diff --git a/.devcontainer/Dockerfile b/.devcontainer/Dockerfile
index 64012baa..36edb285 100644
--- a/.devcontainer/Dockerfile
+++ b/.devcontainer/Dockerfile
@@ -1,15 +1,11 @@
 FROM mcr.microsoft.com/devcontainers/go:1
 
 RUN apt-get update && export DEBIAN_FRONTEND=noninteractive \
-  && apt-get -y install --no-install-recommends ffmpeg python3 python3-pip \
+  && apt-get -y install --no-install-recommends ffmpeg \
   && apt-get clean -y && rm -rf /var/lib/apt/lists/*
 
-RUN pip3 install --no-cache --upgrade --break-system-packages pip streamlink chat-downloader
-
 WORKDIR /tmp
 
-RUN wget https://github.com/rsms/inter/releases/download/v4.0-beta7/Inter-4.0-beta7.zip && unzip Inter-4.0-beta7.zip && mkdir -p /usr/share/fonts/opentype/inter/ && cp /tmp/Desktop/Inter-*.otf /usr/share/fonts/opentype/inter/ && fc-cache -f -v
+RUN wget https://github.com/rsms/inter/releases/download/v4.1/Inter-4.1.zip && unzip Inter-4.1.zip && mkdir -p /usr/share/fonts/opentype/inter/ && cp /tmp/extras/otf/Inter-*.otf /usr/share/fonts/opentype/inter/ && fc-cache -f -v
 
 RUN wget https://github.com/lay295/TwitchDownloader/releases/download/1.55.0/TwitchDownloaderCLI-1.55.0-Linux-x64.zip && unzip TwitchDownloaderCLI-1.55.0-Linux-x64.zip && mv TwitchDownloaderCLI /usr/local/bin/ && chmod +x /usr/local/bin/TwitchDownloaderCLI && rm TwitchDownloaderCLI-1.55.0-Linux-x64.zip
-
-RUN curl -sSfL https://raw.githubusercontent.com/golangci/golangci-lint/master/install.sh | sh -s -- -b $(go env GOPATH)/bin v1.50.1
diff --git a/.devcontainer/devcontainer.json b/.devcontainer/devcontainer.json
index 723a72cf..cad03227 100644
--- a/.devcontainer/devcontainer.json
+++ b/.devcontainer/devcontainer.json
@@ -3,7 +3,10 @@
   "features": {
     "ghcr.io/jungaretti/features/make:1": {},
     "ghcr.io/devcontainers/features/github-cli:1": {},
-    "ghcr.io/devcontainers/features/docker-in-docker:2": {}
+    "ghcr.io/devcontainers/features/docker-in-docker:2": {},
+    "ghcr.io/devcontainers/features/node:1": {},
+    "ghcr.io/guiyomh/features/golangci-lint:0": {},
+    "ghcr.io/devcontainers/features/python:1": {}
   },
   "customizations": {
     "vscode": {
@@ -11,8 +14,13 @@
         "dbaeumer.vscode-eslint",
         "esbenp.prettier-vscode",
         "eamodio.gitlens",
-        "github.copilot",
-        "yzhang.markdown-all-in-one"
+        "yzhang.markdown-all-in-one",
+        "esbenp.prettier-vscode",
+        "naumovs.color-highlight",
+        "ms-vscode-remote.remote-containers",
+        "burkeholland.simple-react-snippets",
+        "vunguyentuan.vscode-css-variables",
+        "vunguyentuan.vscode-postcss"
       ]
     }
   },
@@ -20,22 +28,28 @@
   "appPort": ["0.0.0.0:4000:4000"],
   "mounts": [
     {
-      "source": "${localWorkspaceFolder}/dev/vods",
-      "target": "/vods",
+      "source": "${localWorkspaceFolder}/dev/videos",
+      "target": "/data/videos",
       "type": "bind"
     },
     {
-      "source": "${localWorkspaceFolder}/dev/data",
-      "target": "/data",
+      "source": "${localWorkspaceFolder}/dev/temp",
+      "target": "/data/temp",
       "type": "bind"
     },
     {
       "source": "${localWorkspaceFolder}/dev/logs",
-      "target": "/logs",
+      "target": "/data/logs",
+      "type": "bind"
+    },
+    {
+      "source": "${localWorkspaceFolder}/dev/config",
+      "target": "/data/config",
       "type": "bind"
     }
   ],
   "workspaceMount": "source=${localWorkspaceFolder},target=/workspace,type=bind,consistency=cached",
   "workspaceFolder": "/workspace",
+  "postCreateCommand": "pip install streamlink chat-downloader --break-system-packages",
   "postAttachCommand": "sudo chown -R vscode:vscode /go && make dev_setup"
 }
diff --git a/.dockerignore b/.dockerignore
index 65c8dae4..f03e0998 100644
--- a/.dockerignore
+++ b/.dockerignore
@@ -1,4 +1,22 @@
 .github
 dev
 tmp
-bin
\ No newline at end of file
+bin
+/frontend/node_modules
+/frontend/.pnp
+/frontend/.pnp.*
+/frontend/.yarn/*
+!.yarn/patches
+!.yarn/plugins
+!.yarn/releases
+!.yarn/versions
+/coverage
+/frontend/.next/
+/out/
+/build
+/frontend/npm-debug.log*
+/frontend/yarn-debug.log*
+/frontend/yarn-error.log*
+/frontend/.env*
+/frontend/*.tsbuildinfo
+/frontend/next-env.d.ts
diff --git a/.github/workflows/docker-publish.yml b/.github/workflows/docker-publish.yml
index 2d4b3c1b..e3ab2aeb 100644
--- a/.github/workflows/docker-publish.yml
+++ b/.github/workflows/docker-publish.yml
@@ -9,9 +9,7 @@ on:
     branches: ["main"]
 
 env:
-  # Use docker.io for Docker Hub if empty
   REGISTRY: ghcr.io
-  # github.repository as <account>/<repo>
   IMAGE_NAME: ${{ github.repository }}
 
 jobs:
@@ -60,3 +58,8 @@ jobs:
           push: ${{ github.event_name != 'pull_request' }}
           tags: ${{ steps.meta.outputs.tags }}
           context: .
+          # cache builds in github actions
+          cache-from: type=gha
+          cache-to: type=gha,mode=max
+          # better compression
+          outputs: type=image,oci-mediatypes=true,compression=zstd,compression-level=3,force-compression=true
diff --git a/.gitignore b/.gitignore
index 89e69333..c9f64f44 100644
--- a/.gitignore
+++ b/.gitignore
@@ -1,7 +1,3 @@
-# If you prefer the allow list template instead of the deny list, see community template:
-# https://github.com/github/gitignore/blob/main/community/Golang/Go.AllowList.gitignore
-#
-# Binaries for programs and plugins
 *.exe
 *.exe~
 *.dll
@@ -14,9 +10,6 @@
 # Output of the go coverage tool, specifically when used with LiteIDE
 *.out
 
-# Dependency directories (remove the comment below to include it)
-# vendor/
-
 # Go workspace file
 go.work
 
@@ -26,4 +19,36 @@ go.work
 dev
 tmp
 **/__debug
-__debug*
\ No newline at end of file
+__debug*
+
+# dependencies
+/frontend/node_modules
+/frontend/.pnp
+/frontend/.pnp.*
+/frontend/.yarn/*
+!.yarn/patches
+!.yarn/plugins
+!.yarn/releases
+!.yarn/versions
+
+# testing
+/coverage
+
+# next.js
+/frontend/.next/
+/out/
+
+# production
+/build
+
+# debug
+/frontend/npm-debug.log*
+/frontend/yarn-debug.log*
+/frontend/yarn-error.log*
+
+# env files (can opt-in for committing if needed)
+/frontend/.env*
+
+# typescript
+/frontend/*.tsbuildinfo
+/frontend/next-env.d.ts
diff --git a/.server.air.toml b/.server.air.toml
index b397b8fb..c0dfaa12 100644
--- a/.server.air.toml
+++ b/.server.air.toml
@@ -7,7 +7,7 @@ tmp_dir = "tmp"
   bin = "./tmp/server"
   cmd = "make build_dev_server"
   delay = 1000
-  exclude_dir = ["tmp", "dev"]
+  exclude_dir = ["tmp", "dev", "frontend"]
   exclude_file = []
   exclude_regex = ["_test.go"]
   exclude_unchanged = false
diff --git a/.worker.air.toml b/.worker.air.toml
index 3e8b8ef7..3a7be27f 100644
--- a/.worker.air.toml
+++ b/.worker.air.toml
@@ -7,7 +7,7 @@ tmp_dir = "tmp"
   bin = "./tmp/worker"
   cmd = "make build_dev_worker"
   delay = 1000
-  exclude_dir = ["tmp", "dev"]
+  exclude_dir = ["tmp", "dev", "frontend"]
   exclude_file = []
   exclude_regex = ["_test.go"]
   exclude_unchanged = false
diff --git a/Dockerfile b/Dockerfile
index d44f1e1c..5e98d817 100644
--- a/Dockerfile
+++ b/Dockerfile
@@ -1,17 +1,21 @@
 ARG TWITCHDOWNLOADER_VERSION="1.55.0"
 
-# Build stage
-FROM golang:1.22-bookworm AS build
+#
+# API Build
+#
+FROM golang:1.23-bookworm AS build-api
 WORKDIR /app
 COPY . .
 RUN make build_server build_worker
 
-# Tools stage
+#
+# API Tools
+#
 FROM debian:bookworm-slim AS tools
 WORKDIR /tmp
 RUN apt-get update && apt-get install -y --no-install-recommends \
-unzip git ca-certificates curl \
-&& rm -rf /var/lib/apt/lists/*
+    unzip git ca-certificates curl \
+    && rm -rf /var/lib/apt/lists/*
 
 # Download TwitchDownloader for the correct platform
 ARG TWITCHDOWNLOADER_VERSION
@@ -19,7 +23,7 @@ ENV TWITCHDOWNLOADER_URL=https://github.com/lay295/TwitchDownloader/releases/dow
 
 
 RUN if [ "$(uname -m)" = "aarch64" ]; then \
-TWITCHDOWNLOADER_URL=https://github.com/lay295/TwitchDownloader/releases/download/${TWITCHDOWNLOADER_VERSION}/TwitchDownloaderCLI-${TWITCHDOWNLOADER_VERSION}-LinuxArm64.zip; \
+    TWITCHDOWNLOADER_URL=https://github.com/lay295/TwitchDownloader/releases/download/${TWITCHDOWNLOADER_VERSION}/TwitchDownloaderCLI-${TWITCHDOWNLOADER_VERSION}-LinuxArm64.zip; \
     fi && \
     echo "Download URL: $TWITCHDOWNLOADER_URL" && \
     curl -L $TWITCHDOWNLOADER_URL -o twitchdownloader.zip && \
@@ -28,13 +32,48 @@ TWITCHDOWNLOADER_URL=https://github.com/lay295/TwitchDownloader/releases/downloa
 
 RUN git clone --depth 1 https://github.com/xenova/chat-downloader.git
 
+#
+# Frontend base
+#
+FROM node:22-alpine AS base-frontend
+
+# Install dependencies only when needed
+FROM node:22-alpine AS deps
+RUN apk add --no-cache libc6-compat
+WORKDIR /app
+
+COPY frontend/package.json frontend/package-lock.json* ./
+RUN \
+    if [ -f yarn.lock ]; then yarn --frozen-lockfile; \
+    elif [ -f package-lock.json ]; then npm ci --force; \
+    elif [ -f pnpm-lock.yaml ]; then corepack enable pnpm && pnpm i --frozen-lockfile; \
+    else echo "Lockfile not found." && exit 1; \
+    fi
+
+#
+# Frontend build
+#
+FROM node:22-alpine AS build-frontend
+WORKDIR /app
+COPY --from=deps /app/node_modules ./node_modules
+COPY frontend/. .
+
+ENV NEXT_TELEMETRY_DISABLED=1
+
+RUN \
+    if [ -f yarn.lock ]; then yarn run build; \
+    elif [ -f package-lock.json ]; then npm run build; \
+    elif [ -f pnpm-lock.yaml ]; then corepack enable pnpm && pnpm run build; \
+    else echo "Lockfile not found." && exit 1; \
+    fi
+
 # Production stage
 FROM debian:bookworm-slim
 WORKDIR /opt/app
 
 # Install dependencies
 RUN apt-get update && apt-get install -y --no-install-recommends \
-    python3 python3-pip fontconfig ffmpeg tzdata procps \
+    python3 python3-pip fontconfig ffmpeg tzdata procps supervisor \
     fonts-noto-core fonts-noto-cjk fonts-noto-extra fonts-inter \
     curl \
     && rm -rf /var/lib/apt/lists/* \
@@ -48,6 +87,20 @@ RUN curl -LO https://github.com/tianon/gosu/releases/latest/download/gosu-$(dpkg
     && chmod 0755 gosu-$(dpkg --print-architecture | awk -F- '{ print $NF }') \
     && mv gosu-$(dpkg --print-architecture | awk -F- '{ print $NF }') /usr/local/bin/gosu
 
+# Install node for frontend
+ENV NODE_VERSION=22.x \
+    DEBIAN_FRONTEND=noninteractive
+
+# Install required packages, add NodeSource repository, and install Node.js
+RUN apt-get update && apt-get install -y --no-install-recommends \
+    curl \
+    ca-certificates \
+    gnupg \
+    && curl -fsSL https://deb.nodesource.com/setup_${NODE_VERSION} | bash - \
+    && apt-get install -y --no-install-recommends nodejs \
+    && apt-get clean && rm -rf /var/lib/apt/lists/*
+RUN node --version && npm --version
+
 # Setup user
 RUN useradd -u 911 -d /data abc && usermod -a -G users abc
 
@@ -62,13 +115,30 @@ RUN chmod 644 /usr/share/fonts/* && chmod -R a+rX /usr/share/fonts
 COPY --from=tools /tmp/TwitchDownloaderCLI /usr/local/bin/
 RUN chmod +x /usr/local/bin/TwitchDownloaderCLI
 
-# Copy application files
-COPY --from=build /app/ganymede-api .
-COPY --from=build /app/ganymede-worker .
+# Copy api and worker builds
+COPY --from=build-api /app/ganymede-api .
+COPY --from=build-api /app/ganymede-worker .
+
+# Setup frontend
+ENV NODE_ENV=production
+ENV NEXT_TELEMETRY_DISABLED=1
+RUN addgroup --system --gid 1001 nodejs
+RUN adduser --system --uid 1001 nextjs
+
+COPY --from=build-frontend /app/public ./public
+
+RUN mkdir .next
+RUN chown nextjs:nodejs .next
+
+COPY --from=build-frontend --chown=nextjs:nodejs /app/.next/standalone ./
+COPY --from=build-frontend --chown=nextjs:nodejs /app/.next/static ./.next/static
+ENV HOSTNAME="0.0.0.0" 
+
 
 # Setup entrypoint
 COPY entrypoint.sh /usr/local/bin/
 RUN chmod +x /usr/local/bin/entrypoint.sh
+COPY supervisord.conf /opt/app/supervisord.conf
 
 EXPOSE 4000
 ENTRYPOINT ["/usr/local/bin/entrypoint.sh"]
diff --git a/Makefile b/Makefile
index 5601adde..216910c0 100644
--- a/Makefile
+++ b/Makefile
@@ -1,6 +1,7 @@
 dev_setup:
 	go install github.com/joho/godotenv/cmd/godotenv@latest
 	go install github.com/air-verse/air@latest
+	cd frontend && npm install --force
 
 build_server:
 	go build -ldflags='-X github.com/zibbp/ganymede/internal/utils.Commit=$(shell git rev-parse HEAD) -X github.com/zibbp/ganymede/internal/utils.BuildTime=$(shell date -u "+%Y-%m-%d_%H:%M:%S")' -o ganymede-api cmd/server/main.go
@@ -22,9 +23,16 @@ dev_worker:
 	rm -f ./tmp/worker
 	air -c ./.worker.air.toml
 
+dev_web:
+	cd frontend && npm run dev
+
 ent_generate:
 	go run -mod=mod entgo.io/ent/cmd/ent generate --feature sql/upsert ./ent/schema
 
+ent_new_schema:
+	@read -p "Enter schema name:" schema; \
+	go run -mod=mod entgo.io/ent/cmd/ent new $$schema
+
 go_update_packages:
 	go get -u ./... && go mod tidy
 
diff --git a/README.md b/README.md
index ef052d11..387abe75 100644
--- a/README.md
+++ b/README.md
@@ -7,7 +7,7 @@
   <h2 align="center">Ganymede</h2>
 
   <p align="center">
-    Twitch VOD and Live Stream archiving platform with a real-time and rendered chat experience. Files are saved in a friendly format allowing for use without Ganymede.
+    Ganymede is a Twitch VOD and Live Stream archiving platform with a real-time chat experience. Every archive includes a rendered chat for viewing outside of Ganymede. Files are saved in a friendly format allowing for use without Ganymede.
   </p>
 </div>
 
@@ -15,9 +15,9 @@
 
 ## Screenshot
 
-![ganymede-readme_landing](https://user-images.githubusercontent.com/21207065/203620886-f40b82f6-317c-4ded-afdc-733d1658f6ca.jpg)
+![ganymede-readme_landing](https://github.com/user-attachments/assets/b1c024f5-f5ad-4611-84db-42d599364a74)
 
-https://user-images.githubusercontent.com/21207065/203620893-41a6a3a0-339a-4c62-8df8-0f66ec68327d.mp4
+https://github.com/user-attachments/assets/184451f1-e3ce-4329-8516-a9842648c01b
 
 ## About
 
@@ -28,13 +28,14 @@ Ganymede allows archiving of past streams (VODs) and live streams with a real-ti
 - Realtime Chat Playback
 - SSO / OAuth authentication ([wiki](https://github.com/Zibbp/ganymede/wiki/SSO---OpenID-Connect))
 - Light/dark mode toggle.
-- 'Watched channels' - watch channels for videos and live streams.
+- 'Watched channels'
+  - Allows watching channels for archiving past broadcasts and live streams. Includes advanced filtering options.
 - Twitch VOD/Livestream support.
 - Full VOD, Channel, and User management.
 - Custom post-download video FFmpeg parameters.
 - Custom chat render parameters.
 - Webhook notifications.
-- Simple file structure for long-term archival that will outlas Ganymede.
+- Simple file structure for long-term archival that will outlast Ganymede.
 - Recoverable queue system.
 - Playback / progress saving.
 - Playlists.
@@ -59,16 +60,14 @@ Visit the [docs](https://github.com/Zibbp/ganymede/tree/master/docs) folder for
 
 ### Installation
 
-Ganymede consists of four docker containers:
+Ganymede consists of two docker containers:
 
-1. API
-2. Frontend
-3. Postgres Database
-4. Nginx
+1. Server
+2. Postgres Database
 
-Feel free to use an existing Postgres database container and Nginx container if you don't want to spin new ones up.
+Feel free to use an existing Postgres database container if you don't want to spin new ones up.
 
-1. Download a copy of the `docker-compose.yml` file and `nginx.conf`.
+1. Download a copy of the `docker-compose.yml` file.
 2. Edit the `docker-compose.yml` file modifying the environment variables, see [environment variables](https://github.com/Zibbp/ganymede#environment-variables) for more information.
 3. Run `docker compose up -d`.
 4. Visit the address and port you specified for the frontend and login with username: `admin` password: `ganymede`.
@@ -82,51 +81,40 @@ Note: On startup the container will `chown` the config, temp, and logs directory
 
 ### Environment Variables
 
-The `docker-compose.yml` file has comments for each environment variable. The `*_URL` envionrment variables _must_ be the 'public' URLs (e.g. `https://ganymedem.domain.com`) it cannot be a URL to just the docker service.
-
-##### API
-
-| ENV Name                        | Description                                                                                                                                                                                                                                                                               |
-| ------------------------------- | ----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- |
-| `DEBUG`                         | Enable debug logging `true` or `false`.                                                                                                                                                                                                                                                   |
-| `VIDEOS_DIR`                    | Path inside the container to the videos directory. Default: `/data/videos`.                                                                                                                                                                                                               |
-| `TEMP_DIR`                      | Path inside the container where temporary files are stored during archiving. Default: `/data/temp`.                                                                                                                                                                                       |
-| `LOGS_DIR`                      | Path inside the container where log files are stored. Default: `/data/logs`.                                                                                                                                                                                                              |
-| `CONFIG_DIR`                    | Path inside the container where the config is stored. Default: `/data/config`.                                                                                                                                                                                                            |
-| `PATH_MIGRATION_ENABLED`        | Enable path migration at startup. Default: `true`.                                                                                                                                                                                                                                        |
-| `TZ`                            | Timezone.                                                                                                                                                                                                                                                                                 |
-| `DB_HOST`                       | Host of the database.                                                                                                                                                                                                                                                                     |
-| `DB_PORT`                       | Port of the database.                                                                                                                                                                                                                                                                     |
-| `DB_USER`                       | Username for the database.                                                                                                                                                                                                                                                                |
-| `DB_PASS`                       | Password for the database.                                                                                                                                                                                                                                                                |
-| `DB_NAME`                       | Name of the database.                                                                                                                                                                                                                                                                     |
-| `DB_SSL`                        | Whether to use SSL. Default: `disable`. See [DB SSL](https://github.com/Zibbp/ganymede/wiki/DB-SSL) for more information.                                                                                                                                                                 |
-| `DB_SSL_ROOT_CERT`              | _Optional_ Path to DB SSL root certificate. See [DB SSL](https://github.com/Zibbp/ganymede/wiki/DB-SSL) for more information.                                                                                                                                                             |
-| `JWT_SECRET`                    | Secret for JWT tokens. This should be a long random string.                                                                                                                                                                                                                               |
-| `JWT_REFRESH_SECRET`            | Secret for JWT refresh tokens. This should be a long random string.                                                                                                                                                                                                                       |
-| `TWITCH_CLIENT_ID`              | Twitch application client ID.                                                                                                                                                                                                                                                             |
-| `TWITCH_CLIENT_SECRET`          | Twitch application client secret.                                                                                                                                                                                                                                                         |
-| `FRONTEND_HOST`                 | Host of the frontend, used for CORS. Example: `http://192.168.1.2:4801`                                                                                                                                                                                                                   |
-| `COOKIE_DOMAIN`                 | _Optional_ Domain the cookie is valid for. This is used with a reverse proxy and should be the top level domain (e.g. `domain.com`). You may need to tinker with this variable depending how your reverse proxy is setup. Typically it is the root where ganymede is or the level up-one. |
-| `OAUTH_ENABLED`                 | _Optional_ Wheter OAuth is enabled `true` or `false`. Must have the other OAuth variables set if this is enabled.                                                                                                                                                                         |
-| `OAUTH_PROVIDER_URL`            | _Optional_ OAuth provider URL. See https://github.com/Zibbp/ganymede/wiki/SSO---OpenID-Connect                                                                                                                                                                                            |
-| `OAUTH_CLIENT_ID`               | _Optional_ OAuth client ID.                                                                                                                                                                                                                                                               |
-| `OAUTH_CLIENT_SECRET`           | _Optional_ OAuth client secret.                                                                                                                                                                                                                                                           |
-| `OAUTH_REDIRECT_URL`            | _Optional_ OAuth redirect URL, points to the API. Example: `http://localhost:4000/api/v1/auth/oauth/callback`.                                                                                                                                                                            |
-| `MAX_CHAT_DOWNLOAD_EXECUTIONS`  | Maximum number of chat downloads that can be running at once. Live streams bypass this limit.                                                                                                                                                                                             |
-| `MAX_CHAT_RENDER_EXECUTIONS`    | Maximum number of chat renders that can be running at once.                                                                                                                                                                                                                               |
-| `MAX_VIDEO_DOWNLOAD_EXECUTIONS` | Maximum number of video downloads that can be running at once. Live streams bypass this limit.                                                                                                                                                                                            |
-| `MAX_VIDEO_CONVERT_EXECUTIONS`  | Maximum number of video conversions that can be running at once.                                                                                                                                                                                                                          |
-
-##### Frontend
-
-| ENV Name                | Description                                                            |
-| ----------------------- | ---------------------------------------------------------------------- |
-| `API_URL`               | Host for the API. Example: `http://192.168.1.2:4800`.                  |
-| `CDN_URL`               | Host for the Nginx serivce. Example: `http://197.148.1.2:4802`.        |
-| `SHOW_SSO_LOGIN_BUTTON` | `true/false` Show a "login via sso" button on the login page.          |
-| `FORCE_SSO_AUTH`        | `true/false` Force users to login via SSO by bypassing the login page. |
-| `REQUIRE_LOGIN`         | `true/false` Require users to be logged in to view videos.             |
+The `docker-compose.yml` file has comments for each environment variable. Below is a list of all environment variables and their descriptions.
+
+##### Server
+
+| ENV Name                        | Description                                                                                                                   |
+| ------------------------------- | ----------------------------------------------------------------------------------------------------------------------------- |
+| `DEBUG`                         | Enable debug logging `true` or `false`.                                                                                       |
+| `VIDEOS_DIR`                    | Path inside the container to the videos directory. Default: `/data/videos`.                                                   |
+| `TEMP_DIR`                      | Path inside the container where temporary files are stored during archiving. Default: `/data/temp`.                           |
+| `LOGS_DIR`                      | Path inside the container where log files are stored. Default: `/data/logs`.                                                  |
+| `CONFIG_DIR`                    | Path inside the container where the config is stored. Default: `/data/config`.                                                |
+| `PATH_MIGRATION_ENABLED`        | Enable path migration at startup. Default: `true`.                                                                            |
+| `TZ`                            | Timezone.                                                                                                                     |
+| `DB_HOST`                       | Host of the database.                                                                                                         |
+| `DB_PORT`                       | Port of the database.                                                                                                         |
+| `DB_USER`                       | Username for the database.                                                                                                    |
+| `DB_PASS`                       | Password for the database.                                                                                                    |
+| `DB_NAME`                       | Name of the database.                                                                                                         |
+| `DB_SSL`                        | Whether to use SSL. Default: `disable`. See [DB SSL](https://github.com/Zibbp/ganymede/wiki/DB-SSL) for more information.     |
+| `DB_SSL_ROOT_CERT`              | _Optional_ Path to DB SSL root certificate. See [DB SSL](https://github.com/Zibbp/ganymede/wiki/DB-SSL) for more information. |
+| `TWITCH_CLIENT_ID`              | Twitch application client ID.                                                                                                 |
+| `TWITCH_CLIENT_SECRET`          | Twitch application client secret.                                                                                             |
+| `OAUTH_ENABLED`                 | _Optional_ Wheter OAuth is enabled `true` or `false`. Must have the other OAuth variables set if this is enabled.             |
+| `OAUTH_PROVIDER_URL`            | _Optional_ OAuth provider URL. See https://github.com/Zibbp/ganymede/wiki/SSO---OpenID-Connect                                |
+| `OAUTH_CLIENT_ID`               | _Optional_ OAuth client ID.                                                                                                   |
+| `OAUTH_CLIENT_SECRET`           | _Optional_ OAuth client secret.                                                                                               |
+| `OAUTH_REDIRECT_URL`            | _Optional_ OAuth redirect URL, points to the API. Example: `http://localhost:4000/api/v1/auth/oauth/callback`.                |
+| `MAX_CHAT_DOWNLOAD_EXECUTIONS`  | Maximum number of chat downloads that can be running at once. Live streams bypass this limit.                                 |
+| `MAX_CHAT_RENDER_EXECUTIONS`    | Maximum number of chat renders that can be running at once.                                                                   |
+| `MAX_VIDEO_DOWNLOAD_EXECUTIONS` | Maximum number of video downloads that can be running at once. Live streams bypass this limit.                                |
+| `MAX_VIDEO_CONVERT_EXECUTIONS`  | Maximum number of video conversions that can be running at once.                                                              |
+| `SHOW_SSO_LOGIN_BUTTON`         | Frontend: `true/false` Show a "login via sso" button on the login page.                                                       |
+| `FORCE_SSO_AUTH`                | Frontend: `true/false` Force users to login via SSO by bypassing the login page.                                              |
+| `REQUIRE_LOGIN`                 | Frontend: `true/false` Require users to be logged in to view videos.                                                          |
 
 ##### DB
 
@@ -149,13 +137,6 @@ The `docker-compose.yml` file has comments for each environment variable. The `*
 | `/data/temp`   | Mount to store temporay files during the archive process. This is mounted to the host so files are recoverable in the event of a crash. This **must** match the `TEMP_DIR` environment variable. | `./temp:/data/temp`          |
 | `/data/config` | Mount to store the config. This **must** match the `CONFIG_DIR` environment variable.                                                                                                            | `./config:/data/config`      |
 
-##### Nginx
-
-| Volume                     | Description                                                | Example                                        |
-| -------------------------- | ---------------------------------------------------------- | ---------------------------------------------- |
-| `/data/videos`             | Mount for video storage, same as the API container volume. | `/mnt/nas/vods:/data/videos`                   |
-| `/etc/nginx/nginx.conf:ro` | Path to the Nginx conf file.                               | `/path/to/nginx.conf:/etc/nginx/nginx.conf:ro` |
-
 ## Acknowledgements
 
 - [TwitchDownloader](https://github.com/lay295/TwitchDownloader)
diff --git a/cmd/server/main.go b/cmd/server/main.go
index 8bdec376..45e8eb33 100644
--- a/cmd/server/main.go
+++ b/cmd/server/main.go
@@ -14,7 +14,7 @@ import (
 func main() {
 	ctx := context.Background()
 
-	if os.Getenv("ENV") == "dev" {
+	if os.Getenv("DEVELOPMENT") == "true" {
 		log.Logger = log.Output(zerolog.ConsoleWriter{Out: os.Stderr})
 	}
 	log.Info().Str("commit", utils.Commit).Str("build_time", utils.BuildTime).Msg("starting server")
diff --git a/cmd/worker/main.go b/cmd/worker/main.go
index b46e0c60..2db28a0b 100644
--- a/cmd/worker/main.go
+++ b/cmd/worker/main.go
@@ -34,7 +34,7 @@ func main() {
 		log.Panic().Err(err).Msg("Error initializing server config")
 	}
 
-	if os.Getenv("ENV") == "dev" {
+	if os.Getenv("DEVELOPMENT") == "true" {
 		log.Logger = log.Output(zerolog.ConsoleWriter{Out: os.Stderr})
 	}
 
diff --git a/docker-compose.yml b/docker-compose.yml
index 9977b61a..186d5602 100644
--- a/docker-compose.yml
+++ b/docker-compose.yml
@@ -1,7 +1,7 @@
 version: "3.3"
 services:
-  ganymede-api:
-    container_name: ganymede-api
+  ganymede:
+    container_name: ganymede
     image: ghcr.io/zibbp/ganymede:latest
     restart: unless-stopped
     depends_on:
@@ -21,13 +21,9 @@ services:
       - DB_PASS=PASSWORD
       - DB_NAME=ganymede-prd
       - DB_SSL=disable
-      #- DB_SSL_ROOT_CERT= # path to cert in the container if DB_SSL is not disabled
-      - JWT_SECRET=SECRET # set as a random string
-      - JWT_REFRESH_SECRET=SECRET # set as a random string
+      # - DB_SSL_ROOT_CERT= # path to cert in the container if DB_SSL is not disabled
       - TWITCH_CLIENT_ID= # from your twitch application
       - TWITCH_CLIENT_SECRET= # from your twitch application
-      - FRONTEND_HOST=http://IP:PORT # URL to the frontend service. Needs to be the 'public' url that you visit.
-      #- COOKIE_DOMAIN= # Optional domain that the cookies will be set to. Should be the top level domain with a reverse proxy (e.g. `domain.com`).
       # Worker settings. Max number of tasks to run in parallel per type.
       - MAX_CHAT_DOWNLOAD_EXECUTIONS=3
       - MAX_CHAT_RENDER_EXECUTIONS=2
@@ -39,6 +35,10 @@ services:
       # - OAUTH_CLIENT_ID=
       # - OAUTH_CLIENT_SECRET=
       # - OAUTH_REDIRECT_URL=http://IP:PORT/api/v1/auth/oauth/callback # Points to the API service
+      # Optional Frontend settings
+      - SHOW_SSO_LOGIN_BUTTON=true
+      - FORCE_SSO_AUTH=false
+      - REQUIRE_LOGIN=false
     volumes:
       - /path/to/vod/storage:/data/videos # update VIDEOS_DIR env var
       - ./temp:/data/temp # update TEMP_DIR env var
@@ -46,18 +46,12 @@ services:
       - ./config:/data/config # config and other miscellaneous files
     ports:
       - 4800:4000
-  ganymede-frontend:
-    container_name: ganymede-frontend
-    image: ghcr.io/zibbp/ganymede-frontend:latest
-    restart: unless-stopped
-    environment:
-      - API_URL=http://IP:PORT # Points to the API service; the container must be able to access this URL internally
-      - CDN_URL=http://IP:PORT # Can point to your nginx service, or set same as API_URL if nginx is not used
-      - SHOW_SSO_LOGIN_BUTTON=true # show/hide SSO login button on login page
-      - FORCE_SSO_AUTH=false # force SSO auth for all users (bypasses login page and redirects to SSO)
-      - REQUIRE_LOGIN=false # require login to view videos
-    ports:
-      - 4801:3000
+    healthcheck:
+      test: curl --fail http://localhost:4000/health || exit 1
+      interval: 60s
+      retries: 5
+      start_period: 60s
+      timeout: 10s
   ganymede-db:
     container_name: ganymede-db
     image: postgres:14
@@ -68,20 +62,11 @@ services:
       - POSTGRES_USER=ganymede
       - POSTGRES_DB=ganymede-prd
     ports:
-      - 4803:5432
-  # Nginx is not really required, it provides nice-to-have caching. The API container will serve the VIDEO_DIR env var path if you want to use that instead (e.g. VIDEOS_DIR=/data/videos would be served at IP:4800/data/videos/channel/channel.jpg).
-  ganymede-nginx:
-    container_name: ganymede-nginx
-    image: nginx
-    volumes:
-      - /path/to/nginx.conf:/etc/nginx/nginx.conf:ro
-      - /pah/to/vod/stoage:/data/videos
-    ports:
-      - 4802:8080
-  # River UI is a frontend for the task system that Ganymede uses. This provides a more in-depth look at the task queue.
-  ganymede-river-ui:
-    image: ghcr.io/riverqueue/riverui:0.3
-    environment:
-      - DATABASE_URL=postgres://ganymede:DB_PASSWORD@ganymede-db:5432/ganymede-prd # update with env settings from the ganymede-db container. If you're using the default database settings then just update the DB_PASSWORD env var.
-    ports:
-      - 4804:8080
+      - 4801:5432
+    restart: unless-stopped
+    healthcheck:
+      test: ["CMD-SHELL", "pg_isready", "-d", "{{ ganymede_db_name }}"]
+      interval: 30s
+      timeout: 60s
+      retries: 5
+      start_period: 60s
\ No newline at end of file
diff --git a/ent/client.go b/ent/client.go
index e7534a9b..4d32a21f 100644
--- a/ent/client.go
+++ b/ent/client.go
@@ -27,6 +27,7 @@ import (
 	"github.com/zibbp/ganymede/ent/playback"
 	"github.com/zibbp/ganymede/ent/playlist"
 	"github.com/zibbp/ganymede/ent/queue"
+	"github.com/zibbp/ganymede/ent/sessions"
 	"github.com/zibbp/ganymede/ent/twitchcategory"
 	"github.com/zibbp/ganymede/ent/user"
 	"github.com/zibbp/ganymede/ent/vod"
@@ -59,6 +60,8 @@ type Client struct {
 	Playlist *PlaylistClient
 	// Queue is the client for interacting with the Queue builders.
 	Queue *QueueClient
+	// Sessions is the client for interacting with the Sessions builders.
+	Sessions *SessionsClient
 	// TwitchCategory is the client for interacting with the TwitchCategory builders.
 	TwitchCategory *TwitchCategoryClient
 	// User is the client for interacting with the User builders.
@@ -87,6 +90,7 @@ func (c *Client) init() {
 	c.Playback = NewPlaybackClient(c.config)
 	c.Playlist = NewPlaylistClient(c.config)
 	c.Queue = NewQueueClient(c.config)
+	c.Sessions = NewSessionsClient(c.config)
 	c.TwitchCategory = NewTwitchCategoryClient(c.config)
 	c.User = NewUserClient(c.config)
 	c.Vod = NewVodClient(c.config)
@@ -193,6 +197,7 @@ func (c *Client) Tx(ctx context.Context) (*Tx, error) {
 		Playback:        NewPlaybackClient(cfg),
 		Playlist:        NewPlaylistClient(cfg),
 		Queue:           NewQueueClient(cfg),
+		Sessions:        NewSessionsClient(cfg),
 		TwitchCategory:  NewTwitchCategoryClient(cfg),
 		User:            NewUserClient(cfg),
 		Vod:             NewVodClient(cfg),
@@ -226,6 +231,7 @@ func (c *Client) BeginTx(ctx context.Context, opts *sql.TxOptions) (*Tx, error)
 		Playback:        NewPlaybackClient(cfg),
 		Playlist:        NewPlaylistClient(cfg),
 		Queue:           NewQueueClient(cfg),
+		Sessions:        NewSessionsClient(cfg),
 		TwitchCategory:  NewTwitchCategoryClient(cfg),
 		User:            NewUserClient(cfg),
 		Vod:             NewVodClient(cfg),
@@ -259,7 +265,7 @@ func (c *Client) Close() error {
 func (c *Client) Use(hooks ...Hook) {
 	for _, n := range []interface{ Use(...Hook) }{
 		c.BlockedVideos, c.Channel, c.Chapter, c.Live, c.LiveCategory, c.LiveTitleRegex,
-		c.MultistreamInfo, c.MutedSegment, c.Playback, c.Playlist, c.Queue,
+		c.MultistreamInfo, c.MutedSegment, c.Playback, c.Playlist, c.Queue, c.Sessions,
 		c.TwitchCategory, c.User, c.Vod,
 	} {
 		n.Use(hooks...)
@@ -271,7 +277,7 @@ func (c *Client) Use(hooks ...Hook) {
 func (c *Client) Intercept(interceptors ...Interceptor) {
 	for _, n := range []interface{ Intercept(...Interceptor) }{
 		c.BlockedVideos, c.Channel, c.Chapter, c.Live, c.LiveCategory, c.LiveTitleRegex,
-		c.MultistreamInfo, c.MutedSegment, c.Playback, c.Playlist, c.Queue,
+		c.MultistreamInfo, c.MutedSegment, c.Playback, c.Playlist, c.Queue, c.Sessions,
 		c.TwitchCategory, c.User, c.Vod,
 	} {
 		n.Intercept(interceptors...)
@@ -303,6 +309,8 @@ func (c *Client) Mutate(ctx context.Context, m Mutation) (Value, error) {
 		return c.Playlist.mutate(ctx, m)
 	case *QueueMutation:
 		return c.Queue.mutate(ctx, m)
+	case *SessionsMutation:
+		return c.Sessions.mutate(ctx, m)
 	case *TwitchCategoryMutation:
 		return c.TwitchCategory.mutate(ctx, m)
 	case *UserMutation:
@@ -2001,6 +2009,139 @@ func (c *QueueClient) mutate(ctx context.Context, m *QueueMutation) (Value, erro
 	}
 }
 
+// SessionsClient is a client for the Sessions schema.
+type SessionsClient struct {
+	config
+}
+
+// NewSessionsClient returns a client for the Sessions from the given config.
+func NewSessionsClient(c config) *SessionsClient {
+	return &SessionsClient{config: c}
+}
+
+// Use adds a list of mutation hooks to the hooks stack.
+// A call to `Use(f, g, h)` equals to `sessions.Hooks(f(g(h())))`.
+func (c *SessionsClient) Use(hooks ...Hook) {
+	c.hooks.Sessions = append(c.hooks.Sessions, hooks...)
+}
+
+// Intercept adds a list of query interceptors to the interceptors stack.
+// A call to `Intercept(f, g, h)` equals to `sessions.Intercept(f(g(h())))`.
+func (c *SessionsClient) Intercept(interceptors ...Interceptor) {
+	c.inters.Sessions = append(c.inters.Sessions, interceptors...)
+}
+
+// Create returns a builder for creating a Sessions entity.
+func (c *SessionsClient) Create() *SessionsCreate {
+	mutation := newSessionsMutation(c.config, OpCreate)
+	return &SessionsCreate{config: c.config, hooks: c.Hooks(), mutation: mutation}
+}
+
+// CreateBulk returns a builder for creating a bulk of Sessions entities.
+func (c *SessionsClient) CreateBulk(builders ...*SessionsCreate) *SessionsCreateBulk {
+	return &SessionsCreateBulk{config: c.config, builders: builders}
+}
+
+// MapCreateBulk creates a bulk creation builder from the given slice. For each item in the slice, the function creates
+// a builder and applies setFunc on it.
+func (c *SessionsClient) MapCreateBulk(slice any, setFunc func(*SessionsCreate, int)) *SessionsCreateBulk {
+	rv := reflect.ValueOf(slice)
+	if rv.Kind() != reflect.Slice {
+		return &SessionsCreateBulk{err: fmt.Errorf("calling to SessionsClient.MapCreateBulk with wrong type %T, need slice", slice)}
+	}
+	builders := make([]*SessionsCreate, rv.Len())
+	for i := 0; i < rv.Len(); i++ {
+		builders[i] = c.Create()
+		setFunc(builders[i], i)
+	}
+	return &SessionsCreateBulk{config: c.config, builders: builders}
+}
+
+// Update returns an update builder for Sessions.
+func (c *SessionsClient) Update() *SessionsUpdate {
+	mutation := newSessionsMutation(c.config, OpUpdate)
+	return &SessionsUpdate{config: c.config, hooks: c.Hooks(), mutation: mutation}
+}
+
+// UpdateOne returns an update builder for the given entity.
+func (c *SessionsClient) UpdateOne(s *Sessions) *SessionsUpdateOne {
+	mutation := newSessionsMutation(c.config, OpUpdateOne, withSessions(s))
+	return &SessionsUpdateOne{config: c.config, hooks: c.Hooks(), mutation: mutation}
+}
+
+// UpdateOneID returns an update builder for the given id.
+func (c *SessionsClient) UpdateOneID(id int) *SessionsUpdateOne {
+	mutation := newSessionsMutation(c.config, OpUpdateOne, withSessionsID(id))
+	return &SessionsUpdateOne{config: c.config, hooks: c.Hooks(), mutation: mutation}
+}
+
+// Delete returns a delete builder for Sessions.
+func (c *SessionsClient) Delete() *SessionsDelete {
+	mutation := newSessionsMutation(c.config, OpDelete)
+	return &SessionsDelete{config: c.config, hooks: c.Hooks(), mutation: mutation}
+}
+
+// DeleteOne returns a builder for deleting the given entity.
+func (c *SessionsClient) DeleteOne(s *Sessions) *SessionsDeleteOne {
+	return c.DeleteOneID(s.ID)
+}
+
+// DeleteOneID returns a builder for deleting the given entity by its id.
+func (c *SessionsClient) DeleteOneID(id int) *SessionsDeleteOne {
+	builder := c.Delete().Where(sessions.ID(id))
+	builder.mutation.id = &id
+	builder.mutation.op = OpDeleteOne
+	return &SessionsDeleteOne{builder}
+}
+
+// Query returns a query builder for Sessions.
+func (c *SessionsClient) Query() *SessionsQuery {
+	return &SessionsQuery{
+		config: c.config,
+		ctx:    &QueryContext{Type: TypeSessions},
+		inters: c.Interceptors(),
+	}
+}
+
+// Get returns a Sessions entity by its id.
+func (c *SessionsClient) Get(ctx context.Context, id int) (*Sessions, error) {
+	return c.Query().Where(sessions.ID(id)).Only(ctx)
+}
+
+// GetX is like Get, but panics if an error occurs.
+func (c *SessionsClient) GetX(ctx context.Context, id int) *Sessions {
+	obj, err := c.Get(ctx, id)
+	if err != nil {
+		panic(err)
+	}
+	return obj
+}
+
+// Hooks returns the client hooks.
+func (c *SessionsClient) Hooks() []Hook {
+	return c.hooks.Sessions
+}
+
+// Interceptors returns the client interceptors.
+func (c *SessionsClient) Interceptors() []Interceptor {
+	return c.inters.Sessions
+}
+
+func (c *SessionsClient) mutate(ctx context.Context, m *SessionsMutation) (Value, error) {
+	switch m.Op() {
+	case OpCreate:
+		return (&SessionsCreate{config: c.config, hooks: c.Hooks(), mutation: m}).Save(ctx)
+	case OpUpdate:
+		return (&SessionsUpdate{config: c.config, hooks: c.Hooks(), mutation: m}).Save(ctx)
+	case OpUpdateOne:
+		return (&SessionsUpdateOne{config: c.config, hooks: c.Hooks(), mutation: m}).Save(ctx)
+	case OpDelete, OpDeleteOne:
+		return (&SessionsDelete{config: c.config, hooks: c.Hooks(), mutation: m}).Exec(ctx)
+	default:
+		return nil, fmt.Errorf("ent: unknown Sessions mutation op: %q", m.Op())
+	}
+}
+
 // TwitchCategoryClient is a client for the TwitchCategory schema.
 type TwitchCategoryClient struct {
 	config
@@ -2500,12 +2641,12 @@ func (c *VodClient) mutate(ctx context.Context, m *VodMutation) (Value, error) {
 type (
 	hooks struct {
 		BlockedVideos, Channel, Chapter, Live, LiveCategory, LiveTitleRegex,
-		MultistreamInfo, MutedSegment, Playback, Playlist, Queue, TwitchCategory, User,
-		Vod []ent.Hook
+		MultistreamInfo, MutedSegment, Playback, Playlist, Queue, Sessions,
+		TwitchCategory, User, Vod []ent.Hook
 	}
 	inters struct {
 		BlockedVideos, Channel, Chapter, Live, LiveCategory, LiveTitleRegex,
-		MultistreamInfo, MutedSegment, Playback, Playlist, Queue, TwitchCategory, User,
-		Vod []ent.Interceptor
+		MultistreamInfo, MutedSegment, Playback, Playlist, Queue, Sessions,
+		TwitchCategory, User, Vod []ent.Interceptor
 	}
 )
diff --git a/ent/ent.go b/ent/ent.go
index a7a3fc26..8ebe3d1c 100644
--- a/ent/ent.go
+++ b/ent/ent.go
@@ -23,6 +23,7 @@ import (
 	"github.com/zibbp/ganymede/ent/playback"
 	"github.com/zibbp/ganymede/ent/playlist"
 	"github.com/zibbp/ganymede/ent/queue"
+	"github.com/zibbp/ganymede/ent/sessions"
 	"github.com/zibbp/ganymede/ent/twitchcategory"
 	"github.com/zibbp/ganymede/ent/user"
 	"github.com/zibbp/ganymede/ent/vod"
@@ -97,6 +98,7 @@ func checkColumn(table, column string) error {
 			playback.Table:        playback.ValidColumn,
 			playlist.Table:        playlist.ValidColumn,
 			queue.Table:           queue.ValidColumn,
+			sessions.Table:        sessions.ValidColumn,
 			twitchcategory.Table:  twitchcategory.ValidColumn,
 			user.Table:            user.ValidColumn,
 			vod.Table:             vod.ValidColumn,
diff --git a/ent/hook/hook.go b/ent/hook/hook.go
index 986901f8..522b5c4a 100644
--- a/ent/hook/hook.go
+++ b/ent/hook/hook.go
@@ -141,6 +141,18 @@ func (f QueueFunc) Mutate(ctx context.Context, m ent.Mutation) (ent.Value, error
 	return nil, fmt.Errorf("unexpected mutation type %T. expect *ent.QueueMutation", m)
 }
 
+// The SessionsFunc type is an adapter to allow the use of ordinary
+// function as Sessions mutator.
+type SessionsFunc func(context.Context, *ent.SessionsMutation) (ent.Value, error)
+
+// Mutate calls f(ctx, m).
+func (f SessionsFunc) Mutate(ctx context.Context, m ent.Mutation) (ent.Value, error) {
+	if mv, ok := m.(*ent.SessionsMutation); ok {
+		return f(ctx, mv)
+	}
+	return nil, fmt.Errorf("unexpected mutation type %T. expect *ent.SessionsMutation", m)
+}
+
 // The TwitchCategoryFunc type is an adapter to allow the use of ordinary
 // function as TwitchCategory mutator.
 type TwitchCategoryFunc func(context.Context, *ent.TwitchCategoryMutation) (ent.Value, error)
diff --git a/ent/live.go b/ent/live.go
index 495a0799..0e658dce 100644
--- a/ent/live.go
+++ b/ent/live.go
@@ -18,37 +18,45 @@ import (
 type Live struct {
 	config `json:"-"`
 	// ID of the ent.
-	ID uuid.UUID `json:"id,omitempty"`
+	ID uuid.UUID `json:"id"`
 	// Watch live streams
-	WatchLive bool `json:"watch_live,omitempty"`
+	WatchLive bool `json:"watch_live"`
 	// Watch new VODs
-	WatchVod bool `json:"watch_vod,omitempty"`
+	WatchVod bool `json:"watch_vod"`
 	// Download archives
-	DownloadArchives bool `json:"download_archives,omitempty"`
+	DownloadArchives bool `json:"download_archives"`
 	// Download highlights
-	DownloadHighlights bool `json:"download_highlights,omitempty"`
+	DownloadHighlights bool `json:"download_highlights"`
 	// Download uploads
-	DownloadUploads bool `json:"download_uploads,omitempty"`
+	DownloadUploads bool `json:"download_uploads"`
 	// Download sub only VODs
-	DownloadSubOnly bool `json:"download_sub_only,omitempty"`
+	DownloadSubOnly bool `json:"download_sub_only"`
 	// Whether the channel is currently live.
-	IsLive bool `json:"is_live,omitempty"`
+	IsLive bool `json:"is_live"`
 	// Whether the chat archive is enabled.
-	ArchiveChat bool `json:"archive_chat,omitempty"`
+	ArchiveChat bool `json:"archive_chat"`
 	// Resolution holds the value of the "resolution" field.
-	Resolution string `json:"resolution,omitempty"`
+	Resolution string `json:"resolution"`
 	// The time the channel last went live.
-	LastLive time.Time `json:"last_live,omitempty"`
+	LastLive time.Time `json:"last_live"`
 	// Whether the chat should be rendered.
-	RenderChat bool `json:"render_chat,omitempty"`
+	RenderChat bool `json:"render_chat"`
 	// Restrict fetching videos to a certain age.
-	VideoAge int64 `json:"video_age,omitempty"`
+	VideoAge int64 `json:"video_age"`
 	// Whether the categories should be applied to livestreams.
-	ApplyCategoriesToLive bool `json:"apply_categories_to_live,omitempty"`
+	ApplyCategoriesToLive bool `json:"apply_categories_to_live"`
+	// Whether to download clips on a schedule.
+	WatchClips bool `json:"watch_clips"`
+	// The number of clips to archive.
+	ClipsLimit int `json:"clips_limit"`
+	// How often channel should be checked for clips to archive in days.
+	ClipsIntervalDays int `json:"clips_interval_days"`
+	// Time when clips were last checked.
+	ClipsLastChecked time.Time `json:"clips_last_checked"`
 	// UpdatedAt holds the value of the "updated_at" field.
-	UpdatedAt time.Time `json:"updated_at,omitempty"`
+	UpdatedAt time.Time `json:"updated_at"`
 	// CreatedAt holds the value of the "created_at" field.
-	CreatedAt time.Time `json:"created_at,omitempty"`
+	CreatedAt time.Time `json:"created_at"`
 	// Edges holds the relations/edges for other nodes in the graph.
 	// The values are being populated by the LiveQuery when eager-loading is set.
 	Edges        LiveEdges `json:"edges"`
@@ -103,13 +111,13 @@ func (*Live) scanValues(columns []string) ([]any, error) {
 	values := make([]any, len(columns))
 	for i := range columns {
 		switch columns[i] {
-		case live.FieldWatchLive, live.FieldWatchVod, live.FieldDownloadArchives, live.FieldDownloadHighlights, live.FieldDownloadUploads, live.FieldDownloadSubOnly, live.FieldIsLive, live.FieldArchiveChat, live.FieldRenderChat, live.FieldApplyCategoriesToLive:
+		case live.FieldWatchLive, live.FieldWatchVod, live.FieldDownloadArchives, live.FieldDownloadHighlights, live.FieldDownloadUploads, live.FieldDownloadSubOnly, live.FieldIsLive, live.FieldArchiveChat, live.FieldRenderChat, live.FieldApplyCategoriesToLive, live.FieldWatchClips:
 			values[i] = new(sql.NullBool)
-		case live.FieldVideoAge:
+		case live.FieldVideoAge, live.FieldClipsLimit, live.FieldClipsIntervalDays:
 			values[i] = new(sql.NullInt64)
 		case live.FieldResolution:
 			values[i] = new(sql.NullString)
-		case live.FieldLastLive, live.FieldUpdatedAt, live.FieldCreatedAt:
+		case live.FieldLastLive, live.FieldClipsLastChecked, live.FieldUpdatedAt, live.FieldCreatedAt:
 			values[i] = new(sql.NullTime)
 		case live.FieldID:
 			values[i] = new(uuid.UUID)
@@ -214,6 +222,30 @@ func (l *Live) assignValues(columns []string, values []any) error {
 			} else if value.Valid {
 				l.ApplyCategoriesToLive = value.Bool
 			}
+		case live.FieldWatchClips:
+			if value, ok := values[i].(*sql.NullBool); !ok {
+				return fmt.Errorf("unexpected type %T for field watch_clips", values[i])
+			} else if value.Valid {
+				l.WatchClips = value.Bool
+			}
+		case live.FieldClipsLimit:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field clips_limit", values[i])
+			} else if value.Valid {
+				l.ClipsLimit = int(value.Int64)
+			}
+		case live.FieldClipsIntervalDays:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field clips_interval_days", values[i])
+			} else if value.Valid {
+				l.ClipsIntervalDays = int(value.Int64)
+			}
+		case live.FieldClipsLastChecked:
+			if value, ok := values[i].(*sql.NullTime); !ok {
+				return fmt.Errorf("unexpected type %T for field clips_last_checked", values[i])
+			} else if value.Valid {
+				l.ClipsLastChecked = value.Time
+			}
 		case live.FieldUpdatedAt:
 			if value, ok := values[i].(*sql.NullTime); !ok {
 				return fmt.Errorf("unexpected type %T for field updated_at", values[i])
@@ -323,6 +355,18 @@ func (l *Live) String() string {
 	builder.WriteString("apply_categories_to_live=")
 	builder.WriteString(fmt.Sprintf("%v", l.ApplyCategoriesToLive))
 	builder.WriteString(", ")
+	builder.WriteString("watch_clips=")
+	builder.WriteString(fmt.Sprintf("%v", l.WatchClips))
+	builder.WriteString(", ")
+	builder.WriteString("clips_limit=")
+	builder.WriteString(fmt.Sprintf("%v", l.ClipsLimit))
+	builder.WriteString(", ")
+	builder.WriteString("clips_interval_days=")
+	builder.WriteString(fmt.Sprintf("%v", l.ClipsIntervalDays))
+	builder.WriteString(", ")
+	builder.WriteString("clips_last_checked=")
+	builder.WriteString(l.ClipsLastChecked.Format(time.ANSIC))
+	builder.WriteString(", ")
 	builder.WriteString("updated_at=")
 	builder.WriteString(l.UpdatedAt.Format(time.ANSIC))
 	builder.WriteString(", ")
diff --git a/ent/live/live.go b/ent/live/live.go
index a1de2ca0..35d29dab 100644
--- a/ent/live/live.go
+++ b/ent/live/live.go
@@ -41,6 +41,14 @@ const (
 	FieldVideoAge = "video_age"
 	// FieldApplyCategoriesToLive holds the string denoting the apply_categories_to_live field in the database.
 	FieldApplyCategoriesToLive = "apply_categories_to_live"
+	// FieldWatchClips holds the string denoting the watch_clips field in the database.
+	FieldWatchClips = "watch_clips"
+	// FieldClipsLimit holds the string denoting the clips_limit field in the database.
+	FieldClipsLimit = "clips_limit"
+	// FieldClipsIntervalDays holds the string denoting the clips_interval_days field in the database.
+	FieldClipsIntervalDays = "clips_interval_days"
+	// FieldClipsLastChecked holds the string denoting the clips_last_checked field in the database.
+	FieldClipsLastChecked = "clips_last_checked"
 	// FieldUpdatedAt holds the string denoting the updated_at field in the database.
 	FieldUpdatedAt = "updated_at"
 	// FieldCreatedAt holds the string denoting the created_at field in the database.
@@ -92,6 +100,10 @@ var Columns = []string{
 	FieldRenderChat,
 	FieldVideoAge,
 	FieldApplyCategoriesToLive,
+	FieldWatchClips,
+	FieldClipsLimit,
+	FieldClipsIntervalDays,
+	FieldClipsLastChecked,
 	FieldUpdatedAt,
 	FieldCreatedAt,
 }
@@ -144,6 +156,12 @@ var (
 	DefaultVideoAge int64
 	// DefaultApplyCategoriesToLive holds the default value on creation for the "apply_categories_to_live" field.
 	DefaultApplyCategoriesToLive bool
+	// DefaultWatchClips holds the default value on creation for the "watch_clips" field.
+	DefaultWatchClips bool
+	// DefaultClipsLimit holds the default value on creation for the "clips_limit" field.
+	DefaultClipsLimit int
+	// DefaultClipsIntervalDays holds the default value on creation for the "clips_interval_days" field.
+	DefaultClipsIntervalDays int
 	// DefaultUpdatedAt holds the default value on creation for the "updated_at" field.
 	DefaultUpdatedAt func() time.Time
 	// UpdateDefaultUpdatedAt holds the default value on update for the "updated_at" field.
@@ -227,6 +245,26 @@ func ByApplyCategoriesToLive(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldApplyCategoriesToLive, opts...).ToFunc()
 }
 
+// ByWatchClips orders the results by the watch_clips field.
+func ByWatchClips(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldWatchClips, opts...).ToFunc()
+}
+
+// ByClipsLimit orders the results by the clips_limit field.
+func ByClipsLimit(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldClipsLimit, opts...).ToFunc()
+}
+
+// ByClipsIntervalDays orders the results by the clips_interval_days field.
+func ByClipsIntervalDays(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldClipsIntervalDays, opts...).ToFunc()
+}
+
+// ByClipsLastChecked orders the results by the clips_last_checked field.
+func ByClipsLastChecked(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldClipsLastChecked, opts...).ToFunc()
+}
+
 // ByUpdatedAt orders the results by the updated_at field.
 func ByUpdatedAt(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldUpdatedAt, opts...).ToFunc()
diff --git a/ent/live/where.go b/ent/live/where.go
index 887e620a..ec283913 100644
--- a/ent/live/where.go
+++ b/ent/live/where.go
@@ -121,6 +121,26 @@ func ApplyCategoriesToLive(v bool) predicate.Live {
 	return predicate.Live(sql.FieldEQ(FieldApplyCategoriesToLive, v))
 }
 
+// WatchClips applies equality check predicate on the "watch_clips" field. It's identical to WatchClipsEQ.
+func WatchClips(v bool) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldWatchClips, v))
+}
+
+// ClipsLimit applies equality check predicate on the "clips_limit" field. It's identical to ClipsLimitEQ.
+func ClipsLimit(v int) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsLimit, v))
+}
+
+// ClipsIntervalDays applies equality check predicate on the "clips_interval_days" field. It's identical to ClipsIntervalDaysEQ.
+func ClipsIntervalDays(v int) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsIntervalDays, v))
+}
+
+// ClipsLastChecked applies equality check predicate on the "clips_last_checked" field. It's identical to ClipsLastCheckedEQ.
+func ClipsLastChecked(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsLastChecked, v))
+}
+
 // UpdatedAt applies equality check predicate on the "updated_at" field. It's identical to UpdatedAtEQ.
 func UpdatedAt(v time.Time) predicate.Live {
 	return predicate.Live(sql.FieldEQ(FieldUpdatedAt, v))
@@ -386,6 +406,146 @@ func ApplyCategoriesToLiveNEQ(v bool) predicate.Live {
 	return predicate.Live(sql.FieldNEQ(FieldApplyCategoriesToLive, v))
 }
 
+// WatchClipsEQ applies the EQ predicate on the "watch_clips" field.
+func WatchClipsEQ(v bool) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldWatchClips, v))
+}
+
+// WatchClipsNEQ applies the NEQ predicate on the "watch_clips" field.
+func WatchClipsNEQ(v bool) predicate.Live {
+	return predicate.Live(sql.FieldNEQ(FieldWatchClips, v))
+}
+
+// ClipsLimitEQ applies the EQ predicate on the "clips_limit" field.
+func ClipsLimitEQ(v int) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsLimit, v))
+}
+
+// ClipsLimitNEQ applies the NEQ predicate on the "clips_limit" field.
+func ClipsLimitNEQ(v int) predicate.Live {
+	return predicate.Live(sql.FieldNEQ(FieldClipsLimit, v))
+}
+
+// ClipsLimitIn applies the In predicate on the "clips_limit" field.
+func ClipsLimitIn(vs ...int) predicate.Live {
+	return predicate.Live(sql.FieldIn(FieldClipsLimit, vs...))
+}
+
+// ClipsLimitNotIn applies the NotIn predicate on the "clips_limit" field.
+func ClipsLimitNotIn(vs ...int) predicate.Live {
+	return predicate.Live(sql.FieldNotIn(FieldClipsLimit, vs...))
+}
+
+// ClipsLimitGT applies the GT predicate on the "clips_limit" field.
+func ClipsLimitGT(v int) predicate.Live {
+	return predicate.Live(sql.FieldGT(FieldClipsLimit, v))
+}
+
+// ClipsLimitGTE applies the GTE predicate on the "clips_limit" field.
+func ClipsLimitGTE(v int) predicate.Live {
+	return predicate.Live(sql.FieldGTE(FieldClipsLimit, v))
+}
+
+// ClipsLimitLT applies the LT predicate on the "clips_limit" field.
+func ClipsLimitLT(v int) predicate.Live {
+	return predicate.Live(sql.FieldLT(FieldClipsLimit, v))
+}
+
+// ClipsLimitLTE applies the LTE predicate on the "clips_limit" field.
+func ClipsLimitLTE(v int) predicate.Live {
+	return predicate.Live(sql.FieldLTE(FieldClipsLimit, v))
+}
+
+// ClipsIntervalDaysEQ applies the EQ predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysEQ(v int) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsIntervalDays, v))
+}
+
+// ClipsIntervalDaysNEQ applies the NEQ predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysNEQ(v int) predicate.Live {
+	return predicate.Live(sql.FieldNEQ(FieldClipsIntervalDays, v))
+}
+
+// ClipsIntervalDaysIn applies the In predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysIn(vs ...int) predicate.Live {
+	return predicate.Live(sql.FieldIn(FieldClipsIntervalDays, vs...))
+}
+
+// ClipsIntervalDaysNotIn applies the NotIn predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysNotIn(vs ...int) predicate.Live {
+	return predicate.Live(sql.FieldNotIn(FieldClipsIntervalDays, vs...))
+}
+
+// ClipsIntervalDaysGT applies the GT predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysGT(v int) predicate.Live {
+	return predicate.Live(sql.FieldGT(FieldClipsIntervalDays, v))
+}
+
+// ClipsIntervalDaysGTE applies the GTE predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysGTE(v int) predicate.Live {
+	return predicate.Live(sql.FieldGTE(FieldClipsIntervalDays, v))
+}
+
+// ClipsIntervalDaysLT applies the LT predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysLT(v int) predicate.Live {
+	return predicate.Live(sql.FieldLT(FieldClipsIntervalDays, v))
+}
+
+// ClipsIntervalDaysLTE applies the LTE predicate on the "clips_interval_days" field.
+func ClipsIntervalDaysLTE(v int) predicate.Live {
+	return predicate.Live(sql.FieldLTE(FieldClipsIntervalDays, v))
+}
+
+// ClipsLastCheckedEQ applies the EQ predicate on the "clips_last_checked" field.
+func ClipsLastCheckedEQ(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldEQ(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedNEQ applies the NEQ predicate on the "clips_last_checked" field.
+func ClipsLastCheckedNEQ(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldNEQ(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedIn applies the In predicate on the "clips_last_checked" field.
+func ClipsLastCheckedIn(vs ...time.Time) predicate.Live {
+	return predicate.Live(sql.FieldIn(FieldClipsLastChecked, vs...))
+}
+
+// ClipsLastCheckedNotIn applies the NotIn predicate on the "clips_last_checked" field.
+func ClipsLastCheckedNotIn(vs ...time.Time) predicate.Live {
+	return predicate.Live(sql.FieldNotIn(FieldClipsLastChecked, vs...))
+}
+
+// ClipsLastCheckedGT applies the GT predicate on the "clips_last_checked" field.
+func ClipsLastCheckedGT(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldGT(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedGTE applies the GTE predicate on the "clips_last_checked" field.
+func ClipsLastCheckedGTE(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldGTE(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedLT applies the LT predicate on the "clips_last_checked" field.
+func ClipsLastCheckedLT(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldLT(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedLTE applies the LTE predicate on the "clips_last_checked" field.
+func ClipsLastCheckedLTE(v time.Time) predicate.Live {
+	return predicate.Live(sql.FieldLTE(FieldClipsLastChecked, v))
+}
+
+// ClipsLastCheckedIsNil applies the IsNil predicate on the "clips_last_checked" field.
+func ClipsLastCheckedIsNil() predicate.Live {
+	return predicate.Live(sql.FieldIsNull(FieldClipsLastChecked))
+}
+
+// ClipsLastCheckedNotNil applies the NotNil predicate on the "clips_last_checked" field.
+func ClipsLastCheckedNotNil() predicate.Live {
+	return predicate.Live(sql.FieldNotNull(FieldClipsLastChecked))
+}
+
 // UpdatedAtEQ applies the EQ predicate on the "updated_at" field.
 func UpdatedAtEQ(v time.Time) predicate.Live {
 	return predicate.Live(sql.FieldEQ(FieldUpdatedAt, v))
diff --git a/ent/live_create.go b/ent/live_create.go
index d91cc48a..0c5a39a5 100644
--- a/ent/live_create.go
+++ b/ent/live_create.go
@@ -209,6 +209,62 @@ func (lc *LiveCreate) SetNillableApplyCategoriesToLive(b *bool) *LiveCreate {
 	return lc
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (lc *LiveCreate) SetWatchClips(b bool) *LiveCreate {
+	lc.mutation.SetWatchClips(b)
+	return lc
+}
+
+// SetNillableWatchClips sets the "watch_clips" field if the given value is not nil.
+func (lc *LiveCreate) SetNillableWatchClips(b *bool) *LiveCreate {
+	if b != nil {
+		lc.SetWatchClips(*b)
+	}
+	return lc
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (lc *LiveCreate) SetClipsLimit(i int) *LiveCreate {
+	lc.mutation.SetClipsLimit(i)
+	return lc
+}
+
+// SetNillableClipsLimit sets the "clips_limit" field if the given value is not nil.
+func (lc *LiveCreate) SetNillableClipsLimit(i *int) *LiveCreate {
+	if i != nil {
+		lc.SetClipsLimit(*i)
+	}
+	return lc
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (lc *LiveCreate) SetClipsIntervalDays(i int) *LiveCreate {
+	lc.mutation.SetClipsIntervalDays(i)
+	return lc
+}
+
+// SetNillableClipsIntervalDays sets the "clips_interval_days" field if the given value is not nil.
+func (lc *LiveCreate) SetNillableClipsIntervalDays(i *int) *LiveCreate {
+	if i != nil {
+		lc.SetClipsIntervalDays(*i)
+	}
+	return lc
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (lc *LiveCreate) SetClipsLastChecked(t time.Time) *LiveCreate {
+	lc.mutation.SetClipsLastChecked(t)
+	return lc
+}
+
+// SetNillableClipsLastChecked sets the "clips_last_checked" field if the given value is not nil.
+func (lc *LiveCreate) SetNillableClipsLastChecked(t *time.Time) *LiveCreate {
+	if t != nil {
+		lc.SetClipsLastChecked(*t)
+	}
+	return lc
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (lc *LiveCreate) SetUpdatedAt(t time.Time) *LiveCreate {
 	lc.mutation.SetUpdatedAt(t)
@@ -379,6 +435,18 @@ func (lc *LiveCreate) defaults() {
 		v := live.DefaultApplyCategoriesToLive
 		lc.mutation.SetApplyCategoriesToLive(v)
 	}
+	if _, ok := lc.mutation.WatchClips(); !ok {
+		v := live.DefaultWatchClips
+		lc.mutation.SetWatchClips(v)
+	}
+	if _, ok := lc.mutation.ClipsLimit(); !ok {
+		v := live.DefaultClipsLimit
+		lc.mutation.SetClipsLimit(v)
+	}
+	if _, ok := lc.mutation.ClipsIntervalDays(); !ok {
+		v := live.DefaultClipsIntervalDays
+		lc.mutation.SetClipsIntervalDays(v)
+	}
 	if _, ok := lc.mutation.UpdatedAt(); !ok {
 		v := live.DefaultUpdatedAt()
 		lc.mutation.SetUpdatedAt(v)
@@ -431,6 +499,15 @@ func (lc *LiveCreate) check() error {
 	if _, ok := lc.mutation.ApplyCategoriesToLive(); !ok {
 		return &ValidationError{Name: "apply_categories_to_live", err: errors.New(`ent: missing required field "Live.apply_categories_to_live"`)}
 	}
+	if _, ok := lc.mutation.WatchClips(); !ok {
+		return &ValidationError{Name: "watch_clips", err: errors.New(`ent: missing required field "Live.watch_clips"`)}
+	}
+	if _, ok := lc.mutation.ClipsLimit(); !ok {
+		return &ValidationError{Name: "clips_limit", err: errors.New(`ent: missing required field "Live.clips_limit"`)}
+	}
+	if _, ok := lc.mutation.ClipsIntervalDays(); !ok {
+		return &ValidationError{Name: "clips_interval_days", err: errors.New(`ent: missing required field "Live.clips_interval_days"`)}
+	}
 	if _, ok := lc.mutation.UpdatedAt(); !ok {
 		return &ValidationError{Name: "updated_at", err: errors.New(`ent: missing required field "Live.updated_at"`)}
 	}
@@ -528,6 +605,22 @@ func (lc *LiveCreate) createSpec() (*Live, *sqlgraph.CreateSpec) {
 		_spec.SetField(live.FieldApplyCategoriesToLive, field.TypeBool, value)
 		_node.ApplyCategoriesToLive = value
 	}
+	if value, ok := lc.mutation.WatchClips(); ok {
+		_spec.SetField(live.FieldWatchClips, field.TypeBool, value)
+		_node.WatchClips = value
+	}
+	if value, ok := lc.mutation.ClipsLimit(); ok {
+		_spec.SetField(live.FieldClipsLimit, field.TypeInt, value)
+		_node.ClipsLimit = value
+	}
+	if value, ok := lc.mutation.ClipsIntervalDays(); ok {
+		_spec.SetField(live.FieldClipsIntervalDays, field.TypeInt, value)
+		_node.ClipsIntervalDays = value
+	}
+	if value, ok := lc.mutation.ClipsLastChecked(); ok {
+		_spec.SetField(live.FieldClipsLastChecked, field.TypeTime, value)
+		_node.ClipsLastChecked = value
+	}
 	if value, ok := lc.mutation.UpdatedAt(); ok {
 		_spec.SetField(live.FieldUpdatedAt, field.TypeTime, value)
 		_node.UpdatedAt = value
@@ -805,6 +898,72 @@ func (u *LiveUpsert) UpdateApplyCategoriesToLive() *LiveUpsert {
 	return u
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (u *LiveUpsert) SetWatchClips(v bool) *LiveUpsert {
+	u.Set(live.FieldWatchClips, v)
+	return u
+}
+
+// UpdateWatchClips sets the "watch_clips" field to the value that was provided on create.
+func (u *LiveUpsert) UpdateWatchClips() *LiveUpsert {
+	u.SetExcluded(live.FieldWatchClips)
+	return u
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (u *LiveUpsert) SetClipsLimit(v int) *LiveUpsert {
+	u.Set(live.FieldClipsLimit, v)
+	return u
+}
+
+// UpdateClipsLimit sets the "clips_limit" field to the value that was provided on create.
+func (u *LiveUpsert) UpdateClipsLimit() *LiveUpsert {
+	u.SetExcluded(live.FieldClipsLimit)
+	return u
+}
+
+// AddClipsLimit adds v to the "clips_limit" field.
+func (u *LiveUpsert) AddClipsLimit(v int) *LiveUpsert {
+	u.Add(live.FieldClipsLimit, v)
+	return u
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (u *LiveUpsert) SetClipsIntervalDays(v int) *LiveUpsert {
+	u.Set(live.FieldClipsIntervalDays, v)
+	return u
+}
+
+// UpdateClipsIntervalDays sets the "clips_interval_days" field to the value that was provided on create.
+func (u *LiveUpsert) UpdateClipsIntervalDays() *LiveUpsert {
+	u.SetExcluded(live.FieldClipsIntervalDays)
+	return u
+}
+
+// AddClipsIntervalDays adds v to the "clips_interval_days" field.
+func (u *LiveUpsert) AddClipsIntervalDays(v int) *LiveUpsert {
+	u.Add(live.FieldClipsIntervalDays, v)
+	return u
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (u *LiveUpsert) SetClipsLastChecked(v time.Time) *LiveUpsert {
+	u.Set(live.FieldClipsLastChecked, v)
+	return u
+}
+
+// UpdateClipsLastChecked sets the "clips_last_checked" field to the value that was provided on create.
+func (u *LiveUpsert) UpdateClipsLastChecked() *LiveUpsert {
+	u.SetExcluded(live.FieldClipsLastChecked)
+	return u
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (u *LiveUpsert) ClearClipsLastChecked() *LiveUpsert {
+	u.SetNull(live.FieldClipsLastChecked)
+	return u
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (u *LiveUpsert) SetUpdatedAt(v time.Time) *LiveUpsert {
 	u.Set(live.FieldUpdatedAt, v)
@@ -1064,6 +1223,83 @@ func (u *LiveUpsertOne) UpdateApplyCategoriesToLive() *LiveUpsertOne {
 	})
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (u *LiveUpsertOne) SetWatchClips(v bool) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetWatchClips(v)
+	})
+}
+
+// UpdateWatchClips sets the "watch_clips" field to the value that was provided on create.
+func (u *LiveUpsertOne) UpdateWatchClips() *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateWatchClips()
+	})
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (u *LiveUpsertOne) SetClipsLimit(v int) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsLimit(v)
+	})
+}
+
+// AddClipsLimit adds v to the "clips_limit" field.
+func (u *LiveUpsertOne) AddClipsLimit(v int) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.AddClipsLimit(v)
+	})
+}
+
+// UpdateClipsLimit sets the "clips_limit" field to the value that was provided on create.
+func (u *LiveUpsertOne) UpdateClipsLimit() *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsLimit()
+	})
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (u *LiveUpsertOne) SetClipsIntervalDays(v int) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsIntervalDays(v)
+	})
+}
+
+// AddClipsIntervalDays adds v to the "clips_interval_days" field.
+func (u *LiveUpsertOne) AddClipsIntervalDays(v int) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.AddClipsIntervalDays(v)
+	})
+}
+
+// UpdateClipsIntervalDays sets the "clips_interval_days" field to the value that was provided on create.
+func (u *LiveUpsertOne) UpdateClipsIntervalDays() *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsIntervalDays()
+	})
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (u *LiveUpsertOne) SetClipsLastChecked(v time.Time) *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsLastChecked(v)
+	})
+}
+
+// UpdateClipsLastChecked sets the "clips_last_checked" field to the value that was provided on create.
+func (u *LiveUpsertOne) UpdateClipsLastChecked() *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsLastChecked()
+	})
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (u *LiveUpsertOne) ClearClipsLastChecked() *LiveUpsertOne {
+	return u.Update(func(s *LiveUpsert) {
+		s.ClearClipsLastChecked()
+	})
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (u *LiveUpsertOne) SetUpdatedAt(v time.Time) *LiveUpsertOne {
 	return u.Update(func(s *LiveUpsert) {
@@ -1492,6 +1728,83 @@ func (u *LiveUpsertBulk) UpdateApplyCategoriesToLive() *LiveUpsertBulk {
 	})
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (u *LiveUpsertBulk) SetWatchClips(v bool) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetWatchClips(v)
+	})
+}
+
+// UpdateWatchClips sets the "watch_clips" field to the value that was provided on create.
+func (u *LiveUpsertBulk) UpdateWatchClips() *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateWatchClips()
+	})
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (u *LiveUpsertBulk) SetClipsLimit(v int) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsLimit(v)
+	})
+}
+
+// AddClipsLimit adds v to the "clips_limit" field.
+func (u *LiveUpsertBulk) AddClipsLimit(v int) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.AddClipsLimit(v)
+	})
+}
+
+// UpdateClipsLimit sets the "clips_limit" field to the value that was provided on create.
+func (u *LiveUpsertBulk) UpdateClipsLimit() *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsLimit()
+	})
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (u *LiveUpsertBulk) SetClipsIntervalDays(v int) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsIntervalDays(v)
+	})
+}
+
+// AddClipsIntervalDays adds v to the "clips_interval_days" field.
+func (u *LiveUpsertBulk) AddClipsIntervalDays(v int) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.AddClipsIntervalDays(v)
+	})
+}
+
+// UpdateClipsIntervalDays sets the "clips_interval_days" field to the value that was provided on create.
+func (u *LiveUpsertBulk) UpdateClipsIntervalDays() *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsIntervalDays()
+	})
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (u *LiveUpsertBulk) SetClipsLastChecked(v time.Time) *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.SetClipsLastChecked(v)
+	})
+}
+
+// UpdateClipsLastChecked sets the "clips_last_checked" field to the value that was provided on create.
+func (u *LiveUpsertBulk) UpdateClipsLastChecked() *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.UpdateClipsLastChecked()
+	})
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (u *LiveUpsertBulk) ClearClipsLastChecked() *LiveUpsertBulk {
+	return u.Update(func(s *LiveUpsert) {
+		s.ClearClipsLastChecked()
+	})
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (u *LiveUpsertBulk) SetUpdatedAt(v time.Time) *LiveUpsertBulk {
 	return u.Update(func(s *LiveUpsert) {
diff --git a/ent/live_query.go b/ent/live_query.go
index 8e66e2cf..8173651c 100644
--- a/ent/live_query.go
+++ b/ent/live_query.go
@@ -372,7 +372,7 @@ func (lq *LiveQuery) WithTitleRegex(opts ...func(*LiveTitleRegexQuery)) *LiveQue
 // Example:
 //
 //	var v []struct {
-//		WatchLive bool `json:"watch_live,omitempty"`
+//		WatchLive bool `json:"watch_live"`
 //		Count int `json:"count,omitempty"`
 //	}
 //
@@ -395,7 +395,7 @@ func (lq *LiveQuery) GroupBy(field string, fields ...string) *LiveGroupBy {
 // Example:
 //
 //	var v []struct {
-//		WatchLive bool `json:"watch_live,omitempty"`
+//		WatchLive bool `json:"watch_live"`
 //	}
 //
 //	client.Live.Query().
diff --git a/ent/live_update.go b/ent/live_update.go
index d58af1cf..7caf38fe 100644
--- a/ent/live_update.go
+++ b/ent/live_update.go
@@ -227,6 +227,82 @@ func (lu *LiveUpdate) SetNillableApplyCategoriesToLive(b *bool) *LiveUpdate {
 	return lu
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (lu *LiveUpdate) SetWatchClips(b bool) *LiveUpdate {
+	lu.mutation.SetWatchClips(b)
+	return lu
+}
+
+// SetNillableWatchClips sets the "watch_clips" field if the given value is not nil.
+func (lu *LiveUpdate) SetNillableWatchClips(b *bool) *LiveUpdate {
+	if b != nil {
+		lu.SetWatchClips(*b)
+	}
+	return lu
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (lu *LiveUpdate) SetClipsLimit(i int) *LiveUpdate {
+	lu.mutation.ResetClipsLimit()
+	lu.mutation.SetClipsLimit(i)
+	return lu
+}
+
+// SetNillableClipsLimit sets the "clips_limit" field if the given value is not nil.
+func (lu *LiveUpdate) SetNillableClipsLimit(i *int) *LiveUpdate {
+	if i != nil {
+		lu.SetClipsLimit(*i)
+	}
+	return lu
+}
+
+// AddClipsLimit adds i to the "clips_limit" field.
+func (lu *LiveUpdate) AddClipsLimit(i int) *LiveUpdate {
+	lu.mutation.AddClipsLimit(i)
+	return lu
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (lu *LiveUpdate) SetClipsIntervalDays(i int) *LiveUpdate {
+	lu.mutation.ResetClipsIntervalDays()
+	lu.mutation.SetClipsIntervalDays(i)
+	return lu
+}
+
+// SetNillableClipsIntervalDays sets the "clips_interval_days" field if the given value is not nil.
+func (lu *LiveUpdate) SetNillableClipsIntervalDays(i *int) *LiveUpdate {
+	if i != nil {
+		lu.SetClipsIntervalDays(*i)
+	}
+	return lu
+}
+
+// AddClipsIntervalDays adds i to the "clips_interval_days" field.
+func (lu *LiveUpdate) AddClipsIntervalDays(i int) *LiveUpdate {
+	lu.mutation.AddClipsIntervalDays(i)
+	return lu
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (lu *LiveUpdate) SetClipsLastChecked(t time.Time) *LiveUpdate {
+	lu.mutation.SetClipsLastChecked(t)
+	return lu
+}
+
+// SetNillableClipsLastChecked sets the "clips_last_checked" field if the given value is not nil.
+func (lu *LiveUpdate) SetNillableClipsLastChecked(t *time.Time) *LiveUpdate {
+	if t != nil {
+		lu.SetClipsLastChecked(*t)
+	}
+	return lu
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (lu *LiveUpdate) ClearClipsLastChecked() *LiveUpdate {
+	lu.mutation.ClearClipsLastChecked()
+	return lu
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (lu *LiveUpdate) SetUpdatedAt(t time.Time) *LiveUpdate {
 	lu.mutation.SetUpdatedAt(t)
@@ -428,6 +504,27 @@ func (lu *LiveUpdate) sqlSave(ctx context.Context) (n int, err error) {
 	if value, ok := lu.mutation.ApplyCategoriesToLive(); ok {
 		_spec.SetField(live.FieldApplyCategoriesToLive, field.TypeBool, value)
 	}
+	if value, ok := lu.mutation.WatchClips(); ok {
+		_spec.SetField(live.FieldWatchClips, field.TypeBool, value)
+	}
+	if value, ok := lu.mutation.ClipsLimit(); ok {
+		_spec.SetField(live.FieldClipsLimit, field.TypeInt, value)
+	}
+	if value, ok := lu.mutation.AddedClipsLimit(); ok {
+		_spec.AddField(live.FieldClipsLimit, field.TypeInt, value)
+	}
+	if value, ok := lu.mutation.ClipsIntervalDays(); ok {
+		_spec.SetField(live.FieldClipsIntervalDays, field.TypeInt, value)
+	}
+	if value, ok := lu.mutation.AddedClipsIntervalDays(); ok {
+		_spec.AddField(live.FieldClipsIntervalDays, field.TypeInt, value)
+	}
+	if value, ok := lu.mutation.ClipsLastChecked(); ok {
+		_spec.SetField(live.FieldClipsLastChecked, field.TypeTime, value)
+	}
+	if lu.mutation.ClipsLastCheckedCleared() {
+		_spec.ClearField(live.FieldClipsLastChecked, field.TypeTime)
+	}
 	if value, ok := lu.mutation.UpdatedAt(); ok {
 		_spec.SetField(live.FieldUpdatedAt, field.TypeTime, value)
 	}
@@ -765,6 +862,82 @@ func (luo *LiveUpdateOne) SetNillableApplyCategoriesToLive(b *bool) *LiveUpdateO
 	return luo
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (luo *LiveUpdateOne) SetWatchClips(b bool) *LiveUpdateOne {
+	luo.mutation.SetWatchClips(b)
+	return luo
+}
+
+// SetNillableWatchClips sets the "watch_clips" field if the given value is not nil.
+func (luo *LiveUpdateOne) SetNillableWatchClips(b *bool) *LiveUpdateOne {
+	if b != nil {
+		luo.SetWatchClips(*b)
+	}
+	return luo
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (luo *LiveUpdateOne) SetClipsLimit(i int) *LiveUpdateOne {
+	luo.mutation.ResetClipsLimit()
+	luo.mutation.SetClipsLimit(i)
+	return luo
+}
+
+// SetNillableClipsLimit sets the "clips_limit" field if the given value is not nil.
+func (luo *LiveUpdateOne) SetNillableClipsLimit(i *int) *LiveUpdateOne {
+	if i != nil {
+		luo.SetClipsLimit(*i)
+	}
+	return luo
+}
+
+// AddClipsLimit adds i to the "clips_limit" field.
+func (luo *LiveUpdateOne) AddClipsLimit(i int) *LiveUpdateOne {
+	luo.mutation.AddClipsLimit(i)
+	return luo
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (luo *LiveUpdateOne) SetClipsIntervalDays(i int) *LiveUpdateOne {
+	luo.mutation.ResetClipsIntervalDays()
+	luo.mutation.SetClipsIntervalDays(i)
+	return luo
+}
+
+// SetNillableClipsIntervalDays sets the "clips_interval_days" field if the given value is not nil.
+func (luo *LiveUpdateOne) SetNillableClipsIntervalDays(i *int) *LiveUpdateOne {
+	if i != nil {
+		luo.SetClipsIntervalDays(*i)
+	}
+	return luo
+}
+
+// AddClipsIntervalDays adds i to the "clips_interval_days" field.
+func (luo *LiveUpdateOne) AddClipsIntervalDays(i int) *LiveUpdateOne {
+	luo.mutation.AddClipsIntervalDays(i)
+	return luo
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (luo *LiveUpdateOne) SetClipsLastChecked(t time.Time) *LiveUpdateOne {
+	luo.mutation.SetClipsLastChecked(t)
+	return luo
+}
+
+// SetNillableClipsLastChecked sets the "clips_last_checked" field if the given value is not nil.
+func (luo *LiveUpdateOne) SetNillableClipsLastChecked(t *time.Time) *LiveUpdateOne {
+	if t != nil {
+		luo.SetClipsLastChecked(*t)
+	}
+	return luo
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (luo *LiveUpdateOne) ClearClipsLastChecked() *LiveUpdateOne {
+	luo.mutation.ClearClipsLastChecked()
+	return luo
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (luo *LiveUpdateOne) SetUpdatedAt(t time.Time) *LiveUpdateOne {
 	luo.mutation.SetUpdatedAt(t)
@@ -996,6 +1169,27 @@ func (luo *LiveUpdateOne) sqlSave(ctx context.Context) (_node *Live, err error)
 	if value, ok := luo.mutation.ApplyCategoriesToLive(); ok {
 		_spec.SetField(live.FieldApplyCategoriesToLive, field.TypeBool, value)
 	}
+	if value, ok := luo.mutation.WatchClips(); ok {
+		_spec.SetField(live.FieldWatchClips, field.TypeBool, value)
+	}
+	if value, ok := luo.mutation.ClipsLimit(); ok {
+		_spec.SetField(live.FieldClipsLimit, field.TypeInt, value)
+	}
+	if value, ok := luo.mutation.AddedClipsLimit(); ok {
+		_spec.AddField(live.FieldClipsLimit, field.TypeInt, value)
+	}
+	if value, ok := luo.mutation.ClipsIntervalDays(); ok {
+		_spec.SetField(live.FieldClipsIntervalDays, field.TypeInt, value)
+	}
+	if value, ok := luo.mutation.AddedClipsIntervalDays(); ok {
+		_spec.AddField(live.FieldClipsIntervalDays, field.TypeInt, value)
+	}
+	if value, ok := luo.mutation.ClipsLastChecked(); ok {
+		_spec.SetField(live.FieldClipsLastChecked, field.TypeTime, value)
+	}
+	if luo.mutation.ClipsLastCheckedCleared() {
+		_spec.ClearField(live.FieldClipsLastChecked, field.TypeTime)
+	}
 	if value, ok := luo.mutation.UpdatedAt(); ok {
 		_spec.SetField(live.FieldUpdatedAt, field.TypeTime, value)
 	}
diff --git a/ent/migrate/schema.go b/ent/migrate/schema.go
index fc162561..0fc70aa5 100644
--- a/ent/migrate/schema.go
+++ b/ent/migrate/schema.go
@@ -76,6 +76,10 @@ var (
 		{Name: "render_chat", Type: field.TypeBool, Default: true},
 		{Name: "video_age", Type: field.TypeInt64, Default: 0},
 		{Name: "apply_categories_to_live", Type: field.TypeBool, Default: false},
+		{Name: "watch_clips", Type: field.TypeBool, Default: false},
+		{Name: "clips_limit", Type: field.TypeInt, Default: 0},
+		{Name: "clips_interval_days", Type: field.TypeInt, Default: 0},
+		{Name: "clips_last_checked", Type: field.TypeTime, Nullable: true},
 		{Name: "updated_at", Type: field.TypeTime},
 		{Name: "created_at", Type: field.TypeTime},
 		{Name: "channel_live", Type: field.TypeUUID},
@@ -88,7 +92,7 @@ var (
 		ForeignKeys: []*schema.ForeignKey{
 			{
 				Symbol:     "lives_channels_live",
-				Columns:    []*schema.Column{LivesColumns[16]},
+				Columns:    []*schema.Column{LivesColumns[20]},
 				RefColumns: []*schema.Column{ChannelsColumns[0]},
 				OnDelete:   schema.NoAction,
 			},
@@ -256,6 +260,26 @@ var (
 			},
 		},
 	}
+	// SessionsColumns holds the columns for the "sessions" table.
+	SessionsColumns = []*schema.Column{
+		{Name: "id", Type: field.TypeInt, Increment: true},
+		{Name: "token", Type: field.TypeString, Unique: true, Size: 2147483647},
+		{Name: "data", Type: field.TypeBytes},
+		{Name: "expiry", Type: field.TypeTime},
+	}
+	// SessionsTable holds the schema information for the "sessions" table.
+	SessionsTable = &schema.Table{
+		Name:       "sessions",
+		Columns:    SessionsColumns,
+		PrimaryKey: []*schema.Column{SessionsColumns[0]},
+		Indexes: []*schema.Index{
+			{
+				Name:    "sessions_expiry",
+				Unique:  false,
+				Columns: []*schema.Column{SessionsColumns[3]},
+			},
+		},
+	}
 	// TwitchCategoriesColumns holds the columns for the "twitch_categories" table.
 	TwitchCategoriesColumns = []*schema.Column{
 		{Name: "id", Type: field.TypeString},
@@ -293,11 +317,13 @@ var (
 	VodsColumns = []*schema.Column{
 		{Name: "id", Type: field.TypeUUID},
 		{Name: "ext_id", Type: field.TypeString},
+		{Name: "clip_ext_vod_id", Type: field.TypeString, Nullable: true},
 		{Name: "ext_stream_id", Type: field.TypeString, Nullable: true},
 		{Name: "platform", Type: field.TypeEnum, Enums: []string{"twitch", "youtube"}, Default: "twitch"},
 		{Name: "type", Type: field.TypeEnum, Enums: []string{"archive", "live", "highlight", "upload", "clip"}, Default: "archive"},
 		{Name: "title", Type: field.TypeString},
 		{Name: "duration", Type: field.TypeInt, Default: 1},
+		{Name: "clip_vod_offset", Type: field.TypeInt, Nullable: true},
 		{Name: "views", Type: field.TypeInt, Default: 1},
 		{Name: "resolution", Type: field.TypeString, Nullable: true},
 		{Name: "processing", Type: field.TypeBool, Default: false},
@@ -322,6 +348,13 @@ var (
 		{Name: "tmp_video_hls_path", Type: field.TypeString, Nullable: true},
 		{Name: "locked", Type: field.TypeBool, Default: false},
 		{Name: "local_views", Type: field.TypeInt, Default: 0},
+		{Name: "sprite_thumbnails_enabled", Type: field.TypeBool, Default: false},
+		{Name: "sprite_thumbnails_images", Type: field.TypeJSON, Nullable: true},
+		{Name: "sprite_thumbnails_interval", Type: field.TypeInt, Nullable: true},
+		{Name: "sprite_thumbnails_width", Type: field.TypeInt, Nullable: true},
+		{Name: "sprite_thumbnails_height", Type: field.TypeInt, Nullable: true},
+		{Name: "sprite_thumbnails_rows", Type: field.TypeInt, Nullable: true},
+		{Name: "sprite_thumbnails_columns", Type: field.TypeInt, Nullable: true},
 		{Name: "streamed_at", Type: field.TypeTime},
 		{Name: "updated_at", Type: field.TypeTime},
 		{Name: "created_at", Type: field.TypeTime},
@@ -335,7 +368,7 @@ var (
 		ForeignKeys: []*schema.ForeignKey{
 			{
 				Symbol:     "vods_channels_vods",
-				Columns:    []*schema.Column{VodsColumns[34]},
+				Columns:    []*schema.Column{VodsColumns[43]},
 				RefColumns: []*schema.Column{ChannelsColumns[0]},
 				OnDelete:   schema.NoAction,
 			},
@@ -379,6 +412,7 @@ var (
 		PlaybacksTable,
 		PlaylistsTable,
 		QueuesTable,
+		SessionsTable,
 		TwitchCategoriesTable,
 		UsersTable,
 		VodsTable,
diff --git a/ent/mutation.go b/ent/mutation.go
index caf5ea53..d478c747 100644
--- a/ent/mutation.go
+++ b/ent/mutation.go
@@ -24,6 +24,7 @@ import (
 	"github.com/zibbp/ganymede/ent/playlist"
 	"github.com/zibbp/ganymede/ent/predicate"
 	"github.com/zibbp/ganymede/ent/queue"
+	"github.com/zibbp/ganymede/ent/sessions"
 	"github.com/zibbp/ganymede/ent/twitchcategory"
 	"github.com/zibbp/ganymede/ent/user"
 	"github.com/zibbp/ganymede/ent/vod"
@@ -50,6 +51,7 @@ const (
 	TypePlayback        = "Playback"
 	TypePlaylist        = "Playlist"
 	TypeQueue           = "Queue"
+	TypeSessions        = "Sessions"
 	TypeTwitchCategory  = "TwitchCategory"
 	TypeUser            = "User"
 	TypeVod             = "Vod"
@@ -2082,6 +2084,12 @@ type LiveMutation struct {
 	video_age                *int64
 	addvideo_age             *int64
 	apply_categories_to_live *bool
+	watch_clips              *bool
+	clips_limit              *int
+	addclips_limit           *int
+	clips_interval_days      *int
+	addclips_interval_days   *int
+	clips_last_checked       *time.Time
 	updated_at               *time.Time
 	created_at               *time.Time
 	clearedFields            map[string]struct{}
@@ -2703,6 +2711,203 @@ func (m *LiveMutation) ResetApplyCategoriesToLive() {
 	m.apply_categories_to_live = nil
 }
 
