS2GEhMN3ff<+Ro*l=lb_ zL&%Sow_d7k!Nux-iXf0vwzzM|8wF-rR~C=V{Fr-9vvOodrcoBRku;Fh4)x(RDOZK` z3nHZ|O(CEV4eMEt6PKOaZup+J4xVqH2v7Y5j?8B$kE=f;;uqd)UazT(QNoxXp9tTL z(4?OT3xwIST%JGxzS9fA&-c4hO3G1xzwhaJYQmW0`V)7--0m6isa)#%u7ak5Sq1;* zoLSh5&Fwm}r{XxnjFU>jM~mF<1^HH_i z(E?JN?^K{bm1qQxwvzZokoN96OO=TB6tX9$C!6yasU_z^` z*HwqK-3+QmH{&$Izq1SS4T35GL#9cC>V1b{miFB?AH-!3D}ercdXx%fSJ61L+AQ2> zr`)rkp$!weJk8-Xy=Mq<-zcR_@Jri{Rj2*3BG462aHu^vvLRNvGFa7w7^l%qwl3Vu zce3=zLHr>M)<0;+Q`rnQ$GGNxN-^;USg8nx(;jvb<6==zQ`7XO7*(4U)kJS~xT&uD zvQK;>$27>G&Tc=D8VV3WS)Tb$4~G^P9y@;>siQxQmgf>wCqZwQaikzx(}evyyrZ_j zI;fkW%ic$OR9x;XUXFU=Xfwzi$D|}cVcn1gkEQ;qJY$*x81uo?$pULH|5I#ozq%LN zC0ygq*(#n}Y@%`Efs74K9R9S0=x&}uH5+UOZq-?BP*-!ii0LCsv; zIl@vEd97v-@DVsCe-ux5>21!3hEJqUm+?`@=7eeIqg3EBrnWop(I%F%E{yukL;~C` zs#B;2oR{3s=v>WC@!Iynm7cNfdgioIEqpU1O3!#U zw4h1Wni~hWKz58r-!B6|aXEC)iH7$un=@HeoRo5ATt>ObiOmJ8Z~x2%OnbPE6{0=B z{PDb@1Cny-KLR^ekiafsa`Olt#*U7a79_BXRBN7xyLbwT)l%p0382=@eR}-*vtrJY z|MVGI)AmO2tI=3jiT%-B2uvq7>Mv~PX$BPgZpypfbin^DjK^fA4ys%UEUzdE;B8nQ ze6QU~bm@zyd*`mdkg%_1|2vmwcC24a^Pu)&`OnMFiP7&%P^fEBk92}vON%$-^vk{byq`Axa3-@g#vl{;vVwkNQJ~6Sa zb^6|8@LmpjXKcLACdbXhHLuS6r{3ZBbo9HvxUKPWCkfCg6o*M~Y1&OE*8~6?S=knO zVV;E=yp#{8ofO1HAUX`;Hyoc_25GHx)@EchLmtKVS_)>qs)v96u=(X)kNH|Z6v@i) zj1PHX!cn>pMHT5A@5eTUVbil%s6A=CE*O(WtL;RThD`Lo<9o)c36{*ehP9W4L+`hH z_Q^CazsMDSV#^e+sp_niKgYj3qf=%EkL(UzyzO7Fm_|2l#d+{9rp(=%@%}CMFQ*b- zOh@H=sFrc@>Rg{l&mV6d;yG(H7Yb%j;aFU?X$K_1TUQ;5 zWHK74GIEg&rA*e*qtNHSJ>ziNp z=$B;vWdjb+G-F)OR;KqHqbnC_HcYrJ@yLSAyb2F@p7SWVHIb1uLY@DO*plp7x~~5x<3DVIPjv({CpuL$!?*hx6mbHiOL4jKb5@DM~Z6T7wGJ3A~Pv_hR!7(5E}%jR(S^slR1^)-bP!_>K@& z`-uuYxBV{93NA=SPkVsw+`|Bmq#AYx<4urN7%(GVwuFzcV|k{o^^S8UVz2%G3C@Sj zpfED<|B~m!H@zspC&+U(|5n5nb0SDo-;900OApvPPC)$)e{PKvroa4$l2pmRn?y?j zp%yPx$MYE-CyM}@ig1k0q{Oj|+sspJ3GYKL{GutN8f|smLa4Kyq`#D1@;e|{LR%gu z2Kxyr7@s71K07AgC@?e@YkZ&aD_}Pgky)vMg3dE9Zuv24PP~=)vV>BSGh+nemmbBj zB{qSr(ILkgvhwTWF*?6XCmuo$%Z&?N-lUfWSHL(M6NbVOM->W-nzaW}-8c?Bd*~<| z8=8a(KOPQ`F^)RwyfHr)M$>N`T*T6PLL5X)=GdAj(|VA?j@xUnZDs-&gk{^OlsgDi z#`^~eK@494-Y*334nFsJifLOOMcoy`bDUXiAQYg8dqeaW<7Qp9IP#-& ztDc;=-^Zc+`@k$wjem8%8Se1ThObE;Y1K1zC2$-ch45gqXVNTC{yDRTRdcO+g->$1 ze$|n0+qvamU4dxr*J)W?MKLUN`^$M$*)>C4Y+DJsz$=fj z(g_w-jQZh46d+eCNTICd2h~|w!8Uz^UWYD~1ZM=g7Z zb7<`6-z7Jy8Z*N^>!+yAT{Oc;m#^h&;5Rj{R_ew8lg);eZ1k7#VJQAj3Eq~3zgoY? zK9q3)*c-ewN)cr2Vl284{{uj6byT%oDxf=>nO+54d-cD}nZ#JDrRt2PxmHDTp)e&n zJ}Fronu_7N#%Mhti6kSSQq}{4%y!W;h?6D6AYd%|`&l0Wv#>Ic#Ql&>ySvz)A?AD` zMDe38W{aiW_peHdD9rRlUcq98)Fu_w{gD}YBK-UXcW7)IY6tAx)o4qSsBEU$P57lEh_g6b#?4g zvv!2xKR_9FvgKA1>ej+80cp6iJn&~!h$z4-idq0C_X)TkTK<7C{KSPc0bo6^V(iLC zQrgPmKTMgn)S}(4Pa1OMhLtwl6eXTT{;8xxVP=iP6tneqfM@YVVD4nRCbui>;a&0z zrePnW;T=t3tc_c8<0-jK83?80;pe4}@pqIBS@KeM59psU10d)8305EBPk(tIRYcW7 zpcV@;g`E-VoQ8v51EGXonbe!+sp3a0#ONc_F=FlI3XS6p z6h6;i9%{Y$;i7EWjyr~XO+&se1w(;jKDcXKwtGDLh-XR64Q4koU;+tR-4h_t5U3b+ zuMp;0qSS@1kdCwPtoS5b*gI~b%#mUvL3T2nuUr@&3E;pVYm69=%M(E5f!X1_)_5sR_9k7xq)Bugsd6tVZ^x>4T1i{HF_mFaf$*RH{G|d!_hN%u(Wnl{m zdHTkfDSsNigOXIOn`2?z;TG0LJCk($=%>`RK!e_#{vpG3d=GTbAC%v8jgXR(1lgu; zw^JbR^cjd)%}JZ!3<+dXZ4ifsser%IGCihiA|%KUm!m1LvJq85B_Cayd*}5_+YF}7 z6m3sZe#SF^5O5Ca>MP#&*ZmKvsG)%r@QIbEOW&CPn_Qeh+)w_)$izD9=_+$&rh2S( zHYZIs!F{${f?^%=d1J7;DZRW}Ds4u`8u`oJ+D&KN!-+oHJ2kB~1dz0(kdfAO73k$p ztbgIl>@KyH%L(!LsRS^Vnva9&ZZ0`nf$DKpAo(~V`wb7x76MPuGZ|ia&)T5s_l}M> z9%xpPRWfgkOIv|0s}TNYovEnYLBXj3l0@K%CDf3uxz@%)pfv42Must2rYhPKMex- z`u>VsN#e62UmaJzigTi-^+%HA?_oSTSygyB8MF)I1)SD(o@`myZQZ7c;d458?*`1)8g1~eyQsE70{x65OBmX%9+ z&ebHd&&yQtT`LL|T$lb&Nf-YLQX%#E3bSL1c5cOgZ)FTL861I~zv$sQIJ`WtQuWQ~ zFHU1F)g`i9$`&zP*9#PMmMo)qY?Vvt&zr>mkI9dG`Uy^g%vj*1EoP-@M?^Y9=pt_M z%EN~4)4h>3jWY0uSFs8y_aA-UAr>QT_C}fVScWrECw58^OB)2U!EFc^x&I&NO}8drk2B8ouvRDL$aWtg3s-O z@4;igomdZ(a%u{vmY9mwUKiV9x@QK}R#GC*w2Ch@p65(YMw~Y~m&=Se7)ZOz`nh_0 z`J@w(QGI%!yIBTEX};UUp%h%(YhC@?cG_aKW27 z^GYH{^2fQF`$tvBq$>}dpdhMZoi*Wh9lQE=?PSxhzjAO-83A=YWWGXRINIJyKw+g= z>Ii=+hF0omjx$ZcZBYOkDz3r--K$qknLv$>@>Xr(GT7`<1ipcOEqqXtMl55mf@YAp zhI!h9ZNH-UQ-Z0uYi|!me&Qf1?|#?yox?)npJjI$FF}CDjlz!@C#&}vv0h$H2p!fG z!z31M{#d7W%^S%}t9RrF4HV^n?jsW%vSg+dXpZnk{r3Plb(~9@c01lIU_3qIwAz1wR9JSFZbh`vfZ;C@?!7t+Q zaZDMpBT5v5``j=o=Tj*d(xREHX+w~J%AOk*-=j<5UKJTu$f9zfA&S4Sv^UX|KE z1-v{r)ZEh+p_q09Z(^sIQ5WhR={b*z@5#+W!z88MC}wV1xcwipAeeOGf5?(~(v;N?-`&eI*Gnp_b>(9tH&I)Wq}s z+-5A|k|QcYqnO|veIC%KNUo>V;rEQ-c->fw>pg6hW(hG?uyC1^Rm&+zN5;VT$k8|5 z*N3Ez1IVPf40$?0jKO4ahP;p9KxQb-dT^Go8I8@9waiL1`y}YojU`TB>-!Q@np8Nt zDsABRxOWu_9?i|E1dlufKdB|zzo;esK;a4s{i9`N+V5o28&L4xHRHcEw`4As)nqP? z)q;+o_Sl8AfYtD{<>AV-rODATTZaK>X<%_?QYR(zC8hbr@zR)}V)uOO;ql>C#BAJt ze`Obs#p&_k^(>6ctcIP!wGq97okBYflaOx?5x>!m^`r9{!E67gzrZwXl+QbPwkOu$ zE)X>aMs)34RKVpqSC6mdIX7A%!