+// SetWatchClips sets the "watch_clips" field.
+func (m *LiveMutation) SetWatchClips(b bool) {
+	m.watch_clips = &b
+}
+
+// WatchClips returns the value of the "watch_clips" field in the mutation.
+func (m *LiveMutation) WatchClips() (r bool, exists bool) {
+	v := m.watch_clips
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldWatchClips returns the old "watch_clips" field's value of the Live entity.
+// If the Live object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *LiveMutation) OldWatchClips(ctx context.Context) (v bool, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldWatchClips is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldWatchClips requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldWatchClips: %w", err)
+	}
+	return oldValue.WatchClips, nil
+}
+
+// ResetWatchClips resets all changes to the "watch_clips" field.
+func (m *LiveMutation) ResetWatchClips() {
+	m.watch_clips = nil
+}
+
+// SetClipsLimit sets the "clips_limit" field.
+func (m *LiveMutation) SetClipsLimit(i int) {
+	m.clips_limit = &i
+	m.addclips_limit = nil
+}
+
+// ClipsLimit returns the value of the "clips_limit" field in the mutation.
+func (m *LiveMutation) ClipsLimit() (r int, exists bool) {
+	v := m.clips_limit
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldClipsLimit returns the old "clips_limit" field's value of the Live entity.
+// If the Live object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *LiveMutation) OldClipsLimit(ctx context.Context) (v int, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldClipsLimit is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldClipsLimit requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldClipsLimit: %w", err)
+	}
+	return oldValue.ClipsLimit, nil
+}
+
+// AddClipsLimit adds i to the "clips_limit" field.
+func (m *LiveMutation) AddClipsLimit(i int) {
+	if m.addclips_limit != nil {
+		*m.addclips_limit += i
+	} else {
+		m.addclips_limit = &i
+	}
+}
+
+// AddedClipsLimit returns the value that was added to the "clips_limit" field in this mutation.
+func (m *LiveMutation) AddedClipsLimit() (r int, exists bool) {
+	v := m.addclips_limit
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ResetClipsLimit resets all changes to the "clips_limit" field.
+func (m *LiveMutation) ResetClipsLimit() {
+	m.clips_limit = nil
+	m.addclips_limit = nil
+}
+
+// SetClipsIntervalDays sets the "clips_interval_days" field.
+func (m *LiveMutation) SetClipsIntervalDays(i int) {
+	m.clips_interval_days = &i
+	m.addclips_interval_days = nil
+}
+
+// ClipsIntervalDays returns the value of the "clips_interval_days" field in the mutation.
+func (m *LiveMutation) ClipsIntervalDays() (r int, exists bool) {
+	v := m.clips_interval_days
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldClipsIntervalDays returns the old "clips_interval_days" field's value of the Live entity.
+// If the Live object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *LiveMutation) OldClipsIntervalDays(ctx context.Context) (v int, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldClipsIntervalDays is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldClipsIntervalDays requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldClipsIntervalDays: %w", err)
+	}
+	return oldValue.ClipsIntervalDays, nil
+}
+
+// AddClipsIntervalDays adds i to the "clips_interval_days" field.
+func (m *LiveMutation) AddClipsIntervalDays(i int) {
+	if m.addclips_interval_days != nil {
+		*m.addclips_interval_days += i
+	} else {
+		m.addclips_interval_days = &i
+	}
+}
+
+// AddedClipsIntervalDays returns the value that was added to the "clips_interval_days" field in this mutation.
+func (m *LiveMutation) AddedClipsIntervalDays() (r int, exists bool) {
+	v := m.addclips_interval_days
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ResetClipsIntervalDays resets all changes to the "clips_interval_days" field.
+func (m *LiveMutation) ResetClipsIntervalDays() {
+	m.clips_interval_days = nil
+	m.addclips_interval_days = nil
+}
+
+// SetClipsLastChecked sets the "clips_last_checked" field.
+func (m *LiveMutation) SetClipsLastChecked(t time.Time) {
+	m.clips_last_checked = &t
+}
+
+// ClipsLastChecked returns the value of the "clips_last_checked" field in the mutation.
+func (m *LiveMutation) ClipsLastChecked() (r time.Time, exists bool) {
+	v := m.clips_last_checked
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldClipsLastChecked returns the old "clips_last_checked" field's value of the Live entity.
+// If the Live object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *LiveMutation) OldClipsLastChecked(ctx context.Context) (v time.Time, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldClipsLastChecked is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldClipsLastChecked requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldClipsLastChecked: %w", err)
+	}
+	return oldValue.ClipsLastChecked, nil
+}
+
+// ClearClipsLastChecked clears the value of the "clips_last_checked" field.
+func (m *LiveMutation) ClearClipsLastChecked() {
+	m.clips_last_checked = nil
+	m.clearedFields[live.FieldClipsLastChecked] = struct{}{}
+}
+
+// ClipsLastCheckedCleared returns if the "clips_last_checked" field was cleared in this mutation.
+func (m *LiveMutation) ClipsLastCheckedCleared() bool {
+	_, ok := m.clearedFields[live.FieldClipsLastChecked]
+	return ok
+}
+
+// ResetClipsLastChecked resets all changes to the "clips_last_checked" field.
+func (m *LiveMutation) ResetClipsLastChecked() {
+	m.clips_last_checked = nil
+	delete(m.clearedFields, live.FieldClipsLastChecked)
+}
+
 // SetUpdatedAt sets the "updated_at" field.
 func (m *LiveMutation) SetUpdatedAt(t time.Time) {
 	m.updated_at = &t
@@ -2956,7 +3161,7 @@ func (m *LiveMutation) Type() string {
 // order to get all numeric fields that were incremented/decremented, call
 // AddedFields().
 func (m *LiveMutation) Fields() []string {
-	fields := make([]string, 0, 15)
+	fields := make([]string, 0, 19)
 	if m.watch_live != nil {
 		fields = append(fields, live.FieldWatchLive)
 	}
@@ -2996,6 +3201,18 @@ func (m *LiveMutation) Fields() []string {
 	if m.apply_categories_to_live != nil {
 		fields = append(fields, live.FieldApplyCategoriesToLive)
 	}
+	if m.watch_clips != nil {
+		fields = append(fields, live.FieldWatchClips)
+	}
+	if m.clips_limit != nil {
+		fields = append(fields, live.FieldClipsLimit)
+	}
+	if m.clips_interval_days != nil {
+		fields = append(fields, live.FieldClipsIntervalDays)
+	}
+	if m.clips_last_checked != nil {
+		fields = append(fields, live.FieldClipsLastChecked)
+	}
 	if m.updated_at != nil {
 		fields = append(fields, live.FieldUpdatedAt)
 	}
@@ -3036,6 +3253,14 @@ func (m *LiveMutation) Field(name string) (ent.Value, bool) {
 		return m.VideoAge()
 	case live.FieldApplyCategoriesToLive:
 		return m.ApplyCategoriesToLive()
+	case live.FieldWatchClips:
+		return m.WatchClips()
+	case live.FieldClipsLimit:
+		return m.ClipsLimit()
+	case live.FieldClipsIntervalDays:
+		return m.ClipsIntervalDays()
+	case live.FieldClipsLastChecked:
+		return m.ClipsLastChecked()
 	case live.FieldUpdatedAt:
 		return m.UpdatedAt()
 	case live.FieldCreatedAt:
@@ -3075,6 +3300,14 @@ func (m *LiveMutation) OldField(ctx context.Context, name string) (ent.Value, er
 		return m.OldVideoAge(ctx)
 	case live.FieldApplyCategoriesToLive:
 		return m.OldApplyCategoriesToLive(ctx)
+	case live.FieldWatchClips:
+		return m.OldWatchClips(ctx)
+	case live.FieldClipsLimit:
+		return m.OldClipsLimit(ctx)
+	case live.FieldClipsIntervalDays:
+		return m.OldClipsIntervalDays(ctx)
+	case live.FieldClipsLastChecked:
+		return m.OldClipsLastChecked(ctx)
 	case live.FieldUpdatedAt:
 		return m.OldUpdatedAt(ctx)
 	case live.FieldCreatedAt:
@@ -3179,6 +3412,34 @@ func (m *LiveMutation) SetField(name string, value ent.Value) error {
 		}
 		m.SetApplyCategoriesToLive(v)
 		return nil
+	case live.FieldWatchClips:
+		v, ok := value.(bool)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetWatchClips(v)
+		return nil
+	case live.FieldClipsLimit:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetClipsLimit(v)
+		return nil
+	case live.FieldClipsIntervalDays:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetClipsIntervalDays(v)
+		return nil
+	case live.FieldClipsLastChecked:
+		v, ok := value.(time.Time)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetClipsLastChecked(v)
+		return nil
 	case live.FieldUpdatedAt:
 		v, ok := value.(time.Time)
 		if !ok {
@@ -3204,6 +3465,12 @@ func (m *LiveMutation) AddedFields() []string {
 	if m.addvideo_age != nil {
 		fields = append(fields, live.FieldVideoAge)
 	}
+	if m.addclips_limit != nil {
+		fields = append(fields, live.FieldClipsLimit)
+	}
+	if m.addclips_interval_days != nil {
+		fields = append(fields, live.FieldClipsIntervalDays)
+	}
 	return fields
 }
 
@@ -3214,6 +3481,10 @@ func (m *LiveMutation) AddedField(name string) (ent.Value, bool) {
 	switch name {
 	case live.FieldVideoAge:
 		return m.AddedVideoAge()
+	case live.FieldClipsLimit:
+		return m.AddedClipsLimit()
+	case live.FieldClipsIntervalDays:
+		return m.AddedClipsIntervalDays()
 	}
 	return nil, false
 }
@@ -3230,6 +3501,20 @@ func (m *LiveMutation) AddField(name string, value ent.Value) error {
 		}
 		m.AddVideoAge(v)
 		return nil
+	case live.FieldClipsLimit:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddClipsLimit(v)
+		return nil
+	case live.FieldClipsIntervalDays:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddClipsIntervalDays(v)
+		return nil
 	}
 	return fmt.Errorf("unknown Live numeric field %s", name)
 }
@@ -3241,6 +3526,9 @@ func (m *LiveMutation) ClearedFields() []string {
 	if m.FieldCleared(live.FieldResolution) {
 		fields = append(fields, live.FieldResolution)
 	}
+	if m.FieldCleared(live.FieldClipsLastChecked) {
+		fields = append(fields, live.FieldClipsLastChecked)
+	}
 	return fields
 }
 
@@ -3258,6 +3546,9 @@ func (m *LiveMutation) ClearField(name string) error {
 	case live.FieldResolution:
 		m.ClearResolution()
 		return nil
+	case live.FieldClipsLastChecked:
+		m.ClearClipsLastChecked()
+		return nil
 	}
 	return fmt.Errorf("unknown Live nullable field %s", name)
 }
@@ -3305,6 +3596,18 @@ func (m *LiveMutation) ResetField(name string) error {
 	case live.FieldApplyCategoriesToLive:
 		m.ResetApplyCategoriesToLive()
 		return nil
+	case live.FieldWatchClips:
+		m.ResetWatchClips()
+		return nil
+	case live.FieldClipsLimit:
+		m.ResetClipsLimit()
+		return nil
+	case live.FieldClipsIntervalDays:
+		m.ResetClipsIntervalDays()
+		return nil
+	case live.FieldClipsLastChecked:
+		m.ResetClipsLastChecked()
+		return nil
 	case live.FieldUpdatedAt:
 		m.ResetUpdatedAt()
 		return nil
@@ -8628,34 +8931,32 @@ func (m *QueueMutation) ResetEdge(name string) error {
 	return fmt.Errorf("unknown Queue edge %s", name)
 }
 
-// TwitchCategoryMutation represents an operation that mutates the TwitchCategory nodes in the graph.
-type TwitchCategoryMutation struct {
+// SessionsMutation represents an operation that mutates the Sessions nodes in the graph.
+type SessionsMutation struct {
 	config
 	op            Op
 	typ           string
-	id            *string
-	name          *string
-	box_art_url   *string
-	igdb_id       *string
-	updated_at    *time.Time
-	created_at    *time.Time
+	id            *int
+	token         *string
+	data          *[]byte
+	expiry        *time.Time
 	clearedFields map[string]struct{}
 	done          bool
-	oldValue      func(context.Context) (*TwitchCategory, error)
-	predicates    []predicate.TwitchCategory
+	oldValue      func(context.Context) (*Sessions, error)
+	predicates    []predicate.Sessions
 }
 
-var _ ent.Mutation = (*TwitchCategoryMutation)(nil)
+var _ ent.Mutation = (*SessionsMutation)(nil)
 
-// twitchcategoryOption allows management of the mutation configuration using functional options.
-type twitchcategoryOption func(*TwitchCategoryMutation)
+// sessionsOption allows management of the mutation configuration using functional options.
+type sessionsOption func(*SessionsMutation)
 
-// newTwitchCategoryMutation creates new mutation for the TwitchCategory entity.
-func newTwitchCategoryMutation(c config, op Op, opts ...twitchcategoryOption) *TwitchCategoryMutation {
-	m := &TwitchCategoryMutation{
+// newSessionsMutation creates new mutation for the Sessions entity.
+func newSessionsMutation(c config, op Op, opts ...sessionsOption) *SessionsMutation {
+	m := &SessionsMutation{
 		config:        c,
 		op:            op,
-		typ:           TypeTwitchCategory,
+		typ:           TypeSessions,
 		clearedFields: make(map[string]struct{}),
 	}
 	for _, opt := range opts {
@@ -8664,20 +8965,20 @@ func newTwitchCategoryMutation(c config, op Op, opts ...twitchcategoryOption) *T
 	return m
 }
 
-// withTwitchCategoryID sets the ID field of the mutation.
-func withTwitchCategoryID(id string) twitchcategoryOption {
-	return func(m *TwitchCategoryMutation) {
+// withSessionsID sets the ID field of the mutation.
+func withSessionsID(id int) sessionsOption {
+	return func(m *SessionsMutation) {
 		var (
 			err   error
 			once  sync.Once
-			value *TwitchCategory
+			value *Sessions
 		)
-		m.oldValue = func(ctx context.Context) (*TwitchCategory, error) {
+		m.oldValue = func(ctx context.Context) (*Sessions, error) {
 			once.Do(func() {
 				if m.done {
 					err = errors.New("querying old values post mutation is not allowed")
 				} else {
-					value, err = m.Client().TwitchCategory.Get(ctx, id)
+					value, err = m.Client().Sessions.Get(ctx, id)
 				}
 			})
 			return value, err
@@ -8686,10 +8987,10 @@ func withTwitchCategoryID(id string) twitchcategoryOption {
 	}
 }
 
-// withTwitchCategory sets the old TwitchCategory of the mutation.
-func withTwitchCategory(node *TwitchCategory) twitchcategoryOption {
-	return func(m *TwitchCategoryMutation) {
-		m.oldValue = func(context.Context) (*TwitchCategory, error) {
+// withSessions sets the old Sessions of the mutation.
+func withSessions(node *Sessions) sessionsOption {
+	return func(m *SessionsMutation) {
+		m.oldValue = func(context.Context) (*Sessions, error) {
 			return node, nil
 		}
 		m.id = &node.ID
@@ -8698,7 +8999,7 @@ func withTwitchCategory(node *TwitchCategory) twitchcategoryOption {
 
 // Client returns a new `ent.Client` from the mutation. If the mutation was
 // executed in a transaction (ent.Tx), a transactional client is returned.
-func (m TwitchCategoryMutation) Client() *Client {
+func (m SessionsMutation) Client() *Client {
 	client := &Client{config: m.config}
 	client.init()
 	return client
@@ -8706,7 +9007,7 @@ func (m TwitchCategoryMutation) Client() *Client {
 
 // Tx returns an `ent.Tx` for mutations that were executed in transactions;
 // it returns an error otherwise.
-func (m TwitchCategoryMutation) Tx() (*Tx, error) {
+func (m SessionsMutation) Tx() (*Tx, error) {
 	if _, ok := m.driver.(*txDriver); !ok {
 		return nil, errors.New("ent: mutation is not running in a transaction")
 	}
@@ -8715,15 +9016,9 @@ func (m TwitchCategoryMutation) Tx() (*Tx, error) {
 	return tx, nil
 }
 
-// SetID sets the value of the id field. Note that this
-// operation is only accepted on creation of TwitchCategory entities.
-func (m *TwitchCategoryMutation) SetID(id string) {
-	m.id = &id
-}
-
 // ID returns the ID value in the mutation. Note that the ID is only available
 // if it was provided to the builder or after it was returned from the database.
-func (m *TwitchCategoryMutation) ID() (id string, exists bool) {
+func (m *SessionsMutation) ID() (id int, exists bool) {
 	if m.id == nil {
 		return
 	}
@@ -8734,236 +9029,138 @@ func (m *TwitchCategoryMutation) ID() (id string, exists bool) {
 // That means, if the mutation is applied within a transaction with an isolation level such
 // as sql.LevelSerializable, the returned ids match the ids of the rows that will be updated
 // or updated by the mutation.
-func (m *TwitchCategoryMutation) IDs(ctx context.Context) ([]string, error) {
+func (m *SessionsMutation) IDs(ctx context.Context) ([]int, error) {
 	switch {
 	case m.op.Is(OpUpdateOne | OpDeleteOne):
 		id, exists := m.ID()
 		if exists {
-			return []string{id}, nil
+			return []int{id}, nil
 		}
 		fallthrough
 	case m.op.Is(OpUpdate | OpDelete):
-		return m.Client().TwitchCategory.Query().Where(m.predicates...).IDs(ctx)
+		return m.Client().Sessions.Query().Where(m.predicates...).IDs(ctx)
 	default:
 		return nil, fmt.Errorf("IDs is not allowed on %s operations", m.op)
 	}
 }
 
-// SetName sets the "name" field.
-func (m *TwitchCategoryMutation) SetName(s string) {
-	m.name = &s
+// SetToken sets the "token" field.
+func (m *SessionsMutation) SetToken(s string) {
+	m.token = &s
 }
 
-// Name returns the value of the "name" field in the mutation.
-func (m *TwitchCategoryMutation) Name() (r string, exists bool) {
-	v := m.name
+// Token returns the value of the "token" field in the mutation.
+func (m *SessionsMutation) Token() (r string, exists bool) {
+	v := m.token
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldName returns the old "name" field's value of the TwitchCategory entity.
-// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
+// OldToken returns the old "token" field's value of the Sessions entity.
+// If the Sessions object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *TwitchCategoryMutation) OldName(ctx context.Context) (v string, err error) {
+func (m *SessionsMutation) OldToken(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldName is only allowed on UpdateOne operations")
+		return v, errors.New("OldToken is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldName requires an ID field in the mutation")
+		return v, errors.New("OldToken requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldName: %w", err)
+		return v, fmt.Errorf("querying old value for OldToken: %w", err)
 	}
-	return oldValue.Name, nil
+	return oldValue.Token, nil
 }
 
-// ResetName resets all changes to the "name" field.
-func (m *TwitchCategoryMutation) ResetName() {
-	m.name = nil
+// ResetToken resets all changes to the "token" field.
+func (m *SessionsMutation) ResetToken() {
+	m.token = nil
 }
 
-// SetBoxArtURL sets the "box_art_url" field.
-func (m *TwitchCategoryMutation) SetBoxArtURL(s string) {
-	m.box_art_url = &s
+// SetData sets the "data" field.
+func (m *SessionsMutation) SetData(b []byte) {
+	m.data = &b
 }
 
-// BoxArtURL returns the value of the "box_art_url" field in the mutation.
-func (m *TwitchCategoryMutation) BoxArtURL() (r string, exists bool) {
-	v := m.box_art_url
+// Data returns the value of the "data" field in the mutation.
+func (m *SessionsMutation) Data() (r []byte, exists bool) {
+	v := m.data
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldBoxArtURL returns the old "box_art_url" field's value of the TwitchCategory entity.
-// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
+// OldData returns the old "data" field's value of the Sessions entity.
+// If the Sessions object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *TwitchCategoryMutation) OldBoxArtURL(ctx context.Context) (v string, err error) {
+func (m *SessionsMutation) OldData(ctx context.Context) (v []byte, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldBoxArtURL is only allowed on UpdateOne operations")
+		return v, errors.New("OldData is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldBoxArtURL requires an ID field in the mutation")
+		return v, errors.New("OldData requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldBoxArtURL: %w", err)
+		return v, fmt.Errorf("querying old value for OldData: %w", err)
 	}
-	return oldValue.BoxArtURL, nil
-}
-
-// ClearBoxArtURL clears the value of the "box_art_url" field.
-func (m *TwitchCategoryMutation) ClearBoxArtURL() {
-	m.box_art_url = nil
-	m.clearedFields[twitchcategory.FieldBoxArtURL] = struct{}{}
-}
-
-// BoxArtURLCleared returns if the "box_art_url" field was cleared in this mutation.
-func (m *TwitchCategoryMutation) BoxArtURLCleared() bool {
-	_, ok := m.clearedFields[twitchcategory.FieldBoxArtURL]
-	return ok
+	return oldValue.Data, nil
 }
 
-// ResetBoxArtURL resets all changes to the "box_art_url" field.
-func (m *TwitchCategoryMutation) ResetBoxArtURL() {
-	m.box_art_url = nil
-	delete(m.clearedFields, twitchcategory.FieldBoxArtURL)
+// ResetData resets all changes to the "data" field.
+func (m *SessionsMutation) ResetData() {
+	m.data = nil
 }
 
-// SetIgdbID sets the "igdb_id" field.
-func (m *TwitchCategoryMutation) SetIgdbID(s string) {
-	m.igdb_id = &s
+// SetExpiry sets the "expiry" field.
+func (m *SessionsMutation) SetExpiry(t time.Time) {
+	m.expiry = &t
 }
 
-// IgdbID returns the value of the "igdb_id" field in the mutation.
-func (m *TwitchCategoryMutation) IgdbID() (r string, exists bool) {
-	v := m.igdb_id
+// Expiry returns the value of the "expiry" field in the mutation.
+func (m *SessionsMutation) Expiry() (r time.Time, exists bool) {
+	v := m.expiry
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldIgdbID returns the old "igdb_id" field's value of the TwitchCategory entity.
-// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
+// OldExpiry returns the old "expiry" field's value of the Sessions entity.
+// If the Sessions object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *TwitchCategoryMutation) OldIgdbID(ctx context.Context) (v string, err error) {
+func (m *SessionsMutation) OldExpiry(ctx context.Context) (v time.Time, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldIgdbID is only allowed on UpdateOne operations")
+		return v, errors.New("OldExpiry is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldIgdbID requires an ID field in the mutation")
+		return v, errors.New("OldExpiry requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldIgdbID: %w", err)
+		return v, fmt.Errorf("querying old value for OldExpiry: %w", err)
 	}
-	return oldValue.IgdbID, nil
+	return oldValue.Expiry, nil
 }
 
-// ClearIgdbID clears the value of the "igdb_id" field.
-func (m *TwitchCategoryMutation) ClearIgdbID() {
-	m.igdb_id = nil
-	m.clearedFields[twitchcategory.FieldIgdbID] = struct{}{}
+// ResetExpiry resets all changes to the "expiry" field.
+func (m *SessionsMutation) ResetExpiry() {
+	m.expiry = nil
 }
 
-// IgdbIDCleared returns if the "igdb_id" field was cleared in this mutation.
-func (m *TwitchCategoryMutation) IgdbIDCleared() bool {
-	_, ok := m.clearedFields[twitchcategory.FieldIgdbID]
-	return ok
-}
-
-// ResetIgdbID resets all changes to the "igdb_id" field.
-func (m *TwitchCategoryMutation) ResetIgdbID() {
-	m.igdb_id = nil
-	delete(m.clearedFields, twitchcategory.FieldIgdbID)
-}
-
-// SetUpdatedAt sets the "updated_at" field.
-func (m *TwitchCategoryMutation) SetUpdatedAt(t time.Time) {
-	m.updated_at = &t
-}
-
-// UpdatedAt returns the value of the "updated_at" field in the mutation.
-func (m *TwitchCategoryMutation) UpdatedAt() (r time.Time, exists bool) {
-	v := m.updated_at
-	if v == nil {
-		return
-	}
-	return *v, true
-}
-
-// OldUpdatedAt returns the old "updated_at" field's value of the TwitchCategory entity.
-// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
-// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *TwitchCategoryMutation) OldUpdatedAt(ctx context.Context) (v time.Time, err error) {
-	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldUpdatedAt is only allowed on UpdateOne operations")
-	}
-	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldUpdatedAt requires an ID field in the mutation")
-	}
-	oldValue, err := m.oldValue(ctx)
-	if err != nil {
-		return v, fmt.Errorf("querying old value for OldUpdatedAt: %w", err)
-	}
-	return oldValue.UpdatedAt, nil
-}
-
-// ResetUpdatedAt resets all changes to the "updated_at" field.
-func (m *TwitchCategoryMutation) ResetUpdatedAt() {
-	m.updated_at = nil
-}
-
-// SetCreatedAt sets the "created_at" field.
-func (m *TwitchCategoryMutation) SetCreatedAt(t time.Time) {
-	m.created_at = &t
-}
-
-// CreatedAt returns the value of the "created_at" field in the mutation.
-func (m *TwitchCategoryMutation) CreatedAt() (r time.Time, exists bool) {
-	v := m.created_at
-	if v == nil {
-		return
-	}
-	return *v, true
-}
-
-// OldCreatedAt returns the old "created_at" field's value of the TwitchCategory entity.
-// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
-// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *TwitchCategoryMutation) OldCreatedAt(ctx context.Context) (v time.Time, err error) {
-	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldCreatedAt is only allowed on UpdateOne operations")
-	}
-	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldCreatedAt requires an ID field in the mutation")
-	}
-	oldValue, err := m.oldValue(ctx)
-	if err != nil {
-		return v, fmt.Errorf("querying old value for OldCreatedAt: %w", err)
-	}
-	return oldValue.CreatedAt, nil
-}
-
-// ResetCreatedAt resets all changes to the "created_at" field.
-func (m *TwitchCategoryMutation) ResetCreatedAt() {
-	m.created_at = nil
-}
-
-// Where appends a list predicates to the TwitchCategoryMutation builder.
-func (m *TwitchCategoryMutation) Where(ps ...predicate.TwitchCategory) {
+// Where appends a list predicates to the SessionsMutation builder.
+func (m *SessionsMutation) Where(ps ...predicate.Sessions) {
 	m.predicates = append(m.predicates, ps...)
 }
 
-// WhereP appends storage-level predicates to the TwitchCategoryMutation builder. Using this method,
+// WhereP appends storage-level predicates to the SessionsMutation builder. Using this method,
 // users can use type-assertion to append predicates that do not depend on any generated package.
-func (m *TwitchCategoryMutation) WhereP(ps ...func(*sql.Selector)) {
-	p := make([]predicate.TwitchCategory, len(ps))
+func (m *SessionsMutation) WhereP(ps ...func(*sql.Selector)) {
+	p := make([]predicate.Sessions, len(ps))
 	for i := range ps {
 		p[i] = ps[i]
 	}
@@ -8971,39 +9168,33 @@ func (m *TwitchCategoryMutation) WhereP(ps ...func(*sql.Selector)) {
 }
 
 // Op returns the operation name.
-func (m *TwitchCategoryMutation) Op() Op {
+func (m *SessionsMutation) Op() Op {
 	return m.op
 }
 
 // SetOp allows setting the mutation operation.
-func (m *TwitchCategoryMutation) SetOp(op Op) {
+func (m *SessionsMutation) SetOp(op Op) {
 	m.op = op
 }
 
-// Type returns the node type of this mutation (TwitchCategory).
-func (m *TwitchCategoryMutation) Type() string {
+// Type returns the node type of this mutation (Sessions).
+func (m *SessionsMutation) Type() string {
 	return m.typ
 }
 
 // Fields returns all fields that were changed during this mutation. Note that in
 // order to get all numeric fields that were incremented/decremented, call
 // AddedFields().
-func (m *TwitchCategoryMutation) Fields() []string {
-	fields := make([]string, 0, 5)
-	if m.name != nil {
-		fields = append(fields, twitchcategory.FieldName)
-	}
-	if m.box_art_url != nil {
-		fields = append(fields, twitchcategory.FieldBoxArtURL)
-	}
-	if m.igdb_id != nil {
-		fields = append(fields, twitchcategory.FieldIgdbID)
+func (m *SessionsMutation) Fields() []string {
+	fields := make([]string, 0, 3)
+	if m.token != nil {
+		fields = append(fields, sessions.FieldToken)
 	}
-	if m.updated_at != nil {
-		fields = append(fields, twitchcategory.FieldUpdatedAt)
+	if m.data != nil {
+		fields = append(fields, sessions.FieldData)
 	}
-	if m.created_at != nil {
-		fields = append(fields, twitchcategory.FieldCreatedAt)
+	if m.expiry != nil {
+		fields = append(fields, sessions.FieldExpiry)
 	}
 	return fields
 }
@@ -9011,18 +9202,14 @@ func (m *TwitchCategoryMutation) Fields() []string {
 // Field returns the value of a field with the given name. The second boolean
 // return value indicates that this field was not set, or was not defined in the
 // schema.
-func (m *TwitchCategoryMutation) Field(name string) (ent.Value, bool) {
+func (m *SessionsMutation) Field(name string) (ent.Value, bool) {
 	switch name {
-	case twitchcategory.FieldName:
-		return m.Name()
-	case twitchcategory.FieldBoxArtURL:
-		return m.BoxArtURL()
-	case twitchcategory.FieldIgdbID:
-		return m.IgdbID()
-	case twitchcategory.FieldUpdatedAt:
-		return m.UpdatedAt()
-	case twitchcategory.FieldCreatedAt:
-		return m.CreatedAt()
+	case sessions.FieldToken:
+		return m.Token()
+	case sessions.FieldData:
+		return m.Data()
+	case sessions.FieldExpiry:
+		return m.Expiry()
 	}
 	return nil, false
 }
@@ -9030,224 +9217,182 @@ func (m *TwitchCategoryMutation) Field(name string) (ent.Value, bool) {
 // OldField returns the old value of the field from the database. An error is
 // returned if the mutation operation is not UpdateOne, or the query to the
 // database failed.
-func (m *TwitchCategoryMutation) OldField(ctx context.Context, name string) (ent.Value, error) {
+func (m *SessionsMutation) OldField(ctx context.Context, name string) (ent.Value, error) {
 	switch name {
-	case twitchcategory.FieldName:
-		return m.OldName(ctx)
-	case twitchcategory.FieldBoxArtURL:
-		return m.OldBoxArtURL(ctx)
-	case twitchcategory.FieldIgdbID:
-		return m.OldIgdbID(ctx)
-	case twitchcategory.FieldUpdatedAt:
-		return m.OldUpdatedAt(ctx)
-	case twitchcategory.FieldCreatedAt:
-		return m.OldCreatedAt(ctx)
+	case sessions.FieldToken:
+		return m.OldToken(ctx)
+	case sessions.FieldData:
+		return m.OldData(ctx)
+	case sessions.FieldExpiry:
+		return m.OldExpiry(ctx)
 	}
-	return nil, fmt.Errorf("unknown TwitchCategory field %s", name)
+	return nil, fmt.Errorf("unknown Sessions field %s", name)
 }
 
 // SetField sets the value of a field with the given name. It returns an error if
 // the field is not defined in the schema, or if the type mismatched the field
 // type.
-func (m *TwitchCategoryMutation) SetField(name string, value ent.Value) error {
+func (m *SessionsMutation) SetField(name string, value ent.Value) error {
 	switch name {
-	case twitchcategory.FieldName:
-		v, ok := value.(string)
-		if !ok {
-			return fmt.Errorf("unexpected type %T for field %s", value, name)
-		}
-		m.SetName(v)
-		return nil
-	case twitchcategory.FieldBoxArtURL:
-		v, ok := value.(string)
-		if !ok {
-			return fmt.Errorf("unexpected type %T for field %s", value, name)
-		}
-		m.SetBoxArtURL(v)
-		return nil
-	case twitchcategory.FieldIgdbID:
+	case sessions.FieldToken:
 		v, ok := value.(string)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetIgdbID(v)
+		m.SetToken(v)
 		return nil
-	case twitchcategory.FieldUpdatedAt:
-		v, ok := value.(time.Time)
+	case sessions.FieldData:
+		v, ok := value.([]byte)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetUpdatedAt(v)
+		m.SetData(v)
 		return nil
-	case twitchcategory.FieldCreatedAt:
+	case sessions.FieldExpiry:
 		v, ok := value.(time.Time)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetCreatedAt(v)
+		m.SetExpiry(v)
 		return nil
 	}
-	return fmt.Errorf("unknown TwitchCategory field %s", name)
+	return fmt.Errorf("unknown Sessions field %s", name)
 }
 
 // AddedFields returns all numeric fields that were incremented/decremented during
 // this mutation.
-func (m *TwitchCategoryMutation) AddedFields() []string {
+func (m *SessionsMutation) AddedFields() []string {
 	return nil
 }
 
 // AddedField returns the numeric value that was incremented/decremented on a field
 // with the given name. The second boolean return value indicates that this field
 // was not set, or was not defined in the schema.
-func (m *TwitchCategoryMutation) AddedField(name string) (ent.Value, bool) {
+func (m *SessionsMutation) AddedField(name string) (ent.Value, bool) {
 	return nil, false
 }
 
 // AddField adds the value to the field with the given name. It returns an error if
 // the field is not defined in the schema, or if the type mismatched the field
 // type.
-func (m *TwitchCategoryMutation) AddField(name string, value ent.Value) error {
+func (m *SessionsMutation) AddField(name string, value ent.Value) error {
 	switch name {
 	}
-	return fmt.Errorf("unknown TwitchCategory numeric field %s", name)
+	return fmt.Errorf("unknown Sessions numeric field %s", name)
 }
 
 // ClearedFields returns all nullable fields that were cleared during this
 // mutation.
-func (m *TwitchCategoryMutation) ClearedFields() []string {
-	var fields []string
-	if m.FieldCleared(twitchcategory.FieldBoxArtURL) {
-		fields = append(fields, twitchcategory.FieldBoxArtURL)
-	}
-	if m.FieldCleared(twitchcategory.FieldIgdbID) {
-		fields = append(fields, twitchcategory.FieldIgdbID)
-	}
-	return fields
+func (m *SessionsMutation) ClearedFields() []string {
+	return nil
 }
 
 // FieldCleared returns a boolean indicating if a field with the given name was
 // cleared in this mutation.
-func (m *TwitchCategoryMutation) FieldCleared(name string) bool {
+func (m *SessionsMutation) FieldCleared(name string) bool {
 	_, ok := m.clearedFields[name]
 	return ok
 }
 
 // ClearField clears the value of the field with the given name. It returns an
 // error if the field is not defined in the schema.
-func (m *TwitchCategoryMutation) ClearField(name string) error {
-	switch name {
-	case twitchcategory.FieldBoxArtURL:
-		m.ClearBoxArtURL()
-		return nil
-	case twitchcategory.FieldIgdbID:
-		m.ClearIgdbID()
-		return nil
-	}
-	return fmt.Errorf("unknown TwitchCategory nullable field %s", name)
+func (m *SessionsMutation) ClearField(name string) error {
+	return fmt.Errorf("unknown Sessions nullable field %s", name)
 }
 
 // ResetField resets all changes in the mutation for the field with the given name.
 // It returns an error if the field is not defined in the schema.
-func (m *TwitchCategoryMutation) ResetField(name string) error {
+func (m *SessionsMutation) ResetField(name string) error {
 	switch name {
-	case twitchcategory.FieldName:
-		m.ResetName()
-		return nil
-	case twitchcategory.FieldBoxArtURL:
-		m.ResetBoxArtURL()
-		return nil
-	case twitchcategory.FieldIgdbID:
-		m.ResetIgdbID()
+	case sessions.FieldToken:
+		m.ResetToken()
 		return nil
-	case twitchcategory.FieldUpdatedAt:
-		m.ResetUpdatedAt()
+	case sessions.FieldData:
+		m.ResetData()
 		return nil
-	case twitchcategory.FieldCreatedAt:
-		m.ResetCreatedAt()
+	case sessions.FieldExpiry:
+		m.ResetExpiry()
 		return nil
 	}
-	return fmt.Errorf("unknown TwitchCategory field %s", name)
+	return fmt.Errorf("unknown Sessions field %s", name)
 }
 
 // AddedEdges returns all edge names that were set/added in this mutation.
-func (m *TwitchCategoryMutation) AddedEdges() []string {
+func (m *SessionsMutation) AddedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // AddedIDs returns all IDs (to other nodes) that were added for the given edge
 // name in this mutation.
-func (m *TwitchCategoryMutation) AddedIDs(name string) []ent.Value {
+func (m *SessionsMutation) AddedIDs(name string) []ent.Value {
 	return nil
 }
 
 // RemovedEdges returns all edge names that were removed in this mutation.
-func (m *TwitchCategoryMutation) RemovedEdges() []string {
+func (m *SessionsMutation) RemovedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // RemovedIDs returns all IDs (to other nodes) that were removed for the edge with
 // the given name in this mutation.
-func (m *TwitchCategoryMutation) RemovedIDs(name string) []ent.Value {
+func (m *SessionsMutation) RemovedIDs(name string) []ent.Value {
 	return nil
 }
 
 // ClearedEdges returns all edge names that were cleared in this mutation.
-func (m *TwitchCategoryMutation) ClearedEdges() []string {
+func (m *SessionsMutation) ClearedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // EdgeCleared returns a boolean which indicates if the edge with the given name
 // was cleared in this mutation.
-func (m *TwitchCategoryMutation) EdgeCleared(name string) bool {
+func (m *SessionsMutation) EdgeCleared(name string) bool {
 	return false
 }
 
 // ClearEdge clears the value of the edge with the given name. It returns an error
 // if that edge is not defined in the schema.
-func (m *TwitchCategoryMutation) ClearEdge(name string) error {
-	return fmt.Errorf("unknown TwitchCategory unique edge %s", name)
+func (m *SessionsMutation) ClearEdge(name string) error {
+	return fmt.Errorf("unknown Sessions unique edge %s", name)
 }
 
 // ResetEdge resets all changes to the edge with the given name in this mutation.
 // It returns an error if the edge is not defined in the schema.
-func (m *TwitchCategoryMutation) ResetEdge(name string) error {
-	return fmt.Errorf("unknown TwitchCategory edge %s", name)
+func (m *SessionsMutation) ResetEdge(name string) error {
+	return fmt.Errorf("unknown Sessions edge %s", name)
 }
 
-// UserMutation represents an operation that mutates the User nodes in the graph.
-type UserMutation struct {
+// TwitchCategoryMutation represents an operation that mutates the TwitchCategory nodes in the graph.
+type TwitchCategoryMutation struct {
 	config
 	op            Op
 	typ           string
-	id            *uuid.UUID
-	sub           *string
-	username      *string
-	password      *string
-	oauth         *bool
-	role          *utils.Role
-	webhook       *string
+	id            *string
+	name          *string
+	box_art_url   *string
+	igdb_id       *string
 	updated_at    *time.Time
 	created_at    *time.Time
 	clearedFields map[string]struct{}
 	done          bool
-	oldValue      func(context.Context) (*User, error)
-	predicates    []predicate.User
+	oldValue      func(context.Context) (*TwitchCategory, error)
+	predicates    []predicate.TwitchCategory
 }
 
-var _ ent.Mutation = (*UserMutation)(nil)
+var _ ent.Mutation = (*TwitchCategoryMutation)(nil)
 
-// userOption allows management of the mutation configuration using functional options.
-type userOption func(*UserMutation)
+// twitchcategoryOption allows management of the mutation configuration using functional options.
+type twitchcategoryOption func(*TwitchCategoryMutation)
 
-// newUserMutation creates new mutation for the User entity.
-func newUserMutation(c config, op Op, opts ...userOption) *UserMutation {
-	m := &UserMutation{
+// newTwitchCategoryMutation creates new mutation for the TwitchCategory entity.
+func newTwitchCategoryMutation(c config, op Op, opts ...twitchcategoryOption) *TwitchCategoryMutation {
+	m := &TwitchCategoryMutation{
 		config:        c,
 		op:            op,
-		typ:           TypeUser,
+		typ:           TypeTwitchCategory,
 		clearedFields: make(map[string]struct{}),
 	}
 	for _, opt := range opts {
@@ -9256,20 +9401,20 @@ func newUserMutation(c config, op Op, opts ...userOption) *UserMutation {
 	return m
 }
 
-// withUserID sets the ID field of the mutation.
-func withUserID(id uuid.UUID) userOption {
-	return func(m *UserMutation) {
+// withTwitchCategoryID sets the ID field of the mutation.
+func withTwitchCategoryID(id string) twitchcategoryOption {
+	return func(m *TwitchCategoryMutation) {
 		var (
 			err   error
 			once  sync.Once
-			value *User
+			value *TwitchCategory
 		)
-		m.oldValue = func(ctx context.Context) (*User, error) {
+		m.oldValue = func(ctx context.Context) (*TwitchCategory, error) {
 			once.Do(func() {
 				if m.done {
 					err = errors.New("querying old values post mutation is not allowed")
 				} else {
-					value, err = m.Client().User.Get(ctx, id)
+					value, err = m.Client().TwitchCategory.Get(ctx, id)
 				}
 			})
 			return value, err
@@ -9278,10 +9423,10 @@ func withUserID(id uuid.UUID) userOption {
 	}
 }
 
-// withUser sets the old User of the mutation.
-func withUser(node *User) userOption {
-	return func(m *UserMutation) {
-		m.oldValue = func(context.Context) (*User, error) {
+// withTwitchCategory sets the old TwitchCategory of the mutation.
+func withTwitchCategory(node *TwitchCategory) twitchcategoryOption {
+	return func(m *TwitchCategoryMutation) {
+		m.oldValue = func(context.Context) (*TwitchCategory, error) {
 			return node, nil
 		}
 		m.id = &node.ID
@@ -9290,7 +9435,7 @@ func withUser(node *User) userOption {
 
 // Client returns a new `ent.Client` from the mutation. If the mutation was
 // executed in a transaction (ent.Tx), a transactional client is returned.
-func (m UserMutation) Client() *Client {
+func (m TwitchCategoryMutation) Client() *Client {
 	client := &Client{config: m.config}
 	client.init()
 	return client
@@ -9298,7 +9443,7 @@ func (m UserMutation) Client() *Client {
 
 // Tx returns an `ent.Tx` for mutations that were executed in transactions;
 // it returns an error otherwise.
-func (m UserMutation) Tx() (*Tx, error) {
+func (m TwitchCategoryMutation) Tx() (*Tx, error) {
 	if _, ok := m.driver.(*txDriver); !ok {
 		return nil, errors.New("ent: mutation is not running in a transaction")
 	}
@@ -9308,14 +9453,14 @@ func (m UserMutation) Tx() (*Tx, error) {
 }
 
 // SetID sets the value of the id field. Note that this
-// operation is only accepted on creation of User entities.
-func (m *UserMutation) SetID(id uuid.UUID) {
+// operation is only accepted on creation of TwitchCategory entities.
+func (m *TwitchCategoryMutation) SetID(id string) {
 	m.id = &id
 }
 
 // ID returns the ID value in the mutation. Note that the ID is only available
 // if it was provided to the builder or after it was returned from the database.
-func (m *UserMutation) ID() (id uuid.UUID, exists bool) {
+func (m *TwitchCategoryMutation) ID() (id string, exists bool) {
 	if m.id == nil {
 		return
 	}
@@ -9326,406 +9471,276 @@ func (m *UserMutation) ID() (id uuid.UUID, exists bool) {
 // That means, if the mutation is applied within a transaction with an isolation level such
 // as sql.LevelSerializable, the returned ids match the ids of the rows that will be updated
 // or updated by the mutation.
-func (m *UserMutation) IDs(ctx context.Context) ([]uuid.UUID, error) {
+func (m *TwitchCategoryMutation) IDs(ctx context.Context) ([]string, error) {
 	switch {
 	case m.op.Is(OpUpdateOne | OpDeleteOne):
 		id, exists := m.ID()
 		if exists {
-			return []uuid.UUID{id}, nil
+			return []string{id}, nil
 		}
 		fallthrough
 	case m.op.Is(OpUpdate | OpDelete):
-		return m.Client().User.Query().Where(m.predicates...).IDs(ctx)
+		return m.Client().TwitchCategory.Query().Where(m.predicates...).IDs(ctx)
 	default:
 		return nil, fmt.Errorf("IDs is not allowed on %s operations", m.op)
 	}
 }
 
-// SetSub sets the "sub" field.
-func (m *UserMutation) SetSub(s string) {
-	m.sub = &s
+// SetName sets the "name" field.
+func (m *TwitchCategoryMutation) SetName(s string) {
+	m.name = &s
 }
 
-// Sub returns the value of the "sub" field in the mutation.
-func (m *UserMutation) Sub() (r string, exists bool) {
-	v := m.sub
+// Name returns the value of the "name" field in the mutation.
+func (m *TwitchCategoryMutation) Name() (r string, exists bool) {
+	v := m.name
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldSub returns the old "sub" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
+// OldName returns the old "name" field's value of the TwitchCategory entity.
+// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldSub(ctx context.Context) (v string, err error) {
+func (m *TwitchCategoryMutation) OldName(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldSub is only allowed on UpdateOne operations")
+		return v, errors.New("OldName is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldSub requires an ID field in the mutation")
+		return v, errors.New("OldName requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldSub: %w", err)
+		return v, fmt.Errorf("querying old value for OldName: %w", err)
 	}
-	return oldValue.Sub, nil
-}
-
-// ClearSub clears the value of the "sub" field.
-func (m *UserMutation) ClearSub() {
-	m.sub = nil
-	m.clearedFields[user.FieldSub] = struct{}{}
-}
-
-// SubCleared returns if the "sub" field was cleared in this mutation.
-func (m *UserMutation) SubCleared() bool {
-	_, ok := m.clearedFields[user.FieldSub]
-	return ok
+	return oldValue.Name, nil
 }
 
-// ResetSub resets all changes to the "sub" field.
-func (m *UserMutation) ResetSub() {
-	m.sub = nil
-	delete(m.clearedFields, user.FieldSub)
+// ResetName resets all changes to the "name" field.
+func (m *TwitchCategoryMutation) ResetName() {
+	m.name = nil
 }
 
-// SetUsername sets the "username" field.
-func (m *UserMutation) SetUsername(s string) {
-	m.username = &s
+// SetBoxArtURL sets the "box_art_url" field.
+func (m *TwitchCategoryMutation) SetBoxArtURL(s string) {
+	m.box_art_url = &s
 }
 
-// Username returns the value of the "username" field in the mutation.
-func (m *UserMutation) Username() (r string, exists bool) {
-	v := m.username
+// BoxArtURL returns the value of the "box_art_url" field in the mutation.
+func (m *TwitchCategoryMutation) BoxArtURL() (r string, exists bool) {
+	v := m.box_art_url
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldUsername returns the old "username" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
+// OldBoxArtURL returns the old "box_art_url" field's value of the TwitchCategory entity.
+// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldUsername(ctx context.Context) (v string, err error) {
+func (m *TwitchCategoryMutation) OldBoxArtURL(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldUsername is only allowed on UpdateOne operations")
+		return v, errors.New("OldBoxArtURL is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldUsername requires an ID field in the mutation")
+		return v, errors.New("OldBoxArtURL requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldUsername: %w", err)
+		return v, fmt.Errorf("querying old value for OldBoxArtURL: %w", err)
 	}
-	return oldValue.Username, nil
+	return oldValue.BoxArtURL, nil
 }
 
-// ResetUsername resets all changes to the "username" field.
-func (m *UserMutation) ResetUsername() {
-	m.username = nil
+// ClearBoxArtURL clears the value of the "box_art_url" field.
+func (m *TwitchCategoryMutation) ClearBoxArtURL() {
+	m.box_art_url = nil
+	m.clearedFields[twitchcategory.FieldBoxArtURL] = struct{}{}
 }
 
-// SetPassword sets the "password" field.
-func (m *UserMutation) SetPassword(s string) {
-	m.password = &s
+// BoxArtURLCleared returns if the "box_art_url" field was cleared in this mutation.
+func (m *TwitchCategoryMutation) BoxArtURLCleared() bool {
+	_, ok := m.clearedFields[twitchcategory.FieldBoxArtURL]
+	return ok
 }
 
-// Password returns the value of the "password" field in the mutation.
-func (m *UserMutation) Password() (r string, exists bool) {
-	v := m.password
+// ResetBoxArtURL resets all changes to the "box_art_url" field.
+func (m *TwitchCategoryMutation) ResetBoxArtURL() {
+	m.box_art_url = nil
+	delete(m.clearedFields, twitchcategory.FieldBoxArtURL)
+}
+
+// SetIgdbID sets the "igdb_id" field.
+func (m *TwitchCategoryMutation) SetIgdbID(s string) {
+	m.igdb_id = &s
+}
+
+// IgdbID returns the value of the "igdb_id" field in the mutation.
+func (m *TwitchCategoryMutation) IgdbID() (r string, exists bool) {
+	v := m.igdb_id
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldPassword returns the old "password" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
+// OldIgdbID returns the old "igdb_id" field's value of the TwitchCategory entity.
+// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldPassword(ctx context.Context) (v string, err error) {
+func (m *TwitchCategoryMutation) OldIgdbID(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldPassword is only allowed on UpdateOne operations")
+		return v, errors.New("OldIgdbID is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldPassword requires an ID field in the mutation")
+		return v, errors.New("OldIgdbID requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldPassword: %w", err)
+		return v, fmt.Errorf("querying old value for OldIgdbID: %w", err)
 	}
-	return oldValue.Password, nil
+	return oldValue.IgdbID, nil
 }
 
-// ClearPassword clears the value of the "password" field.
-func (m *UserMutation) ClearPassword() {
-	m.password = nil
-	m.clearedFields[user.FieldPassword] = struct{}{}
+// ClearIgdbID clears the value of the "igdb_id" field.
+func (m *TwitchCategoryMutation) ClearIgdbID() {
+	m.igdb_id = nil
+	m.clearedFields[twitchcategory.FieldIgdbID] = struct{}{}
 }
 
-// PasswordCleared returns if the "password" field was cleared in this mutation.
-func (m *UserMutation) PasswordCleared() bool {
-	_, ok := m.clearedFields[user.FieldPassword]
+// IgdbIDCleared returns if the "igdb_id" field was cleared in this mutation.
+func (m *TwitchCategoryMutation) IgdbIDCleared() bool {
+	_, ok := m.clearedFields[twitchcategory.FieldIgdbID]
 	return ok
 }
 
-// ResetPassword resets all changes to the "password" field.
-func (m *UserMutation) ResetPassword() {
-	m.password = nil
-	delete(m.clearedFields, user.FieldPassword)
+// ResetIgdbID resets all changes to the "igdb_id" field.
+func (m *TwitchCategoryMutation) ResetIgdbID() {
+	m.igdb_id = nil
+	delete(m.clearedFields, twitchcategory.FieldIgdbID)
 }
 
-// SetOauth sets the "oauth" field.
-func (m *UserMutation) SetOauth(b bool) {
-	m.oauth = &b
+// SetUpdatedAt sets the "updated_at" field.
+func (m *TwitchCategoryMutation) SetUpdatedAt(t time.Time) {
+	m.updated_at = &t
 }
 
-// Oauth returns the value of the "oauth" field in the mutation.
-func (m *UserMutation) Oauth() (r bool, exists bool) {
-	v := m.oauth
+// UpdatedAt returns the value of the "updated_at" field in the mutation.
+func (m *TwitchCategoryMutation) UpdatedAt() (r time.Time, exists bool) {
+	v := m.updated_at
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldOauth returns the old "oauth" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
+// OldUpdatedAt returns the old "updated_at" field's value of the TwitchCategory entity.
+// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldOauth(ctx context.Context) (v bool, err error) {
+func (m *TwitchCategoryMutation) OldUpdatedAt(ctx context.Context) (v time.Time, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldOauth is only allowed on UpdateOne operations")
+		return v, errors.New("OldUpdatedAt is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldOauth requires an ID field in the mutation")
+		return v, errors.New("OldUpdatedAt requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldOauth: %w", err)
+		return v, fmt.Errorf("querying old value for OldUpdatedAt: %w", err)
 	}
-	return oldValue.Oauth, nil
+	return oldValue.UpdatedAt, nil
 }
 
-// ResetOauth resets all changes to the "oauth" field.
-func (m *UserMutation) ResetOauth() {
-	m.oauth = nil
+// ResetUpdatedAt resets all changes to the "updated_at" field.
+func (m *TwitchCategoryMutation) ResetUpdatedAt() {
+	m.updated_at = nil
 }
 
-// SetRole sets the "role" field.
-func (m *UserMutation) SetRole(u utils.Role) {
-	m.role = &u
+// SetCreatedAt sets the "created_at" field.
+func (m *TwitchCategoryMutation) SetCreatedAt(t time.Time) {
+	m.created_at = &t
 }
 
-// Role returns the value of the "role" field in the mutation.
-func (m *UserMutation) Role() (r utils.Role, exists bool) {
-	v := m.role
+// CreatedAt returns the value of the "created_at" field in the mutation.
+func (m *TwitchCategoryMutation) CreatedAt() (r time.Time, exists bool) {
+	v := m.created_at
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldRole returns the old "role" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
+// OldCreatedAt returns the old "created_at" field's value of the TwitchCategory entity.
+// If the TwitchCategory object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldRole(ctx context.Context) (v utils.Role, err error) {
+func (m *TwitchCategoryMutation) OldCreatedAt(ctx context.Context) (v time.Time, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldRole is only allowed on UpdateOne operations")
+		return v, errors.New("OldCreatedAt is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldRole requires an ID field in the mutation")
+		return v, errors.New("OldCreatedAt requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldRole: %w", err)
+		return v, fmt.Errorf("querying old value for OldCreatedAt: %w", err)
 	}
-	return oldValue.Role, nil
+	return oldValue.CreatedAt, nil
 }
 
-// ResetRole resets all changes to the "role" field.
-func (m *UserMutation) ResetRole() {
-	m.role = nil
+// ResetCreatedAt resets all changes to the "created_at" field.
+func (m *TwitchCategoryMutation) ResetCreatedAt() {
+	m.created_at = nil
 }
 
-// SetWebhook sets the "webhook" field.
-func (m *UserMutation) SetWebhook(s string) {
-	m.webhook = &s
+// Where appends a list predicates to the TwitchCategoryMutation builder.
+func (m *TwitchCategoryMutation) Where(ps ...predicate.TwitchCategory) {
+	m.predicates = append(m.predicates, ps...)
 }
 
-// Webhook returns the value of the "webhook" field in the mutation.
-func (m *UserMutation) Webhook() (r string, exists bool) {
-	v := m.webhook
-	if v == nil {
-		return
+// WhereP appends storage-level predicates to the TwitchCategoryMutation builder. Using this method,
+// users can use type-assertion to append predicates that do not depend on any generated package.
+func (m *TwitchCategoryMutation) WhereP(ps ...func(*sql.Selector)) {
+	p := make([]predicate.TwitchCategory, len(ps))
+	for i := range ps {
+		p[i] = ps[i]
 	}
-	return *v, true
+	m.Where(p...)
 }
 
-// OldWebhook returns the old "webhook" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
-// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldWebhook(ctx context.Context) (v string, err error) {
-	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldWebhook is only allowed on UpdateOne operations")
-	}
-	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldWebhook requires an ID field in the mutation")
-	}
-	oldValue, err := m.oldValue(ctx)
-	if err != nil {
-		return v, fmt.Errorf("querying old value for OldWebhook: %w", err)
-	}
-	return oldValue.Webhook, nil
-}
-
-// ClearWebhook clears the value of the "webhook" field.
-func (m *UserMutation) ClearWebhook() {
-	m.webhook = nil
-	m.clearedFields[user.FieldWebhook] = struct{}{}
-}
-
-// WebhookCleared returns if the "webhook" field was cleared in this mutation.
-func (m *UserMutation) WebhookCleared() bool {
-	_, ok := m.clearedFields[user.FieldWebhook]
-	return ok
-}
-
-// ResetWebhook resets all changes to the "webhook" field.
-func (m *UserMutation) ResetWebhook() {
-	m.webhook = nil
-	delete(m.clearedFields, user.FieldWebhook)
-}
-
-// SetUpdatedAt sets the "updated_at" field.
-func (m *UserMutation) SetUpdatedAt(t time.Time) {
-	m.updated_at = &t
-}
-
-// UpdatedAt returns the value of the "updated_at" field in the mutation.
-func (m *UserMutation) UpdatedAt() (r time.Time, exists bool) {
-	v := m.updated_at
-	if v == nil {
-		return
-	}
-	return *v, true
-}
-
-// OldUpdatedAt returns the old "updated_at" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
-// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldUpdatedAt(ctx context.Context) (v time.Time, err error) {
-	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldUpdatedAt is only allowed on UpdateOne operations")
-	}
-	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldUpdatedAt requires an ID field in the mutation")
-	}
-	oldValue, err := m.oldValue(ctx)
-	if err != nil {
-		return v, fmt.Errorf("querying old value for OldUpdatedAt: %w", err)
-	}
-	return oldValue.UpdatedAt, nil
-}
-
-// ResetUpdatedAt resets all changes to the "updated_at" field.
-func (m *UserMutation) ResetUpdatedAt() {
-	m.updated_at = nil
-}
-
-// SetCreatedAt sets the "created_at" field.
-func (m *UserMutation) SetCreatedAt(t time.Time) {
-	m.created_at = &t
-}
-
-// CreatedAt returns the value of the "created_at" field in the mutation.
-func (m *UserMutation) CreatedAt() (r time.Time, exists bool) {
-	v := m.created_at
-	if v == nil {
-		return
-	}
-	return *v, true
-}
-
-// OldCreatedAt returns the old "created_at" field's value of the User entity.
-// If the User object wasn't provided to the builder, the object is fetched from the database.
-// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *UserMutation) OldCreatedAt(ctx context.Context) (v time.Time, err error) {
-	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldCreatedAt is only allowed on UpdateOne operations")
-	}
-	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldCreatedAt requires an ID field in the mutation")
-	}
-	oldValue, err := m.oldValue(ctx)
-	if err != nil {
-		return v, fmt.Errorf("querying old value for OldCreatedAt: %w", err)
-	}
-	return oldValue.CreatedAt, nil
-}
-
-// ResetCreatedAt resets all changes to the "created_at" field.
-func (m *UserMutation) ResetCreatedAt() {
-	m.created_at = nil
-}
-
-// Where appends a list predicates to the UserMutation builder.
-func (m *UserMutation) Where(ps ...predicate.User) {
-	m.predicates = append(m.predicates, ps...)
-}
-
-// WhereP appends storage-level predicates to the UserMutation builder. Using this method,
-// users can use type-assertion to append predicates that do not depend on any generated package.
-func (m *UserMutation) WhereP(ps ...func(*sql.Selector)) {
-	p := make([]predicate.User, len(ps))
-	for i := range ps {
-		p[i] = ps[i]
-	}
-	m.Where(p...)
-}
-
-// Op returns the operation name.
-func (m *UserMutation) Op() Op {
-	return m.op
+// Op returns the operation name.
+func (m *TwitchCategoryMutation) Op() Op {
+	return m.op
 }
 
 // SetOp allows setting the mutation operation.
-func (m *UserMutation) SetOp(op Op) {
+func (m *TwitchCategoryMutation) SetOp(op Op) {
 	m.op = op
 }
 
-// Type returns the node type of this mutation (User).
-func (m *UserMutation) Type() string {
+// Type returns the node type of this mutation (TwitchCategory).
+func (m *TwitchCategoryMutation) Type() string {
 	return m.typ
 }
 
 // Fields returns all fields that were changed during this mutation. Note that in
 // order to get all numeric fields that were incremented/decremented, call
 // AddedFields().
-func (m *UserMutation) Fields() []string {
-	fields := make([]string, 0, 8)
-	if m.sub != nil {
-		fields = append(fields, user.FieldSub)
-	}
-	if m.username != nil {
-		fields = append(fields, user.FieldUsername)
-	}
-	if m.password != nil {
-		fields = append(fields, user.FieldPassword)
-	}
-	if m.oauth != nil {
-		fields = append(fields, user.FieldOauth)
+func (m *TwitchCategoryMutation) Fields() []string {
+	fields := make([]string, 0, 5)
+	if m.name != nil {
+		fields = append(fields, twitchcategory.FieldName)
 	}
-	if m.role != nil {
-		fields = append(fields, user.FieldRole)
+	if m.box_art_url != nil {
+		fields = append(fields, twitchcategory.FieldBoxArtURL)
 	}
-	if m.webhook != nil {
-		fields = append(fields, user.FieldWebhook)
+	if m.igdb_id != nil {
+		fields = append(fields, twitchcategory.FieldIgdbID)
 	}
 	if m.updated_at != nil {
-		fields = append(fields, user.FieldUpdatedAt)
+		fields = append(fields, twitchcategory.FieldUpdatedAt)
 	}
 	if m.created_at != nil {
-		fields = append(fields, user.FieldCreatedAt)
+		fields = append(fields, twitchcategory.FieldCreatedAt)
 	}
 	return fields
 }
@@ -9733,23 +9748,17 @@ func (m *UserMutation) Fields() []string {
 // Field returns the value of a field with the given name. The second boolean
 // return value indicates that this field was not set, or was not defined in the
 // schema.
-func (m *UserMutation) Field(name string) (ent.Value, bool) {
+func (m *TwitchCategoryMutation) Field(name string) (ent.Value, bool) {
 	switch name {
-	case user.FieldSub:
-		return m.Sub()
-	case user.FieldUsername:
-		return m.Username()
-	case user.FieldPassword:
-		return m.Password()
-	case user.FieldOauth:
-		return m.Oauth()
-	case user.FieldRole:
-		return m.Role()
-	case user.FieldWebhook:
-		return m.Webhook()
-	case user.FieldUpdatedAt:
+	case twitchcategory.FieldName:
+		return m.Name()
+	case twitchcategory.FieldBoxArtURL:
+		return m.BoxArtURL()
+	case twitchcategory.FieldIgdbID:
+		return m.IgdbID()
+	case twitchcategory.FieldUpdatedAt:
 		return m.UpdatedAt()
-	case user.FieldCreatedAt:
+	case twitchcategory.FieldCreatedAt:
 		return m.CreatedAt()
 	}
 	return nil, false
@@ -9758,83 +9767,56 @@ func (m *UserMutation) Field(name string) (ent.Value, bool) {
 // OldField returns the old value of the field from the database. An error is
 // returned if the mutation operation is not UpdateOne, or the query to the
 // database failed.
-func (m *UserMutation) OldField(ctx context.Context, name string) (ent.Value, error) {
+func (m *TwitchCategoryMutation) OldField(ctx context.Context, name string) (ent.Value, error) {
 	switch name {
-	case user.FieldSub:
-		return m.OldSub(ctx)
-	case user.FieldUsername:
-		return m.OldUsername(ctx)
-	case user.FieldPassword:
-		return m.OldPassword(ctx)
-	case user.FieldOauth:
-		return m.OldOauth(ctx)
-	case user.FieldRole:
-		return m.OldRole(ctx)
-	case user.FieldWebhook:
-		return m.OldWebhook(ctx)
-	case user.FieldUpdatedAt:
+	case twitchcategory.FieldName:
+		return m.OldName(ctx)
+	case twitchcategory.FieldBoxArtURL:
+		return m.OldBoxArtURL(ctx)
+	case twitchcategory.FieldIgdbID:
+		return m.OldIgdbID(ctx)
+	case twitchcategory.FieldUpdatedAt:
 		return m.OldUpdatedAt(ctx)
-	case user.FieldCreatedAt:
+	case twitchcategory.FieldCreatedAt:
 		return m.OldCreatedAt(ctx)
 	}
-	return nil, fmt.Errorf("unknown User field %s", name)
+	return nil, fmt.Errorf("unknown TwitchCategory field %s", name)
 }
 
 // SetField sets the value of a field with the given name. It returns an error if
 // the field is not defined in the schema, or if the type mismatched the field
 // type.
-func (m *UserMutation) SetField(name string, value ent.Value) error {
+func (m *TwitchCategoryMutation) SetField(name string, value ent.Value) error {
 	switch name {
-	case user.FieldSub:
-		v, ok := value.(string)
-		if !ok {
-			return fmt.Errorf("unexpected type %T for field %s", value, name)
-		}
-		m.SetSub(v)
-		return nil
-	case user.FieldUsername:
+	case twitchcategory.FieldName:
 		v, ok := value.(string)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetUsername(v)
+		m.SetName(v)
 		return nil
-	case user.FieldPassword:
+	case twitchcategory.FieldBoxArtURL:
 		v, ok := value.(string)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetPassword(v)
-		return nil
-	case user.FieldOauth:
-		v, ok := value.(bool)
-		if !ok {
-			return fmt.Errorf("unexpected type %T for field %s", value, name)
-		}
-		m.SetOauth(v)
-		return nil
-	case user.FieldRole:
-		v, ok := value.(utils.Role)
-		if !ok {
-			return fmt.Errorf("unexpected type %T for field %s", value, name)
-		}
-		m.SetRole(v)
+		m.SetBoxArtURL(v)
 		return nil
-	case user.FieldWebhook:
+	case twitchcategory.FieldIgdbID:
 		v, ok := value.(string)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
-		m.SetWebhook(v)
+		m.SetIgdbID(v)
 		return nil
-	case user.FieldUpdatedAt:
+	case twitchcategory.FieldUpdatedAt:
 		v, ok := value.(time.Time)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
 		}
 		m.SetUpdatedAt(v)
 		return nil
-	case user.FieldCreatedAt:
+	case twitchcategory.FieldCreatedAt:
 		v, ok := value.(time.Time)
 		if !ok {
 			return fmt.Errorf("unexpected type %T for field %s", value, name)
@@ -9842,226 +9824,167 @@ func (m *UserMutation) SetField(name string, value ent.Value) error {
 		m.SetCreatedAt(v)
 		return nil
 	}
-	return fmt.Errorf("unknown User field %s", name)
+	return fmt.Errorf("unknown TwitchCategory field %s", name)
 }
 
 // AddedFields returns all numeric fields that were incremented/decremented during
 // this mutation.
-func (m *UserMutation) AddedFields() []string {
+func (m *TwitchCategoryMutation) AddedFields() []string {
 	return nil
 }
 
 // AddedField returns the numeric value that was incremented/decremented on a field
 // with the given name. The second boolean return value indicates that this field
 // was not set, or was not defined in the schema.
-func (m *UserMutation) AddedField(name string) (ent.Value, bool) {
+func (m *TwitchCategoryMutation) AddedField(name string) (ent.Value, bool) {
 	return nil, false
 }
 
 // AddField adds the value to the field with the given name. It returns an error if
 // the field is not defined in the schema, or if the type mismatched the field
 // type.
-func (m *UserMutation) AddField(name string, value ent.Value) error {
+func (m *TwitchCategoryMutation) AddField(name string, value ent.Value) error {
 	switch name {
 	}
-	return fmt.Errorf("unknown User numeric field %s", name)
+	return fmt.Errorf("unknown TwitchCategory numeric field %s", name)
 }
 
 // ClearedFields returns all nullable fields that were cleared during this
 // mutation.
-func (m *UserMutation) ClearedFields() []string {
+func (m *TwitchCategoryMutation) ClearedFields() []string {
 	var fields []string
-	if m.FieldCleared(user.FieldSub) {
-		fields = append(fields, user.FieldSub)
-	}
-	if m.FieldCleared(user.FieldPassword) {
-		fields = append(fields, user.FieldPassword)
+	if m.FieldCleared(twitchcategory.FieldBoxArtURL) {
+		fields = append(fields, twitchcategory.FieldBoxArtURL)
 	}
-	if m.FieldCleared(user.FieldWebhook) {
-		fields = append(fields, user.FieldWebhook)
+	if m.FieldCleared(twitchcategory.FieldIgdbID) {
+		fields = append(fields, twitchcategory.FieldIgdbID)
 	}
 	return fields
 }
 
 // FieldCleared returns a boolean indicating if a field with the given name was
 // cleared in this mutation.
-func (m *UserMutation) FieldCleared(name string) bool {
+func (m *TwitchCategoryMutation) FieldCleared(name string) bool {
 	_, ok := m.clearedFields[name]
 	return ok
 }
 
 // ClearField clears the value of the field with the given name. It returns an
 // error if the field is not defined in the schema.
-func (m *UserMutation) ClearField(name string) error {
+func (m *TwitchCategoryMutation) ClearField(name string) error {
 	switch name {
-	case user.FieldSub:
-		m.ClearSub()
-		return nil
-	case user.FieldPassword:
-		m.ClearPassword()
+	case twitchcategory.FieldBoxArtURL:
+		m.ClearBoxArtURL()
 		return nil
-	case user.FieldWebhook:
-		m.ClearWebhook()
+	case twitchcategory.FieldIgdbID:
+		m.ClearIgdbID()
 		return nil
 	}
-	return fmt.Errorf("unknown User nullable field %s", name)
+	return fmt.Errorf("unknown TwitchCategory nullable field %s", name)
 }
 
 // ResetField resets all changes in the mutation for the field with the given name.
 // It returns an error if the field is not defined in the schema.
-func (m *UserMutation) ResetField(name string) error {
+func (m *TwitchCategoryMutation) ResetField(name string) error {
 	switch name {
-	case user.FieldSub:
-		m.ResetSub()
-		return nil
-	case user.FieldUsername:
-		m.ResetUsername()
-		return nil
-	case user.FieldPassword:
-		m.ResetPassword()
-		return nil
-	case user.FieldOauth:
-		m.ResetOauth()
+	case twitchcategory.FieldName:
+		m.ResetName()
 		return nil
-	case user.FieldRole:
-		m.ResetRole()
+	case twitchcategory.FieldBoxArtURL:
+		m.ResetBoxArtURL()
 		return nil
-	case user.FieldWebhook:
-		m.ResetWebhook()
+	case twitchcategory.FieldIgdbID:
+		m.ResetIgdbID()
 		return nil
-	case user.FieldUpdatedAt:
+	case twitchcategory.FieldUpdatedAt:
 		m.ResetUpdatedAt()
 		return nil
-	case user.FieldCreatedAt:
+	case twitchcategory.FieldCreatedAt:
 		m.ResetCreatedAt()
 		return nil
 	}
-	return fmt.Errorf("unknown User field %s", name)
+	return fmt.Errorf("unknown TwitchCategory field %s", name)
 }
 
 // AddedEdges returns all edge names that were set/added in this mutation.
-func (m *UserMutation) AddedEdges() []string {
+func (m *TwitchCategoryMutation) AddedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // AddedIDs returns all IDs (to other nodes) that were added for the given edge
 // name in this mutation.
-func (m *UserMutation) AddedIDs(name string) []ent.Value {
+func (m *TwitchCategoryMutation) AddedIDs(name string) []ent.Value {
 	return nil
 }
 
 // RemovedEdges returns all edge names that were removed in this mutation.
-func (m *UserMutation) RemovedEdges() []string {
+func (m *TwitchCategoryMutation) RemovedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // RemovedIDs returns all IDs (to other nodes) that were removed for the edge with
 // the given name in this mutation.
-func (m *UserMutation) RemovedIDs(name string) []ent.Value {
+func (m *TwitchCategoryMutation) RemovedIDs(name string) []ent.Value {
 	return nil
 }
 
 // ClearedEdges returns all edge names that were cleared in this mutation.
-func (m *UserMutation) ClearedEdges() []string {
+func (m *TwitchCategoryMutation) ClearedEdges() []string {
 	edges := make([]string, 0, 0)
 	return edges
 }
 
 // EdgeCleared returns a boolean which indicates if the edge with the given name
 // was cleared in this mutation.
-func (m *UserMutation) EdgeCleared(name string) bool {
+func (m *TwitchCategoryMutation) EdgeCleared(name string) bool {
 	return false
 }
 
 // ClearEdge clears the value of the edge with the given name. It returns an error
 // if that edge is not defined in the schema.
-func (m *UserMutation) ClearEdge(name string) error {
-	return fmt.Errorf("unknown User unique edge %s", name)
+func (m *TwitchCategoryMutation) ClearEdge(name string) error {
+	return fmt.Errorf("unknown TwitchCategory unique edge %s", name)
 }
 
 // ResetEdge resets all changes to the edge with the given name in this mutation.
 // It returns an error if the edge is not defined in the schema.
-func (m *UserMutation) ResetEdge(name string) error {
-	return fmt.Errorf("unknown User edge %s", name)
+func (m *TwitchCategoryMutation) ResetEdge(name string) error {
+	return fmt.Errorf("unknown TwitchCategory edge %s", name)
 }
 
-// VodMutation represents an operation that mutates the Vod nodes in the graph.
-type VodMutation struct {
+// UserMutation represents an operation that mutates the User nodes in the graph.
+type UserMutation struct {
 	config
-	op                          Op
-	typ                         string
-	id                          *uuid.UUID
-	ext_id                      *string
-	ext_stream_id               *string
-	platform                    *utils.VideoPlatform
-	_type                       *utils.VodType
-	title                       *string
-	duration                    *int
-	addduration                 *int
-	views                       *int
-	addviews                    *int
-	resolution                  *string
-	processing                  *bool
-	thumbnail_path              *string
-	web_thumbnail_path          *string
-	video_path                  *string
-	video_hls_path              *string
-	chat_path                   *string
-	live_chat_path              *string
-	live_chat_convert_path      *string
-	chat_video_path             *string
-	info_path                   *string
-	caption_path                *string
-	folder_name                 *string
-	file_name                   *string
-	tmp_video_download_path     *string
-	tmp_video_convert_path      *string
-	tmp_chat_download_path      *string
-	tmp_live_chat_download_path *string
-	tmp_live_chat_convert_path  *string
-	tmp_chat_render_path        *string
-	tmp_video_hls_path          *string
-	locked                      *bool
-	local_views                 *int
-	addlocal_views              *int
-	streamed_at                 *time.Time
-	updated_at                  *time.Time
-	created_at                  *time.Time
-	clearedFields               map[string]struct{}
-	channel                     *uuid.UUID
-	clearedchannel              bool
-	queue                       *uuid.UUID
-	clearedqueue                bool
-	playlists                   map[uuid.UUID]struct{}
-	removedplaylists            map[uuid.UUID]struct{}
-	clearedplaylists            bool
-	chapters                    map[uuid.UUID]struct{}
-	removedchapters             map[uuid.UUID]struct{}
-	clearedchapters             bool
-	muted_segments              map[uuid.UUID]struct{}
-	removedmuted_segments       map[uuid.UUID]struct{}
-	clearedmuted_segments       bool
-	multistream_info            map[int]struct{}
-	removedmultistream_info     map[int]struct{}
-	clearedmultistream_info     bool
-	done                        bool
-	oldValue                    func(context.Context) (*Vod, error)
-	predicates                  []predicate.Vod
+	op            Op
+	typ           string
+	id            *uuid.UUID
+	sub           *string
+	username      *string
+	password      *string
+	oauth         *bool
+	role          *utils.Role
+	webhook       *string
+	updated_at    *time.Time
+	created_at    *time.Time
+	clearedFields map[string]struct{}
+	done          bool
+	oldValue      func(context.Context) (*User, error)
+	predicates    []predicate.User
 }
 
-var _ ent.Mutation = (*VodMutation)(nil)
+var _ ent.Mutation = (*UserMutation)(nil)
 
-// vodOption allows management of the mutation configuration using functional options.
-type vodOption func(*VodMutation)
+// userOption allows management of the mutation configuration using functional options.
+type userOption func(*UserMutation)
 
-// newVodMutation creates new mutation for the Vod entity.
-func newVodMutation(c config, op Op, opts ...vodOption) *VodMutation {
-	m := &VodMutation{
+// newUserMutation creates new mutation for the User entity.
+func newUserMutation(c config, op Op, opts ...userOption) *UserMutation {
+	m := &UserMutation{
 		config:        c,
 		op:            op,
-		typ:           TypeVod,
+		typ:           TypeUser,
 		clearedFields: make(map[string]struct{}),
 	}
 	for _, opt := range opts {
@@ -10070,20 +9993,20 @@ func newVodMutation(c config, op Op, opts ...vodOption) *VodMutation {
 	return m
 }
 
-// withVodID sets the ID field of the mutation.
-func withVodID(id uuid.UUID) vodOption {
-	return func(m *VodMutation) {
+// withUserID sets the ID field of the mutation.
+func withUserID(id uuid.UUID) userOption {
+	return func(m *UserMutation) {
 		var (
 			err   error
 			once  sync.Once
-			value *Vod
+			value *User
 		)
-		m.oldValue = func(ctx context.Context) (*Vod, error) {
+		m.oldValue = func(ctx context.Context) (*User, error) {
 			once.Do(func() {
 				if m.done {
 					err = errors.New("querying old values post mutation is not allowed")
 				} else {
-					value, err = m.Client().Vod.Get(ctx, id)
+					value, err = m.Client().User.Get(ctx, id)
 				}
 			})
 			return value, err
@@ -10092,10 +10015,10 @@ func withVodID(id uuid.UUID) vodOption {
 	}
 }
 
-// withVod sets the old Vod of the mutation.
-func withVod(node *Vod) vodOption {
-	return func(m *VodMutation) {
-		m.oldValue = func(context.Context) (*Vod, error) {
+// withUser sets the old User of the mutation.
+func withUser(node *User) userOption {
+	return func(m *UserMutation) {
+		m.oldValue = func(context.Context) (*User, error) {
 			return node, nil
 		}
 		m.id = &node.ID
@@ -10104,7 +10027,7 @@ func withVod(node *Vod) vodOption {
 
 // Client returns a new `ent.Client` from the mutation. If the mutation was
 // executed in a transaction (ent.Tx), a transactional client is returned.
-func (m VodMutation) Client() *Client {
+func (m UserMutation) Client() *Client {
 	client := &Client{config: m.config}
 	client.init()
 	return client
@@ -10112,7 +10035,7 @@ func (m VodMutation) Client() *Client {
 
 // Tx returns an `ent.Tx` for mutations that were executed in transactions;
 // it returns an error otherwise.
-func (m VodMutation) Tx() (*Tx, error) {
+func (m UserMutation) Tx() (*Tx, error) {
 	if _, ok := m.driver.(*txDriver); !ok {
 		return nil, errors.New("ent: mutation is not running in a transaction")
 	}
@@ -10122,14 +10045,14 @@ func (m VodMutation) Tx() (*Tx, error) {
 }
 
 // SetID sets the value of the id field. Note that this
-// operation is only accepted on creation of Vod entities.
-func (m *VodMutation) SetID(id uuid.UUID) {
+// operation is only accepted on creation of User entities.
+func (m *UserMutation) SetID(id uuid.UUID) {
 	m.id = &id
 }
 
 // ID returns the ID value in the mutation. Note that the ID is only available
 // if it was provided to the builder or after it was returned from the database.
-func (m *VodMutation) ID() (id uuid.UUID, exists bool) {
+func (m *UserMutation) ID() (id uuid.UUID, exists bool) {
 	if m.id == nil {
 		return
 	}
@@ -10140,7 +10063,7 @@ func (m *VodMutation) ID() (id uuid.UUID, exists bool) {
 // That means, if the mutation is applied within a transaction with an isolation level such
 // as sql.LevelSerializable, the returned ids match the ids of the rows that will be updated
 // or updated by the mutation.
-func (m *VodMutation) IDs(ctx context.Context) ([]uuid.UUID, error) {
+func (m *UserMutation) IDs(ctx context.Context) ([]uuid.UUID, error) {
 	switch {
 	case m.op.Is(OpUpdateOne | OpDeleteOne):
 		id, exists := m.ID()
@@ -10149,1397 +10072,2797 @@ func (m *VodMutation) IDs(ctx context.Context) ([]uuid.UUID, error) {
 		}
 		fallthrough
 	case m.op.Is(OpUpdate | OpDelete):
-		return m.Client().Vod.Query().Where(m.predicates...).IDs(ctx)
+		return m.Client().User.Query().Where(m.predicates...).IDs(ctx)
 	default:
 		return nil, fmt.Errorf("IDs is not allowed on %s operations", m.op)
 	}
 }
 
-// SetExtID sets the "ext_id" field.
-func (m *VodMutation) SetExtID(s string) {
-	m.ext_id = &s
+// SetSub sets the "sub" field.
+func (m *UserMutation) SetSub(s string) {
+	m.sub = &s
 }
 
-// ExtID returns the value of the "ext_id" field in the mutation.
-func (m *VodMutation) ExtID() (r string, exists bool) {
-	v := m.ext_id
+// Sub returns the value of the "sub" field in the mutation.
+func (m *UserMutation) Sub() (r string, exists bool) {
+	v := m.sub
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldExtID returns the old "ext_id" field's value of the Vod entity.
-// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// OldSub returns the old "sub" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldExtID(ctx context.Context) (v string, err error) {
+func (m *UserMutation) OldSub(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldExtID is only allowed on UpdateOne operations")
+		return v, errors.New("OldSub is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldExtID requires an ID field in the mutation")
+		return v, errors.New("OldSub requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldExtID: %w", err)
+		return v, fmt.Errorf("querying old value for OldSub: %w", err)
 	}
-	return oldValue.ExtID, nil
+	return oldValue.Sub, nil
 }
 
-// ResetExtID resets all changes to the "ext_id" field.
-func (m *VodMutation) ResetExtID() {
-	m.ext_id = nil
+// ClearSub clears the value of the "sub" field.
+func (m *UserMutation) ClearSub() {
+	m.sub = nil
+	m.clearedFields[user.FieldSub] = struct{}{}
 }
 
-// SetExtStreamID sets the "ext_stream_id" field.
-func (m *VodMutation) SetExtStreamID(s string) {
-	m.ext_stream_id = &s
+// SubCleared returns if the "sub" field was cleared in this mutation.
+func (m *UserMutation) SubCleared() bool {
+	_, ok := m.clearedFields[user.FieldSub]
+	return ok
 }
 
-// ExtStreamID returns the value of the "ext_stream_id" field in the mutation.
-func (m *VodMutation) ExtStreamID() (r string, exists bool) {
-	v := m.ext_stream_id
+// ResetSub resets all changes to the "sub" field.
+func (m *UserMutation) ResetSub() {
+	m.sub = nil
+	delete(m.clearedFields, user.FieldSub)
+}
+
+// SetUsername sets the "username" field.
+func (m *UserMutation) SetUsername(s string) {
+	m.username = &s
+}
+
+// Username returns the value of the "username" field in the mutation.
+func (m *UserMutation) Username() (r string, exists bool) {
+	v := m.username
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldExtStreamID returns the old "ext_stream_id" field's value of the Vod entity.
-// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// OldUsername returns the old "username" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldExtStreamID(ctx context.Context) (v string, err error) {
+func (m *UserMutation) OldUsername(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldExtStreamID is only allowed on UpdateOne operations")
+		return v, errors.New("OldUsername is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldExtStreamID requires an ID field in the mutation")
+		return v, errors.New("OldUsername requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldExtStreamID: %w", err)
+		return v, fmt.Errorf("querying old value for OldUsername: %w", err)
 	}
-	return oldValue.ExtStreamID, nil
+	return oldValue.Username, nil
 }
 
-// ClearExtStreamID clears the value of the "ext_stream_id" field.
-func (m *VodMutation) ClearExtStreamID() {
-	m.ext_stream_id = nil
-	m.clearedFields[vod.FieldExtStreamID] = struct{}{}
+// ResetUsername resets all changes to the "username" field.
+func (m *UserMutation) ResetUsername() {
+	m.username = nil
 }
 
-// ExtStreamIDCleared returns if the "ext_stream_id" field was cleared in this mutation.
-func (m *VodMutation) ExtStreamIDCleared() bool {
-	_, ok := m.clearedFields[vod.FieldExtStreamID]
-	return ok
+// SetPassword sets the "password" field.
+func (m *UserMutation) SetPassword(s string) {
+	m.password = &s
 }
 
-// ResetExtStreamID resets all changes to the "ext_stream_id" field.
-func (m *VodMutation) ResetExtStreamID() {
-	m.ext_stream_id = nil
-	delete(m.clearedFields, vod.FieldExtStreamID)
+// Password returns the value of the "password" field in the mutation.
+func (m *UserMutation) Password() (r string, exists bool) {
+	v := m.password
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldPassword returns the old "password" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldPassword(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldPassword is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldPassword requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldPassword: %w", err)
+	}
+	return oldValue.Password, nil
+}
+
+// ClearPassword clears the value of the "password" field.
+func (m *UserMutation) ClearPassword() {
+	m.password = nil
+	m.clearedFields[user.FieldPassword] = struct{}{}
+}
+
+// PasswordCleared returns if the "password" field was cleared in this mutation.
+func (m *UserMutation) PasswordCleared() bool {
+	_, ok := m.clearedFields[user.FieldPassword]
+	return ok
+}
+
+// ResetPassword resets all changes to the "password" field.
+func (m *UserMutation) ResetPassword() {
+	m.password = nil
+	delete(m.clearedFields, user.FieldPassword)
+}
+
+// SetOauth sets the "oauth" field.
+func (m *UserMutation) SetOauth(b bool) {
+	m.oauth = &b
+}
+
+// Oauth returns the value of the "oauth" field in the mutation.
+func (m *UserMutation) Oauth() (r bool, exists bool) {
+	v := m.oauth
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldOauth returns the old "oauth" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldOauth(ctx context.Context) (v bool, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldOauth is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldOauth requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldOauth: %w", err)
+	}
+	return oldValue.Oauth, nil
+}
+
+// ResetOauth resets all changes to the "oauth" field.
+func (m *UserMutation) ResetOauth() {
+	m.oauth = nil
+}
+
+// SetRole sets the "role" field.
+func (m *UserMutation) SetRole(u utils.Role) {
+	m.role = &u
+}
+
+// Role returns the value of the "role" field in the mutation.
+func (m *UserMutation) Role() (r utils.Role, exists bool) {
+	v := m.role
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldRole returns the old "role" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldRole(ctx context.Context) (v utils.Role, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldRole is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldRole requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldRole: %w", err)
+	}
+	return oldValue.Role, nil
+}
+
+// ResetRole resets all changes to the "role" field.
+func (m *UserMutation) ResetRole() {
+	m.role = nil
+}
+
+// SetWebhook sets the "webhook" field.
+func (m *UserMutation) SetWebhook(s string) {
+	m.webhook = &s
+}
+
+// Webhook returns the value of the "webhook" field in the mutation.
+func (m *UserMutation) Webhook() (r string, exists bool) {
+	v := m.webhook
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldWebhook returns the old "webhook" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldWebhook(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldWebhook is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldWebhook requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldWebhook: %w", err)
+	}
+	return oldValue.Webhook, nil
+}
+
+// ClearWebhook clears the value of the "webhook" field.
+func (m *UserMutation) ClearWebhook() {
+	m.webhook = nil
+	m.clearedFields[user.FieldWebhook] = struct{}{}
+}
+
+// WebhookCleared returns if the "webhook" field was cleared in this mutation.
+func (m *UserMutation) WebhookCleared() bool {
+	_, ok := m.clearedFields[user.FieldWebhook]
+	return ok
+}
+
+// ResetWebhook resets all changes to the "webhook" field.
+func (m *UserMutation) ResetWebhook() {
+	m.webhook = nil
+	delete(m.clearedFields, user.FieldWebhook)
+}
+
+// SetUpdatedAt sets the "updated_at" field.
+func (m *UserMutation) SetUpdatedAt(t time.Time) {
+	m.updated_at = &t
+}
+
+// UpdatedAt returns the value of the "updated_at" field in the mutation.
+func (m *UserMutation) UpdatedAt() (r time.Time, exists bool) {
+	v := m.updated_at
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldUpdatedAt returns the old "updated_at" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldUpdatedAt(ctx context.Context) (v time.Time, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldUpdatedAt is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldUpdatedAt requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldUpdatedAt: %w", err)
+	}
+	return oldValue.UpdatedAt, nil
+}
+
+// ResetUpdatedAt resets all changes to the "updated_at" field.
+func (m *UserMutation) ResetUpdatedAt() {
+	m.updated_at = nil
+}
+
+// SetCreatedAt sets the "created_at" field.
+func (m *UserMutation) SetCreatedAt(t time.Time) {
+	m.created_at = &t
+}
+
+// CreatedAt returns the value of the "created_at" field in the mutation.
+func (m *UserMutation) CreatedAt() (r time.Time, exists bool) {
+	v := m.created_at
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldCreatedAt returns the old "created_at" field's value of the User entity.
+// If the User object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *UserMutation) OldCreatedAt(ctx context.Context) (v time.Time, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldCreatedAt is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldCreatedAt requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldCreatedAt: %w", err)
+	}
+	return oldValue.CreatedAt, nil
+}
+
+// ResetCreatedAt resets all changes to the "created_at" field.
+func (m *UserMutation) ResetCreatedAt() {
+	m.created_at = nil
+}
+
+// Where appends a list predicates to the UserMutation builder.
+func (m *UserMutation) Where(ps ...predicate.User) {
+	m.predicates = append(m.predicates, ps...)
+}
+
+// WhereP appends storage-level predicates to the UserMutation builder. Using this method,
+// users can use type-assertion to append predicates that do not depend on any generated package.
+func (m *UserMutation) WhereP(ps ...func(*sql.Selector)) {
+	p := make([]predicate.User, len(ps))
+	for i := range ps {
+		p[i] = ps[i]
+	}
+	m.Where(p...)
+}
+
+// Op returns the operation name.
+func (m *UserMutation) Op() Op {
+	return m.op
+}
+
+// SetOp allows setting the mutation operation.
+func (m *UserMutation) SetOp(op Op) {
+	m.op = op
+}
+
+// Type returns the node type of this mutation (User).
+func (m *UserMutation) Type() string {
+	return m.typ
+}
+
+// Fields returns all fields that were changed during this mutation. Note that in
+// order to get all numeric fields that were incremented/decremented, call
+// AddedFields().
+func (m *UserMutation) Fields() []string {
+	fields := make([]string, 0, 8)
+	if m.sub != nil {
+		fields = append(fields, user.FieldSub)
+	}
+	if m.username != nil {
+		fields = append(fields, user.FieldUsername)
+	}
+	if m.password != nil {
+		fields = append(fields, user.FieldPassword)
+	}
+	if m.oauth != nil {
+		fields = append(fields, user.FieldOauth)
+	}
+	if m.role != nil {
+		fields = append(fields, user.FieldRole)
+	}
+	if m.webhook != nil {
+		fields = append(fields, user.FieldWebhook)
+	}
+	if m.updated_at != nil {
+		fields = append(fields, user.FieldUpdatedAt)
+	}
+	if m.created_at != nil {
+		fields = append(fields, user.FieldCreatedAt)
+	}
+	return fields
+}
+
+// Field returns the value of a field with the given name. The second boolean
+// return value indicates that this field was not set, or was not defined in the
+// schema.
+func (m *UserMutation) Field(name string) (ent.Value, bool) {
+	switch name {
+	case user.FieldSub:
+		return m.Sub()
+	case user.FieldUsername:
+		return m.Username()
+	case user.FieldPassword:
+		return m.Password()
+	case user.FieldOauth:
+		return m.Oauth()
+	case user.FieldRole:
+		return m.Role()
+	case user.FieldWebhook:
+		return m.Webhook()
+	case user.FieldUpdatedAt:
+		return m.UpdatedAt()
+	case user.FieldCreatedAt:
+		return m.CreatedAt()
+	}
+	return nil, false
+}
+
+// OldField returns the old value of the field from the database. An error is
+// returned if the mutation operation is not UpdateOne, or the query to the
+// database failed.
+func (m *UserMutation) OldField(ctx context.Context, name string) (ent.Value, error) {
+	switch name {
+	case user.FieldSub:
+		return m.OldSub(ctx)
+	case user.FieldUsername:
+		return m.OldUsername(ctx)
+	case user.FieldPassword:
+		return m.OldPassword(ctx)
+	case user.FieldOauth:
+		return m.OldOauth(ctx)
+	case user.FieldRole:
+		return m.OldRole(ctx)
+	case user.FieldWebhook:
+		return m.OldWebhook(ctx)
+	case user.FieldUpdatedAt:
+		return m.OldUpdatedAt(ctx)
+	case user.FieldCreatedAt:
+		return m.OldCreatedAt(ctx)
+	}
+	return nil, fmt.Errorf("unknown User field %s", name)
+}
+
+// SetField sets the value of a field with the given name. It returns an error if
+// the field is not defined in the schema, or if the type mismatched the field
+// type.
+func (m *UserMutation) SetField(name string, value ent.Value) error {
+	switch name {
+	case user.FieldSub:
+		v, ok := value.(string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSub(v)
+		return nil
+	case user.FieldUsername:
+		v, ok := value.(string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetUsername(v)
+		return nil
+	case user.FieldPassword:
+		v, ok := value.(string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetPassword(v)
+		return nil
+	case user.FieldOauth:
+		v, ok := value.(bool)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetOauth(v)
+		return nil
+	case user.FieldRole:
+		v, ok := value.(utils.Role)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetRole(v)
+		return nil
+	case user.FieldWebhook:
+		v, ok := value.(string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetWebhook(v)
+		return nil
+	case user.FieldUpdatedAt:
+		v, ok := value.(time.Time)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetUpdatedAt(v)
+		return nil
+	case user.FieldCreatedAt:
+		v, ok := value.(time.Time)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetCreatedAt(v)
+		return nil
+	}
+	return fmt.Errorf("unknown User field %s", name)
+}
+
+// AddedFields returns all numeric fields that were incremented/decremented during
+// this mutation.
+func (m *UserMutation) AddedFields() []string {
+	return nil
+}
+
+// AddedField returns the numeric value that was incremented/decremented on a field
+// with the given name. The second boolean return value indicates that this field
+// was not set, or was not defined in the schema.
+func (m *UserMutation) AddedField(name string) (ent.Value, bool) {
+	return nil, false
+}
+
+// AddField adds the value to the field with the given name. It returns an error if
+// the field is not defined in the schema, or if the type mismatched the field
+// type.
+func (m *UserMutation) AddField(name string, value ent.Value) error {
+	switch name {
+	}
+	return fmt.Errorf("unknown User numeric field %s", name)
+}
+
+// ClearedFields returns all nullable fields that were cleared during this
+// mutation.
+func (m *UserMutation) ClearedFields() []string {
+	var fields []string
+	if m.FieldCleared(user.FieldSub) {
+		fields = append(fields, user.FieldSub)
+	}
+	if m.FieldCleared(user.FieldPassword) {
+		fields = append(fields, user.FieldPassword)
+	}
+	if m.FieldCleared(user.FieldWebhook) {
+		fields = append(fields, user.FieldWebhook)
+	}
+	return fields
+}
+
+// FieldCleared returns a boolean indicating if a field with the given name was
+// cleared in this mutation.
+func (m *UserMutation) FieldCleared(name string) bool {
+	_, ok := m.clearedFields[name]
+	return ok
+}
+
+// ClearField clears the value of the field with the given name. It returns an
+// error if the field is not defined in the schema.
+func (m *UserMutation) ClearField(name string) error {
+	switch name {
+	case user.FieldSub:
+		m.ClearSub()
+		return nil
+	case user.FieldPassword:
+		m.ClearPassword()
+		return nil
+	case user.FieldWebhook:
+		m.ClearWebhook()
+		return nil
+	}
+	return fmt.Errorf("unknown User nullable field %s", name)
+}
+
+// ResetField resets all changes in the mutation for the field with the given name.
+// It returns an error if the field is not defined in the schema.
+func (m *UserMutation) ResetField(name string) error {
+	switch name {
+	case user.FieldSub:
+		m.ResetSub()
+		return nil
+	case user.FieldUsername:
+		m.ResetUsername()
+		return nil
+	case user.FieldPassword:
+		m.ResetPassword()
+		return nil
+	case user.FieldOauth:
+		m.ResetOauth()
+		return nil
+	case user.FieldRole:
+		m.ResetRole()
+		return nil
+	case user.FieldWebhook:
+		m.ResetWebhook()
+		return nil
+	case user.FieldUpdatedAt:
+		m.ResetUpdatedAt()
+		return nil
+	case user.FieldCreatedAt:
+		m.ResetCreatedAt()
+		return nil
+	}
+	return fmt.Errorf("unknown User field %s", name)
+}
+
+// AddedEdges returns all edge names that were set/added in this mutation.
+func (m *UserMutation) AddedEdges() []string {
+	edges := make([]string, 0, 0)
+	return edges
+}
+
+// AddedIDs returns all IDs (to other nodes) that were added for the given edge
+// name in this mutation.
+func (m *UserMutation) AddedIDs(name string) []ent.Value {
+	return nil
+}
+
+// RemovedEdges returns all edge names that were removed in this mutation.
+func (m *UserMutation) RemovedEdges() []string {
+	edges := make([]string, 0, 0)
+	return edges
+}
+
+// RemovedIDs returns all IDs (to other nodes) that were removed for the edge with
+// the given name in this mutation.
+func (m *UserMutation) RemovedIDs(name string) []ent.Value {
+	return nil
+}
+
+// ClearedEdges returns all edge names that were cleared in this mutation.
+func (m *UserMutation) ClearedEdges() []string {
+	edges := make([]string, 0, 0)
+	return edges
+}
+
+// EdgeCleared returns a boolean which indicates if the edge with the given name
+// was cleared in this mutation.
+func (m *UserMutation) EdgeCleared(name string) bool {
+	return false
+}
+
+// ClearEdge clears the value of the edge with the given name. It returns an error
+// if that edge is not defined in the schema.
+func (m *UserMutation) ClearEdge(name string) error {
+	return fmt.Errorf("unknown User unique edge %s", name)
+}
+
+// ResetEdge resets all changes to the edge with the given name in this mutation.
+// It returns an error if the edge is not defined in the schema.
+func (m *UserMutation) ResetEdge(name string) error {
+	return fmt.Errorf("unknown User edge %s", name)
+}
+
+// VodMutation represents an operation that mutates the Vod nodes in the graph.
+type VodMutation struct {
+	config
+	op                             Op
+	typ                            string
+	id                             *uuid.UUID
+	ext_id                         *string
+	clip_ext_vod_id                *string
+	ext_stream_id                  *string
+	platform                       *utils.VideoPlatform
+	_type                          *utils.VodType
+	title                          *string
+	duration                       *int
+	addduration                    *int
+	clip_vod_offset                *int
+	addclip_vod_offset             *int
+	views                          *int
+	addviews                       *int
+	resolution                     *string
+	processing                     *bool
+	thumbnail_path                 *string
+	web_thumbnail_path             *string
+	video_path                     *string
+	video_hls_path                 *string
+	chat_path                      *string
+	live_chat_path                 *string
+	live_chat_convert_path         *string
+	chat_video_path                *string
+	info_path                      *string
+	caption_path                   *string
+	folder_name                    *string
+	file_name                      *string
+	tmp_video_download_path        *string
+	tmp_video_convert_path         *string
+	tmp_chat_download_path         *string
+	tmp_live_chat_download_path    *string
+	tmp_live_chat_convert_path     *string
+	tmp_chat_render_path           *string
+	tmp_video_hls_path             *string
+	locked                         *bool
+	local_views                    *int
+	addlocal_views                 *int
+	sprite_thumbnails_enabled      *bool
+	sprite_thumbnails_images       *[]string
+	appendsprite_thumbnails_images []string
+	sprite_thumbnails_interval     *int
+	addsprite_thumbnails_interval  *int
+	sprite_thumbnails_width        *int
+	addsprite_thumbnails_width     *int
+	sprite_thumbnails_height       *int
+	addsprite_thumbnails_height    *int
+	sprite_thumbnails_rows         *int
+	addsprite_thumbnails_rows      *int
+	sprite_thumbnails_columns      *int
+	addsprite_thumbnails_columns   *int
+	streamed_at                    *time.Time
+	updated_at                     *time.Time
+	created_at                     *time.Time
+	clearedFields                  map[string]struct{}
+	channel                        *uuid.UUID
+	clearedchannel                 bool
+	queue                          *uuid.UUID
+	clearedqueue                   bool
+	playlists                      map[uuid.UUID]struct{}
+	removedplaylists               map[uuid.UUID]struct{}
+	clearedplaylists               bool
+	chapters                       map[uuid.UUID]struct{}
+	removedchapters                map[uuid.UUID]struct{}
+	clearedchapters                bool
+	muted_segments                 map[uuid.UUID]struct{}
+	removedmuted_segments          map[uuid.UUID]struct{}
+	clearedmuted_segments          bool
+	multistream_info               map[int]struct{}
+	removedmultistream_info        map[int]struct{}
+	clearedmultistream_info        bool
+	done                           bool
+	oldValue                       func(context.Context) (*Vod, error)
+	predicates                     []predicate.Vod
+}
+
+var _ ent.Mutation = (*VodMutation)(nil)
+
+// vodOption allows management of the mutation configuration using functional options.
+type vodOption func(*VodMutation)
+
+// newVodMutation creates new mutation for the Vod entity.
+func newVodMutation(c config, op Op, opts ...vodOption) *VodMutation {
+	m := &VodMutation{
+		config:        c,
+		op:            op,
+		typ:           TypeVod,
+		clearedFields: make(map[string]struct{}),
+	}
+	for _, opt := range opts {
+		opt(m)
+	}
+	return m
+}
+
+// withVodID sets the ID field of the mutation.
+func withVodID(id uuid.UUID) vodOption {
+	return func(m *VodMutation) {
+		var (
+			err   error
+			once  sync.Once
+			value *Vod
+		)
+		m.oldValue = func(ctx context.Context) (*Vod, error) {
+			once.Do(func() {
+				if m.done {
+					err = errors.New("querying old values post mutation is not allowed")
+				} else {
+					value, err = m.Client().Vod.Get(ctx, id)
+				}
+			})
+			return value, err
+		}
+		m.id = &id
+	}
+}
+
+// withVod sets the old Vod of the mutation.
+func withVod(node *Vod) vodOption {
+	return func(m *VodMutation) {
+		m.oldValue = func(context.Context) (*Vod, error) {
+			return node, nil
+		}
+		m.id = &node.ID
+	}
+}
+
+// Client returns a new `ent.Client` from the mutation. If the mutation was
+// executed in a transaction (ent.Tx), a transactional client is returned.
+func (m VodMutation) Client() *Client {
+	client := &Client{config: m.config}
+	client.init()
+	return client
+}
+
+// Tx returns an `ent.Tx` for mutations that were executed in transactions;
+// it returns an error otherwise.
+func (m VodMutation) Tx() (*Tx, error) {
+	if _, ok := m.driver.(*txDriver); !ok {
+		return nil, errors.New("ent: mutation is not running in a transaction")
+	}
+	tx := &Tx{config: m.config}
+	tx.init()
+	return tx, nil
+}
+
+// SetID sets the value of the id field. Note that this
+// operation is only accepted on creation of Vod entities.
+func (m *VodMutation) SetID(id uuid.UUID) {
+	m.id = &id
+}
+
+// ID returns the ID value in the mutation. Note that the ID is only available
+// if it was provided to the builder or after it was returned from the database.
+func (m *VodMutation) ID() (id uuid.UUID, exists bool) {
+	if m.id == nil {
+		return
+	}
+	return *m.id, true
+}
+
+// IDs queries the database and returns the entity ids that match the mutation's predicate.
+// That means, if the mutation is applied within a transaction with an isolation level such
+// as sql.LevelSerializable, the returned ids match the ids of the rows that will be updated
+// or updated by the mutation.
+func (m *VodMutation) IDs(ctx context.Context) ([]uuid.UUID, error) {
+	switch {
+	case m.op.Is(OpUpdateOne | OpDeleteOne):
+		id, exists := m.ID()
+		if exists {
+			return []uuid.UUID{id}, nil
+		}
+		fallthrough
+	case m.op.Is(OpUpdate | OpDelete):
+		return m.Client().Vod.Query().Where(m.predicates...).IDs(ctx)
+	default:
+		return nil, fmt.Errorf("IDs is not allowed on %s operations", m.op)
+	}
+}
+
+// SetExtID sets the "ext_id" field.
+func (m *VodMutation) SetExtID(s string) {
+	m.ext_id = &s
+}
+
+// ExtID returns the value of the "ext_id" field in the mutation.
+func (m *VodMutation) ExtID() (r string, exists bool) {
+	v := m.ext_id
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldExtID returns the old "ext_id" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldExtID(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldExtID is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldExtID requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldExtID: %w", err)
+	}
+	return oldValue.ExtID, nil
+}
+
+// ResetExtID resets all changes to the "ext_id" field.
+func (m *VodMutation) ResetExtID() {
+	m.ext_id = nil
+}
+
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (m *VodMutation) SetClipExtVodID(s string) {
+	m.clip_ext_vod_id = &s
+}
+
+// ClipExtVodID returns the value of the "clip_ext_vod_id" field in the mutation.
+func (m *VodMutation) ClipExtVodID() (r string, exists bool) {
+	v := m.clip_ext_vod_id
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldClipExtVodID returns the old "clip_ext_vod_id" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldClipExtVodID(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldClipExtVodID is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldClipExtVodID requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldClipExtVodID: %w", err)
+	}
+	return oldValue.ClipExtVodID, nil
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (m *VodMutation) ClearClipExtVodID() {
+	m.clip_ext_vod_id = nil
+	m.clearedFields[vod.FieldClipExtVodID] = struct{}{}
+}
+
+// ClipExtVodIDCleared returns if the "clip_ext_vod_id" field was cleared in this mutation.
+func (m *VodMutation) ClipExtVodIDCleared() bool {
+	_, ok := m.clearedFields[vod.FieldClipExtVodID]
+	return ok
+}
+
+// ResetClipExtVodID resets all changes to the "clip_ext_vod_id" field.
+func (m *VodMutation) ResetClipExtVodID() {
+	m.clip_ext_vod_id = nil
+	delete(m.clearedFields, vod.FieldClipExtVodID)
+}
+
+// SetExtStreamID sets the "ext_stream_id" field.
+func (m *VodMutation) SetExtStreamID(s string) {
+	m.ext_stream_id = &s
+}
+
+// ExtStreamID returns the value of the "ext_stream_id" field in the mutation.
+func (m *VodMutation) ExtStreamID() (r string, exists bool) {
+	v := m.ext_stream_id
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldExtStreamID returns the old "ext_stream_id" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldExtStreamID(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldExtStreamID is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldExtStreamID requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldExtStreamID: %w", err)
+	}
+	return oldValue.ExtStreamID, nil
+}
+
+// ClearExtStreamID clears the value of the "ext_stream_id" field.
+func (m *VodMutation) ClearExtStreamID() {
+	m.ext_stream_id = nil
+	m.clearedFields[vod.FieldExtStreamID] = struct{}{}
+}
+
+// ExtStreamIDCleared returns if the "ext_stream_id" field was cleared in this mutation.
+func (m *VodMutation) ExtStreamIDCleared() bool {
+	_, ok := m.clearedFields[vod.FieldExtStreamID]
+	return ok
+}
+
+// ResetExtStreamID resets all changes to the "ext_stream_id" field.
+func (m *VodMutation) ResetExtStreamID() {
+	m.ext_stream_id = nil
+	delete(m.clearedFields, vod.FieldExtStreamID)
+}
+
+// SetPlatform sets the "platform" field.
+func (m *VodMutation) SetPlatform(up utils.VideoPlatform) {
+	m.platform = &up
+}
+
+// Platform returns the value of the "platform" field in the mutation.
+func (m *VodMutation) Platform() (r utils.VideoPlatform, exists bool) {
+	v := m.platform
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldPlatform returns the old "platform" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldPlatform(ctx context.Context) (v utils.VideoPlatform, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldPlatform is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldPlatform requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldPlatform: %w", err)
+	}
+	return oldValue.Platform, nil
+}
+
+// ResetPlatform resets all changes to the "platform" field.
+func (m *VodMutation) ResetPlatform() {
+	m.platform = nil
+}
+
+// SetType sets the "type" field.
+func (m *VodMutation) SetType(ut utils.VodType) {
+	m._type = &ut
+}
+
+// GetType returns the value of the "type" field in the mutation.
+func (m *VodMutation) GetType() (r utils.VodType, exists bool) {
+	v := m._type
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldType returns the old "type" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldType(ctx context.Context) (v utils.VodType, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldType is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldType requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldType: %w", err)
+	}
+	return oldValue.Type, nil
+}
+
+// ResetType resets all changes to the "type" field.
+func (m *VodMutation) ResetType() {
+	m._type = nil
+}
+
+// SetTitle sets the "title" field.
+func (m *VodMutation) SetTitle(s string) {
+	m.title = &s
+}
+
+// Title returns the value of the "title" field in the mutation.
+func (m *VodMutation) Title() (r string, exists bool) {
+	v := m.title
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldTitle returns the old "title" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldTitle(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldTitle is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldTitle requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldTitle: %w", err)
+	}
+	return oldValue.Title, nil
+}
+
+// ResetTitle resets all changes to the "title" field.
+func (m *VodMutation) ResetTitle() {
+	m.title = nil
+}
+
+// SetDuration sets the "duration" field.
+func (m *VodMutation) SetDuration(i int) {
+	m.duration = &i
+	m.addduration = nil
+}
+
+// Duration returns the value of the "duration" field in the mutation.
+func (m *VodMutation) Duration() (r int, exists bool) {
+	v := m.duration
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldDuration returns the old "duration" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldDuration(ctx context.Context) (v int, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldDuration is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldDuration requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldDuration: %w", err)
+	}
+	return oldValue.Duration, nil
+}
+
+// AddDuration adds i to the "duration" field.
+func (m *VodMutation) AddDuration(i int) {
+	if m.addduration != nil {
+		*m.addduration += i
+	} else {
+		m.addduration = &i
+	}
+}
+
+// AddedDuration returns the value that was added to the "duration" field in this mutation.
+func (m *VodMutation) AddedDuration() (r int, exists bool) {
+	v := m.addduration
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ResetDuration resets all changes to the "duration" field.
+func (m *VodMutation) ResetDuration() {
+	m.duration = nil
+	m.addduration = nil
+}
+
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (m *VodMutation) SetClipVodOffset(i int) {
+	m.clip_vod_offset = &i
+	m.addclip_vod_offset = nil
+}
+
+// ClipVodOffset returns the value of the "clip_vod_offset" field in the mutation.
+func (m *VodMutation) ClipVodOffset() (r int, exists bool) {
+	v := m.clip_vod_offset
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldClipVodOffset returns the old "clip_vod_offset" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldClipVodOffset(ctx context.Context) (v int, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldClipVodOffset is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldClipVodOffset requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldClipVodOffset: %w", err)
+	}
+	return oldValue.ClipVodOffset, nil
+}
+
+// AddClipVodOffset adds i to the "clip_vod_offset" field.
+func (m *VodMutation) AddClipVodOffset(i int) {
+	if m.addclip_vod_offset != nil {
+		*m.addclip_vod_offset += i
+	} else {
+		m.addclip_vod_offset = &i
+	}
+}
+
+// AddedClipVodOffset returns the value that was added to the "clip_vod_offset" field in this mutation.
+func (m *VodMutation) AddedClipVodOffset() (r int, exists bool) {
+	v := m.addclip_vod_offset
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (m *VodMutation) ClearClipVodOffset() {
+	m.clip_vod_offset = nil
+	m.addclip_vod_offset = nil
+	m.clearedFields[vod.FieldClipVodOffset] = struct{}{}
+}
+
+// ClipVodOffsetCleared returns if the "clip_vod_offset" field was cleared in this mutation.
+func (m *VodMutation) ClipVodOffsetCleared() bool {
+	_, ok := m.clearedFields[vod.FieldClipVodOffset]
+	return ok
+}
+
+// ResetClipVodOffset resets all changes to the "clip_vod_offset" field.
+func (m *VodMutation) ResetClipVodOffset() {
+	m.clip_vod_offset = nil
+	m.addclip_vod_offset = nil
+	delete(m.clearedFields, vod.FieldClipVodOffset)
+}
+
+// SetViews sets the "views" field.
+func (m *VodMutation) SetViews(i int) {
+	m.views = &i
+	m.addviews = nil
+}
+
+// Views returns the value of the "views" field in the mutation.
+func (m *VodMutation) Views() (r int, exists bool) {
+	v := m.views
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldViews returns the old "views" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldViews(ctx context.Context) (v int, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldViews is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldViews requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldViews: %w", err)
+	}
+	return oldValue.Views, nil
+}
+
+// AddViews adds i to the "views" field.
+func (m *VodMutation) AddViews(i int) {
+	if m.addviews != nil {
+		*m.addviews += i
+	} else {
+		m.addviews = &i
+	}
+}
+
+// AddedViews returns the value that was added to the "views" field in this mutation.
+func (m *VodMutation) AddedViews() (r int, exists bool) {
+	v := m.addviews
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ResetViews resets all changes to the "views" field.
+func (m *VodMutation) ResetViews() {
+	m.views = nil
+	m.addviews = nil
+}
+
+// SetResolution sets the "resolution" field.
+func (m *VodMutation) SetResolution(s string) {
+	m.resolution = &s
+}
+
+// Resolution returns the value of the "resolution" field in the mutation.
+func (m *VodMutation) Resolution() (r string, exists bool) {
+	v := m.resolution
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldResolution returns the old "resolution" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldResolution(ctx context.Context) (v string, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldResolution is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldResolution requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldResolution: %w", err)
+	}
+	return oldValue.Resolution, nil
+}
+
+// ClearResolution clears the value of the "resolution" field.
+func (m *VodMutation) ClearResolution() {
+	m.resolution = nil
+	m.clearedFields[vod.FieldResolution] = struct{}{}
+}
+
+// ResolutionCleared returns if the "resolution" field was cleared in this mutation.
+func (m *VodMutation) ResolutionCleared() bool {
+	_, ok := m.clearedFields[vod.FieldResolution]
+	return ok
+}
+
+// ResetResolution resets all changes to the "resolution" field.
+func (m *VodMutation) ResetResolution() {
+	m.resolution = nil
+	delete(m.clearedFields, vod.FieldResolution)
+}
+
+// SetProcessing sets the "processing" field.
+func (m *VodMutation) SetProcessing(b bool) {
+	m.processing = &b
+}
+
+// Processing returns the value of the "processing" field in the mutation.
+func (m *VodMutation) Processing() (r bool, exists bool) {
+	v := m.processing
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// OldProcessing returns the old "processing" field's value of the Vod entity.
+// If the Vod object wasn't provided to the builder, the object is fetched from the database.
+// An error is returned if the mutation operation is not UpdateOne, or the database query fails.
+func (m *VodMutation) OldProcessing(ctx context.Context) (v bool, err error) {
+	if !m.op.Is(OpUpdateOne) {
+		return v, errors.New("OldProcessing is only allowed on UpdateOne operations")
+	}
+	if m.id == nil || m.oldValue == nil {
+		return v, errors.New("OldProcessing requires an ID field in the mutation")
+	}
+	oldValue, err := m.oldValue(ctx)
+	if err != nil {
+		return v, fmt.Errorf("querying old value for OldProcessing: %w", err)
+	}
+	return oldValue.Processing, nil
+}
+
+// ResetProcessing resets all changes to the "processing" field.
+func (m *VodMutation) ResetProcessing() {
+	m.processing = nil
 }
 
-// SetPlatform sets the "platform" field.
-func (m *VodMutation) SetPlatform(up utils.VideoPlatform) {
-	m.platform = &up
+// SetThumbnailPath sets the "thumbnail_path" field.
+func (m *VodMutation) SetThumbnailPath(s string) {
+	m.thumbnail_path = &s
 }
 
-// Platform returns the value of the "platform" field in the mutation.
-func (m *VodMutation) Platform() (r utils.VideoPlatform, exists bool) {
-	v := m.platform
+// ThumbnailPath returns the value of the "thumbnail_path" field in the mutation.
+func (m *VodMutation) ThumbnailPath() (r string, exists bool) {
+	v := m.thumbnail_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldPlatform returns the old "platform" field's value of the Vod entity.
+// OldThumbnailPath returns the old "thumbnail_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldPlatform(ctx context.Context) (v utils.VideoPlatform, err error) {
+func (m *VodMutation) OldThumbnailPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldPlatform is only allowed on UpdateOne operations")
+		return v, errors.New("OldThumbnailPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldPlatform requires an ID field in the mutation")
+		return v, errors.New("OldThumbnailPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldPlatform: %w", err)
+		return v, fmt.Errorf("querying old value for OldThumbnailPath: %w", err)
 	}
-	return oldValue.Platform, nil
+	return oldValue.ThumbnailPath, nil
 }
 
-// ResetPlatform resets all changes to the "platform" field.
-func (m *VodMutation) ResetPlatform() {
-	m.platform = nil
+// ClearThumbnailPath clears the value of the "thumbnail_path" field.
+func (m *VodMutation) ClearThumbnailPath() {
+	m.thumbnail_path = nil
+	m.clearedFields[vod.FieldThumbnailPath] = struct{}{}
 }
 
-// SetType sets the "type" field.
-func (m *VodMutation) SetType(ut utils.VodType) {
-	m._type = &ut
+// ThumbnailPathCleared returns if the "thumbnail_path" field was cleared in this mutation.
+func (m *VodMutation) ThumbnailPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldThumbnailPath]
+	return ok
 }
 
-// GetType returns the value of the "type" field in the mutation.
-func (m *VodMutation) GetType() (r utils.VodType, exists bool) {
-	v := m._type
+// ResetThumbnailPath resets all changes to the "thumbnail_path" field.
+func (m *VodMutation) ResetThumbnailPath() {
+	m.thumbnail_path = nil
+	delete(m.clearedFields, vod.FieldThumbnailPath)
+}
+
+// SetWebThumbnailPath sets the "web_thumbnail_path" field.
+func (m *VodMutation) SetWebThumbnailPath(s string) {
+	m.web_thumbnail_path = &s
+}
+
+// WebThumbnailPath returns the value of the "web_thumbnail_path" field in the mutation.
+func (m *VodMutation) WebThumbnailPath() (r string, exists bool) {
+	v := m.web_thumbnail_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldType returns the old "type" field's value of the Vod entity.
+// OldWebThumbnailPath returns the old "web_thumbnail_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldType(ctx context.Context) (v utils.VodType, err error) {
+func (m *VodMutation) OldWebThumbnailPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldType is only allowed on UpdateOne operations")
+		return v, errors.New("OldWebThumbnailPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldType requires an ID field in the mutation")
+		return v, errors.New("OldWebThumbnailPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldType: %w", err)
+		return v, fmt.Errorf("querying old value for OldWebThumbnailPath: %w", err)
 	}
-	return oldValue.Type, nil
+	return oldValue.WebThumbnailPath, nil
 }
 
-// ResetType resets all changes to the "type" field.
-func (m *VodMutation) ResetType() {
-	m._type = nil
+// ResetWebThumbnailPath resets all changes to the "web_thumbnail_path" field.
+func (m *VodMutation) ResetWebThumbnailPath() {
+	m.web_thumbnail_path = nil
 }
 
-// SetTitle sets the "title" field.
-func (m *VodMutation) SetTitle(s string) {
-	m.title = &s
+// SetVideoPath sets the "video_path" field.
+func (m *VodMutation) SetVideoPath(s string) {
+	m.video_path = &s
 }
 
-// Title returns the value of the "title" field in the mutation.
-func (m *VodMutation) Title() (r string, exists bool) {
-	v := m.title
+// VideoPath returns the value of the "video_path" field in the mutation.
+func (m *VodMutation) VideoPath() (r string, exists bool) {
+	v := m.video_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTitle returns the old "title" field's value of the Vod entity.
+// OldVideoPath returns the old "video_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTitle(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldVideoPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTitle is only allowed on UpdateOne operations")
+		return v, errors.New("OldVideoPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTitle requires an ID field in the mutation")
+		return v, errors.New("OldVideoPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTitle: %w", err)
+		return v, fmt.Errorf("querying old value for OldVideoPath: %w", err)
 	}
-	return oldValue.Title, nil
+	return oldValue.VideoPath, nil
 }
 
-// ResetTitle resets all changes to the "title" field.
-func (m *VodMutation) ResetTitle() {
-	m.title = nil
+// ResetVideoPath resets all changes to the "video_path" field.
+func (m *VodMutation) ResetVideoPath() {
+	m.video_path = nil
 }
 
-// SetDuration sets the "duration" field.
-func (m *VodMutation) SetDuration(i int) {
-	m.duration = &i
-	m.addduration = nil
+// SetVideoHlsPath sets the "video_hls_path" field.
+func (m *VodMutation) SetVideoHlsPath(s string) {
+	m.video_hls_path = &s
 }
 
-// Duration returns the value of the "duration" field in the mutation.
-func (m *VodMutation) Duration() (r int, exists bool) {
-	v := m.duration
+// VideoHlsPath returns the value of the "video_hls_path" field in the mutation.
+func (m *VodMutation) VideoHlsPath() (r string, exists bool) {
+	v := m.video_hls_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldDuration returns the old "duration" field's value of the Vod entity.
+// OldVideoHlsPath returns the old "video_hls_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldDuration(ctx context.Context) (v int, err error) {
+func (m *VodMutation) OldVideoHlsPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldDuration is only allowed on UpdateOne operations")
+		return v, errors.New("OldVideoHlsPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldDuration requires an ID field in the mutation")
+		return v, errors.New("OldVideoHlsPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldDuration: %w", err)
+		return v, fmt.Errorf("querying old value for OldVideoHlsPath: %w", err)
 	}
-	return oldValue.Duration, nil
+	return oldValue.VideoHlsPath, nil
 }
 
-// AddDuration adds i to the "duration" field.
-func (m *VodMutation) AddDuration(i int) {
-	if m.addduration != nil {
-		*m.addduration += i
-	} else {
-		m.addduration = &i
-	}
+// ClearVideoHlsPath clears the value of the "video_hls_path" field.
+func (m *VodMutation) ClearVideoHlsPath() {
+	m.video_hls_path = nil
+	m.clearedFields[vod.FieldVideoHlsPath] = struct{}{}
 }
 
-// AddedDuration returns the value that was added to the "duration" field in this mutation.
-func (m *VodMutation) AddedDuration() (r int, exists bool) {
-	v := m.addduration
-	if v == nil {
-		return
-	}
-	return *v, true
+// VideoHlsPathCleared returns if the "video_hls_path" field was cleared in this mutation.
+func (m *VodMutation) VideoHlsPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldVideoHlsPath]
+	return ok
 }
 
-// ResetDuration resets all changes to the "duration" field.
-func (m *VodMutation) ResetDuration() {
-	m.duration = nil
-	m.addduration = nil
+// ResetVideoHlsPath resets all changes to the "video_hls_path" field.
+func (m *VodMutation) ResetVideoHlsPath() {
+	m.video_hls_path = nil
+	delete(m.clearedFields, vod.FieldVideoHlsPath)
 }
 
-// SetViews sets the "views" field.
-func (m *VodMutation) SetViews(i int) {
-	m.views = &i
-	m.addviews = nil
+// SetChatPath sets the "chat_path" field.
+func (m *VodMutation) SetChatPath(s string) {
+	m.chat_path = &s
 }
 
-// Views returns the value of the "views" field in the mutation.
-func (m *VodMutation) Views() (r int, exists bool) {
-	v := m.views
+// ChatPath returns the value of the "chat_path" field in the mutation.
+func (m *VodMutation) ChatPath() (r string, exists bool) {
+	v := m.chat_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldViews returns the old "views" field's value of the Vod entity.
+// OldChatPath returns the old "chat_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldViews(ctx context.Context) (v int, err error) {
+func (m *VodMutation) OldChatPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldViews is only allowed on UpdateOne operations")
+		return v, errors.New("OldChatPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldViews requires an ID field in the mutation")
+		return v, errors.New("OldChatPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldViews: %w", err)
+		return v, fmt.Errorf("querying old value for OldChatPath: %w", err)
 	}
-	return oldValue.Views, nil
+	return oldValue.ChatPath, nil
 }
 
-// AddViews adds i to the "views" field.
-func (m *VodMutation) AddViews(i int) {
-	if m.addviews != nil {
-		*m.addviews += i
-	} else {
-		m.addviews = &i
-	}
+// ClearChatPath clears the value of the "chat_path" field.
+func (m *VodMutation) ClearChatPath() {
+	m.chat_path = nil
+	m.clearedFields[vod.FieldChatPath] = struct{}{}
 }
 
-// AddedViews returns the value that was added to the "views" field in this mutation.
-func (m *VodMutation) AddedViews() (r int, exists bool) {
-	v := m.addviews
-	if v == nil {
-		return
-	}
-	return *v, true
+// ChatPathCleared returns if the "chat_path" field was cleared in this mutation.
+func (m *VodMutation) ChatPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldChatPath]
+	return ok
 }
 
-// ResetViews resets all changes to the "views" field.
-func (m *VodMutation) ResetViews() {
-	m.views = nil
-	m.addviews = nil
+// ResetChatPath resets all changes to the "chat_path" field.
+func (m *VodMutation) ResetChatPath() {
+	m.chat_path = nil
+	delete(m.clearedFields, vod.FieldChatPath)
 }
 
-// SetResolution sets the "resolution" field.
-func (m *VodMutation) SetResolution(s string) {
-	m.resolution = &s
+// SetLiveChatPath sets the "live_chat_path" field.
+func (m *VodMutation) SetLiveChatPath(s string) {
+	m.live_chat_path = &s
 }
 
-// Resolution returns the value of the "resolution" field in the mutation.
-func (m *VodMutation) Resolution() (r string, exists bool) {
-	v := m.resolution
+// LiveChatPath returns the value of the "live_chat_path" field in the mutation.
+func (m *VodMutation) LiveChatPath() (r string, exists bool) {
+	v := m.live_chat_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldResolution returns the old "resolution" field's value of the Vod entity.
+// OldLiveChatPath returns the old "live_chat_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldResolution(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldLiveChatPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldResolution is only allowed on UpdateOne operations")
+		return v, errors.New("OldLiveChatPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldResolution requires an ID field in the mutation")
+		return v, errors.New("OldLiveChatPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldResolution: %w", err)
+		return v, fmt.Errorf("querying old value for OldLiveChatPath: %w", err)
 	}
-	return oldValue.Resolution, nil
+	return oldValue.LiveChatPath, nil
 }
 
-// ClearResolution clears the value of the "resolution" field.
-func (m *VodMutation) ClearResolution() {
-	m.resolution = nil
-	m.clearedFields[vod.FieldResolution] = struct{}{}
+// ClearLiveChatPath clears the value of the "live_chat_path" field.
+func (m *VodMutation) ClearLiveChatPath() {
+	m.live_chat_path = nil
+	m.clearedFields[vod.FieldLiveChatPath] = struct{}{}
 }
 
-// ResolutionCleared returns if the "resolution" field was cleared in this mutation.
-func (m *VodMutation) ResolutionCleared() bool {
-	_, ok := m.clearedFields[vod.FieldResolution]
+// LiveChatPathCleared returns if the "live_chat_path" field was cleared in this mutation.
+func (m *VodMutation) LiveChatPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldLiveChatPath]
 	return ok
 }
 
-// ResetResolution resets all changes to the "resolution" field.
-func (m *VodMutation) ResetResolution() {
-	m.resolution = nil
-	delete(m.clearedFields, vod.FieldResolution)
+// ResetLiveChatPath resets all changes to the "live_chat_path" field.
+func (m *VodMutation) ResetLiveChatPath() {
+	m.live_chat_path = nil
+	delete(m.clearedFields, vod.FieldLiveChatPath)
 }
 
-// SetProcessing sets the "processing" field.
-func (m *VodMutation) SetProcessing(b bool) {
-	m.processing = &b
+// SetLiveChatConvertPath sets the "live_chat_convert_path" field.
+func (m *VodMutation) SetLiveChatConvertPath(s string) {
+	m.live_chat_convert_path = &s
 }
 
-// Processing returns the value of the "processing" field in the mutation.
-func (m *VodMutation) Processing() (r bool, exists bool) {
-	v := m.processing
+// LiveChatConvertPath returns the value of the "live_chat_convert_path" field in the mutation.
+func (m *VodMutation) LiveChatConvertPath() (r string, exists bool) {
+	v := m.live_chat_convert_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldProcessing returns the old "processing" field's value of the Vod entity.
+// OldLiveChatConvertPath returns the old "live_chat_convert_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldProcessing(ctx context.Context) (v bool, err error) {
+func (m *VodMutation) OldLiveChatConvertPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldProcessing is only allowed on UpdateOne operations")
+		return v, errors.New("OldLiveChatConvertPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldProcessing requires an ID field in the mutation")
+		return v, errors.New("OldLiveChatConvertPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldProcessing: %w", err)
+		return v, fmt.Errorf("querying old value for OldLiveChatConvertPath: %w", err)
 	}
-	return oldValue.Processing, nil
+	return oldValue.LiveChatConvertPath, nil
 }
 
-// ResetProcessing resets all changes to the "processing" field.
-func (m *VodMutation) ResetProcessing() {
-	m.processing = nil
+// ClearLiveChatConvertPath clears the value of the "live_chat_convert_path" field.
+func (m *VodMutation) ClearLiveChatConvertPath() {
+	m.live_chat_convert_path = nil
+	m.clearedFields[vod.FieldLiveChatConvertPath] = struct{}{}
 }
 
-// SetThumbnailPath sets the "thumbnail_path" field.
-func (m *VodMutation) SetThumbnailPath(s string) {
-	m.thumbnail_path = &s
+// LiveChatConvertPathCleared returns if the "live_chat_convert_path" field was cleared in this mutation.
+func (m *VodMutation) LiveChatConvertPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldLiveChatConvertPath]
+	return ok
 }
 
-// ThumbnailPath returns the value of the "thumbnail_path" field in the mutation.
-func (m *VodMutation) ThumbnailPath() (r string, exists bool) {
-	v := m.thumbnail_path
+// ResetLiveChatConvertPath resets all changes to the "live_chat_convert_path" field.
+func (m *VodMutation) ResetLiveChatConvertPath() {
+	m.live_chat_convert_path = nil
+	delete(m.clearedFields, vod.FieldLiveChatConvertPath)
+}
+
+// SetChatVideoPath sets the "chat_video_path" field.
+func (m *VodMutation) SetChatVideoPath(s string) {
+	m.chat_video_path = &s
+}
+
+// ChatVideoPath returns the value of the "chat_video_path" field in the mutation.
+func (m *VodMutation) ChatVideoPath() (r string, exists bool) {
+	v := m.chat_video_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldThumbnailPath returns the old "thumbnail_path" field's value of the Vod entity.
+// OldChatVideoPath returns the old "chat_video_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldThumbnailPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldChatVideoPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldThumbnailPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldChatVideoPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldThumbnailPath requires an ID field in the mutation")
+		return v, errors.New("OldChatVideoPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldThumbnailPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldChatVideoPath: %w", err)
 	}
-	return oldValue.ThumbnailPath, nil
+	return oldValue.ChatVideoPath, nil
 }
 
-// ClearThumbnailPath clears the value of the "thumbnail_path" field.
-func (m *VodMutation) ClearThumbnailPath() {
-	m.thumbnail_path = nil
-	m.clearedFields[vod.FieldThumbnailPath] = struct{}{}
+// ClearChatVideoPath clears the value of the "chat_video_path" field.
+func (m *VodMutation) ClearChatVideoPath() {
+	m.chat_video_path = nil
+	m.clearedFields[vod.FieldChatVideoPath] = struct{}{}
 }
 
-// ThumbnailPathCleared returns if the "thumbnail_path" field was cleared in this mutation.
-func (m *VodMutation) ThumbnailPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldThumbnailPath]
+// ChatVideoPathCleared returns if the "chat_video_path" field was cleared in this mutation.
+func (m *VodMutation) ChatVideoPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldChatVideoPath]
 	return ok
 }
 
-// ResetThumbnailPath resets all changes to the "thumbnail_path" field.
-func (m *VodMutation) ResetThumbnailPath() {
-	m.thumbnail_path = nil
-	delete(m.clearedFields, vod.FieldThumbnailPath)
+// ResetChatVideoPath resets all changes to the "chat_video_path" field.
+func (m *VodMutation) ResetChatVideoPath() {
+	m.chat_video_path = nil
+	delete(m.clearedFields, vod.FieldChatVideoPath)
 }
 
-// SetWebThumbnailPath sets the "web_thumbnail_path" field.
-func (m *VodMutation) SetWebThumbnailPath(s string) {
-	m.web_thumbnail_path = &s
+// SetInfoPath sets the "info_path" field.
+func (m *VodMutation) SetInfoPath(s string) {
+	m.info_path = &s
 }
 
-// WebThumbnailPath returns the value of the "web_thumbnail_path" field in the mutation.
-func (m *VodMutation) WebThumbnailPath() (r string, exists bool) {
-	v := m.web_thumbnail_path
+// InfoPath returns the value of the "info_path" field in the mutation.
+func (m *VodMutation) InfoPath() (r string, exists bool) {
+	v := m.info_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldWebThumbnailPath returns the old "web_thumbnail_path" field's value of the Vod entity.
+// OldInfoPath returns the old "info_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldWebThumbnailPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldInfoPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldWebThumbnailPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldInfoPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldWebThumbnailPath requires an ID field in the mutation")
+		return v, errors.New("OldInfoPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldWebThumbnailPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldInfoPath: %w", err)
 	}
-	return oldValue.WebThumbnailPath, nil
+	return oldValue.InfoPath, nil
 }
 
-// ResetWebThumbnailPath resets all changes to the "web_thumbnail_path" field.
-func (m *VodMutation) ResetWebThumbnailPath() {
-	m.web_thumbnail_path = nil
+// ClearInfoPath clears the value of the "info_path" field.
+func (m *VodMutation) ClearInfoPath() {
+	m.info_path = nil
+	m.clearedFields[vod.FieldInfoPath] = struct{}{}
 }
 
-// SetVideoPath sets the "video_path" field.
-func (m *VodMutation) SetVideoPath(s string) {
-	m.video_path = &s
+// InfoPathCleared returns if the "info_path" field was cleared in this mutation.
+func (m *VodMutation) InfoPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldInfoPath]
+	return ok
 }
 
-// VideoPath returns the value of the "video_path" field in the mutation.
-func (m *VodMutation) VideoPath() (r string, exists bool) {
-	v := m.video_path
+// ResetInfoPath resets all changes to the "info_path" field.
+func (m *VodMutation) ResetInfoPath() {
+	m.info_path = nil
+	delete(m.clearedFields, vod.FieldInfoPath)
+}
+
+// SetCaptionPath sets the "caption_path" field.
+func (m *VodMutation) SetCaptionPath(s string) {
+	m.caption_path = &s
+}
+
+// CaptionPath returns the value of the "caption_path" field in the mutation.
+func (m *VodMutation) CaptionPath() (r string, exists bool) {
+	v := m.caption_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldVideoPath returns the old "video_path" field's value of the Vod entity.
+// OldCaptionPath returns the old "caption_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldVideoPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldCaptionPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldVideoPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldCaptionPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldVideoPath requires an ID field in the mutation")
+		return v, errors.New("OldCaptionPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldVideoPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldCaptionPath: %w", err)
 	}
-	return oldValue.VideoPath, nil
+	return oldValue.CaptionPath, nil
 }
 
-// ResetVideoPath resets all changes to the "video_path" field.
-func (m *VodMutation) ResetVideoPath() {
-	m.video_path = nil
+// ClearCaptionPath clears the value of the "caption_path" field.
+func (m *VodMutation) ClearCaptionPath() {
+	m.caption_path = nil
+	m.clearedFields[vod.FieldCaptionPath] = struct{}{}
 }
 
-// SetVideoHlsPath sets the "video_hls_path" field.
-func (m *VodMutation) SetVideoHlsPath(s string) {
-	m.video_hls_path = &s
+// CaptionPathCleared returns if the "caption_path" field was cleared in this mutation.
+func (m *VodMutation) CaptionPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldCaptionPath]
+	return ok
 }
 
-// VideoHlsPath returns the value of the "video_hls_path" field in the mutation.
-func (m *VodMutation) VideoHlsPath() (r string, exists bool) {
-	v := m.video_hls_path
+// ResetCaptionPath resets all changes to the "caption_path" field.
+func (m *VodMutation) ResetCaptionPath() {
+	m.caption_path = nil
+	delete(m.clearedFields, vod.FieldCaptionPath)
+}
+
+// SetFolderName sets the "folder_name" field.
+func (m *VodMutation) SetFolderName(s string) {
+	m.folder_name = &s
+}
+
+// FolderName returns the value of the "folder_name" field in the mutation.
+func (m *VodMutation) FolderName() (r string, exists bool) {
+	v := m.folder_name
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldVideoHlsPath returns the old "video_hls_path" field's value of the Vod entity.
+// OldFolderName returns the old "folder_name" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldVideoHlsPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldFolderName(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldVideoHlsPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldFolderName is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldVideoHlsPath requires an ID field in the mutation")
+		return v, errors.New("OldFolderName requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldVideoHlsPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldFolderName: %w", err)
 	}
-	return oldValue.VideoHlsPath, nil
+	return oldValue.FolderName, nil
 }
 
-// ClearVideoHlsPath clears the value of the "video_hls_path" field.
-func (m *VodMutation) ClearVideoHlsPath() {
-	m.video_hls_path = nil
-	m.clearedFields[vod.FieldVideoHlsPath] = struct{}{}
+// ClearFolderName clears the value of the "folder_name" field.
+func (m *VodMutation) ClearFolderName() {
+	m.folder_name = nil
+	m.clearedFields[vod.FieldFolderName] = struct{}{}
 }
 
-// VideoHlsPathCleared returns if the "video_hls_path" field was cleared in this mutation.
-func (m *VodMutation) VideoHlsPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldVideoHlsPath]
+// FolderNameCleared returns if the "folder_name" field was cleared in this mutation.
+func (m *VodMutation) FolderNameCleared() bool {
+	_, ok := m.clearedFields[vod.FieldFolderName]
 	return ok
 }
 
-// ResetVideoHlsPath resets all changes to the "video_hls_path" field.
-func (m *VodMutation) ResetVideoHlsPath() {
-	m.video_hls_path = nil
-	delete(m.clearedFields, vod.FieldVideoHlsPath)
+// ResetFolderName resets all changes to the "folder_name" field.
+func (m *VodMutation) ResetFolderName() {
+	m.folder_name = nil
+	delete(m.clearedFields, vod.FieldFolderName)
 }
 
-// SetChatPath sets the "chat_path" field.
-func (m *VodMutation) SetChatPath(s string) {
-	m.chat_path = &s
+// SetFileName sets the "file_name" field.
+func (m *VodMutation) SetFileName(s string) {
+	m.file_name = &s
 }
 
-// ChatPath returns the value of the "chat_path" field in the mutation.
-func (m *VodMutation) ChatPath() (r string, exists bool) {
-	v := m.chat_path
+// FileName returns the value of the "file_name" field in the mutation.
+func (m *VodMutation) FileName() (r string, exists bool) {
+	v := m.file_name
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldChatPath returns the old "chat_path" field's value of the Vod entity.
+// OldFileName returns the old "file_name" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldChatPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldFileName(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldChatPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldFileName is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldChatPath requires an ID field in the mutation")
+		return v, errors.New("OldFileName requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldChatPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldFileName: %w", err)
 	}
-	return oldValue.ChatPath, nil
+	return oldValue.FileName, nil
 }
 
-// ClearChatPath clears the value of the "chat_path" field.
-func (m *VodMutation) ClearChatPath() {
-	m.chat_path = nil
-	m.clearedFields[vod.FieldChatPath] = struct{}{}
+// ClearFileName clears the value of the "file_name" field.
+func (m *VodMutation) ClearFileName() {
+	m.file_name = nil
+	m.clearedFields[vod.FieldFileName] = struct{}{}
 }
 
-// ChatPathCleared returns if the "chat_path" field was cleared in this mutation.
-func (m *VodMutation) ChatPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldChatPath]
+// FileNameCleared returns if the "file_name" field was cleared in this mutation.
+func (m *VodMutation) FileNameCleared() bool {
+	_, ok := m.clearedFields[vod.FieldFileName]
 	return ok
 }
 
-// ResetChatPath resets all changes to the "chat_path" field.
-func (m *VodMutation) ResetChatPath() {
-	m.chat_path = nil
-	delete(m.clearedFields, vod.FieldChatPath)
+// ResetFileName resets all changes to the "file_name" field.
+func (m *VodMutation) ResetFileName() {
+	m.file_name = nil
+	delete(m.clearedFields, vod.FieldFileName)
 }
 
-// SetLiveChatPath sets the "live_chat_path" field.
-func (m *VodMutation) SetLiveChatPath(s string) {
-	m.live_chat_path = &s
+// SetTmpVideoDownloadPath sets the "tmp_video_download_path" field.
+func (m *VodMutation) SetTmpVideoDownloadPath(s string) {
+	m.tmp_video_download_path = &s
 }
 
-// LiveChatPath returns the value of the "live_chat_path" field in the mutation.
-func (m *VodMutation) LiveChatPath() (r string, exists bool) {
-	v := m.live_chat_path
+// TmpVideoDownloadPath returns the value of the "tmp_video_download_path" field in the mutation.
+func (m *VodMutation) TmpVideoDownloadPath() (r string, exists bool) {
+	v := m.tmp_video_download_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldLiveChatPath returns the old "live_chat_path" field's value of the Vod entity.
+// OldTmpVideoDownloadPath returns the old "tmp_video_download_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldLiveChatPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpVideoDownloadPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldLiveChatPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpVideoDownloadPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldLiveChatPath requires an ID field in the mutation")
+		return v, errors.New("OldTmpVideoDownloadPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldLiveChatPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpVideoDownloadPath: %w", err)
 	}
-	return oldValue.LiveChatPath, nil
+	return oldValue.TmpVideoDownloadPath, nil
 }
 
-// ClearLiveChatPath clears the value of the "live_chat_path" field.
-func (m *VodMutation) ClearLiveChatPath() {
-	m.live_chat_path = nil
-	m.clearedFields[vod.FieldLiveChatPath] = struct{}{}
+// ClearTmpVideoDownloadPath clears the value of the "tmp_video_download_path" field.
+func (m *VodMutation) ClearTmpVideoDownloadPath() {
+	m.tmp_video_download_path = nil
+	m.clearedFields[vod.FieldTmpVideoDownloadPath] = struct{}{}
 }
 
-// LiveChatPathCleared returns if the "live_chat_path" field was cleared in this mutation.
-func (m *VodMutation) LiveChatPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldLiveChatPath]
+// TmpVideoDownloadPathCleared returns if the "tmp_video_download_path" field was cleared in this mutation.
+func (m *VodMutation) TmpVideoDownloadPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpVideoDownloadPath]
 	return ok
 }
 
-// ResetLiveChatPath resets all changes to the "live_chat_path" field.
-func (m *VodMutation) ResetLiveChatPath() {
-	m.live_chat_path = nil
-	delete(m.clearedFields, vod.FieldLiveChatPath)
+// ResetTmpVideoDownloadPath resets all changes to the "tmp_video_download_path" field.
+func (m *VodMutation) ResetTmpVideoDownloadPath() {
+	m.tmp_video_download_path = nil
+	delete(m.clearedFields, vod.FieldTmpVideoDownloadPath)
 }
 
-// SetLiveChatConvertPath sets the "live_chat_convert_path" field.
-func (m *VodMutation) SetLiveChatConvertPath(s string) {
-	m.live_chat_convert_path = &s
+// SetTmpVideoConvertPath sets the "tmp_video_convert_path" field.
+func (m *VodMutation) SetTmpVideoConvertPath(s string) {
+	m.tmp_video_convert_path = &s
 }
 
-// LiveChatConvertPath returns the value of the "live_chat_convert_path" field in the mutation.
-func (m *VodMutation) LiveChatConvertPath() (r string, exists bool) {
-	v := m.live_chat_convert_path
+// TmpVideoConvertPath returns the value of the "tmp_video_convert_path" field in the mutation.
+func (m *VodMutation) TmpVideoConvertPath() (r string, exists bool) {
+	v := m.tmp_video_convert_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldLiveChatConvertPath returns the old "live_chat_convert_path" field's value of the Vod entity.
+// OldTmpVideoConvertPath returns the old "tmp_video_convert_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldLiveChatConvertPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpVideoConvertPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldLiveChatConvertPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpVideoConvertPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldLiveChatConvertPath requires an ID field in the mutation")
+		return v, errors.New("OldTmpVideoConvertPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldLiveChatConvertPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpVideoConvertPath: %w", err)
 	}
-	return oldValue.LiveChatConvertPath, nil
+	return oldValue.TmpVideoConvertPath, nil
 }
 
-// ClearLiveChatConvertPath clears the value of the "live_chat_convert_path" field.
-func (m *VodMutation) ClearLiveChatConvertPath() {
-	m.live_chat_convert_path = nil
-	m.clearedFields[vod.FieldLiveChatConvertPath] = struct{}{}
+// ClearTmpVideoConvertPath clears the value of the "tmp_video_convert_path" field.
+func (m *VodMutation) ClearTmpVideoConvertPath() {
+	m.tmp_video_convert_path = nil
+	m.clearedFields[vod.FieldTmpVideoConvertPath] = struct{}{}
 }
 
-// LiveChatConvertPathCleared returns if the "live_chat_convert_path" field was cleared in this mutation.
-func (m *VodMutation) LiveChatConvertPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldLiveChatConvertPath]
+// TmpVideoConvertPathCleared returns if the "tmp_video_convert_path" field was cleared in this mutation.
+func (m *VodMutation) TmpVideoConvertPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpVideoConvertPath]
 	return ok
 }
 
-// ResetLiveChatConvertPath resets all changes to the "live_chat_convert_path" field.
-func (m *VodMutation) ResetLiveChatConvertPath() {
-	m.live_chat_convert_path = nil
-	delete(m.clearedFields, vod.FieldLiveChatConvertPath)
+// ResetTmpVideoConvertPath resets all changes to the "tmp_video_convert_path" field.
+func (m *VodMutation) ResetTmpVideoConvertPath() {
+	m.tmp_video_convert_path = nil
+	delete(m.clearedFields, vod.FieldTmpVideoConvertPath)
 }
 
-// SetChatVideoPath sets the "chat_video_path" field.
-func (m *VodMutation) SetChatVideoPath(s string) {
-	m.chat_video_path = &s
+// SetTmpChatDownloadPath sets the "tmp_chat_download_path" field.
+func (m *VodMutation) SetTmpChatDownloadPath(s string) {
+	m.tmp_chat_download_path = &s
 }
 
-// ChatVideoPath returns the value of the "chat_video_path" field in the mutation.
-func (m *VodMutation) ChatVideoPath() (r string, exists bool) {
-	v := m.chat_video_path
+// TmpChatDownloadPath returns the value of the "tmp_chat_download_path" field in the mutation.
+func (m *VodMutation) TmpChatDownloadPath() (r string, exists bool) {
+	v := m.tmp_chat_download_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldChatVideoPath returns the old "chat_video_path" field's value of the Vod entity.
+// OldTmpChatDownloadPath returns the old "tmp_chat_download_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldChatVideoPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpChatDownloadPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldChatVideoPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpChatDownloadPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldChatVideoPath requires an ID field in the mutation")
+		return v, errors.New("OldTmpChatDownloadPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldChatVideoPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpChatDownloadPath: %w", err)
 	}
-	return oldValue.ChatVideoPath, nil
+	return oldValue.TmpChatDownloadPath, nil
 }
 
-// ClearChatVideoPath clears the value of the "chat_video_path" field.
-func (m *VodMutation) ClearChatVideoPath() {
-	m.chat_video_path = nil
-	m.clearedFields[vod.FieldChatVideoPath] = struct{}{}
+// ClearTmpChatDownloadPath clears the value of the "tmp_chat_download_path" field.
+func (m *VodMutation) ClearTmpChatDownloadPath() {
+	m.tmp_chat_download_path = nil
+	m.clearedFields[vod.FieldTmpChatDownloadPath] = struct{}{}
 }
 
-// ChatVideoPathCleared returns if the "chat_video_path" field was cleared in this mutation.
-func (m *VodMutation) ChatVideoPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldChatVideoPath]
+// TmpChatDownloadPathCleared returns if the "tmp_chat_download_path" field was cleared in this mutation.
+func (m *VodMutation) TmpChatDownloadPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpChatDownloadPath]
 	return ok
 }
 
-// ResetChatVideoPath resets all changes to the "chat_video_path" field.
-func (m *VodMutation) ResetChatVideoPath() {
-	m.chat_video_path = nil
-	delete(m.clearedFields, vod.FieldChatVideoPath)
+// ResetTmpChatDownloadPath resets all changes to the "tmp_chat_download_path" field.
+func (m *VodMutation) ResetTmpChatDownloadPath() {
+	m.tmp_chat_download_path = nil
+	delete(m.clearedFields, vod.FieldTmpChatDownloadPath)
 }
 
-// SetInfoPath sets the "info_path" field.
-func (m *VodMutation) SetInfoPath(s string) {
-	m.info_path = &s
+// SetTmpLiveChatDownloadPath sets the "tmp_live_chat_download_path" field.
+func (m *VodMutation) SetTmpLiveChatDownloadPath(s string) {
+	m.tmp_live_chat_download_path = &s
 }
 
-// InfoPath returns the value of the "info_path" field in the mutation.
-func (m *VodMutation) InfoPath() (r string, exists bool) {
-	v := m.info_path
+// TmpLiveChatDownloadPath returns the value of the "tmp_live_chat_download_path" field in the mutation.
+func (m *VodMutation) TmpLiveChatDownloadPath() (r string, exists bool) {
+	v := m.tmp_live_chat_download_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldInfoPath returns the old "info_path" field's value of the Vod entity.
+// OldTmpLiveChatDownloadPath returns the old "tmp_live_chat_download_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldInfoPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpLiveChatDownloadPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldInfoPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpLiveChatDownloadPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldInfoPath requires an ID field in the mutation")
+		return v, errors.New("OldTmpLiveChatDownloadPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldInfoPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpLiveChatDownloadPath: %w", err)
 	}
-	return oldValue.InfoPath, nil
+	return oldValue.TmpLiveChatDownloadPath, nil
 }
 
-// ClearInfoPath clears the value of the "info_path" field.
-func (m *VodMutation) ClearInfoPath() {
-	m.info_path = nil
-	m.clearedFields[vod.FieldInfoPath] = struct{}{}
+// ClearTmpLiveChatDownloadPath clears the value of the "tmp_live_chat_download_path" field.
+func (m *VodMutation) ClearTmpLiveChatDownloadPath() {
+	m.tmp_live_chat_download_path = nil
+	m.clearedFields[vod.FieldTmpLiveChatDownloadPath] = struct{}{}
 }
 
-// InfoPathCleared returns if the "info_path" field was cleared in this mutation.
-func (m *VodMutation) InfoPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldInfoPath]
+// TmpLiveChatDownloadPathCleared returns if the "tmp_live_chat_download_path" field was cleared in this mutation.
+func (m *VodMutation) TmpLiveChatDownloadPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpLiveChatDownloadPath]
 	return ok
 }
 
-// ResetInfoPath resets all changes to the "info_path" field.
-func (m *VodMutation) ResetInfoPath() {
-	m.info_path = nil
-	delete(m.clearedFields, vod.FieldInfoPath)
+// ResetTmpLiveChatDownloadPath resets all changes to the "tmp_live_chat_download_path" field.
+func (m *VodMutation) ResetTmpLiveChatDownloadPath() {
+	m.tmp_live_chat_download_path = nil
+	delete(m.clearedFields, vod.FieldTmpLiveChatDownloadPath)
 }
 
-// SetCaptionPath sets the "caption_path" field.
-func (m *VodMutation) SetCaptionPath(s string) {
-	m.caption_path = &s
+// SetTmpLiveChatConvertPath sets the "tmp_live_chat_convert_path" field.
+func (m *VodMutation) SetTmpLiveChatConvertPath(s string) {
+	m.tmp_live_chat_convert_path = &s
 }
 
-// CaptionPath returns the value of the "caption_path" field in the mutation.
-func (m *VodMutation) CaptionPath() (r string, exists bool) {
-	v := m.caption_path
+// TmpLiveChatConvertPath returns the value of the "tmp_live_chat_convert_path" field in the mutation.
+func (m *VodMutation) TmpLiveChatConvertPath() (r string, exists bool) {
+	v := m.tmp_live_chat_convert_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldCaptionPath returns the old "caption_path" field's value of the Vod entity.
+// OldTmpLiveChatConvertPath returns the old "tmp_live_chat_convert_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldCaptionPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpLiveChatConvertPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldCaptionPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpLiveChatConvertPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldCaptionPath requires an ID field in the mutation")
+		return v, errors.New("OldTmpLiveChatConvertPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldCaptionPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpLiveChatConvertPath: %w", err)
 	}
-	return oldValue.CaptionPath, nil
+	return oldValue.TmpLiveChatConvertPath, nil
 }
 
-// ClearCaptionPath clears the value of the "caption_path" field.
-func (m *VodMutation) ClearCaptionPath() {
-	m.caption_path = nil
-	m.clearedFields[vod.FieldCaptionPath] = struct{}{}
+// ClearTmpLiveChatConvertPath clears the value of the "tmp_live_chat_convert_path" field.
+func (m *VodMutation) ClearTmpLiveChatConvertPath() {
+	m.tmp_live_chat_convert_path = nil
+	m.clearedFields[vod.FieldTmpLiveChatConvertPath] = struct{}{}
 }
 
-// CaptionPathCleared returns if the "caption_path" field was cleared in this mutation.
-func (m *VodMutation) CaptionPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldCaptionPath]
+// TmpLiveChatConvertPathCleared returns if the "tmp_live_chat_convert_path" field was cleared in this mutation.
+func (m *VodMutation) TmpLiveChatConvertPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpLiveChatConvertPath]
 	return ok
 }
 
-// ResetCaptionPath resets all changes to the "caption_path" field.
-func (m *VodMutation) ResetCaptionPath() {
-	m.caption_path = nil
-	delete(m.clearedFields, vod.FieldCaptionPath)
-}
-
-// SetFolderName sets the "folder_name" field.
-func (m *VodMutation) SetFolderName(s string) {
-	m.folder_name = &s
+// ResetTmpLiveChatConvertPath resets all changes to the "tmp_live_chat_convert_path" field.
+func (m *VodMutation) ResetTmpLiveChatConvertPath() {
+	m.tmp_live_chat_convert_path = nil
+	delete(m.clearedFields, vod.FieldTmpLiveChatConvertPath)
 }
 
-// FolderName returns the value of the "folder_name" field in the mutation.
-func (m *VodMutation) FolderName() (r string, exists bool) {
-	v := m.folder_name
+// SetTmpChatRenderPath sets the "tmp_chat_render_path" field.
+func (m *VodMutation) SetTmpChatRenderPath(s string) {
+	m.tmp_chat_render_path = &s
+}
+
+// TmpChatRenderPath returns the value of the "tmp_chat_render_path" field in the mutation.
+func (m *VodMutation) TmpChatRenderPath() (r string, exists bool) {
+	v := m.tmp_chat_render_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldFolderName returns the old "folder_name" field's value of the Vod entity.
+// OldTmpChatRenderPath returns the old "tmp_chat_render_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldFolderName(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpChatRenderPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldFolderName is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpChatRenderPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldFolderName requires an ID field in the mutation")
+		return v, errors.New("OldTmpChatRenderPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldFolderName: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpChatRenderPath: %w", err)
 	}
-	return oldValue.FolderName, nil
+	return oldValue.TmpChatRenderPath, nil
 }
 
-// ClearFolderName clears the value of the "folder_name" field.
-func (m *VodMutation) ClearFolderName() {
-	m.folder_name = nil
-	m.clearedFields[vod.FieldFolderName] = struct{}{}
+// ClearTmpChatRenderPath clears the value of the "tmp_chat_render_path" field.
+func (m *VodMutation) ClearTmpChatRenderPath() {
+	m.tmp_chat_render_path = nil
+	m.clearedFields[vod.FieldTmpChatRenderPath] = struct{}{}
 }
 
-// FolderNameCleared returns if the "folder_name" field was cleared in this mutation.
-func (m *VodMutation) FolderNameCleared() bool {
-	_, ok := m.clearedFields[vod.FieldFolderName]
+// TmpChatRenderPathCleared returns if the "tmp_chat_render_path" field was cleared in this mutation.
+func (m *VodMutation) TmpChatRenderPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpChatRenderPath]
 	return ok
 }
 
-// ResetFolderName resets all changes to the "folder_name" field.
-func (m *VodMutation) ResetFolderName() {
-	m.folder_name = nil
-	delete(m.clearedFields, vod.FieldFolderName)
+// ResetTmpChatRenderPath resets all changes to the "tmp_chat_render_path" field.
+func (m *VodMutation) ResetTmpChatRenderPath() {
+	m.tmp_chat_render_path = nil
+	delete(m.clearedFields, vod.FieldTmpChatRenderPath)
 }
 
-// SetFileName sets the "file_name" field.
-func (m *VodMutation) SetFileName(s string) {
-	m.file_name = &s
+// SetTmpVideoHlsPath sets the "tmp_video_hls_path" field.
+func (m *VodMutation) SetTmpVideoHlsPath(s string) {
+	m.tmp_video_hls_path = &s
 }
 
-// FileName returns the value of the "file_name" field in the mutation.
-func (m *VodMutation) FileName() (r string, exists bool) {
-	v := m.file_name
+// TmpVideoHlsPath returns the value of the "tmp_video_hls_path" field in the mutation.
+func (m *VodMutation) TmpVideoHlsPath() (r string, exists bool) {
+	v := m.tmp_video_hls_path
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldFileName returns the old "file_name" field's value of the Vod entity.
+// OldTmpVideoHlsPath returns the old "tmp_video_hls_path" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldFileName(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldTmpVideoHlsPath(ctx context.Context) (v string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldFileName is only allowed on UpdateOne operations")
+		return v, errors.New("OldTmpVideoHlsPath is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldFileName requires an ID field in the mutation")
+		return v, errors.New("OldTmpVideoHlsPath requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldFileName: %w", err)
+		return v, fmt.Errorf("querying old value for OldTmpVideoHlsPath: %w", err)
 	}
-	return oldValue.FileName, nil
+	return oldValue.TmpVideoHlsPath, nil
 }
 
-// ClearFileName clears the value of the "file_name" field.
-func (m *VodMutation) ClearFileName() {
-	m.file_name = nil
-	m.clearedFields[vod.FieldFileName] = struct{}{}
+// ClearTmpVideoHlsPath clears the value of the "tmp_video_hls_path" field.
+func (m *VodMutation) ClearTmpVideoHlsPath() {
+	m.tmp_video_hls_path = nil
+	m.clearedFields[vod.FieldTmpVideoHlsPath] = struct{}{}
 }
 
-// FileNameCleared returns if the "file_name" field was cleared in this mutation.
-func (m *VodMutation) FileNameCleared() bool {
-	_, ok := m.clearedFields[vod.FieldFileName]
+// TmpVideoHlsPathCleared returns if the "tmp_video_hls_path" field was cleared in this mutation.
+func (m *VodMutation) TmpVideoHlsPathCleared() bool {
+	_, ok := m.clearedFields[vod.FieldTmpVideoHlsPath]
 	return ok
 }
 
-// ResetFileName resets all changes to the "file_name" field.
-func (m *VodMutation) ResetFileName() {
-	m.file_name = nil
-	delete(m.clearedFields, vod.FieldFileName)
+// ResetTmpVideoHlsPath resets all changes to the "tmp_video_hls_path" field.
+func (m *VodMutation) ResetTmpVideoHlsPath() {
+	m.tmp_video_hls_path = nil
+	delete(m.clearedFields, vod.FieldTmpVideoHlsPath)
 }
 
-// SetTmpVideoDownloadPath sets the "tmp_video_download_path" field.
-func (m *VodMutation) SetTmpVideoDownloadPath(s string) {
-	m.tmp_video_download_path = &s
+// SetLocked sets the "locked" field.
+func (m *VodMutation) SetLocked(b bool) {
+	m.locked = &b
 }
 
-// TmpVideoDownloadPath returns the value of the "tmp_video_download_path" field in the mutation.
-func (m *VodMutation) TmpVideoDownloadPath() (r string, exists bool) {
-	v := m.tmp_video_download_path
+// Locked returns the value of the "locked" field in the mutation.
+func (m *VodMutation) Locked() (r bool, exists bool) {
+	v := m.locked
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpVideoDownloadPath returns the old "tmp_video_download_path" field's value of the Vod entity.
+// OldLocked returns the old "locked" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpVideoDownloadPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldLocked(ctx context.Context) (v bool, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpVideoDownloadPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldLocked is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpVideoDownloadPath requires an ID field in the mutation")
+		return v, errors.New("OldLocked requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpVideoDownloadPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldLocked: %w", err)
 	}
-	return oldValue.TmpVideoDownloadPath, nil
-}
-
-// ClearTmpVideoDownloadPath clears the value of the "tmp_video_download_path" field.
-func (m *VodMutation) ClearTmpVideoDownloadPath() {
-	m.tmp_video_download_path = nil
-	m.clearedFields[vod.FieldTmpVideoDownloadPath] = struct{}{}
-}
-
-// TmpVideoDownloadPathCleared returns if the "tmp_video_download_path" field was cleared in this mutation.
-func (m *VodMutation) TmpVideoDownloadPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpVideoDownloadPath]
-	return ok
+	return oldValue.Locked, nil
 }
 
-// ResetTmpVideoDownloadPath resets all changes to the "tmp_video_download_path" field.
-func (m *VodMutation) ResetTmpVideoDownloadPath() {
-	m.tmp_video_download_path = nil
-	delete(m.clearedFields, vod.FieldTmpVideoDownloadPath)
+// ResetLocked resets all changes to the "locked" field.
+func (m *VodMutation) ResetLocked() {
+	m.locked = nil
 }
 
-// SetTmpVideoConvertPath sets the "tmp_video_convert_path" field.
-func (m *VodMutation) SetTmpVideoConvertPath(s string) {
-	m.tmp_video_convert_path = &s
+// SetLocalViews sets the "local_views" field.
+func (m *VodMutation) SetLocalViews(i int) {
+	m.local_views = &i
+	m.addlocal_views = nil
 }
 
-// TmpVideoConvertPath returns the value of the "tmp_video_convert_path" field in the mutation.
-func (m *VodMutation) TmpVideoConvertPath() (r string, exists bool) {
-	v := m.tmp_video_convert_path
+// LocalViews returns the value of the "local_views" field in the mutation.
+func (m *VodMutation) LocalViews() (r int, exists bool) {
+	v := m.local_views
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpVideoConvertPath returns the old "tmp_video_convert_path" field's value of the Vod entity.
+// OldLocalViews returns the old "local_views" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpVideoConvertPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldLocalViews(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpVideoConvertPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldLocalViews is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpVideoConvertPath requires an ID field in the mutation")
+		return v, errors.New("OldLocalViews requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpVideoConvertPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldLocalViews: %w", err)
 	}
-	return oldValue.TmpVideoConvertPath, nil
+	return oldValue.LocalViews, nil
 }
 
-// ClearTmpVideoConvertPath clears the value of the "tmp_video_convert_path" field.
-func (m *VodMutation) ClearTmpVideoConvertPath() {
-	m.tmp_video_convert_path = nil
-	m.clearedFields[vod.FieldTmpVideoConvertPath] = struct{}{}
+// AddLocalViews adds i to the "local_views" field.
+func (m *VodMutation) AddLocalViews(i int) {
+	if m.addlocal_views != nil {
+		*m.addlocal_views += i
+	} else {
+		m.addlocal_views = &i
+	}
 }
 
-// TmpVideoConvertPathCleared returns if the "tmp_video_convert_path" field was cleared in this mutation.
-func (m *VodMutation) TmpVideoConvertPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpVideoConvertPath]
-	return ok
+// AddedLocalViews returns the value that was added to the "local_views" field in this mutation.
+func (m *VodMutation) AddedLocalViews() (r int, exists bool) {
+	v := m.addlocal_views
+	if v == nil {
+		return
+	}
+	return *v, true
 }
 
-// ResetTmpVideoConvertPath resets all changes to the "tmp_video_convert_path" field.
-func (m *VodMutation) ResetTmpVideoConvertPath() {
-	m.tmp_video_convert_path = nil
-	delete(m.clearedFields, vod.FieldTmpVideoConvertPath)
+// ResetLocalViews resets all changes to the "local_views" field.
+func (m *VodMutation) ResetLocalViews() {
+	m.local_views = nil
+	m.addlocal_views = nil
 }
 
-// SetTmpChatDownloadPath sets the "tmp_chat_download_path" field.
-func (m *VodMutation) SetTmpChatDownloadPath(s string) {
-	m.tmp_chat_download_path = &s
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (m *VodMutation) SetSpriteThumbnailsEnabled(b bool) {
+	m.sprite_thumbnails_enabled = &b
 }
 
-// TmpChatDownloadPath returns the value of the "tmp_chat_download_path" field in the mutation.
-func (m *VodMutation) TmpChatDownloadPath() (r string, exists bool) {
-	v := m.tmp_chat_download_path
+// SpriteThumbnailsEnabled returns the value of the "sprite_thumbnails_enabled" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsEnabled() (r bool, exists bool) {
+	v := m.sprite_thumbnails_enabled
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpChatDownloadPath returns the old "tmp_chat_download_path" field's value of the Vod entity.
+// OldSpriteThumbnailsEnabled returns the old "sprite_thumbnails_enabled" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpChatDownloadPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldSpriteThumbnailsEnabled(ctx context.Context) (v bool, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpChatDownloadPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsEnabled is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpChatDownloadPath requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsEnabled requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpChatDownloadPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsEnabled: %w", err)
 	}
-	return oldValue.TmpChatDownloadPath, nil
-}
-
-// ClearTmpChatDownloadPath clears the value of the "tmp_chat_download_path" field.
-func (m *VodMutation) ClearTmpChatDownloadPath() {
-	m.tmp_chat_download_path = nil
-	m.clearedFields[vod.FieldTmpChatDownloadPath] = struct{}{}
-}
-
-// TmpChatDownloadPathCleared returns if the "tmp_chat_download_path" field was cleared in this mutation.
-func (m *VodMutation) TmpChatDownloadPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpChatDownloadPath]
-	return ok
+	return oldValue.SpriteThumbnailsEnabled, nil
 }
 
-// ResetTmpChatDownloadPath resets all changes to the "tmp_chat_download_path" field.
-func (m *VodMutation) ResetTmpChatDownloadPath() {
-	m.tmp_chat_download_path = nil
-	delete(m.clearedFields, vod.FieldTmpChatDownloadPath)
+// ResetSpriteThumbnailsEnabled resets all changes to the "sprite_thumbnails_enabled" field.
+func (m *VodMutation) ResetSpriteThumbnailsEnabled() {
+	m.sprite_thumbnails_enabled = nil
 }
 
-// SetTmpLiveChatDownloadPath sets the "tmp_live_chat_download_path" field.
-func (m *VodMutation) SetTmpLiveChatDownloadPath(s string) {
-	m.tmp_live_chat_download_path = &s
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (m *VodMutation) SetSpriteThumbnailsImages(s []string) {
+	m.sprite_thumbnails_images = &s
+	m.appendsprite_thumbnails_images = nil
 }
 
-// TmpLiveChatDownloadPath returns the value of the "tmp_live_chat_download_path" field in the mutation.
-func (m *VodMutation) TmpLiveChatDownloadPath() (r string, exists bool) {
-	v := m.tmp_live_chat_download_path
+// SpriteThumbnailsImages returns the value of the "sprite_thumbnails_images" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsImages() (r []string, exists bool) {
+	v := m.sprite_thumbnails_images
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpLiveChatDownloadPath returns the old "tmp_live_chat_download_path" field's value of the Vod entity.
+// OldSpriteThumbnailsImages returns the old "sprite_thumbnails_images" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpLiveChatDownloadPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldSpriteThumbnailsImages(ctx context.Context) (v []string, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpLiveChatDownloadPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsImages is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpLiveChatDownloadPath requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsImages requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpLiveChatDownloadPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsImages: %w", err)
 	}
-	return oldValue.TmpLiveChatDownloadPath, nil
+	return oldValue.SpriteThumbnailsImages, nil
 }
 
-// ClearTmpLiveChatDownloadPath clears the value of the "tmp_live_chat_download_path" field.
-func (m *VodMutation) ClearTmpLiveChatDownloadPath() {
-	m.tmp_live_chat_download_path = nil
-	m.clearedFields[vod.FieldTmpLiveChatDownloadPath] = struct{}{}
+// AppendSpriteThumbnailsImages adds s to the "sprite_thumbnails_images" field.
+func (m *VodMutation) AppendSpriteThumbnailsImages(s []string) {
+	m.appendsprite_thumbnails_images = append(m.appendsprite_thumbnails_images, s...)
 }
 
-// TmpLiveChatDownloadPathCleared returns if the "tmp_live_chat_download_path" field was cleared in this mutation.
-func (m *VodMutation) TmpLiveChatDownloadPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpLiveChatDownloadPath]
+// AppendedSpriteThumbnailsImages returns the list of values that were appended to the "sprite_thumbnails_images" field in this mutation.
+func (m *VodMutation) AppendedSpriteThumbnailsImages() ([]string, bool) {
+	if len(m.appendsprite_thumbnails_images) == 0 {
+		return nil, false
+	}
+	return m.appendsprite_thumbnails_images, true
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (m *VodMutation) ClearSpriteThumbnailsImages() {
+	m.sprite_thumbnails_images = nil
+	m.appendsprite_thumbnails_images = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsImages] = struct{}{}
+}
+
+// SpriteThumbnailsImagesCleared returns if the "sprite_thumbnails_images" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsImagesCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsImages]
 	return ok
 }
 
-// ResetTmpLiveChatDownloadPath resets all changes to the "tmp_live_chat_download_path" field.
-func (m *VodMutation) ResetTmpLiveChatDownloadPath() {
-	m.tmp_live_chat_download_path = nil
-	delete(m.clearedFields, vod.FieldTmpLiveChatDownloadPath)
+// ResetSpriteThumbnailsImages resets all changes to the "sprite_thumbnails_images" field.
+func (m *VodMutation) ResetSpriteThumbnailsImages() {
+	m.sprite_thumbnails_images = nil
+	m.appendsprite_thumbnails_images = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsImages)
 }
 
-// SetTmpLiveChatConvertPath sets the "tmp_live_chat_convert_path" field.
-func (m *VodMutation) SetTmpLiveChatConvertPath(s string) {
-	m.tmp_live_chat_convert_path = &s
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (m *VodMutation) SetSpriteThumbnailsInterval(i int) {
+	m.sprite_thumbnails_interval = &i
+	m.addsprite_thumbnails_interval = nil
 }
 
-// TmpLiveChatConvertPath returns the value of the "tmp_live_chat_convert_path" field in the mutation.
-func (m *VodMutation) TmpLiveChatConvertPath() (r string, exists bool) {
-	v := m.tmp_live_chat_convert_path
+// SpriteThumbnailsInterval returns the value of the "sprite_thumbnails_interval" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsInterval() (r int, exists bool) {
+	v := m.sprite_thumbnails_interval
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpLiveChatConvertPath returns the old "tmp_live_chat_convert_path" field's value of the Vod entity.
+// OldSpriteThumbnailsInterval returns the old "sprite_thumbnails_interval" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpLiveChatConvertPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldSpriteThumbnailsInterval(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpLiveChatConvertPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsInterval is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpLiveChatConvertPath requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsInterval requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpLiveChatConvertPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsInterval: %w", err)
+	}
+	return oldValue.SpriteThumbnailsInterval, nil
+}
+
+// AddSpriteThumbnailsInterval adds i to the "sprite_thumbnails_interval" field.
+func (m *VodMutation) AddSpriteThumbnailsInterval(i int) {
+	if m.addsprite_thumbnails_interval != nil {
+		*m.addsprite_thumbnails_interval += i
+	} else {
+		m.addsprite_thumbnails_interval = &i
+	}
+}
+
+// AddedSpriteThumbnailsInterval returns the value that was added to the "sprite_thumbnails_interval" field in this mutation.
+func (m *VodMutation) AddedSpriteThumbnailsInterval() (r int, exists bool) {
+	v := m.addsprite_thumbnails_interval
+	if v == nil {
+		return
 	}
-	return oldValue.TmpLiveChatConvertPath, nil
+	return *v, true
 }
 
-// ClearTmpLiveChatConvertPath clears the value of the "tmp_live_chat_convert_path" field.
-func (m *VodMutation) ClearTmpLiveChatConvertPath() {
-	m.tmp_live_chat_convert_path = nil
-	m.clearedFields[vod.FieldTmpLiveChatConvertPath] = struct{}{}
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (m *VodMutation) ClearSpriteThumbnailsInterval() {
+	m.sprite_thumbnails_interval = nil
+	m.addsprite_thumbnails_interval = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsInterval] = struct{}{}
 }
 
-// TmpLiveChatConvertPathCleared returns if the "tmp_live_chat_convert_path" field was cleared in this mutation.
-func (m *VodMutation) TmpLiveChatConvertPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpLiveChatConvertPath]
+// SpriteThumbnailsIntervalCleared returns if the "sprite_thumbnails_interval" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsIntervalCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsInterval]
 	return ok
 }
 
-// ResetTmpLiveChatConvertPath resets all changes to the "tmp_live_chat_convert_path" field.
-func (m *VodMutation) ResetTmpLiveChatConvertPath() {
-	m.tmp_live_chat_convert_path = nil
-	delete(m.clearedFields, vod.FieldTmpLiveChatConvertPath)
+// ResetSpriteThumbnailsInterval resets all changes to the "sprite_thumbnails_interval" field.
+func (m *VodMutation) ResetSpriteThumbnailsInterval() {
+	m.sprite_thumbnails_interval = nil
+	m.addsprite_thumbnails_interval = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsInterval)
 }
 
-// SetTmpChatRenderPath sets the "tmp_chat_render_path" field.
-func (m *VodMutation) SetTmpChatRenderPath(s string) {
-	m.tmp_chat_render_path = &s
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (m *VodMutation) SetSpriteThumbnailsWidth(i int) {
+	m.sprite_thumbnails_width = &i
+	m.addsprite_thumbnails_width = nil
 }
 
-// TmpChatRenderPath returns the value of the "tmp_chat_render_path" field in the mutation.
-func (m *VodMutation) TmpChatRenderPath() (r string, exists bool) {
-	v := m.tmp_chat_render_path
+// SpriteThumbnailsWidth returns the value of the "sprite_thumbnails_width" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsWidth() (r int, exists bool) {
+	v := m.sprite_thumbnails_width
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpChatRenderPath returns the old "tmp_chat_render_path" field's value of the Vod entity.
+// OldSpriteThumbnailsWidth returns the old "sprite_thumbnails_width" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpChatRenderPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldSpriteThumbnailsWidth(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpChatRenderPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsWidth is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpChatRenderPath requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsWidth requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpChatRenderPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsWidth: %w", err)
 	}
-	return oldValue.TmpChatRenderPath, nil
+	return oldValue.SpriteThumbnailsWidth, nil
 }
 
-// ClearTmpChatRenderPath clears the value of the "tmp_chat_render_path" field.
-func (m *VodMutation) ClearTmpChatRenderPath() {
-	m.tmp_chat_render_path = nil
-	m.clearedFields[vod.FieldTmpChatRenderPath] = struct{}{}
+// AddSpriteThumbnailsWidth adds i to the "sprite_thumbnails_width" field.
+func (m *VodMutation) AddSpriteThumbnailsWidth(i int) {
+	if m.addsprite_thumbnails_width != nil {
+		*m.addsprite_thumbnails_width += i
+	} else {
+		m.addsprite_thumbnails_width = &i
+	}
 }
 
-// TmpChatRenderPathCleared returns if the "tmp_chat_render_path" field was cleared in this mutation.
-func (m *VodMutation) TmpChatRenderPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpChatRenderPath]
+// AddedSpriteThumbnailsWidth returns the value that was added to the "sprite_thumbnails_width" field in this mutation.
+func (m *VodMutation) AddedSpriteThumbnailsWidth() (r int, exists bool) {
+	v := m.addsprite_thumbnails_width
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (m *VodMutation) ClearSpriteThumbnailsWidth() {
+	m.sprite_thumbnails_width = nil
+	m.addsprite_thumbnails_width = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsWidth] = struct{}{}
+}
+
+// SpriteThumbnailsWidthCleared returns if the "sprite_thumbnails_width" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsWidthCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsWidth]
 	return ok
 }
 
-// ResetTmpChatRenderPath resets all changes to the "tmp_chat_render_path" field.
-func (m *VodMutation) ResetTmpChatRenderPath() {
-	m.tmp_chat_render_path = nil
-	delete(m.clearedFields, vod.FieldTmpChatRenderPath)
+// ResetSpriteThumbnailsWidth resets all changes to the "sprite_thumbnails_width" field.
+func (m *VodMutation) ResetSpriteThumbnailsWidth() {
+	m.sprite_thumbnails_width = nil
+	m.addsprite_thumbnails_width = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsWidth)
 }
 