}HxCHZluUZiI(33s7chE+W~B_zUr{x$b4w-jCb( zfs4UFip6~(SK}g+5Ow6S7o<>5&7w$q2p+*xp7E*gXxAe%Sc1ZFaX4Q4)v=3&?CP0- z_ME@y;W?V=-}9B~lkX8H!jM@U6uo+6*|k=6a=3Quls<-IXrQe~@JoG4N7vLC2Z};D4#AKz>r@(Zzau_wBS`Hn?4aVcjHooSM z?ACj4#IVn;)rca~CxB`EEzK&pOb|M}nY(=cwMZa|I2-erz@2%lU#b0jT)Li(SxWD= zO!@tUbv0a!G;os7;pFirf-c;mC#Q9VVY&emHjq!D(zS|6-_AZ#r_UT9dB(rF*i60n zYN2DAh@gXE+ey->!0nB2y$REnRXgl=eA}L>N6$ECX$QFzqc)NYlw0}~6Q5R0Ug~NO zz?uPmm({)kW5WusKX--?_JQ+Kuu9p?UWuA?4)Gu}Ya5uOYs}bKjCgOUqj6$;011jY zTsy%Cv`hjpEi2R56T7Vdb95?q*a&{`8*xx-9SAbV3f}q#4RsA9e;vGkhjt`gae#*8 z3ZQgnEHjtfVRYvh=J$$YCcFbrIr&>8#6p)-WT>Jy0HJ?xd#-fip*sOEkax( zhM^7vIdT457;pKh`7l>Y^H@2yTPDc=M-qRR}ew82qhW zxu!?@_(P|n?bj41)GGAPv9Zosx!@~+>SHc;VpWwlHxv7|QkW^DwM2E58_44HBWIeb zOoxOC;d;P=73JInHaeJ>Ogkpn8(zfN^7E&y1SB7LpfZuaaOO7gs6d|g9B{V8e@q$i zl<@JS@r>|lel9F!FOQY#=8sbBq^p{e*f#c6K#=?vx+)ZCK zo8~B5>Z4r2P1A#xzKqElLbm$jPpZs{V~M<`29n9vO3X&=MXcc{#BtMxk{>sZ!{#J! zs^0uOIm_OuNK3e_XBOrgQ5T;|E71i_6+0hm6#ocvJ&Y^s?=gWWrO@syKVO85J0Do{ zy_!Av4K}|zqGO_ptnJvh!$5V<6`d_~9ZP3>bJtSO3$ZzchkusaJkvU$4x4@U@s;p4 zKku{-<+DphtHQ&xtCOJI!w=KcBQ?9X+0MCUX|2Pqg^JaeAd0!Lsi?ap`!*%OQN+a~ z9e%1BTnHCSfY^nL#BVCxs;^`w@_Uht)Qj;s=UrhW_`A!I>PRcshWUmyo z?9SJjUX^}?Z0&AYp1EAkpp(Wr78_mu*I_*4Ib%SBM(`ViuZl(;Y&<#Cd~-jKhZN^IHfmWae%b_^jgh}d;-Vd_ z5akf=Sx*F0WAL+|l#PVV?uHHBNQO`WlBEAyaiID{4` zHI#GBv#uxEt8i`ZjQPDQj?UqYz{P;;_;mm`-p#g_zw|W-X1q& zjmoyl>${I?aISg1EGqq`W%AoDO(AO0(vgQ=p>&uVmR^A`(^KDN{UAvH7RJ}DI`!~q zS~dfa<)~h5QetV#z7Bfv>Kn>DJm%BtrTD65G?t&{SftfB==nP>K$ccSF2LSCPEd}+ z!+xPzV{y7vg>QeeRF$3abaCjHlF`g53+w#*$a3*SG7jN;ys4SL0?G{d)^v!%>m$QT z@Oc(_9ulRf=&xuV#bf+9=;zOeCvcu*&Vm7?P{aa^#=R#=qsdboIEZ}9_naaULVvYT zObc$fpwkKp&?;o|XUYxMIeL>_akFJS3{r@_(U1LYsG@V6;+!Aw-t&A-}$lY z3~LVwdK4CtMHL04|5xgXvu>5|y0LEBfc*DFZ!*@E?@eOZ$LSl;RKv82V-%B+ABY%M zs7!SSbl{8S0bxQ$5rK@6%jlb%-%w@KZ?&hTUJx|4x2=tY{^N`+CIE4BGy)i-mpA1; zLCM?l+ed)$+cW7?4q-hAi1#)+GU2PGDEEmt=3wa~zD~E;Z}FaJ|C+(!k@TgX z(^`~*`)V_F$v_0pg8}0^s$EtXiyNH*_wkvRRQ`Rg8*A@A%aEVt5pr(=Flcw3b9}i+ zsX(n&;-}3LTN?01G0cGQC%2jP8Q{27B<3n&4)a}MetLeZ5Q1#ze_w1Y0CcrxfkU=x z`~rksR?Jb}7rH&G9j18jUs2VH@v1NDqwvM+R~4D%)oR`92EaT zw4ieS!^`UnQJtce_yc&!rZ#$*7*Q;scFs@N0WWoIq3(Z}=vVxqy8I$xmKNZw02iaV z?aPt{QNx46mB*?G7pM8{%aQ?6!;iw3_n-);hb3t88rb3L`itGZE zC8eSPP-~a??~1JcdZcJl0#ZQTh4UeqEvCCd`&0Cc2M`OIP>`Pe3{LNlR-}eIVD+Wl zjbDki%|h)?&DI~QhD768a6Vkm8$RfZ@mw;&1c)15;Ajrq7b1Rgx3BX?d*}jd- z;Ib;bB>$T&klh9&x}DS7s|;L107N!Xca19C%=|C&rM<069B~Ql`YdhYcyH0-unFh* zypfN8Qf{*hxw=5$vrVHHaASFKgPlBnnopWP)+iR375)x%zyk~@0DGgtSbF`(+YCM* zt?GGpN<0mZhu!2An)SQ3bSWq0YZR`PkDTB6EtNS+7%{4IBdg=ipY^dIwQ=+6ke04? z)*;fLbeqY-WWE%{m@?fcNYqcSEbnx>?G|NDcKo6* z&lEDdE=fCARKuvdgJmA`FPs6ADJ$P@%YU3T0Y>z ze>L3l1sAPnPof6q_EDAxHSg88Z=1w8wAGe(2!`~#TiZVF%kUB}ALy<}3o>oEmZhNQK>UmE*(*@XP z0Q%0X7br^4t1SOPs^6qA#9;9I6JZr{YX%^{ZtvJ~E`Y7Vnrv}C9C0xB8xXqHolxB7 zKGUF(bQPv0{hPPEhSFYNCCh@lo{UDbH*S!2vgj40;B^Mj8U4exl=w?I zD_=rEh2d*A0} zkj38=L}etC;oEc+{21kfmfcs$HS~ikv?O`Ue3~~NUMaub%o?;r9Mtzn65*ePCZyBg z2x3l}y@rt>xPEDID+*a$BZ^T0#M;Gu>{2b`w~XpsY*q;yHXX5rz&Eo?M{3h*C`7ky zp4w<-a081Lh>jm#UX?63G|7&tQkIu`mBaZDw33V^wIY_yRy?lJTMg621avL}&p+MQ zE0^#-L56sn?)i1~-?^LN^2UEZ1qbT0fZiwoiR{nTs8NmY3zvaxh1Fbz*Piko@5oYS zU@uE0gxvE^j}@?(x*r7B3MxhasPz!H_0kt|x5LDxUy36fWL|3As)y>bEI+ul6k^D? zu#!SpZzMaZh<0;f$fk0vD-d&jX!zaAhMmQqo^}zdQ!th5xdsLyhe|L#$#76;;jwyr zB%wiT-bk(o{UtD96Std5f*<}vj5jlHt~bB_H#C&8^60Sw4Eqfuz6@OpOfbe!1HBQh z6(mu=O*h}Vq`LY`(=FFF&?*Ij?F{%s=Brd%@ba>k*YkM+xYAB%C{fX#O|fSL0f77$ zDfN)dg|MN>p$>7;Uzv^n!m8bXvn5dm;?|5_ShYbq?@=fqHi;5)7W&?3>2iglmqh7pSNru z8SIpVxpO;{!C)6}RZ0j6wWe1FUx(7-qlbT59sXXp^la*ObV=q@UKsTVqDTEZSin+a z_GP|$qh`5w?1sgyam}7|7wm+|1So%#7jHHa|+>IIqIe+mft48?T zdiaB){X^BW2i9yH*VsOl!nrw&1b%cEv{2WuRwJv*PF{O9N}sK@_r&NmLECfBQj~Jh zh28&tWf!By-nCl`R~`393?*5rEuy!pljwzmWx>s}XPrSSd}`W9%V&czdGnCObx`Nw z;0T{UF7J04f`ZMn3*;110WoHO?(z6W6<#%+o^W5`E04Bg)! zEpTyj!7RUyeBe%uXAsNeQGb4 zvQayQw3r!$E6}5mQoo8FOA{SN=9wR=Ss)yTj`i(JvH)i8p><-fSV|7{1|99^vrBMv zHC&E-I_?>!W|`+>f<=`$$PH8Zn=#jNp@ti8^_GV712qi5jsmC7QxPiQ#sm*Jx9^VV2^7A&Cj3 zLi2yBQSt_ULVYyLMIkL`cw@wywkXJkTIQLXin4Sz4~14}^=YP`%^q5p@#u08zpiY~ zTzhhS(%t)GQg|@I-}lsZZ4L5AexICt8Zbs6i99zW;^&Ee&pL9QKZ3ljqc0eJ-R2=P z&U+CkWWLiJ=HC1-57*Ma6$=VsY9WJ9tV?0Uwp~}C-7@%hGWa36R~D}m6138}IROTD zZqD=u%c!+yh3kkSEj3mGo=7Av9im(Y&l`}H+z?un^!p53IZ2&&&_#eAcPNZH_R-(V zNs?;+{<(ucFrQ^7YvNpVSKwP#e$aSEjMi5p=XEV$g#(IPV5wfD4(i2I4RO-!ugonr zuvKH%bvLN9En09CuP+DQAxRuypu4{vI#})BL2BwXf=F)uR1ks(o|en z@rno3yw+w>YFwd?u8r%UuGP0Z4E-&=@8%5Q@M#`SUU&O2ZjH3{d0RQ~nfA&s z7B_h=I2=(d&knLKzWm36lRF8EPwd_PXP4RAFlrR;_*(-h#rN3>+tJfgaAo1&IaDqR zMk;00!LS_^xM#C1htv&>O^As3l2(D0VEcEjS-5TSGokPKhX0Sj@uEiH<^JA^U{8lO zrRJU4(eSw@|I>;;TkL?