-// SetTmpVideoHlsPath sets the "tmp_video_hls_path" field.
-func (m *VodMutation) SetTmpVideoHlsPath(s string) {
-	m.tmp_video_hls_path = &s
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (m *VodMutation) SetSpriteThumbnailsHeight(i int) {
+	m.sprite_thumbnails_height = &i
+	m.addsprite_thumbnails_height = nil
 }
 
-// TmpVideoHlsPath returns the value of the "tmp_video_hls_path" field in the mutation.
-func (m *VodMutation) TmpVideoHlsPath() (r string, exists bool) {
-	v := m.tmp_video_hls_path
+// SpriteThumbnailsHeight returns the value of the "sprite_thumbnails_height" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsHeight() (r int, exists bool) {
+	v := m.sprite_thumbnails_height
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldTmpVideoHlsPath returns the old "tmp_video_hls_path" field's value of the Vod entity.
+// OldSpriteThumbnailsHeight returns the old "sprite_thumbnails_height" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldTmpVideoHlsPath(ctx context.Context) (v string, err error) {
+func (m *VodMutation) OldSpriteThumbnailsHeight(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldTmpVideoHlsPath is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsHeight is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldTmpVideoHlsPath requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsHeight requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldTmpVideoHlsPath: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsHeight: %w", err)
 	}
-	return oldValue.TmpVideoHlsPath, nil
+	return oldValue.SpriteThumbnailsHeight, nil
 }
 
-// ClearTmpVideoHlsPath clears the value of the "tmp_video_hls_path" field.
-func (m *VodMutation) ClearTmpVideoHlsPath() {
-	m.tmp_video_hls_path = nil
-	m.clearedFields[vod.FieldTmpVideoHlsPath] = struct{}{}
+// AddSpriteThumbnailsHeight adds i to the "sprite_thumbnails_height" field.
+func (m *VodMutation) AddSpriteThumbnailsHeight(i int) {
+	if m.addsprite_thumbnails_height != nil {
+		*m.addsprite_thumbnails_height += i
+	} else {
+		m.addsprite_thumbnails_height = &i
+	}
 }
 
-// TmpVideoHlsPathCleared returns if the "tmp_video_hls_path" field was cleared in this mutation.
-func (m *VodMutation) TmpVideoHlsPathCleared() bool {
-	_, ok := m.clearedFields[vod.FieldTmpVideoHlsPath]
+// AddedSpriteThumbnailsHeight returns the value that was added to the "sprite_thumbnails_height" field in this mutation.
+func (m *VodMutation) AddedSpriteThumbnailsHeight() (r int, exists bool) {
+	v := m.addsprite_thumbnails_height
+	if v == nil {
+		return
+	}
+	return *v, true
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (m *VodMutation) ClearSpriteThumbnailsHeight() {
+	m.sprite_thumbnails_height = nil
+	m.addsprite_thumbnails_height = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsHeight] = struct{}{}
+}
+
+// SpriteThumbnailsHeightCleared returns if the "sprite_thumbnails_height" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsHeightCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsHeight]
 	return ok
 }
 
-// ResetTmpVideoHlsPath resets all changes to the "tmp_video_hls_path" field.
-func (m *VodMutation) ResetTmpVideoHlsPath() {
-	m.tmp_video_hls_path = nil
-	delete(m.clearedFields, vod.FieldTmpVideoHlsPath)
+// ResetSpriteThumbnailsHeight resets all changes to the "sprite_thumbnails_height" field.
+func (m *VodMutation) ResetSpriteThumbnailsHeight() {
+	m.sprite_thumbnails_height = nil
+	m.addsprite_thumbnails_height = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsHeight)
 }
 
-// SetLocked sets the "locked" field.
-func (m *VodMutation) SetLocked(b bool) {
-	m.locked = &b
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (m *VodMutation) SetSpriteThumbnailsRows(i int) {
+	m.sprite_thumbnails_rows = &i
+	m.addsprite_thumbnails_rows = nil
 }
 
-// Locked returns the value of the "locked" field in the mutation.
-func (m *VodMutation) Locked() (r bool, exists bool) {
-	v := m.locked
+// SpriteThumbnailsRows returns the value of the "sprite_thumbnails_rows" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsRows() (r int, exists bool) {
+	v := m.sprite_thumbnails_rows
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldLocked returns the old "locked" field's value of the Vod entity.
+// OldSpriteThumbnailsRows returns the old "sprite_thumbnails_rows" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldLocked(ctx context.Context) (v bool, err error) {
+func (m *VodMutation) OldSpriteThumbnailsRows(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldLocked is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsRows is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldLocked requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsRows requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldLocked: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsRows: %w", err)
 	}
-	return oldValue.Locked, nil
+	return oldValue.SpriteThumbnailsRows, nil
 }
 
-// ResetLocked resets all changes to the "locked" field.
-func (m *VodMutation) ResetLocked() {
-	m.locked = nil
+// AddSpriteThumbnailsRows adds i to the "sprite_thumbnails_rows" field.
+func (m *VodMutation) AddSpriteThumbnailsRows(i int) {
+	if m.addsprite_thumbnails_rows != nil {
+		*m.addsprite_thumbnails_rows += i
+	} else {
+		m.addsprite_thumbnails_rows = &i
+	}
 }
 
-// SetLocalViews sets the "local_views" field.
-func (m *VodMutation) SetLocalViews(i int) {
-	m.local_views = &i
-	m.addlocal_views = nil
+// AddedSpriteThumbnailsRows returns the value that was added to the "sprite_thumbnails_rows" field in this mutation.
+func (m *VodMutation) AddedSpriteThumbnailsRows() (r int, exists bool) {
+	v := m.addsprite_thumbnails_rows
+	if v == nil {
+		return
+	}
+	return *v, true
 }
 
-// LocalViews returns the value of the "local_views" field in the mutation.
-func (m *VodMutation) LocalViews() (r int, exists bool) {
-	v := m.local_views
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (m *VodMutation) ClearSpriteThumbnailsRows() {
+	m.sprite_thumbnails_rows = nil
+	m.addsprite_thumbnails_rows = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsRows] = struct{}{}
+}
+
+// SpriteThumbnailsRowsCleared returns if the "sprite_thumbnails_rows" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsRowsCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsRows]
+	return ok
+}
+
+// ResetSpriteThumbnailsRows resets all changes to the "sprite_thumbnails_rows" field.
+func (m *VodMutation) ResetSpriteThumbnailsRows() {
+	m.sprite_thumbnails_rows = nil
+	m.addsprite_thumbnails_rows = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsRows)
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (m *VodMutation) SetSpriteThumbnailsColumns(i int) {
+	m.sprite_thumbnails_columns = &i
+	m.addsprite_thumbnails_columns = nil
+}
+
+// SpriteThumbnailsColumns returns the value of the "sprite_thumbnails_columns" field in the mutation.
+func (m *VodMutation) SpriteThumbnailsColumns() (r int, exists bool) {
+	v := m.sprite_thumbnails_columns
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// OldLocalViews returns the old "local_views" field's value of the Vod entity.
+// OldSpriteThumbnailsColumns returns the old "sprite_thumbnails_columns" field's value of the Vod entity.
 // If the Vod object wasn't provided to the builder, the object is fetched from the database.
 // An error is returned if the mutation operation is not UpdateOne, or the database query fails.
-func (m *VodMutation) OldLocalViews(ctx context.Context) (v int, err error) {
+func (m *VodMutation) OldSpriteThumbnailsColumns(ctx context.Context) (v int, err error) {
 	if !m.op.Is(OpUpdateOne) {
-		return v, errors.New("OldLocalViews is only allowed on UpdateOne operations")
+		return v, errors.New("OldSpriteThumbnailsColumns is only allowed on UpdateOne operations")
 	}
 	if m.id == nil || m.oldValue == nil {
-		return v, errors.New("OldLocalViews requires an ID field in the mutation")
+		return v, errors.New("OldSpriteThumbnailsColumns requires an ID field in the mutation")
 	}
 	oldValue, err := m.oldValue(ctx)
 	if err != nil {
-		return v, fmt.Errorf("querying old value for OldLocalViews: %w", err)
+		return v, fmt.Errorf("querying old value for OldSpriteThumbnailsColumns: %w", err)
 	}
-	return oldValue.LocalViews, nil
+	return oldValue.SpriteThumbnailsColumns, nil
 }
 
-// AddLocalViews adds i to the "local_views" field.
-func (m *VodMutation) AddLocalViews(i int) {
-	if m.addlocal_views != nil {
-		*m.addlocal_views += i
+// AddSpriteThumbnailsColumns adds i to the "sprite_thumbnails_columns" field.
+func (m *VodMutation) AddSpriteThumbnailsColumns(i int) {
+	if m.addsprite_thumbnails_columns != nil {
+		*m.addsprite_thumbnails_columns += i
 	} else {
-		m.addlocal_views = &i
+		m.addsprite_thumbnails_columns = &i
 	}
 }
 
-// AddedLocalViews returns the value that was added to the "local_views" field in this mutation.
-func (m *VodMutation) AddedLocalViews() (r int, exists bool) {
-	v := m.addlocal_views
+// AddedSpriteThumbnailsColumns returns the value that was added to the "sprite_thumbnails_columns" field in this mutation.
+func (m *VodMutation) AddedSpriteThumbnailsColumns() (r int, exists bool) {
+	v := m.addsprite_thumbnails_columns
 	if v == nil {
 		return
 	}
 	return *v, true
 }
 
-// ResetLocalViews resets all changes to the "local_views" field.
-func (m *VodMutation) ResetLocalViews() {
-	m.local_views = nil
-	m.addlocal_views = nil
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (m *VodMutation) ClearSpriteThumbnailsColumns() {
+	m.sprite_thumbnails_columns = nil
+	m.addsprite_thumbnails_columns = nil
+	m.clearedFields[vod.FieldSpriteThumbnailsColumns] = struct{}{}
+}
+
+// SpriteThumbnailsColumnsCleared returns if the "sprite_thumbnails_columns" field was cleared in this mutation.
+func (m *VodMutation) SpriteThumbnailsColumnsCleared() bool {
+	_, ok := m.clearedFields[vod.FieldSpriteThumbnailsColumns]
+	return ok
+}
+
+// ResetSpriteThumbnailsColumns resets all changes to the "sprite_thumbnails_columns" field.
+func (m *VodMutation) ResetSpriteThumbnailsColumns() {
+	m.sprite_thumbnails_columns = nil
+	m.addsprite_thumbnails_columns = nil
+	delete(m.clearedFields, vod.FieldSpriteThumbnailsColumns)
 }
 
 // SetStreamedAt sets the "streamed_at" field.
@@ -11978,10 +13301,13 @@ func (m *VodMutation) Type() string {
 // order to get all numeric fields that were incremented/decremented, call
 // AddedFields().
 func (m *VodMutation) Fields() []string {
-	fields := make([]string, 0, 33)
+	fields := make([]string, 0, 42)
 	if m.ext_id != nil {
 		fields = append(fields, vod.FieldExtID)
 	}
+	if m.clip_ext_vod_id != nil {
+		fields = append(fields, vod.FieldClipExtVodID)
+	}
 	if m.ext_stream_id != nil {
 		fields = append(fields, vod.FieldExtStreamID)
 	}
@@ -11997,6 +13323,9 @@ func (m *VodMutation) Fields() []string {
 	if m.duration != nil {
 		fields = append(fields, vod.FieldDuration)
 	}
+	if m.clip_vod_offset != nil {
+		fields = append(fields, vod.FieldClipVodOffset)
+	}
 	if m.views != nil {
 		fields = append(fields, vod.FieldViews)
 	}
@@ -12069,6 +13398,27 @@ func (m *VodMutation) Fields() []string {
 	if m.local_views != nil {
 		fields = append(fields, vod.FieldLocalViews)
 	}
+	if m.sprite_thumbnails_enabled != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsEnabled)
+	}
+	if m.sprite_thumbnails_images != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsImages)
+	}
+	if m.sprite_thumbnails_interval != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsInterval)
+	}
+	if m.sprite_thumbnails_width != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsWidth)
+	}
+	if m.sprite_thumbnails_height != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsHeight)
+	}
+	if m.sprite_thumbnails_rows != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsRows)
+	}
+	if m.sprite_thumbnails_columns != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsColumns)
+	}
 	if m.streamed_at != nil {
 		fields = append(fields, vod.FieldStreamedAt)
 	}
@@ -12088,6 +13438,8 @@ func (m *VodMutation) Field(name string) (ent.Value, bool) {
 	switch name {
 	case vod.FieldExtID:
 		return m.ExtID()
+	case vod.FieldClipExtVodID:
+		return m.ClipExtVodID()
 	case vod.FieldExtStreamID:
 		return m.ExtStreamID()
 	case vod.FieldPlatform:
@@ -12098,6 +13450,8 @@ func (m *VodMutation) Field(name string) (ent.Value, bool) {
 		return m.Title()
 	case vod.FieldDuration:
 		return m.Duration()
+	case vod.FieldClipVodOffset:
+		return m.ClipVodOffset()
 	case vod.FieldViews:
 		return m.Views()
 	case vod.FieldResolution:
@@ -12146,6 +13500,20 @@ func (m *VodMutation) Field(name string) (ent.Value, bool) {
 		return m.Locked()
 	case vod.FieldLocalViews:
 		return m.LocalViews()
+	case vod.FieldSpriteThumbnailsEnabled:
+		return m.SpriteThumbnailsEnabled()
+	case vod.FieldSpriteThumbnailsImages:
+		return m.SpriteThumbnailsImages()
+	case vod.FieldSpriteThumbnailsInterval:
+		return m.SpriteThumbnailsInterval()
+	case vod.FieldSpriteThumbnailsWidth:
+		return m.SpriteThumbnailsWidth()
+	case vod.FieldSpriteThumbnailsHeight:
+		return m.SpriteThumbnailsHeight()
+	case vod.FieldSpriteThumbnailsRows:
+		return m.SpriteThumbnailsRows()
+	case vod.FieldSpriteThumbnailsColumns:
+		return m.SpriteThumbnailsColumns()
 	case vod.FieldStreamedAt:
 		return m.StreamedAt()
 	case vod.FieldUpdatedAt:
@@ -12163,6 +13531,8 @@ func (m *VodMutation) OldField(ctx context.Context, name string) (ent.Value, err
 	switch name {
 	case vod.FieldExtID:
 		return m.OldExtID(ctx)
+	case vod.FieldClipExtVodID:
+		return m.OldClipExtVodID(ctx)
 	case vod.FieldExtStreamID:
 		return m.OldExtStreamID(ctx)
 	case vod.FieldPlatform:
@@ -12173,6 +13543,8 @@ func (m *VodMutation) OldField(ctx context.Context, name string) (ent.Value, err
 		return m.OldTitle(ctx)
 	case vod.FieldDuration:
 		return m.OldDuration(ctx)
+	case vod.FieldClipVodOffset:
+		return m.OldClipVodOffset(ctx)
 	case vod.FieldViews:
 		return m.OldViews(ctx)
 	case vod.FieldResolution:
@@ -12221,6 +13593,20 @@ func (m *VodMutation) OldField(ctx context.Context, name string) (ent.Value, err
 		return m.OldLocked(ctx)
 	case vod.FieldLocalViews:
 		return m.OldLocalViews(ctx)
+	case vod.FieldSpriteThumbnailsEnabled:
+		return m.OldSpriteThumbnailsEnabled(ctx)
+	case vod.FieldSpriteThumbnailsImages:
+		return m.OldSpriteThumbnailsImages(ctx)
+	case vod.FieldSpriteThumbnailsInterval:
+		return m.OldSpriteThumbnailsInterval(ctx)
+	case vod.FieldSpriteThumbnailsWidth:
+		return m.OldSpriteThumbnailsWidth(ctx)
+	case vod.FieldSpriteThumbnailsHeight:
+		return m.OldSpriteThumbnailsHeight(ctx)
+	case vod.FieldSpriteThumbnailsRows:
+		return m.OldSpriteThumbnailsRows(ctx)
+	case vod.FieldSpriteThumbnailsColumns:
+		return m.OldSpriteThumbnailsColumns(ctx)
 	case vod.FieldStreamedAt:
 		return m.OldStreamedAt(ctx)
 	case vod.FieldUpdatedAt:
@@ -12243,6 +13629,13 @@ func (m *VodMutation) SetField(name string, value ent.Value) error {
 		}
 		m.SetExtID(v)
 		return nil
+	case vod.FieldClipExtVodID:
+		v, ok := value.(string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetClipExtVodID(v)
+		return nil
 	case vod.FieldExtStreamID:
 		v, ok := value.(string)
 		if !ok {
@@ -12278,6 +13671,13 @@ func (m *VodMutation) SetField(name string, value ent.Value) error {
 		}
 		m.SetDuration(v)
 		return nil
+	case vod.FieldClipVodOffset:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetClipVodOffset(v)
+		return nil
 	case vod.FieldViews:
 		v, ok := value.(int)
 		if !ok {
@@ -12446,6 +13846,55 @@ func (m *VodMutation) SetField(name string, value ent.Value) error {
 		}
 		m.SetLocalViews(v)
 		return nil
+	case vod.FieldSpriteThumbnailsEnabled:
+		v, ok := value.(bool)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsEnabled(v)
+		return nil
+	case vod.FieldSpriteThumbnailsImages:
+		v, ok := value.([]string)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsImages(v)
+		return nil
+	case vod.FieldSpriteThumbnailsInterval:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsInterval(v)
+		return nil
+	case vod.FieldSpriteThumbnailsWidth:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsWidth(v)
+		return nil
+	case vod.FieldSpriteThumbnailsHeight:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsHeight(v)
+		return nil
+	case vod.FieldSpriteThumbnailsRows:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsRows(v)
+		return nil
+	case vod.FieldSpriteThumbnailsColumns:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.SetSpriteThumbnailsColumns(v)
+		return nil
 	case vod.FieldStreamedAt:
 		v, ok := value.(time.Time)
 		if !ok {
@@ -12478,12 +13927,30 @@ func (m *VodMutation) AddedFields() []string {
 	if m.addduration != nil {
 		fields = append(fields, vod.FieldDuration)
 	}
+	if m.addclip_vod_offset != nil {
+		fields = append(fields, vod.FieldClipVodOffset)
+	}
 	if m.addviews != nil {
 		fields = append(fields, vod.FieldViews)
 	}
 	if m.addlocal_views != nil {
 		fields = append(fields, vod.FieldLocalViews)
 	}
+	if m.addsprite_thumbnails_interval != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsInterval)
+	}
+	if m.addsprite_thumbnails_width != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsWidth)
+	}
+	if m.addsprite_thumbnails_height != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsHeight)
+	}
+	if m.addsprite_thumbnails_rows != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsRows)
+	}
+	if m.addsprite_thumbnails_columns != nil {
+		fields = append(fields, vod.FieldSpriteThumbnailsColumns)
+	}
 	return fields
 }
 
@@ -12494,10 +13961,22 @@ func (m *VodMutation) AddedField(name string) (ent.Value, bool) {
 	switch name {
 	case vod.FieldDuration:
 		return m.AddedDuration()
+	case vod.FieldClipVodOffset:
+		return m.AddedClipVodOffset()
 	case vod.FieldViews:
 		return m.AddedViews()
 	case vod.FieldLocalViews:
 		return m.AddedLocalViews()
+	case vod.FieldSpriteThumbnailsInterval:
+		return m.AddedSpriteThumbnailsInterval()
+	case vod.FieldSpriteThumbnailsWidth:
+		return m.AddedSpriteThumbnailsWidth()
+	case vod.FieldSpriteThumbnailsHeight:
+		return m.AddedSpriteThumbnailsHeight()
+	case vod.FieldSpriteThumbnailsRows:
+		return m.AddedSpriteThumbnailsRows()
+	case vod.FieldSpriteThumbnailsColumns:
+		return m.AddedSpriteThumbnailsColumns()
 	}
 	return nil, false
 }
@@ -12514,6 +13993,13 @@ func (m *VodMutation) AddField(name string, value ent.Value) error {
 		}
 		m.AddDuration(v)
 		return nil
+	case vod.FieldClipVodOffset:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddClipVodOffset(v)
+		return nil
 	case vod.FieldViews:
 		v, ok := value.(int)
 		if !ok {
@@ -12528,6 +14014,41 @@ func (m *VodMutation) AddField(name string, value ent.Value) error {
 		}
 		m.AddLocalViews(v)
 		return nil
+	case vod.FieldSpriteThumbnailsInterval:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddSpriteThumbnailsInterval(v)
+		return nil
+	case vod.FieldSpriteThumbnailsWidth:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddSpriteThumbnailsWidth(v)
+		return nil
+	case vod.FieldSpriteThumbnailsHeight:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddSpriteThumbnailsHeight(v)
+		return nil
+	case vod.FieldSpriteThumbnailsRows:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddSpriteThumbnailsRows(v)
+		return nil
+	case vod.FieldSpriteThumbnailsColumns:
+		v, ok := value.(int)
+		if !ok {
+			return fmt.Errorf("unexpected type %T for field %s", value, name)
+		}
+		m.AddSpriteThumbnailsColumns(v)
+		return nil
 	}
 	return fmt.Errorf("unknown Vod numeric field %s", name)
 }
@@ -12536,9 +14057,15 @@ func (m *VodMutation) AddField(name string, value ent.Value) error {
 // mutation.
 func (m *VodMutation) ClearedFields() []string {
 	var fields []string
+	if m.FieldCleared(vod.FieldClipExtVodID) {
+		fields = append(fields, vod.FieldClipExtVodID)
+	}
 	if m.FieldCleared(vod.FieldExtStreamID) {
 		fields = append(fields, vod.FieldExtStreamID)
 	}
+	if m.FieldCleared(vod.FieldClipVodOffset) {
+		fields = append(fields, vod.FieldClipVodOffset)
+	}
 	if m.FieldCleared(vod.FieldResolution) {
 		fields = append(fields, vod.FieldResolution)
 	}
@@ -12593,6 +14120,24 @@ func (m *VodMutation) ClearedFields() []string {
 	if m.FieldCleared(vod.FieldTmpVideoHlsPath) {
 		fields = append(fields, vod.FieldTmpVideoHlsPath)
 	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsImages) {
+		fields = append(fields, vod.FieldSpriteThumbnailsImages)
+	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsInterval) {
+		fields = append(fields, vod.FieldSpriteThumbnailsInterval)
+	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsWidth) {
+		fields = append(fields, vod.FieldSpriteThumbnailsWidth)
+	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsHeight) {
+		fields = append(fields, vod.FieldSpriteThumbnailsHeight)
+	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsRows) {
+		fields = append(fields, vod.FieldSpriteThumbnailsRows)
+	}
+	if m.FieldCleared(vod.FieldSpriteThumbnailsColumns) {
+		fields = append(fields, vod.FieldSpriteThumbnailsColumns)
+	}
 	return fields
 }
 
@@ -12607,9 +14152,15 @@ func (m *VodMutation) FieldCleared(name string) bool {
 // error if the field is not defined in the schema.
 func (m *VodMutation) ClearField(name string) error {
 	switch name {
+	case vod.FieldClipExtVodID:
+		m.ClearClipExtVodID()
+		return nil
 	case vod.FieldExtStreamID:
 		m.ClearExtStreamID()
 		return nil
+	case vod.FieldClipVodOffset:
+		m.ClearClipVodOffset()
+		return nil
 	case vod.FieldResolution:
 		m.ClearResolution()
 		return nil
@@ -12664,6 +14215,24 @@ func (m *VodMutation) ClearField(name string) error {
 	case vod.FieldTmpVideoHlsPath:
 		m.ClearTmpVideoHlsPath()
 		return nil
+	case vod.FieldSpriteThumbnailsImages:
+		m.ClearSpriteThumbnailsImages()
+		return nil
+	case vod.FieldSpriteThumbnailsInterval:
+		m.ClearSpriteThumbnailsInterval()
+		return nil
+	case vod.FieldSpriteThumbnailsWidth:
+		m.ClearSpriteThumbnailsWidth()
+		return nil
+	case vod.FieldSpriteThumbnailsHeight:
+		m.ClearSpriteThumbnailsHeight()
+		return nil
+	case vod.FieldSpriteThumbnailsRows:
+		m.ClearSpriteThumbnailsRows()
+		return nil
+	case vod.FieldSpriteThumbnailsColumns:
+		m.ClearSpriteThumbnailsColumns()
+		return nil
 	}
 	return fmt.Errorf("unknown Vod nullable field %s", name)
 }
@@ -12675,6 +14244,9 @@ func (m *VodMutation) ResetField(name string) error {
 	case vod.FieldExtID:
 		m.ResetExtID()
 		return nil
+	case vod.FieldClipExtVodID:
+		m.ResetClipExtVodID()
+		return nil
 	case vod.FieldExtStreamID:
 		m.ResetExtStreamID()
 		return nil
@@ -12690,6 +14262,9 @@ func (m *VodMutation) ResetField(name string) error {
 	case vod.FieldDuration:
 		m.ResetDuration()
 		return nil
+	case vod.FieldClipVodOffset:
+		m.ResetClipVodOffset()
+		return nil
 	case vod.FieldViews:
 		m.ResetViews()
 		return nil
@@ -12762,6 +14337,27 @@ func (m *VodMutation) ResetField(name string) error {
 	case vod.FieldLocalViews:
 		m.ResetLocalViews()
 		return nil
+	case vod.FieldSpriteThumbnailsEnabled:
+		m.ResetSpriteThumbnailsEnabled()
+		return nil
+	case vod.FieldSpriteThumbnailsImages:
+		m.ResetSpriteThumbnailsImages()
+		return nil
+	case vod.FieldSpriteThumbnailsInterval:
+		m.ResetSpriteThumbnailsInterval()
+		return nil
+	case vod.FieldSpriteThumbnailsWidth:
+		m.ResetSpriteThumbnailsWidth()
+		return nil
+	case vod.FieldSpriteThumbnailsHeight:
+		m.ResetSpriteThumbnailsHeight()
+		return nil
+	case vod.FieldSpriteThumbnailsRows:
+		m.ResetSpriteThumbnailsRows()
+		return nil
+	case vod.FieldSpriteThumbnailsColumns:
+		m.ResetSpriteThumbnailsColumns()
+		return nil
 	case vod.FieldStreamedAt:
 		m.ResetStreamedAt()
 		return nil
diff --git a/ent/predicate/predicate.go b/ent/predicate/predicate.go
index ecf937f3..a3e689de 100644
--- a/ent/predicate/predicate.go
+++ b/ent/predicate/predicate.go
@@ -39,6 +39,9 @@ type Playlist func(*sql.Selector)
 // Queue is the predicate function for queue builders.
 type Queue func(*sql.Selector)
 
+// Sessions is the predicate function for sessions builders.
+type Sessions func(*sql.Selector)
+
 // TwitchCategory is the predicate function for twitchcategory builders.
 type TwitchCategory func(*sql.Selector)
 
diff --git a/ent/runtime.go b/ent/runtime.go
index 58e2371a..8ab8471a 100644
--- a/ent/runtime.go
+++ b/ent/runtime.go
@@ -17,6 +17,7 @@ import (
 	"github.com/zibbp/ganymede/ent/playlist"
 	"github.com/zibbp/ganymede/ent/queue"
 	"github.com/zibbp/ganymede/ent/schema"
+	"github.com/zibbp/ganymede/ent/sessions"
 	"github.com/zibbp/ganymede/ent/twitchcategory"
 	"github.com/zibbp/ganymede/ent/user"
 	"github.com/zibbp/ganymede/ent/vod"
@@ -112,14 +113,26 @@ func init() {
 	liveDescApplyCategoriesToLive := liveFields[13].Descriptor()
 	// live.DefaultApplyCategoriesToLive holds the default value on creation for the apply_categories_to_live field.
 	live.DefaultApplyCategoriesToLive = liveDescApplyCategoriesToLive.Default.(bool)
+	// liveDescWatchClips is the schema descriptor for watch_clips field.
+	liveDescWatchClips := liveFields[14].Descriptor()
+	// live.DefaultWatchClips holds the default value on creation for the watch_clips field.
+	live.DefaultWatchClips = liveDescWatchClips.Default.(bool)
+	// liveDescClipsLimit is the schema descriptor for clips_limit field.
+	liveDescClipsLimit := liveFields[15].Descriptor()
+	// live.DefaultClipsLimit holds the default value on creation for the clips_limit field.
+	live.DefaultClipsLimit = liveDescClipsLimit.Default.(int)
+	// liveDescClipsIntervalDays is the schema descriptor for clips_interval_days field.
+	liveDescClipsIntervalDays := liveFields[16].Descriptor()
+	// live.DefaultClipsIntervalDays holds the default value on creation for the clips_interval_days field.
+	live.DefaultClipsIntervalDays = liveDescClipsIntervalDays.Default.(int)
 	// liveDescUpdatedAt is the schema descriptor for updated_at field.
-	liveDescUpdatedAt := liveFields[14].Descriptor()
+	liveDescUpdatedAt := liveFields[18].Descriptor()
 	// live.DefaultUpdatedAt holds the default value on creation for the updated_at field.
 	live.DefaultUpdatedAt = liveDescUpdatedAt.Default.(func() time.Time)
 	// live.UpdateDefaultUpdatedAt holds the default value on update for the updated_at field.
 	live.UpdateDefaultUpdatedAt = liveDescUpdatedAt.UpdateDefault.(func() time.Time)
 	// liveDescCreatedAt is the schema descriptor for created_at field.
-	liveDescCreatedAt := liveFields[15].Descriptor()
+	liveDescCreatedAt := liveFields[19].Descriptor()
 	// live.DefaultCreatedAt holds the default value on creation for the created_at field.
 	live.DefaultCreatedAt = liveDescCreatedAt.Default.(func() time.Time)
 	// liveDescID is the schema descriptor for id field.
@@ -232,6 +245,16 @@ func init() {
 	queueDescID := queueFields[0].Descriptor()
 	// queue.DefaultID holds the default value on creation for the id field.
 	queue.DefaultID = queueDescID.Default.(func() uuid.UUID)
+	sessionsFields := schema.Sessions{}.Fields()
+	_ = sessionsFields
+	// sessionsDescToken is the schema descriptor for token field.
+	sessionsDescToken := sessionsFields[0].Descriptor()
+	// sessions.TokenValidator is a validator for the "token" field. It is called by the builders before save.
+	sessions.TokenValidator = sessionsDescToken.Validators[0].(func(string) error)
+	// sessionsDescData is the schema descriptor for data field.
+	sessionsDescData := sessionsFields[1].Descriptor()
+	// sessions.DataValidator is a validator for the "data" field. It is called by the builders before save.
+	sessions.DataValidator = sessionsDescData.Validators[0].(func([]byte) error)
 	twitchcategoryFields := schema.TwitchCategory{}.Fields()
 	_ = twitchcategoryFields
 	// twitchcategoryDescUpdatedAt is the schema descriptor for updated_at field.
@@ -267,37 +290,41 @@ func init() {
 	vodFields := schema.Vod{}.Fields()
 	_ = vodFields
 	// vodDescDuration is the schema descriptor for duration field.
-	vodDescDuration := vodFields[6].Descriptor()
+	vodDescDuration := vodFields[7].Descriptor()
 	// vod.DefaultDuration holds the default value on creation for the duration field.
 	vod.DefaultDuration = vodDescDuration.Default.(int)
 	// vodDescViews is the schema descriptor for views field.
-	vodDescViews := vodFields[7].Descriptor()
+	vodDescViews := vodFields[9].Descriptor()
 	// vod.DefaultViews holds the default value on creation for the views field.
 	vod.DefaultViews = vodDescViews.Default.(int)
 	// vodDescProcessing is the schema descriptor for processing field.
-	vodDescProcessing := vodFields[9].Descriptor()
+	vodDescProcessing := vodFields[11].Descriptor()
 	// vod.DefaultProcessing holds the default value on creation for the processing field.
 	vod.DefaultProcessing = vodDescProcessing.Default.(bool)
 	// vodDescLocked is the schema descriptor for locked field.
-	vodDescLocked := vodFields[29].Descriptor()
+	vodDescLocked := vodFields[31].Descriptor()
 	// vod.DefaultLocked holds the default value on creation for the locked field.
 	vod.DefaultLocked = vodDescLocked.Default.(bool)
 	// vodDescLocalViews is the schema descriptor for local_views field.
-	vodDescLocalViews := vodFields[30].Descriptor()
+	vodDescLocalViews := vodFields[32].Descriptor()
 	// vod.DefaultLocalViews holds the default value on creation for the local_views field.
 	vod.DefaultLocalViews = vodDescLocalViews.Default.(int)
+	// vodDescSpriteThumbnailsEnabled is the schema descriptor for sprite_thumbnails_enabled field.
+	vodDescSpriteThumbnailsEnabled := vodFields[33].Descriptor()
+	// vod.DefaultSpriteThumbnailsEnabled holds the default value on creation for the sprite_thumbnails_enabled field.
+	vod.DefaultSpriteThumbnailsEnabled = vodDescSpriteThumbnailsEnabled.Default.(bool)
 	// vodDescStreamedAt is the schema descriptor for streamed_at field.
-	vodDescStreamedAt := vodFields[31].Descriptor()
+	vodDescStreamedAt := vodFields[40].Descriptor()
 	// vod.DefaultStreamedAt holds the default value on creation for the streamed_at field.
 	vod.DefaultStreamedAt = vodDescStreamedAt.Default.(func() time.Time)
 	// vodDescUpdatedAt is the schema descriptor for updated_at field.
-	vodDescUpdatedAt := vodFields[32].Descriptor()
+	vodDescUpdatedAt := vodFields[41].Descriptor()
 	// vod.DefaultUpdatedAt holds the default value on creation for the updated_at field.
 	vod.DefaultUpdatedAt = vodDescUpdatedAt.Default.(func() time.Time)
 	// vod.UpdateDefaultUpdatedAt holds the default value on update for the updated_at field.
 	vod.UpdateDefaultUpdatedAt = vodDescUpdatedAt.UpdateDefault.(func() time.Time)
 	// vodDescCreatedAt is the schema descriptor for created_at field.
-	vodDescCreatedAt := vodFields[33].Descriptor()
+	vodDescCreatedAt := vodFields[42].Descriptor()
 	// vod.DefaultCreatedAt holds the default value on creation for the created_at field.
 	vod.DefaultCreatedAt = vodDescCreatedAt.Default.(func() time.Time)
 	// vodDescID is the schema descriptor for id field.
diff --git a/ent/schema/live.go b/ent/schema/live.go
index 6c17412c..158bb877 100644
--- a/ent/schema/live.go
+++ b/ent/schema/live.go
@@ -20,7 +20,7 @@ type Live struct {
 
 // Fields of the Live.
 func (Live) Fields() []ent.Field {
-	return []ent.Field{
+	fields := []ent.Field{
 		field.UUID("id", uuid.UUID{}).Default(uuid.New),
 		field.Bool("watch_live").Default(true).Comment("Watch live streams"),
 		field.Bool("watch_vod").Default(false).Comment("Watch new VODs"),
@@ -35,9 +35,17 @@ func (Live) Fields() []ent.Field {
 		field.Bool("render_chat").Default(true).Comment("Whether the chat should be rendered."),
 		field.Int64("video_age").Default(0).Comment("Restrict fetching videos to a certain age."),
 		field.Bool("apply_categories_to_live").Default(false).Comment("Whether the categories should be applied to livestreams."),
+		field.Bool("watch_clips").Default(false).Comment("Whether to download clips on a schedule."),
+		field.Int("clips_limit").Default(0).Comment("The number of clips to archive."),
+		field.Int("clips_interval_days").Default(0).Comment("How often channel should be checked for clips to archive in days."),
+		field.Time("clips_last_checked").Comment("Time when clips were last checked.").Optional(),
 		field.Time("updated_at").Default(time.Now).UpdateDefault(time.Now),
 		field.Time("created_at").Default(time.Now).Immutable(),
 	}
+	for _, f := range fields {
+		f.Descriptor().Tag = `json:"` + f.Descriptor().Name + `"`
+	}
+	return fields
 }
 
 // Edges of the Live.
diff --git a/ent/schema/playback.go b/ent/schema/playback.go
index 0ef93884..7cfca4cb 100644
--- a/ent/schema/playback.go
+++ b/ent/schema/playback.go
@@ -1,11 +1,12 @@
 package schema
 
 import (
+	"time"
+
 	"entgo.io/ent"
 	"entgo.io/ent/schema/field"
 	"github.com/google/uuid"
 	"github.com/zibbp/ganymede/internal/utils"
-	"time"
 )
 
 // Playback holds the schema definition for the Playback entity.
diff --git a/ent/schema/sessions.go b/ent/schema/sessions.go
new file mode 100644
index 00000000..48637461
--- /dev/null
+++ b/ent/schema/sessions.go
@@ -0,0 +1,32 @@
+package schema
+
+import (
+	"entgo.io/ent"
+	"entgo.io/ent/schema/field"
+	"entgo.io/ent/schema/index"
+)
+
+// Sessions holds the schema definition for the Sessions entity.
+type Sessions struct {
+	ent.Schema
+}
+
+// Fields of the Sessions.
+func (Sessions) Fields() []ent.Field {
+	return []ent.Field{
+		field.Text("token").Unique().NotEmpty().Immutable(),
+		field.Bytes("data").NotEmpty(),
+		field.Time("expiry"),
+	}
+}
+
+func (Sessions) Indexes() []ent.Index {
+	return []ent.Index{
+		index.Fields("expiry"),
+	}
+}
+
+// Edges of the Sessions.
+func (Sessions) Edges() []ent.Edge {
+	return nil
+}
diff --git a/ent/schema/vod.go b/ent/schema/vod.go
index 34fbe4be..c5715fb6 100644
--- a/ent/schema/vod.go
+++ b/ent/schema/vod.go
@@ -20,11 +20,13 @@ func (Vod) Fields() []ent.Field {
 	return []ent.Field{
 		field.UUID("id", uuid.UUID{}).Default(uuid.New),
 		field.String("ext_id").Comment("The ID of the video on the external platform."),
+		field.String("clip_ext_vod_id").Optional().Comment("The external VOD ID of a clip. This is only populated if the clip is linked to a video."),
 		field.String("ext_stream_id").Optional().Comment("The ID of the stream on the external platform, if applicable."),
 		field.Enum("platform").GoType(utils.VideoPlatform("")).Default(string(utils.PlatformTwitch)).Comment("The platform the VOD is from, takes an enum."),
 		field.Enum("type").GoType(utils.VodType("")).Default(string(utils.Archive)).Comment("The type of VOD, takes an enum."),
 		field.String("title"),
 		field.Int("duration").Default(1),
+		field.Int("clip_vod_offset").Optional().Comment("The offset in seconds to where the clip starts in the VOD. This is only populdated if the video is a clip."),
 		field.Int("views").Default(1),
 		field.String("resolution").Optional(),
 		field.Bool("processing").Default(false).Comment("Whether the VOD is currently processing."),
@@ -49,6 +51,13 @@ func (Vod) Fields() []ent.Field {
 		field.String("tmp_video_hls_path").Optional().Comment("The path where the temporary video hls files are"),
 		field.Bool("locked").Default(false),
 		field.Int("local_views").Default(0),
+		field.Bool("sprite_thumbnails_enabled").Default(false),
+		field.Strings("sprite_thumbnails_images").Optional(),
+		field.Int("sprite_thumbnails_interval").Optional(),
+		field.Int("sprite_thumbnails_width").Optional(),
+		field.Int("sprite_thumbnails_height").Optional(),
+		field.Int("sprite_thumbnails_rows").Optional(),
+		field.Int("sprite_thumbnails_columns").Optional(),
 		field.Time("streamed_at").Default(time.Now).Comment("The time the VOD was streamed."),
 		field.Time("updated_at").Default(time.Now).UpdateDefault(time.Now),
 		field.Time("created_at").Default(time.Now).Immutable(),
diff --git a/ent/sessions.go b/ent/sessions.go
new file mode 100644
index 00000000..02b114cd
--- /dev/null
+++ b/ent/sessions.go
@@ -0,0 +1,130 @@
+// Code generated by ent, DO NOT EDIT.
+
+package ent
+
+import (
+	"fmt"
+	"strings"
+	"time"
+
+	"entgo.io/ent"
+	"entgo.io/ent/dialect/sql"
+	"github.com/zibbp/ganymede/ent/sessions"
+)
+
+// Sessions is the model entity for the Sessions schema.
+type Sessions struct {
+	config `json:"-"`
+	// ID of the ent.
+	ID int `json:"id,omitempty"`
+	// Token holds the value of the "token" field.
+	Token string `json:"token,omitempty"`
+	// Data holds the value of the "data" field.
+	Data []byte `json:"data,omitempty"`
+	// Expiry holds the value of the "expiry" field.
+	Expiry       time.Time `json:"expiry,omitempty"`
+	selectValues sql.SelectValues
+}
+
+// scanValues returns the types for scanning values from sql.Rows.
+func (*Sessions) scanValues(columns []string) ([]any, error) {
+	values := make([]any, len(columns))
+	for i := range columns {
+		switch columns[i] {
+		case sessions.FieldData:
+			values[i] = new([]byte)
+		case sessions.FieldID:
+			values[i] = new(sql.NullInt64)
+		case sessions.FieldToken:
+			values[i] = new(sql.NullString)
+		case sessions.FieldExpiry:
+			values[i] = new(sql.NullTime)
+		default:
+			values[i] = new(sql.UnknownType)
+		}
+	}
+	return values, nil
+}
+
+// assignValues assigns the values that were returned from sql.Rows (after scanning)
+// to the Sessions fields.
+func (s *Sessions) assignValues(columns []string, values []any) error {
+	if m, n := len(values), len(columns); m < n {
+		return fmt.Errorf("mismatch number of scan values: %d != %d", m, n)
+	}
+	for i := range columns {
+		switch columns[i] {
+		case sessions.FieldID:
+			value, ok := values[i].(*sql.NullInt64)
+			if !ok {
+				return fmt.Errorf("unexpected type %T for field id", value)
+			}
+			s.ID = int(value.Int64)
+		case sessions.FieldToken:
+			if value, ok := values[i].(*sql.NullString); !ok {
+				return fmt.Errorf("unexpected type %T for field token", values[i])
+			} else if value.Valid {
+				s.Token = value.String
+			}
+		case sessions.FieldData:
+			if value, ok := values[i].(*[]byte); !ok {
+				return fmt.Errorf("unexpected type %T for field data", values[i])
+			} else if value != nil {
+				s.Data = *value
+			}
+		case sessions.FieldExpiry:
+			if value, ok := values[i].(*sql.NullTime); !ok {
+				return fmt.Errorf("unexpected type %T for field expiry", values[i])
+			} else if value.Valid {
+				s.Expiry = value.Time
+			}
+		default:
+			s.selectValues.Set(columns[i], values[i])
+		}
+	}
+	return nil
+}
+
+// Value returns the ent.Value that was dynamically selected and assigned to the Sessions.
+// This includes values selected through modifiers, order, etc.
+func (s *Sessions) Value(name string) (ent.Value, error) {
+	return s.selectValues.Get(name)
+}
+
+// Update returns a builder for updating this Sessions.
+// Note that you need to call Sessions.Unwrap() before calling this method if this Sessions
+// was returned from a transaction, and the transaction was committed or rolled back.
+func (s *Sessions) Update() *SessionsUpdateOne {
+	return NewSessionsClient(s.config).UpdateOne(s)
+}
+
+// Unwrap unwraps the Sessions entity that was returned from a transaction after it was closed,
+// so that all future queries will be executed through the driver which created the transaction.
+func (s *Sessions) Unwrap() *Sessions {
+	_tx, ok := s.config.driver.(*txDriver)
+	if !ok {
+		panic("ent: Sessions is not a transactional entity")
+	}
+	s.config.driver = _tx.drv
+	return s
+}
+
+// String implements the fmt.Stringer.
+func (s *Sessions) String() string {
+	var builder strings.Builder
+	builder.WriteString("Sessions(")
+	builder.WriteString(fmt.Sprintf("id=%v, ", s.ID))
+	builder.WriteString("token=")
+	builder.WriteString(s.Token)
+	builder.WriteString(", ")
+	builder.WriteString("data=")
+	builder.WriteString(fmt.Sprintf("%v", s.Data))
+	builder.WriteString(", ")
+	builder.WriteString("expiry=")
+	builder.WriteString(s.Expiry.Format(time.ANSIC))
+	builder.WriteByte(')')
+	return builder.String()
+}
+
+// SessionsSlice is a parsable slice of Sessions.
+type SessionsSlice []*Sessions
diff --git a/ent/sessions/sessions.go b/ent/sessions/sessions.go
new file mode 100644
index 00000000..54aceca5
--- /dev/null
+++ b/ent/sessions/sessions.go
@@ -0,0 +1,65 @@
+// Code generated by ent, DO NOT EDIT.
+
+package sessions
+
+import (
+	"entgo.io/ent/dialect/sql"
+)
+
+const (
+	// Label holds the string label denoting the sessions type in the database.
+	Label = "sessions"
+	// FieldID holds the string denoting the id field in the database.
+	FieldID = "id"
+	// FieldToken holds the string denoting the token field in the database.
+	FieldToken = "token"
+	// FieldData holds the string denoting the data field in the database.
+	FieldData = "data"
+	// FieldExpiry holds the string denoting the expiry field in the database.
+	FieldExpiry = "expiry"
+	// Table holds the table name of the sessions in the database.
+	Table = "sessions"
+)
+
+// Columns holds all SQL columns for sessions fields.
+var Columns = []string{
+	FieldID,
+	FieldToken,
+	FieldData,
+	FieldExpiry,
+}
+
+// ValidColumn reports if the column name is valid (part of the table columns).
+func ValidColumn(column string) bool {
+	for i := range Columns {
+		if column == Columns[i] {
+			return true
+		}
+	}
+	return false
+}
+
+var (
+	// TokenValidator is a validator for the "token" field. It is called by the builders before save.
+	TokenValidator func(string) error
+	// DataValidator is a validator for the "data" field. It is called by the builders before save.
+	DataValidator func([]byte) error
+)
+
+// OrderOption defines the ordering options for the Sessions queries.
+type OrderOption func(*sql.Selector)
+
+// ByID orders the results by the id field.
+func ByID(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldID, opts...).ToFunc()
+}
+
+// ByToken orders the results by the token field.
+func ByToken(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldToken, opts...).ToFunc()
+}
+
+// ByExpiry orders the results by the expiry field.
+func ByExpiry(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldExpiry, opts...).ToFunc()
+}
diff --git a/ent/sessions/where.go b/ent/sessions/where.go
new file mode 100644
index 00000000..a6ea7fb4
--- /dev/null
+++ b/ent/sessions/where.go
@@ -0,0 +1,230 @@
+// Code generated by ent, DO NOT EDIT.
+
+package sessions
+
+import (
+	"time"
+
+	"entgo.io/ent/dialect/sql"
+	"github.com/zibbp/ganymede/ent/predicate"
+)
+
+// ID filters vertices based on their ID field.
+func ID(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldID, id))
+}
+
+// IDEQ applies the EQ predicate on the ID field.
+func IDEQ(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldID, id))
+}
+
+// IDNEQ applies the NEQ predicate on the ID field.
+func IDNEQ(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNEQ(FieldID, id))
+}
+
+// IDIn applies the In predicate on the ID field.
+func IDIn(ids ...int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldIn(FieldID, ids...))
+}
+
+// IDNotIn applies the NotIn predicate on the ID field.
+func IDNotIn(ids ...int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNotIn(FieldID, ids...))
+}
+
+// IDGT applies the GT predicate on the ID field.
+func IDGT(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGT(FieldID, id))
+}
+
+// IDGTE applies the GTE predicate on the ID field.
+func IDGTE(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGTE(FieldID, id))
+}
+
+// IDLT applies the LT predicate on the ID field.
+func IDLT(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLT(FieldID, id))
+}
+
+// IDLTE applies the LTE predicate on the ID field.
+func IDLTE(id int) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLTE(FieldID, id))
+}
+
+// Token applies equality check predicate on the "token" field. It's identical to TokenEQ.
+func Token(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldToken, v))
+}
+
+// Data applies equality check predicate on the "data" field. It's identical to DataEQ.
+func Data(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldData, v))
+}
+
+// Expiry applies equality check predicate on the "expiry" field. It's identical to ExpiryEQ.
+func Expiry(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldExpiry, v))
+}
+
+// TokenEQ applies the EQ predicate on the "token" field.
+func TokenEQ(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldToken, v))
+}
+
+// TokenNEQ applies the NEQ predicate on the "token" field.
+func TokenNEQ(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNEQ(FieldToken, v))
+}
+
+// TokenIn applies the In predicate on the "token" field.
+func TokenIn(vs ...string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldIn(FieldToken, vs...))
+}
+
+// TokenNotIn applies the NotIn predicate on the "token" field.
+func TokenNotIn(vs ...string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNotIn(FieldToken, vs...))
+}
+
+// TokenGT applies the GT predicate on the "token" field.
+func TokenGT(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGT(FieldToken, v))
+}
+
+// TokenGTE applies the GTE predicate on the "token" field.
+func TokenGTE(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGTE(FieldToken, v))
+}
+
+// TokenLT applies the LT predicate on the "token" field.
+func TokenLT(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLT(FieldToken, v))
+}
+
+// TokenLTE applies the LTE predicate on the "token" field.
+func TokenLTE(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLTE(FieldToken, v))
+}
+
+// TokenContains applies the Contains predicate on the "token" field.
+func TokenContains(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldContains(FieldToken, v))
+}
+
+// TokenHasPrefix applies the HasPrefix predicate on the "token" field.
+func TokenHasPrefix(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldHasPrefix(FieldToken, v))
+}
+
+// TokenHasSuffix applies the HasSuffix predicate on the "token" field.
+func TokenHasSuffix(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldHasSuffix(FieldToken, v))
+}
+
+// TokenEqualFold applies the EqualFold predicate on the "token" field.
+func TokenEqualFold(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEqualFold(FieldToken, v))
+}
+
+// TokenContainsFold applies the ContainsFold predicate on the "token" field.
+func TokenContainsFold(v string) predicate.Sessions {
+	return predicate.Sessions(sql.FieldContainsFold(FieldToken, v))
+}
+
+// DataEQ applies the EQ predicate on the "data" field.
+func DataEQ(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldData, v))
+}
+
+// DataNEQ applies the NEQ predicate on the "data" field.
+func DataNEQ(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNEQ(FieldData, v))
+}
+
+// DataIn applies the In predicate on the "data" field.
+func DataIn(vs ...[]byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldIn(FieldData, vs...))
+}
+
+// DataNotIn applies the NotIn predicate on the "data" field.
+func DataNotIn(vs ...[]byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNotIn(FieldData, vs...))
+}
+
+// DataGT applies the GT predicate on the "data" field.
+func DataGT(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGT(FieldData, v))
+}
+
+// DataGTE applies the GTE predicate on the "data" field.
+func DataGTE(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGTE(FieldData, v))
+}
+
+// DataLT applies the LT predicate on the "data" field.
+func DataLT(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLT(FieldData, v))
+}
+
+// DataLTE applies the LTE predicate on the "data" field.
+func DataLTE(v []byte) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLTE(FieldData, v))
+}
+
+// ExpiryEQ applies the EQ predicate on the "expiry" field.
+func ExpiryEQ(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldEQ(FieldExpiry, v))
+}
+
+// ExpiryNEQ applies the NEQ predicate on the "expiry" field.
+func ExpiryNEQ(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNEQ(FieldExpiry, v))
+}
+
+// ExpiryIn applies the In predicate on the "expiry" field.
+func ExpiryIn(vs ...time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldIn(FieldExpiry, vs...))
+}
+
+// ExpiryNotIn applies the NotIn predicate on the "expiry" field.
+func ExpiryNotIn(vs ...time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldNotIn(FieldExpiry, vs...))
+}
+
+// ExpiryGT applies the GT predicate on the "expiry" field.
+func ExpiryGT(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGT(FieldExpiry, v))
+}
+
+// ExpiryGTE applies the GTE predicate on the "expiry" field.
+func ExpiryGTE(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldGTE(FieldExpiry, v))
+}
+
+// ExpiryLT applies the LT predicate on the "expiry" field.
+func ExpiryLT(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLT(FieldExpiry, v))
+}
+
+// ExpiryLTE applies the LTE predicate on the "expiry" field.
+func ExpiryLTE(v time.Time) predicate.Sessions {
+	return predicate.Sessions(sql.FieldLTE(FieldExpiry, v))
+}
+
+// And groups predicates with the AND operator between them.
+func And(predicates ...predicate.Sessions) predicate.Sessions {
+	return predicate.Sessions(sql.AndPredicates(predicates...))
+}
+
+// Or groups predicates with the OR operator between them.
+func Or(predicates ...predicate.Sessions) predicate.Sessions {
+	return predicate.Sessions(sql.OrPredicates(predicates...))
+}
+
+// Not applies the not operator on the given predicate.
+func Not(p predicate.Sessions) predicate.Sessions {
+	return predicate.Sessions(sql.NotPredicates(p))
+}
diff --git a/ent/sessions_create.go b/ent/sessions_create.go
new file mode 100644
index 00000000..4750cd13
--- /dev/null
+++ b/ent/sessions_create.go
@@ -0,0 +1,543 @@
+// Code generated by ent, DO NOT EDIT.
+
+package ent
+
+import (
+	"context"
+	"errors"
+	"fmt"
+	"time"
+
+	"entgo.io/ent/dialect/sql"
+	"entgo.io/ent/dialect/sql/sqlgraph"
+	"entgo.io/ent/schema/field"
+	"github.com/zibbp/ganymede/ent/sessions"
+)
+
+// SessionsCreate is the builder for creating a Sessions entity.
+type SessionsCreate struct {
+	config
+	mutation *SessionsMutation
+	hooks    []Hook
+	conflict []sql.ConflictOption
+}
+
+// SetToken sets the "token" field.
+func (sc *SessionsCreate) SetToken(s string) *SessionsCreate {
+	sc.mutation.SetToken(s)
+	return sc
+}
+
+// SetData sets the "data" field.
+func (sc *SessionsCreate) SetData(b []byte) *SessionsCreate {
+	sc.mutation.SetData(b)
+	return sc
+}
+
+// SetExpiry sets the "expiry" field.
+func (sc *SessionsCreate) SetExpiry(t time.Time) *SessionsCreate {
+	sc.mutation.SetExpiry(t)
+	return sc
+}
+
+// Mutation returns the SessionsMutation object of the builder.
+func (sc *SessionsCreate) Mutation() *SessionsMutation {
+	return sc.mutation
+}
+
+// Save creates the Sessions in the database.
+func (sc *SessionsCreate) Save(ctx context.Context) (*Sessions, error) {
+	return withHooks(ctx, sc.sqlSave, sc.mutation, sc.hooks)
+}
+
+// SaveX calls Save and panics if Save returns an error.
+func (sc *SessionsCreate) SaveX(ctx context.Context) *Sessions {
+	v, err := sc.Save(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return v
+}
+
+// Exec executes the query.
+func (sc *SessionsCreate) Exec(ctx context.Context) error {
+	_, err := sc.Save(ctx)
+	return err
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (sc *SessionsCreate) ExecX(ctx context.Context) {
+	if err := sc.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
+
+// check runs all checks and user-defined validators on the builder.
+func (sc *SessionsCreate) check() error {
+	if _, ok := sc.mutation.Token(); !ok {
+		return &ValidationError{Name: "token", err: errors.New(`ent: missing required field "Sessions.token"`)}
+	}
+	if v, ok := sc.mutation.Token(); ok {
+		if err := sessions.TokenValidator(v); err != nil {
+			return &ValidationError{Name: "token", err: fmt.Errorf(`ent: validator failed for field "Sessions.token": %w`, err)}
+		}
+	}
+	if _, ok := sc.mutation.Data(); !ok {
+		return &ValidationError{Name: "data", err: errors.New(`ent: missing required field "Sessions.data"`)}
+	}
+	if v, ok := sc.mutation.Data(); ok {
+		if err := sessions.DataValidator(v); err != nil {
+			return &ValidationError{Name: "data", err: fmt.Errorf(`ent: validator failed for field "Sessions.data": %w`, err)}
+		}
+	}
+	if _, ok := sc.mutation.Expiry(); !ok {
+		return &ValidationError{Name: "expiry", err: errors.New(`ent: missing required field "Sessions.expiry"`)}
+	}
+	return nil
+}
+
+func (sc *SessionsCreate) sqlSave(ctx context.Context) (*Sessions, error) {
+	if err := sc.check(); err != nil {
+		return nil, err
+	}
+	_node, _spec := sc.createSpec()
+	if err := sqlgraph.CreateNode(ctx, sc.driver, _spec); err != nil {
+		if sqlgraph.IsConstraintError(err) {
+			err = &ConstraintError{msg: err.Error(), wrap: err}
+		}
+		return nil, err
+	}
+	id := _spec.ID.Value.(int64)
+	_node.ID = int(id)
+	sc.mutation.id = &_node.ID
+	sc.mutation.done = true
+	return _node, nil
+}
+
+func (sc *SessionsCreate) createSpec() (*Sessions, *sqlgraph.CreateSpec) {
+	var (
+		_node = &Sessions{config: sc.config}
+		_spec = sqlgraph.NewCreateSpec(sessions.Table, sqlgraph.NewFieldSpec(sessions.FieldID, field.TypeInt))
+	)
+	_spec.OnConflict = sc.conflict
+	if value, ok := sc.mutation.Token(); ok {
+		_spec.SetField(sessions.FieldToken, field.TypeString, value)
+		_node.Token = value
+	}
+	if value, ok := sc.mutation.Data(); ok {
+		_spec.SetField(sessions.FieldData, field.TypeBytes, value)
+		_node.Data = value
+	}
+	if value, ok := sc.mutation.Expiry(); ok {
+		_spec.SetField(sessions.FieldExpiry, field.TypeTime, value)
+		_node.Expiry = value
+	}
+	return _node, _spec
+}
+
+// OnConflict allows configuring the `ON CONFLICT` / `ON DUPLICATE KEY` clause
+// of the `INSERT` statement. For example:
+//
+//	client.Sessions.Create().
+//		SetToken(v).
+//		OnConflict(
+//			// Update the row with the new values
+//			// the was proposed for insertion.
+//			sql.ResolveWithNewValues(),
+//		).
+//		// Override some of the fields with custom
+//		// update values.
+//		Update(func(u *ent.SessionsUpsert) {
+//			SetToken(v+v).
+//		}).
+//		Exec(ctx)
+func (sc *SessionsCreate) OnConflict(opts ...sql.ConflictOption) *SessionsUpsertOne {
+	sc.conflict = opts
+	return &SessionsUpsertOne{
+		create: sc,
+	}
+}
+
+// OnConflictColumns calls `OnConflict` and configures the columns
+// as conflict target. Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//		OnConflict(sql.ConflictColumns(columns...)).
+//		Exec(ctx)
+func (sc *SessionsCreate) OnConflictColumns(columns ...string) *SessionsUpsertOne {
+	sc.conflict = append(sc.conflict, sql.ConflictColumns(columns...))
+	return &SessionsUpsertOne{
+		create: sc,
+	}
+}
+
+type (
+	// SessionsUpsertOne is the builder for "upsert"-ing
+	//  one Sessions node.
+	SessionsUpsertOne struct {
+		create *SessionsCreate
+	}
+
+	// SessionsUpsert is the "OnConflict" setter.
+	SessionsUpsert struct {
+		*sql.UpdateSet
+	}
+)
+
+// SetData sets the "data" field.
+func (u *SessionsUpsert) SetData(v []byte) *SessionsUpsert {
+	u.Set(sessions.FieldData, v)
+	return u
+}
+
+// UpdateData sets the "data" field to the value that was provided on create.
+func (u *SessionsUpsert) UpdateData() *SessionsUpsert {
+	u.SetExcluded(sessions.FieldData)
+	return u
+}
+
+// SetExpiry sets the "expiry" field.
+func (u *SessionsUpsert) SetExpiry(v time.Time) *SessionsUpsert {
+	u.Set(sessions.FieldExpiry, v)
+	return u
+}
+
+// UpdateExpiry sets the "expiry" field to the value that was provided on create.
+func (u *SessionsUpsert) UpdateExpiry() *SessionsUpsert {
+	u.SetExcluded(sessions.FieldExpiry)
+	return u
+}
+
+// UpdateNewValues updates the mutable fields using the new values that were set on create.
+// Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//		OnConflict(
+//			sql.ResolveWithNewValues(),
+//		).
+//		Exec(ctx)
+func (u *SessionsUpsertOne) UpdateNewValues() *SessionsUpsertOne {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWithNewValues())
+	u.create.conflict = append(u.create.conflict, sql.ResolveWith(func(s *sql.UpdateSet) {
+		if _, exists := u.create.mutation.Token(); exists {
+			s.SetIgnore(sessions.FieldToken)
+		}
+	}))
+	return u
+}
+
+// Ignore sets each column to itself in case of conflict.
+// Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//	    OnConflict(sql.ResolveWithIgnore()).
+//	    Exec(ctx)
+func (u *SessionsUpsertOne) Ignore() *SessionsUpsertOne {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWithIgnore())
+	return u
+}
+
+// DoNothing configures the conflict_action to `DO NOTHING`.
+// Supported only by SQLite and PostgreSQL.
+func (u *SessionsUpsertOne) DoNothing() *SessionsUpsertOne {
+	u.create.conflict = append(u.create.conflict, sql.DoNothing())
+	return u
+}
+
+// Update allows overriding fields `UPDATE` values. See the SessionsCreate.OnConflict
+// documentation for more info.
+func (u *SessionsUpsertOne) Update(set func(*SessionsUpsert)) *SessionsUpsertOne {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWith(func(update *sql.UpdateSet) {
+		set(&SessionsUpsert{UpdateSet: update})
+	}))
+	return u
+}
+
+// SetData sets the "data" field.
+func (u *SessionsUpsertOne) SetData(v []byte) *SessionsUpsertOne {
+	return u.Update(func(s *SessionsUpsert) {
+		s.SetData(v)
+	})
+}
+
+// UpdateData sets the "data" field to the value that was provided on create.
+func (u *SessionsUpsertOne) UpdateData() *SessionsUpsertOne {
+	return u.Update(func(s *SessionsUpsert) {
+		s.UpdateData()
+	})
+}
+
+// SetExpiry sets the "expiry" field.
+func (u *SessionsUpsertOne) SetExpiry(v time.Time) *SessionsUpsertOne {
+	return u.Update(func(s *SessionsUpsert) {
+		s.SetExpiry(v)
+	})
+}
+
+// UpdateExpiry sets the "expiry" field to the value that was provided on create.
+func (u *SessionsUpsertOne) UpdateExpiry() *SessionsUpsertOne {
+	return u.Update(func(s *SessionsUpsert) {
+		s.UpdateExpiry()
+	})
+}
+
+// Exec executes the query.
+func (u *SessionsUpsertOne) Exec(ctx context.Context) error {
+	if len(u.create.conflict) == 0 {
+		return errors.New("ent: missing options for SessionsCreate.OnConflict")
+	}
+	return u.create.Exec(ctx)
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (u *SessionsUpsertOne) ExecX(ctx context.Context) {
+	if err := u.create.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
+
+// Exec executes the UPSERT query and returns the inserted/updated ID.
+func (u *SessionsUpsertOne) ID(ctx context.Context) (id int, err error) {
+	node, err := u.create.Save(ctx)
+	if err != nil {
+		return id, err
+	}
+	return node.ID, nil
+}
+
+// IDX is like ID, but panics if an error occurs.
+func (u *SessionsUpsertOne) IDX(ctx context.Context) int {
+	id, err := u.ID(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return id
+}
+
+// SessionsCreateBulk is the builder for creating many Sessions entities in bulk.
+type SessionsCreateBulk struct {
+	config
+	err      error
+	builders []*SessionsCreate
+	conflict []sql.ConflictOption
+}
+
+// Save creates the Sessions entities in the database.
+func (scb *SessionsCreateBulk) Save(ctx context.Context) ([]*Sessions, error) {
+	if scb.err != nil {
+		return nil, scb.err
+	}
+	specs := make([]*sqlgraph.CreateSpec, len(scb.builders))
+	nodes := make([]*Sessions, len(scb.builders))
+	mutators := make([]Mutator, len(scb.builders))
+	for i := range scb.builders {
+		func(i int, root context.Context) {
+			builder := scb.builders[i]
+			var mut Mutator = MutateFunc(func(ctx context.Context, m Mutation) (Value, error) {
+				mutation, ok := m.(*SessionsMutation)
+				if !ok {
+					return nil, fmt.Errorf("unexpected mutation type %T", m)
+				}
+				if err := builder.check(); err != nil {
+					return nil, err
+				}
+				builder.mutation = mutation
+				var err error
+				nodes[i], specs[i] = builder.createSpec()
+				if i < len(mutators)-1 {
+					_, err = mutators[i+1].Mutate(root, scb.builders[i+1].mutation)
+				} else {
+					spec := &sqlgraph.BatchCreateSpec{Nodes: specs}
+					spec.OnConflict = scb.conflict
+					// Invoke the actual operation on the latest mutation in the chain.
+					if err = sqlgraph.BatchCreate(ctx, scb.driver, spec); err != nil {
+						if sqlgraph.IsConstraintError(err) {
+							err = &ConstraintError{msg: err.Error(), wrap: err}
+						}
+					}
+				}
+				if err != nil {
+					return nil, err
+				}
+				mutation.id = &nodes[i].ID
+				if specs[i].ID.Value != nil {
+					id := specs[i].ID.Value.(int64)
+					nodes[i].ID = int(id)
+				}
+				mutation.done = true
+				return nodes[i], nil
+			})
+			for i := len(builder.hooks) - 1; i >= 0; i-- {
+				mut = builder.hooks[i](mut)
+			}
+			mutators[i] = mut
+		}(i, ctx)
+	}
+	if len(mutators) > 0 {
+		if _, err := mutators[0].Mutate(ctx, scb.builders[0].mutation); err != nil {
+			return nil, err
+		}
+	}
+	return nodes, nil
+}
+
+// SaveX is like Save, but panics if an error occurs.
+func (scb *SessionsCreateBulk) SaveX(ctx context.Context) []*Sessions {
+	v, err := scb.Save(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return v
+}
+
+// Exec executes the query.
+func (scb *SessionsCreateBulk) Exec(ctx context.Context) error {
+	_, err := scb.Save(ctx)
+	return err
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (scb *SessionsCreateBulk) ExecX(ctx context.Context) {
+	if err := scb.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
+
+// OnConflict allows configuring the `ON CONFLICT` / `ON DUPLICATE KEY` clause
+// of the `INSERT` statement. For example:
+//
+//	client.Sessions.CreateBulk(builders...).
+//		OnConflict(
+//			// Update the row with the new values
+//			// the was proposed for insertion.
+//			sql.ResolveWithNewValues(),
+//		).
+//		// Override some of the fields with custom
+//		// update values.
+//		Update(func(u *ent.SessionsUpsert) {
+//			SetToken(v+v).
+//		}).
+//		Exec(ctx)
+func (scb *SessionsCreateBulk) OnConflict(opts ...sql.ConflictOption) *SessionsUpsertBulk {
+	scb.conflict = opts
+	return &SessionsUpsertBulk{
+		create: scb,
+	}
+}
+
+// OnConflictColumns calls `OnConflict` and configures the columns
+// as conflict target. Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//		OnConflict(sql.ConflictColumns(columns...)).
+//		Exec(ctx)
+func (scb *SessionsCreateBulk) OnConflictColumns(columns ...string) *SessionsUpsertBulk {
+	scb.conflict = append(scb.conflict, sql.ConflictColumns(columns...))
+	return &SessionsUpsertBulk{
+		create: scb,
+	}
+}
+
+// SessionsUpsertBulk is the builder for "upsert"-ing
+// a bulk of Sessions nodes.
+type SessionsUpsertBulk struct {
+	create *SessionsCreateBulk
+}
+
+// UpdateNewValues updates the mutable fields using the new values that
+// were set on create. Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//		OnConflict(
+//			sql.ResolveWithNewValues(),
+//		).
+//		Exec(ctx)
+func (u *SessionsUpsertBulk) UpdateNewValues() *SessionsUpsertBulk {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWithNewValues())
+	u.create.conflict = append(u.create.conflict, sql.ResolveWith(func(s *sql.UpdateSet) {
+		for _, b := range u.create.builders {
+			if _, exists := b.mutation.Token(); exists {
+				s.SetIgnore(sessions.FieldToken)
+			}
+		}
+	}))
+	return u
+}
+
+// Ignore sets each column to itself in case of conflict.
+// Using this option is equivalent to using:
+//
+//	client.Sessions.Create().
+//		OnConflict(sql.ResolveWithIgnore()).
+//		Exec(ctx)
+func (u *SessionsUpsertBulk) Ignore() *SessionsUpsertBulk {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWithIgnore())
+	return u
+}
+
+// DoNothing configures the conflict_action to `DO NOTHING`.
+// Supported only by SQLite and PostgreSQL.
+func (u *SessionsUpsertBulk) DoNothing() *SessionsUpsertBulk {
+	u.create.conflict = append(u.create.conflict, sql.DoNothing())
+	return u
+}
+
+// Update allows overriding fields `UPDATE` values. See the SessionsCreateBulk.OnConflict
+// documentation for more info.
+func (u *SessionsUpsertBulk) Update(set func(*SessionsUpsert)) *SessionsUpsertBulk {
+	u.create.conflict = append(u.create.conflict, sql.ResolveWith(func(update *sql.UpdateSet) {
+		set(&SessionsUpsert{UpdateSet: update})
+	}))
+	return u
+}
+
+// SetData sets the "data" field.
+func (u *SessionsUpsertBulk) SetData(v []byte) *SessionsUpsertBulk {
+	return u.Update(func(s *SessionsUpsert) {
+		s.SetData(v)
+	})
+}
+
+// UpdateData sets the "data" field to the value that was provided on create.
+func (u *SessionsUpsertBulk) UpdateData() *SessionsUpsertBulk {
+	return u.Update(func(s *SessionsUpsert) {
+		s.UpdateData()
+	})
+}
+
+// SetExpiry sets the "expiry" field.
+func (u *SessionsUpsertBulk) SetExpiry(v time.Time) *SessionsUpsertBulk {
+	return u.Update(func(s *SessionsUpsert) {
+		s.SetExpiry(v)
+	})
+}
+
+// UpdateExpiry sets the "expiry" field to the value that was provided on create.
+func (u *SessionsUpsertBulk) UpdateExpiry() *SessionsUpsertBulk {
+	return u.Update(func(s *SessionsUpsert) {
+		s.UpdateExpiry()
+	})
+}
+
+// Exec executes the query.
+func (u *SessionsUpsertBulk) Exec(ctx context.Context) error {
+	if u.create.err != nil {
+		return u.create.err
+	}
+	for i, b := range u.create.builders {
+		if len(b.conflict) != 0 {
+			return fmt.Errorf("ent: OnConflict was set for builder %d. Set it on the SessionsCreateBulk instead", i)
+		}
+	}
+	if len(u.create.conflict) == 0 {
+		return errors.New("ent: missing options for SessionsCreateBulk.OnConflict")
+	}
+	return u.create.Exec(ctx)
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (u *SessionsUpsertBulk) ExecX(ctx context.Context) {
+	if err := u.create.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
diff --git a/ent/sessions_delete.go b/ent/sessions_delete.go
new file mode 100644
index 00000000..98dde758
--- /dev/null
+++ b/ent/sessions_delete.go
@@ -0,0 +1,88 @@
+// Code generated by ent, DO NOT EDIT.
+
+package ent
+
+import (
+	"context"
+
+	"entgo.io/ent/dialect/sql"
+	"entgo.io/ent/dialect/sql/sqlgraph"
+	"entgo.io/ent/schema/field"
+	"github.com/zibbp/ganymede/ent/predicate"
+	"github.com/zibbp/ganymede/ent/sessions"
+)
+
+// SessionsDelete is the builder for deleting a Sessions entity.
+type SessionsDelete struct {
+	config
+	hooks    []Hook
+	mutation *SessionsMutation
+}
+
+// Where appends a list predicates to the SessionsDelete builder.
+func (sd *SessionsDelete) Where(ps ...predicate.Sessions) *SessionsDelete {
+	sd.mutation.Where(ps...)
+	return sd
+}
+
+// Exec executes the deletion query and returns how many vertices were deleted.
+func (sd *SessionsDelete) Exec(ctx context.Context) (int, error) {
+	return withHooks(ctx, sd.sqlExec, sd.mutation, sd.hooks)
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (sd *SessionsDelete) ExecX(ctx context.Context) int {
+	n, err := sd.Exec(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return n
+}
+
+func (sd *SessionsDelete) sqlExec(ctx context.Context) (int, error) {
+	_spec := sqlgraph.NewDeleteSpec(sessions.Table, sqlgraph.NewFieldSpec(sessions.FieldID, field.TypeInt))
+	if ps := sd.mutation.predicates; len(ps) > 0 {
+		_spec.Predicate = func(selector *sql.Selector) {
+			for i := range ps {
+				ps[i](selector)
+			}
+		}
+	}
+	affected, err := sqlgraph.DeleteNodes(ctx, sd.driver, _spec)
+	if err != nil && sqlgraph.IsConstraintError(err) {
+		err = &ConstraintError{msg: err.Error(), wrap: err}
+	}
+	sd.mutation.done = true
+	return affected, err
+}
+
+// SessionsDeleteOne is the builder for deleting a single Sessions entity.
+type SessionsDeleteOne struct {
+	sd *SessionsDelete
+}
+
+// Where appends a list predicates to the SessionsDelete builder.
+func (sdo *SessionsDeleteOne) Where(ps ...predicate.Sessions) *SessionsDeleteOne {
+	sdo.sd.mutation.Where(ps...)
+	return sdo
+}
+
+// Exec executes the deletion query.
+func (sdo *SessionsDeleteOne) Exec(ctx context.Context) error {
+	n, err := sdo.sd.Exec(ctx)
+	switch {
+	case err != nil:
+		return err
+	case n == 0:
+		return &NotFoundError{sessions.Label}
+	default:
+		return nil
+	}
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (sdo *SessionsDeleteOne) ExecX(ctx context.Context) {
+	if err := sdo.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
diff --git a/ent/sessions_query.go b/ent/sessions_query.go
new file mode 100644
index 00000000..7e904227
--- /dev/null
+++ b/ent/sessions_query.go
@@ -0,0 +1,526 @@
+// Code generated by ent, DO NOT EDIT.
+
+package ent
+
+import (
+	"context"
+	"fmt"
+	"math"
+
+	"entgo.io/ent/dialect/sql"
+	"entgo.io/ent/dialect/sql/sqlgraph"
+	"entgo.io/ent/schema/field"
+	"github.com/zibbp/ganymede/ent/predicate"
+	"github.com/zibbp/ganymede/ent/sessions"
+)
+
+// SessionsQuery is the builder for querying Sessions entities.
+type SessionsQuery struct {
+	config
+	ctx        *QueryContext
+	order      []sessions.OrderOption
+	inters     []Interceptor
+	predicates []predicate.Sessions
+	// intermediate query (i.e. traversal path).
+	sql  *sql.Selector
+	path func(context.Context) (*sql.Selector, error)
+}
+
+// Where adds a new predicate for the SessionsQuery builder.
+func (sq *SessionsQuery) Where(ps ...predicate.Sessions) *SessionsQuery {
+	sq.predicates = append(sq.predicates, ps...)
+	return sq
+}
+
+// Limit the number of records to be returned by this query.
+func (sq *SessionsQuery) Limit(limit int) *SessionsQuery {
+	sq.ctx.Limit = &limit
+	return sq
+}
+
+// Offset to start from.
+func (sq *SessionsQuery) Offset(offset int) *SessionsQuery {
+	sq.ctx.Offset = &offset
+	return sq
+}
+
+// Unique configures the query builder to filter duplicate records on query.
+// By default, unique is set to true, and can be disabled using this method.
+func (sq *SessionsQuery) Unique(unique bool) *SessionsQuery {
+	sq.ctx.Unique = &unique
+	return sq
+}
+
+// Order specifies how the records should be ordered.
+func (sq *SessionsQuery) Order(o ...sessions.OrderOption) *SessionsQuery {
+	sq.order = append(sq.order, o...)
+	return sq
+}
+
+// First returns the first Sessions entity from the query.
+// Returns a *NotFoundError when no Sessions was found.
+func (sq *SessionsQuery) First(ctx context.Context) (*Sessions, error) {
+	nodes, err := sq.Limit(1).All(setContextOp(ctx, sq.ctx, "First"))
+	if err != nil {
+		return nil, err
+	}
+	if len(nodes) == 0 {
+		return nil, &NotFoundError{sessions.Label}
+	}
+	return nodes[0], nil
+}
+
+// FirstX is like First, but panics if an error occurs.
+func (sq *SessionsQuery) FirstX(ctx context.Context) *Sessions {
+	node, err := sq.First(ctx)
+	if err != nil && !IsNotFound(err) {
+		panic(err)
+	}
+	return node
+}
+
+// FirstID returns the first Sessions ID from the query.
+// Returns a *NotFoundError when no Sessions ID was found.
+func (sq *SessionsQuery) FirstID(ctx context.Context) (id int, err error) {
+	var ids []int
+	if ids, err = sq.Limit(1).IDs(setContextOp(ctx, sq.ctx, "FirstID")); err != nil {
+		return
+	}
+	if len(ids) == 0 {
+		err = &NotFoundError{sessions.Label}
+		return
+	}
+	return ids[0], nil
+}
+
+// FirstIDX is like FirstID, but panics if an error occurs.
+func (sq *SessionsQuery) FirstIDX(ctx context.Context) int {
+	id, err := sq.FirstID(ctx)
+	if err != nil && !IsNotFound(err) {
+		panic(err)
+	}
+	return id
+}
+
+// Only returns a single Sessions entity found by the query, ensuring it only returns one.
+// Returns a *NotSingularError when more than one Sessions entity is found.
+// Returns a *NotFoundError when no Sessions entities are found.
+func (sq *SessionsQuery) Only(ctx context.Context) (*Sessions, error) {
+	nodes, err := sq.Limit(2).All(setContextOp(ctx, sq.ctx, "Only"))
+	if err != nil {
+		return nil, err
+	}
+	switch len(nodes) {
+	case 1:
+		return nodes[0], nil
+	case 0:
+		return nil, &NotFoundError{sessions.Label}
+	default:
+		return nil, &NotSingularError{sessions.Label}
+	}
+}
+
+// OnlyX is like Only, but panics if an error occurs.
+func (sq *SessionsQuery) OnlyX(ctx context.Context) *Sessions {
+	node, err := sq.Only(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return node
+}
+
+// OnlyID is like Only, but returns the only Sessions ID in the query.
+// Returns a *NotSingularError when more than one Sessions ID is found.
+// Returns a *NotFoundError when no entities are found.
+func (sq *SessionsQuery) OnlyID(ctx context.Context) (id int, err error) {
+	var ids []int
+	if ids, err = sq.Limit(2).IDs(setContextOp(ctx, sq.ctx, "OnlyID")); err != nil {
+		return
+	}
+	switch len(ids) {
+	case 1:
+		id = ids[0]
+	case 0:
+		err = &NotFoundError{sessions.Label}
+	default:
+		err = &NotSingularError{sessions.Label}
+	}
+	return
+}
+
+// OnlyIDX is like OnlyID, but panics if an error occurs.
+func (sq *SessionsQuery) OnlyIDX(ctx context.Context) int {
+	id, err := sq.OnlyID(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return id
+}
+
+// All executes the query and returns a list of SessionsSlice.
+func (sq *SessionsQuery) All(ctx context.Context) ([]*Sessions, error) {
+	ctx = setContextOp(ctx, sq.ctx, "All")
+	if err := sq.prepareQuery(ctx); err != nil {
+		return nil, err
+	}
+	qr := querierAll[[]*Sessions, *SessionsQuery]()
+	return withInterceptors[[]*Sessions](ctx, sq, qr, sq.inters)
+}
+
+// AllX is like All, but panics if an error occurs.
+func (sq *SessionsQuery) AllX(ctx context.Context) []*Sessions {
+	nodes, err := sq.All(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return nodes
+}
+
+// IDs executes the query and returns a list of Sessions IDs.
+func (sq *SessionsQuery) IDs(ctx context.Context) (ids []int, err error) {
+	if sq.ctx.Unique == nil && sq.path != nil {
+		sq.Unique(true)
+	}
+	ctx = setContextOp(ctx, sq.ctx, "IDs")
+	if err = sq.Select(sessions.FieldID).Scan(ctx, &ids); err != nil {
+		return nil, err
+	}
+	return ids, nil
+}
+
+// IDsX is like IDs, but panics if an error occurs.
+func (sq *SessionsQuery) IDsX(ctx context.Context) []int {
+	ids, err := sq.IDs(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return ids
+}
+
+// Count returns the count of the given query.
+func (sq *SessionsQuery) Count(ctx context.Context) (int, error) {
+	ctx = setContextOp(ctx, sq.ctx, "Count")
+	if err := sq.prepareQuery(ctx); err != nil {
+		return 0, err
+	}
+	return withInterceptors[int](ctx, sq, querierCount[*SessionsQuery](), sq.inters)
+}
+
+// CountX is like Count, but panics if an error occurs.
+func (sq *SessionsQuery) CountX(ctx context.Context) int {
+	count, err := sq.Count(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return count
+}
+
+// Exist returns true if the query has elements in the graph.
+func (sq *SessionsQuery) Exist(ctx context.Context) (bool, error) {
+	ctx = setContextOp(ctx, sq.ctx, "Exist")
+	switch _, err := sq.FirstID(ctx); {
+	case IsNotFound(err):
+		return false, nil
+	case err != nil:
+		return false, fmt.Errorf("ent: check existence: %w", err)
+	default:
+		return true, nil
+	}
+}
+
+// ExistX is like Exist, but panics if an error occurs.
+func (sq *SessionsQuery) ExistX(ctx context.Context) bool {
+	exist, err := sq.Exist(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return exist
+}
+
+// Clone returns a duplicate of the SessionsQuery builder, including all associated steps. It can be
+// used to prepare common query builders and use them differently after the clone is made.
+func (sq *SessionsQuery) Clone() *SessionsQuery {
+	if sq == nil {
+		return nil
+	}
+	return &SessionsQuery{
+		config:     sq.config,
+		ctx:        sq.ctx.Clone(),
+		order:      append([]sessions.OrderOption{}, sq.order...),
+		inters:     append([]Interceptor{}, sq.inters...),
+		predicates: append([]predicate.Sessions{}, sq.predicates...),
+		// clone intermediate query.
+		sql:  sq.sql.Clone(),
+		path: sq.path,
+	}
+}
+
+// GroupBy is used to group vertices by one or more fields/columns.
+// It is often used with aggregate functions, like: count, max, mean, min, sum.
+//
+// Example:
+//
+//	var v []struct {
+//		Token string `json:"token,omitempty"`
+//		Count int `json:"count,omitempty"`
+//	}
+//
+//	client.Sessions.Query().
+//		GroupBy(sessions.FieldToken).
+//		Aggregate(ent.Count()).
+//		Scan(ctx, &v)
+func (sq *SessionsQuery) GroupBy(field string, fields ...string) *SessionsGroupBy {
+	sq.ctx.Fields = append([]string{field}, fields...)
+	grbuild := &SessionsGroupBy{build: sq}
+	grbuild.flds = &sq.ctx.Fields
+	grbuild.label = sessions.Label
+	grbuild.scan = grbuild.Scan
+	return grbuild
+}
+
+// Select allows the selection one or more fields/columns for the given query,
+// instead of selecting all fields in the entity.
+//
+// Example:
+//
+//	var v []struct {
+//		Token string `json:"token,omitempty"`
+//	}
+//
+//	client.Sessions.Query().
+//		Select(sessions.FieldToken).
+//		Scan(ctx, &v)
+func (sq *SessionsQuery) Select(fields ...string) *SessionsSelect {
+	sq.ctx.Fields = append(sq.ctx.Fields, fields...)
+	sbuild := &SessionsSelect{SessionsQuery: sq}
+	sbuild.label = sessions.Label
+	sbuild.flds, sbuild.scan = &sq.ctx.Fields, sbuild.Scan
+	return sbuild
+}
+
+// Aggregate returns a SessionsSelect configured with the given aggregations.
+func (sq *SessionsQuery) Aggregate(fns ...AggregateFunc) *SessionsSelect {
+	return sq.Select().Aggregate(fns...)
+}
+
+func (sq *SessionsQuery) prepareQuery(ctx context.Context) error {
+	for _, inter := range sq.inters {
+		if inter == nil {
+			return fmt.Errorf("ent: uninitialized interceptor (forgotten import ent/runtime?)")
+		}
+		if trv, ok := inter.(Traverser); ok {
+			if err := trv.Traverse(ctx, sq); err != nil {
+				return err
+			}
+		}
+	}
+	for _, f := range sq.ctx.Fields {
+		if !sessions.ValidColumn(f) {
+			return &ValidationError{Name: f, err: fmt.Errorf("ent: invalid field %q for query", f)}
+		}
+	}
+	if sq.path != nil {
+		prev, err := sq.path(ctx)
+		if err != nil {
+			return err
+		}
+		sq.sql = prev
+	}
+	return nil
+}
+
+func (sq *SessionsQuery) sqlAll(ctx context.Context, hooks ...queryHook) ([]*Sessions, error) {
+	var (
+		nodes = []*Sessions{}
+		_spec = sq.querySpec()
+	)
+	_spec.ScanValues = func(columns []string) ([]any, error) {
+		return (*Sessions).scanValues(nil, columns)
+	}
+	_spec.Assign = func(columns []string, values []any) error {
+		node := &Sessions{config: sq.config}
+		nodes = append(nodes, node)
+		return node.assignValues(columns, values)
+	}
+	for i := range hooks {
+		hooks[i](ctx, _spec)
+	}
+	if err := sqlgraph.QueryNodes(ctx, sq.driver, _spec); err != nil {
+		return nil, err
+	}
+	if len(nodes) == 0 {
+		return nodes, nil
+	}
+	return nodes, nil
+}
+
+func (sq *SessionsQuery) sqlCount(ctx context.Context) (int, error) {
+	_spec := sq.querySpec()
+	_spec.Node.Columns = sq.ctx.Fields
+	if len(sq.ctx.Fields) > 0 {
+		_spec.Unique = sq.ctx.Unique != nil && *sq.ctx.Unique
+	}
+	return sqlgraph.CountNodes(ctx, sq.driver, _spec)
+}
+
+func (sq *SessionsQuery) querySpec() *sqlgraph.QuerySpec {
+	_spec := sqlgraph.NewQuerySpec(sessions.Table, sessions.Columns, sqlgraph.NewFieldSpec(sessions.FieldID, field.TypeInt))
+	_spec.From = sq.sql
+	if unique := sq.ctx.Unique; unique != nil {
+		_spec.Unique = *unique
+	} else if sq.path != nil {
+		_spec.Unique = true
+	}
+	if fields := sq.ctx.Fields; len(fields) > 0 {
+		_spec.Node.Columns = make([]string, 0, len(fields))
+		_spec.Node.Columns = append(_spec.Node.Columns, sessions.FieldID)
+		for i := range fields {
+			if fields[i] != sessions.FieldID {
+				_spec.Node.Columns = append(_spec.Node.Columns, fields[i])
+			}
+		}
+	}
+	if ps := sq.predicates; len(ps) > 0 {
+		_spec.Predicate = func(selector *sql.Selector) {
+			for i := range ps {
+				ps[i](selector)
+			}
+		}
+	}
+	if limit := sq.ctx.Limit; limit != nil {
+		_spec.Limit = *limit
+	}
+	if offset := sq.ctx.Offset; offset != nil {
+		_spec.Offset = *offset
+	}
+	if ps := sq.order; len(ps) > 0 {
+		_spec.Order = func(selector *sql.Selector) {
+			for i := range ps {
+				ps[i](selector)
+			}
+		}
+	}
+	return _spec
+}
+
+func (sq *SessionsQuery) sqlQuery(ctx context.Context) *sql.Selector {
+	builder := sql.Dialect(sq.driver.Dialect())
+	t1 := builder.Table(sessions.Table)
+	columns := sq.ctx.Fields
+	if len(columns) == 0 {
+		columns = sessions.Columns
+	}
+	selector := builder.Select(t1.Columns(columns...)...).From(t1)
+	if sq.sql != nil {
+		selector = sq.sql
+		selector.Select(selector.Columns(columns...)...)
+	}
+	if sq.ctx.Unique != nil && *sq.ctx.Unique {
+		selector.Distinct()
+	}
+	for _, p := range sq.predicates {
+		p(selector)
+	}
+	for _, p := range sq.order {
+		p(selector)
+	}
+	if offset := sq.ctx.Offset; offset != nil {
+		// limit is mandatory for offset clause. We start
+		// with default value, and override it below if needed.
+		selector.Offset(*offset).Limit(math.MaxInt32)
+	}
+	if limit := sq.ctx.Limit; limit != nil {
+		selector.Limit(*limit)
+	}
+	return selector
+}
+
+// SessionsGroupBy is the group-by builder for Sessions entities.
+type SessionsGroupBy struct {
+	selector
+	build *SessionsQuery
+}
+
+// Aggregate adds the given aggregation functions to the group-by query.
+func (sgb *SessionsGroupBy) Aggregate(fns ...AggregateFunc) *SessionsGroupBy {
+	sgb.fns = append(sgb.fns, fns...)
+	return sgb
+}
+
+// Scan applies the selector query and scans the result into the given value.
+func (sgb *SessionsGroupBy) Scan(ctx context.Context, v any) error {
+	ctx = setContextOp(ctx, sgb.build.ctx, "GroupBy")
+	if err := sgb.build.prepareQuery(ctx); err != nil {
+		return err
+	}
+	return scanWithInterceptors[*SessionsQuery, *SessionsGroupBy](ctx, sgb.build, sgb, sgb.build.inters, v)
+}
+
+func (sgb *SessionsGroupBy) sqlScan(ctx context.Context, root *SessionsQuery, v any) error {
+	selector := root.sqlQuery(ctx).Select()
+	aggregation := make([]string, 0, len(sgb.fns))
+	for _, fn := range sgb.fns {
+		aggregation = append(aggregation, fn(selector))
+	}
+	if len(selector.SelectedColumns()) == 0 {
+		columns := make([]string, 0, len(*sgb.flds)+len(sgb.fns))
+		for _, f := range *sgb.flds {
+			columns = append(columns, selector.C(f))
+		}
+		columns = append(columns, aggregation...)
+		selector.Select(columns...)
+	}
+	selector.GroupBy(selector.Columns(*sgb.flds...)...)
+	if err := selector.Err(); err != nil {
+		return err
+	}
+	rows := &sql.Rows{}
+	query, args := selector.Query()
+	if err := sgb.build.driver.Query(ctx, query, args, rows); err != nil {
+		return err
+	}
+	defer rows.Close()
+	return sql.ScanSlice(rows, v)
+}
+
+// SessionsSelect is the builder for selecting fields of Sessions entities.
+type SessionsSelect struct {
+	*SessionsQuery
+	selector
+}
+
+// Aggregate adds the given aggregation functions to the selector query.
+func (ss *SessionsSelect) Aggregate(fns ...AggregateFunc) *SessionsSelect {
+	ss.fns = append(ss.fns, fns...)
+	return ss
+}
+
+// Scan applies the selector query and scans the result into the given value.
+func (ss *SessionsSelect) Scan(ctx context.Context, v any) error {
+	ctx = setContextOp(ctx, ss.ctx, "Select")
+	if err := ss.prepareQuery(ctx); err != nil {
+		return err
+	}
+	return scanWithInterceptors[*SessionsQuery, *SessionsSelect](ctx, ss.SessionsQuery, ss, ss.inters, v)
+}
+
+func (ss *SessionsSelect) sqlScan(ctx context.Context, root *SessionsQuery, v any) error {
+	selector := root.sqlQuery(ctx)
+	aggregation := make([]string, 0, len(ss.fns))
+	for _, fn := range ss.fns {
+		aggregation = append(aggregation, fn(selector))
+	}
+	switch n := len(*ss.selector.flds); {
+	case n == 0 && len(aggregation) > 0:
+		selector.Select(aggregation...)
+	case n != 0 && len(aggregation) > 0:
+		selector.AppendSelect(aggregation...)
+	}
+	rows := &sql.Rows{}
+	query, args := selector.Query()
+	if err := ss.driver.Query(ctx, query, args, rows); err != nil {
+		return err
+	}
+	defer rows.Close()
+	return sql.ScanSlice(rows, v)
+}
diff --git a/ent/sessions_update.go b/ent/sessions_update.go
new file mode 100644
index 00000000..08e7652d
--- /dev/null
+++ b/ent/sessions_update.go
@@ -0,0 +1,254 @@
+// Code generated by ent, DO NOT EDIT.
+
+package ent
+
+import (
+	"context"
+	"errors"
+	"fmt"
+	"time"
+
+	"entgo.io/ent/dialect/sql"
+	"entgo.io/ent/dialect/sql/sqlgraph"
+	"entgo.io/ent/schema/field"
+	"github.com/zibbp/ganymede/ent/predicate"
+	"github.com/zibbp/ganymede/ent/sessions"
+)
+
+// SessionsUpdate is the builder for updating Sessions entities.
+type SessionsUpdate struct {
+	config
+	hooks    []Hook
+	mutation *SessionsMutation
+}
+
+// Where appends a list predicates to the SessionsUpdate builder.
+func (su *SessionsUpdate) Where(ps ...predicate.Sessions) *SessionsUpdate {
+	su.mutation.Where(ps...)
+	return su
+}
+
+// SetData sets the "data" field.
+func (su *SessionsUpdate) SetData(b []byte) *SessionsUpdate {
+	su.mutation.SetData(b)
+	return su
+}
+
+// SetExpiry sets the "expiry" field.
+func (su *SessionsUpdate) SetExpiry(t time.Time) *SessionsUpdate {
+	su.mutation.SetExpiry(t)
+	return su
+}
+
+// SetNillableExpiry sets the "expiry" field if the given value is not nil.
+func (su *SessionsUpdate) SetNillableExpiry(t *time.Time) *SessionsUpdate {
+	if t != nil {
+		su.SetExpiry(*t)
+	}
+	return su
+}
+
+// Mutation returns the SessionsMutation object of the builder.
+func (su *SessionsUpdate) Mutation() *SessionsMutation {
+	return su.mutation
+}
+
+// Save executes the query and returns the number of nodes affected by the update operation.
+func (su *SessionsUpdate) Save(ctx context.Context) (int, error) {
+	return withHooks(ctx, su.sqlSave, su.mutation, su.hooks)
+}
+
+// SaveX is like Save, but panics if an error occurs.
+func (su *SessionsUpdate) SaveX(ctx context.Context) int {
+	affected, err := su.Save(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return affected
+}
+
+// Exec executes the query.
+func (su *SessionsUpdate) Exec(ctx context.Context) error {
+	_, err := su.Save(ctx)
+	return err
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (su *SessionsUpdate) ExecX(ctx context.Context) {
+	if err := su.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
+
+// check runs all checks and user-defined validators on the builder.
+func (su *SessionsUpdate) check() error {
+	if v, ok := su.mutation.Data(); ok {
+		if err := sessions.DataValidator(v); err != nil {
+			return &ValidationError{Name: "data", err: fmt.Errorf(`ent: validator failed for field "Sessions.data": %w`, err)}
+		}
+	}
+	return nil
+}
+
+func (su *SessionsUpdate) sqlSave(ctx context.Context) (n int, err error) {
+	if err := su.check(); err != nil {
+		return n, err
+	}
+	_spec := sqlgraph.NewUpdateSpec(sessions.Table, sessions.Columns, sqlgraph.NewFieldSpec(sessions.FieldID, field.TypeInt))
+	if ps := su.mutation.predicates; len(ps) > 0 {
+		_spec.Predicate = func(selector *sql.Selector) {
+			for i := range ps {
+				ps[i](selector)
+			}
+		}
+	}
+	if value, ok := su.mutation.Data(); ok {
+		_spec.SetField(sessions.FieldData, field.TypeBytes, value)
+	}
+	if value, ok := su.mutation.Expiry(); ok {
+		_spec.SetField(sessions.FieldExpiry, field.TypeTime, value)
+	}
+	if n, err = sqlgraph.UpdateNodes(ctx, su.driver, _spec); err != nil {
+		if _, ok := err.(*sqlgraph.NotFoundError); ok {
+			err = &NotFoundError{sessions.Label}
+		} else if sqlgraph.IsConstraintError(err) {
+			err = &ConstraintError{msg: err.Error(), wrap: err}
+		}
+		return 0, err
+	}
+	su.mutation.done = true
+	return n, nil
+}
+
+// SessionsUpdateOne is the builder for updating a single Sessions entity.
+type SessionsUpdateOne struct {
+	config
+	fields   []string
+	hooks    []Hook
+	mutation *SessionsMutation
+}
+
+// SetData sets the "data" field.
+func (suo *SessionsUpdateOne) SetData(b []byte) *SessionsUpdateOne {
+	suo.mutation.SetData(b)
+	return suo
+}
+
+// SetExpiry sets the "expiry" field.
+func (suo *SessionsUpdateOne) SetExpiry(t time.Time) *SessionsUpdateOne {
+	suo.mutation.SetExpiry(t)
+	return suo
+}
+
+// SetNillableExpiry sets the "expiry" field if the given value is not nil.
+func (suo *SessionsUpdateOne) SetNillableExpiry(t *time.Time) *SessionsUpdateOne {
+	if t != nil {
+		suo.SetExpiry(*t)
+	}
+	return suo
+}
+
+// Mutation returns the SessionsMutation object of the builder.
+func (suo *SessionsUpdateOne) Mutation() *SessionsMutation {
+	return suo.mutation
+}
+
+// Where appends a list predicates to the SessionsUpdate builder.
+func (suo *SessionsUpdateOne) Where(ps ...predicate.Sessions) *SessionsUpdateOne {
+	suo.mutation.Where(ps...)
+	return suo
+}
+
+// Select allows selecting one or more fields (columns) of the returned entity.
+// The default is selecting all fields defined in the entity schema.
+func (suo *SessionsUpdateOne) Select(field string, fields ...string) *SessionsUpdateOne {
+	suo.fields = append([]string{field}, fields...)
+	return suo
+}
+
+// Save executes the query and returns the updated Sessions entity.
+func (suo *SessionsUpdateOne) Save(ctx context.Context) (*Sessions, error) {
+	return withHooks(ctx, suo.sqlSave, suo.mutation, suo.hooks)
+}
+
+// SaveX is like Save, but panics if an error occurs.
+func (suo *SessionsUpdateOne) SaveX(ctx context.Context) *Sessions {
+	node, err := suo.Save(ctx)
+	if err != nil {
+		panic(err)
+	}
+	return node
+}
+
+// Exec executes the query on the entity.
+func (suo *SessionsUpdateOne) Exec(ctx context.Context) error {
+	_, err := suo.Save(ctx)
+	return err
+}
+
+// ExecX is like Exec, but panics if an error occurs.
+func (suo *SessionsUpdateOne) ExecX(ctx context.Context) {
+	if err := suo.Exec(ctx); err != nil {
+		panic(err)
+	}
+}
+
+// check runs all checks and user-defined validators on the builder.
+func (suo *SessionsUpdateOne) check() error {
+	if v, ok := suo.mutation.Data(); ok {
+		if err := sessions.DataValidator(v); err != nil {
+			return &ValidationError{Name: "data", err: fmt.Errorf(`ent: validator failed for field "Sessions.data": %w`, err)}
+		}
+	}
+	return nil
+}
+
+func (suo *SessionsUpdateOne) sqlSave(ctx context.Context) (_node *Sessions, err error) {
+	if err := suo.check(); err != nil {
+		return _node, err
+	}
+	_spec := sqlgraph.NewUpdateSpec(sessions.Table, sessions.Columns, sqlgraph.NewFieldSpec(sessions.FieldID, field.TypeInt))
+	id, ok := suo.mutation.ID()
+	if !ok {
+		return nil, &ValidationError{Name: "id", err: errors.New(`ent: missing "Sessions.id" for update`)}
+	}
+	_spec.Node.ID.Value = id
+	if fields := suo.fields; len(fields) > 0 {
+		_spec.Node.Columns = make([]string, 0, len(fields))
+		_spec.Node.Columns = append(_spec.Node.Columns, sessions.FieldID)
+		for _, f := range fields {
+			if !sessions.ValidColumn(f) {
+				return nil, &ValidationError{Name: f, err: fmt.Errorf("ent: invalid field %q for query", f)}
+			}
+			if f != sessions.FieldID {
+				_spec.Node.Columns = append(_spec.Node.Columns, f)
+			}
+		}
+	}
+	if ps := suo.mutation.predicates; len(ps) > 0 {
+		_spec.Predicate = func(selector *sql.Selector) {
+			for i := range ps {
+				ps[i](selector)
+			}
+		}
+	}
+	if value, ok := suo.mutation.Data(); ok {
+		_spec.SetField(sessions.FieldData, field.TypeBytes, value)
+	}
+	if value, ok := suo.mutation.Expiry(); ok {
+		_spec.SetField(sessions.FieldExpiry, field.TypeTime, value)
+	}
+	_node = &Sessions{config: suo.config}
+	_spec.Assign = _node.assignValues
+	_spec.ScanValues = _node.scanValues
+	if err = sqlgraph.UpdateNode(ctx, suo.driver, _spec); err != nil {
+		if _, ok := err.(*sqlgraph.NotFoundError); ok {
+			err = &NotFoundError{sessions.Label}
+		} else if sqlgraph.IsConstraintError(err) {
+			err = &ConstraintError{msg: err.Error(), wrap: err}
+		}
+		return nil, err
+	}
+	suo.mutation.done = true
+	return _node, nil
+}
diff --git a/ent/tx.go b/ent/tx.go
index 0456ac0d..454bb269 100644
--- a/ent/tx.go
+++ b/ent/tx.go
@@ -34,6 +34,8 @@ type Tx struct {
 	Playlist *PlaylistClient
 	// Queue is the client for interacting with the Queue builders.
 	Queue *QueueClient
+	// Sessions is the client for interacting with the Sessions builders.
+	Sessions *SessionsClient
 	// TwitchCategory is the client for interacting with the TwitchCategory builders.
 	TwitchCategory *TwitchCategoryClient
 	// User is the client for interacting with the User builders.
@@ -182,6 +184,7 @@ func (tx *Tx) init() {
 	tx.Playback = NewPlaybackClient(tx.config)
 	tx.Playlist = NewPlaylistClient(tx.config)
 	tx.Queue = NewQueueClient(tx.config)
+	tx.Sessions = NewSessionsClient(tx.config)
 	tx.TwitchCategory = NewTwitchCategoryClient(tx.config)
 	tx.User = NewUserClient(tx.config)
 	tx.Vod = NewVodClient(tx.config)
diff --git a/ent/vod.go b/ent/vod.go
index 34acb2de..b747bf8c 100644
--- a/ent/vod.go
+++ b/ent/vod.go
@@ -3,6 +3,7 @@
 package ent
 
 import (
+	"encoding/json"
 	"fmt"
 	"strings"
 	"time"
@@ -23,6 +24,8 @@ type Vod struct {
 	ID uuid.UUID `json:"id,omitempty"`
 	// The ID of the video on the external platform.
 	ExtID string `json:"ext_id,omitempty"`
+	// The external VOD ID of a clip. This is only populated if the clip is linked to a video.
+	ClipExtVodID string `json:"clip_ext_vod_id,omitempty"`
 	// The ID of the stream on the external platform, if applicable.
 	ExtStreamID string `json:"ext_stream_id,omitempty"`
 	// The platform the VOD is from, takes an enum.
@@ -33,6 +36,8 @@ type Vod struct {
 	Title string `json:"title,omitempty"`
 	// Duration holds the value of the "duration" field.
 	Duration int `json:"duration,omitempty"`
+	// The offset in seconds to where the clip starts in the VOD. This is only populdated if the video is a clip.
+	ClipVodOffset int `json:"clip_vod_offset,omitempty"`
 	// Views holds the value of the "views" field.
 	Views int `json:"views,omitempty"`
 	// Resolution holds the value of the "resolution" field.
@@ -81,6 +86,20 @@ type Vod struct {
 	Locked bool `json:"locked,omitempty"`
 	// LocalViews holds the value of the "local_views" field.
 	LocalViews int `json:"local_views,omitempty"`
+	// SpriteThumbnailsEnabled holds the value of the "sprite_thumbnails_enabled" field.
+	SpriteThumbnailsEnabled bool `json:"sprite_thumbnails_enabled,omitempty"`
+	// SpriteThumbnailsImages holds the value of the "sprite_thumbnails_images" field.
+	SpriteThumbnailsImages []string `json:"sprite_thumbnails_images,omitempty"`
+	// SpriteThumbnailsInterval holds the value of the "sprite_thumbnails_interval" field.
+	SpriteThumbnailsInterval int `json:"sprite_thumbnails_interval,omitempty"`
+	// SpriteThumbnailsWidth holds the value of the "sprite_thumbnails_width" field.
+	SpriteThumbnailsWidth int `json:"sprite_thumbnails_width,omitempty"`
+	// SpriteThumbnailsHeight holds the value of the "sprite_thumbnails_height" field.
+	SpriteThumbnailsHeight int `json:"sprite_thumbnails_height,omitempty"`
+	// SpriteThumbnailsRows holds the value of the "sprite_thumbnails_rows" field.
+	SpriteThumbnailsRows int `json:"sprite_thumbnails_rows,omitempty"`
+	// SpriteThumbnailsColumns holds the value of the "sprite_thumbnails_columns" field.
+	SpriteThumbnailsColumns int `json:"sprite_thumbnails_columns,omitempty"`
 	// The time the VOD was streamed.
 	StreamedAt time.Time `json:"streamed_at,omitempty"`
 	// UpdatedAt holds the value of the "updated_at" field.
@@ -176,11 +195,13 @@ func (*Vod) scanValues(columns []string) ([]any, error) {
 	values := make([]any, len(columns))
 	for i := range columns {
 		switch columns[i] {
-		case vod.FieldProcessing, vod.FieldLocked:
+		case vod.FieldSpriteThumbnailsImages:
+			values[i] = new([]byte)
+		case vod.FieldProcessing, vod.FieldLocked, vod.FieldSpriteThumbnailsEnabled:
 			values[i] = new(sql.NullBool)
-		case vod.FieldDuration, vod.FieldViews, vod.FieldLocalViews:
+		case vod.FieldDuration, vod.FieldClipVodOffset, vod.FieldViews, vod.FieldLocalViews, vod.FieldSpriteThumbnailsInterval, vod.FieldSpriteThumbnailsWidth, vod.FieldSpriteThumbnailsHeight, vod.FieldSpriteThumbnailsRows, vod.FieldSpriteThumbnailsColumns:
 			values[i] = new(sql.NullInt64)
-		case vod.FieldExtID, vod.FieldExtStreamID, vod.FieldPlatform, vod.FieldType, vod.FieldTitle, vod.FieldResolution, vod.FieldThumbnailPath, vod.FieldWebThumbnailPath, vod.FieldVideoPath, vod.FieldVideoHlsPath, vod.FieldChatPath, vod.FieldLiveChatPath, vod.FieldLiveChatConvertPath, vod.FieldChatVideoPath, vod.FieldInfoPath, vod.FieldCaptionPath, vod.FieldFolderName, vod.FieldFileName, vod.FieldTmpVideoDownloadPath, vod.FieldTmpVideoConvertPath, vod.FieldTmpChatDownloadPath, vod.FieldTmpLiveChatDownloadPath, vod.FieldTmpLiveChatConvertPath, vod.FieldTmpChatRenderPath, vod.FieldTmpVideoHlsPath:
+		case vod.FieldExtID, vod.FieldClipExtVodID, vod.FieldExtStreamID, vod.FieldPlatform, vod.FieldType, vod.FieldTitle, vod.FieldResolution, vod.FieldThumbnailPath, vod.FieldWebThumbnailPath, vod.FieldVideoPath, vod.FieldVideoHlsPath, vod.FieldChatPath, vod.FieldLiveChatPath, vod.FieldLiveChatConvertPath, vod.FieldChatVideoPath, vod.FieldInfoPath, vod.FieldCaptionPath, vod.FieldFolderName, vod.FieldFileName, vod.FieldTmpVideoDownloadPath, vod.FieldTmpVideoConvertPath, vod.FieldTmpChatDownloadPath, vod.FieldTmpLiveChatDownloadPath, vod.FieldTmpLiveChatConvertPath, vod.FieldTmpChatRenderPath, vod.FieldTmpVideoHlsPath:
 			values[i] = new(sql.NullString)
 		case vod.FieldStreamedAt, vod.FieldUpdatedAt, vod.FieldCreatedAt:
 			values[i] = new(sql.NullTime)
@@ -215,6 +236,12 @@ func (v *Vod) assignValues(columns []string, values []any) error {
 			} else if value.Valid {
 				v.ExtID = value.String
 			}
+		case vod.FieldClipExtVodID:
+			if value, ok := values[i].(*sql.NullString); !ok {
+				return fmt.Errorf("unexpected type %T for field clip_ext_vod_id", values[i])
+			} else if value.Valid {
+				v.ClipExtVodID = value.String
+			}
 		case vod.FieldExtStreamID:
 			if value, ok := values[i].(*sql.NullString); !ok {
 				return fmt.Errorf("unexpected type %T for field ext_stream_id", values[i])
@@ -245,6 +272,12 @@ func (v *Vod) assignValues(columns []string, values []any) error {
 			} else if value.Valid {
 				v.Duration = int(value.Int64)
 			}
+		case vod.FieldClipVodOffset:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field clip_vod_offset", values[i])
+			} else if value.Valid {
+				v.ClipVodOffset = int(value.Int64)
+			}
 		case vod.FieldViews:
 			if value, ok := values[i].(*sql.NullInt64); !ok {
 				return fmt.Errorf("unexpected type %T for field views", values[i])
@@ -389,6 +422,50 @@ func (v *Vod) assignValues(columns []string, values []any) error {
 			} else if value.Valid {
 				v.LocalViews = int(value.Int64)
 			}
+		case vod.FieldSpriteThumbnailsEnabled:
+			if value, ok := values[i].(*sql.NullBool); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_enabled", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsEnabled = value.Bool
+			}
+		case vod.FieldSpriteThumbnailsImages:
+			if value, ok := values[i].(*[]byte); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_images", values[i])
+			} else if value != nil && len(*value) > 0 {
+				if err := json.Unmarshal(*value, &v.SpriteThumbnailsImages); err != nil {
+					return fmt.Errorf("unmarshal field sprite_thumbnails_images: %w", err)
+				}
+			}
+		case vod.FieldSpriteThumbnailsInterval:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_interval", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsInterval = int(value.Int64)
+			}
+		case vod.FieldSpriteThumbnailsWidth:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_width", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsWidth = int(value.Int64)
+			}
+		case vod.FieldSpriteThumbnailsHeight:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_height", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsHeight = int(value.Int64)
+			}
+		case vod.FieldSpriteThumbnailsRows:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_rows", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsRows = int(value.Int64)
+			}
+		case vod.FieldSpriteThumbnailsColumns:
+			if value, ok := values[i].(*sql.NullInt64); !ok {
+				return fmt.Errorf("unexpected type %T for field sprite_thumbnails_columns", values[i])
+			} else if value.Valid {
+				v.SpriteThumbnailsColumns = int(value.Int64)
+			}
 		case vod.FieldStreamedAt:
 			if value, ok := values[i].(*sql.NullTime); !ok {
 				return fmt.Errorf("unexpected type %T for field streamed_at", values[i])
@@ -483,6 +560,9 @@ func (v *Vod) String() string {
 	builder.WriteString("ext_id=")
 	builder.WriteString(v.ExtID)
 	builder.WriteString(", ")
+	builder.WriteString("clip_ext_vod_id=")
+	builder.WriteString(v.ClipExtVodID)
+	builder.WriteString(", ")
 	builder.WriteString("ext_stream_id=")
 	builder.WriteString(v.ExtStreamID)
 	builder.WriteString(", ")
@@ -498,6 +578,9 @@ func (v *Vod) String() string {
 	builder.WriteString("duration=")
 	builder.WriteString(fmt.Sprintf("%v", v.Duration))
 	builder.WriteString(", ")
+	builder.WriteString("clip_vod_offset=")
+	builder.WriteString(fmt.Sprintf("%v", v.ClipVodOffset))
+	builder.WriteString(", ")
 	builder.WriteString("views=")
 	builder.WriteString(fmt.Sprintf("%v", v.Views))
 	builder.WriteString(", ")
@@ -570,6 +653,27 @@ func (v *Vod) String() string {
 	builder.WriteString("local_views=")
 	builder.WriteString(fmt.Sprintf("%v", v.LocalViews))
 	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_enabled=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsEnabled))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_images=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsImages))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_interval=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsInterval))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_width=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsWidth))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_height=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsHeight))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_rows=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsRows))
+	builder.WriteString(", ")
+	builder.WriteString("sprite_thumbnails_columns=")
+	builder.WriteString(fmt.Sprintf("%v", v.SpriteThumbnailsColumns))
+	builder.WriteString(", ")
 	builder.WriteString("streamed_at=")
 	builder.WriteString(v.StreamedAt.Format(time.ANSIC))
 	builder.WriteString(", ")
diff --git a/ent/vod/vod.go b/ent/vod/vod.go
index a6684544..d4c7f233 100644
--- a/ent/vod/vod.go
+++ b/ent/vod/vod.go
@@ -19,6 +19,8 @@ const (
 	FieldID = "id"
 	// FieldExtID holds the string denoting the ext_id field in the database.
 	FieldExtID = "ext_id"
+	// FieldClipExtVodID holds the string denoting the clip_ext_vod_id field in the database.
+	FieldClipExtVodID = "clip_ext_vod_id"
 	// FieldExtStreamID holds the string denoting the ext_stream_id field in the database.
 	FieldExtStreamID = "ext_stream_id"
 	// FieldPlatform holds the string denoting the platform field in the database.
@@ -29,6 +31,8 @@ const (
 	FieldTitle = "title"
 	// FieldDuration holds the string denoting the duration field in the database.
 	FieldDuration = "duration"
+	// FieldClipVodOffset holds the string denoting the clip_vod_offset field in the database.
+	FieldClipVodOffset = "clip_vod_offset"
 	// FieldViews holds the string denoting the views field in the database.
 	FieldViews = "views"
 	// FieldResolution holds the string denoting the resolution field in the database.
@@ -77,6 +81,20 @@ const (
 	FieldLocked = "locked"
 	// FieldLocalViews holds the string denoting the local_views field in the database.
 	FieldLocalViews = "local_views"
+	// FieldSpriteThumbnailsEnabled holds the string denoting the sprite_thumbnails_enabled field in the database.
+	FieldSpriteThumbnailsEnabled = "sprite_thumbnails_enabled"
+	// FieldSpriteThumbnailsImages holds the string denoting the sprite_thumbnails_images field in the database.
+	FieldSpriteThumbnailsImages = "sprite_thumbnails_images"
+	// FieldSpriteThumbnailsInterval holds the string denoting the sprite_thumbnails_interval field in the database.
+	FieldSpriteThumbnailsInterval = "sprite_thumbnails_interval"
+	// FieldSpriteThumbnailsWidth holds the string denoting the sprite_thumbnails_width field in the database.
+	FieldSpriteThumbnailsWidth = "sprite_thumbnails_width"
+	// FieldSpriteThumbnailsHeight holds the string denoting the sprite_thumbnails_height field in the database.
+	FieldSpriteThumbnailsHeight = "sprite_thumbnails_height"
+	// FieldSpriteThumbnailsRows holds the string denoting the sprite_thumbnails_rows field in the database.
+	FieldSpriteThumbnailsRows = "sprite_thumbnails_rows"
+	// FieldSpriteThumbnailsColumns holds the string denoting the sprite_thumbnails_columns field in the database.
+	FieldSpriteThumbnailsColumns = "sprite_thumbnails_columns"
 	// FieldStreamedAt holds the string denoting the streamed_at field in the database.
 	FieldStreamedAt = "streamed_at"
 	// FieldUpdatedAt holds the string denoting the updated_at field in the database.
@@ -143,11 +161,13 @@ const (
 var Columns = []string{
 	FieldID,
 	FieldExtID,
+	FieldClipExtVodID,
 	FieldExtStreamID,
 	FieldPlatform,
 	FieldType,
 	FieldTitle,
 	FieldDuration,
+	FieldClipVodOffset,
 	FieldViews,
 	FieldResolution,
 	FieldProcessing,
@@ -172,6 +192,13 @@ var Columns = []string{
 	FieldTmpVideoHlsPath,
 	FieldLocked,
 	FieldLocalViews,
+	FieldSpriteThumbnailsEnabled,
+	FieldSpriteThumbnailsImages,
+	FieldSpriteThumbnailsInterval,
+	FieldSpriteThumbnailsWidth,
+	FieldSpriteThumbnailsHeight,
+	FieldSpriteThumbnailsRows,
+	FieldSpriteThumbnailsColumns,
 	FieldStreamedAt,
 	FieldUpdatedAt,
 	FieldCreatedAt,
@@ -215,6 +242,8 @@ var (
 	DefaultLocked bool
 	// DefaultLocalViews holds the default value on creation for the "local_views" field.
 	DefaultLocalViews int
+	// DefaultSpriteThumbnailsEnabled holds the default value on creation for the "sprite_thumbnails_enabled" field.
+	DefaultSpriteThumbnailsEnabled bool
 	// DefaultStreamedAt holds the default value on creation for the "streamed_at" field.
 	DefaultStreamedAt func() time.Time
 	// DefaultUpdatedAt holds the default value on creation for the "updated_at" field.
@@ -264,6 +293,11 @@ func ByExtID(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldExtID, opts...).ToFunc()
 }
 
+// ByClipExtVodID orders the results by the clip_ext_vod_id field.
+func ByClipExtVodID(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldClipExtVodID, opts...).ToFunc()
+}
+
 // ByExtStreamID orders the results by the ext_stream_id field.
 func ByExtStreamID(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldExtStreamID, opts...).ToFunc()
@@ -289,6 +323,11 @@ func ByDuration(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldDuration, opts...).ToFunc()
 }
 
+// ByClipVodOffset orders the results by the clip_vod_offset field.
+func ByClipVodOffset(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldClipVodOffset, opts...).ToFunc()
+}
+
 // ByViews orders the results by the views field.
 func ByViews(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldViews, opts...).ToFunc()
@@ -409,6 +448,36 @@ func ByLocalViews(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldLocalViews, opts...).ToFunc()
 }
 
+// BySpriteThumbnailsEnabled orders the results by the sprite_thumbnails_enabled field.
+func BySpriteThumbnailsEnabled(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsEnabled, opts...).ToFunc()
+}
+
+// BySpriteThumbnailsInterval orders the results by the sprite_thumbnails_interval field.
+func BySpriteThumbnailsInterval(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsInterval, opts...).ToFunc()
+}
+
+// BySpriteThumbnailsWidth orders the results by the sprite_thumbnails_width field.
+func BySpriteThumbnailsWidth(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsWidth, opts...).ToFunc()
+}
+
+// BySpriteThumbnailsHeight orders the results by the sprite_thumbnails_height field.
+func BySpriteThumbnailsHeight(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsHeight, opts...).ToFunc()
+}
+
+// BySpriteThumbnailsRows orders the results by the sprite_thumbnails_rows field.
+func BySpriteThumbnailsRows(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsRows, opts...).ToFunc()
+}
+
+// BySpriteThumbnailsColumns orders the results by the sprite_thumbnails_columns field.
+func BySpriteThumbnailsColumns(opts ...sql.OrderTermOption) OrderOption {
+	return sql.OrderByField(FieldSpriteThumbnailsColumns, opts...).ToFunc()
+}
+
 // ByStreamedAt orders the results by the streamed_at field.
 func ByStreamedAt(opts ...sql.OrderTermOption) OrderOption {
 	return sql.OrderByField(FieldStreamedAt, opts...).ToFunc()
diff --git a/ent/vod/where.go b/ent/vod/where.go
index eacad8f1..a2dc8f10 100644
--- a/ent/vod/where.go
+++ b/ent/vod/where.go
@@ -62,6 +62,11 @@ func ExtID(v string) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldExtID, v))
 }
 
+// ClipExtVodID applies equality check predicate on the "clip_ext_vod_id" field. It's identical to ClipExtVodIDEQ.
+func ClipExtVodID(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldClipExtVodID, v))
+}
+
 // ExtStreamID applies equality check predicate on the "ext_stream_id" field. It's identical to ExtStreamIDEQ.
 func ExtStreamID(v string) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldExtStreamID, v))
@@ -77,6 +82,11 @@ func Duration(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldDuration, v))
 }
 
+// ClipVodOffset applies equality check predicate on the "clip_vod_offset" field. It's identical to ClipVodOffsetEQ.
+func ClipVodOffset(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldClipVodOffset, v))
+}
+
 // Views applies equality check predicate on the "views" field. It's identical to ViewsEQ.
 func Views(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldViews, v))
@@ -197,6 +207,36 @@ func LocalViews(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldLocalViews, v))
 }
 
+// SpriteThumbnailsEnabled applies equality check predicate on the "sprite_thumbnails_enabled" field. It's identical to SpriteThumbnailsEnabledEQ.
+func SpriteThumbnailsEnabled(v bool) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsEnabled, v))
+}
+
+// SpriteThumbnailsInterval applies equality check predicate on the "sprite_thumbnails_interval" field. It's identical to SpriteThumbnailsIntervalEQ.
+func SpriteThumbnailsInterval(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsWidth applies equality check predicate on the "sprite_thumbnails_width" field. It's identical to SpriteThumbnailsWidthEQ.
+func SpriteThumbnailsWidth(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsHeight applies equality check predicate on the "sprite_thumbnails_height" field. It's identical to SpriteThumbnailsHeightEQ.
+func SpriteThumbnailsHeight(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsRows applies equality check predicate on the "sprite_thumbnails_rows" field. It's identical to SpriteThumbnailsRowsEQ.
+func SpriteThumbnailsRows(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsColumns applies equality check predicate on the "sprite_thumbnails_columns" field. It's identical to SpriteThumbnailsColumnsEQ.
+func SpriteThumbnailsColumns(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsColumns, v))
+}
+
 // StreamedAt applies equality check predicate on the "streamed_at" field. It's identical to StreamedAtEQ.
 func StreamedAt(v time.Time) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldStreamedAt, v))
@@ -277,6 +317,81 @@ func ExtIDContainsFold(v string) predicate.Vod {
 	return predicate.Vod(sql.FieldContainsFold(FieldExtID, v))
 }
 
+// ClipExtVodIDEQ applies the EQ predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDEQ(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDNEQ applies the NEQ predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDNEQ(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDIn applies the In predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDIn(vs ...string) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldClipExtVodID, vs...))
+}
+
+// ClipExtVodIDNotIn applies the NotIn predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDNotIn(vs ...string) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldClipExtVodID, vs...))
+}
+
+// ClipExtVodIDGT applies the GT predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDGT(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDGTE applies the GTE predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDGTE(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDLT applies the LT predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDLT(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDLTE applies the LTE predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDLTE(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDContains applies the Contains predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDContains(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldContains(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDHasPrefix applies the HasPrefix predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDHasPrefix(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldHasPrefix(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDHasSuffix applies the HasSuffix predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDHasSuffix(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldHasSuffix(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDIsNil applies the IsNil predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldClipExtVodID))
+}
+
+// ClipExtVodIDNotNil applies the NotNil predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldClipExtVodID))
+}
+
+// ClipExtVodIDEqualFold applies the EqualFold predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDEqualFold(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldEqualFold(FieldClipExtVodID, v))
+}
+
+// ClipExtVodIDContainsFold applies the ContainsFold predicate on the "clip_ext_vod_id" field.
+func ClipExtVodIDContainsFold(v string) predicate.Vod {
+	return predicate.Vod(sql.FieldContainsFold(FieldClipExtVodID, v))
+}
+
 // ExtStreamIDEQ applies the EQ predicate on the "ext_stream_id" field.
 func ExtStreamIDEQ(v string) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldExtStreamID, v))
@@ -517,6 +632,56 @@ func DurationLTE(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldLTE(FieldDuration, v))
 }
 
+// ClipVodOffsetEQ applies the EQ predicate on the "clip_vod_offset" field.
+func ClipVodOffsetEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetNEQ applies the NEQ predicate on the "clip_vod_offset" field.
+func ClipVodOffsetNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetIn applies the In predicate on the "clip_vod_offset" field.
+func ClipVodOffsetIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldClipVodOffset, vs...))
+}
+
+// ClipVodOffsetNotIn applies the NotIn predicate on the "clip_vod_offset" field.
+func ClipVodOffsetNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldClipVodOffset, vs...))
+}
+
+// ClipVodOffsetGT applies the GT predicate on the "clip_vod_offset" field.
+func ClipVodOffsetGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetGTE applies the GTE predicate on the "clip_vod_offset" field.
+func ClipVodOffsetGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetLT applies the LT predicate on the "clip_vod_offset" field.
+func ClipVodOffsetLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetLTE applies the LTE predicate on the "clip_vod_offset" field.
+func ClipVodOffsetLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldClipVodOffset, v))
+}
+
+// ClipVodOffsetIsNil applies the IsNil predicate on the "clip_vod_offset" field.
+func ClipVodOffsetIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldClipVodOffset))
+}
+
+// ClipVodOffsetNotNil applies the NotNil predicate on the "clip_vod_offset" field.
+func ClipVodOffsetNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldClipVodOffset))
+}
+
 // ViewsEQ applies the EQ predicate on the "views" field.
 func ViewsEQ(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldViews, v))
@@ -2097,6 +2262,276 @@ func LocalViewsLTE(v int) predicate.Vod {
 	return predicate.Vod(sql.FieldLTE(FieldLocalViews, v))
 }
 
+// SpriteThumbnailsEnabledEQ applies the EQ predicate on the "sprite_thumbnails_enabled" field.
+func SpriteThumbnailsEnabledEQ(v bool) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsEnabled, v))
+}
+
+// SpriteThumbnailsEnabledNEQ applies the NEQ predicate on the "sprite_thumbnails_enabled" field.
+func SpriteThumbnailsEnabledNEQ(v bool) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsEnabled, v))
+}
+
+// SpriteThumbnailsImagesIsNil applies the IsNil predicate on the "sprite_thumbnails_images" field.
+func SpriteThumbnailsImagesIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsImages))
+}
+
+// SpriteThumbnailsImagesNotNil applies the NotNil predicate on the "sprite_thumbnails_images" field.
+func SpriteThumbnailsImagesNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsImages))
+}
+
+// SpriteThumbnailsIntervalEQ applies the EQ predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalNEQ applies the NEQ predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalIn applies the In predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldSpriteThumbnailsInterval, vs...))
+}
+
+// SpriteThumbnailsIntervalNotIn applies the NotIn predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldSpriteThumbnailsInterval, vs...))
+}
+
+// SpriteThumbnailsIntervalGT applies the GT predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalGTE applies the GTE predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalLT applies the LT predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalLTE applies the LTE predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldSpriteThumbnailsInterval, v))
+}
+
+// SpriteThumbnailsIntervalIsNil applies the IsNil predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsInterval))
+}
+
+// SpriteThumbnailsIntervalNotNil applies the NotNil predicate on the "sprite_thumbnails_interval" field.
+func SpriteThumbnailsIntervalNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsInterval))
+}
+
+// SpriteThumbnailsWidthEQ applies the EQ predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthNEQ applies the NEQ predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthIn applies the In predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldSpriteThumbnailsWidth, vs...))
+}
+
+// SpriteThumbnailsWidthNotIn applies the NotIn predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldSpriteThumbnailsWidth, vs...))
+}
+
+// SpriteThumbnailsWidthGT applies the GT predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthGTE applies the GTE predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthLT applies the LT predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthLTE applies the LTE predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldSpriteThumbnailsWidth, v))
+}
+
+// SpriteThumbnailsWidthIsNil applies the IsNil predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsWidth))
+}
+
+// SpriteThumbnailsWidthNotNil applies the NotNil predicate on the "sprite_thumbnails_width" field.
+func SpriteThumbnailsWidthNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsWidth))
+}
+
+// SpriteThumbnailsHeightEQ applies the EQ predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightNEQ applies the NEQ predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightIn applies the In predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldSpriteThumbnailsHeight, vs...))
+}
+
+// SpriteThumbnailsHeightNotIn applies the NotIn predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldSpriteThumbnailsHeight, vs...))
+}
+
+// SpriteThumbnailsHeightGT applies the GT predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightGTE applies the GTE predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightLT applies the LT predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightLTE applies the LTE predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldSpriteThumbnailsHeight, v))
+}
+
+// SpriteThumbnailsHeightIsNil applies the IsNil predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsHeight))
+}
+
+// SpriteThumbnailsHeightNotNil applies the NotNil predicate on the "sprite_thumbnails_height" field.
+func SpriteThumbnailsHeightNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsHeight))
+}
+
+// SpriteThumbnailsRowsEQ applies the EQ predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsNEQ applies the NEQ predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsIn applies the In predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldSpriteThumbnailsRows, vs...))
+}
+
+// SpriteThumbnailsRowsNotIn applies the NotIn predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldSpriteThumbnailsRows, vs...))
+}
+
+// SpriteThumbnailsRowsGT applies the GT predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsGTE applies the GTE predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsLT applies the LT predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsLTE applies the LTE predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldSpriteThumbnailsRows, v))
+}
+
+// SpriteThumbnailsRowsIsNil applies the IsNil predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsRows))
+}
+
+// SpriteThumbnailsRowsNotNil applies the NotNil predicate on the "sprite_thumbnails_rows" field.
+func SpriteThumbnailsRowsNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsRows))
+}
+
+// SpriteThumbnailsColumnsEQ applies the EQ predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldEQ(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsNEQ applies the NEQ predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsNEQ(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldNEQ(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsIn applies the In predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldIn(FieldSpriteThumbnailsColumns, vs...))
+}
+
+// SpriteThumbnailsColumnsNotIn applies the NotIn predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsNotIn(vs ...int) predicate.Vod {
+	return predicate.Vod(sql.FieldNotIn(FieldSpriteThumbnailsColumns, vs...))
+}
+
+// SpriteThumbnailsColumnsGT applies the GT predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsGT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGT(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsGTE applies the GTE predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsGTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldGTE(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsLT applies the LT predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsLT(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLT(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsLTE applies the LTE predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsLTE(v int) predicate.Vod {
+	return predicate.Vod(sql.FieldLTE(FieldSpriteThumbnailsColumns, v))
+}
+
+// SpriteThumbnailsColumnsIsNil applies the IsNil predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsIsNil() predicate.Vod {
+	return predicate.Vod(sql.FieldIsNull(FieldSpriteThumbnailsColumns))
+}
+
+// SpriteThumbnailsColumnsNotNil applies the NotNil predicate on the "sprite_thumbnails_columns" field.
+func SpriteThumbnailsColumnsNotNil() predicate.Vod {
+	return predicate.Vod(sql.FieldNotNull(FieldSpriteThumbnailsColumns))
+}
+
 // StreamedAtEQ applies the EQ predicate on the "streamed_at" field.
 func StreamedAtEQ(v time.Time) predicate.Vod {
 	return predicate.Vod(sql.FieldEQ(FieldStreamedAt, v))
diff --git a/ent/vod_create.go b/ent/vod_create.go
index b7638eaf..f323b500 100644
--- a/ent/vod_create.go
+++ b/ent/vod_create.go
@@ -37,6 +37,20 @@ func (vc *VodCreate) SetExtID(s string) *VodCreate {
 	return vc
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (vc *VodCreate) SetClipExtVodID(s string) *VodCreate {
+	vc.mutation.SetClipExtVodID(s)
+	return vc
+}
+
+// SetNillableClipExtVodID sets the "clip_ext_vod_id" field if the given value is not nil.
+func (vc *VodCreate) SetNillableClipExtVodID(s *string) *VodCreate {
+	if s != nil {
+		vc.SetClipExtVodID(*s)
+	}
+	return vc
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (vc *VodCreate) SetExtStreamID(s string) *VodCreate {
 	vc.mutation.SetExtStreamID(s)
@@ -99,6 +113,20 @@ func (vc *VodCreate) SetNillableDuration(i *int) *VodCreate {
 	return vc
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (vc *VodCreate) SetClipVodOffset(i int) *VodCreate {
+	vc.mutation.SetClipVodOffset(i)
+	return vc
+}
+
+// SetNillableClipVodOffset sets the "clip_vod_offset" field if the given value is not nil.
+func (vc *VodCreate) SetNillableClipVodOffset(i *int) *VodCreate {
+	if i != nil {
+		vc.SetClipVodOffset(*i)
+	}
+	return vc
+}
+
 // SetViews sets the "views" field.
 func (vc *VodCreate) SetViews(i int) *VodCreate {
 	vc.mutation.SetViews(i)
@@ -419,6 +447,96 @@ func (vc *VodCreate) SetNillableLocalViews(i *int) *VodCreate {
 	return vc
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (vc *VodCreate) SetSpriteThumbnailsEnabled(b bool) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsEnabled(b)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsEnabled(b *bool) *VodCreate {
+	if b != nil {
+		vc.SetSpriteThumbnailsEnabled(*b)
+	}
+	return vc
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (vc *VodCreate) SetSpriteThumbnailsImages(s []string) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsImages(s)
+	return vc
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (vc *VodCreate) SetSpriteThumbnailsInterval(i int) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsInterval(i)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsInterval(i *int) *VodCreate {
+	if i != nil {
+		vc.SetSpriteThumbnailsInterval(*i)
+	}
+	return vc
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (vc *VodCreate) SetSpriteThumbnailsWidth(i int) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsWidth(i)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsWidth(i *int) *VodCreate {
+	if i != nil {
+		vc.SetSpriteThumbnailsWidth(*i)
+	}
+	return vc
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (vc *VodCreate) SetSpriteThumbnailsHeight(i int) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsHeight(i)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsHeight(i *int) *VodCreate {
+	if i != nil {
+		vc.SetSpriteThumbnailsHeight(*i)
+	}
+	return vc
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (vc *VodCreate) SetSpriteThumbnailsRows(i int) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsRows(i)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsRows(i *int) *VodCreate {
+	if i != nil {
+		vc.SetSpriteThumbnailsRows(*i)
+	}
+	return vc
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (vc *VodCreate) SetSpriteThumbnailsColumns(i int) *VodCreate {
+	vc.mutation.SetSpriteThumbnailsColumns(i)
+	return vc
+}
+
+// SetNillableSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field if the given value is not nil.
+func (vc *VodCreate) SetNillableSpriteThumbnailsColumns(i *int) *VodCreate {
+	if i != nil {
+		vc.SetSpriteThumbnailsColumns(*i)
+	}
+	return vc
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (vc *VodCreate) SetStreamedAt(t time.Time) *VodCreate {
 	vc.mutation.SetStreamedAt(t)
@@ -628,6 +746,10 @@ func (vc *VodCreate) defaults() {
 		v := vod.DefaultLocalViews
 		vc.mutation.SetLocalViews(v)
 	}
+	if _, ok := vc.mutation.SpriteThumbnailsEnabled(); !ok {
+		v := vod.DefaultSpriteThumbnailsEnabled
+		vc.mutation.SetSpriteThumbnailsEnabled(v)
+	}
 	if _, ok := vc.mutation.StreamedAt(); !ok {
 		v := vod.DefaultStreamedAt()
 		vc.mutation.SetStreamedAt(v)
@@ -691,6 +813,9 @@ func (vc *VodCreate) check() error {
 	if _, ok := vc.mutation.LocalViews(); !ok {
 		return &ValidationError{Name: "local_views", err: errors.New(`ent: missing required field "Vod.local_views"`)}
 	}
+	if _, ok := vc.mutation.SpriteThumbnailsEnabled(); !ok {
+		return &ValidationError{Name: "sprite_thumbnails_enabled", err: errors.New(`ent: missing required field "Vod.sprite_thumbnails_enabled"`)}
+	}
 	if _, ok := vc.mutation.StreamedAt(); !ok {
 		return &ValidationError{Name: "streamed_at", err: errors.New(`ent: missing required field "Vod.streamed_at"`)}
 	}
@@ -743,6 +868,10 @@ func (vc *VodCreate) createSpec() (*Vod, *sqlgraph.CreateSpec) {
 		_spec.SetField(vod.FieldExtID, field.TypeString, value)
 		_node.ExtID = value
 	}
+	if value, ok := vc.mutation.ClipExtVodID(); ok {
+		_spec.SetField(vod.FieldClipExtVodID, field.TypeString, value)
+		_node.ClipExtVodID = value
+	}
 	if value, ok := vc.mutation.ExtStreamID(); ok {
 		_spec.SetField(vod.FieldExtStreamID, field.TypeString, value)
 		_node.ExtStreamID = value
@@ -763,6 +892,10 @@ func (vc *VodCreate) createSpec() (*Vod, *sqlgraph.CreateSpec) {
 		_spec.SetField(vod.FieldDuration, field.TypeInt, value)
 		_node.Duration = value
 	}
+	if value, ok := vc.mutation.ClipVodOffset(); ok {
+		_spec.SetField(vod.FieldClipVodOffset, field.TypeInt, value)
+		_node.ClipVodOffset = value
+	}
 	if value, ok := vc.mutation.Views(); ok {
 		_spec.SetField(vod.FieldViews, field.TypeInt, value)
 		_node.Views = value
@@ -859,6 +992,34 @@ func (vc *VodCreate) createSpec() (*Vod, *sqlgraph.CreateSpec) {
 		_spec.SetField(vod.FieldLocalViews, field.TypeInt, value)
 		_node.LocalViews = value
 	}
+	if value, ok := vc.mutation.SpriteThumbnailsEnabled(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsEnabled, field.TypeBool, value)
+		_node.SpriteThumbnailsEnabled = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsImages(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsImages, field.TypeJSON, value)
+		_node.SpriteThumbnailsImages = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsInterval(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsInterval, field.TypeInt, value)
+		_node.SpriteThumbnailsInterval = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsWidth(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsWidth, field.TypeInt, value)
+		_node.SpriteThumbnailsWidth = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsHeight(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsHeight, field.TypeInt, value)
+		_node.SpriteThumbnailsHeight = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsRows(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsRows, field.TypeInt, value)
+		_node.SpriteThumbnailsRows = value
+	}
+	if value, ok := vc.mutation.SpriteThumbnailsColumns(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsColumns, field.TypeInt, value)
+		_node.SpriteThumbnailsColumns = value
+	}
 	if value, ok := vc.mutation.StreamedAt(); ok {
 		_spec.SetField(vod.FieldStreamedAt, field.TypeTime, value)
 		_node.StreamedAt = value
@@ -1032,6 +1193,24 @@ func (u *VodUpsert) UpdateExtID() *VodUpsert {
 	return u
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (u *VodUpsert) SetClipExtVodID(v string) *VodUpsert {
+	u.Set(vod.FieldClipExtVodID, v)
+	return u
+}
+
+// UpdateClipExtVodID sets the "clip_ext_vod_id" field to the value that was provided on create.
+func (u *VodUpsert) UpdateClipExtVodID() *VodUpsert {
+	u.SetExcluded(vod.FieldClipExtVodID)
+	return u
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (u *VodUpsert) ClearClipExtVodID() *VodUpsert {
+	u.SetNull(vod.FieldClipExtVodID)
+	return u
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (u *VodUpsert) SetExtStreamID(v string) *VodUpsert {
 	u.Set(vod.FieldExtStreamID, v)
@@ -1104,6 +1283,30 @@ func (u *VodUpsert) AddDuration(v int) *VodUpsert {
 	return u
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (u *VodUpsert) SetClipVodOffset(v int) *VodUpsert {
+	u.Set(vod.FieldClipVodOffset, v)
+	return u
+}
+
+// UpdateClipVodOffset sets the "clip_vod_offset" field to the value that was provided on create.
+func (u *VodUpsert) UpdateClipVodOffset() *VodUpsert {
+	u.SetExcluded(vod.FieldClipVodOffset)
+	return u
+}
+
+// AddClipVodOffset adds v to the "clip_vod_offset" field.
+func (u *VodUpsert) AddClipVodOffset(v int) *VodUpsert {
+	u.Add(vod.FieldClipVodOffset, v)
+	return u
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (u *VodUpsert) ClearClipVodOffset() *VodUpsert {
+	u.SetNull(vod.FieldClipVodOffset)
+	return u
+}
+
 // SetViews sets the "views" field.
 func (u *VodUpsert) SetViews(v int) *VodUpsert {
 	u.Set(vod.FieldViews, v)
@@ -1512,6 +1715,156 @@ func (u *VodUpsert) AddLocalViews(v int) *VodUpsert {
 	return u
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (u *VodUpsert) SetSpriteThumbnailsEnabled(v bool) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsEnabled, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsEnabled() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsEnabled)
+	return u
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (u *VodUpsert) SetSpriteThumbnailsImages(v []string) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsImages, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsImages sets the "sprite_thumbnails_images" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsImages() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsImages)
+	return u
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (u *VodUpsert) ClearSpriteThumbnailsImages() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsImages)
+	return u
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (u *VodUpsert) SetSpriteThumbnailsInterval(v int) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsInterval, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsInterval() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsInterval)
+	return u
+}
+
+// AddSpriteThumbnailsInterval adds v to the "sprite_thumbnails_interval" field.
+func (u *VodUpsert) AddSpriteThumbnailsInterval(v int) *VodUpsert {
+	u.Add(vod.FieldSpriteThumbnailsInterval, v)
+	return u
+}
+
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (u *VodUpsert) ClearSpriteThumbnailsInterval() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsInterval)
+	return u
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (u *VodUpsert) SetSpriteThumbnailsWidth(v int) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsWidth, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsWidth() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsWidth)
+	return u
+}
+
+// AddSpriteThumbnailsWidth adds v to the "sprite_thumbnails_width" field.
+func (u *VodUpsert) AddSpriteThumbnailsWidth(v int) *VodUpsert {
+	u.Add(vod.FieldSpriteThumbnailsWidth, v)
+	return u
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (u *VodUpsert) ClearSpriteThumbnailsWidth() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsWidth)
+	return u
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (u *VodUpsert) SetSpriteThumbnailsHeight(v int) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsHeight, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsHeight() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsHeight)
+	return u
+}
+
+// AddSpriteThumbnailsHeight adds v to the "sprite_thumbnails_height" field.
+func (u *VodUpsert) AddSpriteThumbnailsHeight(v int) *VodUpsert {
+	u.Add(vod.FieldSpriteThumbnailsHeight, v)
+	return u
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (u *VodUpsert) ClearSpriteThumbnailsHeight() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsHeight)
+	return u
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (u *VodUpsert) SetSpriteThumbnailsRows(v int) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsRows, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsRows() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsRows)
+	return u
+}
+
+// AddSpriteThumbnailsRows adds v to the "sprite_thumbnails_rows" field.
+func (u *VodUpsert) AddSpriteThumbnailsRows(v int) *VodUpsert {
+	u.Add(vod.FieldSpriteThumbnailsRows, v)
+	return u
+}
+
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (u *VodUpsert) ClearSpriteThumbnailsRows() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsRows)
+	return u
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (u *VodUpsert) SetSpriteThumbnailsColumns(v int) *VodUpsert {
+	u.Set(vod.FieldSpriteThumbnailsColumns, v)
+	return u
+}
+
+// UpdateSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field to the value that was provided on create.
+func (u *VodUpsert) UpdateSpriteThumbnailsColumns() *VodUpsert {
+	u.SetExcluded(vod.FieldSpriteThumbnailsColumns)
+	return u
+}
+
+// AddSpriteThumbnailsColumns adds v to the "sprite_thumbnails_columns" field.
+func (u *VodUpsert) AddSpriteThumbnailsColumns(v int) *VodUpsert {
+	u.Add(vod.FieldSpriteThumbnailsColumns, v)
+	return u
+}
+
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (u *VodUpsert) ClearSpriteThumbnailsColumns() *VodUpsert {
+	u.SetNull(vod.FieldSpriteThumbnailsColumns)
+	return u
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (u *VodUpsert) SetStreamedAt(v time.Time) *VodUpsert {
 	u.Set(vod.FieldStreamedAt, v)
@@ -1601,6 +1954,27 @@ func (u *VodUpsertOne) UpdateExtID() *VodUpsertOne {
 	})
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (u *VodUpsertOne) SetClipExtVodID(v string) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetClipExtVodID(v)
+	})
+}
+
+// UpdateClipExtVodID sets the "clip_ext_vod_id" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateClipExtVodID() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateClipExtVodID()
+	})
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (u *VodUpsertOne) ClearClipExtVodID() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearClipExtVodID()
+	})
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (u *VodUpsertOne) SetExtStreamID(v string) *VodUpsertOne {
 	return u.Update(func(s *VodUpsert) {
@@ -1685,6 +2059,34 @@ func (u *VodUpsertOne) UpdateDuration() *VodUpsertOne {
 	})
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (u *VodUpsertOne) SetClipVodOffset(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetClipVodOffset(v)
+	})
+}
+
+// AddClipVodOffset adds v to the "clip_vod_offset" field.
+func (u *VodUpsertOne) AddClipVodOffset(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddClipVodOffset(v)
+	})
+}
+
+// UpdateClipVodOffset sets the "clip_vod_offset" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateClipVodOffset() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateClipVodOffset()
+	})
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (u *VodUpsertOne) ClearClipVodOffset() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearClipVodOffset()
+	})
+}
+
 // SetViews sets the "views" field.
 func (u *VodUpsertOne) SetViews(v int) *VodUpsertOne {
 	return u.Update(func(s *VodUpsert) {
@@ -2161,6 +2563,181 @@ func (u *VodUpsertOne) UpdateLocalViews() *VodUpsertOne {
 	})
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsEnabled(v bool) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsEnabled(v)
+	})
+}
+
+// UpdateSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsEnabled() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsEnabled()
+	})
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsImages(v []string) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsImages(v)
+	})
+}
+
+// UpdateSpriteThumbnailsImages sets the "sprite_thumbnails_images" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsImages() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsImages()
+	})
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsImages() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsImages()
+	})
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsInterval(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsInterval(v)
+	})
+}
+
+// AddSpriteThumbnailsInterval adds v to the "sprite_thumbnails_interval" field.
+func (u *VodUpsertOne) AddSpriteThumbnailsInterval(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsInterval(v)
+	})
+}
+
+// UpdateSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsInterval() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsInterval()
+	})
+}
+
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsInterval() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsInterval()
+	})
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsWidth(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsWidth(v)
+	})
+}
+
+// AddSpriteThumbnailsWidth adds v to the "sprite_thumbnails_width" field.
+func (u *VodUpsertOne) AddSpriteThumbnailsWidth(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsWidth(v)
+	})
+}
+
+// UpdateSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsWidth() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsWidth()
+	})
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsWidth() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsWidth()
+	})
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsHeight(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsHeight(v)
+	})
+}
+
+// AddSpriteThumbnailsHeight adds v to the "sprite_thumbnails_height" field.
+func (u *VodUpsertOne) AddSpriteThumbnailsHeight(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsHeight(v)
+	})
+}
+
+// UpdateSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsHeight() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsHeight()
+	})
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsHeight() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsHeight()
+	})
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsRows(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsRows(v)
+	})
+}
+
+// AddSpriteThumbnailsRows adds v to the "sprite_thumbnails_rows" field.
+func (u *VodUpsertOne) AddSpriteThumbnailsRows(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsRows(v)
+	})
+}
+
+// UpdateSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsRows() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsRows()
+	})
+}
+
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsRows() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsRows()
+	})
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (u *VodUpsertOne) SetSpriteThumbnailsColumns(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsColumns(v)
+	})
+}
+
+// AddSpriteThumbnailsColumns adds v to the "sprite_thumbnails_columns" field.
+func (u *VodUpsertOne) AddSpriteThumbnailsColumns(v int) *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsColumns(v)
+	})
+}
+
+// UpdateSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field to the value that was provided on create.
+func (u *VodUpsertOne) UpdateSpriteThumbnailsColumns() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsColumns()
+	})
+}
+
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (u *VodUpsertOne) ClearSpriteThumbnailsColumns() *VodUpsertOne {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsColumns()
+	})
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (u *VodUpsertOne) SetStreamedAt(v time.Time) *VodUpsertOne {
 	return u.Update(func(s *VodUpsert) {
@@ -2421,6 +2998,27 @@ func (u *VodUpsertBulk) UpdateExtID() *VodUpsertBulk {
 	})
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (u *VodUpsertBulk) SetClipExtVodID(v string) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetClipExtVodID(v)
+	})
+}
+
+// UpdateClipExtVodID sets the "clip_ext_vod_id" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateClipExtVodID() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateClipExtVodID()
+	})
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (u *VodUpsertBulk) ClearClipExtVodID() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearClipExtVodID()
+	})
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (u *VodUpsertBulk) SetExtStreamID(v string) *VodUpsertBulk {
 	return u.Update(func(s *VodUpsert) {
@@ -2505,6 +3103,34 @@ func (u *VodUpsertBulk) UpdateDuration() *VodUpsertBulk {
 	})
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (u *VodUpsertBulk) SetClipVodOffset(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetClipVodOffset(v)
+	})
+}
+
+// AddClipVodOffset adds v to the "clip_vod_offset" field.
+func (u *VodUpsertBulk) AddClipVodOffset(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddClipVodOffset(v)
+	})
+}
+
+// UpdateClipVodOffset sets the "clip_vod_offset" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateClipVodOffset() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateClipVodOffset()
+	})
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (u *VodUpsertBulk) ClearClipVodOffset() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearClipVodOffset()
+	})
+}
+
 // SetViews sets the "views" field.
 func (u *VodUpsertBulk) SetViews(v int) *VodUpsertBulk {
 	return u.Update(func(s *VodUpsert) {
@@ -2981,6 +3607,181 @@ func (u *VodUpsertBulk) UpdateLocalViews() *VodUpsertBulk {
 	})
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsEnabled(v bool) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsEnabled(v)
+	})
+}
+
+// UpdateSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsEnabled() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsEnabled()
+	})
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsImages(v []string) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsImages(v)
+	})
+}
+
+// UpdateSpriteThumbnailsImages sets the "sprite_thumbnails_images" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsImages() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsImages()
+	})
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsImages() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsImages()
+	})
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsInterval(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsInterval(v)
+	})
+}
+
+// AddSpriteThumbnailsInterval adds v to the "sprite_thumbnails_interval" field.
+func (u *VodUpsertBulk) AddSpriteThumbnailsInterval(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsInterval(v)
+	})
+}
+
+// UpdateSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsInterval() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsInterval()
+	})
+}
+
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsInterval() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsInterval()
+	})
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsWidth(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsWidth(v)
+	})
+}
+
+// AddSpriteThumbnailsWidth adds v to the "sprite_thumbnails_width" field.
+func (u *VodUpsertBulk) AddSpriteThumbnailsWidth(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsWidth(v)
+	})
+}
+
+// UpdateSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsWidth() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsWidth()
+	})
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsWidth() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsWidth()
+	})
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsHeight(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsHeight(v)
+	})
+}
+
+// AddSpriteThumbnailsHeight adds v to the "sprite_thumbnails_height" field.
+func (u *VodUpsertBulk) AddSpriteThumbnailsHeight(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsHeight(v)
+	})
+}
+
+// UpdateSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsHeight() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsHeight()
+	})
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsHeight() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsHeight()
+	})
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsRows(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsRows(v)
+	})
+}
+
+// AddSpriteThumbnailsRows adds v to the "sprite_thumbnails_rows" field.
+func (u *VodUpsertBulk) AddSpriteThumbnailsRows(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsRows(v)
+	})
+}
+
+// UpdateSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsRows() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsRows()
+	})
+}
+
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsRows() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsRows()
+	})
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (u *VodUpsertBulk) SetSpriteThumbnailsColumns(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.SetSpriteThumbnailsColumns(v)
+	})
+}
+
+// AddSpriteThumbnailsColumns adds v to the "sprite_thumbnails_columns" field.
+func (u *VodUpsertBulk) AddSpriteThumbnailsColumns(v int) *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.AddSpriteThumbnailsColumns(v)
+	})
+}
+
+// UpdateSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field to the value that was provided on create.
+func (u *VodUpsertBulk) UpdateSpriteThumbnailsColumns() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.UpdateSpriteThumbnailsColumns()
+	})
+}
+
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (u *VodUpsertBulk) ClearSpriteThumbnailsColumns() *VodUpsertBulk {
+	return u.Update(func(s *VodUpsert) {
+		s.ClearSpriteThumbnailsColumns()
+	})
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (u *VodUpsertBulk) SetStreamedAt(v time.Time) *VodUpsertBulk {
 	return u.Update(func(s *VodUpsert) {
diff --git a/ent/vod_update.go b/ent/vod_update.go
index ff1fb588..56766f8f 100644
--- a/ent/vod_update.go
+++ b/ent/vod_update.go
@@ -10,6 +10,7 @@ import (
 
 	"entgo.io/ent/dialect/sql"
 	"entgo.io/ent/dialect/sql/sqlgraph"
+	"entgo.io/ent/dialect/sql/sqljson"
 	"entgo.io/ent/schema/field"
 	"github.com/google/uuid"
 	"github.com/zibbp/ganymede/ent/channel"
@@ -50,6 +51,26 @@ func (vu *VodUpdate) SetNillableExtID(s *string) *VodUpdate {
 	return vu
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (vu *VodUpdate) SetClipExtVodID(s string) *VodUpdate {
+	vu.mutation.SetClipExtVodID(s)
+	return vu
+}
+
+// SetNillableClipExtVodID sets the "clip_ext_vod_id" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableClipExtVodID(s *string) *VodUpdate {
+	if s != nil {
+		vu.SetClipExtVodID(*s)
+	}
+	return vu
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (vu *VodUpdate) ClearClipExtVodID() *VodUpdate {
+	vu.mutation.ClearClipExtVodID()
+	return vu
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (vu *VodUpdate) SetExtStreamID(s string) *VodUpdate {
 	vu.mutation.SetExtStreamID(s)
@@ -133,6 +154,33 @@ func (vu *VodUpdate) AddDuration(i int) *VodUpdate {
 	return vu
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (vu *VodUpdate) SetClipVodOffset(i int) *VodUpdate {
+	vu.mutation.ResetClipVodOffset()
+	vu.mutation.SetClipVodOffset(i)
+	return vu
+}
+
+// SetNillableClipVodOffset sets the "clip_vod_offset" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableClipVodOffset(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetClipVodOffset(*i)
+	}
+	return vu
+}
+
+// AddClipVodOffset adds i to the "clip_vod_offset" field.
+func (vu *VodUpdate) AddClipVodOffset(i int) *VodUpdate {
+	vu.mutation.AddClipVodOffset(i)
+	return vu
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (vu *VodUpdate) ClearClipVodOffset() *VodUpdate {
+	vu.mutation.ClearClipVodOffset()
+	return vu
+}
+
 // SetViews sets the "views" field.
 func (vu *VodUpdate) SetViews(i int) *VodUpdate {
 	vu.mutation.ResetViews()
@@ -591,6 +639,173 @@ func (vu *VodUpdate) AddLocalViews(i int) *VodUpdate {
 	return vu
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (vu *VodUpdate) SetSpriteThumbnailsEnabled(b bool) *VodUpdate {
+	vu.mutation.SetSpriteThumbnailsEnabled(b)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsEnabled(b *bool) *VodUpdate {
+	if b != nil {
+		vu.SetSpriteThumbnailsEnabled(*b)
+	}
+	return vu
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (vu *VodUpdate) SetSpriteThumbnailsImages(s []string) *VodUpdate {
+	vu.mutation.SetSpriteThumbnailsImages(s)
+	return vu
+}
+
+// AppendSpriteThumbnailsImages appends s to the "sprite_thumbnails_images" field.
+func (vu *VodUpdate) AppendSpriteThumbnailsImages(s []string) *VodUpdate {
+	vu.mutation.AppendSpriteThumbnailsImages(s)
+	return vu
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsImages() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsImages()
+	return vu
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (vu *VodUpdate) SetSpriteThumbnailsInterval(i int) *VodUpdate {
+	vu.mutation.ResetSpriteThumbnailsInterval()
+	vu.mutation.SetSpriteThumbnailsInterval(i)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsInterval(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetSpriteThumbnailsInterval(*i)
+	}
+	return vu
+}
+
+// AddSpriteThumbnailsInterval adds i to the "sprite_thumbnails_interval" field.
+func (vu *VodUpdate) AddSpriteThumbnailsInterval(i int) *VodUpdate {
+	vu.mutation.AddSpriteThumbnailsInterval(i)
+	return vu
+}
+
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsInterval() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsInterval()
+	return vu
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (vu *VodUpdate) SetSpriteThumbnailsWidth(i int) *VodUpdate {
+	vu.mutation.ResetSpriteThumbnailsWidth()
+	vu.mutation.SetSpriteThumbnailsWidth(i)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsWidth(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetSpriteThumbnailsWidth(*i)
+	}
+	return vu
+}
+
+// AddSpriteThumbnailsWidth adds i to the "sprite_thumbnails_width" field.
+func (vu *VodUpdate) AddSpriteThumbnailsWidth(i int) *VodUpdate {
+	vu.mutation.AddSpriteThumbnailsWidth(i)
+	return vu
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsWidth() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsWidth()
+	return vu
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (vu *VodUpdate) SetSpriteThumbnailsHeight(i int) *VodUpdate {
+	vu.mutation.ResetSpriteThumbnailsHeight()
+	vu.mutation.SetSpriteThumbnailsHeight(i)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsHeight(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetSpriteThumbnailsHeight(*i)
+	}
+	return vu
+}
+
+// AddSpriteThumbnailsHeight adds i to the "sprite_thumbnails_height" field.
+func (vu *VodUpdate) AddSpriteThumbnailsHeight(i int) *VodUpdate {
+	vu.mutation.AddSpriteThumbnailsHeight(i)
+	return vu
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsHeight() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsHeight()
+	return vu
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (vu *VodUpdate) SetSpriteThumbnailsRows(i int) *VodUpdate {
+	vu.mutation.ResetSpriteThumbnailsRows()
+	vu.mutation.SetSpriteThumbnailsRows(i)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsRows(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetSpriteThumbnailsRows(*i)
+	}
+	return vu
+}
+
+// AddSpriteThumbnailsRows adds i to the "sprite_thumbnails_rows" field.
+func (vu *VodUpdate) AddSpriteThumbnailsRows(i int) *VodUpdate {
+	vu.mutation.AddSpriteThumbnailsRows(i)
+	return vu
+}
+
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsRows() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsRows()
+	return vu
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (vu *VodUpdate) SetSpriteThumbnailsColumns(i int) *VodUpdate {
+	vu.mutation.ResetSpriteThumbnailsColumns()
+	vu.mutation.SetSpriteThumbnailsColumns(i)
+	return vu
+}
+
+// SetNillableSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field if the given value is not nil.
+func (vu *VodUpdate) SetNillableSpriteThumbnailsColumns(i *int) *VodUpdate {
+	if i != nil {
+		vu.SetSpriteThumbnailsColumns(*i)
+	}
+	return vu
+}
+
+// AddSpriteThumbnailsColumns adds i to the "sprite_thumbnails_columns" field.
+func (vu *VodUpdate) AddSpriteThumbnailsColumns(i int) *VodUpdate {
+	vu.mutation.AddSpriteThumbnailsColumns(i)
+	return vu
+}
+
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (vu *VodUpdate) ClearSpriteThumbnailsColumns() *VodUpdate {
+	vu.mutation.ClearSpriteThumbnailsColumns()
+	return vu
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (vu *VodUpdate) SetStreamedAt(t time.Time) *VodUpdate {
 	vu.mutation.SetStreamedAt(t)
@@ -871,6 +1086,12 @@ func (vu *VodUpdate) sqlSave(ctx context.Context) (n int, err error) {
 	if value, ok := vu.mutation.ExtID(); ok {
 		_spec.SetField(vod.FieldExtID, field.TypeString, value)
 	}
+	if value, ok := vu.mutation.ClipExtVodID(); ok {
+		_spec.SetField(vod.FieldClipExtVodID, field.TypeString, value)
+	}
+	if vu.mutation.ClipExtVodIDCleared() {
+		_spec.ClearField(vod.FieldClipExtVodID, field.TypeString)
+	}
 	if value, ok := vu.mutation.ExtStreamID(); ok {
 		_spec.SetField(vod.FieldExtStreamID, field.TypeString, value)
 	}
@@ -892,6 +1113,15 @@ func (vu *VodUpdate) sqlSave(ctx context.Context) (n int, err error) {
 	if value, ok := vu.mutation.AddedDuration(); ok {
 		_spec.AddField(vod.FieldDuration, field.TypeInt, value)
 	}
+	if value, ok := vu.mutation.ClipVodOffset(); ok {
+		_spec.SetField(vod.FieldClipVodOffset, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedClipVodOffset(); ok {
+		_spec.AddField(vod.FieldClipVodOffset, field.TypeInt, value)
+	}
+	if vu.mutation.ClipVodOffsetCleared() {
+		_spec.ClearField(vod.FieldClipVodOffset, field.TypeInt)
+	}
 	if value, ok := vu.mutation.Views(); ok {
 		_spec.SetField(vod.FieldViews, field.TypeInt, value)
 	}
@@ -1024,6 +1254,65 @@ func (vu *VodUpdate) sqlSave(ctx context.Context) (n int, err error) {
 	if value, ok := vu.mutation.AddedLocalViews(); ok {
 		_spec.AddField(vod.FieldLocalViews, field.TypeInt, value)
 	}
+	if value, ok := vu.mutation.SpriteThumbnailsEnabled(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsEnabled, field.TypeBool, value)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsImages(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsImages, field.TypeJSON, value)
+	}
+	if value, ok := vu.mutation.AppendedSpriteThumbnailsImages(); ok {
+		_spec.AddModifier(func(u *sql.UpdateBuilder) {
+			sqljson.Append(u, vod.FieldSpriteThumbnailsImages, value)
+		})
+	}
+	if vu.mutation.SpriteThumbnailsImagesCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsImages, field.TypeJSON)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsInterval(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsInterval, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedSpriteThumbnailsInterval(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsInterval, field.TypeInt, value)
+	}
+	if vu.mutation.SpriteThumbnailsIntervalCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsInterval, field.TypeInt)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsWidth(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsWidth, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedSpriteThumbnailsWidth(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsWidth, field.TypeInt, value)
+	}
+	if vu.mutation.SpriteThumbnailsWidthCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsWidth, field.TypeInt)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsHeight(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsHeight, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedSpriteThumbnailsHeight(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsHeight, field.TypeInt, value)
+	}
+	if vu.mutation.SpriteThumbnailsHeightCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsHeight, field.TypeInt)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsRows(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsRows, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedSpriteThumbnailsRows(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsRows, field.TypeInt, value)
+	}
+	if vu.mutation.SpriteThumbnailsRowsCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsRows, field.TypeInt)
+	}
+	if value, ok := vu.mutation.SpriteThumbnailsColumns(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsColumns, field.TypeInt, value)
+	}
+	if value, ok := vu.mutation.AddedSpriteThumbnailsColumns(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsColumns, field.TypeInt, value)
+	}
+	if vu.mutation.SpriteThumbnailsColumnsCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsColumns, field.TypeInt)
+	}
 	if value, ok := vu.mutation.StreamedAt(); ok {
 		_spec.SetField(vod.FieldStreamedAt, field.TypeTime, value)
 	}
@@ -1302,6 +1591,26 @@ func (vuo *VodUpdateOne) SetNillableExtID(s *string) *VodUpdateOne {
 	return vuo
 }
 
+// SetClipExtVodID sets the "clip_ext_vod_id" field.
+func (vuo *VodUpdateOne) SetClipExtVodID(s string) *VodUpdateOne {
+	vuo.mutation.SetClipExtVodID(s)
+	return vuo
+}
+
+// SetNillableClipExtVodID sets the "clip_ext_vod_id" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableClipExtVodID(s *string) *VodUpdateOne {
+	if s != nil {
+		vuo.SetClipExtVodID(*s)
+	}
+	return vuo
+}
+
+// ClearClipExtVodID clears the value of the "clip_ext_vod_id" field.
+func (vuo *VodUpdateOne) ClearClipExtVodID() *VodUpdateOne {
+	vuo.mutation.ClearClipExtVodID()
+	return vuo
+}
+
 // SetExtStreamID sets the "ext_stream_id" field.
 func (vuo *VodUpdateOne) SetExtStreamID(s string) *VodUpdateOne {
 	vuo.mutation.SetExtStreamID(s)
@@ -1385,6 +1694,33 @@ func (vuo *VodUpdateOne) AddDuration(i int) *VodUpdateOne {
 	return vuo
 }
 
+// SetClipVodOffset sets the "clip_vod_offset" field.
+func (vuo *VodUpdateOne) SetClipVodOffset(i int) *VodUpdateOne {
+	vuo.mutation.ResetClipVodOffset()
+	vuo.mutation.SetClipVodOffset(i)
+	return vuo
+}
+
+// SetNillableClipVodOffset sets the "clip_vod_offset" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableClipVodOffset(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetClipVodOffset(*i)
+	}
+	return vuo
+}
+
+// AddClipVodOffset adds i to the "clip_vod_offset" field.
+func (vuo *VodUpdateOne) AddClipVodOffset(i int) *VodUpdateOne {
+	vuo.mutation.AddClipVodOffset(i)
+	return vuo
+}
+
+// ClearClipVodOffset clears the value of the "clip_vod_offset" field.
+func (vuo *VodUpdateOne) ClearClipVodOffset() *VodUpdateOne {
+	vuo.mutation.ClearClipVodOffset()
+	return vuo
+}
+
 // SetViews sets the "views" field.
 func (vuo *VodUpdateOne) SetViews(i int) *VodUpdateOne {
 	vuo.mutation.ResetViews()
@@ -1843,6 +2179,173 @@ func (vuo *VodUpdateOne) AddLocalViews(i int) *VodUpdateOne {
 	return vuo
 }
 
+// SetSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsEnabled(b bool) *VodUpdateOne {
+	vuo.mutation.SetSpriteThumbnailsEnabled(b)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsEnabled sets the "sprite_thumbnails_enabled" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsEnabled(b *bool) *VodUpdateOne {
+	if b != nil {
+		vuo.SetSpriteThumbnailsEnabled(*b)
+	}
+	return vuo
+}
+
+// SetSpriteThumbnailsImages sets the "sprite_thumbnails_images" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsImages(s []string) *VodUpdateOne {
+	vuo.mutation.SetSpriteThumbnailsImages(s)
+	return vuo
+}
+
+// AppendSpriteThumbnailsImages appends s to the "sprite_thumbnails_images" field.
+func (vuo *VodUpdateOne) AppendSpriteThumbnailsImages(s []string) *VodUpdateOne {
+	vuo.mutation.AppendSpriteThumbnailsImages(s)
+	return vuo
+}
+
+// ClearSpriteThumbnailsImages clears the value of the "sprite_thumbnails_images" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsImages() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsImages()
+	return vuo
+}
+
+// SetSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsInterval(i int) *VodUpdateOne {
+	vuo.mutation.ResetSpriteThumbnailsInterval()
+	vuo.mutation.SetSpriteThumbnailsInterval(i)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsInterval sets the "sprite_thumbnails_interval" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsInterval(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetSpriteThumbnailsInterval(*i)
+	}
+	return vuo
+}
+
+// AddSpriteThumbnailsInterval adds i to the "sprite_thumbnails_interval" field.
+func (vuo *VodUpdateOne) AddSpriteThumbnailsInterval(i int) *VodUpdateOne {
+	vuo.mutation.AddSpriteThumbnailsInterval(i)
+	return vuo
+}
+
+// ClearSpriteThumbnailsInterval clears the value of the "sprite_thumbnails_interval" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsInterval() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsInterval()
+	return vuo
+}
+
+// SetSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsWidth(i int) *VodUpdateOne {
+	vuo.mutation.ResetSpriteThumbnailsWidth()
+	vuo.mutation.SetSpriteThumbnailsWidth(i)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsWidth sets the "sprite_thumbnails_width" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsWidth(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetSpriteThumbnailsWidth(*i)
+	}
+	return vuo
+}
+
+// AddSpriteThumbnailsWidth adds i to the "sprite_thumbnails_width" field.
+func (vuo *VodUpdateOne) AddSpriteThumbnailsWidth(i int) *VodUpdateOne {
+	vuo.mutation.AddSpriteThumbnailsWidth(i)
+	return vuo
+}
+
+// ClearSpriteThumbnailsWidth clears the value of the "sprite_thumbnails_width" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsWidth() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsWidth()
+	return vuo
+}
+
+// SetSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsHeight(i int) *VodUpdateOne {
+	vuo.mutation.ResetSpriteThumbnailsHeight()
+	vuo.mutation.SetSpriteThumbnailsHeight(i)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsHeight sets the "sprite_thumbnails_height" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsHeight(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetSpriteThumbnailsHeight(*i)
+	}
+	return vuo
+}
+
+// AddSpriteThumbnailsHeight adds i to the "sprite_thumbnails_height" field.
+func (vuo *VodUpdateOne) AddSpriteThumbnailsHeight(i int) *VodUpdateOne {
+	vuo.mutation.AddSpriteThumbnailsHeight(i)
+	return vuo
+}
+
+// ClearSpriteThumbnailsHeight clears the value of the "sprite_thumbnails_height" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsHeight() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsHeight()
+	return vuo
+}
+
+// SetSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsRows(i int) *VodUpdateOne {
+	vuo.mutation.ResetSpriteThumbnailsRows()
+	vuo.mutation.SetSpriteThumbnailsRows(i)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsRows sets the "sprite_thumbnails_rows" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsRows(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetSpriteThumbnailsRows(*i)
+	}
+	return vuo
+}
+
+// AddSpriteThumbnailsRows adds i to the "sprite_thumbnails_rows" field.
+func (vuo *VodUpdateOne) AddSpriteThumbnailsRows(i int) *VodUpdateOne {
+	vuo.mutation.AddSpriteThumbnailsRows(i)
+	return vuo
+}
+
+// ClearSpriteThumbnailsRows clears the value of the "sprite_thumbnails_rows" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsRows() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsRows()
+	return vuo
+}
+
+// SetSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field.
+func (vuo *VodUpdateOne) SetSpriteThumbnailsColumns(i int) *VodUpdateOne {
+	vuo.mutation.ResetSpriteThumbnailsColumns()
+	vuo.mutation.SetSpriteThumbnailsColumns(i)
+	return vuo
+}
+
+// SetNillableSpriteThumbnailsColumns sets the "sprite_thumbnails_columns" field if the given value is not nil.
+func (vuo *VodUpdateOne) SetNillableSpriteThumbnailsColumns(i *int) *VodUpdateOne {
+	if i != nil {
+		vuo.SetSpriteThumbnailsColumns(*i)
+	}
+	return vuo
+}
+
+// AddSpriteThumbnailsColumns adds i to the "sprite_thumbnails_columns" field.
+func (vuo *VodUpdateOne) AddSpriteThumbnailsColumns(i int) *VodUpdateOne {
+	vuo.mutation.AddSpriteThumbnailsColumns(i)
+	return vuo
+}
+
+// ClearSpriteThumbnailsColumns clears the value of the "sprite_thumbnails_columns" field.
+func (vuo *VodUpdateOne) ClearSpriteThumbnailsColumns() *VodUpdateOne {
+	vuo.mutation.ClearSpriteThumbnailsColumns()
+	return vuo
+}
+
 // SetStreamedAt sets the "streamed_at" field.
 func (vuo *VodUpdateOne) SetStreamedAt(t time.Time) *VodUpdateOne {
 	vuo.mutation.SetStreamedAt(t)
@@ -2153,6 +2656,12 @@ func (vuo *VodUpdateOne) sqlSave(ctx context.Context) (_node *Vod, err error) {
 	if value, ok := vuo.mutation.ExtID(); ok {
 		_spec.SetField(vod.FieldExtID, field.TypeString, value)
 	}
+	if value, ok := vuo.mutation.ClipExtVodID(); ok {
+		_spec.SetField(vod.FieldClipExtVodID, field.TypeString, value)
+	}
+	if vuo.mutation.ClipExtVodIDCleared() {
+		_spec.ClearField(vod.FieldClipExtVodID, field.TypeString)
+	}
 	if value, ok := vuo.mutation.ExtStreamID(); ok {
 		_spec.SetField(vod.FieldExtStreamID, field.TypeString, value)
 	}
@@ -2174,6 +2683,15 @@ func (vuo *VodUpdateOne) sqlSave(ctx context.Context) (_node *Vod, err error) {
 	if value, ok := vuo.mutation.AddedDuration(); ok {
 		_spec.AddField(vod.FieldDuration, field.TypeInt, value)
 	}
+	if value, ok := vuo.mutation.ClipVodOffset(); ok {
+		_spec.SetField(vod.FieldClipVodOffset, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedClipVodOffset(); ok {
+		_spec.AddField(vod.FieldClipVodOffset, field.TypeInt, value)
+	}
+	if vuo.mutation.ClipVodOffsetCleared() {
+		_spec.ClearField(vod.FieldClipVodOffset, field.TypeInt)
+	}
 	if value, ok := vuo.mutation.Views(); ok {
 		_spec.SetField(vod.FieldViews, field.TypeInt, value)
 	}
@@ -2306,6 +2824,65 @@ func (vuo *VodUpdateOne) sqlSave(ctx context.Context) (_node *Vod, err error) {
 	if value, ok := vuo.mutation.AddedLocalViews(); ok {
 		_spec.AddField(vod.FieldLocalViews, field.TypeInt, value)
 	}
+	if value, ok := vuo.mutation.SpriteThumbnailsEnabled(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsEnabled, field.TypeBool, value)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsImages(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsImages, field.TypeJSON, value)
+	}
+	if value, ok := vuo.mutation.AppendedSpriteThumbnailsImages(); ok {
+		_spec.AddModifier(func(u *sql.UpdateBuilder) {
+			sqljson.Append(u, vod.FieldSpriteThumbnailsImages, value)
+		})
+	}
+	if vuo.mutation.SpriteThumbnailsImagesCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsImages, field.TypeJSON)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsInterval(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsInterval, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedSpriteThumbnailsInterval(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsInterval, field.TypeInt, value)
+	}
+	if vuo.mutation.SpriteThumbnailsIntervalCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsInterval, field.TypeInt)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsWidth(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsWidth, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedSpriteThumbnailsWidth(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsWidth, field.TypeInt, value)
+	}
+	if vuo.mutation.SpriteThumbnailsWidthCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsWidth, field.TypeInt)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsHeight(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsHeight, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedSpriteThumbnailsHeight(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsHeight, field.TypeInt, value)
+	}
+	if vuo.mutation.SpriteThumbnailsHeightCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsHeight, field.TypeInt)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsRows(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsRows, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedSpriteThumbnailsRows(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsRows, field.TypeInt, value)
+	}
+	if vuo.mutation.SpriteThumbnailsRowsCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsRows, field.TypeInt)
+	}
+	if value, ok := vuo.mutation.SpriteThumbnailsColumns(); ok {
+		_spec.SetField(vod.FieldSpriteThumbnailsColumns, field.TypeInt, value)
+	}
+	if value, ok := vuo.mutation.AddedSpriteThumbnailsColumns(); ok {
+		_spec.AddField(vod.FieldSpriteThumbnailsColumns, field.TypeInt, value)
+	}
+	if vuo.mutation.SpriteThumbnailsColumnsCleared() {
+		_spec.ClearField(vod.FieldSpriteThumbnailsColumns, field.TypeInt)
+	}
 	if value, ok := vuo.mutation.StreamedAt(); ok {
 		_spec.SetField(vod.FieldStreamedAt, field.TypeTime, value)
 	}
diff --git a/entrypoint.sh b/entrypoint.sh
index 10bf40e2..82cc3365 100644
--- a/entrypoint.sh
+++ b/entrypoint.sh
@@ -33,15 +33,5 @@ gosu abc fc-cache -f
 export DOTNET_BUNDLE_EXTRACT_BASE_DIR=/tmp
 export FONTCONFIG_CACHE=/var/cache/fontconfig
 