{m-`*jMQ-D?VxtGDe??Di+DpBM+#4Z`@$fh2^||29u_X#n z4+Gp!8716UWKhTlz&gT|q)3iM^PEF0(K>>c=;vMXqw3wQqFYWW{p{boOHy$+!vV~u z2nW;ZJPWw%qSU)~ABN>1rQ?#$Ae}2k+PkuAY)#AU+H=>GY$?SCqlRe1E|k)~WSioQ zqbHzs7ymejWTVjJBEjtL^YrfEebG4!Q}g?i{=u^rUJW?Zb9!cAV7r2Oq?3$S;vbRL zC{8ki>*o%tNncG5f3mDiiCcI&XOQP;E%KpXC_4nhOVqeLrEW4Ll`U0giK@Y)_VH*@ zavoBJ^`UOhQdn$2=VdWCm}J&GhH!Cn8<(mN$YI~Sv!yJA%OonK5z{9n`zbMtYctB9weQ30@%lly=PT_a`Ze+yyXOETRCwR|^2bE%`c8Wg zzo-6qJ!2^$wswC~>4A&u2Xbb?AH53>T5KKxLC&#$Kw!k&7&d7_E(@T4u_xVL3FV9X z#J?~&(={onniW3hzE_xcJnN&HqfQ2e%hWYs(;m=JGNHpe{U|ZArFN%@0XJ}7aHiu3 z+ev5i1Xn8E!Gu^S>^bP9H}{ss*3~$HYvuv+mkfOt9v`!7swiHjdUNXeg_Jx6Dy65F zW}@N4+S{;WtlI}2dRR8>)j(b$^{`1uz9Ig(Hy8=V9(^3{ozeU$L4V3+p;MW#ZNusK zqrj7_sd`IF?6Iwh@Ta{kJC1mpCt6;L`b}*FQL{cJW_nl##eB*7R0Z(m&WrVb_9Di- zAhLII+Hn?=jGouvb7;DJqu;e=Rig?#8FP37%tbf0aoMX_S6br6Gvw00Zub-4J(@-E zR}Br2n;o2iT)onMdS-CWj*0WV4)!jh426yVLMS}rYr_=?8kQatEUE7=|8ebAg8X4+ zzvFdl{?Y3t&d>LdybG!cXz{AHY5{dBmv~>XK#t)-QvZMw2X&Lcj-=82Z*Sih;;HmN zL%+d~A6fN`CW1efGYf6ZFZJAzsU-KNn>h*tfA~2pEmw1`p8vCoUapp3x%Fwgxe6UH zFKn5O>oZu1$`X!H#^02!QV}D-BcO^&9Kff~o1);fZDfGv#M_l$riLL9>ig%`Jx7+C zyaVH7u(UIYEk$*D<^a}4qxJjKx2s)%DtQMb01^FU>HaQZorxjoNtl@bfx_G1=aZDC zns?$PQ*UG^rT+HU``(jL)#0QoOQEa!zWBL2F?Fr_cu_0lz?7WR&0j=0fKo!BmlZv` z0=E!n<>VyWS{_5lXA$_U3_5m3K7%RWr!D>tNidfA`+nedc3-yosmWLgh4|BWD~Uu=dO8 zbDc7-cFW7lQm>0^q*u1IW~RNEbTcC!ED5NJt%4?}!&jY4X zv038myCK@)H|Ab3^HlBZ>s@Bka?yALM{Fez$WlU$zKxy}82% zUeQKm4z*;Q*fpNkb@N#hB=t)(q>aS3iKzor`r3;h3$--ql14lyu)~hl`-9et`FNr6 zLAH&5uR4eF&TGNmy{IH?>(DiM_{6l;(DUmtifJ6V&=Ogr%Fw;@BNm;I5-KEPyjho81}uZ_GG z1kYsI30JEH884NVTuvF@rwLhs?k69^#-L@9JjM?oU<4lss?C^x`%hy71)M)W_8!eJ zYVY0XRd3qf20hP*{8yGgFhKW4@73I~yPY71xjSGspZ;raStl0{+VqWb>ANpi#ZH5E zxDsR0q~P2U;psi1%Nxuy!HM2?AOkQUIt%nup4mMv=fDr-n@4mlh7!V@2?qho(;~M;4hAQM&c42UzX3x&;flePb^l&OH?3! zib&2`CCVNPYLJ!}G~pSLBIqdKNLc@pk8n@NR5g?2;>+tzCu_J)c*y;?D5sEPe6#X$ z5oQ2bsoxBX6AhG<6i7WB4VWRBoz35WC>8fXSMtVD4`ZnPvr~)uXT|k8ToV65hTK(Y z_3l`9ARv5~#Ki@_RG6aOCK3AuMUPzDkL$vwaiXW}UsR2m?Tx^4d+o!Ow_%*@r=%Wh z-uO4?CG8VXLht)zi_iNEsJZbq7zbCIzC06@KNA+wXy#>SEvx7JGu!o7Xg!;uo36CV z9?O;Le4`a*co?^~6e;KJT6lwQyPT+_lyV>4C_HX-I^6bV{Ja{Wy>6@>W|nRr)?2V6 zQ%GU5Yn@~M6to;#OhOeFU^$d<5#DTt2;v1s!`{E9-fjaj zk&x@!e=L-(KHtkw?$u=jFgoVt0s^`38%ISr2SoaD6b(kKxo|U~uydNKgKaN=-~u*H zB9H8o3X%nG;ed{m)RUq)RYL?Q8LW+75l!?#%L%5 zA&;|Z5j!bV0sx9!&<%6aw*j8#G9I5YunE(FDBP^ponp3Q$}F&@o*2xp@Yrm^Azq>I z1;4otZ?Rs{eSU-_=bOj|g}@V)Yr~~))Tdf{FujIy6frws*l#wp5Er2U{=1SHkue5N zb0#Kg;}M)pQmbObmSM$O3EGL68&dqALguJ64UUc@?tg7XL_Z5;%E$nV%IFS4QcrRw zAgVxh@rkbJ$~l~G)F_((?L=%>+liFrCft9zuOvfDsQLsdVsK zmYwc3~Y)%9dlg_Z1%H`+abrU`JOCJ9dmrD zoZhGzFJL4O9etg?fG+P}j_xpMIxu1j<&Gxuzc1JlTuK71hX0i(xHO;SM^z7!o}JGW zL{)FBtnxUkWp_62%+0LTMl|C(JmYHdd~oxMkX&0`aeZ)m)$GMu`(=G?UjCu_MJbRC zY6P}5?y$zq`1O3PeDZvFx|>@cUY=~FSC=>DY9iKJ%&o4?R(3j>9L*nHXDm&v*&8}M zKU~zaV`XH0b$M9;BnUu*d^I?j3)0S33G?P?g<{#A3l@%z{auv9XANgS$a)c9OkTN`iuIB4v+j*}-N z3=n;}=n(AiehZ{ywh5}h^ZlpXV|&zlbKQ15{B<`p^Hm>_lq(}JOSeVn+j-aQEctk~ zeR2|cs_unY7|IZ@Z~Ee3cm#1qm%P42up%YqOC*Vm(R!&!2FT}={B_!JQFmS+K`uUk zLPP90u?>ck=b18BB`5W_fiphT!-|5h85Je}5>SSmu>&`a5E9J9nNn-(8~yfagyTw$ zyBq#tPrstQ8K==wIsq4)(T3TYTQKgrz*d@MS0OG!+1c)PmbC8W0o>VmI)Cs(m32)b2fx`&5(^*Q?P-F-h%`;52_R~&B5O$4#^QdR7>5}88Z z4U&5Hf&6eV*}xYC0(YSOHO8|5Wr8Mj2p0wd@{W@`4d>hqu($id+YXm=z&8a5h`VX8 zCr@yhNirLeW^is#XDiRXuntQ-6~okWlBPj@s$~>HAroc@7)D%31$1p{fn)SR{DO$O z(c$vY94QLj+fMKQ-J?~GLDmU9Mj*dOYT+Z4a&hLPLesTL46C&A6_Wg=A;NXej0)xl zmWN0d6BGDJgun=fDegnb34d7~r%i>A- zd3i)DJErtRq1CD4Calf?5selOh_TsEjEHOU(SSuYB>75usW4c3){ylD=kR+&@Lou&8Lw3TZ+47D3ZuxOnZp?`wV$CD((0Y@hRRyb9doiEVeeMW0QDbVHAKdUmJFF`cs)+d%XZ%JuI>X z*tnk1vs2=JBf~f)sPNqxwNkl(?&`B9XG4#9m7pO6Z%PDT35HeHhgr=^I3cOkk0D40 z{kVH=gt0FH`5W`G!+mE%@en zG^Z%q6886G@3v0_Gfy*;I7N$Bnv@u8hOCW0v*Vezg+YI+&v&eMAQ6Ao^OhmaYVHdcKWAIvUfvs9S_Vl~%5C=4@zG9Tk6SsE8mUR6gR z(klERdO8hfkkmIH(0`cJfCspSm&ZOO|OtSC8ZX;%R)ei*&9zTjL>vsyXK0_ z^Z?~_Lx7Abjm&Sm1}Lg<&6akYJ*$BIT=mGj*pQA*c<0{olaKg8bJ>QiiiF~^;Bc~= z+TCLPs;&~fH_G*;fE^fCyNZ<)&x1;pDS47+}}S(_mXd7)js9E7D9LF^p_GuPqFFN5WK3gO7v$e>tX+JHmetMS<*&}KiJ@Vo-&@zp?|J|$^J8EF|x`U?E-!#4e4D{ zW;#D5$$E(`)AP4;*pvO801#1lAa!_}CqKv=YNh@%u1e$zz?!ew_)%uy^!3jIZVkeM z%S(RF^;~L`0bj(5^2{UXFtLp_lf?Q%sB{c~CvS@{O`{l>GU6h}PmyAIQFWr;ppqF& zg|8>1-vqu?