-# start api and worker as user abc
-gosu abc /opt/app/ganymede-api &
-api_pid=$!
-
-# delay 5 seconds to wait for api to start
-sleep 5
-
-gosu abc /opt/app/ganymede-worker &
-worker_pid=$!
-
-# wait
-wait $api_pid $worker_pid
\ No newline at end of file
+# start applications
+/usr/bin/supervisord -c /opt/app/supervisord.conf
\ No newline at end of file
diff --git a/frontend/.eslintrc.json b/frontend/.eslintrc.json
new file mode 100644
index 00000000..37224185
--- /dev/null
+++ b/frontend/.eslintrc.json
@@ -0,0 +1,3 @@
+{
+  "extends": ["next/core-web-vitals", "next/typescript"]
+}
diff --git a/frontend/.gitignore b/frontend/.gitignore
new file mode 100644
index 00000000..44fdeff2
--- /dev/null
+++ b/frontend/.gitignore
@@ -0,0 +1,42 @@
+# See https://help.github.com/articles/ignoring-files/ for more about ignoring files.
+
+# dependencies
+/node_modules
+/.pnp
+.pnp.*
+.yarn/*
+!.yarn/patches
+!.yarn/plugins
+!.yarn/releases
+!.yarn/versions
+
+# testing
+/coverage
+
+# next.js
+/.next/
+/out/
+
+# production
+/build
+
+# misc
+.DS_Store
+*.pem
+
+# debug
+npm-debug.log*
+yarn-debug.log*
+yarn-error.log*
+
+# env files (can opt-in for committing if needed)
+.env*
+
+# vercel
+.vercel
+
+# typescript
+*.tsbuildinfo
+next-env.d.ts
+
+certificates
\ No newline at end of file
diff --git a/frontend/.vscode/extensions.json b/frontend/.vscode/extensions.json
new file mode 100644
index 00000000..7d608d2a
--- /dev/null
+++ b/frontend/.vscode/extensions.json
@@ -0,0 +1,11 @@
+{
+  "recommendations": [
+    "burkeholland.simple-react-snippets",
+    "esbenp.prettier-vscode",
+    "vunguyentuan.vscode-postcss",
+    "eamodio.gitlens",
+    "dbaeumer.vscode-eslint",
+    "vunguyentuan.vscode-css-variables",
+    "naumovs.color-highlight"
+  ]
+}
\ No newline at end of file
diff --git a/frontend/.vscode/settings.json b/frontend/.vscode/settings.json
new file mode 100644
index 00000000..076b96ee
--- /dev/null
+++ b/frontend/.vscode/settings.json
@@ -0,0 +1,9 @@
+{
+  "cssVariables.lookupFiles": [
+    "**/*.css",
+    "**/*.scss",
+    "**/*.sass",
+    "**/*.less",
+    "node_modules/@mantine/core/styles.css"
+  ]
+}
\ No newline at end of file
diff --git a/frontend/Dockerfile b/frontend/Dockerfile
new file mode 100644
index 00000000..09f9b694
--- /dev/null
+++ b/frontend/Dockerfile
@@ -0,0 +1,70 @@
+# syntax=docker.io/docker/dockerfile:1
+
+FROM node:22-alpine AS base
+
+# Install dependencies only when needed
+FROM base AS deps
+# Check https://github.com/nodejs/docker-node/tree/b4117f9333da4138b03a546ec926ef50a31506c3#nodealpine to understand why libc6-compat might be needed.
+RUN apk add --no-cache libc6-compat
+WORKDIR /app
+
+# Install dependencies based on the preferred package manager
+COPY package.json yarn.lock* package-lock.json* pnpm-lock.yaml* .npmrc* ./
+RUN \
+  if [ -f yarn.lock ]; then yarn --frozen-lockfile; \
+  elif [ -f package-lock.json ]; then npm ci --force; \
+  elif [ -f pnpm-lock.yaml ]; then corepack enable pnpm && pnpm i --frozen-lockfile; \
+  else echo "Lockfile not found." && exit 1; \
+  fi
+
+
+# Rebuild the source code only when needed
+FROM base AS builder
+WORKDIR /app
+COPY --from=deps /app/node_modules ./node_modules
+COPY . .
+
+# Next.js collects completely anonymous telemetry data about general usage.
+# Learn more here: https://nextjs.org/telemetry
+# Uncomment the following line in case you want to disable telemetry during the build.
+ENV NEXT_TELEMETRY_DISABLED=1
+
+RUN \
+  if [ -f yarn.lock ]; then yarn run build; \
+  elif [ -f package-lock.json ]; then npm run build; \
+  elif [ -f pnpm-lock.yaml ]; then corepack enable pnpm && pnpm run build; \
+  else echo "Lockfile not found." && exit 1; \
+  fi
+
+# Production image, copy all the files and run next
+FROM base AS runner
+WORKDIR /app
+
+ENV NODE_ENV=production
+# Uncomment the following line in case you want to disable telemetry during runtime.
+ENV NEXT_TELEMETRY_DISABLED=1
+
+RUN addgroup --system --gid 1001 nodejs
+RUN adduser --system --uid 1001 nextjs
+
+COPY --from=builder /app/public ./public
+
+# Set the correct permission for prerender cache
+RUN mkdir .next
+RUN chown nextjs:nodejs .next
+
+# Automatically leverage output traces to reduce image size
+# https://nextjs.org/docs/advanced-features/output-file-tracing
+COPY --from=builder --chown=nextjs:nodejs /app/.next/standalone ./
+COPY --from=builder --chown=nextjs:nodejs /app/.next/static ./.next/static
+
+USER nextjs
+
+EXPOSE 3000
+
+ENV PORT=3000
+
+# server.js is created by next build from the standalone output
+# https://nextjs.org/docs/pages/api-reference/next-config-js/output
+ENV HOSTNAME="0.0.0.0"
+CMD ["node", "server.js"]
\ No newline at end of file
diff --git a/frontend/README.md b/frontend/README.md
new file mode 100644
index 00000000..db4b38bd
--- /dev/null
+++ b/frontend/README.md
@@ -0,0 +1,3 @@
+# Ganymede Frontend 
+
+Ganymede frontend is a [Next.js](https://nextjs.org) project.
diff --git a/frontend/app/admin/blocked-videos/AdminBlockedVideosPage.module.css b/frontend/app/admin/blocked-videos/AdminBlockedVideosPage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/blocked-videos/AdminBlockedVideosPage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/blocked-videos/page.tsx b/frontend/app/admin/blocked-videos/page.tsx
new file mode 100644
index 00000000..c0eff2ec
--- /dev/null
+++ b/frontend/app/admin/blocked-videos/page.tsx
@@ -0,0 +1,169 @@
+"use client"
+import { ActionIcon, Container, Group, TextInput, Title, Box, Button, Drawer, Modal, Text } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useEffect, useState } from "react";
+import sortBy from "lodash/sortBy";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { IconSearch, IconTrash } from "@tabler/icons-react";
+import dayjs from "dayjs";
+
+import classes from "./AdminBlockedVideosPage.module.css"
+import { BlockedVideo, useGetBlockedVideos } from "@/app/hooks/useBlockedVideos";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import DeleteBlockedVideoModalContent from "@/app/components/admin/blocked-videos/DeleteModalContent";
+import AdminBlockedVideosDrawerContent from "@/app/components/admin/blocked-videos/DrawerContent";
+
+const AdminBlockedVideosPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Blocked Videos";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<BlockedVideo[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<BlockedVideo>>({
+    columnAccessor: "id",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeBlockedVideo, setActiveBlockedVideo] = useState<BlockedVideo | null>(null);
+
+  const [blockedVideoDrawerOpened, { open: openBlockedVideoDrawer, close: closeBlockedVideoDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+  const axiosPrivate = useAxiosPrivate()
+
+  const { data: blockedVideos, isPending, isError } = useGetBlockedVideos(axiosPrivate)
+
+  useEffect(() => {
+    if (!blockedVideos) return;
+
+    let filteredData = [...blockedVideos] as BlockedVideo[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((blockedVideo) => {
+        return (
+          blockedVideo.id.toString().includes(debouncedQuery)
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [blockedVideos, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const handleDeleteModal = (blockedVideo: BlockedVideo) => {
+    setActiveBlockedVideo(blockedVideo);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Blocked Videos" />
+  )
+  if (isError) return <div>Error loading blocked videos</div>
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Blocked Videos</Title>
+          <Box>
+            <Button
+              onClick={() => {
+                setActiveBlockedVideo(null)
+                openBlockedVideoDrawer()
+              }}
+              mr={5}
+              variant="default"
+            >
+              Add Blocked Video ID
+            </Button>
+          </Box>
+        </Group>
+
+        <Text>External platform video IDs that are blocked from being archived.</Text>
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search blocked videos..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<BlockedVideo>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover
+            records={records}
+            columns={[
+              { accessor: "id", title: "ID" },
+              {
+                accessor: "created_at",
+                title: "Created At",
+                sortable: true,
+                render: ({ created_at }) => (
+                  <div>{dayjs(created_at).format("YYYY/MM/DD")}</div>
+                ),
+              },
+              {
+                accessor: "actions",
+                title: "Actions",
+                render: (blockedVideo) => (
+                  <Group>
+                    <ActionIcon
+                      onClick={() => handleDeleteModal(blockedVideo)}
+                      className={classes.actionButton}
+                      variant="light"
+                      color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Group>
+                ),
+              },
+            ]}
+            totalRecords={blockedVideos?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={blockedVideoDrawerOpened} onClose={closeBlockedVideoDrawer} position="right" title="Channel">
+        <AdminBlockedVideosDrawerContent blockedVideo={activeBlockedVideo} handleClose={closeBlockedVideoDrawer} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Channel">
+        {activeBlockedVideo && (
+          <DeleteBlockedVideoModalContent blockedVideo={activeBlockedVideo} handleClose={closeDeleteModal} />
+        )}
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminBlockedVideosPage;
\ No newline at end of file
diff --git a/frontend/app/admin/channels/AdminChannelsPage.module.css b/frontend/app/admin/channels/AdminChannelsPage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/channels/AdminChannelsPage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/channels/page.tsx b/frontend/app/admin/channels/page.tsx
new file mode 100644
index 00000000..bbf16ae4
--- /dev/null
+++ b/frontend/app/admin/channels/page.tsx
@@ -0,0 +1,208 @@
+"use client"
+import { Channel, useFetchChannels } from "@/app/hooks/useChannels";
+import { ActionIcon, Container, Group, TextInput, Title, Box, Button, Drawer, Modal } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useEffect, useState } from "react";
+import sortBy from "lodash/sortBy";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { IconPencil, IconSearch, IconTrash } from "@tabler/icons-react";
+import dayjs from "dayjs";
+
+import classes from "./AdminChannelsPage.module.css"
+import AdminChannelDrawerContent, { ChannelEditMode } from "@/app/components/admin/channel/DrawerContent";
+import PlatformChannelDrawerContent from "@/app/components/admin/channel/PlatformDrawerContent";
+import DeleteChannelModalContent from "@/app/components/admin/channel/DeleteModalContent";
+
+const AdminChannelsPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Channels";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<Channel[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<Channel>>({
+    columnAccessor: "name",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeChannel, setActiveChannel] = useState<Channel | null>(null);
+  const [drawerEditMode, setDrawerEditMode] = useState<ChannelEditMode>(ChannelEditMode.Create)
+
+  const [channelDrawerOpened, { open: openChannelDrawer, close: closeChannelDrawer }] = useDisclosure(false);
+  const [platformChannelDrawerOpened, { open: openPlatformChannelDrawer, close: closePlatformChannelDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+
+  const { data: channels, isPending, isError } = useFetchChannels()
+
+  useEffect(() => {
+    if (!channels) return;
+
+    let filteredData = [...channels] as Channel[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((channel) => {
+        return (
+          channel.id.toString().includes(debouncedQuery) ||
+          channel.name.toLowerCase().includes(debouncedQuery.toLowerCase()) ||
+          channel.display_name.toLowerCase().includes(debouncedQuery.toLowerCase())
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [channels, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const openDrawer = (mode: ChannelEditMode, channel: Channel) => {
+    setActiveChannel(channel);
+    setDrawerEditMode(ChannelEditMode.Edit)
+    openChannelDrawer()
+    // setDrawerOpened(true);
+  };
+
+  const handleDeleteModal = (channel: Channel) => {
+    setActiveChannel(channel);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Channels" />
+  )
+  if (isError) return <div>Error loading channels</div>
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Channels</Title>
+          <Box>
+            <Button
+              onClick={() => {
+                setDrawerEditMode(ChannelEditMode.Create)
+                setActiveChannel(null)
+                openChannelDrawer()
+              }}
+              mr={5}
+              variant="default"
+            >
+              Create Channel
+            </Button>
+            <Button
+              onClick={openPlatformChannelDrawer}
+              color="violet"
+            >
+              Add Twitch Channel
+            </Button>
+          </Box>
+        </Group>
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search channels..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<Channel>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover
+            records={records}
+            columns={[
+              { accessor: "id", title: "ID" },
+              { accessor: "ext_id", title: "External ID" },
+              { accessor: "name", title: "Name", sortable: true },
+              { accessor: "display_name", title: "Display Name", sortable: true },
+              {
+                accessor: "retention",
+                title: "Video Retention",
+                sortable: false,
+                render: ({ retention }) => (
+                  retention ? (
+                    <div>✅</div>
+                  ) : (
+                    <div>❌</div>
+                  )
+                ),
+              },
+              {
+                accessor: "created_at",
+                title: "Created At",
+                sortable: true,
+                render: ({ created_at }) => (
+                  <div>{dayjs(created_at).format("YYYY/MM/DD")}</div>
+                ),
+              },
+              {
+                accessor: "actions",
+                title: "Actions",
+                render: (channel) => (
+                  <Group>
+                    <ActionIcon
+                      onClick={() => openDrawer(ChannelEditMode.Edit, channel)}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconPencil size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      onClick={() => handleDeleteModal(channel)}
+                      className={classes.actionButton}
+                      variant="light"
+                      color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Group>
+                ),
+              },
+            ]}
+            totalRecords={channels?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={channelDrawerOpened} onClose={closeChannelDrawer} position="right" title="Channel">
+        <AdminChannelDrawerContent mode={drawerEditMode} channel={activeChannel} handleClose={closeChannelDrawer} />
+      </Drawer>
+      <Drawer opened={platformChannelDrawerOpened} onClose={closePlatformChannelDrawer} position="right" title="Platform Channel">
+        <PlatformChannelDrawerContent handleClose={closePlatformChannelDrawer} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Channel">
+        <DeleteChannelModalContent channel={activeChannel} handleClose={closeDeleteModal} />
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminChannelsPage;
\ No newline at end of file
diff --git a/frontend/app/admin/info/AdminInformationPage.module.css b/frontend/app/admin/info/AdminInformationPage.module.css
new file mode 100644
index 00000000..affb1415
--- /dev/null
+++ b/frontend/app/admin/info/AdminInformationPage.module.css
@@ -0,0 +1,3 @@
+.link {
+  color: var(--mantine-color-blue-6);
+}
diff --git a/frontend/app/admin/info/page.tsx b/frontend/app/admin/info/page.tsx
new file mode 100644
index 00000000..ff35b705
--- /dev/null
+++ b/frontend/app/admin/info/page.tsx
@@ -0,0 +1,74 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { useGetGanymedeInformation } from "@/app/hooks/useAdmin";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Card, Container, Flex, Title, Text, Code } from "@mantine/core";
+import Link from "next/link";
+import classes from "./AdminInformationPage.module.css"
+import { useEffect } from "react";
+
+const AdminInformationPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Info";
+  }, []);
+  const axiosPrivate = useAxiosPrivate()
+
+  const { data, isPending, isError } = useGetGanymedeInformation(axiosPrivate)
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Ganymde Information" />
+  )
+  if (isError) return <div>Error loading Ganymede information</div>
+
+
+  return (
+    <div>
+      <Container mt={15}>
+        <Card withBorder p="xl" radius={"sm"}>
+          {/* server info */}
+          <div>
+            <Title>
+              Server
+            </Title>
+            <Flex>
+              <Text>Commit:</Text>
+              <Code ml={5}>{data.commit_hash}</Code>
+            </Flex>
+            <Flex>
+              <Text>Build Date:</Text>
+              <Code ml={5}>{data.build_time}</Code>
+            </Flex>
+            <Flex>
+              <Text>Uptime:</Text>
+              <Code ml={5}>{data.uptime}</Code>
+            </Flex>
+          </div>
+          {/* package info */}
+          <div>
+            <Title>
+              Package Versions
+            </Title>
+            <Flex>
+              <Text component={Link} href="https://github.com/lay295/TwitchDownloader" target="_blank" className={classes.link}>TwitchDownloader:</Text>
+              <Code ml={5}>{data.program_versions.twitch_downloader}</Code>
+            </Flex>
+            <Flex>
+              <Text component={Link} href="https://github.com/xenova/chat-downloader" target="_blank" className={classes.link}>Chat-Downloader:</Text>
+              <Code ml={5}>{data.program_versions.chat_downloader}</Code>
+            </Flex>
+            <Flex>
+              <Text component={Link} href="https://github.com/streamlink/streamlink" target="_blank" className={classes.link}>Streamlink:</Text>
+              <Code ml={5}>{data.program_versions.streamlink}</Code>
+            </Flex>
+            <div>
+              <Text component={Link} href="https://www.ffmpeg.org/" target="_blank" className={classes.link}>FFmpeg:</Text>
+              <Code ml={5} block>{data.program_versions.ffmpeg}</Code>
+            </div>
+          </div>
+        </Card>
+      </Container>
+    </div>
+  );
+}
+
+export default AdminInformationPage;
\ No newline at end of file
diff --git a/frontend/app/admin/queue/AdminQueuePage.module.css b/frontend/app/admin/queue/AdminQueuePage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/queue/AdminQueuePage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/queue/page.tsx b/frontend/app/admin/queue/page.tsx
new file mode 100644
index 00000000..560100fb
--- /dev/null
+++ b/frontend/app/admin/queue/page.tsx
@@ -0,0 +1,228 @@
+"use client"
+import { ActionIcon, Container, Group, TextInput, Title, Box, Drawer, Modal, Tooltip, Text } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useEffect, useState } from "react";
+import sortBy from "lodash/sortBy";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { IconEye, IconPencil, IconSearch, IconTrash } from "@tabler/icons-react";
+import dayjs from "dayjs";
+import classes from "./AdminQueuePage.module.css"
+import { Queue, useGetQueueItems } from "@/app/hooks/useQueue";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import AdminQueueDrawerContent from "@/app/components/admin/queue/DrawerContent";
+import DeleteQueueModalContent from "@/app/components/admin/queue/DeleteModalContent";
+import Link from "next/link";
+
+const AdminQueuePage = () => {
+  useEffect(() => {
+    document.title = "Admin - Queue";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<Queue[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<Queue>>({
+    columnAccessor: "name",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeQueue, setActiveQueue] = useState<Queue | null>(null);
+
+  const [queueDrawerOpened, { open: openQueueDrawer, close: closeQueueDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+  const axiosPrivate = useAxiosPrivate()
+  const { data: queues, isPending, isError } = useGetQueueItems(axiosPrivate, false)
+
+  useEffect(() => {
+    if (!queues) return;
+
+    let filteredData = [...queues] as Queue[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((queue) => {
+        return (
+          queue.id.toString().includes(debouncedQuery)
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [queues, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const openDrawer = (queue: Queue) => {
+    setActiveQueue(queue);
+    openQueueDrawer()
+  };
+
+  const handleDeleteModal = (queue: Queue) => {
+    setActiveQueue(queue);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading queue items" />
+  )
+  if (isError) return <div>Error loading queue items</div>
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Queue</Title>
+        </Group>
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search queue items..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<Queue>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover
+            records={records}
+            columns={[
+              {
+                accessor: "id", title: "ID",
+                render: ({ id }) => (
+                  <Tooltip label={id}>
+                    <Text lineClamp={1}>{id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "edges.vod.id", title: "Video ID", sortable: true,
+                render: (queue) => (
+                  <Tooltip label={queue.edges.vod.id}>
+                    <Text lineClamp={1}>{queue.edges.vod.id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "edges.vod.ext_id",
+                title: "External Video ID",
+                sortable: true,
+                render: (queue) => (
+                  <Tooltip label={queue.edges.vod.ext_id}>
+                    <Text lineClamp={1}>{queue.edges.vod.ext_id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "processing",
+                title: "Processing",
+                sortable: true,
+                render: ({ processing }) => {
+                  return processing ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "on_hold",
+                title: "On Hold",
+                sortable: true,
+                render: ({ on_hold }) => {
+                  return on_hold ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "live_archive",
+                title: "Live Archive",
+                sortable: true,
+                render: ({ live_archive }) => {
+                  return live_archive ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "created_at",
+                title: "Created At",
+                sortable: true,
+                render: ({ created_at }) => (
+                  <div>{dayjs(created_at).format("YYYY/MM/DD")}</div>
+                ),
+              },
+              {
+                accessor: "actions",
+                title: "Actions",
+                width: "150px",
+                render: (queue) => (
+                  <Group>
+                    <ActionIcon
+                      component={Link}
+                      href={`/queue/${queue.id}`}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconEye size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      onClick={() => openDrawer(queue)}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconPencil size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      onClick={() => handleDeleteModal(queue)}
+                      className={classes.actionButton}
+                      variant="light"
+                      color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Group>
+                ),
+              },
+            ]}
+            totalRecords={queues?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={queueDrawerOpened} onClose={closeQueueDrawer} position="right" title="Queue">
+        {activeQueue && (
+          <AdminQueueDrawerContent queue={activeQueue} handleClose={closeQueueDrawer} />
+        )}
+      </Drawer>
+
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Queue">
+        {activeQueue && (
+          <DeleteQueueModalContent queue={activeQueue} handleClose={closeDeleteModal} />
+        )}
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminQueuePage;
\ No newline at end of file
diff --git a/frontend/app/admin/settings/AdminSettingsPage.module.css b/frontend/app/admin/settings/AdminSettingsPage.module.css
new file mode 100644
index 00000000..7850c73c
--- /dev/null
+++ b/frontend/app/admin/settings/AdminSettingsPage.module.css
@@ -0,0 +1,12 @@
+.link {
+  color: var(--mantine-color-blue-6);
+}
+.proxyList {
+  display: flex;
+  align-items: center;
+  justify-content: space-between;
+}
+.proxyInput {
+  width: 100%;
+  margin-right: 1rem;
+}
diff --git a/frontend/app/admin/settings/page.tsx b/frontend/app/admin/settings/page.tsx
new file mode 100644
index 00000000..42413cff
--- /dev/null
+++ b/frontend/app/admin/settings/page.tsx
@@ -0,0 +1,541 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText"
+import { useAxiosPrivate } from "@/app/hooks/useAxios"
+import { Config, NotificationType, ProxyListItem, useEditConfig, useGetConfig, useTestNotification } from "@/app/hooks/useConfig"
+import { ActionIcon, Button, Card, Checkbox, Code, Collapse, Container, Flex, MultiSelect, Text, Textarea, TextInput, Title } from "@mantine/core"
+import { useForm } from "@mantine/form"
+import { useDisclosure } from "@mantine/hooks"
+import Link from "next/link"
+import { useEffect, useState } from "react"
+import classes from "./AdminSettingsPage.module.css"
+import { IconPlus, IconTrash } from "@tabler/icons-react"
+import { Channel, useFetchChannels } from "@/app/hooks/useChannels"
+import { showNotification } from "@mantine/notifications"
+
+interface SelectOption {
+  label: string;
+  value: string;
+}
+
+const AdminSettingsPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Settings";
+  }, []);
+  const [notificationsOpened, { toggle: toggleNotifications }] = useDisclosure(false);
+  const [storageTemplateOpened, { toggle: toggleStorageTemplate }] = useDisclosure(false);
+  const [channelSelect, setChannelSelect] = useState<SelectOption[]>([]);
+  const axiosPrivate = useAxiosPrivate()
+
+  const testNotificationMutate = useTestNotification()
+
+  const editConfigMutate = useEditConfig()
+
+  const { data, isPending, isError } = useGetConfig(axiosPrivate)
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      registration_enabled: data?.registration_enabled ?? true,
+      parameters: {
+        twitch_token: data?.parameters.twitch_token || "",
+        video_convert: data?.parameters.video_convert || "",
+        chat_render: data?.parameters.chat_render || "",
+        streamlink_live: data?.parameters.streamlink_live || "",
+      },
+      archive: {
+        save_as_hls: data?.archive.save_as_hls ?? false,
+      },
+      notifications: {
+        video_success_webhook_url: data?.notifications.video_success_webhook_url || "",
+        video_success_template: data?.notifications.video_success_template || "",
+        video_success_enabled: data?.notifications.video_success_enabled ?? false,
+        live_success_webhook_url: data?.notifications.live_success_webhook_url || "",
+        live_success_template: data?.notifications.live_success_template || "",
+        live_success_enabled: data?.notifications.live_success_enabled ?? false,
+        error_webhook_url: data?.notifications.error_webhook_url || "",
+        error_template: data?.notifications.error_template || "",
+        error_enabled: data?.notifications.error_enabled ?? false,
+        is_live_webhook_url: data?.notifications.is_live_webhook_url || "",
+        is_live_template: data?.notifications.is_live_template || "",
+        is_live_enabled: data?.notifications.is_live_enabled ?? false,
+      },
+      storage_templates: {
+        folder_template: data?.storage_templates.folder_template || "",
+        file_template: data?.storage_templates.file_template || "",
+      },
+      livestream: {
+        proxies: data?.livestream.proxies || [],
+        proxy_enabled: data?.livestream.proxy_enabled ?? true,
+        proxy_whitelist: data?.livestream.proxy_whitelist || [],
+      }
+    }
+  })
+
+  useEffect(() => {
+    if (!data || !form) return
+
+    form.setValues(data)
+    form.resetDirty(data)
+
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [data])
+
+  const folderExample1 = "{{id}}-{{uuid}}";
+  const folderExample2 = "{{date}}-{{title}}-{{type}}-{{id}}-{{uuid}}";
+  const fileExample1 = "{{id}}";
+
+  const { data: channels } = useFetchChannels();
+
+  useEffect(() => {
+    if (!channels) return;
+
+    const transformedChannels: SelectOption[] = channels.map((channel: Channel) => ({
+      label: channel.name,
+      value: channel.name,
+    }));
+
+    setChannelSelect(transformedChannels);
+  }, [channels]);
+
+  const handleSubmitForm = async () => {
+    try {
+      const formValues = form.getValues()
+
+      const submitConfig: Config = { ...formValues }
+
+      await editConfigMutate.mutateAsync({
+        axiosPrivate,
+        config: submitConfig
+      });
+
+      showNotification({
+        message: "Settings Saved",
+        color: "green"
+      });
+
+    } catch (error) {
+      console.error(error);
+    }
+  }
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading settings" />
+  )
+  if (isError) return <div>Error loading settings</div>
+
+  return (
+    <div>
+      <Container mt={15}>
+        <Card withBorder p="xl" radius={"sm"}>
+          <form onSubmit={form.onSubmit(() => {
+            handleSubmitForm()
+          })}>
+            <Title>Settings</Title>
+            <Text>Visit the <a href="https://github.com/Zibbp/ganymede/wiki/Application-Settings" target="_blank">wiki</a> for documentation about each setting.</Text>
+
+            <Title order={3}>Application</Title>
+            <Checkbox
+              mt={10}
+              label="Registration Enabled"
+              key={form.key('registration_enabled')}
+              {...form.getInputProps('registration_enabled', { type: "checkbox" })}
+            />
+
+            <Button
+              mt={15}
+              onClick={toggleNotifications}
+              fullWidth
+              radius="md"
+              size="md"
+              variant="outline"
+              color="orange"
+            >
+              Notification Settings
+            </Button>
+
+            <Collapse in={notificationsOpened}>
+              <Text>Must be a webhook URL or an Apprise HTTP URL, visit the <a href="https://github.com/Zibbp/ganymede/wiki/Notifications" target="_blank">wiki</a> for more information.</Text>
+
+              {/* video archive success */}
+              <Title order={3}>Video Archive Success Notification</Title>
+              <Flex>
+                <Checkbox
+                  mt={10}
+                  label="Enabled"
+                  key={form.key('notifications.video_success_enabled')}
+                  {...form.getInputProps('notifications.video_success_enabled', { type: "checkbox" })}
+                  mr={15}
+                />
+                <Button variant="outline" color="violet"
+                  onClick={() => testNotificationMutate.mutate({ axiosPrivate, type: NotificationType.VideoSuccess })}>
+                  Test
+                </Button>
+              </Flex>
+              <TextInput
+                label="Webhook URL"
+                placeholder="https://webhook.curl"
+                key={form.key('notifications.video_success_webhook_url')}
+                {...form.getInputProps('notifications.video_success_webhook_url')}
+              />
+              <Textarea
+                label="Template"
+                placeholder=""
+                key={form.key('notifications.video_success_template')}
+                {...form.getInputProps('notifications.video_success_template')}
+              />
+
+              <Text>Available variables to use in the template:</Text>
+              <div>
+                <Text>Channel</Text>
+                <Code>
+                  {"{{channel_id}} {{channel_ext_id}} {{channel_display_name}}"}
+                </Code>
+                <Text>Video</Text>
+                <Code>
+                  {
+                    "{{vod_id}} {{vod_ext_id}} {{vod_platform}} {{vod_type}} {{vod_title}} {{vod_duration}} {{vod_views}} {{vod_resolution}} {{vod_streamed_at}} {{vod_created_at}}"
+                  }
+                </Code>
+                <Text>Queue</Text>
+                <Code>{"{{queue_id}} {{queue_created_at}}"}</Code>
+              </div>
+
+              {/* live archive success */}
+              <Title order={3}>Live Archive Success Notification</Title>
+              <Flex>
+                <Checkbox
+                  mt={10}
+                  label="Enabled"
+                  key={form.key('notifications.live_success_enabled')}
+                  {...form.getInputProps('notifications.live_success_enabled', { type: "checkbox" })}
+                  mr={15}
+                />
+                <Button variant="outline" color="violet"
+                  onClick={() => testNotificationMutate.mutate({ axiosPrivate, type: NotificationType.LiveSuccess })}>
+                  Test
+                </Button>
+              </Flex>
+              <TextInput
+                label="Webhook URL"
+                placeholder="https://webhook.curl"
+                key={form.key('notifications.live_success_webhook_url')}
+                {...form.getInputProps('notifications.live_success_webhook_url')}
+              />
+              <Textarea
+                label="Template"
+                placeholder=""
+                key={form.key('notifications.live_success_template')}
+                {...form.getInputProps('notifications.live_success_template')}
+              />
+
+              <Text>Available variables to use in the template:</Text>
+              <div>
+                <Text>Channel</Text>
+                <Code>
+                  {"{{channel_id}} {{channel_ext_id}} {{channel_display_name}}"}
+                </Code>
+                <Text>Video</Text>
+                <Code>
+                  {
+                    "{{vod_id}} {{vod_ext_id}} {{vod_platform}} {{vod_type}} {{vod_title}} {{vod_duration}} {{vod_views}} {{vod_resolution}} {{vod_streamed_at}} {{vod_created_at}}"
+                  }
+                </Code>
+                <Text>Queue</Text>
+                <Code>{"{{queue_id}} {{queue_created_at}}"}</Code>
+              </div>
+
+              {/* is live */}
+              <Title order={3}>Channel Is Live Notification</Title>
+              <Flex>
+                <Checkbox
+                  mt={10}
+                  label="Enabled"
+                  key={form.key('notifications.is_live_enabled')}
+                  {...form.getInputProps('notifications.is_live_enabled', { type: "checkbox" })}
+                  mr={15}
+                />
+                <Button variant="outline" color="violet"
+                  onClick={() => testNotificationMutate.mutate({ axiosPrivate, type: NotificationType.IsLive })}>
+                  Test
+                </Button>
+              </Flex>
+              <TextInput
+                label="Webhook URL"
+                placeholder="https://webhook.curl"
+                key={form.key('notifications.is_live_webhook_url')}
+                {...form.getInputProps('notifications.is_live_webhook_url')}
+              />
+              <Textarea
+                label="Template"
+                placeholder=""
+                key={form.key('notifications.is_live_template')}
+                {...form.getInputProps('notifications.is_live_template')}
+              />
+
+              <Text>Available variables to use in the template:</Text>
+              <div>
+                <Text>Channel</Text>
+                <Code>
+                  {"{{channel_id}} {{channel_ext_id}} {{channel_display_name}}"}
+                </Code>
+                <Text>Video</Text>
+                <Code>
+                  {
+                    "{{vod_id}} {{vod_ext_id}} {{vod_platform}} {{vod_type}} {{vod_title}} {{vod_duration}} {{vod_views}} {{vod_resolution}} {{vod_streamed_at}} {{vod_created_at}}"
+                  }
+                </Code>
+                <Text>Queue</Text>
+                <Code>{"{{queue_id}} {{queue_created_at}}"}</Code>
+              </div>
+
+              {/* error */}
+              <Title order={3}>Error Notification</Title>
+              <Flex>
+                <Checkbox
+                  mt={10}
+                  label="Enabled"
+                  key={form.key('notifications.error_enabled')}
+                  {...form.getInputProps('notifications.error_enabled', { type: "checkbox" })}
+                  mr={15}
+                />
+                <Button variant="outline" color="violet"
+                  onClick={() => testNotificationMutate.mutate({ axiosPrivate, type: NotificationType.Error })}>
+                  Test
+                </Button>
+              </Flex>
+              <TextInput
+                label="Webhook URL"
+                placeholder="https://webhook.curl"
+                key={form.key('notifications.error_webhook_url')}
+                {...form.getInputProps('notifications.error_webhook_url')}
+              />
+              <Textarea
+                label="Template"
+                placeholder=""
+                key={form.key('notifications.error_template')}
+                {...form.getInputProps('notifications.error_template')}
+              />
+
+              <Text>Available variables to use in the template:</Text>
+              <div>
+                <Text>Task</Text>
+                <Code>{"{{failed_task}}"}</Code>
+                <Text>Channel</Text>
+                <Code>
+                  {"{{channel_id}} {{channel_ext_id}} {{channel_display_name}}"}
+                </Code>
+                <Text>Video</Text>
+                <Code>
+                  {
+                    "{{vod_id}} {{vod_ext_id}} {{vod_platform}} {{vod_type}} {{vod_title}} {{vod_duration}} {{vod_views}} {{vod_resolution}} {{vod_streamed_at}} {{vod_created_at}}"
+                  }
+                </Code>
+                <Text>Queue</Text>
+                <Code>{"{{queue_id}} {{queue_created_at}}"}</Code>
+              </div>
+
+            </Collapse>
+
+            <Title mt={10} order={3}>Archive</Title>
+
+            <Checkbox
+              mt={10}
+              label="Convert MP4 to HLS"
+              key={form.key('archive.save_as_hls')}
+              {...form.getInputProps('archive.save_as_hls', { type: "checkbox" })}
+              mr={15}
+            />
+
+            <Button
+              mt={15}
+              onClick={toggleStorageTemplate}
+              fullWidth
+              radius="md"
+              size="md"
+              variant="outline"
+              color="orange"
+            >
+              Storage Template Settings
+            </Button>
+
+            <Collapse in={storageTemplateOpened}>
+
+              <div>
+                <Text mb={10}>
+                  Customize how folders and files are named. This only applies to new
+                  files. To apply to existing files execute the migration task on the{" "}
+                  <Link className={classes.link} href="/admin/tasks">
+                    tasks
+                  </Link>{" "}
+                  page.
+                </Text>
+                <div>
+                  <Title order={4}>Folder Template</Title>
+
+                  <Textarea
+                    description="{{uuid}} is required to be present for the folder template."
+                    key={form.key('storage_templates.folder_template')}
+                    {...form.getInputProps('storage_templates.folder_template')}
+                    required
+                  />
+                </div>
+
+                <div>
+                  <Title mt={5} order={4}>
+                    File Template
+                  </Title>
+
+                  <Textarea
+                    description="Do not include the file extension. The file type will be appened to the end of the file name such as -video -chat and -thumbnail."
+                    key={form.key('storage_templates.file_template')}
+                    {...form.getInputProps('storage_templates.file_template')}
+                    required
+                  />
+                </div>
+
+                <div>
+                  <Title mt={5} order={4}>
+                    Available Variables
+                  </Title>
+
+                  <div>
+                    <Text>Ganymede</Text>
+                    <Code>{"{{uuid}}"}</Code>
+                    <Text>Twitch Video</Text>
+                    <Code>{"{{id}} {{channel}} {{title}} {{date}} {{type}}"}</Code>
+                    <Text ml={20} mt={5} size="sm">
+                      ID: Twitch video ID <br /> Date: Date streamed or uploaded <br />{" "}
+                      Type: Twitch video type (live, archive, highlight)
+                    </Text>
+                  </div>
+                </div>
+
+                <div>
+                  <Title mt={5} order={4}>
+                    Examples
+                  </Title>
+
+                  <Text>Folder</Text>
+                  <Code block>{folderExample1}</Code>
+                  <Code block>{folderExample2}</Code>
+                  <Text>File</Text>
+                  <Code block>{fileExample1}</Code>
+                </div>
+
+
+              </div>
+
+            </Collapse>
+
+            <Title mt={10} order={3}>Video</Title>
+
+            <TextInput
+              label="Twitch Token"
+              description="Supply your Twitch token for downloading ad-free livestreams and subscriber-only videos."
+              key={form.key('parameters.twitch_token')}
+              {...form.getInputProps('parameters.twitch_token')}
+            />
+
+            <TextInput
+              label="Video Convert FFmpeg Arguments"
+              description="Post-download video processing FFmpeg arguments."
+              key={form.key('parameters.video_convert')}
+              {...form.getInputProps('parameters.video_convert')}
+            />
+
+            <Title mt={10} order={3}>Live Stream</Title>
+
+            <TextInput
+              label="Streamlink Parameters"
+              description="For live streams. Must be comma separated."
+              key={form.key('parameters.streamlink_live')}
+              {...form.getInputProps('parameters.streamlink_live')}
+            />
+
+            <Title mt={5} order={5}>Proxy</Title>
+            <Text>Archive live streams through a proxy to prevent ads. Your Twitch token <b>is not sent</b> to the proxy.</Text>
+
+            <Checkbox
+              mt={10}
+              label="Enable proxy"
+              key={form.key('livestream.proxy_enabled')}
+              {...form.getInputProps('livestream.proxy_enabled', { type: "checkbox" })}
+              mr={15}
+            />
+
+            <div>
+              {form.values.livestream.proxies && form.values.livestream.proxies.map((proxy: ProxyListItem, index) => (
+                <div key={index}>
+                  <div key={index} className={classes.proxyList}>
+                    <TextInput
+                      className={classes.proxyInput}
+                      placeholder="https://proxy.url"
+                      label="Proxy URL"
+                      key={form.key(`livestream.proxies.${index}.url`)}
+                      {...form.getInputProps(`livestream.proxies.${index}.url`)}
+                    />
+                    <TextInput
+                      label="Header"
+                      className={classes.proxyInput}
+                      key={form.key(`livestream.proxies.${index}.header`)}
+                      {...form.getInputProps(`livestream.proxies.${index}.header`)}
+                    />
+                    <ActionIcon
+                      color="red"
+                      size="lg"
+                      mt={20}
+                      onClick={() => form.removeListItem('livestream.proxies', index)}
+                    >
+                      <IconTrash size="1.125rem" />
+                    </ActionIcon>
+                  </div>
+                </div>
+              ))}
+            </div>
+            <Button
+              onClick={() =>
+                form.insertListItem('livestream.proxies', { url: '', header: '' })
+              }
+              mt={10}
+              leftSection={<IconPlus size="1rem" />}
+            >
+              Add
+            </Button>
+
+            <MultiSelect
+              label="Whitelist Channels"
+              description="Select channels that are excluded from using the proxy if enabled. Instead your Twitch token will be used. Select channels that you are subscribed to."
+              data={channelSelect}
+              key={form.key('livestream.proxy_whitelist')}
+              {...form.getInputProps('livestream.proxy_whitelist')}
+              searchable
+            />
+
+            <Title mt={10} order={3}>Chat</Title>
+
+            <TextInput
+              label="Chat Render Arguments"
+              description="TwitchDownloaderCLI chat render arguments."
+              key={form.key('parameters.chat_render')}
+              {...form.getInputProps('parameters.chat_render')}
+            />
+
+            <Button
+              mt={15}
+              type="submit"
+              fullWidth
+              loading={editConfigMutate.isPending}
+            >
+              Save Settings
+            </Button>
+
+          </form>
+
+        </Card>
+
+      </Container>
+    </div>
+  );
+}
+
+export default AdminSettingsPage;
\ No newline at end of file
diff --git a/frontend/app/admin/tasks/AdminTasksPage.module.css b/frontend/app/admin/tasks/AdminTasksPage.module.css
new file mode 100644
index 00000000..affb1415
--- /dev/null
+++ b/frontend/app/admin/tasks/AdminTasksPage.module.css
@@ -0,0 +1,3 @@
+.link {
+  color: var(--mantine-color-blue-6);
+}
diff --git a/frontend/app/admin/tasks/page.tsx b/frontend/app/admin/tasks/page.tsx
new file mode 100644
index 00000000..9ef8596b
--- /dev/null
+++ b/frontend/app/admin/tasks/page.tsx
@@ -0,0 +1,215 @@
+"use client"
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Card, Container, Title, Text, Tooltip, ActionIcon, Group, Box } from "@mantine/core";
+import classes from "./AdminTasksPage.module.css"
+import { useEffect, useState } from "react";
+import { IconPlayerPlay } from "@tabler/icons-react";
+import { Task, useStartTask } from "@/app/hooks/useTasks";
+import { showNotification } from "@mantine/notifications";
+
+const AdminTasksPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Tasks";
+  }, []);
+  const axiosPrivate = useAxiosPrivate()
+  const [loading, setLoading] = useState(false)
+
+  const startTaskMutate = useStartTask()
+
+  const startTask = async (task: Task) => {
+    try {
+      setLoading(true)
+
+      await startTaskMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        task: task
+      })
+
+      showNotification({
+        message: "Task started, see container logs for more information."
+      })
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Container mt={15}>
+        <Card withBorder p="xl" radius={"sm"}>
+
+          <Title>Tasks</Title>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Check watched channels for live streams to archive</Text>
+              <Text size="xs">Occurs at interval set in the config.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.CheckLive)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Check watched channels for videos to archive</Text>
+              <Text size="xs">Occurs at interval set in the config.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.CheckVod)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Check watched channels for clips to archive</Text>
+              <Text size="xs">Occurs daily at 00:00.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.CheckClips)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Storage Template Migration</Text>
+              <Text size="xs">Apply storage template to existing files. Read the <a className={classes.link} target="_blank" href="https://github.com/Zibbp/ganymede/wiki/Storage-Templates-and-Migration">docs</a> before starting.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.StorageMigration)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Prune Videos</Text>
+              <Text size="xs">Prune videos from channels that have retention settings configured.</Text>
+              <Text size="xs">Occurs daily at 00:00.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.PruneVideo)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Get JSON Web Key Sets (JWKS) From SSO Provider</Text>
+              <Text size="xs">Occurs daily at 00:00.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.GetJWKS)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Save Chapters for Twitch Videos</Text>
+              <Text size="xs">Save chapters for already archived Twitch videos (automatically does this for new archives).</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.SaveChapters)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>Update Live Stream Archives with Video IDs</Text>
+              <Text size="xs">Attempt to update live stream archives with their corresponding video ID (automatically does this after live archive finishes).</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.UpdateStreamVodIds)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+          <Group justify="space-between" py={5}>
+            <Box>
+              <Text fw={"bold"}>[EXPERIMENTAL] Generate Sprite Thumbnails</Text>
+              <Text size="xs">Generate preview thumbnails seen when hovering over the player progress bar for all videos.</Text>
+            </Box>
+            <Tooltip label="Start Task">
+              <ActionIcon
+                onClick={() => startTask(Task.GenerateSpriteThumbnails)}
+                loading={loading}
+                color="green"
+                variant="filled"
+                size="lg"
+              >
+                <IconPlayerPlay size={24} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+
+
+        </Card>
+      </Container>
+    </div>
+  );
+}
+
+export default AdminTasksPage;
\ No newline at end of file
diff --git a/frontend/app/admin/users/AdminUsersPage.module.css b/frontend/app/admin/users/AdminUsersPage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/users/AdminUsersPage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/users/page.tsx b/frontend/app/admin/users/page.tsx
new file mode 100644
index 00000000..b2848072
--- /dev/null
+++ b/frontend/app/admin/users/page.tsx
@@ -0,0 +1,197 @@
+"use client"
+import { ActionIcon, Container, Group, TextInput, Title, Box, Drawer, Modal, Tooltip, Text } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useEffect, useState } from "react";
+import sortBy from "lodash/sortBy";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { IconPencil, IconSearch, IconTrash } from "@tabler/icons-react";
+import dayjs from "dayjs";
+import classes from "./AdminUsersPage.module.css"
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { User } from "@/app/hooks/useAuthentication";
+import { useGetUsers } from "@/app/hooks/useUsers";
+import AdminUserDrawerContent from "@/app/components/admin/user/DrawerContent";
+import DeleteUserModalContent from "@/app/components/admin/user/DeleteModalContent";
+
+const AdminUsersPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Users";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<User[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<User>>({
+    columnAccessor: "name",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeUser, setActiveUser] = useState<User | null>(null);
+
+  const [userDrawerOpened, { open: openUserDrawer, close: closeUserDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+  const axiosPrivate = useAxiosPrivate()
+  const { data: users, isPending, isError } = useGetUsers(axiosPrivate)
+
+  useEffect(() => {
+    if (!users || users.length == 0) return;
+
+    let filteredData = [...users] as User[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((user) => {
+        return (
+          user.id.toString().includes(debouncedQuery) ||
+          user.username.includes(debouncedQuery)
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [users, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const openDrawer = (user: User) => {
+    setActiveUser(user);
+    openUserDrawer()
+  };
+
+  const handleDeleteModal = (user: User) => {
+    setActiveUser(user);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading users" />
+  )
+  if (isError) return <div>Error loading users</div>
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Users</Title>
+        </Group>
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search users..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<User>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover
+            records={records}
+            columns={[
+              {
+                accessor: "id", title: "ID",
+                render: ({ id }) => (
+                  <Tooltip label={id}>
+                    <Text lineClamp={1}>{id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "username",
+                title: "Username",
+                sortable: true
+              },
+              {
+                accessor: "role",
+                title: "Role",
+                sortable: true
+              },
+              {
+                accessor: "oauth",
+                title: "Auth Method",
+                sortable: true,
+                render: ({ oauth }) => {
+                  return oauth ? "SSO" : "Local";
+                },
+              },
+              {
+                accessor: "created_at",
+                title: "Created At",
+                sortable: true,
+                render: ({ created_at }) => (
+                  <div>{dayjs(created_at).format("YYYY/MM/DD")}</div>
+                ),
+              },
+              {
+                accessor: "actions",
+                title: "Actions",
+                width: "150px",
+                render: (user) => (
+                  <Group>
+                    <ActionIcon
+                      onClick={() => openDrawer(user)}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconPencil size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      onClick={() => handleDeleteModal(user)}
+                      className={classes.actionButton}
+                      variant="light"
+                      color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Group>
+                ),
+              },
+            ]}
+            totalRecords={users?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={userDrawerOpened} onClose={closeUserDrawer} position="right" title="User">
+        {activeUser && (
+          <AdminUserDrawerContent user={activeUser} handleClose={closeUserDrawer} />
+        )}
+      </Drawer>
+
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete User">
+        {activeUser && (
+          <DeleteUserModalContent user={activeUser} handleClose={closeDeleteModal} />
+        )}
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminUsersPage;
\ No newline at end of file
diff --git a/frontend/app/admin/videos/AdminVideosPage.module.css b/frontend/app/admin/videos/AdminVideosPage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/videos/AdminVideosPage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/videos/page.tsx b/frontend/app/admin/videos/page.tsx
new file mode 100644
index 00000000..b3d37480
--- /dev/null
+++ b/frontend/app/admin/videos/page.tsx
@@ -0,0 +1,260 @@
+"use client"
+import { ActionIcon, Container, Group, TextInput, Text, Title, Box, Button, Drawer, Modal, Tooltip, Flex } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useEffect, useState } from "react";
+import sortBy from "lodash/sortBy";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { IconPencil, IconSearch, IconTrash } from "@tabler/icons-react";
+import dayjs from "dayjs";
+
+import classes from "./AdminVideosPage.module.css"
+import { useGetVideosNoPaginate, Video } from "@/app/hooks/useVideos";
+import AdminVideoDrawerContent, { VideoEditMode } from "@/app/components/admin/video/DrawerContent";
+import DeleteVideoModalContent from "@/app/components/admin/video/DeleteModalContent";
+import MultiDeleteVideoModalContent from "@/app/components/admin/video/MultiDeleteModalContent";
+
+const AdminVideosPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Videos";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<Video[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<Video>>({
+    columnAccessor: "name",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeVideo, setActiveVideo] = useState<Video | null>(null);
+  const [drawerEditMode, setDrawerEditMode] = useState<VideoEditMode>(VideoEditMode.Create)
+
+  const [videoDrawerOpened, { open: openVideoDrawer, close: closeVideoDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+  const [multiDeleteModalOpened, { open: openMultiDeleteModal, close: closeMultiDeleteModal }] = useDisclosure(false);
+  const [activeVideos, setActiveVideos] = useState<Video[] | null>([]);
+
+
+
+  const { data: videos, isPending, isError } = useGetVideosNoPaginate()
+
+  useEffect(() => {
+    if (!videos) return;
+
+    let filteredData = [...videos] as Video[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((video) => {
+        return (
+          video.id.toString().includes(debouncedQuery) ||
+          video.title.toLowerCase().includes(debouncedQuery.toLowerCase()) ||
+          video.ext_id.toString().includes(debouncedQuery.toLowerCase()) ||
+          video.streamed_at.toString().includes(debouncedQuery.toLowerCase()) ||
+          video.edges.channel.name
+            .toLowerCase()
+            .includes(debouncedQuery.toLowerCase()) ||
+          video.edges.channel.id
+            .toString()
+            .includes(debouncedQuery.toLowerCase())
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [videos, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const openDrawer = (mode: VideoEditMode, video: Video) => {
+    setActiveVideo(video);
+    setDrawerEditMode(VideoEditMode.Edit)
+    openVideoDrawer()
+  };
+
+  const handleDeleteModal = (video: Video) => {
+    setActiveVideo(video);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Videos" />
+  )
+  if (isError) return <div>Error loading videos</div>
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Videos</Title>
+          <Box>
+            {(activeVideos && activeVideos.length > 1) && (
+              <Button
+                mx={10}
+                leftSection={<IconTrash size={16} />}
+                color="red"
+                disabled={!activeVideos.length}
+                onClick={() => {
+                  openMultiDeleteModal();
+                }}
+              >
+                {activeVideos.length
+                  ? `Delete ${activeVideos.length === 1
+                    ? "one selected vod"
+                    : `${activeVideos.length} selected videos`
+                  }`
+                  : "Select vods to delete"}
+              </Button>
+            )}
+
+            <Button
+              onClick={() => {
+                setDrawerEditMode(VideoEditMode.Create)
+                setActiveVideo(null)
+                openVideoDrawer()
+              }}
+              mr={5}
+              variant="default"
+            >
+              Manually Add Video
+            </Button>
+          </Box>
+        </Group>
+
+
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search videos..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<Video>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover={true}
+            records={records}
+            columns={[
+              {
+                accessor: "id",
+                title: "ID",
+                width: 90,
+                render: ({ id }) => (
+                  <Tooltip label={id}>
+                    <Text lineClamp={1}>{id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "ext_id", title: "External ID",
+                render: ({ ext_id }) => (
+                  <Tooltip label={ext_id}>
+                    <Text lineClamp={1}>{ext_id}</Text>
+                  </Tooltip>
+                ),
+              },
+              {
+                accessor: "edges.channel.display_name",
+                title: "Channel",
+                sortable: true,
+              },
+              { accessor: "title", title: "Title", sortable: true, },
+              { accessor: "type", title: "Type", sortable: true },
+
+              {
+                accessor: "streamed_at",
+                title: "Streamed At",
+                sortable: true,
+                render: ({ streamed_at }) => (
+                  <div title={`${new Date(streamed_at).toLocaleString()}`}>
+                    {dayjs(streamed_at).format("YYYY/MM/DD")}
+                  </div>
+                ),
+              },
+              {
+                accessor: "created_at",
+                title: "Archived At",
+                sortable: true,
+                render: ({ created_at }) => (
+                  <div title={`${new Date(created_at).toLocaleString()}`}>
+                    {dayjs(created_at).format("YYYY/MM/DD")}
+                  </div>
+                ),
+              },
+              {
+                accessor: "actions",
+                title: "Actions",
+                render: (video) => (
+                  <Flex>
+                    <ActionIcon
+                      mx={2}
+                      onClick={() => openDrawer(VideoEditMode.Edit, video)}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconPencil size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      mx={2}
+                      onClick={() => handleDeleteModal(video)}
+                      className={classes.actionButton}
+                      variant="light" color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Flex>
+                ),
+              },
+            ]}
+            totalRecords={videos?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+            selectedRecords={activeVideos ?? []}
+            onSelectedRecordsChange={setActiveVideos}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={videoDrawerOpened} onClose={closeVideoDrawer} position="right" size="lg" title="Video">
+        <AdminVideoDrawerContent mode={drawerEditMode} video={activeVideo} handleClose={closeVideoDrawer} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Video">
+        {activeVideo && (
+          <DeleteVideoModalContent video={activeVideo} handleClose={closeDeleteModal} />
+        )}
+      </Modal>
+      <Modal opened={multiDeleteModalOpened} onClose={closeMultiDeleteModal} title="Delete Videos">
+        {activeVideos && (
+          <MultiDeleteVideoModalContent videos={activeVideos} handleClose={closeMultiDeleteModal} />
+        )}
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminVideosPage;
\ No newline at end of file
diff --git a/frontend/app/admin/watched/AdminWatchedChannelsPage.module.css b/frontend/app/admin/watched/AdminWatchedChannelsPage.module.css
new file mode 100644
index 00000000..96bf4254
--- /dev/null
+++ b/frontend/app/admin/watched/AdminWatchedChannelsPage.module.css
@@ -0,0 +1,6 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
diff --git a/frontend/app/admin/watched/page.tsx b/frontend/app/admin/watched/page.tsx
new file mode 100644
index 00000000..4076d0bc
--- /dev/null
+++ b/frontend/app/admin/watched/page.tsx
@@ -0,0 +1,211 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useGetWatchedChannesl, WatchedChannel } from "@/app/hooks/useWatchedChannels";
+import { Container, Group, Title, Box, Button, TextInput, ActionIcon, Drawer, Modal } from "@mantine/core";
+import { useDebouncedValue, useDisclosure } from "@mantine/hooks";
+import { IconSearch, IconPencil, IconTrash } from "@tabler/icons-react";
+import { sortBy } from "lodash";
+import { DataTable, DataTableSortStatus } from "mantine-datatable";
+import { useState, useEffect } from "react";
+import classes from "./AdminWatchedChannelsPage.module.css"
+import AdminWatchedChannelDrawerContent, { WatchedChannelEditMode } from "@/app/components/admin/watched/DrawerContent";
+import DeleteWatchedChannelModalContent from "@/app/components/admin/watched/DeleteModalContent";
+
+const AdminWatchChannelsPage = () => {
+  useEffect(() => {
+    document.title = "Admin - Watched Channels";
+  }, []);
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(20);
+  const [records, setRecords] = useState<WatchedChannel[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [sortStatus, setSortStatus] = useState<DataTableSortStatus<WatchedChannel>>({
+    columnAccessor: "edges.channel.name",
+    direction: "asc",
+  });
+  const [query, setQuery] = useState("");
+  const [debouncedQuery] = useDebouncedValue(query, 500);
+  const [activeWatchedChannel, setActiveWatchedChannel] = useState<WatchedChannel | null>(null);
+  const [drawerEditMode, setDrawerEditMode] = useState<WatchedChannelEditMode>(WatchedChannelEditMode.Create)
+
+  const [channelDrawerOpened, { open: openChannelDrawer, close: closeChannelDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+  const axiosPrivate = useAxiosPrivate()
+
+  const { data: channels, isPending, isError } = useGetWatchedChannesl(axiosPrivate)
+
+  useEffect(() => {
+    if (!channels) return;
+
+    let filteredData = [...channels] as WatchedChannel[];
+
+    // Apply search filter
+    if (debouncedQuery) {
+      filteredData = filteredData.filter((channel) => {
+        return (
+          channel.id.toString().includes(debouncedQuery) ||
+          channel.edges.channel.name.toLowerCase().includes(debouncedQuery.toLowerCase()) ||
+          channel.edges.channel.display_name.toLowerCase().includes(debouncedQuery.toLowerCase())
+        );
+      });
+    }
+
+    // Apply sorting
+    const sortedData = sortBy(filteredData, sortStatus.columnAccessor);
+    filteredData = sortStatus.direction === "desc" ? sortedData.reverse() : sortedData;
+
+    // Apply pagination
+    const from = (page - 1) * perPage;
+    const to = from + perPage;
+    setRecords(filteredData.slice(from, to));
+
+    if (!initialRecords) {
+      setInitialRecords(true);
+    }
+  }, [channels, page, perPage, sortStatus, debouncedQuery, initialRecords]);
+
+  const openDrawer = (mode: WatchedChannelEditMode, watchedChannel: WatchedChannel) => {
+    setActiveWatchedChannel(watchedChannel);
+    setDrawerEditMode(WatchedChannelEditMode.Edit)
+    openChannelDrawer()
+  };
+
+  const handleDeleteModal = (watchedChannel: WatchedChannel) => {
+    setActiveWatchedChannel(watchedChannel);
+    openDeleteModal()
+  };
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Watched Channels" />
+  )
+  if (isError) return <div>Error loading watched channels</div>
+
+
+  return (
+    <div>
+      <Container size="7xl">
+        <Group justify="space-between" mt={2} >
+          <Title>Manage Watched Channels</Title>
+          <Box>
+            <Button
+              onClick={() => {
+                setDrawerEditMode(WatchedChannelEditMode.Create)
+                setActiveWatchedChannel(null)
+                openChannelDrawer()
+              }}
+              mr={5}
+              variant="default"
+            >
+              Add
+            </Button>
+          </Box>
+        </Group>
+
+        <Box mt={5}>
+          <div>
+            <TextInput
+              placeholder="Search watched channels..."
+              leftSection={<IconSearch size={16} />}
+              value={query}
+              onChange={(e) => setQuery(e.currentTarget.value)}
+              mb={10}
+            />
+
+          </div>
+          <DataTable<WatchedChannel>
+            withTableBorder
+            borderRadius="sm"
+            withColumnBorders
+            striped
+            highlightOnHover
+            records={records}
+            columns={[
+              { accessor: "id", title: "ID" },
+              {
+                accessor: "edges.channel.display_name",
+                title: "Channel",
+                sortable: true,
+              },
+              {
+                accessor: "watch_live",
+                title: "Watch Live",
+                sortable: true,
+                render: ({ watch_live }) => {
+                  return watch_live ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "is_live",
+                title: "Is Live",
+                sortable: true,
+                render: ({ is_live }) => {
+                  return is_live ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "watch_vod",
+                title: "Watch Videos",
+                sortable: true,
+                render: ({ watch_vod }) => {
+                  return watch_vod ? "✅" : "❌";
+                },
+              },
+              {
+                accessor: "watch_clips",
+                title: "Watch Clips",
+                sortable: true,
+                render: ({ watch_clips }) => {
+                  return watch_clips ? "✅" : "❌";
+                },
+              },
+
+              {
+                accessor: "actions",
+                title: "Actions",
+                render: (watched) => (
+                  <Group>
+                    <ActionIcon
+                      onClick={() => openDrawer(WatchedChannelEditMode.Edit, watched)}
+                      className={classes.actionButton}
+                      variant="light"
+                    >
+                      <IconPencil size={18} />
+                    </ActionIcon>
+                    <ActionIcon
+                      onClick={() => handleDeleteModal(watched)}
+                      className={classes.actionButton}
+                      variant="light" color="red"
+                    >
+                      <IconTrash size={18} />
+                    </ActionIcon>
+                  </Group>
+                ),
+              },
+            ]}
+            totalRecords={channels?.length ?? 0}
+            page={page}
+            recordsPerPage={perPage}
+            onPageChange={(p) => setPage(p)}
+            recordsPerPageOptions={[20, 40, 100]}
+            onRecordsPerPageChange={setPerPage}
+            sortStatus={sortStatus}
+            onSortStatusChange={setSortStatus}
+          />
+        </Box>
+      </Container>
+
+      <Drawer opened={channelDrawerOpened} onClose={closeChannelDrawer} position="right" title="Channel">
+        <AdminWatchedChannelDrawerContent mode={drawerEditMode} watchedChannel={activeWatchedChannel} handleClose={closeChannelDrawer} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Channel">
+        <DeleteWatchedChannelModalContent watchedChannel={activeWatchedChannel} handleClose={closeDeleteModal} />
+      </Modal>
+
+    </div>
+  );
+}
+
+export default AdminWatchChannelsPage;
\ No newline at end of file
diff --git a/frontend/app/android-chrome-192x192.png b/frontend/app/android-chrome-192x192.png
new file mode 100644
index 00000000..0f9bff61
Binary files /dev/null and b/frontend/app/android-chrome-192x192.png differ
diff --git a/frontend/app/android-chrome-512x512.png b/frontend/app/android-chrome-512x512.png
new file mode 100644
index 00000000..299a6fac
Binary files /dev/null and b/frontend/app/android-chrome-512x512.png differ
diff --git a/frontend/app/apple-touch-icon.png b/frontend/app/apple-touch-icon.png
new file mode 100644
index 00000000..38a5685e
Binary files /dev/null and b/frontend/app/apple-touch-icon.png differ
diff --git a/frontend/app/archive/page.tsx b/frontend/app/archive/page.tsx
new file mode 100644
index 00000000..7dacd47f
--- /dev/null
+++ b/frontend/app/archive/page.tsx
@@ -0,0 +1,209 @@
+"use client"
+import { Card, Center, Container, Title, Text, TextInput, Divider, Select, Group, Switch, Button, rem } from "@mantine/core";
+import { useInputState } from "@mantine/hooks";
+import { useEffect, useState } from "react";
+import { Channel, useFetchChannels } from "../hooks/useChannels";
+import { showNotification } from "@mantine/notifications";
+import { useArchiveVideo, VideoQuality } from "../hooks/useArchive";
+import { useAxiosPrivate } from "../hooks/useAxios";
+
+interface SelectOption {
+  label: string;
+  value: string;
+}
+
+function extractTwitchId(input: string): string {
+  // Regex patterns for various inputs
+  const clipUrlRegex = /\/clip\/(?<id>[a-zA-Z0-9-_]+)/; // Extract full clip ID from URL
+  const videoUrlRegex = /\/videos\/(?<id>\d+)/; // Extract video ID from URL
+  const clipIdRegex = /^[a-zA-Z]+(?:[a-zA-Z0-9-]+)?$/; // Match standalone clip IDs
+  const videoIdRegex = /^\d+$/; // Match standalone video IDs (numeric)
+
+  // Check for a clip URL
+  const clipUrlMatch = input.match(clipUrlRegex);
+  if (clipUrlMatch?.groups?.id) {
+    return clipUrlMatch.groups.id;
+  }
+
+  // Check for a video URL
+  const videoUrlMatch = input.match(videoUrlRegex);
+  if (videoUrlMatch?.groups?.id) {
+    return videoUrlMatch.groups.id;
+  }
+
+  // Check for standalone clip IDs
+  if (clipIdRegex.test(input)) {
+    return input; // If input is already a valid clip ID, return it
+  }
+
+  // Check for standalone video IDs
+  if (videoIdRegex.test(input)) {
+    return input; // If input is already a valid video ID, return it
+  }
+
+  return ""
+}
+
+
+const ArchivePage = () => {
+  useEffect(() => {
+    document.title = "Archive";
+  }, []);
+
+  // State management with proper typing
+  const [archiveInput, setArchiveInput] = useInputState("");
+  const [archiveSubmitLoading, setArchiveSubmitLoading] = useState(false);
+  const [archiveChat, setArchiveChat] = useInputState(true);
+  const [renderChat, setRenderChat] = useInputState(true);
+  const [archiveQuality, setArchiveQuality] = useInputState<VideoQuality>(VideoQuality.Best);
+  const [channelData, setChannelData] = useState<SelectOption[]>([]);
+  const [channelId, setChannelId] = useState("");
+
+  const axiosPrivate = useAxiosPrivate();
+  const useArchiveVideoMutate = useArchiveVideo();
+  const { data: channels, isPending: channelsIsPending } = useFetchChannels();
+
+  // Quality options using the enum
+  const qualityOptions: SelectOption[] = Object.entries(VideoQuality).map(([key, value]) => ({
+    label: key.replace('quality', ''),
+    value: value
+  }));
+
+  // Effect to transform channel data
+  useEffect(() => {
+    if (!channels) return;
+
+    const transformedChannels: SelectOption[] = channels.map((channel: Channel) => ({
+      label: channel.name,
+      value: channel.id,
+    }));
+
+    setChannelData(transformedChannels);
+  }, [channels]);
+
+  const archiveVideo = async () => {
+    try {
+      // Input validation
+      if (!archiveInput && !channelId) {
+        showNotification({
+          title: "Input Required",
+          message: "Please enter a video ID or select a channel",
+          color: "red",
+        });
+        return;
+      }
+
+      if (archiveInput && channelId) {
+        showNotification({
+          title: "Invalid Selection",
+          message: "Please either enter an ID or select a channel (not both)",
+          color: "red",
+        });
+        return;
+      }
+
+      setArchiveSubmitLoading(true);
+
+      await useArchiveVideoMutate.mutateAsync({
+        axiosPrivate,
+        video_id: extractTwitchId(archiveInput),
+        channel_id: channelId,
+        quality: archiveQuality,
+        archive_chat: archiveChat,
+        render_chat: renderChat,
+      });
+
+      setArchiveInput("")
+
+      showNotification({
+        title: "Success",
+        message: "Video added to archive queue",
+        color: "green",
+      });
+
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setArchiveSubmitLoading(false);
+    }
+  };
+
+  return (
+    <div>
+      <Container size="md" mt={20}>
+        <Center>
+          <div style={{ width: "100%" }}>
+            <Card
+              shadow="sm"
+              p="lg"
+              radius="md"
+              withBorder
+            >
+              <Center>
+                <div>
+                  <Title>Archive</Title>
+                </div>
+              </Center>
+              <Center mb={10}>
+                <Text>
+                  Enter a video ID or select a channel to archive a livestream
+                </Text>
+              </Center>
+              <TextInput
+                value={archiveInput}
+                onChange={setArchiveInput}
+                placeholder="Video ID or URL"
+                disabled={channelsIsPending}
+                className="mb-4"
+              />
+              <Divider my="xs" label="Or" labelPosition="center" />
+              <Select
+                placeholder="Select Channel"
+                data={channelData}
+                value={channelId}
+                onChange={(value) => setChannelId(value || "")}
+                searchable
+                mb={"md"}
+                disabled={channelsIsPending}
+              />
+              <Group mt={5} mb={10}>
+                <Select
+                  placeholder="Resolution"
+                  value={archiveQuality}
+                  onChange={(value) => setArchiveQuality(value as VideoQuality)}
+                  data={qualityOptions}
+                  w={rem(200)}
+                />
+                <Switch
+                  checked={archiveChat}
+                  onChange={setArchiveChat}
+                  label="Archive Chat"
+                  color="violet"
+                />
+                <Switch
+                  checked={renderChat}
+                  onChange={setRenderChat}
+                  label="Render Chat"
+                  color="violet"
+                />
+              </Group>
+              <Button
+                onClick={archiveVideo}
+                fullWidth
+                radius="md"
+                size="md"
+                color="violet"
+                loading={archiveSubmitLoading}
+                disabled={channelsIsPending || (!archiveInput && !channelId)}
+              >
+                Archive
+              </Button>
+            </Card>
+          </div>
+        </Center>
+      </Container>
+    </div>
+  );
+}
+
+export default ArchivePage;
\ No newline at end of file
diff --git a/frontend/app/channels/[name]/page.tsx b/frontend/app/channels/[name]/page.tsx
new file mode 100644
index 00000000..638896d8
--- /dev/null
+++ b/frontend/app/channels/[name]/page.tsx
@@ -0,0 +1,44 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import ChannelVideos from "@/app/components/videos/ChannelVideos";
+import { useFetchChannelByName } from "@/app/hooks/useChannels";
+import { Center, Container, Title } from "@mantine/core";
+import React, { useEffect } from "react";
+
+interface Params {
+  name: string;
+}
+
+const ChannelPage = ({ params }: { params: Promise<Params> }) => {
+  const { name } = React.use(params);
+  useEffect(() => {
+    document.title = `${name}`;
+  }, [name]);
+
+  const { data: channel, isPending, isError } = useFetchChannelByName(name)
+
+  if (isPending) {
+    return (
+      <GanymedeLoadingText message="Loading Channel" />
+    );
+  }
+
+  if (isError) {
+    return (
+      <Center>
+        <div>Error loading channel</div>
+      </Center>
+    );
+  }
+  return (
+    <div>
+      <Container size="xl" px="xl" fluid={true}>
+        <Center>
+          <Title>{channel.display_name}</Title>
+        </Center>
+        <ChannelVideos channel={channel} />
+      </Container>
+    </div>
+  );
+}
+export default ChannelPage;
\ No newline at end of file
diff --git a/frontend/app/channels/page.tsx b/frontend/app/channels/page.tsx
new file mode 100644
index 00000000..6d45531b
--- /dev/null
+++ b/frontend/app/channels/page.tsx
@@ -0,0 +1,35 @@
+'use client';
+import { Container, SimpleGrid } from "@mantine/core";
+import ChannelCard from "../components/channel/Card";
+import { useFetchChannels } from "../hooks/useChannels";
+import GanymedeLoadingText from "../components/utils/GanymedeLoadingText";
+import { useEffect } from "react";
+
+const ChannelsPage = () => {
+
+  useEffect(() => {
+    document.title = "Channels";
+  }, []);
+
+  const { data: channels, isPending, isError } = useFetchChannels()
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Channels" />
+  )
+  if (isError) return <div>Error loading channels</div>
+
+  return (
+    <Container size="7xl" px="xl" mt={10}>
+      <SimpleGrid
+        cols={{ base: 1, sm: 3, lg: 6, xl: 8 }}
+        verticalSpacing={{ base: 'md', sm: 'xl' }}
+      >
+        {channels.map((channel) => (
+          <ChannelCard key={channel.id} channel={channel} />
+        ))}
+      </SimpleGrid>
+    </Container>
+  );
+}
+
+export default ChannelsPage;
\ No newline at end of file
diff --git a/frontend/app/components/admin/blocked-videos/DeleteModalContent.tsx b/frontend/app/components/admin/blocked-videos/DeleteModalContent.tsx
new file mode 100644
index 00000000..84c71fa3
--- /dev/null
+++ b/frontend/app/components/admin/blocked-videos/DeleteModalContent.tsx
@@ -0,0 +1,47 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { BlockedVideo, useUnblockVideo } from "@/app/hooks/useBlockedVideos";
+import { Button, Code, Text } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  blockedVideo: BlockedVideo
+  handleClose: () => void;
+}
+
+
+const DeleteBlockedVideoModalContent = ({ blockedVideo, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+
+  const unblockVideoMutate = useUnblockVideo()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleUnblockVideo = async () => {
+    if (!blockedVideo || !blockedVideo.id) return
+    try {
+      setLoading(true)
+
+      await unblockVideoMutate.mutateAsync({ axiosPrivate: axiosPrivate, videoId: blockedVideo.id })
+
+      showNotification({
+        message: "Video unblocked"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to unblock this video?</Text>
+      <Code block>{JSON.stringify(blockedVideo, null, 2)}</Code>
+      <Button mt={5} color="red" onClick={handleUnblockVideo} loading={loading} fullWidth>Unblock Video</Button>
+    </div>
+  );
+}
+
+export default DeleteBlockedVideoModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/blocked-videos/DrawerContent.tsx b/frontend/app/components/admin/blocked-videos/DrawerContent.tsx
new file mode 100644
index 00000000..71ab744a
--- /dev/null
+++ b/frontend/app/components/admin/blocked-videos/DrawerContent.tsx
@@ -0,0 +1,68 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { BlockedVideo, useBlockVideo } from "@/app/hooks/useBlockedVideos";
+import { Button, TextInput } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { z } from "zod";
+
+type Props = {
+  blockedVideo: BlockedVideo | null
+  handleClose: () => void;
+}
+
+const schema = z.object({
+  id: z.string().min(1, { message: "ID should have at least 2 characters" }),
+})
+
+const AdminBlockedVideosDrawerContent = ({ blockedVideo, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const useBlockVideoMutate = useBlockVideo()
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: blockedVideo?.id || "",
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+    console.debug(`Admin blocked video form submit`, formValues)
+
+    // create channel
+    try {
+      await useBlockVideoMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        id: formValues.id
+      })
+
+      showNotification({
+        message: "Video blocked"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    }
+  }
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          label="ID"
+          placeholder="External Platform Video ID"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+        />
+        <Button mt={10} type="submit" fullWidth>Block Video</Button>
+      </form>
+    </div>
+  );
+}
+
+export default AdminBlockedVideosDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/channel/DeleteModalContent.tsx b/frontend/app/components/admin/channel/DeleteModalContent.tsx
new file mode 100644
index 00000000..48dd16c4
--- /dev/null
+++ b/frontend/app/components/admin/channel/DeleteModalContent.tsx
@@ -0,0 +1,47 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Channel, useDeleteChannel } from "@/app/hooks/useChannels";
+import { Button, Code, Text } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  channel: Channel | null
+  handleClose: () => void;
+}
+
+
+const DeleteChannelModalContent = ({ channel, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+
+  const deleteChannelMutate = useDeleteChannel()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteChannel = async () => {
+    if (!channel || !channel.id) return
+    try {
+      setLoading(true)
+
+      await deleteChannelMutate.mutateAsync({ axiosPrivate: axiosPrivate, channelId: channel.id })
+
+      showNotification({
+        message: "Channel deleted"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete this channel?</Text>
+      <Code block>{JSON.stringify(channel, null, 2)}</Code>
+      <Button mt={5} color="red" onClick={handleDeleteChannel} loading={loading} fullWidth>Delete Channel</Button>
+    </div>
+  );
+}
+
+export default DeleteChannelModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/channel/DrawerContent.tsx b/frontend/app/components/admin/channel/DrawerContent.tsx
new file mode 100644
index 00000000..333540bd
--- /dev/null
+++ b/frontend/app/components/admin/channel/DrawerContent.tsx
@@ -0,0 +1,204 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Channel, useCreateChannel, useEditChannel, useUpdateChannelImage } from "@/app/hooks/useChannels";
+import { ActionIcon, Button, NumberInput, TextInput, Tooltip, Text, Divider, Checkbox } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { IconHelpCircle } from "@tabler/icons-react";
+import { z } from "zod";
+
+type Props = {
+  channel: Channel | null
+  mode: ChannelEditMode
+  handleClose: () => void;
+}
+
+export enum ChannelEditMode {
+  Create = "create",
+  Edit = "edit",
+}
+
+const schema = z.object({
+  display_name: z.string().min(2, { message: "Display name should have at least 2 characters" }),
+  name: z.string().min(2, { message: "Name should have at least 2 characters" }),
+  image_path: z.string().min(3, { message: "Image path should have at least 3 characters" }),
+  retention: z.boolean(),
+  retention_days: z.number().min(1)
+})
+
+const AdminChannelDrawerContent = ({ channel, mode, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const useCreateChannelMutate = useCreateChannel()
+  const useEditChannelMutate = useEditChannel()
+  const useUpdateChannelImageMutate = useUpdateChannelImage()
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: channel?.id || "",
+      external_id: channel?.ext_id || "",
+      name: channel?.name || "",
+      display_name: channel?.display_name || "",
+      image_path: channel?.image_path || "",
+      retention: channel?.retention || false,
+      retention_days: channel?.retention_days || 7,
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+    console.debug(`Admin channel form submit - ${formValues}`)
+
+    // @ts-expect-error partial channel
+    const submitChannel: Channel = {
+      id: formValues.id,
+      ext_id: formValues.external_id,
+      name: formValues.name,
+      display_name: formValues.display_name,
+      image_path: formValues.image_path,
+      retention: formValues.retention,
+      retention_days: formValues.retention_days,
+    }
+
+    // create channel
+    if (mode == ChannelEditMode.Create) {
+      try {
+        await useCreateChannelMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          channel: submitChannel
+        })
+
+        showNotification({
+          message: "Channel created"
+        })
+
+        handleClose()
+      } catch (error) {
+        console.error(error)
+      }
+    }
+
+    // edit channel
+    if (mode == ChannelEditMode.Edit) {
+      try {
+        if (!channel) return;
+        await useEditChannelMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          channelId: channel.id,
+          channel: submitChannel
+        })
+
+        showNotification({
+          message: "Channel edited"
+        })
+
+        handleClose()
+      } catch (error) {
+        console.error(error)
+      }
+    }
+  }
+
+  const handleUpdateChannelImage = async () => {
+    if (!channel || !channel.id) return
+
+    try {
+      await useUpdateChannelImageMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        channelId: channel.id
+      })
+
+      showNotification({
+        message: "Channel image updated from platform"
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          disabled={true}
+          label="ID"
+          placeholder="Auto generated"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+        />
+        <TextInput
+          label="External Platform ID"
+          placeholder="123456789"
+          key={form.key('external_id')}
+          {...form.getInputProps('external_id')}
+        />
+        <TextInput
+          withAsterisk
+          label="Name"
+          placeholder="ganymede"
+          key={form.key('name')}
+          {...form.getInputProps('name')}
+        />
+        <TextInput
+          withAsterisk
+          label="Display Name"
+          placeholder="Ganymede"
+          key={form.key('display_name')}
+          {...form.getInputProps('display_name')}
+        />
+        <TextInput
+          withAsterisk
+          label="Image Path"
+          placeholder="/data/videos/ganymede/profile.jpg"
+          key={form.key('image_path')}
+          {...form.getInputProps('image_path')}
+        />
+
+        <div style={{ display: "flex" }}>
+          <Text>Retention settings</Text>
+          <Tooltip
+            multiline
+            label="If this setting is enabled channel videos will be deleted (including files) after the specified number of days. 'Lock' a video to prevent it from being deleted."
+          >
+            <ActionIcon variant="transparent">
+              <IconHelpCircle size="1.125rem" />
+            </ActionIcon>
+          </Tooltip>
+        </div>
+
+        <Checkbox
+          label="Enable Video Retention"
+          key={form.key('retention')}
+          {...form.getInputProps('retention', { type: "checkbox" })}
+        />
+
+        {form.values.retention && (
+          <Text c="red" mt={5}>
+            Videos will be deleted after {form.values.retention_days} days!
+          </Text>
+        )}
+
+        <NumberInput
+          disabled={!form.values.retention}
+          label="Retention Days"
+          placeholder="7"
+          key={form.key('retention_days')}
+          {...form.getInputProps('retention_days')}
+        />
+
+        <Button mt={10} type="submit" fullWidth>{mode == ChannelEditMode.Create ? 'Create Channel' : 'Edit Channel'}</Button>
+      </form>
+      {channel && (
+        <div>
+          <Divider mt={10} />
+          <Button mt={10} fullWidth variant="default" onClick={handleUpdateChannelImage}>Update Image from Platform</Button>
+        </div>
+      )}
+    </div>
+  );
+}
+
+export default AdminChannelDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/channel/PlatformDrawerContent.tsx b/frontend/app/components/admin/channel/PlatformDrawerContent.tsx
new file mode 100644
index 00000000..0a4b8c3f
--- /dev/null
+++ b/frontend/app/components/admin/channel/PlatformDrawerContent.tsx
@@ -0,0 +1,73 @@
+import { useArchiveChannel } from "@/app/hooks/useArchive";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Button, TextInput } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+import { z } from "zod";
+
+type Props = {
+  handleClose: () => void;
+}
+
+const schema = z.object({
+  channel_name: z.string().min(2, { message: "Channel name should have at least 2 characters" })
+})
+
+const PlatformChannelDrawerContent = ({ handleClose }: Props) => {
+  const useArchiveChannelMutate = useArchiveChannel()
+  const axiosPrivate = useAxiosPrivate()
+  const [loading, setLoading] = useState(false)
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      channel_name: ""
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+    console.debug(`Admin platform channel form submit - ${formValues}`)
+
+    // archive platform channel
+    try {
+      setLoading(true)
+      await useArchiveChannelMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        channel_name: formValues.channel_name
+      })
+
+      showNotification({
+        message: "Channel added"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          label="Platform Channel Name"
+          placeholder="ganymede"
+          key={form.key('channel_name')}
+          {...form.getInputProps('channel_name')}
+        />
+
+        <Button mt={10} type="submit" loading={loading} fullWidth>Add Channel</Button>
+      </form>
+    </div>
+  );
+}
+
+export default PlatformChannelDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/queue/DeleteModalContent.tsx b/frontend/app/components/admin/queue/DeleteModalContent.tsx
new file mode 100644
index 00000000..12f77937
--- /dev/null
+++ b/frontend/app/components/admin/queue/DeleteModalContent.tsx
@@ -0,0 +1,53 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Queue, useDeleteQueue } from "@/app/hooks/useQueue";
+import { Button, Code, Flex, Text } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  queue: Queue
+  handleClose: () => void;
+}
+
+
+const DeleteQueueModalContent = ({ queue, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+
+  const deleteQueueMutate = useDeleteQueue()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteQueue = async () => {
+    try {
+      setLoading(true)
+
+      await deleteQueueMutate.mutateAsync({ axiosPrivate: axiosPrivate, queueId: queue.id })
+
+      showNotification({
+        message: "Channel deleted"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete this queue item?</Text>
+      <Flex>
+        ID: <Code ml={3}>{queue.id}</Code>
+      </Flex>
+
+      <Text fs={"italic"} fz={"sm"}>
+        This action does not delete any files.
+      </Text>
+
+      <Button mt={5} color="red" onClick={handleDeleteQueue} loading={loading} fullWidth>Delete Queue</Button>
+    </div>
+  );
+}
+
+export default DeleteQueueModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/queue/DrawerContent.tsx b/frontend/app/components/admin/queue/DrawerContent.tsx
new file mode 100644
index 00000000..a1703553
--- /dev/null
+++ b/frontend/app/components/admin/queue/DrawerContent.tsx
@@ -0,0 +1,203 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Queue, QueueTaskStatus, useEditQueue } from "@/app/hooks/useQueue";
+import { Button, TextInput, Checkbox, Select } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+import { z } from "zod";
+
+type Props = {
+  queue: Queue
+  handleClose: () => void;
+}
+
+
+const schema = z.object({
+  id: z.string().min(2, { message: "ID should have at least 2 characters" }),
+  processing: z.boolean(),
+  on_hold: z.boolean(),
+  video_processing: z.boolean(),
+  chat_processing: z.boolean(),
+  live_archive: z.boolean(),
+
+  task_vod_create_folder: z.nativeEnum(QueueTaskStatus),
+  task_vod_download_thumbnail: z.nativeEnum(QueueTaskStatus),
+  task_vod_save_info: z.nativeEnum(QueueTaskStatus),
+  task_video_download: z.nativeEnum(QueueTaskStatus),
+  task_video_convert: z.nativeEnum(QueueTaskStatus),
+  task_video_move: z.nativeEnum(QueueTaskStatus),
+  task_chat_convert: z.nativeEnum(QueueTaskStatus),
+  task_chat_render: z.nativeEnum(QueueTaskStatus),
+  task_chat_move: z.nativeEnum(QueueTaskStatus),
+})
+
+const AdminQueueDrawerContent = ({ queue, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const useEditQueueMutate = useEditQueue()
+  const [loading, setLoading] = useState(false)
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: queue.id,
+      processing: queue.processing ?? false,
+      on_hold: queue.on_hold ?? false,
+      video_processing: queue.video_processing ?? false,
+      chat_processing: queue.chat_processing ?? false,
+      live_archive: queue.live_archive ?? false,
+
+      task_vod_create_folder: queue.task_vod_create_folder,
+      task_vod_download_thumbnail: queue.task_vod_download_thumbnail,
+      task_vod_save_info: queue.task_vod_save_info,
+      task_video_download: queue.task_video_download,
+      task_video_convert: queue.task_video_convert,
+      task_video_move: queue.task_video_move,
+      task_chat_download: queue.task_chat_download,
+      task_chat_convert: queue.task_chat_convert,
+      task_chat_render: queue.task_chat_render,
+      task_chat_move: queue.task_chat_move,
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+    console.debug(`Queue form submit - ${formValues}`)
+
+    // @ts-expect-error uncessary
+    const submitQueue: Queue = { ...formValues }
+
+    // edit queue
+    try {
+      setLoading(true)
+
+      await useEditQueueMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        queue: submitQueue
+      })
+
+      showNotification({
+        message: "Queue edited"
+      })
+
+      handleClose()
+    } catch (error) {
+      setLoading(false)
+      console.error(error)
+    }
+  }
+
+  const selectorQueueTaskStatus = Object.values(QueueTaskStatus).map((type) => ({
+    value: type,
+    label: type.charAt(0).toUpperCase() + type.slice(1),
+  }));
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          disabled={true}
+          label="ID"
+          placeholder="Auto generated"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+        />
+
+        <Checkbox
+          label="Is Processing"
+          key={form.key('processing')}
+          {...form.getInputProps('processing', { type: "checkbox" })}
+        />
+        <Checkbox
+          label="On Hold"
+          key={form.key('on_hold')}
+          {...form.getInputProps('on_hold', { type: "checkbox" })}
+        />
+        <Checkbox
+          label="Video Processing"
+          key={form.key('video_processing')}
+          {...form.getInputProps('video_processing', { type: "checkbox" })}
+        />
+        <Checkbox
+          label="Chat Processing"
+          key={form.key('chat_processing')}
+          {...form.getInputProps('chat_processing', { type: "checkbox" })}
+        />
+        <Checkbox
+          label="Live Archive"
+          key={form.key('live_archive')}
+          {...form.getInputProps('live_archive', { type: "checkbox" })}
+        />
+
+        <Select
+          label="Task Create Folder"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_vod_create_folder')}
+          {...form.getInputProps('task_vod_create_folder')}
+        />
+        <Select
+          label="Task Download Thumbnail"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_vod_download_thumbnail')}
+          {...form.getInputProps('task_vod_download_thumbnail')}
+        />
+        <Select
+          label="Task Save Information"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_vod_save_info')}
+          {...form.getInputProps('task_vod_save_info')}
+        />
+        <Select
+          label="Task Video Download"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_video_download')}
+          {...form.getInputProps('task_video_download')}
+        />
+        <Select
+          label="Task Video Convert"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_video_convert')}
+          {...form.getInputProps('task_video_convert')}
+        />
+        <Select
+          label="Task Video Move"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_video_move')}
+          {...form.getInputProps('task_video_move')}
+        />
+        <Select
+          label="Task Chat Download"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_chat_download')}
+          {...form.getInputProps('task_chat_download')}
+        />
+        <Select
+          label="Task Chat Convert"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_chat_convert')}
+          {...form.getInputProps('task_chat_convert')}
+        />
+        <Select
+          label="Task Chat Render"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_chat_render')}
+          {...form.getInputProps('task_chat_render')}
+        />
+        <Select
+          label="Task Chat Move"
+          data={selectorQueueTaskStatus}
+          key={form.key('task_chat_move')}
+          {...form.getInputProps('task_chat_move')}
+        />
+
+        <Button mt={10} type="submit" loading={loading} fullWidth>Edit Queue Item</Button>
+      </form>
+
+    </div>
+  );
+}
+
+export default AdminQueueDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/user/DeleteModalContent.tsx b/frontend/app/components/admin/user/DeleteModalContent.tsx
new file mode 100644
index 00000000..3b4fcba1
--- /dev/null
+++ b/frontend/app/components/admin/user/DeleteModalContent.tsx
@@ -0,0 +1,49 @@
+import { User } from "@/app/hooks/useAuthentication";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useDeleteUser } from "@/app/hooks/useUsers";
+import { Button, Code, Text } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  user: User
+  handleClose: () => void;
+}
+
+
+const DeleteUserModalContent = ({ user, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+
+  const deleteUserMutate = useDeleteUser()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteQueue = async () => {
+    try {
+      setLoading(true)
+
+      await deleteUserMutate.mutateAsync({ axiosPrivate: axiosPrivate, userId: user.id })
+
+      showNotification({
+        message: "User deleted"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete this user?</Text>
+
+      <Code block>{JSON.stringify(user, null, 2)}</Code>
+
+      <Button mt={5} color="red" onClick={handleDeleteQueue} loading={loading} fullWidth>Delete User</Button>
+    </div>
+  );
+}
+
+export default DeleteUserModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/user/DrawerContent.tsx b/frontend/app/components/admin/user/DrawerContent.tsx
new file mode 100644
index 00000000..76a74cae
--- /dev/null
+++ b/frontend/app/components/admin/user/DrawerContent.tsx
@@ -0,0 +1,114 @@
+import { User, UserRole } from "@/app/hooks/useAuthentication";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useEditUser } from "@/app/hooks/useUsers";
+import { Button, TextInput, Select } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+import { z } from "zod";
+
+type Props = {
+  user: User
+  handleClose: () => void;
+}
+
+
+const schema = z.object({
+  id: z.string().min(2, { message: "ID should have at least 2 characters" }).max(50),
+  username: z.string().min(3, { message: "Username should have at least 3 characters" }),
+  role: z.nativeEnum(UserRole)
+})
+
+const AdminUserDrawerContent = ({ user, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const useEditUserMutate = useEditUser()
+  const [loading, setLoading] = useState(false)
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: user.id,
+      username: user.username,
+      role: user.role,
+      oauth: user.oauth,
+      created_at: user.created_at
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+    console.debug(`User form submit - ${formValues}`)
+
+    // @ts-expect-error uncessary
+    const submitUser: User = { ...formValues }
+
+    // edit user
+    try {
+      setLoading(true)
+
+      await useEditUserMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        user: submitUser
+      })
+
+      showNotification({
+        message: "User edited"
+      })
+
+      handleClose()
+    } catch (error) {
+      setLoading(false)
+      console.error(error)
+    }
+  }
+
+  const selectorUserRole = Object.values(UserRole).map((type) => ({
+    value: type,
+    label: type.charAt(0).toUpperCase() + type.slice(1),
+  }));
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          disabled={true}
+          label="ID"
+          placeholder="Auto generated"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+        />
+
+        <TextInput
+          withAsterisk
+          label="Username"
+          placeholder="ganymede"
+          key={form.key('username')}
+          {...form.getInputProps('username')}
+        />
+
+        <Select
+          label="Role"
+          data={selectorUserRole}
+          key={form.key('role')}
+          {...form.getInputProps('role')}
+        />
+
+        <TextInput
+          disabled
+          label="Created At"
+          placeholder="ganymede"
+          key={form.key('created_at')}
+          {...form.getInputProps('created_at')}
+        />
+        <Button mt={10} type="submit" loading={loading} fullWidth>Edit User</Button>
+      </form>
+
+    </div>
+  );
+}
+
+export default AdminUserDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/video/DeleteModalContent.tsx b/frontend/app/components/admin/video/DeleteModalContent.tsx
new file mode 100644
index 00000000..5fd5476d
--- /dev/null
+++ b/frontend/app/components/admin/video/DeleteModalContent.tsx
@@ -0,0 +1,88 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useBlockVideo } from "@/app/hooks/useBlockedVideos";
+import { useDeleteVideo, Video } from "@/app/hooks/useVideos";
+import { escapeURL } from "@/app/util/util";
+import { Button, Code, Text, Image, Flex, Checkbox } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { env } from "next-runtime-env";
+import { useState } from "react";
+
+type Props = {
+  video: Video
+  handleClose: () => void;
+}
+
+const DeleteVideoModalContent = ({ video, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+  const [deleteFiles, setDeleteFiles] = useState(false)
+  const [blockVideo, setBlockVideo] = useState(false)
+
+  const deleteVideoMutate = useDeleteVideo()
+  const blockVideoMutate = useBlockVideo()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteVideo = async () => {
+    try {
+      setLoading(true)
+
+      if (blockVideo) {
+        await blockVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          id: video.ext_id
+        })
+      }
+
+      await deleteVideoMutate.mutateAsync({ axiosPrivate: axiosPrivate, id: video.id, deleteFiles: deleteFiles })
+
+      showNotification({
+        message: "Video deleted"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+      setBlockVideo(false)
+      setDeleteFiles(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete this video?</Text>
+      <Code block mb={5}>
+        <pre>ID: {video.id}</pre>
+        <pre>External ID: {video.ext_id}</pre>
+        <pre>Title: {video.title}</pre>
+        <pre>Channel: {video.edges.channel.name}</pre>
+      </Code>
+      <Image
+        src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(
+          video.web_thumbnail_path
+        )}`}
+        fallbackSrc="/images/ganymede-thumbnail.webp"
+        alt={video.title}
+      />
+
+      <Flex my={10}>
+        <Checkbox
+          label="Delete files"
+          checked={deleteFiles}
+          onChange={(event) => setDeleteFiles(event.currentTarget.checked)}
+          mr={10}
+        />
+        <Checkbox
+          label="Block external video ID"
+          checked={blockVideo}
+          onChange={(event) => setBlockVideo(event.currentTarget.checked)}
+        />
+
+      </Flex>
+
+      <Button mt={5} color="red" onClick={handleDeleteVideo} loading={loading} fullWidth>Delete Video</Button>
+    </div>
+  );
+}
+
+export default DeleteVideoModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/video/DrawerContent.tsx b/frontend/app/components/admin/video/DrawerContent.tsx
new file mode 100644
index 00000000..e6c203c3
--- /dev/null
+++ b/frontend/app/components/admin/video/DrawerContent.tsx
@@ -0,0 +1,312 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Channel, useFetchChannels } from "@/app/hooks/useChannels";
+import { CreateVodRequest, Platform, useCreateVideo, useEditVideo, Video, VideoType } from "@/app/hooks/useVideos";
+import { Select, Button, NumberInput, TextInput, Checkbox, Flex } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useEffect, useState } from "react";
+import { z } from "zod";
+
+type Props = {
+  video: Video | null
+  mode: VideoEditMode
+  handleClose: () => void;
+}
+
+export enum VideoEditMode {
+  Create = "create",
+  Edit = "edit",
+}
+
+
+interface SelectOption {
+  label: string;
+  value: string;
+}
+
+const schema = z.object({
+  title: z.string().min(1, { message: "Title should have at least 1 characters" }),
+  ext_id: z.string().min(1, { message: "External ID should have at least 1 characters" }),
+  channel_id: z.string().min(1, { message: "Select a channel" }),
+  type: z.nativeEnum(VideoType, { message: "Select a video type" }),
+  platform: z.nativeEnum(Platform, { message: "Select a platform" }),
+  duration: z.number().min(1, { message: "Duration should be at least 1 second" }),
+  views: z.number().min(1),
+  resolution: z.string().min(1),
+  streamed_at: z.string().datetime(),
+  web_thumbnail_path: z.string().min(1),
+  video_path: z.string().min(1)
+})
+
+const AdminVideoDrawerContent = ({ video, mode, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const [loading, setLoading] = useState(false)
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: video?.id || "",
+      ext_id: video?.ext_id || "",
+      platform: video?.platform || Platform.Twitch,
+      type: video?.type || "",
+      title: video?.title || "",
+      duration: video?.duration || 0,
+      views: video?.views || 0,
+      resolution: video?.resolution || "",
+      thumbnail_path: video?.thumbnail_path || "",
+      web_thumbnail_path: video?.web_thumbnail_path || "",
+      video_path: video?.video_path || "",
+      chat_path: video?.chat_path || "",
+      chat_video_path: video?.chat_video_path || "",
+      info_path: video?.info_path || "",
+      processing: video?.processing ?? false,
+      streamed_at: video?.streamed_at || "",
+      channel_id: video?.edges.channel.id || "",
+      caption_path: video?.caption_path || "",
+      locked: video?.locked ?? false
+    },
+
+    validate: zodResolver(schema),
+  })
+
+  const editVideoMutate = useEditVideo()
+  const createVideoMutate = useCreateVideo()
+
+  const handleSubmitForm = async () => {
+    setLoading(true)
+    const formValues = form.getValues()
+    console.debug(`Admin video form submit - ${formValues}`)
+
+    try {
+
+      const req: CreateVodRequest = {
+        ...formValues,
+        type: formValues.type as VideoType,
+        streamed_at: formValues.streamed_at instanceof Date
+          ? formValues.streamed_at.toISOString()
+          : formValues.streamed_at,
+      };
+
+      if (mode === VideoEditMode.Create) {
+        await createVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          videoData: req
+        })
+      } else {
+        await editVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          videoData: req,
+          videoId: req.id
+        })
+      }
+
+      showNotification({
+        message: `Video ${mode == VideoEditMode.Create ? 'created' : 'edited'}`
+      })
+
+      handleClose()
+
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+
+  }
+
+  const { data: channels } = useFetchChannels();
+  const [channelSelect, setChannelSelect] = useState<SelectOption[]>([]);
+
+  useEffect(() => {
+    if (!channels) return;
+
+    const transformedChannels: SelectOption[] = channels.map((channel: Channel) => ({
+      label: channel.name,
+      value: channel.id,
+    }));
+
+    setChannelSelect(transformedChannels);
+  }, [channels]);
+
+  const selectorVideoTypes = Object.values(VideoType).map((type) => ({
+    value: type,
+    label: type.charAt(0).toUpperCase() + type.slice(1),
+  }));
+
+  const selectorVideoPlatforms = Object.values(Platform).map((type) => ({
+    value: type,
+    label: type.charAt(0).toUpperCase() + type.slice(1),
+  }));
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          disabled={true}
+          label="ID"
+          placeholder="Auto generated"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+          withAsterisk
+        />
+        <TextInput
+          label="External Platform ID"
+          placeholder="123456789"
+          key={form.key('ext_id')}
+          {...form.getInputProps('ext_id')}
+          withAsterisk
+        />
+
+        <Select
+          label="Channel"
+          data={channelSelect}
+          key={form.key('channel_id')}
+          {...form.getInputProps('channel_id')}
+          searchable
+          withAsterisk
+        />
+
+        <Flex
+          my={10}
+          gap="md"
+          justify="flex-start"
+          align="center"
+          direction="row"
+        >
+
+          <Checkbox
+            label="Is Processing"
+            key={form.key('processing')}
+            {...form.getInputProps('processing', { type: "checkbox" })}
+          />
+          <Checkbox
+            label="Locked"
+            key={form.key('locked')}
+            {...form.getInputProps('locked', { type: "checkbox" })}
+          />
+
+        </Flex>
+
+
+        <TextInput
+          withAsterisk
+          label="Title"
+          placeholder="An awesome title"
+          key={form.key('title')}
+          {...form.getInputProps('title')}
+        />
+
+        <Select
+          label="Type"
+          data={selectorVideoTypes}
+          key={form.key('type')}
+          {...form.getInputProps('type')}
+          searchable
+          withAsterisk
+        />
+
+        <Select
+          label="Platform"
+          data={selectorVideoPlatforms}
+          key={form.key('platform')}
+          {...form.getInputProps('platform')}
+          searchable
+          withAsterisk
+        />
+
+        <Flex
+          gap="md"
+          justify="flex-start"
+          align="center"
+          direction="row"
+        >
+          <NumberInput
+            label="Duration (seconds)"
+            placeholder="0"
+            key={form.key('duration')}
+            {...form.getInputProps('duration')}
+            min={0}
+            withAsterisk
+          />
+          <NumberInput
+            label="View Count"
+            placeholder="0"
+            key={form.key('views')}
+            {...form.getInputProps('views')}
+            min={0}
+            withAsterisk
+          />
+        </Flex>
+
+        <TextInput
+          withAsterisk
+          label="Resolution"
+          placeholder="best"
+          key={form.key('resolution')}
+          {...form.getInputProps('resolution')}
+        />
+
+        <TextInput
+          withAsterisk
+          label="Streamed At"
+          placeholder="2022-01-01"
+          key={form.key('streamed_at')}
+          {...form.getInputProps('streamed_at')}
+        />
+
+        <TextInput
+          label="Thumbnail Path"
+          placeholder="/data/videos/channel/123_456/123-thumbnail.jpg"
+          key={form.key('thumbnail_path')}
+          {...form.getInputProps('thumbnail_path')}
+        />
+        <TextInput
+          label="Web Thumbnail Path"
+          placeholder="/data/videos/channel/123_456/123-web_thumbnail.jpg"
+          key={form.key('web_thumbnail_path')}
+          {...form.getInputProps('web_thumbnail_path')}
+          withAsterisk
+        />
+        <TextInput
+          label="Video Path"
+          placeholder="/data/videos/channel/123_456/123-video.mp4"
+          key={form.key('video_path')}
+          {...form.getInputProps('video_path')}
+          withAsterisk
+        />
+        <TextInput
+          label="Chat Path"
+          placeholder="/data/videos/channel/123_456/123-chat.json"
+          key={form.key('chat_path')}
+          {...form.getInputProps('chat_path')}
+        />
+        <TextInput
+          label="Chat Video Path"
+          placeholder="/data/videos/channel/123_456/123-chat.mp4"
+          key={form.key('chat_video_path')}
+          {...form.getInputProps('chat_video_path')}
+        />
+        <TextInput
+          label="Caption Path"
+          placeholder="/data/videos/channel/123_456/123.vtt"
+          key={form.key('caption_path')}
+          {...form.getInputProps('caption_path')}
+        />
+        <TextInput
+          label="Info Path"
+          placeholder="/data/videos/channel/123_456/123-info.json"
+          key={form.key('info_path')}
+          {...form.getInputProps('info_path')}
+        />
+
+
+
+        <Button mt={10} type="submit" loading={loading} fullWidth>{mode == VideoEditMode.Create ? 'Create Video' : 'Edit Video'}</Button>
+      </form>
+    </div>
+  );
+}
+
+export default AdminVideoDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/video/MultiDeleteModalContent.tsx b/frontend/app/components/admin/video/MultiDeleteModalContent.tsx
new file mode 100644
index 00000000..b2e066bb
--- /dev/null
+++ b/frontend/app/components/admin/video/MultiDeleteModalContent.tsx
@@ -0,0 +1,72 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useBlockVideo } from "@/app/hooks/useBlockedVideos";
+import { useDeleteVideo, Video } from "@/app/hooks/useVideos";
+import { Button, Text, Flex, Checkbox } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  videos: Video[]
+  handleClose: () => void;
+}
+
+const MultiDeleteVideoModalContent = ({ videos, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+  const [deleteFiles, setDeleteFiles] = useState(false)
+  const [blockVideo, setBlockVideo] = useState(false)
+  const deleteVideoMutate = useDeleteVideo()
+  const blockVideoMutate = useBlockVideo()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteVideo = async () => {
+    setLoading(true)
+    try {
+      await Promise.all(videos.map(async (video) => {
+        if (blockVideo) {
+          await blockVideoMutate.mutateAsync({
+            axiosPrivate: axiosPrivate,
+            id: video.ext_id
+          })
+        }
+        await deleteVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          id: video.id,
+          deleteFiles: deleteFiles
+        })
+      }))
+
+      showNotification({
+        message: "Videos deleted"
+      })
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+      setBlockVideo(false)
+      setDeleteFiles(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete the {videos.length} selected videos?</Text>
+      <Flex my={10}>
+        <Checkbox
+          label="Delete files"
+          checked={deleteFiles}
+          onChange={(event) => setDeleteFiles(event.currentTarget.checked)}
+          mr={10}
+        />
+        <Checkbox
+          label="Block external video ID"
+          checked={blockVideo}
+          onChange={(event) => setBlockVideo(event.currentTarget.checked)}
+        />
+      </Flex>
+      <Button mt={5} color="red" onClick={handleDeleteVideo} loading={loading} fullWidth>Delete Videos</Button>
+    </div>
+  );
+}
+
+export default MultiDeleteVideoModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/watched/DeleteModalContent.tsx b/frontend/app/components/admin/watched/DeleteModalContent.tsx
new file mode 100644
index 00000000..afacc09c
--- /dev/null
+++ b/frontend/app/components/admin/watched/DeleteModalContent.tsx
@@ -0,0 +1,48 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { } from "@/app/hooks/useChannels";
+import { useDeleteWatchedChannel, WatchedChannel } from "@/app/hooks/useWatchedChannels";
+import { Button, Code, Text } from "@mantine/core";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  watchedChannel: WatchedChannel | null
+  handleClose: () => void;
+}
+
+
+const DeleteWatchedChannelModalContent = ({ watchedChannel, handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+
+  const deleteWatchedChannelMutate = useDeleteWatchedChannel()
+  const axiosPrivate = useAxiosPrivate()
+
+  const handleDeleteChannel = async () => {
+    if (!watchedChannel || !watchedChannel.id) return
+    try {
+      setLoading(true)
+
+      await deleteWatchedChannelMutate.mutateAsync({ axiosPrivate: axiosPrivate, watchedChannelId: watchedChannel.id })
+
+      showNotification({
+        message: "Watched channel deleted"
+      })
+
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <Text>Are you sure you want to delete this watched channel?</Text>
+      <Code block>{JSON.stringify(watchedChannel, null, 2)}</Code>
+      <Button mt={5} color="red" onClick={handleDeleteChannel} loading={loading} fullWidth>Delete Watched Channel</Button>
+    </div>
+  );
+}
+
+export default DeleteWatchedChannelModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/watched/DrawerContent.tsx b/frontend/app/components/admin/watched/DrawerContent.tsx
new file mode 100644
index 00000000..0bc31dff
--- /dev/null
+++ b/frontend/app/components/admin/watched/DrawerContent.tsx
@@ -0,0 +1,497 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Channel, useFetchChannels } from "@/app/hooks/useChannels";
+import { WatchedChannel, WatchedChannelTitleRegex, useCreateWatchedChannel, useEditWatchedChannel } from "@/app/hooks/useWatchedChannels";
+import { ActionIcon, Button, NumberInput, TextInput, Tooltip, Text, Divider, Checkbox, Select, Title, Box, Group, Grid, MultiSelect } from "@mantine/core";
+import { useForm } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { IconPlus, IconTrash } from "@tabler/icons-react";
+import { useEffect, useState } from "react";
+import classes from "./Watched.module.css"
+import { getTwitchCategories } from "@/app/hooks/useCategory";
+
+type Props = {
+  watchedChannel: WatchedChannel | null
+  mode: WatchedChannelEditMode
+  handleClose: () => void;
+}
+
+export enum WatchedChannelEditMode {
+  Create = "create",
+  Edit = "edit",
+}
+
+const qualityOptions = [
+  { label: "Best", value: "best" },
+  { label: "720p60", value: "720p60" },
+  { label: "480p", value: "480p30" },
+  { label: "360p", value: "360p30" },
+  { label: "160p", value: "160p30" },
+  { label: "audio", value: "audio" }
+];
+
+interface SelectOption {
+  label: string;
+  value: string;
+}
+
+const AdminWatchedChannelDrawerContent = ({ watchedChannel, mode, handleClose }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const [liveTitleRegexes, setLiveTitleRegexes] = useState<WatchedChannelTitleRegex[]>(
+    watchedChannel?.edges.title_regex || []
+  );
+
+  const [channelSelect, setChannelSelect] = useState<SelectOption[]>([]);
+
+  // Initialize edit watched channel mutation
+  const editWatchedChannelMutation = useEditWatchedChannel();
+
+  const form = useForm({
+    mode: "controlled",
+    initialValues: {
+      id: watchedChannel?.id || "",
+      watch_live: watchedChannel?.watch_live ?? false,
+      watch_vod: watchedChannel?.watch_vod ?? false,
+      download_archives: watchedChannel?.download_archives ?? true,
+      download_highlights: watchedChannel?.download_highlights ?? true,
+      download_uploads: watchedChannel?.download_uploads ?? true,
+      resolution: watchedChannel?.resolution || "best",
+      archive_chat: watchedChannel?.archive_chat ?? true,
+      channel_id: watchedChannel?.edges.channel.id || "",
+      render_chat: watchedChannel?.render_chat ?? true,
+      download_sub_only: watchedChannel?.download_sub_only ?? false,
+      max_age: watchedChannel?.max_age || 7,
+      apply_categories_to_live: watchedChannel?.apply_categories_to_live ?? false,
+      watch_clips: watchedChannel?.watch_clips ?? false,
+      clips_limit: watchedChannel?.clips_limit || 5,
+      clips_interval_days: watchedChannel?.clips_interval_days || 7,
+      live_title_regexes: [],
+      categories: [] as string[],
+    },
+  })
+
+  useEffect(() => {
+    if (!watchedChannel || !watchedChannel.edges.categories) return
+
+    const categories = watchedChannel.edges.categories.map((category) => category.name);
+    form.setFieldValue('categories', categories);
+
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [watchedChannel])
+
+  const [twitchCategoriesLoading, setTwitchCategoriesLoading] = useState(false);
+  const [formattedTwitchCategories, setFormattedTwitchCategories] = useState<SelectOption[]>([]);
+
+  const handleGetTwitchCategories = async () => {
+    try {
+      setTwitchCategoriesLoading(true)
+
+      const categories = await getTwitchCategories()
+      if (!categories) return
+
+      const tmpArr = categories.map((category) => ({
+        label: category.name,
+        value: category.name,
+      })).filter((item, index, self) =>
+        index === self.findIndex((t) => t.label === item.label)
+      );
+
+      setFormattedTwitchCategories(tmpArr);
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setTwitchCategoriesLoading(false)
+    }
+  }
+
+  const createWatchedChannelMutation = useCreateWatchedChannel();
+
+  const handleSubmitForm = async () => {
+    const formValues = form.getValues()
+
+    try {
+      if (mode === WatchedChannelEditMode.Create) {
+        const newWatchedChannel: WatchedChannel = {
+          id: "", // Will be generated by backend
+          watch_live: formValues.watch_live,
+          watch_vod: formValues.watch_vod,
+          download_archives: formValues.download_archives,
+          download_highlights: formValues.download_highlights,
+          download_uploads: formValues.download_uploads,
+          resolution: formValues.resolution,
+          archive_chat: formValues.archive_chat,
+          render_chat: formValues.render_chat,
+          download_sub_only: formValues.download_sub_only,
+          max_age: formValues.max_age,
+          apply_categories_to_live: formValues.apply_categories_to_live,
+          watch_clips: formValues.watch_clips,
+          clips_limit: formValues.clips_limit,
+          clips_interval_days: formValues.clips_interval_days,
+          is_live: false, // Default value
+          edges: {
+            channel: { id: formValues.channel_id } as Channel,
+            categories: [],
+            title_regex: liveTitleRegexes
+          },
+          last_live: "",
+          updated_at: "",
+          created_at: ""
+        };
+
+        await createWatchedChannelMutation.mutateAsync({
+          axiosPrivate,
+          channelId: formValues.channel_id,
+          watchedChannel: newWatchedChannel,
+          categories: formValues.categories
+        });
+
+        showNotification({
+          message: "Watched Channel Created",
+          color: "green"
+        });
+
+        handleClose();
+      } else if (mode === WatchedChannelEditMode.Edit && watchedChannel) {
+        const updatedWatchedChannel: WatchedChannel = {
+          ...watchedChannel,
+          watch_live: formValues.watch_live,
+          watch_vod: formValues.watch_vod,
+          download_archives: formValues.download_archives,
+          download_highlights: formValues.download_highlights,
+          download_uploads: formValues.download_uploads,
+          resolution: formValues.resolution,
+          archive_chat: formValues.archive_chat,
+          render_chat: formValues.render_chat,
+          download_sub_only: formValues.download_sub_only,
+          max_age: formValues.max_age,
+          apply_categories_to_live: formValues.apply_categories_to_live,
+          watch_clips: formValues.watch_clips,
+          clips_limit: formValues.clips_limit,
+          clips_interval_days: formValues.clips_interval_days,
+          edges: {
+            ...watchedChannel.edges,
+            title_regex: liveTitleRegexes
+          }
+        };
+
+        await editWatchedChannelMutation.mutateAsync({
+          axiosPrivate,
+          watchedChannel: updatedWatchedChannel,
+          categories: formValues.categories
+        });
+
+        showNotification({
+          message: "Watched Channel Updated",
+          color: "green"
+        });
+
+        handleClose();
+      }
+    } catch (error) {
+      console.error(error);
+      showNotification({
+        message: mode === WatchedChannelEditMode.Create
+          ? "Failed to create Watched Channel"
+          : "Failed to update Watched Channel",
+        color: "red"
+      });
+    }
+  }
+
+
+  const { data: channels } = useFetchChannels();
+
+  useEffect(() => {
+    if (!channels) return;
+
+    const transformedChannels: SelectOption[] = channels.map((channel: Channel) => ({
+      label: channel.name,
+      value: channel.id,
+    }));
+
+    setChannelSelect(transformedChannels);
+  }, [channels]);
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(() => {
+        handleSubmitForm()
+      })}>
+        <TextInput
+          disabled={true}
+          label="ID"
+          placeholder="Auto generated"
+          key={form.key('id')}
+          {...form.getInputProps('id')}
+        />
+
+        <Select
+          disabled={mode == WatchedChannelEditMode.Edit}
+          label="Channel"
+          data={channelSelect}
+          key={form.key('channel_id')}
+          {...form.getInputProps('channel_id')}
+          searchable
+        />
+
+        <Select
+          label="Resolution"
+          data={qualityOptions}
+          key={form.key('resolution')}
+          {...form.getInputProps('resolution')}
+          searchable
+        />
+
+        <Checkbox
+          mt={10}
+          label="Archive Chat"
+          key={form.key('archive_chat')}
+          {...form.getInputProps('archive_chat', { type: "checkbox" })}
+        />
+
+        <Checkbox
+          mt={5}
+          label="Render Chat"
+          key={form.key('render_chat')}
+          {...form.getInputProps('render_chat', { type: "checkbox" })}
+        />
+
+        <Divider my="sm" size="md" />
+
+        <div>
+          <Title order={3}>Live Streams</Title>
+          <Text>Archive live streams as they are broadcasted.</Text>
+
+          <Checkbox
+            mt={5}
+            label="Watch Live Streams"
+            key={form.key('watch_live')}
+            {...form.getInputProps('watch_live', { type: "checkbox" })}
+          />
+        </div>
+
+        <Divider my="sm" size="md" />
+
+        <div>
+          <Title order={3}>Channel Videos</Title>
+          <Text>Archive past channel videos.</Text>
+          <Text size="xs" fs="italic">
+            Check for new videos occurs once a day.
+          </Text>
+
+          <Checkbox
+            mt={5}
+            label="Watch Videos"
+            key={form.key('watch_vod')}
+            {...form.getInputProps('watch_vod', { type: "checkbox" })}
+          />
+
+          <Box ml={30}>
+            <Checkbox
+              mt={5}
+              label="Download Archives"
+              description="Download past live streams"
+              key={form.key('download_archives')}
+              {...form.getInputProps('download_archives', { type: "checkbox" })}
+            />
+            <Checkbox
+              mt={5}
+              label="Download Highlights"
+              description="Download past highlights"
+              key={form.key('download_highlights')}
+              {...form.getInputProps('download_highlights', { type: "checkbox" })}
+            />
+            <Checkbox
+              mt={5}
+              label="Download Uploads"
+              description="Download past uploads"
+              key={form.key('download_uploads')}
+              {...form.getInputProps('download_uploads', { type: "checkbox" })}
+            />
+            <Checkbox
+              mt={5}
+              label="Download Subscriber-only Videos"
+              description="Do not check this if you are not a subscriber. Must have Twitch token set in Admin > Settings to download subscriber-only videos."
+              key={form.key('download_sub_only')}
+              {...form.getInputProps('download_sub_only', { type: "checkbox" })}
+            />
+          </Box>
+        </div>
+
+        <Divider my="sm" size="md" />
+
+        <div>
+          <Title order={3}>Channel Clips</Title>
+          <Text>Archive past channel clips.</Text>
+          <Text size="xs" >
+            Check watched channel every <code>interval</code> days archiving the top <code>number</code> of clips. No restrictions (categories, age, title, regex, etc) are applied to this.
+          </Text>
+
+          <Checkbox
+            my={5}
+            label="Watch Clips"
+            key={form.key('watch_clips')}
+            {...form.getInputProps('watch_clips', { type: "checkbox" })}
+          />
+
+
+          <NumberInput
+            label="Number of Clips"
+            description="Number of clips to archive."
+            key={form.key('clips_limit')}
+            {...form.getInputProps('clips_limit')}
+            min={1}
+          />
+
+          <NumberInput
+            label="Interval Days"
+            description="How often channel is checked for clips to archive (in days)."
+            key={form.key('clips_interval_days')}
+            {...form.getInputProps('clips_interval_days')}
+            min={1}
+          />
+
+        </div>
+
+        <Divider my="sm" size="md" />
+
+        <div>
+          <Title order={3}>Advanced</Title>
+
+          <NumberInput
+            label="Max Video Age (days)"
+            description="Archive videos that are not older than this number of days (0 to archive all)."
+            key={form.key('max_age')}
+            {...form.getInputProps('max_age')}
+          />
+
+          <Group mt={5}>
+            <Title order={5}>Title Regex</Title>
+            <Tooltip label="Add title regex">
+              <ActionIcon size="sm" variant="filled" color="green" aria-label="Add Title Regex" onClick={() => {
+                const newRegex: WatchedChannelTitleRegex = {
+                  apply_to_videos: false,
+                  negative: false,
+                  regex: "",
+                  id: ""
+                }
+                setLiveTitleRegexes(liveTitleRegexes => [...(liveTitleRegexes ?? []), newRegex])
+              }}>
+                <IconPlus style={{ width: '70%', height: '70%' }} stroke={1.5} />
+              </ActionIcon>
+            </Tooltip>
+          </Group>
+          <div>
+            <Text size="sm">Use regex to filter and match specific patterns in livestream and video titles. See <a className={classes.link} href="https://github.com/Zibbp/ganymede/wiki/Watched-Channel-Title-Regex" target="_blank">wiki</a> for more information.</Text>
+          </div>
+
+          <div>
+            {liveTitleRegexes && liveTitleRegexes.map((regex: WatchedChannelTitleRegex, index) => (
+              <div key={index}>
+                <Grid grow>
+                  <Grid.Col span={10}>
+                    <TextInput
+                      label="Regex"
+                      placeholder="(?i:rerun)"
+                      value={regex.regex}  // Use the specific regex from the current item
+                      onChange={(e) => {
+                        const updatedRegexes = [...liveTitleRegexes];
+                        updatedRegexes[index] = {
+                          ...updatedRegexes[index],
+                          regex: e.currentTarget.value,
+                        };
+                        setLiveTitleRegexes(updatedRegexes);
+                      }}
+                    />
+
+                    <Group mt={7}>
+                      <Checkbox
+                        defaultChecked
+                        label="Negative"
+                        description="Invert match"
+                        checked={regex.negative}
+                        onChange={(e) => {
+                          const updatedRegexes = [...liveTitleRegexes];
+                          updatedRegexes[index].negative = e.currentTarget.checked;
+                          setLiveTitleRegexes(updatedRegexes)
+                        }}
+                      />
+                      <Checkbox
+                        defaultChecked
+                        label="Apply to video downloads"
+                        description="Applies to live streams only by default"
+                        checked={regex.apply_to_videos}
+                        onChange={(e) => {
+                          const updatedRegexes = [...liveTitleRegexes];
+                          updatedRegexes[index].apply_to_videos = e.currentTarget.checked;
+                          setLiveTitleRegexes(updatedRegexes)
+                        }}
+                      />
+                    </Group>
+                  </Grid.Col>
+                  <Grid.Col span={1} mt={25}>
+                    <Group>
+                      <ActionIcon size="lg" variant="filled" color="red" aria-label="Settings" h={80} onClick={() => {
+                        const updatedRegexs = [...liveTitleRegexes]
+                        updatedRegexs.splice(index, 1)
+                        setLiveTitleRegexes(updatedRegexs)
+                      }}>
+                        <IconTrash style={{ width: '70%', height: '70%' }} stroke={1.5} />
+                      </ActionIcon>
+                    </Group>
+                  </Grid.Col>
+                </Grid>
+              </div>
+            ))}
+          </div>
+        </div>
+
+        <Divider my="sm" size="md" />
+
+        <div>
+          <Title order={3}>Categories</Title>
+          <Text size="sm">Archive videso and live streams from select categories. Leave blank to archive all categories.</Text>
+        </div>
+
+        <Checkbox
+          mt={5}
+          label="Apply to livestreams"
+          description="Apply category restrictions to livestreams"
+          key={form.key('apply_categories_to_live')}
+          {...form.getInputProps('apply_categories_to_live', { type: "checkbox" })}
+        />
+
+
+        <Box mt={10}>
+          {formattedTwitchCategories.length == 0 ? (
+            <Button variant="filled" color="violet" onClick={() => handleGetTwitchCategories()}
+              loading={twitchCategoriesLoading}
+            >Load categories</Button>
+          ) : (
+            <MultiSelect
+              searchable
+              limit={20}
+              data={formattedTwitchCategories}
+              comboboxProps={{ position: 'top', middlewares: { flip: false, shift: false } }}
+              placeholder="Search for a category"
+              clearable
+              key={form.key('categories')}
+              {...form.getInputProps('categories')}
+            />
+          )}
+        </Box>
+
+        <Button
+          mt={10}
+          type="submit"
+          fullWidth
+          loading={editWatchedChannelMutation.isPending}
+        >
+          {mode === WatchedChannelEditMode.Create ? 'Create Watched Channel' : 'Save Watched Channel'}
+        </Button>
+      </form>
+
+    </div>
+  );
+}
+
+export default AdminWatchedChannelDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/admin/watched/Watched.module.css b/frontend/app/components/admin/watched/Watched.module.css
new file mode 100644
index 00000000..43c97989
--- /dev/null
+++ b/frontend/app/components/admin/watched/Watched.module.css
@@ -0,0 +1,12 @@
+.actionButton {
+  cursor: pointer;
+}
+.actionButtons {
+  display: flex;
+}
+.queueDrawer {
+  overflow-y: scroll;
+}
+.link {
+  color: var(--mantine-color-blue-6);
+}
diff --git a/frontend/app/components/auth/ChangePassword.tsx b/frontend/app/components/auth/ChangePassword.tsx
new file mode 100644
index 00000000..481f7516
--- /dev/null
+++ b/frontend/app/components/auth/ChangePassword.tsx
@@ -0,0 +1,83 @@
+import { authChangePassword } from "@/app/hooks/useAuthentication";
+import { Button, PasswordInput } from "@mantine/core";
+import { useForm, zodResolver } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+import { z } from "zod";
+
+const schema = z.object({
+  password: z.string().min(8, { message: "Password should have at least 8 characters" }),
+  new_password: z.string().min(8, { message: "Password should have at least 8 characters" }),
+  confirm_new_password: z.string().min(8, { message: "Password should have at least 8 characters" })
+})
+
+type Props = {
+  handleClose: () => void;
+}
+
+const AuthChangePassword = ({ handleClose }: Props) => {
+  const [loading, setLoading] = useState(false)
+  const form = useForm({
+    mode: "uncontrolled",
+    initialValues: {
+      password: '',
+      new_password: '',
+      confirm_new_password: '',
+    },
+
+    validate: zodResolver(schema),
+  });
+
+  const handleSubmit = async (password: string, newPassword: string, confirmNewPassword: string) => {
+    if (newPassword != confirmNewPassword) {
+      showNotification({
+        message: "New passwords must match",
+        color: "red"
+      })
+      return
+    }
+    try {
+      setLoading(true)
+      await authChangePassword(password, newPassword, confirmNewPassword)
+      showNotification({
+        message: "Passwor changed"
+      })
+      handleClose()
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit((values) => handleSubmit(values.password, values.new_password, values.confirm_new_password))}>
+        <PasswordInput
+          label="Current password"
+          key={form.key('password')}
+          {...form.getInputProps('password')}
+          radius="md"
+        />
+        <PasswordInput
+          label="New password"
+          key={form.key('new_password')}
+          {...form.getInputProps('new_password')}
+          radius="md"
+        />
+        <PasswordInput
+          label="Confirm new password"
+          key={form.key('confirm_new_password')}
+          {...form.getInputProps('confirm_new_password')}
+          radius="md"
+        />
+
+        <Button mt={10} type="submit" loading={loading} fullWidth>
+          Change Password
+        </Button>
+      </form>
+    </div>
+  );
+}
+
+export default AuthChangePassword;
\ No newline at end of file
diff --git a/frontend/app/components/authentication/AuthenticationForm.tsx b/frontend/app/components/authentication/AuthenticationForm.tsx
new file mode 100644
index 00000000..5a1efdec
--- /dev/null
+++ b/frontend/app/components/authentication/AuthenticationForm.tsx
@@ -0,0 +1,151 @@
+'use client'
+import { upperFirst } from '@mantine/hooks';
+import { useForm, zodResolver } from '@mantine/form';
+import {
+  TextInput,
+  PasswordInput,
+  Text,
+  Paper,
+  Group,
+  Button,
+  Divider,
+  Anchor,
+  Stack,
+  Box,
+} from '@mantine/core';
+import { z } from 'zod';
+import { authLogin, authRegister } from '@/app/hooks/useAuthentication';
+import { useRouter } from 'next/navigation';
+import useAuthStore from '@/app/store/useAuthStore';
+import { env } from 'next-runtime-env';
+import { showNotification } from '@mantine/notifications';
+import { useEffect, useState } from 'react';
+import Link from 'next/link';
+
+const schema = z.object({
+  username: z.string().min(3, { message: "Username should have at least 3 characters" }),
+  password: z.string().min(8, { message: "Password should have at least 8 characters" })
+})
+
+export enum AuthFormType {
+  Login = "login",
+  Register = "register"
+}
+
+type Props = {
+  type: AuthFormType
+}
+
+export function AuthenticationForm({ type }: Props) {
+  const [loading, setLoading] = useState(false)
+  const router = useRouter()
+  const { fetchUser } = useAuthStore();
+  const form = useForm({
+    mode: "uncontrolled",
+    initialValues: {
+      username: '',
+      password: '',
+    },
+
+    validate: zodResolver(schema),
+  });
+
+  // If force SSO is enabled redirect immediately
+  useEffect(() => {
+    if (env('NEXT_PUBLIC_FORCE_SSO_AUTH') == "true") {
+      handleSSOLogin()
+    }
+  }, [])
+
+  const handleAuth = async (username: string, password: string) => {
+    if (type == AuthFormType.Login) {
+      try {
+        setLoading(true)
+        await authLogin(username, password)
+        await fetchUser()
+        showNotification({
+          message: "Logged in"
+        })
+        router.push('/')
+      } catch (error) {
+        console.error(`Error logging in: ${error instanceof Error ? error.message : String(error)}`)
+      } finally {
+        setLoading(false)
+      }
+    } else {
+      try {
+        setLoading(true)
+        await authRegister(username, password)
+        router.push('/login')
+        showNotification({
+          message: "Successfully registered, please sign in."
+        })
+      } catch (error) {
+        console.error(`Error registering in: ${error instanceof Error ? error.message : String(error)}`)
+      } finally {
+        setLoading(false)
+      }
+    }
+  }
+
+  const handleSSOLogin = async () => {
+    window.location.href = `${(env('NEXT_PUBLIC_API_URL') ?? '')}/api/v1/auth/oauth/login`
+  }
+
+  return (
+    <Paper radius="md" p="xl" withBorder>
+      <Text size="lg" fw={500}>
+        Welcome to Ganymede, {type} with
+      </Text>
+
+      {(env("NEXT_PUBLIC_SHOW_SSO_LOGIN_BUTTON") == "true") ? (
+        <Box>
+          <Group grow mb="md" mt="md">
+            <Button fullWidth onClick={handleSSOLogin}>Single Sign-On (SSO)</Button>
+          </Group>
+
+          <Divider label="Or continue with local credentials" labelPosition="center" my="lg" />
+        </Box>
+      ) : (
+        <Box mt="md" mb="md"></Box>
+      )}
+
+      <form onSubmit={form.onSubmit((values) => handleAuth(values.username, values.password))}>
+        <Stack>
+          <TextInput
+            label="Username"
+            placeholder="Your username"
+            key={form.key('username')}
+            {...form.getInputProps('username')}
+            radius="md"
+          />
+
+          <PasswordInput
+            label="Password"
+            placeholder="Your password"
+            key={form.key('password')}
+            {...form.getInputProps('password')}
+            radius="md"
+          />
+        </Stack>
+
+        <Group justify="space-between" mt="xl">
+
+          {(type == AuthFormType.Login) && (
+            <Anchor component={Link} href="/register" type="button" c="dimmed" size="xs">
+              {"Don't have an account? Register"}
+            </Anchor>
+          )}
+          {(type == AuthFormType.Register) && (
+            <Anchor component={Link} href="/login" type="button" c="dimmed" size="xs">
+              {"Already have an account? Login"}
+            </Anchor>
+          )}
+          <Button type="submit" loading={loading}>
+            {upperFirst(type)}
+          </Button>
+        </Group>
+      </form>
+    </Paper>
+  );
+}
\ No newline at end of file
diff --git a/frontend/app/components/channel/Card.module.css b/frontend/app/components/channel/Card.module.css
new file mode 100644
index 00000000..d5960b4c
--- /dev/null
+++ b/frontend/app/components/channel/Card.module.css
@@ -0,0 +1,3 @@
+.link {
+  text-decoration: none;
+}
diff --git a/frontend/app/components/channel/Card.tsx b/frontend/app/components/channel/Card.tsx
new file mode 100644
index 00000000..a5c846ad
--- /dev/null
+++ b/frontend/app/components/channel/Card.tsx
@@ -0,0 +1,30 @@
+import { Channel } from "@/app/hooks/useChannels";
+import { AspectRatio, Card, Center, Title, Image } from "@mantine/core";
+import Link from "next/link";
+import { env } from "next-runtime-env";
+import classes from "./Card.module.css"
+
+type Props = {
+  channel: Channel
+}
+
+const ChannelCard = ({ channel }: Props) => {
+  return (
+    <div>
+      <Link href={"/channels/" + channel.name} className={classes.link}>
+        <Card key={channel.id} p="md" radius="md" >
+          <AspectRatio ratio={300 / 300}>
+            <Image src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${channel.image_path}`} alt={`${channel.name}`} />
+          </AspectRatio>
+          <Center mt={5}>
+            <Title order={3} mt={5}>
+              {channel.display_name}
+            </Title>
+          </Center>
+        </Card>
+      </Link>
+    </div>
+  );
+}
+
+export default ChannelCard;
\ No newline at end of file
diff --git a/frontend/app/components/landing/ContinueWatching.tsx b/frontend/app/components/landing/ContinueWatching.tsx
new file mode 100644
index 00000000..a193f658
--- /dev/null
+++ b/frontend/app/components/landing/ContinueWatching.tsx
@@ -0,0 +1,51 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios"
+import { useGetLastPlaybackVideos } from "@/app/hooks/usePlayback"
+import { rem, SimpleGrid, useMantineTheme } from "@mantine/core"
+import { useMediaQuery } from "@mantine/hooks"
+import VideoCard from "../videos/Card"
+import { Carousel } from "@mantine/carousel";
+
+type Props = {
+  count: number
+}
+
+const ContinueWatching = ({ count }: Props) => {
+  const axiosPrivate = useAxiosPrivate()
+  const theme = useMantineTheme()
+  const isMobile = useMediaQuery(`(max-width: ${theme.breakpoints.sm})`);
+
+  const { data, isPending, isError } = useGetLastPlaybackVideos(axiosPrivate, count)
+
+  if (isPending) return (<div></div>)
+  if (isError) return <div>Error loading last playback videos</div>
+
+
+  return (
+    <div>
+      {isMobile ? (
+        <Carousel
+          slideSize={{ base: '100%', sm: '50%' }}
+          slideGap={{ base: rem(4), sm: 'xl' }}
+          align="start"
+          slidesToScroll={isMobile ? 1 : 2}
+          controlSize={40}
+          withIndicators
+        >
+          {data.data && data.data.map((item) => (
+            <Carousel.Slide key={item.vod.id}>
+              <VideoCard video={item.vod} showProgress={true} showChannel={true} showMenu={true} />
+            </Carousel.Slide>
+          ))}
+        </Carousel>
+      ) : (
+        <SimpleGrid cols={{ base: 1, sm: 2, lg: 4 }} spacing="xs" verticalSpacing="xs">
+          {data.data && data.data.map((item) => (
+            <VideoCard key={item.vod.id} video={item.vod} showProgress={true} showChannel={true} showMenu={true} />
+          ))}
+        </SimpleGrid>
+      )}
+    </div>
+  );
+}
+
+export default ContinueWatching;
\ No newline at end of file
diff --git a/frontend/app/components/landing/Hero.module.css b/frontend/app/components/landing/Hero.module.css
new file mode 100644
index 00000000..2f654529
--- /dev/null
+++ b/frontend/app/components/landing/Hero.module.css
@@ -0,0 +1,42 @@
+.root {
+  background-color: #1b1b1f;
+  background-size: cover;
+  background-position: center;
+  padding-top: calc(var(--mantine-spacing-xl) * 2);
+  padding-bottom: calc(var(--mantine-spacing-xl) * 2);
+}
+
+.logoBackground {
+  background-image: linear-gradient(
+    -45deg,
+    rgb(189, 0, 254) 50%,
+    rgb(71, 202, 255) 50%
+  );
+  filter: blur(45px);
+  height: 90px;
+  width: 90px;
+  position: absolute;
+}
+
+.logo {
+  z-index: 50;
+}
+
+.button {
+  color: var(--mantine-color-white);
+}
+
+.title {
+  color: var(--mantine-color-white);
+  font-family: Greycliff CF, var(--mantine-font-family);
+  font-weight: 900;
+  line-height: 1.05;
+  max-width: 500px;
+  font-size: 48px;
+
+  @media (max-width: $mantine-breakpoint-md) {
+    max-width: 100%;
+    font-size: 34px;
+    line-height: 1.15;
+  }
+}
diff --git a/frontend/app/components/landing/Hero.tsx b/frontend/app/components/landing/Hero.tsx
new file mode 100644
index 00000000..677c7273
--- /dev/null
+++ b/frontend/app/components/landing/Hero.tsx
@@ -0,0 +1,84 @@
+"use client"
+import { Box, Button, Container, Flex, Group, Title, Text, useMantineTheme } from '@mantine/core';
+import classes from './Hero.module.css';
+import Image from 'next/image';
+import Link from 'next/link';
+import { useMediaQuery } from '@mantine/hooks';
+
+
+export function LandingHero() {
+  const theme = useMantineTheme()
+  const isMobile = useMediaQuery(`(max-width: ${theme.breakpoints.sm})`);
+  return (
+    <div className={classes.root}>
+      <Container size="xxl">
+        <Group justify="space-between">
+
+          <div>
+            <Text className={classes.title}>Ganymede</Text>
+            <Title c={theme.colors.gray[3]} mt={5} order={3}>A platform to archive live streams and videos</Title>
+            <Flex mt={10}>
+              <Button
+                variant="gradient"
+                gradient={{ from: 'blue', to: 'purple' }}
+                component={Link}
+                href="/channels"
+                className={classes.button}
+              >
+                Channels
+              </Button>
+              <Button
+                ml={10}
+                variant="default"
+                component={Link}
+                href="/login"
+              >
+                Login
+              </Button>
+            </Flex>
+          </div>
+
+          {!isMobile && (
+            <Box>
+              <Flex justify={"center"} align={"center"}>
+                <div className={classes.logoBackground}></div>
+                <Image src="/images/ganymede_logo.png" height={100} width={100} alt="Ganymede logo" className={classes.logo} />
+              </Flex>
+            </Box>
+          )}
+        </Group>
+        {/* <div className={classes.inner}>
+          <div className={classes.content}>
+            <Title className={classes.title}>
+              A{' '}
+              <Text
+                component="span"
+                inherit
+                variant="gradient"
+                gradient={{ from: 'pink', to: 'yellow' }}
+              >
+                fully featured
+              </Text>{' '}
+              React components library
+            </Title>
+
+            <Text className={classes.description} mt={30}>
+              Build fully functional accessible web applications with ease – Mantine includes more
+              than 100 customizable components and hooks to cover you in any situation
+            </Text>
+
+            <Button
+              variant="gradient"
+              gradient={{ from: 'pink', to: 'yellow' }}
+              size="xl"
+              className={classes.control}
+              mt={40}
+            >
+              Get started
+            </Button>
+          </div>
+        </div> */}
+      </Container>
+    </div>
+  );
+}
\ No newline at end of file
diff --git a/frontend/app/components/landing/RecentlyArchived.tsx b/frontend/app/components/landing/RecentlyArchived.tsx
new file mode 100644
index 00000000..04b67eda
--- /dev/null
+++ b/frontend/app/components/landing/RecentlyArchived.tsx
@@ -0,0 +1,48 @@
+import { rem, SimpleGrid, useMantineTheme } from "@mantine/core"
+import { useMediaQuery } from "@mantine/hooks"
+import VideoCard from "../videos/Card"
+import { Carousel } from "@mantine/carousel";
+import { useFetchVideosFilter } from "@/app/hooks/useVideos"
+
+type Props = {
+  count: number
+}
+
+const RecentlyArchived = ({ count }: Props) => {
+  const theme = useMantineTheme()
+  const isMobile = useMediaQuery(`(max-width: ${theme.breakpoints.sm})`);
+
+  const { data, isPending, isError } = useFetchVideosFilter({ limit: count, offset: 0 })
+
+  if (isPending) return (<div></div>)
+  if (isError) return <div>Error loading recently archived videos</div>
+
+  return (
+    <div>
+      {isMobile ? (
+        <Carousel
+          slideSize={{ base: '100%', sm: '50%' }}
+          slideGap={{ base: rem(4), sm: 'xl' }}
+          align="start"
+          slidesToScroll={isMobile ? 1 : 2}
+          controlSize={40}
+          withIndicators
+        >
+          {data.data && data.data.map((item) => (
+            <Carousel.Slide key={item.id}>
+              <VideoCard video={item} showProgress={true} showChannel={true} showMenu={true} />
+            </Carousel.Slide>
+          ))}
+        </Carousel>
+      ) : (
+        <SimpleGrid cols={{ base: 1, sm: 2, lg: 4 }} spacing="xs" verticalSpacing="xs">
+          {data.data && data.data.map((item) => (
+            <VideoCard key={item.id} video={item} showProgress={true} showChannel={true} showMenu={true} />
+          ))}
+        </SimpleGrid>
+      )}
+    </div>
+  );
+}
+
+export default RecentlyArchived;
\ No newline at end of file
diff --git a/frontend/app/components/notifications/Notifications.module.css b/frontend/app/components/notifications/Notifications.module.css
new file mode 100644
index 00000000..947d09a0
--- /dev/null
+++ b/frontend/app/components/notifications/Notifications.module.css
@@ -0,0 +1,20 @@
+.root {
+  background-color: var(--notification-color, var(--mantine-primary-color-filled));
+
+  &::before {
+    background-color: var(--mantine-color-white);
+  }
+}
+
+.description,
+.title {
+  color: var(--mantine-color-white);
+}
+
+.closeButton {
+  color: var(--mantine-color-white);
+
+  @mixin hover {
+    background-color: rgba(0, 0, 0, 0.1);
+  }
+}
\ No newline at end of file
diff --git a/frontend/app/components/playlist/EditForm.tsx b/frontend/app/components/playlist/EditForm.tsx
new file mode 100644
index 00000000..09287ba8
--- /dev/null
+++ b/frontend/app/components/playlist/EditForm.tsx
@@ -0,0 +1,87 @@
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Playlist, useCreatePlaylist, useEditPlaylist } from "@/app/hooks/usePlaylist";
+import { Button, TextInput } from "@mantine/core";
+import { useForm } from "@mantine/form";
+import { showNotification } from "@mantine/notifications";
+import { useState } from "react";
+
+type Props = {
+  playlist: Playlist | null
+  mode: PlaylistEditFormMode
+  handleClose: () => void;
+}
+
+export enum PlaylistEditFormMode {
+  Create = "create",
+  Edit = "edit",
+}
+
+const PlaylistEditForm = ({ playlist, mode, handleClose }: Props) => {
+  const [editButtonLoading, setEditButtonLoading] = useState(false)
+
+  const axiosPrivate = useAxiosPrivate();
+
+  const createPlaylistMutation = useCreatePlaylist()
+  const editPlaylistMutation = useEditPlaylist()
+
+
+  const form = useForm({
+    mode: 'uncontrolled',
+    initialValues: {
+      name: playlist?.name || "",
+      description: playlist?.description || "",
+    },
+  })
+
+  const handleSubmit = async (values: typeof form.values) => {
+    try {
+      setEditButtonLoading(true)
+
+      if (mode == PlaylistEditFormMode.Edit) {
+        await editPlaylistMutation.mutateAsync({
+          axiosPrivate,
+          id: playlist?.id || "",
+          name: values.name,
+          description: values.description
+        })
+      } else {
+        await createPlaylistMutation.mutateAsync({ axiosPrivate, name: values.name, description: values.description })
+      }
+
+      setEditButtonLoading(false)
+
+      showNotification({
+        message: `Playlist ${mode == PlaylistEditFormMode.Edit ? "edited" : "created"}`
+      })
+
+      handleClose()
+
+    } catch (error) {
+      console.error("Error creating playlist", error)
+      setEditButtonLoading(false)
+    }
+  };
+
+  return (
+    <div>
+      <form onSubmit={form.onSubmit(handleSubmit)}>
+        <TextInput
+          label="Name"
+          description="Playlist name"
+          key={form.key('name')}
+          {...form.getInputProps('name')}
+          required
+        />
+        <TextInput
+          label="Description"
+          description="Playlist description"
+          key={form.key('description')}
+          {...form.getInputProps('description')}
+        />
+        <Button mt={10} type="submit" fullWidth loading={editButtonLoading}>{mode == PlaylistEditFormMode.Create ? 'Create Playlist' : 'Edit Playlist'}</Button>
+      </form>
+    </div>
+  );
+}
+
+export default PlaylistEditForm;
\ No newline at end of file
diff --git a/frontend/app/components/playlist/ManageDrawerContent.tsx b/frontend/app/components/playlist/ManageDrawerContent.tsx
new file mode 100644
index 00000000..2a9b7ea4
--- /dev/null
+++ b/frontend/app/components/playlist/ManageDrawerContent.tsx
@@ -0,0 +1,120 @@
+import { useAddVideoToPlaylist, useGetPlaylists, useRemoveVideoFromPlaylist } from "@/app/hooks/usePlaylist";
+import { useGetPlaylistsForVideo } from "@/app/hooks/useVideos";
+import GanymedeLoadingText from "../utils/GanymedeLoadingText";
+import { ActionIcon, Button, Divider, Flex, Text, Select } from "@mantine/core";
+import { useEffect, useState } from "react";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { showNotification } from "@mantine/notifications";
+import { useQueryClient } from "@tanstack/react-query";
+import { IconTrash } from "@tabler/icons-react";
+interface Params {
+  videoId: string;
+}
+
+interface FormattedPlaylist {
+  label: string;
+  value: string;
+}
+
+const PlaylistManageDrawerContent = ({ videoId }: Params) => {
+  const [playlistsFormatted, setPlaylistsFormatted] = useState<FormattedPlaylist[]>([]);
+  const [selectedPlaylistValue, setSelectedPlaylistValue] = useState<string | null>(null);
+  const queryClient = useQueryClient()
+
+  const axiosPrivate = useAxiosPrivate();
+
+  const useAddVideoToPlaylistMutate = useAddVideoToPlaylist()
+  const useRemoveVideoFromPlaylistMutate = useRemoveVideoFromPlaylist()
+
+  const { data: videoPlaylists, isPending: isVideoPlaylistsPending, isError: isVideoPlaylistsError } = useGetPlaylistsForVideo(videoId)
+
+  const { data: playlists, isPending: isPlaylistsPending, isError: isPlaylistsError } = useGetPlaylists()
+
+  useEffect(() => {
+    setPlaylistsFormatted([])
+    if (!playlists) return
+    playlists.forEach((playlist) => {
+      setPlaylistsFormatted(prevPlaylists => {
+        const currentPlaylists = prevPlaylists || [];
+        return [...currentPlaylists, {
+          label: playlist.name,
+          value: playlist.id
+        }];
+      });
+    })
+  }, [playlists])
+
+
+  const addVideoToPlayist = async () => {
+    if (!selectedPlaylistValue) return;
+    try {
+      await useAddVideoToPlaylistMutate.mutateAsync({ axiosPrivate, playlistId: selectedPlaylistValue, videoId: videoId })
+
+      queryClient.invalidateQueries({ queryKey: ["video", "playlists", videoId] })
+
+      showNotification({
+        message: "Addded video to playlist"
+      })
+
+
+    } catch (error) {
+      console.error(error)
+    }
+  }
+
+  const removeVideoFromPlaylist = async (playlistId: string) => {
+    try {
+      await useRemoveVideoFromPlaylistMutate.mutateAsync({ axiosPrivate, playlistId: playlistId, videoId: videoId })
+
+      queryClient.invalidateQueries({ queryKey: ["video", "playlists", videoId] })
+
+      showNotification({
+        message: "Removed video from playlist"
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+
+
+  if (isVideoPlaylistsPending || isPlaylistsPending) {
+    return <GanymedeLoadingText message="Loading Playlists" />;
+  }
+
+  if (isVideoPlaylistsError || isPlaylistsError) {
+    return <div>Error loading playlists</div>;
+  }
+
+  return (
+    <div>
+      <Select
+        data={playlistsFormatted}
+        value={selectedPlaylistValue}
+        onChange={setSelectedPlaylistValue}
+        searchable
+        placeholder="Add Video to Playlist"
+        w="100%"
+      />
+
+      <Button mt={10} onClick={addVideoToPlayist} fullWidth>Add to Playlist</Button>
+
+      <Divider my="md" />
+
+      {videoPlaylists.map((playlist) => (
+        <div key={playlist.id}>
+
+          <Flex>
+            <ActionIcon variant="light" color="red" aria-label="Settings" mr={5} my={5} onClick={() => removeVideoFromPlaylist(playlist.id)}>
+              <IconTrash style={{ width: '70%', height: '70%' }} stroke={1.5} />
+            </ActionIcon>
+            <Text>{playlist.name}</Text>
+          </Flex>
+
+        </div>
+      ))}
+
+    </div>
+  );
+}
+
+export default PlaylistManageDrawerContent;
\ No newline at end of file
diff --git a/frontend/app/components/queue/ChatTimeline.tsx b/frontend/app/components/queue/ChatTimeline.tsx
new file mode 100644
index 00000000..ce3542cd
--- /dev/null
+++ b/frontend/app/components/queue/ChatTimeline.tsx
@@ -0,0 +1,134 @@
+import { useDisclosure } from "@mantine/hooks";
+import { useState } from "react";
+import QueueTimelineBullet from "./TimelineBullet";
+import { Timeline, Text, Modal } from "@mantine/core";
+import { Queue, QueueLogType, QueueTask } from "@/app/hooks/useQueue";
+import { openQueueTaskLog } from "@/app/util/queue";
+import classes from "./Timeline.module.css"
+import QueueRestartTaskModalContent from "./RestartTaskModalContent";
+
+interface Params {
+  queue: Queue;
+}
+
+const QueueChatTimeline = ({ queue }: Params) => {
+  const [restartTaskModalOpened, { open: openRestartTaskModal, close: closeRestartTaskModal }] = useDisclosure(false);
+
+  const [restartTaskName, setRestartTaskName] = useState<QueueTask | null>(null);
+
+  const restartTask = (task: QueueTask) => {
+    setRestartTaskName(task);
+    openRestartTaskModal();
+  };
+
+  return (
+    <div>
+      <Timeline
+        active={0}
+        bulletSize={24}
+        color="dark"
+        align="right"
+        lineWidth={3}
+      >
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_chat_download} />}
+          title="Chat Download"
+        >
+          <Text size="sm">
+            {!queue.live_archive && (
+              <span>
+                <span
+                  className={classes.restartText}
+                  onClick={() => restartTask(QueueTask.TaskChatDownload)}
+                >
+                  restart
+                </span>
+                <span> - </span>
+              </span>
+            )}
+            <span
+              className={classes.restartText}
+              onClick={() => openQueueTaskLog(queue.id, QueueLogType.Chat)}
+            >
+              logs
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        {queue.live_archive && (
+          <Timeline.Item
+            bullet={<QueueTimelineBullet status={queue.task_chat_convert} />}
+            title="Chat Convert"
+          >
+            <Text size="sm">
+              <span>
+                <span
+                  className={classes.restartText}
+                  onClick={() => restartTask(QueueTask.TaskChatConvert)}
+                >
+                  restart
+                </span>
+                <span> - </span>
+              </span>
+              <span
+                className={classes.restartText}
+                onClick={() => openQueueTaskLog(queue.id, QueueLogType.ChatConvert)}
+              >
+                logs
+              </span>
+            </Text>
+          </Timeline.Item>
+        )}
+
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_chat_render} />}
+          title="Chat Render"
+        >
+          <Text size="sm">
+            <span>
+              <span
+                className={classes.restartText}
+                onClick={() => restartTask(QueueTask.TaskChatRender)}
+              >
+                restart
+              </span>
+              <span> - </span>
+            </span>
+            <span
+              className={classes.restartText}
+              onClick={() => openQueueTaskLog(queue.id, QueueLogType.ChatRender)}
+            >
+              logs
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_chat_move} />}
+          title="Chat Move"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskChatMove)}
+            >
+              restart
+            </span>
+          </Text>
+        </Timeline.Item>
+      </Timeline>
+
+      <Modal
+        opened={restartTaskModalOpened}
+        onClose={closeRestartTaskModal}
+        title="Restart Queue Task"
+      >
+        {restartTaskName !== null && (
+          <QueueRestartTaskModalContent queue={queue} task={restartTaskName} closeModal={closeRestartTaskModal} />
+        )}
+      </Modal>
+    </div>
+  );
+}
+
+export default QueueChatTimeline;
\ No newline at end of file
diff --git a/frontend/app/components/queue/GeneralTimeline.tsx b/frontend/app/components/queue/GeneralTimeline.tsx
new file mode 100644
index 00000000..22fc8b41
--- /dev/null
+++ b/frontend/app/components/queue/GeneralTimeline.tsx
@@ -0,0 +1,84 @@
+"use client"
+import { Timeline, Text, Modal } from "@mantine/core";
+import classes from "./Timeline.module.css"
+import QueueTimelineBullet from "./TimelineBullet";
+import { Queue, QueueTask } from "@/app/hooks/useQueue";
+import { useDisclosure } from "@mantine/hooks";
+import { useState } from "react";
+import QueueRestartTaskModalContent from "./RestartTaskModalContent";
+
+interface Params {
+  queue: Queue;
+}
+
+const QueueGeneralTimeline = ({ queue }: Params) => {
+  const [restartTaskModalOpened, { open: openRestartTaskModal, close: closeRestartTaskModal }] = useDisclosure(false);
+
+  const [restartTaskName, setRestartTaskName] = useState<QueueTask | null>(null);
+
+  const restartTask = (task: QueueTask) => {
+    setRestartTaskName(task);
+    openRestartTaskModal();
+  };
+
+  return (
+    <div>
+      <Timeline active={0} bulletSize={24} color="dark" lineWidth={3}>
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_vod_create_folder} />}
+          title="Create Folder"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskVodCreateFolder)}
+            >
+              restart
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_vod_save_info} />}
+          title="Save Information"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskVodSaveInfo)}
+            >
+              restart
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        <Timeline.Item
+          bullet={
+            <QueueTimelineBullet status={queue.task_vod_download_thumbnail} />
+          }
+          title="Download Thumbnails"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskVodDownloadThumbnail)}
+            >
+              restart
+            </span>
+          </Text>
+        </Timeline.Item>
+      </Timeline>
+      <Modal
+        opened={restartTaskModalOpened}
+        onClose={closeRestartTaskModal}
+        title="Restart Queue Task"
+      >
+        {restartTaskName !== null && (
+          <QueueRestartTaskModalContent queue={queue} task={restartTaskName} closeModal={closeRestartTaskModal} />
+        )}
+      </Modal>
+    </div>
+  );
+}
+
+export default QueueGeneralTimeline;
\ No newline at end of file
diff --git a/frontend/app/components/queue/Header.module.css b/frontend/app/components/queue/Header.module.css
new file mode 100644
index 00000000..f98ddf9a
--- /dev/null
+++ b/frontend/app/components/queue/Header.module.css
@@ -0,0 +1,45 @@
+.queueHeader {
+  height: auto;
+  padding-bottom: 10px;
+  padding-top: 10px;
+  background-color: light-dark(
+    var(--mantine-color-gray-0),
+    var(--mantine-color-dark-6)
+  );
+}
+.queueHeaderContents {
+  display: flex;
+
+  @media (max-width: $mantine-breakpoint-sm) {
+    flex-direction: column;
+  }
+}
+.queueHeaderTitle {
+  font-weight: 600;
+  font-size: 24px;
+}
+.queueHeaderHoverText {
+  font-weight: 600;
+  font-size: 18px;
+}
+.queueHeaderRight {
+  padding-left: 10px;
+}
+.liveArchive {
+  font-weight: 600;
+  font-size: 18px;
+  background-color: var(--mantine-color-red-8);
+  color: var(--mantine-color-gray-0);
+  padding: 2px;
+  border-radius: 4px;
+  margin-right: 7px;
+}
+.onHold {
+  font-weight: 600;
+  font-size: 18px;
+  background-color: var(--mantine-color-indigo-8);
+  color: var(--mantine-color-gray-0);
+  padding: 2px;
+  border-radius: 4px;
+  margin-right: 7px;
+}
diff --git a/frontend/app/components/queue/Header.tsx b/frontend/app/components/queue/Header.tsx
new file mode 100644
index 00000000..a2f67407
--- /dev/null
+++ b/frontend/app/components/queue/Header.tsx
@@ -0,0 +1,75 @@
+import { Queue } from "@/app/hooks/useQueue";
+import { escapeURL } from "@/app/util/util";
+import { env } from "next-runtime-env";
+import { Container, Divider, Flex, Image, Text, Tooltip } from "@mantine/core";
+import dayjs from "dayjs";
+import classes from "./Header.module.css"
+
+interface Params {
+  queue: Queue;
+}
+
+const QueueHeader = ({ queue }: Params) => {
+  return (
+    <div className={classes.queueHeader}>
+      <Container size="4xl">
+        <div className={classes.queueHeaderContents}>
+          <div>
+            <Image
+              src={
+                (env('NEXT_PUBLIC_CDN_URL') ?? '') +
+                escapeURL(queue.edges.vod.web_thumbnail_path)
+              }
+              w={160}
+              alt={queue.edges.vod.title}
+            />
+          </div>
+          <div className={classes.queueHeaderRight}>
+            <div>
+              <Tooltip label={queue.edges.vod.title}>
+                <Text lineClamp={1} className={classes.queueHeaderTitle}>
+                  {queue.edges.vod.title}
+                </Text>
+              </Tooltip>
+            </div>
+            <Flex>
+              <Tooltip label="External Platform Video ID">
+                <Text
+                  className={classes.queueHeaderHoverText}
+                >
+                  {queue.edges.vod.ext_id}
+                </Text>
+              </Tooltip>
+              <Divider mx={5} orientation="vertical" />
+              <Tooltip label="Internal Ganymede Video ID">
+                <Text
+                  className={classes.queueHeaderHoverText}
+                >
+                  {queue.edges.vod.id}
+                </Text>
+              </Tooltip>
+            </Flex>
+            <Flex>
+              {queue.live_archive && (
+                <Text className={classes.liveArchive}>Live Archive</Text>
+              )}
+
+              {queue.on_hold && <Text className={classes.onHold}>On Hold</Text>}
+
+              <Tooltip label="Streamed At">
+                <Text
+                  className={classes.queueHeaderHoverText}
+                >
+                  {dayjs(queue.edges.vod.streamed_at).format("YYYY/MM/DD")}
+                </Text>
+              </Tooltip>
+
+            </Flex>
+          </div>
+        </div>
+      </Container>
+    </div>
+  );
+}
+
+export default QueueHeader;
\ No newline at end of file
diff --git a/frontend/app/components/queue/RestartTaskModalContent.tsx b/frontend/app/components/queue/RestartTaskModalContent.tsx
new file mode 100644
index 00000000..6ff93cc8
--- /dev/null
+++ b/frontend/app/components/queue/RestartTaskModalContent.tsx
@@ -0,0 +1,72 @@
+import { Button, Code, Switch } from "@mantine/core";
+import { Queue, QueueTask, useStartQueueTask } from "@/app/hooks/useQueue";
+import { useState } from "react";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { showNotification } from "@mantine/notifications";
+
+interface Params {
+  queue: Queue;
+  task: QueueTask;
+  closeModal: () => void;
+}
+
+const QueueRestartTaskModalContent = ({ queue, task, closeModal }: Params) => {
+  const [checked, setChecked] = useState(true);
+  const [isLoading, setIsLoading] = useState(false);
+
+  const axiosPrivate = useAxiosPrivate()
+
+  const useStartQueueTaskMutate = useStartQueueTask()
+
+  const restartTask = async () => {
+    try {
+      setIsLoading(true)
+
+      await useStartQueueTaskMutate.mutateAsync({
+        axiosPrivate: axiosPrivate, queueId: queue.id, taskName: task, continueWithSubsequent: checked
+      })
+
+      showNotification({
+        message: "Restarted queue task"
+      })
+
+      closeModal()
+
+    } catch (error) {
+      console.error(error)
+    } finally {
+      setIsLoading(false)
+    }
+  }
+
+  return (
+    <div>
+      <div>
+        Restart queue task <Code>{task}</Code>?
+      </div>
+      <div>
+        <Switch
+          mt={10}
+          label="Continue with subsequent tasks"
+          checked={checked}
+          onChange={(event) => setChecked(event.currentTarget.checked)}
+        />
+      </div>
+      <div>
+        <Button
+          onClick={() => restartTask()}
+          fullWidth
+          radius="md"
+          mt="sm"
+          size="md"
+          color="green"
+          loading={isLoading}
+        >
+          Restart Task
+        </Button>
+      </div>
+    </div>
+  );
+}
+
+export default QueueRestartTaskModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/queue/Timeline.module.css b/frontend/app/components/queue/Timeline.module.css
new file mode 100644
index 00000000..7ceeb622
--- /dev/null
+++ b/frontend/app/components/queue/Timeline.module.css
@@ -0,0 +1,3 @@
+.restartText {
+  cursor: pointer;
+}
diff --git a/frontend/app/components/queue/TimelineBullet.tsx b/frontend/app/components/queue/TimelineBullet.tsx
new file mode 100644
index 00000000..f0703eb9
--- /dev/null
+++ b/frontend/app/components/queue/TimelineBullet.tsx
@@ -0,0 +1,46 @@
+import { QueueTaskStatus } from "@/app/hooks/useQueue";
+import { Loader, ThemeIcon } from "@mantine/core";
+import { IconCircleCheck, IconCircleX, IconHourglass } from "@tabler/icons-react";
+
+interface Props {
+  status: QueueTaskStatus
+}
+
+const QueueTimelineBullet = ({ status }: Props) => {
+  if (status == QueueTaskStatus.Running) {
+    return (
+      <div style={{ marginTop: "6px", marginLeft: "0.3px" }}>
+        <Loader size="sm" color="green" />
+      </div>
+    );
+  }
+  if (status == QueueTaskStatus.Success) {
+    return (
+      <div style={{ marginTop: "5px" }}>
+        <ThemeIcon radius="xl" color="green">
+          <IconCircleCheck />
+        </ThemeIcon>
+      </div>
+    );
+  }
+  if (status == QueueTaskStatus.Failed) {
+    return (
+      <div style={{ marginTop: "5px" }}>
+        <ThemeIcon radius="xl" color="red">
+          <IconCircleX />
+        </ThemeIcon>
+      </div>
+    );
+  }
+  if (status == QueueTaskStatus.Pending) {
+    return (
+      <div style={{ marginTop: "5px" }}>
+        <ThemeIcon radius="xl" color="blue">
+          <IconHourglass />
+        </ThemeIcon>
+      </div>
+    );
+  }
+};
+
+export default QueueTimelineBullet;
\ No newline at end of file
diff --git a/frontend/app/components/queue/VideoTimeline.tsx b/frontend/app/components/queue/VideoTimeline.tsx
new file mode 100644
index 00000000..4cb21b94
--- /dev/null
+++ b/frontend/app/components/queue/VideoTimeline.tsx
@@ -0,0 +1,100 @@
+import { Timeline, Text, Modal } from "@mantine/core";
+import { useState } from "react";
+import classes from "./Timeline.module.css"
+import { useDisclosure } from "@mantine/hooks";
+import QueueTimelineBullet from "./TimelineBullet";
+import QueueRestartTaskModalContent from "./RestartTaskModalContent";
+import { Queue, QueueLogType, QueueTask } from "@/app/hooks/useQueue";
+import { openQueueTaskLog } from "@/app/util/queue";
+
+interface Params {
+  queue: Queue;
+}
+
+const QueueVideoTimeline = ({ queue }: Params) => {
+  const [restartTaskModalOpened, { open: openRestartTaskModal, close: closeRestartTaskModal }] = useDisclosure(false);
+
+  const [restartTaskName, setRestartTaskName] = useState<QueueTask | null>(null);
+
+  const restartTask = (task: QueueTask) => {
+    setRestartTaskName(task);
+    openRestartTaskModal();
+  };
+
+  return (
+    <div>
+      <Timeline active={0} bulletSize={24} color="dark" lineWidth={3}>
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_video_download} />}
+          title="Video Download"
+        >
+          <Text size="sm">
+            {!queue.live_archive && (
+              <span>
+                <span
+                  className={classes.restartText}
+                  onClick={() => restartTask(QueueTask.TaskVideoDownload)}
+                >
+                  restart
+                </span>
+                <span> - </span>
+              </span>
+            )}
+            <span
+              className={classes.restartText}
+              onClick={() => openQueueTaskLog(queue.id, QueueLogType.Video)}
+            >
+              logs
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_video_convert} />}
+          title="Video Convert"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskVideoConvert)}
+            >
+              restart
+            </span>
+            <span> - </span>
+            <span
+              className={classes.restartText}
+              onClick={() => openQueueTaskLog(queue.id, QueueLogType.VideoConvert)}
+            >
+              logs
+            </span>
+          </Text>
+        </Timeline.Item>
+
+        <Timeline.Item
+          bullet={<QueueTimelineBullet status={queue.task_video_move} />}
+          title="Video Move"
+        >
+          <Text size="sm">
+            <span
+              className={classes.restartText}
+              onClick={() => restartTask(QueueTask.TaskVideoMove)}
+            >
+              restart
+            </span>
+          </Text>
+        </Timeline.Item>
+      </Timeline>
+      <Modal
+        opened={restartTaskModalOpened}
+        onClose={closeRestartTaskModal}
+        title="Restart Queue Task"
+      >
+        {restartTaskName !== null && (
+          <QueueRestartTaskModalContent queue={queue} task={restartTaskName} closeModal={closeRestartTaskModal} />
+        )}
+      </Modal>
+    </div>
+  );
+}
+
+export default QueueVideoTimeline;
\ No newline at end of file
diff --git a/frontend/app/components/utils/GanymedeLoader.tsx b/frontend/app/components/utils/GanymedeLoader.tsx
new file mode 100644
index 00000000..e9565568
--- /dev/null
+++ b/frontend/app/components/utils/GanymedeLoader.tsx
@@ -0,0 +1,9 @@
+import { Loader } from "@mantine/core";
+
+const GanymedeLoader = () => {
+  return (
+    <Loader size="lg" />
+  );
+}
+
+export default GanymedeLoader;
\ No newline at end of file
diff --git a/frontend/app/components/utils/GanymedeLoadingText.tsx b/frontend/app/components/utils/GanymedeLoadingText.tsx
new file mode 100644
index 00000000..afeb8778
--- /dev/null
+++ b/frontend/app/components/utils/GanymedeLoadingText.tsx
@@ -0,0 +1,19 @@
+import { Center, Stack } from "@mantine/core";
+import GanymedeLoader from "./GanymedeLoader";
+
+interface params {
+  message: string;
+}
+
+const GanymedeLoadingText = ({ message }: params) => {
+  return (
+    <Center mt={10}>
+      <Stack align="center">
+        <GanymedeLoader />
+        <div>{message}</div>
+      </Stack>
+    </Center>
+  );
+}
+
+export default GanymedeLoadingText;
\ No newline at end of file
diff --git a/frontend/app/components/videos/Card.module.css b/frontend/app/components/videos/Card.module.css
new file mode 100644
index 00000000..2bb67bd0
--- /dev/null
+++ b/frontend/app/components/videos/Card.module.css
@@ -0,0 +1,55 @@
+.card {
+  position: relative;
+  background-color: transparent;
+}
+
+.processingOverlay {
+  position: absolute;
+  top: 35%;
+  transform: translateY(-50%);
+  z-index: 50;
+  margin-left: auto;
+  margin-right: auto;
+  left: 0;
+  right: 0;
+  width: 100%;
+  text-align: center;
+  opacity: 2;
+}
+
+.videoImage {
+  pointer-events: none;
+  cursor: default;
+}
+
+.durationBadge {
+  position: absolute;
+  top: var(--mantine-spacing-sm);
+  left: var(--mantine-spacing-sm);
+  pointer-events: none;
+  background-color: rgba(0, 0, 0, 0.5);
+}
+
+.watchedIcon {
+  position: absolute;
+  top: var(--mantine-spacing-sm);
+  right: rem(12px);
+}
+
+.title {
+  margin-top: var(--mantine-spacing-xs);
+  margin-bottom: rem(2px);
+}
+
+.progressBar {
+  margin-top: rem(-5px);
+}
+
+.channelFooter {
+  margin-top: rem(5px);
+}
+
+.vodMenu {
+  margin-left: auto;
+  display: flex;
+}
diff --git a/frontend/app/components/videos/Card.tsx b/frontend/app/components/videos/Card.tsx
new file mode 100644
index 00000000..d0ffa4d7
--- /dev/null
+++ b/frontend/app/components/videos/Card.tsx
@@ -0,0 +1,180 @@
+import { Video } from "@/app/hooks/useVideos";
+import { Badge, Card, Image, Progress, Tooltip, Text, Title, Group, Center, Avatar, Flex, ThemeIcon, LoadingOverlay, Loader, Box } from "@mantine/core";
+import Link from "next/link";
+import { useEffect, useState } from "react";
+import dayjs from "dayjs";
+import duration from "dayjs/plugin/duration";
+import localizedFormat from "dayjs/plugin/localizedFormat";
+import classes from "./Card.module.css"
+import { env } from "next-runtime-env";
+import { escapeURL } from "@/app/util/util";
+import { PlaybackStatus, useFetchPlaybackForVideo } from "@/app/hooks/usePlayback";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import useAuthStore from "@/app/store/useAuthStore";
+import { IconCircleCheck } from "@tabler/icons-react";
+import VideoMenu from "./Menu";
+import { UserRole } from "@/app/hooks/useAuthentication";
+
+dayjs.extend(duration);
+dayjs.extend(localizedFormat);
+
+type Props = {
+  video: Video;
+  showProgress: boolean;
+  showMenu: boolean;
+  showChannel: boolean;
+}
+
+const VideoCard = ({ video, showProgress = true, showMenu = true, showChannel = true }: Props) => {
+  const { isLoggedIn, hasPermission } = useAuthStore()
+  const [thumbnailError, setThumbnailError] = useState(false);
+
+  const [playbackProgress, setPlaybackProgress] = useState(0);
+  const [playbackIsWatched, setPlaybackIsWatched] = useState(false)
+
+  // Handle thumbnail loading error
+  const handleThumbnailError = () => {
+    setThumbnailError(true);
+  };
+
+  const axiosPrivate = useAxiosPrivate();
+  const { data: playbackData } = useFetchPlaybackForVideo(
+    axiosPrivate,
+    video.id,
+    {
+      enabled: (showProgress && isLoggedIn)
+    }
+  );
+
+  // Set playback state
+  useEffect(() => {
+    if (!playbackData) return
+    setPlaybackProgress(((playbackData.time) / video.duration) * 100);
+    setPlaybackIsWatched(playbackData.status == PlaybackStatus.Finished)
+  }, [playbackData, video.duration])
+
+  return (
+    <Card radius="md" padding={5} className={classes.card}>
+
+      {video.processing && (
+        <LoadingOverlay visible zIndex={5} overlayProps={{ radius: "sm", blur: 1 }} loaderProps={{
+          children: <div><Text size="xl">Processing</Text>
+            <Center>
+              <Box>
+                <Loader color="red" />
+              </Box>
+            </Center></div>
+        }} />
+      )}
+
+      <Link href={`/videos/${video.id}`}>
+
+        <Card.Section>
+          <Image
+            className={classes.videoImage}
+            src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(
+              video.web_thumbnail_path
+            )}`}
+            onError={handleThumbnailError}
+            width={thumbnailError ? "100%" : "100%"}
+            height={thumbnailError ? "100%" : "100%"}
+            fallbackSrc="/images/ganymede-thumbnail.webp"
+            alt={video.title}
+          />
+          {showProgress && Math.round(playbackProgress) > 0 && !playbackIsWatched && (
+            <Tooltip label={`${Math.round(playbackProgress)}% watched`}>
+              <Progress
+                className={classes.progressBar}
+                color="red"
+                radius={0}
+                size="sm"
+                value={playbackProgress}
+              />
+            </Tooltip>
+          )}
+        </Card.Section>
+
+      </Link>
+
+
+      {/* Duration badge */}
+      <Badge py={0} px={5} className={classes.durationBadge} radius="md">
+        <Text>
+          {dayjs
+            .duration(video.duration, "seconds")
+            .format("HH:mm:ss")}
+        </Text>
+      </Badge>
+
+      {/* Watched icon */}
+      {showProgress && playbackIsWatched && (
+        <Tooltip label="You have watched this video">
+          <ThemeIcon className={classes.watchedIcon} radius="xl" color="green">
+            <IconCircleCheck />
+          </ThemeIcon>
+        </Tooltip>
+      )}
+
+      {/* Title */}
+      <Link href={video.processing ? `#` : `/videos/${video.id}`}>
+        <Tooltip label={video.title} openDelay={250} withinPortal>
+          <Title lineClamp={1} order={4} mt="xs">
+            {video.title}
+          </Title>
+        </Tooltip>
+      </Link>
+
+      {/* Optionally show channel */}
+      {showChannel && (
+        <Group className={classes.channelFooter}>
+          <Center>
+            <Avatar
+              src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(
+                video.edges.channel.image_path
+              )}`}
+              size={24}
+              radius="xl"
+              mr="xs"
+            />
+            <Link href={`/channels/${video.edges.channel.name}`}>
+              <Text fz="sm" inline>
+                {video.edges.channel.display_name}
+              </Text>
+            </Link>
+          </Center>
+        </Group>
+      )}
+
+      {/* Additional video information and menu */}
+      <Flex gap="xs" justify="flex-start"
+        align="center" pt={2}>
+
+        <Tooltip
+          label={`Streamed on ${new Date(
+            video.streamed_at
+          ).toLocaleString()}`}
+        >
+          <Text size="sm">
+            {dayjs(video.streamed_at).format("YYYY/MM/DD")}
+          </Text>
+        </Tooltip>
+
+        <div className={classes.vodMenu}>
+          <Badge variant="default" color="rgba(0, 0, 0, 1)" mt={4}>
+            {video.type.toUpperCase()}
+          </Badge>
+
+          {(showMenu && hasPermission(UserRole.Archiver)) && (
+            <VideoMenu video={video} />
+          )}
+        </div>
+
+
+      </Flex>
+
+
+    </Card>
+  );
+}
+
+export default VideoCard;
\ No newline at end of file
diff --git a/frontend/app/components/videos/ChannelVideo.module.css b/frontend/app/components/videos/ChannelVideo.module.css
new file mode 100644
index 00000000..4b757c1f
--- /dev/null
+++ b/frontend/app/components/videos/ChannelVideo.module.css
@@ -0,0 +1,3 @@
+.header {
+  display: flex;
+}
diff --git a/frontend/app/components/videos/ChannelVideos.tsx b/frontend/app/components/videos/ChannelVideos.tsx
new file mode 100644
index 00000000..49e2cd6f
--- /dev/null
+++ b/frontend/app/components/videos/ChannelVideos.tsx
@@ -0,0 +1,52 @@
+// ChannelVideos.tsx
+import { useState } from "react";
+import { Channel } from "@/app/hooks/useChannels";
+import { useFetchVideosFilter, VideoType } from "@/app/hooks/useVideos";
+import useSettingsStore from "@/app/store/useSettingsStore";
+import VideoGrid from "./Grid";
+import GanymedeLoadingText from "../utils/GanymedeLoadingText";
+
+type Props = {
+  channel: Channel;
+};
+
+const ChannelVideos = ({ channel }: Props) => {
+  const [activePage, setActivePage] = useState(1);
+  const [videoTypes, setVideoTypes] = useState<VideoType[]>([]);
+
+  const videoLimit = useSettingsStore((state) => state.videoLimit);
+  const setVideoLimit = useSettingsStore((state) => state.setVideoLimit);
+
+  const { data: videos, isPending, isError } = useFetchVideosFilter({
+    limit: videoLimit,
+    offset: (activePage - 1) * videoLimit,
+    channel_id: channel.id,
+    types: videoTypes,
+  });
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading Videos" />;
+  }
+
+  if (isError) {
+    return <div>Error loading channel</div>;
+  }
+
+  return (
+    <div>
+      <VideoGrid
+        videos={videos.data}
+        totalPages={videos.pages}
+        currentPage={activePage}
+        onPageChange={setActivePage}
+        isPending={isPending}
+        videoLimit={videoLimit}
+        onVideoLimitChange={setVideoLimit}
+        onVideoTypeChange={setVideoTypes}
+        showChannel={false}
+      />
+    </div>
+  );
+};
+
+export default ChannelVideos;
\ No newline at end of file
diff --git a/frontend/app/components/videos/ChatHistogram.tsx b/frontend/app/components/videos/ChatHistogram.tsx
new file mode 100644
index 00000000..4baa1ceb
--- /dev/null
+++ b/frontend/app/components/videos/ChatHistogram.tsx
@@ -0,0 +1,51 @@
+import { useGetVideoChatHistogram } from "@/app/hooks/useVideos";
+import { BarChart } from '@mantine/charts';
+import { Title } from "@mantine/core";
+import GanymedeLoadingText from "../utils/GanymedeLoadingText";
+
+type Props = {
+  videoId: string;
+}
+
+const VideoChatHistogram = ({ videoId }: Props) => {
+  const { data, isPending, isError } = useGetVideoChatHistogram(videoId)
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading Chat Histogram" />
+  }
+  if (isError) {
+    return <div>Error loading chat histogram</div>
+  }
+
+  const secondsToHHMM = (seconds: number): string => {
+    const hours = Math.floor(seconds / 3600);
+    const minutes = Math.floor((seconds % 3600) / 60);
+    return `${hours.toString().padStart(2, '0')}:${minutes.toString().padStart(2, '0')}`;
+  };
+
+  const result = Object.entries(data).map(([time, count]) => ({
+    Time: secondsToHHMM(parseInt(time)),
+    Messages: count,
+  }));
+
+  if (!result.length) {
+    return <div>Error loading chat histogram</div>
+  }
+
+  return (
+    <div>
+      <Title my={5}>Chat Histogram</Title>
+      <BarChart
+        h={300}
+        data={result}
+        dataKey="Time"
+        series={[
+          { name: 'Messages', color: 'violet.6' },
+        ]}
+        tickLine="y"
+      />
+    </div>
+  );
+}
+
+export default VideoChatHistogram;
\ No newline at end of file
diff --git a/frontend/app/components/videos/ChatMessage.module.css b/frontend/app/components/videos/ChatMessage.module.css
new file mode 100644
index 00000000..93ff1d72
--- /dev/null
+++ b/frontend/app/components/videos/ChatMessage.module.css
@@ -0,0 +1,20 @@
+.chatMessage {
+  font-style: normal;
+  font-weight: normal;
+  font-size: 14px;
+  margin-top: 6px;
+  margin-bottom: 6px;
+}
+.message {
+  font-weight: 400;
+  line-height: 20px;
+  font-size: 14px;
+}
+.emoteImage {
+  padding-right: 2px;
+  vertical-align: middle;
+}
+.badge {
+  padding-right: 2px;
+  vertical-align: middle;
+}
diff --git a/frontend/app/components/videos/ChatMessage.tsx b/frontend/app/components/videos/ChatMessage.tsx