`p8+%ryZy388pRRv|u8@X4{z^4c_2a<+R_=|QUF>ra=T-<0{7 z2L;x`1<&xJ9k^f>Wci*3=4F9wi6FW|q&<*oqEG_;ciLD9Wvr~M$w2?ST;PZ1mqr$; zs5nTo4s4fuZOtC<=rg_K%SYNneITz+E0N`~+pTCOvqa3GU`$m5G)nZVEecC&ZQx0& z+FC#+Of3N92&e%9CSjxt1uA6d5VGuND=*Mb*+)KQg{&x`9x;OoQB zXkSbRdZiz%2C#?V9he`BMRS#8l3{`#T#s4>z{cmvaHg%}@KeMoR|2v=0 zy!{^|VeNkb5b0k6UnT1mh1JyXvg*Xh@qx^4ggG`zb5Bber@o+MJveR3qInW!c8-Z7 zzJ#VLx=@WPY6su#Rx;z|h@{1No~~|oc_R3V^SR|;{G&b!ua z@y)r-KNYy8`u(2vgg&A6L%sbuAb1POqwLck@@WDApG% zSiSP3sHu6?_u5cIR?rWWr7b2Fv!_PWDz6GRJ0i9I%PtiURGaBix9F(rl&RCys4$K8 zo5~85yN0sRPU_)@8+w_h@m|qd%xjOQ!kQM_3dx+dpEfhub1PL~J7kp@u`b%Gwr{z$7z-UIA>zwmJ z=t1{K>sP+IORn?y?w%D{Zg&)`ulQt!z1fp3CYy0-veem3ZS$D! zZ-|t)#7gE+QO6U^)CPV9Wc3Q6a7qs_r7U~W2oiRqGkrDsP#xY@^f%ypR5GW!Yl1Gx zbX8nU9n%vS_uOc=OPk#tyV3eV0ZY{IZC2U0&WBcz_bSQLJ-D#~*xHOl#pXY*3$9SYC);*ma^CoH0s8E9cn7!XvWE6kDC=O6>mLSJ#qUA?S{b8(^BQO zy%w}yJRCZm;3)g#&$btZ{n=q1J+!avDJHr9w_=1@dVp2;f3u+H|BYsW_y3NO9t;1c znrV*cKNZfvjCMP$nX;RUkS_e`UT_7k%vPvnvh@nE_ z<&qwETdJt~Nq<;>+h+O2%d?kfG>B8o20S}0z#_E8a3c$|tW`fa=Nj{NfAQsgwL;(ma>Rnj9I^c0eW+WK*Gw zUm&?Syry#4MTku)>|Be@s_L9BpVhca7!azyaF3>b>}cvmn#6h1Yy$14EHBYd+XI-k z)nHw&$dMe5~3t%84UFPF>0B^$4=lG}s=F_Y}_ z2l)_CK8CP9R5@e|^y;;(?RvNPR(%R2we)i7OD{-!5<@J`taC*FJ_TOF_l$c(eZ z33Xk^>1w_Ia}z5ENtPYCWm&H1eqVOx=;e7}t3P#U^{0nzzFbA0Qak!};!izNWdY0d zKx0r@#otC^JjIBp!UfppM3JkC!c)s$tRzD^2sNkeDcXBpM3Jkr)QD=4@~ literal 0 HcmV?d00001 diff --git a/wstools/tests/test_t1.py b/wstools/tests/test_t1.py new file mode 100644 index 00000000..5c338995 --- /dev/null +++ b/wstools/tests/test_t1.py @@ -0,0 +1,20 @@ +############################################################################ +# Joshua R. Boverhof, David W. Robertson, LBNL +# See LBNLCopyright for copyright notice! +########################################################################### +import unittest +import test_wsdl +import utils + +def makeTestSuite(): + suite = unittest.TestSuite() + suite.addTest(test_wsdl.makeTestSuite("services_by_file")) + return suite + +def main(): + loader = utils.MatchTestLoader(True, None, "makeTestSuite") + unittest.main(defaultTest="makeTestSuite", testLoader=loader) + +if __name__ == "__main__" : main() + + diff --git a/wstools/tests/test_wsdl.py b/wstools/tests/test_wsdl.py new file mode 100644 index 00000000..5f617b91 --- /dev/null +++ b/wstools/tests/test_wsdl.py @@ -0,0 +1,164 @@ +#!/usr/bin/env python + +############################################################################ +# Joshua R. Boverhof, David W. Robertson, LBNL +# See LBNLCopyright for copyright notice! +########################################################################### + +import sys, unittest +import ConfigParser +import os +from wstools.Utility import DOM +from wstools.WSDLTools import WSDLReader +from wstools.TimeoutSocket import TimeoutError + +from wstools import tests +cwd = os.path.dirname(tests.__file__) + +class WSDLToolsTestCase(unittest.TestCase): + + def __init__(self, methodName='runTest'): + unittest.TestCase.__init__(self, methodName) + + def setUp(self): + self.path = nameGenerator.next() + print self.path + sys.stdout.flush() + + def __str__(self): + teststr = unittest.TestCase.__str__(self) + if hasattr(self, "path"): + return "%s: %s" % (teststr, self.path ) + else: + return "%s" % (teststr) + + def checkWSDLCollection(self, tag_name, component, key='name'): + if self.wsdl is None: + return + definition = self.wsdl.document.documentElement + version = DOM.WSDLUriToVersion(definition.namespaceURI) + nspname = DOM.GetWSDLUri(version) + for node in DOM.getElements(definition, tag_name, nspname): + name = DOM.getAttr(node, key) + comp = component[name] + self.failUnlessEqual(eval('comp.%s' %key), name) + + def checkXSDCollection(self, tag_name, component, node, key='name'): + for cnode in DOM.getElements(node, tag_name): + name = DOM.getAttr(cnode, key) + component[name] + + def test_all(self): + try: + if self.path[:7] == 'http://': + self.wsdl = WSDLReader().loadFromURL(self.path) + else: + self.wsdl = WSDLReader().loadFromFile(self.path) + + except TimeoutError: + print "connection timed out" + sys.stdout.flush() + return + except: + self.path = self.path + ": load failed, unable to start" + raise + + try: + self.checkWSDLCollection('service', self.wsdl.services) + except: + self.path = self.path + ": wsdl.services" + raise + + try: + self.checkWSDLCollection('message', self.wsdl.messages) + except: + self.path = self.path + ": wsdl.messages" + raise + + try: + self.checkWSDLCollection('portType', self.wsdl.portTypes) + except: + self.path = self.path + ": wsdl.portTypes" + raise + + try: + self.checkWSDLCollection('binding', self.wsdl.bindings) + except: + self.path = self.path + ": wsdl.bindings" + raise + + try: + self.checkWSDLCollection('import', self.wsdl.imports, key='namespace') + except: + self.path = self.path + ": wsdl.imports" + raise + + try: + for key in self.wsdl.types.keys(): + schema = self.wsdl.types[key] + self.failUnlessEqual(key, schema.getTargetNamespace()) + + definition = self.wsdl.document.documentElement + version = DOM.WSDLUriToVersion(definition.namespaceURI) + nspname = DOM.GetWSDLUri(version) + for node in DOM.getElements(definition, 'types', nspname): + for snode in DOM.getElements(node, 'schema'): + tns = DOM.findTargetNS(snode) + schema = self.wsdl.types[tns] + self.schemaAttributesDeclarations(schema, snode) + self.schemaAttributeGroupDeclarations(schema, snode) + self.schemaElementDeclarations(schema, snode) + self.schemaTypeDefinitions(schema, snode) + except: + self.path = self.path + ": wsdl.types" + raise + + if self.wsdl.extensions: + print 'No check for WSDLTools(%s) Extensions:' %(self.wsdl.name) + for ext in self.wsdl.extensions: print '\t', ext + + def schemaAttributesDeclarations(self, schema, node): + self.checkXSDCollection('attribute', schema.attr_decl, node) + + def schemaAttributeGroupDeclarations(self, schema, node): + self.checkXSDCollection('group', schema.attr_groups, node) + + def schemaElementDeclarations(self, schema, node): + self.checkXSDCollection('element', schema.elements, node) + + def schemaTypeDefinitions(self, schema, node): + self.checkXSDCollection('complexType', schema.types, node) + self.checkXSDCollection('simpleType', schema.types, node) + + +def setUpOptions(section): + cp = ConfigParser.ConfigParser() + cp.read(cwd+'/config.txt') + if not cp.sections(): + print 'fatal error: configuration file config.txt not present' + sys.exit(0) + if not cp.has_section(section): + print '%s section not present in configuration file, exiting' % section + sys.exit(0) + return cp, len(cp.options(section)) + +def getOption(cp, section): + for name, value in cp.items(section): + yield value + +def makeTestSuite(section='services_by_file'): + global nameGenerator + + cp, numTests = setUpOptions(section) + nameGenerator = getOption(cp, section) + suite = unittest.TestSuite() + for i in range(0, numTests): + suite.addTest(unittest.makeSuite(WSDLToolsTestCase, 'test_')) + return suite + + +def main(): + unittest.main(defaultTest="makeTestSuite") + + +if __name__ == "__main__" : main() diff --git a/wstools/tests/test_wstools.py b/wstools/tests/test_wstools.py new file mode 100644 index 00000000..0e0f9582 --- /dev/null +++ b/wstools/tests/test_wstools.py @@ -0,0 +1,37 @@ +#!/usr/bin/env python + +############################################################################ +# Joshua R. Boverhof, David W. Robertson, LBNL +# See LBNLCopyright for copyright notice! +########################################################################### + +import unittest, tarfile, os, ConfigParser +import test_wsdl + + +SECTION='files' +CONFIG_FILE = 'config.txt' + +def extractFiles(section, option): + config = ConfigParser.ConfigParser() + config.read(CONFIG_FILE) + archives = config.get(section, option) + archives = eval(archives) + for file in archives: + tar = tarfile.open(file) + if not os.access(tar.membernames[0], os.R_OK): + for i in tar.getnames(): + tar.extract(i) + +def makeTestSuite(): + suite = unittest.TestSuite() + suite.addTest(test_wsdl.makeTestSuite("services_by_file")) + return suite + +def main(): + extractFiles(SECTION, 'archives') + unittest.main(defaultTest="makeTestSuite") + +if __name__ == "__main__" : main() + + diff --git a/wstools/tests/test_wstools_net.py b/wstools/tests/test_wstools_net.py new file mode 100644 index 00000000..880cff31 --- /dev/null +++ b/wstools/tests/test_wstools_net.py @@ -0,0 +1,20 @@ +#!/usr/bin/env python + +############################################################################ +# Joshua R. Boverhof, David W. Robertson, LBNL +# See LBNLCopyright for copyright notice! +########################################################################### +import unittest +import test_wsdl + +def makeTestSuite(): + suite = unittest.TestSuite() + suite.addTest(test_wsdl.makeTestSuite("services_by_http")) + return suite + +def main(): + unittest.main(defaultTest="makeTestSuite") + +if __name__ == "__main__" : main() + + diff --git a/wstools/tests/xmethods.tar.gz b/wstools/tests/xmethods.tar.gz new file mode 100644 index 0000000000000000000000000000000000000000..4521a9ac9794a2d76c08453a62bf5af5cd359254 GIT binary patch literal 15209 zcmZXaV{j$T6Ru;Nq=JoYdt=+!*w)6jZQI${wr$(C?c|*M``?fER!!AZPfg8->FTb2 z-fp63IJh@)c|kBp4_h-A3wu*%Mi(O|up8eWm2IxYdmupVOYq#NDz3+C&<9M~jXS9f zE`i>i+#%4$X`@rd)0}NTb}a7&mf73&ZVxEaXe#^PBAmm*(YOg~cv-M&(cY<1e;a}u zZ5trA^5^U-TiUqe^9Q2;Y+dmAw=#Xp=HDp>?)2>VKJV?i=ichO_k9s~@Q7wKQbih5 zLG5?xJHQTY8J5#&y!eXe!*YP)@Zy4*?RF#~>kb5Xb`;JwfW79xw>P)^g%3$VxBSAl zow7e&-g|)xLk`sW_C7#l(4EmSI9u~L;2TS4NBu8?P#+PZF6eYb{TH&k-{xmu`kp-@ z(*FF*4t8o(z+KFKbWKr;aVwbBKs=J&k;k_&0tobPC+@S&;aH5}nFf&KNC#)XnbElU z?wzeRkY8D~Z{V3){r&Ufd*v68zIEf$dGp79u1*R~Yavb(^OY2Px5M|n;^p=^D;ylq zj*bWcJ|qJp!#7DAyX}W9Ho$E6608Jx87CNULnJzEQ`qi1xjJB4DWZI710$Wq!|oG> ziyu`W!i_2KykKC<2g4stW{DZkKZg~8qCxrxD>)x;0DEu_g_JuSZD8}0$d$+Ia?p=N zxXEFe%ONWb%Pw4THceERhcBm5NBLI+YfSiX?BJLSyT4n&65Pn`dLY~yiv5iQngE#i z?*erXVJA)(RJiv?B!ob0pX@B~=h99o!D39ZhY%M$5Eg*>@?wn8LKJQR(I%vG-ClEz z)2BWVwWs1xDmLvM;@ymR7DKEuk1|4!dK$Om;e@)#lworg-RxKJMIkYxypRg$gic(= z1BB3Q%w_(wD3c8j8$tO)AvZM=d*1bNXNR=*pj>ED;SmqF79`7_RRN8iIkkQ zLB@=N!-#RW+2P|JQQR`#5y-*&f$X%|r{ErNAhp)5l` zE|y)w{~Ku)-(qGy$BNf7X6HNTS(nYsiad)hJ{G)Cc%#aY88wmJ7Zlo}8--w!S|+V% z9vJ%wtsNKaMC1EucgFR#T}eyO6d17~_vVc6?RcUGvygNThB#4}89<2lbOzBhDEZ<= zKQJiw(Vs&jq#gOGG#8G>#_6?9yE-R!-=LesP8ee()nER%UjQHK2MSVjvPVn>!NN5F zK>!>=98zxaTyInP6_&V~;!B#g*V7xo7&ZjQ{x0xvmkZAo4wUyn&?V{)WA+==&-c1# zBmnzzit`(t06WB@x~B|L^mti)Nydf%u3%il0)?nwYJFdza$te6+bQqAZRNZ&Ik3RT zh`^Y>95#V)UT6W#@aLDppu)FsThwqID?R@lVm-lJMQ8SSnc*B#e{6Ecn^I;9r%DeA zrZgy3<68Zt1O~tXKO7XvKZGp9UT~g8nzt7z>8ju@#pH@mFL}{bHnA}qSzZau7(f&Y zD>qxeYl`^=d(HYH;D{A)qapqz&yQ48-(q2TT0av~@OvSG*4X;ud_hLCqjWDMV3_9C z8ppDO+EV}bVl$MQ`MZv+jI6LUYhp^w#pt?CXIgq%sIfT}ll+wJvcwroF{MqjcC>uF zwoReiLg_K3`Kc~~!j!n|6M9Z5X~p7DQp*O+OdKo$#$ui8NzR01hEGwUaj9^PWuXUWvK0s z68CdO0>Gy0SGleETxA4~?4RquVFiZF;L;(qo^~+-k0Cs^4Zm{Twj@Hdn-Vo~M=A$v z9vz8SJ(g<2XKBYK#{$Kwa;ud(kGnL*O$l3R1Q`#muh|Ovw@*x9f&^BF2@t&_x*uA` zMzPs1i0y|FJ{5QzOQ+jyM5Kzr(J4TieEGg zFvxLO75S~EyXQ2ZNz|w3v-F|D+J+-o%xs4D%Z_b=XcPxF8JTL;!`e`NNX;ll*U}dU zc#ay*N`0G&+~(8Tg12^sSz(rNnzo~QF_79T%XOLab=8^~;5qf+pQZWIC+A4#W_AK0 zH;A}fi03I?B%mmtd4h%EiXw&@ls)_{KA2~X&$t%O138`d)4e=?cW8hok$*OJF(n^doMgV5pE@q`19a$`@;Yw*SlmKiP*8=EBSy+OJ&}< zzBIt4r=Oi4*Y7e+67c4XQIkup+1{kU9qkC{$JxCOC66oWkW&kOiuun8F_<(v4Qfgjy6LWK}pPKleskb@8^>w#u zco(T?XOO~rpW3jnj0kA|vDz2nE^dJkmq#DZp3Y@mYn-~d=@3p{B9y2wkak_|?JVD4 z9jdDmRi?`Am~J~wID;nJLlrONPyt^IMG2qshf5d_kXH>(iB7;B*n8x80WK|N|1EI= zWoLR&!@+@sN~z^R2S}obWB8l>oaHtZ>i^Hh1qTL_O@O{^A;?mi?bj#k4}(N7m$2-} z3u&oLX^4x^9${z!>xNa+>ZXYE#UB>LP(q&7cy3c7k$7S8`<&fotMp~ADBZnAfHj#dqedLGFL}802MNkCC?Ydu@>JPyGx0lGohEgJole3H~liDeU)_|!Itqm zV8O#nQsF$Ir}p-77=T*E7&N`B(dOWbKmbLpy>z$458eQ|bx~{ZRC7dSaW)V`)m-g$ zcqq~X6}#AYy76Crw}94*ohPl*dSk$EpC~s!ah~3wzsf5*&<`^$Ypirn3~{aW70MRM z^}0J?hWEB}(W(1%-1m%d*vW&vQtj(?9U7oecBZ=9_sxZ=#YdL7BLG#I^=KG55DD{1 zE{ezrc8gYafrEtDPBf3U29yW6yMtSceKMc<_>@|w&h&m)LSASsH<`uPp;`};Muw=o zZibNY&U%v@f41r@SfamLsqu9N+7A-rY^isNLIf;1^K<5{*DgEmxuu3EfU06t9~TY7 zugTa+03vP7bk|eGor$t@kq!4uoCE*+2bmI+s}-lSLGKQo*VYu4b}}|$5{$@W%;LJ0 z`+T|(^vBvx+FwYA*XoVI47^e8e!m)}Dq9f~1snURLpllGVpM4%LCA~Tqjlqz@y;YLcDXY#&ptx0Q?^8?g~ey75{dS7uchiZM>K`7#6V#qc8;b^v}H+?FoTKmh#SvJ?>L+O zQvv?Y4nCC%ZnLdU#*@us3Ika(i54P(bn*F@E>h2ek4U-O$JbdyR$knaS9vkj1e0CtLL| z-qtD(M$UoqO2qwKU%_Q8bM-5}y`CGYX30yxhnt0-yyZ*<+EF1OuHk+v&rr4ucRZLf((ZU! zMX4nB&NOP-9Z%3Nd6U{N5v!th3?}O%k*tY~pOAWiM5k#)V=XRT2#oYUhFK<+LlMBb z*=uuy($A7B&bj8CXkYO~hSz*6n1Gd1W|AF76~+mjK|J&jBPGT;Bcw^` z)PI{BF74flKACSd5Gxf$u47q~*IhVTW`0b(kSD6&EU!A(E0L99&~nF+Jnaid355mC}$pO*Hl`t6@Xn> zy;TScLCVM>#yw34lj!&|L@H9f$OWK1>Q@TQpo?-Mrdbp~O-f}#sPz8g7?;84KkL4t z7+d9?ExQe~+xUa_99^fG!~tWg7D>Xl1)wO~sv#O7J4`~*d`XLuU?oN*NL4m4`({Q^+$n?c&&u79qFSW*#wFNSJQ#`gP4gc3_zvIR$<+zP^$mDG`TR_} z={6o0^*bt&pNtCdvc?Q@TY_sN;cja~+}~;4yOb4qNrQd2cv6`_)KRYArkBAD8={v& zL}+$OEgaxuLUsY-ARw=`PT}y85PA*MOS#xgfc2+Nxs4laO zER(O(tNFis6=}_1ThG5W%6JBUb{`e=D~yc!9jAC5Pg=8HrWx+0)v)XSdx&0TOmgUt zyk{BE5Wn5;!ZQ<_Ex&C7e!%*p{~mfsj}S-SXwzg=Fi*ev;9%lDm%iPe_x=mXGc%LP zQt>_3RqlO*PwV?lAH~O(`IHxwGUmUxb;EZf^{|)k_V%{=uy^)Aec1O`7onleqy0$* z7bOolLg6Ufy~#C32KHxb)$kDcJK~;IPC=Q^S+|u3n+v#`M_JiHoA+i{wxl*Jcb9@l zJg1Gyj>5uEXqGBrCx}>Rh>aE}2@}v%*lhA1AXeJ$KeaYwP>CvZX^&BqvV}NHFUJd} zrTfCB0f??r*a`Umi02_q3#~cbQ#lRNJ>^DP%@%HW?Gz8SCv~r%9??6klrkwN5qw`j zToe28>(IO4Ao0rJ`Aa(DK2m*g+|#hHQ>S^UsY>H+eL-`$yNH{5$&`As_ud-A<((h; zpHqEz^ei7t?x^}X;qeaHX2zJuABcl<``%>wQ2mTEKG~zZH=nBj;wFWL1^FXKT||R| zP#N`o{QJeJ&quvEXD?0S_#r4K#TWE_)q}TZBO02i#uaL*K|YZWh>4f~Y`C<528SdD zmx>Zy1_vm5xA?Gwsso1XJv-~$^+F-#9y2U+$tIWRwywq?QcoJo@u(nO#`11A@C`QX zt_F=Ba$9Y5`zy}HW3K<=LKjcIg~lAxqIiXEM5Rc+vj~szOI|ejzd*c>8I^C&dha2A zV9mzp%{xO5a+v;Gw7)uA_r2CSJPbe(o7$LEC)g8TLO=oaEp$X|V{`ELnVzR}Ic|tP z-K4c~{m@T#$%(R#Ct6lAxTIWf`$6%5*PE^-yiR=|(##stZu|b@MQwe{`|#Xc_@0FP zMEk)L%|VS65g8qAR@kKSKP#wCjwY{NkfoH*e5QmKeico2tM&JV#i1poxnAzC&(YfiI7L>FON?Y%u+@T#wY@!>N>*@)MLPpL;$;5lp8!}+ zFSXnswY&#_K3s60@G!*uCjb&$rtVzD@<{VBEe$A>UG{GJrL zz3rr!qfG{Z2)>r{!Mxx+?A#7J76s>7z zIT#87l;@I>%z(O3MOh+j{YJD_w|P_4i|7hIYR!2VK8!(GrM@Cz3ZO2aIXL^HJx#X5*I6Cc{9BkvjWBDE-ucn<_A z&mI`OENtgVY1WN@aB+oqPV#R(F8yXv)kY=^8TFunfSamcsk&M?xxvI2p7V|Nt%``9 zv(X%jPu!{bF)%Yx93moPK0yT?a##4D#@Jb&8r(Q3ZtRG`3x9pxqi`J+m3v1!YbdL# zEeL|r6#n99hX760G9T&~61Xu9LLjkAS)Y&7}Z(gK7@S;lcw zxUI9LRSa?E#u+ihW!M#ROI}u-`1XNEDa=J)MWZ=pQK(Nb(lfP)lC%*JxbOwLaIC+X zVv-m=5*SU29ww{B=1dXC^wwu&I6AXjQP`tyzZs+6j!h`GH}NPVo7OxpW60HdO8bgSHe;!Vhq;Jb^$>TDZ&h(nn;Dl_!5 zWOYh2S+c>i(3W7E#JJK`{m^y850A}{fD}{J%HHaA>I!bJN`g+3B&FzobYXuWD;Lfg z=s4zS;KJd!0jTmy7&9+3g$y&l2Ni-hEn)Z0SYJJyveb zWEZy^2lWfnv==hylBzsRW{NmowudQ@T|w+7%>(n;#B3Kj`Q}ge(dN z+mi_eRvQ880yTR8`?>@``Ez7>AbWS6T-y^zK_k*Fi-Wd8Y4k3E7#&D1fOd+Fev!X| zz7k`Lo&(ald3EN>jL6=h;QAJaUE(ieZ#)!*K>}ZU4FXdHwR_=Lw-w=5MY7kT3h+QlQfrt|SX|Afx7bUvxO?N^0$G+s(rQg&=5?XfSg#y`c zz+H4wf;^F}IF<2ojiV%1YoiCY&LSdU)X^tMudB}?&8@+*07sBV!T-X_ zXbgbc=HlZ7VKVko=oRpH<)ap9>*Le6gF9VKPZ&YARTrRM?d|G=I-4O z#aX7H6UE$WNJuXzMa1WB-~DWMBl0P(1+O;iRqSxyO$>6)l0uI}9(ot*z?3nUM6b-BBSTh$?c6$X zDeC31twf9Y@;+T8VmfL-`P!O;n!MWLwakZ4K1r-sk^z}J1tr*6l;O~DMiB4PChprg zA!PZ8&VKmCBpTE19}&lNAUpp|z}l4;AQ!kc-byzu`di&UHoIJ#Vt-%&f48eq_MR-n{+K)y?s9KHP*4*+Ab!w7=D*bo8UxzAKp6 zW1S>KOx}?}oOg>xz4d9OgMkp}PZyPX&?SXx7g@?<5FCTdHa6=LLhW)Z4RQt}2pN0s(V9oaetMFZ6# z=z&5`f5@^*8aMJ2C1tm%f?~+r7*@e{@dom2D zr6t07h*Mm-8Hb|h5JmC|3G^YU>)e8oznakE@>1>?yjaMz51lDcrGZ!xtCD%H7Guzu z0PB%h>_?}@TvJ<0snV=dQF2Hu!&7!rU&tr~s20G?D`;9hX{K|(q)4T^d79*uz0fP_ zQ}nY3I?`LsfE^|AuriE_&kW-q73Tp)>B#3~V(4xOe}jc?g)b_|h^Igpeq&a_cj}zp zrR;ESm!@O1X^|@%k(*_=g=`2#;cOx|vN-ky%1#tiy^Q$HWaKNaadgg?*S z%zIvUces9kA$t9#!XHFU{-q!2X=?!RGO(vzvtgVWnhWmXnQEIXvo%_jDQGS}=@V<9 zq{!!f{`H{$OdyRejS|%I%fXtZryCZymbr0+N13FexB`|arTY& zOw1Jl&o%CzvYWd6-F87eoS#17=WjQCZvJs|Z@c_AcRfUJ5`Av7?t9)n@q#aHZ$cDPJeE*xA|KxRdh>DN^MfI5pKd_)w+JYdj}Vt%`uyTy7GQ+ z8$dn^afOkQg-tjG7%tMP>omfY% za9a?Z9Kr4lXr~3fHQhR20PmXqUVZgFc}^brQ#~XMgMfZd^$s{5S2G_YRYgzn^iFL0 zW-D(s_iwN2v3UB`QNk`(>dj+P?G*zgyzTuAs-;LOo0SAF+L@snuziLO}H98TZ#NNnN4YN_>~aW$E-{}*g%|Q$X~%UjzL1gT#U4C z$&r&IOc({;>l`!|=r;S!7pY9R!ONQ&*ZTX8BI{R1gTUsKQT7Lunp@~n>FOn2pS#^^ z8Czsa7){;Sr`{H_P8;^MVjk6|`m=sdI$TNBM=*gRZccH>poh)6D=A4WKIBro^v+Jq z=qO1-DU*JqrCDa;8EYK{SH{FJ2PY5B#Q0pgHhTH(cc zZ^F%cKS}?WiSYomLp&*R)Hh!gFUTpr$3vh}u7v(3lucu9dZa|u0G7mNc7UIDJlp#b zvoOUbIcI?yq2o=fGQZbMo?(t~cZ}h&SfA`4R_;F>lz4G<0!Wh$1A%_=mN9-I*R6EI zLMb0QN+>4#@!=sc4T_DqIB1C(BL(f2C-5mRcv++Ai}dcn0##i&GigwDD>{Lj-Gfa* zmM6BBog7Jk%S8Zb6`OOr)7lD3Pd5$S@321Z8Yygj^8Lk}gCzA@iKigermbHl7Xj>_ zAIeDEarMPM&nH_gLCuxP3v)rO>ZBd-htv)f^D0^1djCY#4qZd#`p;n2qM(J`pKErV z2&K#&9{SgqBRjIftplr5ZG0&mFj;HTokF!lI#n%Ko1Q>T2J@Q1z_pGu&@G?u?gqm# z=+4h2FC*DMYf>?*RxQA zw9{TcUw-6*FXHn?++uYm;|r@t>{Lz`wAJNvKGi`kc^<{IHIYW;oKwU;f#;c#$redn zFztkpn{EO&@_^!pJS8}KO%-b5F*%mw_)%CHP#XM#E^#Rp7*J) zZ3tgP-SH)DOKk>VGYZR?9YjMNwNqJ^K-&+u07T3LP(|0;#un4D|K)An%YWR`^4+J= zf52-OjuzTf*hYW#f50*PzYy!~bo=>(KO}_5m zKS8>!$!a>gUes1a$hXITH@?Nq)ir#8K7<;JAb=o;zT(iJf{JD(zy0bbbb`Od_CGG^ zMhxa%yVKweTXW#DZ=Q+1AAQ&n3>CVIWy>j1vTI(TAF)fWAq<^As3DGJ^NQvAKI^aB zC^t6)9*R-T4m;c19nry}t^>y2yoC3K%i3veHwD9tuG@R-N$nz2w$s#`2Q^EyPJcTm zdq`o}v$!wJt*7-|dG&f{zIOr$w0J79w7S&dOJ+AKV-}yAI2-D4h&+QJZ4(R#d9bJyX-T%IJ|ROm{P;%2t*(QM4Jq^Ox4goSx`c4E6>d z5!d-Sb}gGYqoZrI@ENIe!Bi&HxvS7hL0UC4Hu>ia|5Am^T_m%kq}KBduS4&{(HFOq zZa@iak`)ricqT*Y=f&QGJq?<+)YT#Pr~lYD0tjw04qq@rE_?NA zja8>-HSv$QBu__&gPNL(JhH50PZ86Q!KOlUR*Aaj^7QaPFtE zSa*QP6jW2y=x1h;6>)D(VtSxg`?T`M`k623Ujduq5smJalo7Nka-o?N!itd8v`C57 zec#J*%_km&HuIKN`MTjgpZ!^e(P{*_~I^4xW9I}#= z*Vhpw5$1n*L@t#(X*$(;fEwbLJKN0_)(m6m=M@uVaNbs!iR7G2nWIu)>CXg~2C7CD zs?rH}uItC_a^ETUiune;2^^+7f1Aot%eu%0ss_81`*osxQ&~$QP;}!o1Ub30v2d%) zpOP!h{1QG>9JtXLvJC&n|aUxma-)IiDjJ<{>1uh~wqRtOqI%6c8f_3efos8G@ zx4l};Z1RPF1XgIW__=>qZjapoP~+``2Y98M_xZV3)<$#kjfSS+X{ab+dYneSS#HE7 zChn1?qIc0)r8U$tFL#u+>51ZQ>rK4o=)LuaNU=TIqUM{F4V z`*&(bZPLQ{0M?iz3mf&RqKKcJRO4@8A7iyi9zB*lQsw6DKR>-gkQ0Oolbw^kK^p~M zD$#EKn!RDpGaskO;@3u`Cz(h5F*9A{_a#o@V~baz=?ryf^P`oKwwfTSAj`C1m2oEgkO>TIp4j@7grDm~)j z6#g=GE4)^^&B~d}VsA)RHyuaat6PT>x6UO8303w-^y>NuHuh4Pbvy850A@|U98Nrk zT`wUeTzdUjP=AiB5Iyt5;zG3UcDYuzk~Ox;PiWE6IS=h>Dw6@TwuIe^JU~o|QC%pW zmwF^>e8N>Is$`Od_`yDylD+5zd5NQVs2PIw^v^Oamus-Fv=uWD-JPQLM7cOBO9yewtofjUpT6nr0pKC-QXE3KIgm|vc1&SK~ z1K`B}LZTqsZWhNv)CuO-pHpeI1jrDzBZ*-CR{Uep{*+iX+vOnB_ zit0R`4;u%40c)y!n7nDwSr3}151Q}oL;l5@*D>uj z6`Te?T!x)cwCo#wU=i};BTVELTctt>52X;Xk2N=nXFQBtK1{Iq*$F%=H{)7;#M^DuFyQV23N6h?zPbbS44F=<2P4Fyt5gL zOoQ1>9>oT7gP;|QughKWB%>ifem`{{&T_FMYyIC}AF9H?qK$%ZrNk&bu005Ov2u~; zj=XHVCi-0YBa(C3@bs5^Ecpg$?Urq_TWw#OcriKUfCb7_VRv?R%u&Qs@YW@$0FiV2pPxUhrAtCxN}^buKkO6OXk zHpcNVCGY(5Z>HyxY+ATP9X@1-vT3)B>_)$lkacJ7sw11x8DarxcUF@NS#{DF z7^z5Wif74HsuyBDo+^ME#j@_?P7mh1=tH1t`05LICssRH4TQ^_1@tBA()TYL!|tUz z;h%uM25}2^ywobiPR_x&hj@OfC}k$Z%~(?SJYb5D6ZXMvDPh1H`CoIW!z~mMW(WIi zY%VS<`q$)0DKVU}{CVc)WHD11cgX!SR5>4nCSI>$QZcaaMp!^rwHC2i~y3={~gewn@*FOQ+v3Oh1%;J_zGRo zNnJGz#jJOv3~`G5U|~G!EKfYSdNEdKl71q`Kl$x!BHPKvFcwu~*(67Zq5N*5x6+cJ zlCZIMrQOE{K$}nbEqeTA`O`h3?qfdd-! zb4k;36lFrP+#X#mlqG$%STi?GhBLMuHDcz~BaD-3;tTlcw=)0A+4{2T1Dw6R{QfGD z6g_FRHXHMxK~B~&oIWC0M;!9^$^Fd$$T4782)E3tahO;{e@w|}U0olnoUwiR`TkM$ zX#C38=)-qipd?fnbzIUAn!59MbA(~O0G>6?{!bdnfAW~V^;huzab5y`o|S&Q%*mg; z%*kRKcM;M`WQ9?f@U%wH)m@4A3q^>|4*Xa73tp~v`<8Pm$iNB~T0)d9?y42HkOq|Q*v@gwX> z`a=g8Xk+J0frlghS3f6|z%2$Ju!`ewgO&+ir}BWR?RNKh*b7f#8LUth=mL|IjaW9@ zUq+U3Hm1kUEgk^Mk-u(HU{M?Zocs<~k@$((=|~O|@yNE5j>PaG;0&6? z_n%3$4-4SnjFB^fsaPoebqP})!qFb-_&?nEP&zn!(a2Ou-r+bzVgkPFtfw7S+r@s* zXka_;6!fyXcxmdz+7l36AG$039<|TEK|^0MkV1|lBRmth|K}e(8f8QfK0thtjMS)} z*x3|J>*y+m9{i=#<{z!Z8Q`JI#iA215aAg1cFrNi7osTDAW}N}KnW&5e83^{KC~2D z?9S(|NnJ7%TW=!+CcQyz-UFv4wJ*v}&@Czeev2X(1m)W~=|LypLsH(?r?}gWE2#WW=-criE4$? zGYq!ND=+|E86faaNjLVM+uv&u|6r|s4E)!;P?luUGyqdSKVVprP0-*lp9vT*1@o_hs>nyJD9GKA$ zslu$~?JL$6As6=ki&qiR@cP>iFNS!RS$krQ<3Q?WVc(Ls)3wvXq3vN@Wspv!Qr|v8 zfK)^s%obA1To|A-n`#9QxjsZ(VoVETA-w-3A^1f?9*Km?t4v(n9-6oiRoBn%BJr`W zvw`^!Q_MqD+vw>`-eU7da4$m!U~z;lLk^wLZq@A@zA^K76QwyDV8{)51!le1pS%Gg z#lll7Vj<1^*aY$XanE-({o32T-Q5Io#!DK3h7NXn_l9Zuq-$;ZPf{T2_=l6-VR~-h zbV-81Q;dV^q21gTy+-5`x%h9@6!dlWqLtkSB2<;~wD&1BJ6Y&$(k_&=Rz}S$Z2K3- z%WcM(V~ZHG^ENiCJc@z#?Ym~Q&WJ+!|j)7Qt^rp?$9as zov>FtLis^tYTSLNM6$Jn3Z1u3I z$U1;oPm|2(MXft-LTmDYxah!PcR2WkFWxQxlDHht^$SyAUD%jA+$m38EIUP$-)WV_`rA@6_AU43PRikVUUAX>=*N$-yE`~tw_o2WG>{0(qv~`Y>`$9%Wd`OnInjg#WKS_ad7;UB*h_18MvASAd;3p zaiE{?joqh~|2e(_RFTq7>Z@5C5)Z@kxd}mub0K@BbK%hfnTXe+Lj5Rb+`f18bY7mJ z_xQ(s`)m+Z^Q2C0YX<3MBrLN(vyJx|f~t0!XM&{T_Z~ST9l3Y1O5Fn)R&slVthw<& zH9HO@Q>_fqSZml~w395^snLTn`XfNT*$5vvJf`+KVB-LWJGz-h7F;csjT#VFG9Ef; zC-9ogOddDy$>8(auP`RiT&o>WyH@CEAd^a}l$$~=F5EzwshojL;V>GU&qFhMuYv3+ zBQ``bh=I7~sj?bBkUZfp?Sh>9ju|#X6;SaA^4+Cb2l0Aae}Q!KBy&I~gs;?dU&~(M zcha>!5ZEsfnCajWVd1Q(==@58rPn9?_|BB<+8(0^U4mUE$>-;+GRMS-K1R~`rqpZ- zEls1aSJG&hZP*Djl%%!HquK?A;-u^`9UAAW0#Mai5|_^gxVMeQB+D1$TuD1AdKW{m z9Q@Q(?>;5I(wi^gbekG#x&nYIRW1eO2JgN8OfcGRBV+|P%3)Qk%9eHUW+jG_ODT@Y zR7FlFr@hZO|(xB?%SCezbU zrbx@1LxH#T!fJHQaAU^oh}y#J^hGHc8645rOS8CIB~w;h@;^jsCaV_uKT>cwgKA|x zzjTgrV^VWw&LcSg(jp&6P__}_NT5>JDp44^8WXS~=&*DKrgi^?&K1ZTXnxI~28OrZ z?%;7nKhLSX_WjtsW#)i9`?j>UK&KCU>R$%Sm&lX?!>1i;oZlGXjl|JJ$Wj#}SKEpQzuk)e4*JcvmDNCowl+dNn)DcLvjL89jga0p@|xh1PBB z6%l~wobarLMU}%PX2e0CR`36*c3fiFY4OUQhFNK4Qnq&akMHGc2nTvaH(8teH86tW z9Q-qKJxIZ*lq{SI9)_^>cX2t!#(%C#6S>xXrq%{xgd_lSQ2Rw)**L;6I(bN@1T{T9 zRvaUTW@f=lB^oK%E*M9xJQfAE%RI(LgMkH}c~_G_P4Qj6n@@UvnF@5y_rVqA5CW;u zF|^5v)^l0^%f|Kxo!q$$Vxh+TqFk&0guhB8OMpnNDJ#|5jLHq}b{7|}@IDzo9Sjmj za`H3e`>6LQtTZ~*XqPtFH^LZu|I2;uJE2^Wi6Q0TGnJ=lY(u)3ArV)wuvZ{qUy(}i z<~zzkJ3v3m_Z~yRfj&S1R}faBf!0u=qefr%eFf9Y@@18O@t=yZ1IjbQT+~c~N@6}6 zGpAa({NCp=HjxcYyWR{LLtf^|?|`V0nFp>aDOea-t(=#FnP}Abn`@c>G<|97!|h5g z@DfRyr14UTo8S3r6MQm}%NKJM=7Fm#g4u=C>bY|8+mV7sO3dY#Dl~bb#9@T6oXq31 z?1+E-j#tXSCO^e0joPEmlyFJ&Fie|xW3>gJ{2HJ7mZ)^MLd|J<1Stx7Q`uQHd2LZkI#?MDf0cB=_M=%UHtkSgsF%JA z0j+-~vRu>*0>XG*lQG>+CmEQ!w7RcmEozMNpy~Iu8Aj<*LPMnWAmehgH4Bi4YLnDQ zo*HN_?kfS;R~Cx3)Z-3l-p!E|;$hcR2~w8ZjmTorVRS0avk|6EBP{!XmsQYDi(*&2 zOg;Y`>c4m^2p>ZY8D>Rg-@yD#!-g+IeJmogDxhbobsZ}4dHntp=nh*)se~vw4BITs zUoQgk&KvRH*%{*@jsq?2=zRIlo>=OGhNg#|iIU(PQH(W>1s{bB@oO@z*;`!2gb`|> zbIa>jtqXf6ElUVjS0ZMfwM)#o@kFR03mt2os1b7~MiPKe&?H9)E4ht}V-@hg6Ov7l zL`n%Lsd?x6|I)x~fT|>W4mQR)1q&2chR-Wb+3$=5II#djmaiE)>%O0_Hh&ZBEnUuz z(QI&%%KlAo1~>B6qk82NGCAG_^2)_hy}slNY6~2q^RrEvKeJtR^<>A;o^%k%QP7A^ zLK=2IDYTM^5rug%3q`!~bI^7|ai@AY4CH;iNo8aMo}3QI=gt7Y1ouH)LdNwwvlOYr z?I+4jQ<*=xr3|93;T!z=(1w*y!n?uG{%*WBd9pa1BseMeC0xMfXvN?D+-TfBu1<1z zF?=H8+GI+|0l1Nwk+*@_eu9G>DlTw<*vij?-n9LDxo%q>ZnOG{Oy9*u+@u@ylx@<{w?={;MGKY* zX<8&@ZW5Kf_v{Zz{+^3DC{44Hmk40+XP5{N<9dJtpNODN(V(svfqT1X4%X!k@= z=$}2&2DgXlUB@ScejVWkw+HFopr5yCsU##A8gguuL$==m4M$$6@*PR+yjCYx1u0jeW~$>1>>d|W+p