new file mode 100644
index 00000000..3015decd
--- /dev/null
+++ b/frontend/app/components/videos/ChatMessage.tsx
@@ -0,0 +1,87 @@
+/* eslint-disable @next/next/no-img-element */
+import { Comment, GanymedeFormattedBadge, GanymedeFormattedMessageFragment, GanymedeFormattedMessageType } from "@/app/hooks/useChat";
+import classes from "./ChatMessage.module.css"
+import { Text, Tooltip } from "@mantine/core"
+
+interface Params {
+  comment: Comment;
+}
+
+const ChatMessage = ({ comment }: Params) => {
+  return (
+    <div key={comment._id} className={classes.chatMessage}>
+      {/* badges */}
+      <span>
+        {comment.ganymede_formatted_badges &&
+          comment.ganymede_formatted_badges.map(
+            (badge: GanymedeFormattedBadge) => (
+              <Tooltip key={badge._id} label={badge.title} position="top">
+                <img
+                  className={classes.badge}
+                  src={badge.url}
+                  height="18"
+                  alt={badge.title}
+                />
+              </Tooltip>
+            )
+          )}
+      </span>
+      {/* username */}
+      <Text
+        fw={700}
+        lh={1}
+        size="sm"
+        style={{ color: comment.message.user_color }}
+        span
+      >
+        {comment.commenter.display_name}
+      </Text>
+      <Text className={classes.message} span>
+        :{" "}
+      </Text>
+      {/* message */}
+      {comment.ganymede_formatted_message && comment.ganymede_formatted_message.map(
+        (fragment: GanymedeFormattedMessageFragment) => {
+          switch (fragment.type) {
+            case GanymedeFormattedMessageType.Text:
+              return (
+                <Text className={classes.message} span>
+                  {fragment.text}
+                </Text>
+              )
+            case GanymedeFormattedMessageType.Emote:
+              const emoteName = fragment.emote?.name || fragment.text;
+              // some emotes include a height, use the provided height or hardcode a standard height if not included
+              if (fragment.emote?.height != 0 && fragment.emote?.width != 0) {
+                return (
+                  <Tooltip label={emoteName} position="top">
+                    <img
+                      src={fragment.url}
+                      className={classes.emoteImage}
+                      height={fragment.emote?.height}
+                      alt={emoteName}
+                    />
+                  </Tooltip>
+                );
+              } else {
+                return (
+                  <Tooltip label={emoteName} position="top">
+                    <img
+                      src={fragment.url}
+                      className={classes.emoteImage}
+                      alt={emoteName}
+                      height={28}
+                    />
+                  </Tooltip>
+                );
+              }
+
+          }
+        }
+      )}
+
+    </div>
+  );
+}
+
+export default ChatMessage;
\ No newline at end of file
diff --git a/frontend/app/components/videos/ChatPlayer.module.css b/frontend/app/components/videos/ChatPlayer.module.css
new file mode 100644
index 00000000..309ddef4
--- /dev/null
+++ b/frontend/app/components/videos/ChatPlayer.module.css
@@ -0,0 +1,12 @@
+.chatPlayerContainer {
+  height: 100%;
+  overflow-y: scroll;
+  padding-left: 2px;
+  padding-right: 2px;
+  -ms-overflow-style: none;
+  scrollbar-width: none;
+
+  &::-webkit-scrollbar {
+    display: none;
+  }
+}
diff --git a/frontend/app/components/videos/ChatPlayer.tsx b/frontend/app/components/videos/ChatPlayer.tsx
new file mode 100644
index 00000000..60fd2e45
--- /dev/null
+++ b/frontend/app/components/videos/ChatPlayer.tsx
@@ -0,0 +1,435 @@
+import { Video } from "@/app/hooks/useVideos";
+import classes from "./ChatPlayer.module.css";
+import {
+  Emote,
+  Badge,
+  useGetEmotesForVideo,
+  useGetBadgesForVideo,
+  Comment,
+  GanymedeFormattedMessageFragment,
+  GanymedeFormattedMessageType,
+  getChatForVideo,
+  getSeekChatForVideo
+} from "@/app/hooks/useChat";
+import { useEffect, useRef, useState, useCallback, useMemo } from "react";
+import { Box, Center, Loader, Text } from "@mantine/core";
+import ChatMessage from "./ChatMessage";
+import { uuidv4 } from "@/app/util/util";
+import VideoEventBus from "@/app/util/VideoEventBus";
+import useSettingsStore from "@/app/store/useSettingsStore";
+
+// Constants moved to top level
+const CHAT_OFFSET_SIZE = 10;
+const MAX_CHAT_MESSAGES = 50;
+const TICK_INTERVAL = 100;
+const TIME_SKIP_THRESHOLD = 2;
+const IGNORED_BADGES = new Set(['no_audio', 'no_video', 'predictions']);
+const SUBSCRIPTION_BADGES = new Set(['subscriber', 'sub-gifter', 'sub_gifter', 'bits']);
+const SCROLL_THRESHOLD = 100; // px from bottom to trigger auto-scroll
+
+interface ChatMaps {
+  emoteMap: Map<string, Emote>;
+  generalBadgeMap: Map<string, Badge>;
+  subscriptionBadgeMap: Map<string, Badge>;
+  subscriptionGiftBadgeMap: Map<string, Badge>;
+  bitBadgeMap: Map<string, Badge>;
+}
+
+interface Params {
+  video: Video;
+}
+
+interface ChatError {
+  message: string;
+  timestamp: number;
+}
+
+const ChatPlayer = ({ video }: Params) => {
+  const [isReady, setIsReady] = useState(false);
+  const [messages, setMessages] = useState<Comment[]>([]);
+  const [error, setError] = useState<ChatError | null>(null);
+  const [shouldAutoScroll, setShouldAutoScroll] = useState(true);
+
+  // Refs for internal state management
+  const internalMessagesRef = useRef<Comment[]>([]);
+  const lastTimeRef = useRef(0);
+  const lastCheckTimeRef = useRef(0);
+  const lastEndTimeRef = useRef(0);
+  const isLoadingRef = useRef(false);
+  const retryCountRef = useRef(0);
+  const chatMapsRef = useRef<ChatMaps>({
+    emoteMap: new Map(),
+    generalBadgeMap: new Map(),
+    subscriptionBadgeMap: new Map(),
+    subscriptionGiftBadgeMap: new Map(),
+    bitBadgeMap: new Map()
+  });
+  const chatContainerRef = useRef<HTMLDivElement>(null);
+
+  const { chatPlaybackSmoothScroll } = useSettingsStore()
+
+  // Custom hooks with error handling
+  const { data: chatEmotes, error: emotesError } = useGetEmotesForVideo(video.id);
+  const { data: chatBadges, error: badgesError } = useGetBadgesForVideo(video.id);
+
+  const scrollToBottom = useCallback((smooth = chatPlaybackSmoothScroll) => {
+    if (chatContainerRef.current) {
+      chatContainerRef.current.scrollTo({
+        top: chatContainerRef.current.scrollHeight,
+        behavior: smooth ? 'smooth' : 'auto'
+      });
+    }
+  }, [chatPlaybackSmoothScroll]);
+
+  const checkShouldScroll = useCallback(() => {
+    if (!chatContainerRef.current) return true;
+
+    const { scrollHeight, scrollTop, clientHeight } = chatContainerRef.current;
+    const distanceFromBottom = scrollHeight - (scrollTop + clientHeight);
+
+    return distanceFromBottom <= SCROLL_THRESHOLD;
+  }, []);
+
+  // Scroll event handler
+  const handleScroll = useCallback(() => {
+    if (!chatContainerRef.current) return;
+
+    const shouldScroll = checkShouldScroll();
+    if (shouldScroll !== shouldAutoScroll) {
+      setShouldAutoScroll(shouldScroll);
+    }
+  }, [checkShouldScroll, shouldAutoScroll]);
+
+  // Modified message setter with scroll behavior
+  const setMessagesWithScroll = useCallback((newMessages: Comment[] | ((prev: Comment[]) => Comment[])) => {
+    setMessages(prev => {
+      const nextMessages = typeof newMessages === 'function' ? newMessages(prev) : newMessages;
+
+      // Schedule scroll after render if auto-scroll is enabled
+      if (shouldAutoScroll) {
+        requestAnimationFrame(() => scrollToBottom());
+      }
+
+      return nextMessages;
+    });
+  }, [shouldAutoScroll, scrollToBottom]);
+
+  // Error handling utility
+  const handleError = useCallback((error: Error, context: string) => {
+    console.error(`Error in ${context}:`, error);
+    setError({ message: `${context}: ${error.message}`, timestamp: Date.now() });
+
+    // Implement exponential backoff for retries
+    const maxRetries = 3;
+    if (retryCountRef.current < maxRetries) {
+      const backoffTime = Math.pow(2, retryCountRef.current) * 1000;
+      setTimeout(() => {
+        retryCountRef.current++;
+        // Reset error if successful
+        setError(null);
+      }, backoffTime);
+    }
+  }, []);
+
+  // Memoized system message creator
+  const createSystemMessage = useMemo(() => (message: string): Comment => ({
+    _id: uuidv4(),
+    content_offset_seconds: 0,
+    // @ts-expect-error additional fields unnecessary
+    commenter: {
+      display_name: "Ganymede",
+    },
+    // @ts-expect-error additional fields unnecessary
+    message: {
+      body: message,
+      user_color: "#a65ee8",
+    },
+    ganymede_formatted_message: [{
+      type: GanymedeFormattedMessageType.Text,
+      text: message
+    }]
+  }), []);
+
+  const addCustomComment = useCallback((message: string) => {
+    const comment = createSystemMessage(message);
+    setMessagesWithScroll(prev => [...prev, comment]);
+  }, [createSystemMessage, setMessagesWithScroll]);
+
+  // Optimized badge processing
+  const addBadgesToFormattedComment = useCallback((comment: Comment) => {
+    if (!comment.message.user_badges) {
+      comment.ganymede_formatted_badges = [];
+      return comment;
+    }
+
+    comment.ganymede_formatted_badges = comment.message.user_badges
+      .filter(badge => !IGNORED_BADGES.has(badge._id))
+      .map(badge => {
+        const isSubscriptionBadge = SUBSCRIPTION_BADGES.has(badge._id);
+        const badgeMap = isSubscriptionBadge
+          ? chatMapsRef.current.subscriptionBadgeMap.get(badge.version)
+          : chatMapsRef.current.generalBadgeMap.get(badge._id);
+
+        return {
+          _id: badge._id,
+          id: badge._id,
+          version: badge.version,
+          title: badgeMap?.title || '',
+          url: badgeMap?.image_url_1x || '',
+        };
+      });
+
+    return comment;
+  }, []);
+
+  // Optimized emote processing with error handling
+  const addEmotesToFormattedComment = useCallback((comment: Comment): GanymedeFormattedMessageFragment[] => {
+    if (!comment.message.fragments?.length) return [];
+
+    try {
+      return comment.message.fragments.flatMap(fragment => {
+        if (fragment.emoticon) {
+          const emote = chatMapsRef.current.emoteMap.get(fragment.emoticon.emoticon_id);
+          if (!emote) {
+            throw new Error(`Emote not found for ID: ${fragment.emoticon.emoticon_id}`);
+          }
+          return [{
+            type: GanymedeFormattedMessageType.Emote,
+            text: fragment.text,
+            url: emote.type === "embed"
+              ? `data:image/png;base64,${emote.url}`
+              : emote.url,
+            emote,
+          }];
+        }
+
+        return fragment.text.split(" ").map(word => {
+          const thirdPartyEmote = chatMapsRef.current.emoteMap.get(word);
+          return thirdPartyEmote
+            ? {
+              type: GanymedeFormattedMessageType.Emote,
+              text: word,
+              url: thirdPartyEmote.type === "embed"
+                ? `data:image/png;base64,${thirdPartyEmote.url}`
+                : thirdPartyEmote.url,
+              emote: thirdPartyEmote,
+            }
+            : {
+              type: GanymedeFormattedMessageType.Text,
+              text: ` ${word} `,
+            };
+        });
+      });
+    } catch (error) {
+      handleError(error as Error, "Emote processing");
+      return [{ type: GanymedeFormattedMessageType.Text, text: comment.message.body }];
+    }
+  }, [handleError]);
+
+  // Optimized chat fetching with rate limiting and error handling
+  const getChat = useCallback(async (start: number, end: number) => {
+    if (isLoadingRef.current) return;
+
+    try {
+      isLoadingRef.current = true;
+      const data = await getChatForVideo(video.id, start, end);
+      if (data?.length) {
+        internalMessagesRef.current.push(...data);
+      }
+    } catch (error) {
+      handleError(error as Error, "Chat fetching");
+    } finally {
+      isLoadingRef.current = false;
+    }
+  }, [video.id, handleError]);
+
+  const getSeekChat = useCallback(async (start: number, count: number) => {
+    if (isLoadingRef.current) return;
+
+    try {
+      isLoadingRef.current = true;
+      const data = await getSeekChatForVideo(video.id, start, count);
+      if (data?.length) {
+        internalMessagesRef.current.push(...data);
+      }
+    } catch (error) {
+      handleError(error as Error, "Seek chat fetching");
+    } finally {
+      isLoadingRef.current = false;
+    }
+  }, [video.id, handleError]);
+
+  const clearChat = useCallback(() => {
+    setMessagesWithScroll([]);
+    internalMessagesRef.current = [];
+    addCustomComment("Time skip detected. Chat cleared.");
+  }, [addCustomComment, setMessagesWithScroll]);
+
+  // Optimized chat processing with error boundary
+  const chatTick = useCallback(async (time: number) => {
+    try {
+      while (internalMessagesRef.current.length > 0) {
+        const comment = internalMessagesRef.current[0];
+        if (comment.content_offset_seconds > time) break;
+
+        internalMessagesRef.current.shift();
+        const processedComment = addBadgesToFormattedComment(comment);
+        processedComment.ganymede_formatted_message = addEmotesToFormattedComment(processedComment);
+
+        setMessagesWithScroll(prev => {
+          const newMessages = [...prev, processedComment];
+          return newMessages.slice(-MAX_CHAT_MESSAGES);
+        });
+      }
+    } catch (error) {
+      handleError(error as Error, "Chat processing");
+    }
+  }, [addBadgesToFormattedComment, addEmotesToFormattedComment, handleError, setMessagesWithScroll]);
+
+  // Initialize chat data
+  useEffect(() => {
+    if (!chatEmotes?.length || !chatBadges?.length) return;
+    if (emotesError || badgesError) {
+      const errorMessage = (emotesError?.message || badgesError?.message || "Unknown error");
+      handleError(new Error(errorMessage), "Chat initialization");
+      return;
+    }
+
+    try {
+      // Process emotes
+      chatEmotes.forEach((emote: Emote) => {
+        if (!emote.name || emote.type === "twitch") {
+          chatMapsRef.current.emoteMap.set(emote.id, emote);
+        } else {
+          chatMapsRef.current.emoteMap.set(emote.name, emote);
+        }
+      });
+
+      // Process badges
+      chatBadges.forEach((badge: Badge) => {
+        switch (badge.name) {
+          case "subscriber":
+            chatMapsRef.current.subscriptionBadgeMap.set(badge.version, badge);
+            break;
+          case "sub-gifter":
+            chatMapsRef.current.subscriptionGiftBadgeMap.set(badge.version, badge);
+            break;
+          case "bits":
+            chatMapsRef.current.bitBadgeMap.set(badge.version, badge);
+            break;
+          default:
+            if (!IGNORED_BADGES.has(badge.name)) {
+              chatMapsRef.current.generalBadgeMap.set(badge.name, badge);
+            }
+        }
+      });
+
+      setIsReady(true);
+      addCustomComment("Chat player ready.");
+      addCustomComment(
+        `Chat playback contains ${chatMapsRef.current.generalBadgeMap.size.toLocaleString()} badges, ` +
+        `${chatMapsRef.current.subscriptionBadgeMap.size.toLocaleString()} subscription badges, and ` +
+        `${chatMapsRef.current.emoteMap.size.toLocaleString()} emotes.`
+      );
+    } catch (error) {
+      handleError(error as Error, "Chat initialization");
+    }
+  }, [chatEmotes, chatBadges, addCustomComment, handleError, emotesError, badgesError]);
+
+  // Chat update interval
+  useEffect(() => {
+    if (!isReady) return;
+
+    const interval = setInterval(() => {
+      const { time, isPaused } = VideoEventBus.getData();
+      if (isPaused) return;
+
+      if (Math.abs(time - lastTimeRef.current) > TIME_SKIP_THRESHOLD) {
+        console.log(`Player time skip detected - ${lastTimeRef.current} -> ${time}`);
+        clearChat();
+        lastEndTimeRef.current = 0;
+        lastCheckTimeRef.current = time;
+        getSeekChat(time, 50);
+      }
+
+      lastTimeRef.current = time;
+
+      if (time <= lastCheckTimeRef.current) return;
+
+      const startTime = lastCheckTimeRef.current || time;
+      const endTime = startTime + CHAT_OFFSET_SIZE;
+
+      lastCheckTimeRef.current = endTime;
+      lastEndTimeRef.current = endTime;
+
+      getChat(startTime, endTime);
+    }, TICK_INTERVAL);
+
+    return () => clearInterval(interval);
+  }, [isReady, clearChat, getChat, getSeekChat]);
+
+  // Chat processing interval
+  useEffect(() => {
+    if (!isReady) return;
+
+    const interval = setInterval(() => {
+      const { time } = VideoEventBus.getData();
+      chatTick(time);
+    }, TICK_INTERVAL);
+
+    return () => clearInterval(interval);
+  }, [isReady, chatTick]);
+
+  // Add scroll event listener
+  useEffect(() => {
+    const container = chatContainerRef.current;
+    if (!container) return;
+
+    container.addEventListener('scroll', handleScroll);
+    return () => container.removeEventListener('scroll', handleScroll);
+  }, [handleScroll]);
+
+  // Initial scroll on mount
+  useEffect(() => {
+    scrollToBottom(false);
+  }, [scrollToBottom]);
+
+  if (!isReady) {
+    return (
+      <div className={classes.chatPlayerContainer}>
+        <Center>
+          <div style={{ marginTop: "100%" }}>
+            <Center>
+              <Loader size="xl" />
+            </Center>
+            <Text mt={5}>Loading Chat Playback</Text>
+            {error && (
+              <Text size="sm">
+                Error: {error.message}
+              </Text>
+            )}
+          </div>
+        </Center>
+
+      </div>
+    );
+  }
+
+  return (
+    <div
+      ref={chatContainerRef}
+      className={`${classes.chatPlayerContainer} `}
+    >
+      {error && (
+        <Box className="p-2 mb-2 bg-red-100 text-red-800 rounded">
+          <Text size="sm">{error.message}</Text>
+        </Box>
+      )}
+      {messages.map((comment) => (
+        <ChatMessage key={comment._id} comment={comment} />
+      ))}
+    </div>
+  );
+};
+
+export default ChatPlayer;
\ No newline at end of file
diff --git a/frontend/app/components/videos/Grid.tsx b/frontend/app/components/videos/Grid.tsx
new file mode 100644
index 00000000..13004d17
--- /dev/null
+++ b/frontend/app/components/videos/Grid.tsx
@@ -0,0 +1,181 @@
+// VideoGrid.tsx
+import { Box, Center, Group, Pagination, SimpleGrid, ActionIcon, NumberInput, MultiSelect, Text } from "@mantine/core";
+import { IconMinus, IconPlus } from "@tabler/icons-react";
+import { useRef, useState, useEffect } from "react";
+import type { NumberInputHandlers } from "@mantine/core";
+import VideoCard from "./Card";
+import { Video, VideoType } from "@/app/hooks/useVideos";
+import GanymedeLoadingText from "../utils/GanymedeLoadingText";
+
+export type VideoGridProps<T extends Video> = {
+  videos: T[];
+  totalPages: number;
+  currentPage: number;
+  onPageChange: (page: number) => void;
+  isPending?: boolean;
+  videoLimit: number;
+  onVideoLimitChange: (limit: number) => void;
+  onVideoTypeChange: (types: VideoType[]) => void;
+  showChannel?: boolean;
+  showMenu?: boolean;
+  showProgress?: boolean;
+};
+
+const VideoGrid = <T extends Video>({
+  videos,
+  totalPages,
+  currentPage,
+  onPageChange,
+  isPending = false,
+  videoLimit,
+  onVideoLimitChange,
+  onVideoTypeChange,
+  showChannel = false,
+  showMenu = true,
+  showProgress = true,
+}: VideoGridProps<T>) => {
+  const handlersRef = useRef<NumberInputHandlers>(null);
+  // Local state to handle the input value while typing
+  const [localLimit, setLocalLimit] = useState(videoLimit);
+  const [totalVideoCount, setTotalVideoCount] = useState(0);
+  const [videoTypes, setVideoTypes] = useState<VideoType[]>([]);
+
+  useEffect(() => {
+    setLocalLimit(videoLimit);
+  }, [videoLimit]);
+
+  const handleSetVideoLimit = (value: string | number) => {
+    const numValue = Number(value);
+    // Update local state immediately
+    setLocalLimit(numValue);
+
+    // Only update parent state if it's a valid number within bounds
+    if (!isNaN(numValue)) {
+      onVideoLimitChange(numValue);
+    }
+  };
+
+  useEffect(() => {
+    if (!videos) return;
+    setTotalVideoCount(videos.length);
+  }, [videos]);
+
+  // Convert the enum VideoType to an array for the multiselector
+  const selectorVideoTypes = Object.values(VideoType).map((type) => ({
+    value: type,
+    label: type.charAt(0).toUpperCase() + type.slice(1),
+  }));
+
+  const convertToVideoTypes = (selectedValues: string[]): VideoType[] => {
+    return selectedValues
+      .filter((value) => Object.values(VideoType).includes(value as VideoType))
+      .map((value) => value as VideoType);
+  };
+
+  const handleSetVideoTypes = (selectedStrings: string[]) => {
+    const videoTypesArray = convertToVideoTypes(selectedStrings);
+    onVideoTypeChange(videoTypesArray)
+    setVideoTypes(videoTypesArray)
+    onPageChange(1);
+  };
+
+
+  const handleIncrement = () => {
+    const newValue = Math.min(localLimit + 24, 120);
+    setLocalLimit(newValue);
+    onVideoLimitChange(newValue);
+  };
+
+  const handleDecrement = () => {
+    const newValue = Math.max(localLimit - 24, 24);
+    setLocalLimit(newValue);
+    onVideoLimitChange(newValue);
+  };
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading Videos" />;
+  }
+
+  return (
+    <Box>
+      <Group justify="space-between" gap="xs" mb="md">
+        <Box w={200}>
+          <MultiSelect
+            data={selectorVideoTypes}
+            value={videoTypes}
+            onChange={(value) => handleSetVideoTypes(value)}
+            label="Filter by"
+            placeholder="Select video types"
+            clearable
+          />
+        </Box>
+        <div>
+          <Text>{totalVideoCount.toLocaleString()} Videos</Text>
+        </div>
+      </Group>
+
+      <SimpleGrid
+        cols={{ base: 1, sm: 2, md: 3, lg: 4, xl: 5, xxl: 6 }}
+        spacing="xs"
+        verticalSpacing="xs"
+      >
+        {videos.map((video) => (
+          <VideoCard
+            key={video.id}
+            video={video}
+            showChannel={showChannel}
+            showMenu={showMenu}
+            showProgress={showProgress}
+          />
+        ))}
+      </SimpleGrid>
+
+      <div>
+        <Center>
+          <Pagination
+            value={currentPage}
+            onChange={onPageChange}
+            total={totalPages}
+            color="violet"
+            size="lg"
+            withEdges
+          />
+        </Center>
+        <Center mt={5}>
+          <Group>
+            <ActionIcon
+              size="lg"
+              variant="default"
+              onClick={handleDecrement}
+            >
+              <IconMinus style={{ width: '70%', height: '70%' }} stroke={1.5} />
+            </ActionIcon>
+
+            <NumberInput
+              hideControls
+              value={localLimit}
+              onChange={handleSetVideoLimit}
+              handlersRef={handlersRef}
+              max={120}
+              min={24}
+              step={24}
+              styles={{ input: { width: 54, textAlign: "center" } }}
+              clampBehavior="strict"
+              allowDecimal={false}
+            />
+
+            <ActionIcon
+              size="lg"
+              variant="default"
+              onClick={handleIncrement}
+            >
+              <IconPlus style={{ width: '70%', height: '70%' }} stroke={1.5} />
+            </ActionIcon>
+          </Group>
+        </Center>
+      </div>
+    </Box>
+  );
+};
+
+export default VideoGrid;
\ No newline at end of file
diff --git a/frontend/app/components/videos/LoginRequired.module.css b/frontend/app/components/videos/LoginRequired.module.css
new file mode 100644
index 00000000..641ef2ed
--- /dev/null
+++ b/frontend/app/components/videos/LoginRequired.module.css
@@ -0,0 +1,25 @@
+.container {
+  width: 100%;
+  height: calc(100vh - rem(56px));
+  max-height: calc(100vh - rem(56px));
+}
+
+.thumbnail {
+  width: 100%;
+  height: 100%;
+  background-size: cover;
+  background-position: center;
+  filter: blur(8px);
+  -webkit-filter: blur(8px);
+}
+.textContainer {
+  position: absolute;
+  top: 50%;
+  left: 50%;
+  transform: translate(-50%, -50%);
+  color: var(--mantine-color-white);
+  text-align: center;
+  background-color: rgba(0, 0, 0, 0.5);
+  padding: 1rem;
+  background-origin: var(--mantine-radius-sm);
+}
diff --git a/frontend/app/components/videos/LoginRequired.tsx b/frontend/app/components/videos/LoginRequired.tsx
new file mode 100644
index 00000000..da004a8f
--- /dev/null
+++ b/frontend/app/components/videos/LoginRequired.tsx
@@ -0,0 +1,35 @@
+import { Video } from "@/app/hooks/useVideos";
+import classes from "./LoginRequired.module.css"
+import { env } from "next-runtime-env";
+import { escapeURL } from "@/app/util/util";
+import { Center } from "@mantine/core";
+import { IconLock } from "@tabler/icons-react";
+
+interface Params {
+  video: Video;
+}
+
+const VideoLoginRequired = ({ video }: Params) => {
+  return (
+    <div className={classes.container}>
+      <div
+        style={{
+          backgroundImage: `url(${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(
+            video.web_thumbnail_path
+          )})`
+        }}
+        className={classes.thumbnail}
+      ></div>
+      <div className={classes.textContainer}>
+        <Center>
+          <IconLock size={64} />
+        </Center>
+        <div className={classes.text}>
+          You must be logged in to view this video
+        </div>
+      </div>
+    </div>
+  );
+}
+
+export default VideoLoginRequired;
\ No newline at end of file
diff --git a/frontend/app/components/videos/Menu.tsx b/frontend/app/components/videos/Menu.tsx
new file mode 100644
index 00000000..e24d4122
--- /dev/null
+++ b/frontend/app/components/videos/Menu.tsx
@@ -0,0 +1,238 @@
+import { Menu, rem, ActionIcon, Modal, Drawer } from '@mantine/core';
+import { useDisclosure } from '@mantine/hooks';
+import {
+  IconPhoto,
+  IconTrash,
+  IconMenu2,
+  IconPlaylistAdd,
+  IconInfoCircle,
+  IconHourglassHigh,
+  IconHourglassEmpty,
+  IconLockOpen,
+  IconShare,
+  IconLock,
+  IconMovie,
+} from '@tabler/icons-react';
+import VideoInfoModalContent from './modals/InfoModalContent';
+import { useGenerateSpriteThumbnails, useGenerateStaticThumbnail, useLockVideo, Video } from '@/app/hooks/useVideos';
+import PlaylistManageDrawerContent from '../playlist/ManageDrawerContent';
+import { useAxiosPrivate } from '@/app/hooks/useAxios';
+import { useDeletePlayback, useMarkVideoAsWatched } from '@/app/hooks/usePlayback';
+import { showNotification } from '@mantine/notifications';
+import { useEffect, useRef } from 'react';
+import videoEventBusInstance from '@/app/util/VideoEventBus';
+import DeleteVideoModalContent from '../admin/video/DeleteModalContent';
+import useAuthStore from '@/app/store/useAuthStore';
+import { UserRole } from '@/app/hooks/useAuthentication';
+
+type Props = {
+  video: Video
+}
+
+const VideoMenu = ({ video }: Props) => {
+  const [infoModalOpened, { open: infoModalOpen, close: infoModalClose }] = useDisclosure(false);
+  const [playlistsDrawerOpened, { open: openPlaylistDrawer, close: closePlaylistDrawer }] = useDisclosure(false);
+  const axiosPrivate = useAxiosPrivate()
+  const isLocked = useRef(false);
+  const { hasPermission } = useAuthStore()
+
+  useEffect(() => {
+    if (video.locked) {
+      isLocked.current = true;
+    }
+  }, [video]);
+
+  const markAsWatchedMutate = useMarkVideoAsWatched()
+  const deletePlaybackMutate = useDeletePlayback()
+  const lockVideoMutate = useLockVideo()
+  const generateStaticThumbnailMutate = useGenerateStaticThumbnail()
+  const generateSpriteThumbnailsMutate = useGenerateSpriteThumbnails()
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+  const handleMarkAsWatched = async () => {
+    try {
+      await markAsWatchedMutate.mutateAsync({
+        axiosPrivate,
+        videoId: video.id
+      })
+      showNotification({
+        message: "Video marked as watched"
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+  const handleMarkAsUnWatched = async () => {
+    try {
+      await deletePlaybackMutate.mutateAsync({
+        axiosPrivate,
+        videoId: video.id
+      })
+      showNotification({
+        message: "Video marked as unwatched"
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+  const handleLockVideo = async (lock: boolean) => {
+    try {
+      await lockVideoMutate.mutateAsync({
+        axiosPrivate,
+        videoId: video.id,
+        locked: lock
+      })
+      showNotification({
+        message: `Video has been ${lock ? "locked" : "unlocked"}`
+      })
+      if (lock == true) {
+        isLocked.current = true;
+      } else {
+        isLocked.current = false;
+      }
+    } catch (error) {
+      console.error(error)
+    }
+  }
+  const handleGenerateStaticThumbnail = async () => {
+    try {
+      await generateStaticThumbnailMutate.mutateAsync({
+        axiosPrivate,
+        videoId: video.id
+      })
+      showNotification({
+        message: `Queued task to generate static thumbnail`
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+  const handleGenerateSpriteThumbnails = async () => {
+    try {
+      await generateSpriteThumbnailsMutate.mutateAsync({
+        axiosPrivate,
+        videoId: video.id
+      })
+      showNotification({
+        message: `Queued task to generate sprite thumbnails`
+      })
+    } catch (error) {
+      console.error(error)
+    }
+  }
+
+  const handleShareVideo = () => {
+    let shareUrl: string = "";
+    const url = window.location.origin;
+
+    // check if we are on a vod page
+    if (window.location.pathname.includes("/videos/") && window.location.pathname.includes(video.id)) {
+      // get the current time
+      const { time } = videoEventBusInstance.getData()
+      const roundedTime = Math.ceil(time);
+      // create the url
+      shareUrl = `${url}/videos/${video.id}?t=${roundedTime}`;
+    } else {
+      // create the url
+      shareUrl = `${url}/videos/${video.id}`;
+    }
+
+    // copy the url to the clipboard
+    try {
+      navigator.clipboard.writeText(shareUrl);
+      showNotification({
+        title: "Copied to Clipboard",
+        message: "The video url has been copied to your clipboard",
+      });
+
+    } catch (err) {
+      console.error(err);
+      showNotification({
+        title: "Error",
+        message: "The clipboard API requires HTTPS, falling back to a prompt",
+        color: "red",
+      });
+      prompt("Copy to clipboard: Ctrl+C, Enter", shareUrl);
+    }
+  }
+
+  return (
+    <div>
+      <Menu shadow="md" width={200} position="top-end">
+        {/* @ts-expect-error valid */}
+        <Menu.Target>
+          <ActionIcon color="gray" variant="subtle">
+            <IconMenu2 size="1rem" />
+          </ActionIcon>
+        </Menu.Target>
+
+        <Menu.Dropdown>
+          <Menu.Item onClick={openPlaylistDrawer} leftSection={<IconPlaylistAdd style={{ width: rem(14), height: rem(14) }} />}>
+            Playlists
+          </Menu.Item>
+          <Menu.Item leftSection={<IconInfoCircle style={{ width: rem(14), height: rem(14) }} />}
+            onClick={infoModalOpen}>
+            Info
+          </Menu.Item>
+          <Menu.Item leftSection={<IconHourglassHigh style={{ width: rem(14), height: rem(14) }} />} onClick={handleMarkAsWatched}>
+            Mark as Watched
+          </Menu.Item>
+          <Menu.Item leftSection={<IconHourglassEmpty style={{ width: rem(14), height: rem(14) }} />} onClick={handleMarkAsUnWatched}>
+            Mark as Unwatched
+          </Menu.Item>
+          {isLocked.current ? (
+            <Menu.Item leftSection={<IconLockOpen style={{ width: rem(14), height: rem(14) }} />} onClick={() => handleLockVideo(false)}>
+              Unlock
+            </Menu.Item>
+          ) : (
+            <Menu.Item leftSection={<IconLock style={{ width: rem(14), height: rem(14) }} />} onClick={() => handleLockVideo(true)}>
+              Lock
+            </Menu.Item>
+          )}
+          <Menu.Item leftSection={<IconPhoto style={{ width: rem(14), height: rem(14) }} />} onClick={handleGenerateStaticThumbnail}>
+            Regenerate Thumbnail
+          </Menu.Item>
+          <Menu.Item leftSection={<IconMovie style={{ width: rem(14), height: rem(14) }} />} onClick={handleGenerateSpriteThumbnails}>
+            Generate Sprite Thumbnails
+          </Menu.Item>
+          <Menu.Item leftSection={<IconShare style={{ width: rem(14), height: rem(14) }} />} onClick={handleShareVideo}>
+            Share
+          </Menu.Item>
+
+          {hasPermission(UserRole.Admin) && (
+            <>
+              <Menu.Divider />
+              <Menu.Item
+                color="red"
+                leftSection={<IconTrash style={{ width: rem(14), height: rem(14) }} />}
+                onClick={openDeleteModal}
+              >
+                Delete
+              </Menu.Item>
+            </>
+          )}
+
+        </Menu.Dropdown>
+      </Menu>
+
+      <Modal
+        opened={infoModalOpened}
+        onClose={infoModalClose}
+        size="xl"
+        title="Video Information"
+      >
+        <VideoInfoModalContent video={video} />
+      </Modal>
+
+      <Drawer opened={playlistsDrawerOpened} onClose={closePlaylistDrawer} position="right" title="Manage Playlists">
+        <PlaylistManageDrawerContent videoId={video.id} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Video">
+        <DeleteVideoModalContent video={video} handleClose={closeDeleteModal} />
+      </Modal>
+    </div>
+  );
+}
+
+export default VideoMenu;
\ No newline at end of file
diff --git a/frontend/app/components/videos/Player.module.css b/frontend/app/components/videos/Player.module.css
new file mode 100644
index 00000000..b2eaf21b
--- /dev/null
+++ b/frontend/app/components/videos/Player.module.css
@@ -0,0 +1,28 @@
+.mediaPlayer {
+  height: calc(100vh - rem(56px) - 60px);
+
+  video {
+    height: calc(100vh - rem(56px) - 60px);
+  }
+
+  @media (max-width: em(1000px)) {
+    height: 100%;
+    video {
+      height: 100%;
+    }
+  }
+}
+
+.mediaPlayerTheaterMode {
+  height: 100vh;
+
+  video {
+    height: 100vh;
+  }
+
+  width: 100%;
+}
+
+.mediaPlayerPoster {
+  object-fit: contain;
+}
diff --git a/frontend/app/components/videos/Player.tsx b/frontend/app/components/videos/Player.tsx
new file mode 100644
index 00000000..9019dc8b
--- /dev/null
+++ b/frontend/app/components/videos/Player.tsx
@@ -0,0 +1,195 @@
+import '@vidstack/react/player/styles/default/theme.css';
+import '@vidstack/react/player/styles/default/layouts/video.css';
+import { MediaPlayer, MediaPlayerInstance, MediaProvider, MediaSrc, Poster, Track, VideoMimeType } from '@vidstack/react';
+import { defaultLayoutIcons, DefaultVideoLayout } from '@vidstack/react/player/layouts/default';
+import { Video, VideoType } from '@/app/hooks/useVideos';
+import classes from "./Player.module.css"
+import { useEffect, useRef, useState } from 'react';
+import { env } from 'next-runtime-env';
+import { escapeURL } from '@/app/util/util';
+import { PlaybackStatus, useFetchPlaybackForVideo, useSetPlaybackProgressForVideo, useStartPlaybackForVideo, useUpdatePlaybackProgressForVideo } from '@/app/hooks/usePlayback';
+import { useAxiosPrivate } from '@/app/hooks/useAxios';
+import useAuthStore from '@/app/store/useAuthStore';
+import { useSearchParams } from 'next/navigation';
+import VideoEventBus from '@/app/util/VideoEventBus';
+import VideoPlayerTheaterModeIcon from './PlayerTheaterModeIcon';
+import useSettingsStore from '@/app/store/useSettingsStore';
+
+interface Params {
+  video: Video;
+}
+
+const VideoPlayer = ({ video }: Params) => {
+  const searchParams = useSearchParams()
+
+  const isLoggedIn = useAuthStore(state => state.isLoggedIn);
+
+  const player = useRef<MediaPlayerInstance>(null);
+  const [videoSource, setVideoSource] = useState<MediaSrc>();
+  const [videoPoster, setVideoPoster] = useState<string>("");
+
+  const hasStartedPlayback = useRef(false);
+
+  const [playerVolume, setPlayerVolume] = useState(1);
+
+  const updatePlaybackProgressMutation = useUpdatePlaybackProgressForVideo()
+  const setPlaybackProgressMutation = useSetPlaybackProgressForVideo()
+
+  const videoTheaterMode = useSettingsStore((state) => state.videoTheaterMode);
+
+  const axiosPrivate = useAxiosPrivate();
+  // get playback data
+  const { data: playbackData } = useFetchPlaybackForVideo(axiosPrivate, video.id, {
+    refetchOnWindowFocus: false,
+    refetchOnReconnect: false,
+    retry: false,
+    enabled: (isLoggedIn)
+  })
+
+  // start playback
+  const startPlaybackMutation = useStartPlaybackForVideo(axiosPrivate, video.id)
+  useEffect(() => {
+    if (isLoggedIn && !hasStartedPlayback.current) {
+      startPlaybackMutation.mutate();
+      hasStartedPlayback.current = true;
+    }
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [])
+
+  useEffect(() => {
+    if (!player) return
+
+    const videoExtension = video.video_path.substr(video.video_path.length - 4)
+    let videoType: VideoMimeType = "video/mp4"
+    if (videoExtension == "m3u8") {
+      videoType = "video/object";
+    }
+
+    setVideoSource({
+      src: `${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(video.video_path)}`,
+      type: videoType
+    })
+
+    if (video.thumbnail_path) {
+      setVideoPoster(`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(video.thumbnail_path)}`)
+    }
+
+    // todo: captions?
+
+    const localVolume = localStorage.getItem("ganymede-volume")
+    if (localVolume) {
+      setPlayerVolume(parseFloat(localVolume))
+    }
+
+    player.current?.subscribe(({ volume }) => {
+      if (volume != 1) {
+        localStorage.setItem("ganymede-volume", volume.toString());
+      }
+    });
+
+    // set playback progress
+    if (playbackData && playbackData.time) {
+      player.current!.currentTime = playbackData.time
+    }
+
+    // Check if time is set in the url
+    const time = searchParams.get("t");
+    if (time) {
+      player.current!.currentTime = parseInt(time);
+    }
+
+  }, [player, video, playbackData, searchParams])
+
+
+  // Playback progress reporting
+  useEffect(() => {
+    if (!isLoggedIn) return;
+    const playbackInerval = setInterval(async () => {
+      if (player.current == null) return;
+      if (player.current.paused) return;
+
+      const playerTimeInt = Math.floor(player.current.currentTime)
+      if (playerTimeInt == 0) return;
+
+
+      updatePlaybackProgressMutation.mutate({
+        axiosPrivate: axiosPrivate,
+        videoId: video.id,
+        time: playerTimeInt
+      })
+
+      // mark video as finished if over duration threshold
+      if (playerTimeInt / video.duration >= 0.98) {
+        setPlaybackProgressMutation.mutate({
+          axiosPrivate: axiosPrivate,
+          videoId: video.id,
+          status: PlaybackStatus.Finished
+        })
+
+        // remove interval
+        clearInterval(playbackInerval)
+      }
+    }, 10000);
+    return () => clearInterval(playbackInerval);
+
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, []);
+
+  // Fast tick for chat player - set player information in bus
+  useEffect(() => {
+    const ticketInterval = setInterval(() => {
+      if (player.current == null) return;
+
+      let time = player.current.state.currentTime
+      // Clip chats are offset with the position of the clip in the VOD
+      // Append the offset to the current player time to account for this
+      if (video.type == VideoType.Clip && video.clip_vod_offset) {
+        time = time + video.clip_vod_offset
+      };
+
+      VideoEventBus.setData({
+        isPaused: player.current.state.paused,
+        isPlaying: player.current.state.playing,
+        time: time
+      })
+    }, 100);
+    return () => {
+      clearInterval(ticketInterval);
+    };
+  }, [player, video.clip_vod_offset, video.type]);
+
+  return (
+    <MediaPlayer
+      ref={player}
+      className={
+        videoTheaterMode
+          ? classes.mediaPlayerTheaterMode
+          : classes.mediaPlayer
+      }
+      src={videoSource}
+      aspect-ratio={16 / 9}
+      crossOrigin={true}
+      playsInline={true}
+      load="eager"
+      posterLoad="eager"
+      volume={playerVolume}
+    >
+      <MediaProvider>
+        <Poster className={`${classes.mediaPlayerPoster} vds-poster`} src={videoPoster} alt={video.title} />
+        <Track
+          src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}/api/v1/chapter/video/${video.id}/webvtt`}
+          kind="chapters"
+          default={true}
+        />
+      </MediaProvider>
+      <DefaultVideoLayout icons={defaultLayoutIcons} noScrubGesture={false}
+        slots={{
+          beforeFullscreenButton: <VideoPlayerTheaterModeIcon />,
+        }}
+        thumbnails={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}/api/v1/vod/${video.id}/thumbnails/vtt`}
+      />
+    </MediaPlayer>
+  );
+}
+
+export default VideoPlayer;
\ No newline at end of file
diff --git a/frontend/app/components/videos/PlayerTheaterModeIcon.module.css b/frontend/app/components/videos/PlayerTheaterModeIcon.module.css
new file mode 100644
index 00000000..6962940c
--- /dev/null
+++ b/frontend/app/components/videos/PlayerTheaterModeIcon.module.css
@@ -0,0 +1,13 @@
+.theaterIcon {
+  cursor: pointer;
+  color: #f5f5f5;
+  transition: all 0.2s ease-in-out;
+}
+.customFullScreenButton {
+  color: #f5f5f5;
+
+  &:hover {
+    color: #f5f5f5;
+    background-color: rgb(255 255 255 / 0.2);
+  }
+}
diff --git a/frontend/app/components/videos/PlayerTheaterModeIcon.tsx b/frontend/app/components/videos/PlayerTheaterModeIcon.tsx
new file mode 100644
index 00000000..1a0a51fc
--- /dev/null
+++ b/frontend/app/components/videos/PlayerTheaterModeIcon.tsx
@@ -0,0 +1,30 @@
+import { ActionIcon, Tooltip } from "@mantine/core";
+import { IconMaximize } from "@tabler/icons-react";
+import classes from "./PlayerTheaterModeIcon.module.css"
+import useSettingsStore from "@/app/store/useSettingsStore";
+
+const VideoPlayerTheaterModeIcon = () => {
+  const { setVideoTheaterMode } = useSettingsStore()
+  const videoTheaterMode = useSettingsStore((state) => state.videoTheaterMode);
+
+  const toggleTheaterMode = () => {
+    setVideoTheaterMode(!videoTheaterMode)
+  };
+  return (
+    <div className={classes.theaterIcon}>
+      <Tooltip label="Theater Mode" position="bottom">
+        <ActionIcon
+          size="xl"
+          variant="transparent"
+          onClick={toggleTheaterMode}
+          onTouchStart={toggleTheaterMode}
+          className={classes.customFullScreenButton}
+        >
+          <IconMaximize size="1.7rem" />
+        </ActionIcon>
+      </Tooltip>
+    </div>
+  );
+}
+
+export default VideoPlayerTheaterModeIcon;
\ No newline at end of file
diff --git a/frontend/app/components/videos/TitleBar.module.css b/frontend/app/components/videos/TitleBar.module.css
new file mode 100644
index 00000000..8a8cc4ca
--- /dev/null
+++ b/frontend/app/components/videos/TitleBar.module.css
@@ -0,0 +1,33 @@
+.titleBarContainer {
+  width: 100%;
+  height: 60px;
+  position: relative;
+  overflow-x: auto;
+}
+.titleBar {
+  display: flex;
+  position: absolute;
+  margin: 0;
+  top: 50%;
+  transform: translateY(-50%);
+  width: 100%;
+  padding-left: 10px;
+  padding-right: 10px;
+}
+.titleBarRight {
+  margin-left: auto;
+  float: right;
+  display: flex;
+}
+.titleBarBadge {
+  display: flex;
+  align-items: center;
+  margin-right: 5px;
+}
+.typeBadge {
+  padding-left: 5px;
+  padding-right: 5px;
+  padding-top: 2px;
+  padding-bottom: 2px;
+  border-radius: 5px;
+}
diff --git a/frontend/app/components/videos/TitleBar.tsx b/frontend/app/components/videos/TitleBar.tsx
new file mode 100644
index 00000000..7c60ec70
--- /dev/null
+++ b/frontend/app/components/videos/TitleBar.tsx
@@ -0,0 +1,118 @@
+"use client"
+import { useGetVideoByExternalId, Video } from "@/app/hooks/useVideos";
+import { escapeURL } from "@/app/util/util";
+import { Avatar, Box, Divider, Tooltip, Text, Group, Badge, Button } from "@mantine/core";
+import { env } from "next-runtime-env";
+import classes from "./TitleBar.module.css";
+import { IconCalendarEvent, IconUser, IconUsers } from "@tabler/icons-react";
+import dayjs from "dayjs";
+import VideoMenu from "./Menu";
+import useAuthStore from "@/app/store/useAuthStore";
+import { UserRole } from "@/app/hooks/useAuthentication";
+import Link from "next/link";
+
+interface Params {
+  video: Video;
+}
+
+const VideoTitleBar = ({ video }: Params) => {
+  const hasPermission = useAuthStore(state => state.hasPermission);
+
+  const { data: clipFullVideo } = useGetVideoByExternalId(video.clip_ext_vod_id)
+
+  return (
+    <div className={classes.titleBarContainer}>
+      <div className={classes.titleBar}>
+        <Avatar
+          src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(video.edges.channel.image_path)}`}
+          radius="xl"
+          alt={video.edges.channel.display_name}
+          mr={10}
+        />
+
+        <Divider size="sm" orientation="vertical" mr={10} />
+
+        <div style={{ width: "60%" }}>
+          <Tooltip label={video.title} openDelay={250}>
+            <Text size="xl" lineClamp={1} pt={3}>
+              {video.title}
+            </Text>
+          </Tooltip>
+        </div>
+
+        <div className={classes.titleBarRight}>
+
+          <div className={classes.titleBarBadge}>
+
+            {clipFullVideo && (
+              <Group mr={15}>
+                <Button variant="default" size="xs" component={Link} href={`/videos/${clipFullVideo.id}?t=${video.clip_vod_offset}`}>Go To Full Video</Button>
+              </Group>
+            )}
+
+            {video.views && (
+              <Group mr={15}>
+                <Tooltip
+                  label={`${video.views.toLocaleString()} source views`}
+                  openDelay={250}
+                >
+                  <div className={classes.titleBarBadge}>
+                    <Text mr={3}>{video.views.toLocaleString()}</Text>
+                    <IconUsers size={20} />
+                  </div>
+                </Tooltip>
+              </Group>
+            )}
+
+            {video.local_views && (
+              <Group mr={15}>
+                <Tooltip
+                  label={`${video.local_views.toLocaleString()} local views`}
+                  openDelay={250}
+                >
+                  <div className={classes.titleBarBadge}>
+                    <Text mr={3}>{video.local_views.toLocaleString()}</Text>
+                    <IconUser size={20} />
+                  </div>
+                </Tooltip>
+              </Group>
+            )}
+
+            <Group mr={15}>
+              <Tooltip
+                label={`Originally streamed at ${video.streamed_at}`}
+                openDelay={250}
+              >
+                <div className={classes.titleBarBadge}>
+                  <Text mr={5}>
+                    {dayjs(video.streamed_at).format("YYYY/MM/DD")}
+                  </Text>
+                  <IconCalendarEvent size={20} />
+                </div>
+              </Tooltip>
+            </Group>
+
+            <Group>
+              <Tooltip label={`Video Type`} openDelay={250}>
+                <div className={classes.titleBarBadge}>
+                  <Badge variant="default">
+                    {video.type}
+                  </Badge>
+                </div>
+              </Tooltip>
+            </Group>
+          </div>
+
+          {hasPermission(UserRole.Archiver) && (
+            <Box mt={5}>
+              <VideoMenu video={video} />
+            </Box>
+          )}
+
+        </div>
+      </div>
+    </div>
+  );
+};
+
+export default VideoTitleBar;
\ No newline at end of file
diff --git a/frontend/app/components/videos/VideoClips.tsx b/frontend/app/components/videos/VideoClips.tsx
new file mode 100644
index 00000000..1411b9ce
--- /dev/null
+++ b/frontend/app/components/videos/VideoClips.tsx
@@ -0,0 +1,38 @@
+import { Video } from "@/app/hooks/useVideos";
+import { Carousel } from "@mantine/carousel";
+import { Title } from "@mantine/core";
+import VideoCard from "./Card";
+
+interface Params {
+  clips: Video[];
+}
+
+const VideoPageClips = ({ clips }: Params) => {
+
+  return (
+    <div>
+      <Title my={5}>Video Clips</Title>
+      <Carousel
+        withIndicators
+        slideSize={{ base: '100%', sm: '50%', md: '33.333333%', lg: '25%', xl: '16.666666%' }}
+        slideGap={{ base: 0, sm: 'md' }}
+        loop
+        align="start"
+      >
+        {clips.map((video) => (
+          <Carousel.Slide key={video.id}>
+            <VideoCard
+              key={video.id}
+              video={video}
+              showChannel={false}
+              showMenu={true}
+              showProgress={true}
+            />
+          </Carousel.Slide>
+        ))}
+      </Carousel>
+    </div>
+  );
+}
+
+export default VideoPageClips;
\ No newline at end of file
diff --git a/frontend/app/components/videos/modals/InfoModalContent.tsx b/frontend/app/components/videos/modals/InfoModalContent.tsx
new file mode 100644
index 00000000..52835d31
--- /dev/null
+++ b/frontend/app/components/videos/modals/InfoModalContent.tsx
@@ -0,0 +1,34 @@
+import { useFetchVideo, Video } from "@/app/hooks/useVideos";
+import { Center, Code } from "@mantine/core";
+import GanymedeLoadingText from "../../utils/GanymedeLoadingText";
+
+type Props = {
+  video: Video
+}
+
+const VideoInfoModalContent = ({ video }: Props) => {
+
+  const { data, isPending, isError } = useFetchVideo({ id: video.id, with_channel: true, with_chapters: true, with_muted_segments: true })
+
+  if (isPending) {
+    return (
+      <GanymedeLoadingText message="Loading Video Information" />
+    );
+  }
+
+  if (isError) {
+    return (
+      <Center>
+        <div>Error loading video information</div>
+      </Center>
+    );
+  }
+
+  return (
+    <div>
+      <Code block>{JSON.stringify(data, null, 2)}</Code>
+    </div>
+  );
+}
+
+export default VideoInfoModalContent;
\ No newline at end of file
diff --git a/frontend/app/components/videos/multistream/MultistreamTimeline.module.css b/frontend/app/components/videos/multistream/MultistreamTimeline.module.css
new file mode 100644
index 00000000..15ef8201
--- /dev/null
+++ b/frontend/app/components/videos/multistream/MultistreamTimeline.module.css
@@ -0,0 +1,73 @@
+.timelineGrid {
+  position: relative;
+  flex-shrink: 0;
+  overflow: auto;
+  display: grid;
+  grid-template-columns: auto 1fr;
+  align-items: center;
+  gap: 0.25rem;
+  margin: 0 1rem 1rem 1rem;
+}
+
+.timelineStreamerColumn {
+  display: flex;
+  gap: 0.25rem;
+}
+
+.timelineBar {
+  position: relative;
+  height: 0.75rem;
+  border-radius: 0.25rem;
+  overflow: hidden;
+}
+
+.timelineBar:before {
+  content: "";
+  background: var(--mantine-color-violet-9);
+  opacity: 0.25;
+  position: absolute;
+  inset: 0;
+}
+
+.timelineBarActive {
+  pointer-events: none;
+  background-color: var(--mantine-color-violet-9);
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: var(--bar-start);
+  width: var(--bar-length);
+}
+
+.gridInput {
+  width: 4.5rem;
+}
+
+.offsetInput {
+  width: 4.5rem;
+}
+
+.playheadContainer {
+  position: absolute;
+  grid-column: 2 / 3;
+  grid-row: 1;
+  width: 100%;
+  height: 100%;
+}
+
+.playhead {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: var(--playhead-position);
+  transform: translateX(-50%);
+  width: 0.125rem;
+  background-color: var(--mantine-color-grape-5);
+  opacity: 0.75;
+  pointer-events: none;
+}
+
+.playheadPreview {
+  background-color: var(--mantine-color-pink-5);
+  opacity: 0.75;
+}
diff --git a/frontend/app/components/videos/multistream/MultistreamTimeline.tsx b/frontend/app/components/videos/multistream/MultistreamTimeline.tsx
new file mode 100644
index 00000000..e26ad53f
--- /dev/null
+++ b/frontend/app/components/videos/multistream/MultistreamTimeline.tsx
@@ -0,0 +1,221 @@
+import { ActionIcon, Center, Group, Image, NumberInput, Stack, Tooltip } from "@mantine/core";
+import classes from "./MultistreamTimeline.module.css"
+import { IconPlayerPauseFilled, IconPlayerPlayFilled, IconRewindBackward5, IconRewindBackward60, IconRewindForward5, IconRewindForward60 } from "@tabler/icons-react";
+import React, { Fragment, useRef, useState } from "react";
+import dayjs from "dayjs";
+import { escapeURL } from "@/app/util/util";
+import { env } from "next-runtime-env";
+import { Video } from "@/app/hooks/useVideos";
+
+export type MultistreamTimelineProps = {
+  seek: (time: number) => void;
+  pause: () => void;
+  play: () => void;
+  vodPlaybackOffsets: Record<string, number>;
+  globalTime: number;
+  startDateMs: number | null;
+  endDateMs: number | null;
+  playStartAtDate: number;
+  playing: boolean;
+  setVodOffset: (vodId: string, offset: number) => void;
+  playingVodForStreamer: Record<string, Video | null>;
+  streamers: Record<string, {
+    name: string
+    vods: Video[],
+    imagePath: string
+  }>;
+  gridWidth: number;
+  gridHeight: number;
+  setGridWidth: (width: number) => void;
+  setGridHeight: (height: number) => void;
+  onStreamerDragStart: () => void;
+}
+
+export const MultistreamTimeline = ({ vodPlaybackOffsets, globalTime, startDateMs, endDateMs, playStartAtDate, seek, pause, play, playing, playingVodForStreamer, streamers, setVodOffset, onStreamerDragStart, gridWidth, gridHeight, setGridWidth, setGridHeight }: MultistreamTimelineProps) => {
+  const [timelineTooltipText, setTimelineTooltipText] = useState<string>("");
+  const [hoverPlayheadDate, setHoverPlayheadDate] = useState<number | null>(null);
+  const timeAtMousePosition = (timelineBar: HTMLDivElement | null, event: React.MouseEvent) => {
+    if (!timelineBar) return null;
+    const rect = timelineBar.getBoundingClientRect();
+    const x = event.clientX - rect.left;
+    const percentage = x / rect.width;
+    const globalTime = startDateMs! + percentage * timelineDurationMs;
+    return globalTime;
+  }
+
+  const streamerImageRefs = useRef<Record<string, HTMLImageElement | null>>({});
+
+  const onTimelineClick = (timelineBar: HTMLDivElement | null, event: React.MouseEvent) => {
+    const newGlobalTime = timeAtMousePosition(timelineBar, event);
+    if (newGlobalTime == null) {
+      return;
+    }
+    seek(newGlobalTime);
+  }
+
+  const hideHoverPlayhead = () => {
+    setHoverPlayheadDate(null);
+  }
+  const updateHoverPlayhead = (timelineBar: HTMLDivElement | null, event: React.PointerEvent) => {
+    setHoverPlayheadDate(timeAtMousePosition(timelineBar, event));
+  }
+  const timelineDurationMs: number = startDateMs != null && endDateMs != null ? endDateMs - startDateMs : 0;
+
+  const getCurrentTime = () => {
+    return (playing ? (Date.now() - playStartAtDate) : 0) + globalTime
+  }
+
+  const updateTimelineTooltip = (timelineBar: HTMLDivElement | null, event: React.PointerEvent) => {
+    const timeUnderPointer = timeAtMousePosition(timelineBar, event);
+    setTimelineTooltipText(timeUnderPointer != null ? dayjs(timeUnderPointer).format("YYYY/MM/DD HH:mm:ss") : "");
+  }
+
+  const onStreamerNameDragStart = (event: React.DragEvent, streamerId: string) => {
+    event.dataTransfer.setData("streamerid", streamerId);
+    event.dataTransfer.effectAllowed = 'move';
+    if (streamerImageRefs.current?.[streamerId]) {
+      event.dataTransfer.setDragImage(streamerImageRefs.current[streamerId], 0, 0);
+    }
+    onStreamerDragStart();
+  }
+
+  const timelineEnd = dayjs(endDateMs).format("YYYY/MM/DD HH:mm:ss")
+
+  return <Stack gap="sm">
+    <Group justify="center" gap="xs">
+      <Tooltip label="Seek back 60 seconds" position="top">
+        <ActionIcon
+          size="sm"
+          variant="subtle"
+          color="violet"
+          aria-label="Seek back 60 seconds"
+          onClick={() => seek(getCurrentTime() - 60000)}
+        ><IconRewindBackward60 /></ActionIcon>
+      </Tooltip>
+
+      <Tooltip label="Seek back 5 seconds" position="top">
+        <ActionIcon
+          size="sm"
+          variant="subtle"
+          color="violet"
+          aria-label="Seek back 5 seconds"
+          onClick={() => seek(getCurrentTime() - 5000)}
+        ><IconRewindBackward5 /></ActionIcon>
+      </Tooltip>
+
+      <Tooltip label={playing ? "Pause" : "Play"} position="top">
+        <ActionIcon
+          // eslint-disable-next-line @typescript-eslint/no-unused-expressions
+          onClick={() => { playing ? pause() : play() }}
+          size="md"
+          variant="subtle"
+          color="violet"
+          aria-label={playing ? "Pause" : "Play"}
+        >
+          {playing ? <IconPlayerPauseFilled /> : <IconPlayerPlayFilled />}
+        </ActionIcon>
+      </Tooltip>
+
+      <Tooltip label="Seek forward 5 seconds" position="top">
+        <ActionIcon
+          size="sm"
+          variant="subtle"
+          color="violet"
+          aria-label="Seek forward 5 seconds"
+          onClick={() => seek(getCurrentTime() + 5000)}
+        ><IconRewindForward5 /></ActionIcon>
+      </Tooltip>
+
+      <Tooltip label="Seek forward 60 seconds" position="top">
+        <ActionIcon
+          size="sm"
+          variant="subtle"
+          color="violet"
+          aria-label="Seek forward 60 seconds"
+          onClick={() => seek(getCurrentTime() + 60000)}
+        ><IconRewindForward60 /></ActionIcon>
+      </Tooltip>
+
+      <NumberInput className={classes.gridInput} label="Grid width" value={gridWidth} onChange={(value) => setGridWidth(+value)} size="xs" step={1} min={1} />
+      <NumberInput className={classes.gridInput} label="Grid height" value={gridHeight} onChange={(value) => setGridHeight(+value)} size="xs" step={1} min={1} />
+    </Group>
+
+    <Center>
+      <Group gap="sm">
+        <div>
+          {dayjs(getCurrentTime()).format("YYYY/MM/DD HH:mm:ss")} / {timelineEnd}
+        </div>
+      </Group>
+    </Center>
+
+    {
+      startDateMs != null && endDateMs != null && <div className={classes.timelineGrid}>
+        {Object.keys(streamers).map((streamerId) => {
+          const streamer = streamers[streamerId]
+
+          const timelineBar = <div className={classes.timelineBar}>
+            {streamer.vods.map(vod => <div key={vod.id + "-vod-timeline-online"} className={classes.timelineBarActive} style={{
+              '--bar-start': `${100 * (+new Date(getVodStartDate(vod)) - startDateMs!) / timelineDurationMs}%`,
+              '--bar-length': `${100 * 1000 * vod.duration / timelineDurationMs}%`,
+            } as React.CSSProperties}></div>)}
+          </div>
+
+          const playingVod = playingVodForStreamer[streamerId];
+
+          return (
+            <Fragment key={streamer.name + "-timeline-row"}>
+              <div className={classes.timelineStreamerColumn}>
+                <Group gap='sm'>
+                  <div onDragStart={(e) => onStreamerNameDragStart(e, streamerId)} draggable="true">
+                    <Group gap="sm">
+                      <Image ref={(img) => { streamerImageRefs.current[streamerId] = img }} src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(streamer.imagePath)}`} alt={streamer.name} w={'1.5em'} h={'1.5em'} radius={'1.5em'} />
+                      {streamer.name}
+                    </Group>
+                  </div>
+                  <NumberInput
+                    className={classes.offsetInput}
+                    size="xs"
+                    step={0.1}
+                    value={playingVod && vodPlaybackOffsets[playingVod.id] != null ? (vodPlaybackOffsets[playingVod.id] || 0) / 1000 : ''}
+                    placeholder="Offset"
+                    disabled={!playingVod}
+                    onChange={(value) => {
+                      if (!playingVod) return;
+                      const valAsNumber = Math.trunc(+value * 1000);
+                      if (isNaN(valAsNumber)) return;
+                      setVodOffset(playingVod.id, valAsNumber);
+                    }}
+                  />
+                </Group>
+              </div>
+              <div>{timelineBar}</div>
+            </Fragment>
+          )
+        })}
+
+        {
+          (() => {
+            let timelineBarRef: HTMLDivElement | null = null;
+
+            return <Tooltip.Floating label={timelineTooltipText}>
+              <div className={classes.playheadContainer} ref={el => { timelineBarRef = el; }} onClick={(event) => onTimelineClick(timelineBarRef, event)} onPointerMove={(event) => { updateTimelineTooltip(timelineBarRef, event); updateHoverPlayhead(timelineBarRef, event) }} onPointerLeave={hideHoverPlayhead}>
+                <div className={classes.playhead} style={{ '--playhead-position': `${((getCurrentTime() - startDateMs) / timelineDurationMs) * 100}%` } as React.CSSProperties}></div>
+                {hoverPlayheadDate != null && <div className={`${classes.playhead} ${classes.playheadPreview}`} style={{ '--playhead-position': `${((hoverPlayheadDate - startDateMs) / timelineDurationMs) * 100}%` } as React.CSSProperties}></div>}
+              </div>
+            </Tooltip.Floating>
+          })()
+        }
+      </div>
+    }
+  </Stack>
+}
+
+function getVodStartDate(vod: Video): Date {
+  if (!vod) {
+    return new Date();
+  }
+  if (vod.type === 'live') {
+    return vod.created_at;
+  }
+  return vod.streamed_at;
+}
\ No newline at end of file
diff --git a/frontend/app/components/videos/multistream/SyncedVideoPlayer.module.css b/frontend/app/components/videos/multistream/SyncedVideoPlayer.module.css
new file mode 100644
index 00000000..e4225810
--- /dev/null
+++ b/frontend/app/components/videos/multistream/SyncedVideoPlayer.module.css
@@ -0,0 +1,11 @@
+.mediaPlayer {
+  height: 100%;
+
+  video {
+    height: 100%;
+  }
+}
+
+.ganymedePoster {
+  object-fit: contain;
+}
diff --git a/frontend/app/components/videos/multistream/SyncedVideoPlayer.tsx b/frontend/app/components/videos/multistream/SyncedVideoPlayer.tsx
new file mode 100644
index 00000000..a8ddc125
--- /dev/null
+++ b/frontend/app/components/videos/multistream/SyncedVideoPlayer.tsx
@@ -0,0 +1,74 @@
+import { MediaPlayer, MediaPlayerInstance, MediaProvider, MediaProviderInstance, Poster, Track } from "@vidstack/react";
+import { defaultLayoutIcons, DefaultVideoLayout } from '@vidstack/react/player/layouts/default';
+import { useEffect, useRef, useState } from "react";
+import '@vidstack/react/player/styles/default/theme.css';
+import '@vidstack/react/player/styles/default/layouts/video.css';
+import classes from "./SyncedVideoPlayer.module.css"
+import { env } from "next-runtime-env";
+
+export type SyncedVideoPlayerProps = {
+  src: string;
+  vodId: string;
+  title: string;
+  poster: string;
+  time: number;
+  playing: boolean;
+  muted: boolean;
+}
+
+const SyncedVideoPlayer = ({ src, vodId, title, poster, time, playing, muted }: SyncedVideoPlayerProps) => {
+  const player = useRef<MediaPlayerInstance>(null)
+  const mediaProvider = useRef<MediaProviderInstance>(null)
+  const [canPlay, setCanPlay] = useState(false)
+
+  useEffect(() => {
+    const currentPlayer = player.current
+    if (!currentPlayer || !canPlay) return;
+    (async () => {
+      if (playing) {
+        currentPlayer.currentTime = time;
+        await (new Promise<void>(resolve => setTimeout(resolve, 1)));
+        await currentPlayer.play();
+      } else {
+        await (new Promise<void>(resolve => setTimeout(resolve, 1)));
+        await currentPlayer.pause();
+      }
+    })();
+  }, [playing, canPlay, time])
+
+  useEffect(() => {
+    if (!player.current) return;
+    player.current.muted = muted;
+  }, [muted])
+
+  useEffect(() => {
+    if (!player.current || Math.abs(player.current.currentTime - time) < 0.2) return;
+    player.current.currentTime = time;
+  }, [time])
+
+  return (
+    <MediaPlayer
+      className={classes.mediaPlayer}
+      src={src}
+      ref={player}
+      aspect-ratio={16 / 9}
+      crossOrigin
+      onCanPlay={() => setCanPlay(true)}
+      playsInline
+      muted={muted}
+    >
+      <MediaProvider ref={mediaProvider}>
+        <Poster className={`${classes.ganymedePoster} vds-poster`} src={poster} alt={title} />
+        <Track
+          src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}/api/v1/chapter/video/${vodId}/webvtt`}
+          kind="chapters"
+          default={true}
+        />
+      </MediaProvider>
+
+      <DefaultVideoLayout icons={defaultLayoutIcons} />
+    </MediaPlayer>
+  )
+};
+
+export default SyncedVideoPlayer;
\ No newline at end of file
diff --git a/frontend/app/favicon-16x16.png b/frontend/app/favicon-16x16.png
new file mode 100644
index 00000000..dcc3325e
Binary files /dev/null and b/frontend/app/favicon-16x16.png differ
diff --git a/frontend/app/favicon-32x32.png b/frontend/app/favicon-32x32.png
new file mode 100644
index 00000000..ea98c5d4
Binary files /dev/null and b/frontend/app/favicon-32x32.png differ
diff --git a/frontend/app/favicon.ico b/frontend/app/favicon.ico
new file mode 100644
index 00000000..0e9d5426
Binary files /dev/null and b/frontend/app/favicon.ico differ
diff --git a/frontend/app/get-query-client.ts b/frontend/app/get-query-client.ts
new file mode 100644
index 00000000..a2a1f5a6
--- /dev/null
+++ b/frontend/app/get-query-client.ts
@@ -0,0 +1,32 @@
+import {
+  QueryClient,
+  defaultShouldDehydrateQuery,
+  isServer,
+} from "@tanstack/react-query";
+
+function makeQueryClient() {
+  return new QueryClient({
+    defaultOptions: {
+      queries: {
+        staleTime: 60 * 1000,
+      },
+      dehydrate: {
+        // include pending queries in dehydration
+        shouldDehydrateQuery: (query) =>
+          defaultShouldDehydrateQuery(query) ||
+          query.state.status === "pending",
+      },
+    },
+  });
+}
+
+let browserQueryClient: QueryClient | undefined = undefined;
+
+export function getQueryClient() {
+  if (isServer) {
+    return makeQueryClient();
+  } else {
+    if (!browserQueryClient) browserQueryClient = makeQueryClient();
+    return browserQueryClient;
+  }
+}
diff --git a/frontend/app/global.css b/frontend/app/global.css
new file mode 100644
index 00000000..0c793dd4
--- /dev/null
+++ b/frontend/app/global.css
@@ -0,0 +1,5 @@
+/* disable link underlines by default */
+a {
+  color: inherit;
+  text-decoration: none;
+}
diff --git a/frontend/app/hooks/filterFilter.ts b/frontend/app/hooks/filterFilter.ts
new file mode 100644
index 00000000..325190f4
--- /dev/null
+++ b/frontend/app/hooks/filterFilter.ts
@@ -0,0 +1,48 @@
+import { Channel } from "@/app/hooks/useChannels";
+import { useFetchVideosFilter, VideoType } from "@/app/hooks/useVideos";
+import useSettingsStore from "@/app/store/useSettingsStore";
+import { useState } from "react";
+
+export type FilterParams = {
+  limit: number;
+  page: number;
+  types: VideoType[];
+};
+
+export const useFilteredVideos = (channel: Channel) => {
+  const videoLimit = useSettingsStore((state) => state.videoLimit);
+  const setVideoLimit = useSettingsStore((state) => state.setVideoLimit);
+
+  const [filterParams, setFilterParams] = useState<FilterParams>({
+    limit: videoLimit,
+    page: 1,
+    types: [],
+  });
+
+  const {
+    data: videos,
+    isPending,
+    isError,
+  } = useFetchVideosFilter({
+    limit: filterParams.limit,
+    offset: (filterParams.page - 1) * filterParams.limit,
+    types: filterParams.types,
+    channel_id: channel.id,
+  });
+
+  const handleFilterChange = (newParams: Partial<FilterParams>) => {
+    setFilterParams((current) => ({
+      ...current,
+      ...newParams,
+    }));
+  };
+
+  return {
+    videos,
+    isPending,
+    isError,
+    filterParams,
+    handleFilterChange,
+    setVideoLimit,
+  };
+};
diff --git a/frontend/app/hooks/useAdmin.ts b/frontend/app/hooks/useAdmin.ts
new file mode 100644
index 00000000..7de4de6e
--- /dev/null
+++ b/frontend/app/hooks/useAdmin.ts
@@ -0,0 +1,35 @@
+import { AxiosInstance } from "axios";
+import { ApiResponse } from "./useAxios";
+import { useQuery } from "@tanstack/react-query";
+
+export interface GanymedeInformation {
+  commit_hash: string;
+  build_time: string;
+  uptime: string;
+  program_versions: GanymedeProgramVersions;
+}
+
+export interface GanymedeProgramVersions {
+  ffmpeg: string;
+  twitch_downloader: string;
+  chat_downloader: string;
+  streamlink: string;
+}
+
+const getGanymedeInformation = async (
+  axiosPrivate: AxiosInstance
+): Promise<GanymedeInformation> => {
+  const response = await axiosPrivate.get<ApiResponse<GanymedeInformation>>(
+    "/api/v1/admin/info"
+  );
+  return response.data.data;
+};
+
+const useGetGanymedeInformation = (axiosPrivate: AxiosInstance) => {
+  return useQuery({
+    queryKey: ["ganymede-information"],
+    queryFn: () => getGanymedeInformation(axiosPrivate),
+  });
+};
+
+export { useGetGanymedeInformation };
diff --git a/frontend/app/hooks/useArchive.ts b/frontend/app/hooks/useArchive.ts
new file mode 100644
index 00000000..f5380000
--- /dev/null
+++ b/frontend/app/hooks/useArchive.ts
@@ -0,0 +1,93 @@
+import { AxiosInstance } from "axios";
+import { ApiResponse } from "./useAxios";
+import { NullResponse } from "./usePlayback";
+import { useMutation, useQueryClient } from "@tanstack/react-query";
+
+export interface ArchiveVideoInput {
+  axiosPrivate: AxiosInstance;
+  video_id: string;
+  channel_id: string;
+  quality: VideoQuality;
+  archive_chat: boolean;
+  render_chat: boolean;
+}
+
+export enum VideoQuality {
+  Best = "best",
+  quality720p60 = "720p60",
+  quality480p = "480p30",
+  quality360p = "360p30",
+  quality160p = "160p30",
+  audio = "audio",
+}
+
+const archiveVideo = async (
+  axiosPrivate: AxiosInstance,
+  video_id: string,
+  channel_id: string,
+  quality: VideoQuality,
+  archive_chat: boolean,
+  render_chat: boolean
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/archive/video`, {
+    video_id,
+    channel_id,
+    quality,
+    archive_chat,
+    render_chat,
+  });
+  return response.data.data;
+};
+
+const useArchiveVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<ApiResponse<NullResponse>, Error, ArchiveVideoInput>({
+    mutationFn: ({
+      axiosPrivate,
+      video_id,
+      channel_id,
+      quality,
+      archive_chat,
+      render_chat,
+    }) =>
+      archiveVideo(
+        axiosPrivate,
+        video_id,
+        channel_id,
+        quality,
+        archive_chat,
+        render_chat
+      ),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["queue"] });
+    },
+  });
+};
+
+export interface ArchiveChannelInput {
+  axiosPrivate: AxiosInstance;
+  channel_name: string;
+}
+
+const archiveChannel = async (
+  axiosPrivate: AxiosInstance,
+  channel_name: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/archive/channel`, {
+    channel_name,
+  });
+  return response.data.data;
+};
+
+const useArchiveChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<ApiResponse<NullResponse>, Error, ArchiveChannelInput>({
+    mutationFn: ({ axiosPrivate, channel_name }) =>
+      archiveChannel(axiosPrivate, channel_name),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["channels"] });
+    },
+  });
+};
+
+export { useArchiveVideo, useArchiveChannel };
diff --git a/frontend/app/hooks/useAuthentication.ts b/frontend/app/hooks/useAuthentication.ts
new file mode 100644
index 00000000..4b3e51ec
--- /dev/null
+++ b/frontend/app/hooks/useAuthentication.ts
@@ -0,0 +1,167 @@
+import useAxios, { ApiResponse } from "./useAxios";
+import { notifications } from "@mantine/notifications";
+import { AxiosError } from "axios";
+import classes from "@/app/components/notifications/Notifications.module.css";
+
+export interface User {
+  id: string;
+  username: string;
+  oauth: boolean;
+  role: UserRole;
+  updated_at: Date;
+  created_at: Date;
+}
+
+export enum UserRole {
+  Admin = "admin",
+  Editor = "editor",
+  Archiver = "archiver",
+  User = "user",
+}
+
+type MeResponse = ApiResponse<User>;
+
+// authLogin performs a HTTP request to the login route
+const authLogin = async (username: string, password: string) => {
+  try {
+    await useAxios.post(
+      "/api/v1/auth/login",
+      {
+        username,
+        password,
+      },
+      {
+        withCredentials: true,
+      }
+    );
+  } catch (error) {
+    if (error instanceof AxiosError) {
+      console.error("error logging in", error);
+
+      notifications.show({
+        color: "red",
+        title: error.response?.statusText || "Error",
+        message:
+          error.response?.data?.message || "An unexpected error occurred",
+        classNames: classes,
+      });
+
+      throw new Error("Error logging in");
+    }
+  }
+};
+
+// authRegister performs a HTTP request to the register route
+const authRegister = async (username: string, password: string) => {
+  try {
+    await useAxios.post(
+      "/api/v1/auth/register",
+      {
+        username,
+        password,
+      },
+      {
+        withCredentials: true,
+      }
+    );
+  } catch (error) {
+    if (error instanceof AxiosError) {
+      console.error("error registering in", error);
+
+      notifications.show({
+        color: "red",
+        title: error.response?.statusText || "Error",
+        message:
+          error.response?.data?.message || "An unexpected error occurred",
+        classNames: classes,
+      });
+
+      throw new Error("Error registering in");
+    }
+  }
+};
+
+// authLogout performs a HTTP request to the logout route
+const authLogout = async () => {
+  try {
+    await useAxios.post(
+      "/api/v1/auth/logout",
+      {},
+      {
+        withCredentials: true,
+      }
+    );
+  } catch (error) {
+    if (error instanceof AxiosError) {
+      console.error("error logging out", error);
+
+      notifications.show({
+        color: "red",
+        title: error.response?.statusText || "Error",
+        message:
+          error.response?.data?.message || "An unexpected error occurred",
+        classNames: classes,
+      });
+
+      throw new Error("Error logging out");
+    }
+  }
+};
+
+// authChangePassword performs a HTTP request to the change password route
+const authChangePassword = async (
+  oldPassword: string,
+  newPassword: string,
+  confirmNewPassword: string
+) => {
+  try {
+    await useAxios.post(
+      "/api/v1/auth/change-password",
+      {
+        old_password: oldPassword,
+        new_password: newPassword,
+        confirm_new_password: confirmNewPassword,
+      },
+      {
+        withCredentials: true,
+      }
+    );
+  } catch (error) {
+    if (error instanceof AxiosError) {
+      console.error("error changin password", error);
+
+      notifications.show({
+        color: "red",
+        title: error.response?.statusText || "Error",
+        message:
+          error.response?.data?.message || "An unexpected error occurred",
+        classNames: classes,
+      });
+    }
+  }
+};
+
+// getUserInfo performs a HTTP request getting the logged in user's information
+const getUserInfo = async (): Promise<MeResponse> => {
+  try {
+    const response = await useAxios.get("/api/v1/auth/me", {
+      withCredentials: true,
+    });
+    return response.data;
+  } catch (error) {
+    // Handle all types of errors
+    if (error instanceof AxiosError) {
+      throw new Error(`Error getting user information: ${error.message}`, {
+        cause: error,
+      });
+    }
+    // Handle other types of errors
+    throw new Error(
+      `Unknown error occurred: ${
+        error instanceof Error ? error.message : String(error)
+      }`
+    );
+  }
+};
+
+export { authLogin, getUserInfo, authLogout, authRegister, authChangePassword };
diff --git a/frontend/app/hooks/useAxios.ts b/frontend/app/hooks/useAxios.ts
new file mode 100644
index 00000000..52176db4
--- /dev/null
+++ b/frontend/app/hooks/useAxios.ts
@@ -0,0 +1,75 @@
+import axios from "axios";
+import { env } from "next-runtime-env";
+import { useRouter } from "next/navigation";
+import useAuthStore from "../store/useAuthStore";
+import { showNotification } from "@mantine/notifications";
+
+export interface ApiResponse<T> {
+  success: boolean;
+  data: T;
+  message: string;
+}
+
+const useAxios = axios.create({
+  baseURL: env("NEXT_PUBLIC_CDN_URL"),
+  headers: {
+    "Content-Type": "application/json",
+  },
+});
+
+export const useAxiosPrivate = () => {
+  const router = useRouter();
+  const { logout } = useAuthStore();
+
+  const axiosPrivate = axios.create({
+    baseURL: env("NEXT_PUBLIC_API_URL"),
+    headers: {
+      "Content-Type": "application/json",
+    },
+    withCredentials: true, // Send cookies with requests
+  });
+
+  axiosPrivate.interceptors.response.use(
+    function (response) {
+      return response;
+    },
+    async (err) => {
+      const prevRequest = err?.config;
+      console.log(err);
+      if (err.response.status === 401 && !prevRequest?.sent) {
+        console.debug("401 detected in private request");
+        // clear auth store
+        logout();
+
+        router.push("/login");
+        prevRequest.sent = true;
+        // try {
+        //   if (useUserStore.getState().oauth == true) {
+        //     await refreshOAuthAccessToken();
+        //   } else {
+        //     await refreshAccessToken();
+        //   }
+
+        //   console.debug("New access token received - retrying request");
+        //   prevRequest.headers["Content-Type"] = "application/json";
+        //   delete prevRequest.headers;
+        //   return axiosInstance.request(prevRequest);
+        // } catch (err) {
+        //   console.error(
+        //     "Failed to refresh access token - redirecting to login"
+        //   );
+        // }
+      }
+      showNotification({
+        color: "red",
+        title: "Request error",
+        message: err.response.data.message,
+      });
+      return Promise.reject(err);
+    }
+  );
+
+  return axiosPrivate;
+};
+
+export default useAxios;
diff --git a/frontend/app/hooks/useBlockedVideos.ts b/frontend/app/hooks/useBlockedVideos.ts
new file mode 100644
index 00000000..2864ae16
--- /dev/null
+++ b/frontend/app/hooks/useBlockedVideos.ts
@@ -0,0 +1,70 @@
+import { AxiosInstance } from "axios";
+import { NullResponse } from "./usePlayback";
+import { useMutation, useQuery, useQueryClient } from "@tanstack/react-query";
+
+export interface BlockedVideo {
+  id: string;
+  created_at: Date;
+}
+
+const blockVideo = async (
+  axiosPrivate: AxiosInstance,
+  id: string
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.post(`/api/v1/blocked-video/${id}`);
+  return response.data.data;
+};
+
+interface BlockVideoVariables {
+  axiosPrivate: AxiosInstance;
+  id: string;
+}
+
+const useBlockVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, BlockVideoVariables>({
+    mutationFn: ({ axiosPrivate, id }) => blockVideo(axiosPrivate, id),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["blocked_videos"] });
+    },
+  });
+};
+
+const getBlockedVideos = async (
+  axiosPrivate: AxiosInstance
+): Promise<Array<BlockedVideo>> => {
+  const response = await axiosPrivate.get(`/api/v1/blocked-video`);
+  return response.data.data;
+};
+
+const useGetBlockedVideos = (axiosPrivate: AxiosInstance) => {
+  return useQuery({
+    queryKey: ["blocked_videos"],
+    queryFn: () => getBlockedVideos(axiosPrivate),
+  });
+};
+
+const unblockVideo = async (axiosPrivate: AxiosInstance, videoId: string) => {
+  const response = await axiosPrivate.delete(
+    `/api/v1/blocked-video/${videoId}`
+  );
+  return response.data.data;
+};
+
+interface UnblockedVideoVariables {
+  axiosPrivate: AxiosInstance;
+  videoId: string;
+}
+
+const useUnblockVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, UnblockedVideoVariables>({
+    mutationFn: ({ axiosPrivate, videoId }) =>
+      unblockVideo(axiosPrivate, videoId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["blocked_videos"] });
+    },
+  });
+};
+
+export { useBlockVideo, useGetBlockedVideos, useUnblockVideo };
diff --git a/frontend/app/hooks/useCategory.ts b/frontend/app/hooks/useCategory.ts
new file mode 100644
index 00000000..690e517f
--- /dev/null
+++ b/frontend/app/hooks/useCategory.ts
@@ -0,0 +1,21 @@
+import { useQuery } from "@tanstack/react-query";
+import useAxios from "./useAxios";
+
+export interface Category {
+  id: string;
+  name: string;
+}
+
+const getTwitchCategories = async (): Promise<Array<Category>> => {
+  const response = await useAxios.get(`/api/v1/category`);
+  return response.data.data;
+};
+
+const useGetTwitchCategories = () => {
+  return useQuery({
+    queryKey: ["twitch_categories"],
+    queryFn: () => getTwitchCategories(),
+  });
+};
+
+export { useGetTwitchCategories, getTwitchCategories };
diff --git a/frontend/app/hooks/useChannels.ts b/frontend/app/hooks/useChannels.ts
new file mode 100644
index 00000000..7b1e8f61
--- /dev/null
+++ b/frontend/app/hooks/useChannels.ts
@@ -0,0 +1,163 @@
+import { useMutation, useQuery, useQueryClient } from "@tanstack/react-query";
+import useAxios, { ApiResponse } from "./useAxios";
+import { AxiosInstance } from "axios";
+
+export interface Channel {
+  id: string;
+  ext_id: string;
+  name: string;
+  display_name: string;
+  image_path: string;
+  retention: boolean;
+  retention_days: number;
+  updated_at: Date;
+  created_at: Date;
+}
+
+const fetchChannels = async (): Promise<Array<Channel>> => {
+  const response = await useAxios.get<ApiResponse<Array<Channel>>>(
+    "/api/v1/channel"
+  );
+  return response.data.data;
+};
+
+const fetchChannelByName = async (name: string): Promise<Channel> => {
+  const response = await useAxios.get<ApiResponse<Channel>>(
+    `/api/v1/channel/name/${name}`
+  );
+  return response.data.data;
+};
+
+const useFetchChannels = () => {
+  return useQuery({
+    queryKey: ["channels"],
+    queryFn: () => fetchChannels(),
+  });
+};
+
+const useFetchChannelByName = (name: string) => {
+  return useQuery({
+    queryKey: ["channel", name],
+    queryFn: () => fetchChannelByName(name),
+  });
+};
+
+const createChannel = async (
+  axiosPrivate: AxiosInstance,
+  channel: Channel
+): Promise<Channel> => {
+  const response = await axiosPrivate.post(`/api/v1/channel`, {
+    ext_id: channel.ext_id,
+    name: channel.name,
+    display_name: channel.display_name,
+    image_path: channel.image_path,
+    retention: channel.retention,
+    retention_days: channel.retention_days,
+  });
+  return response.data.data;
+};
+
+interface CreateChannelVariables {
+  axiosPrivate: AxiosInstance;
+  channel: Channel;
+}
+
+const useCreateChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Channel, Error, CreateChannelVariables>({
+    mutationFn: ({ axiosPrivate, channel }) =>
+      createChannel(axiosPrivate, channel),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["channels"] });
+    },
+  });
+};
+
+const editChannel = async (
+  axiosPrivate: AxiosInstance,
+  channelId: string,
+  channel: Channel
+): Promise<Channel> => {
+  const response = await axiosPrivate.put(`/api/v1/channel/${channelId}`, {
+    name: channel.name,
+    display_name: channel.display_name,
+    image_path: channel.image_path,
+    retention: channel.retention,
+    retention_days: channel.retention_days,
+  });
+  return response.data.data;
+};
+
+interface EditChannelVariables {
+  axiosPrivate: AxiosInstance;
+  channelId: string;
+  channel: Channel;
+}
+
+const useEditChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Channel, Error, EditChannelVariables>({
+    mutationFn: ({ axiosPrivate, channelId, channel }) =>
+      editChannel(axiosPrivate, channelId, channel),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["channels"] });
+    },
+  });
+};
+
+const updatedChannelImage = async (
+  axiosPrivate: AxiosInstance,
+  channelId: string
+): Promise<Channel> => {
+  const response = await axiosPrivate.post(
+    `/api/v1/channel/${channelId}/update-image`
+  );
+  return response.data.data;
+};
+
+interface UpdateChannelImageVariables {
+  axiosPrivate: AxiosInstance;
+  channelId: string;
+}
+
+const useUpdateChannelImage = () => {
+  return useMutation<Channel, Error, UpdateChannelImageVariables>({
+    mutationFn: ({ axiosPrivate, channelId }) =>
+      updatedChannelImage(axiosPrivate, channelId),
+  });
+};
+
+const deleteChannel = async (
+  axiosPrivate: AxiosInstance,
+  channelId: string
+) => {
+  const response = await axiosPrivate.delete(`/api/v1/channel/${channelId}`);
+  return response.data;
+};
+
+interface DeleteChannelVariables {
+  axiosPrivate: AxiosInstance;
+  channelId: string;
+}
+
+const useDeleteChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Channel, Error, DeleteChannelVariables>({
+    mutationFn: ({ axiosPrivate, channelId }) =>
+      deleteChannel(axiosPrivate, channelId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["channels"] });
+    },
+  });
+};
+
+export {
+  useFetchChannels,
+  fetchChannels,
+  fetchChannelByName,
+  useFetchChannelByName,
+  useCreateChannel,
+  useEditChannel,
+  useUpdateChannelImage,
+  useDeleteChannel,
+};
diff --git a/frontend/app/hooks/useChat.ts b/frontend/app/hooks/useChat.ts
new file mode 100644
index 00000000..bb17c2dd
--- /dev/null
+++ b/frontend/app/hooks/useChat.ts
@@ -0,0 +1,209 @@
+import { useQuery } from "@tanstack/react-query";
+import useAxios from "./useAxios";
+
+export interface Emote {
+  id: string;
+  name: string;
+  url: string;
+  type: string;
+  source: string;
+  width: number;
+  height: number;
+}
+
+export interface Badge {
+  version: string;
+  name: string;
+  image_url: string;
+  image_url_1x: string;
+  image_url_2x: string;
+  image_url_4x: string;
+  description: string;
+  title: string;
+  click_action: string;
+  click_url: string;
+}
+
+export interface Comment {
+  _id: string;
+  created_at: string;
+  updated_at: string;
+  channel_id: string;
+  content_type: string;
+  content_id: string;
+  content_offset_seconds: number;
+  commenter: Commenter;
+  source: string;
+  state: string;
+  message: Message;
+  more_replies: boolean;
+  // format complex object into simpler ones for rendering
+  ganymede_formatted_badges: GanymedeFormattedBadge[];
+  ganymede_formatted_message: GanymedeFormattedMessageFragment[];
+}
+
+export interface GanymedeFormattedBadge {
+  _id: string;
+  version: string;
+  title: string;
+  url: string;
+}
+
+export interface GanymedeFormattedMessageFragment {
+  type: GanymedeFormattedMessageType;
+  text?: string;
+  url?: string;
+  emote?: GanymedeFormattedEmote;
+}
+
+export enum GanymedeFormattedMessageType {
+  Text = "text",
+  Emote = "emote",
+}
+
+export interface GanymedeFormattedEmote {
+  id: string;
+  name: string;
+  url: string;
+  type: string;
+  width: number;
+  height: number;
+}
+
+export interface Commenter {
+  display_name: string;
+  _id: string;
+  name: string;
+  type: string;
+  bio: string;
+  created_at: string;
+  updated_at: string;
+  logo: string;
+}
+
+export interface Message {
+  body: string;
+  bits_spent: string;
+  fragments: Fragment[];
+  is_action: boolean;
+  user_badges: UserBadge[];
+  user_color: string;
+  user_notice_params: UserNoticeParams;
+  Emoticons: EmoticonElement[];
+}
+
+export interface Fragment {
+  text: string;
+  emoticon: FragmentEmoticon;
+}
+
+export interface FragmentEmoticon {
+  emoticon_id: string;
+  emoticon_set_id: string;
+}
+
+export interface UserBadge {
+  _id: string;
+  version: string;
+}
+
+export interface UserNoticeParams {
+  msg_id: string;
+}
+
+export interface EmoticonElement {
+  _id: string;
+  begin: number;
+  end: number;
+}
+
+const getEmotesForVideo = async (videoId: string): Promise<Array<Emote>> => {
+  const response = await useAxios.get(`/api/v1/vod/${videoId}/chat/emotes`);
+  return response.data.data;
+};
+
+const useGetEmotesForVideo = (videoId: string) => {
+  return useQuery<Array<Emote>>({
+    queryKey: ["video", "emotes", videoId],
+    queryFn: () => getEmotesForVideo(videoId),
+    refetchOnMount: false,
+    refetchOnReconnect: false,
+    refetchOnWindowFocus: false,
+  });
+};
+
+const getChatForVideo = async (
+  videoId: string,
+  start: number,
+  end: number
+): Promise<Array<Comment>> => {
+  const response = await useAxios.get(`/api/v1/vod/${videoId}/chat`, {
+    params: {
+      start,
+      end,
+    },
+  });
+  return response.data.data;
+};
+
+const useGetChatForVideo = (videoId: string, start: number, end: number) => {
+  return useQuery<Array<Comment>>({
+    queryKey: ["video", "chat", videoId, start, end],
+    queryFn: () => getChatForVideo(videoId, start, end),
+    refetchOnMount: false,
+    refetchOnReconnect: false,
+    refetchOnWindowFocus: false,
+  });
+};
+
+const getSeekChatForVideo = async (
+  videoId: string,
+  start: number,
+  count: number
+): Promise<Array<Comment>> => {
+  const response = await useAxios.get(`/api/v1/vod/${videoId}/chat/seek`, {
+    params: {
+      start,
+      count,
+    },
+  });
+  return response.data.data;
+};
+
+const useGetSeekChatForVideo = (
+  videoId: string,
+  start: number,
+  count: number
+) => {
+  return useQuery<Array<Comment>>({
+    queryKey: ["video", "chat", "seek", videoId, start, count],
+    queryFn: () => getSeekChatForVideo(videoId, start, count),
+    refetchOnMount: false,
+    refetchOnReconnect: false,
+    refetchOnWindowFocus: false,
+  });
+};
+
+const getBadgesForVideo = async (videoId: string): Promise<Array<Badge>> => {
+  const response = await useAxios.get(`/api/v1/vod/${videoId}/chat/badges`);
+  return response.data.data;
+};
+
+const useGetBadgesForVideo = (videoId: string) => {
+  return useQuery<Array<Badge>>({
+    queryKey: ["video", "badges", videoId],
+    queryFn: () => getBadgesForVideo(videoId),
+    refetchOnMount: false,
+    refetchOnReconnect: false,
+    refetchOnWindowFocus: false,
+  });
+};
+
+export {
+  useGetEmotesForVideo,
+  useGetBadgesForVideo,
+  useGetChatForVideo,
+  useGetSeekChatForVideo,
+  getChatForVideo,
+  getSeekChatForVideo,
+};
diff --git a/frontend/app/hooks/useConfig.ts b/frontend/app/hooks/useConfig.ts
new file mode 100644
index 00000000..66fcbd10
--- /dev/null
+++ b/frontend/app/hooks/useConfig.ts
@@ -0,0 +1,126 @@
+import { useMutation, useQuery, useQueryClient } from "@tanstack/react-query";
+import { ApiResponse } from "./useAxios";
+import { AxiosInstance } from "axios";
+import { User } from "./useAuthentication";
+import { NullResponse } from "./usePlayback";
+
+export interface Config {
+  registration_enabled: boolean;
+  parameters: {
+    twitch_token: string;
+    video_convert: string;
+    chat_render: string;
+    streamlink_live: string;
+  };
+  archive: {
+    save_as_hls: boolean;
+  };
+  notifications: Notification;
+  storage_templates: StorageTemplate;
+  livestream: {
+    proxies: ProxyListItem[];
+    proxy_enabled: boolean;
+    proxy_whitelist: string[];
+  };
+}
+
+export interface Notification {
+  video_success_webhook_url: string;
+  video_success_template: string;
+  video_success_enabled: boolean;
+  live_success_webhook_url: string;
+  live_success_template: string;
+  live_success_enabled: boolean;
+  error_webhook_url: string;
+  error_template: string;
+  error_enabled: boolean;
+  is_live_webhook_url: string;
+  is_live_template: string;
+  is_live_enabled: boolean;
+}
+
+export interface StorageTemplate {
+  folder_template: string;
+  file_template: string;
+}
+
+export interface ProxyListItem {
+  url: string;
+  header: string;
+}
+
+const getConfig = async (axiosPrivate: AxiosInstance): Promise<Config> => {
+  const response = await axiosPrivate.get<ApiResponse<Config>>(
+    "/api/v1/config"
+  );
+  return response.data.data;
+};
+
+const useGetConfig = (axiosPrivate: AxiosInstance) => {
+  return useQuery({
+    queryKey: ["admin_config"],
+    queryFn: () => getConfig(axiosPrivate),
+  });
+};
+
+const editConfig = async (
+  axiosPrivate: AxiosInstance,
+  config: Config
+): Promise<User> => {
+  const response = await axiosPrivate.put(`/api/v1/config`, {
+    ...config,
+  });
+  return response.data.data;
+};
+
+interface EditConfigVariables {
+  axiosPrivate: AxiosInstance;
+  config: Config;
+}
+
+const useEditConfig = () => {
+  const queryClient = useQueryClient();
+  return useMutation<User, Error, EditConfigVariables>({
+    mutationFn: ({ axiosPrivate, config }) => editConfig(axiosPrivate, config),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["admin_config"] });
+    },
+  });
+};
+
+export enum NotificationType {
+  VideoSuccess = "video_success",
+  LiveSuccess = "live_success",
+  Error = "error",
+  IsLive = "is_live",
+}
+
+const testNotification = async (
+  axiosPrivate: AxiosInstance,
+  type: NotificationType
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.post(
+    `/api/v1/notification/test`,
+    {},
+    {
+      params: {
+        type: type,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+interface TestNotificationVariables {
+  axiosPrivate: AxiosInstance;
+  type: NotificationType;
+}
+
+const useTestNotification = () => {
+  return useMutation<NullResponse, Error, TestNotificationVariables>({
+    mutationFn: ({ axiosPrivate, type }) =>
+      testNotification(axiosPrivate, type),
+  });
+};
+
+export { useEditConfig, useGetConfig, useTestNotification };
diff --git a/frontend/app/hooks/usePlayback.ts b/frontend/app/hooks/usePlayback.ts
new file mode 100644
index 00000000..e9516065
--- /dev/null
+++ b/frontend/app/hooks/usePlayback.ts
@@ -0,0 +1,241 @@
+import {
+  useMutation,
+  UseMutationOptions,
+  useQuery,
+  useQueryClient,
+  UseQueryOptions,
+} from "@tanstack/react-query";
+import { ApiResponse } from "@/app/hooks/useAxios";
+import { AxiosInstance } from "axios";
+import { Video } from "./useVideos";
+
+export interface Playback {
+  id: string;
+  vod_id: string;
+  user_id: string;
+  time: number;
+  status: PlaybackStatus;
+  updated_at: Date;
+  created_at: Date;
+}
+
+export interface NullResponse {
+  null: null;
+}
+
+export enum PlaybackStatus {
+  InProgress = "in_progress",
+  Finished = "finished",
+}
+
+export interface LastPlaybackResponse {
+  playback: Playback[];
+  data: LastPlayback[];
+}
+
+interface LastPlayback {
+  playback: Playback;
+  vod: Video;
+}
+
+const fetchPlaybackForVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string
+): Promise<Playback> => {
+  const response = await axiosPrivate.get<ApiResponse<Playback>>(
+    `/api/v1/playback/${videoId}`
+  );
+  return response.data.data;
+};
+
+const useFetchPlaybackForVideo = (
+  axiosPrivate: AxiosInstance,
+  videoId: string,
+  options?: Omit<
+    UseQueryOptions<Playback, Error, Playback, [string, string]>,
+    "queryKey" | "queryFn"
+  >
+) => {
+  return useQuery<Playback, Error, Playback, [string, string]>({
+    queryKey: ["playback-data", videoId],
+    queryFn: () => fetchPlaybackForVideo(axiosPrivate, videoId),
+    ...options,
+  });
+};
+
+const startPlaybackForVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(
+    `/api/v1/playback/start?video_id=${videoId}`
+  );
+  return response.data.data;
+};
+
+const useStartPlaybackForVideo = (
+  axiosPrivate: AxiosInstance,
+  videoId: string,
+  options?: Omit<
+    UseMutationOptions<
+      ApiResponse<NullResponse>,
+      Error,
+      void,
+      [string, string]
+    >,
+    "queryKey" | "queryFn"
+  >
+) => {
+  return useMutation<ApiResponse<NullResponse>, Error, void, [string, string]>({
+    mutationFn: () => startPlaybackForVideo(axiosPrivate, videoId),
+    ...options,
+  });
+};
+
+type UpdatePlaybackProgressVariables = {
+  axiosPrivate: AxiosInstance;
+  videoId: string;
+  time: number;
+};
+
+// API function that takes individual parameters
+const updatePlaybackProgressForVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string,
+  time: number
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/playback/progress`, {
+    vod_id: videoId,
+    time,
+  });
+  return response.data.data;
+};
+
+// Custom hook that uses the mutation with proper typing
+const useUpdatePlaybackProgressForVideo = () => {
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    UpdatePlaybackProgressVariables
+  >({
+    mutationFn: ({ axiosPrivate, videoId, time }) =>
+      updatePlaybackProgressForVideo(axiosPrivate, videoId, time),
+  });
+};
+
+type SetPlaybackStatusForVideoVariables = {
+  axiosPrivate: AxiosInstance;
+  videoId: string;
+  status: PlaybackStatus;
+};
+
+// API function that takes individual parameters
+const setPlaybackProgressForVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string,
+  status: PlaybackStatus
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/playback/status`, {
+    vod_id: videoId,
+    status,
+  });
+  return response.data.data;
+};
+
+// Custom hook that uses the mutation with proper typing
+const useSetPlaybackProgressForVideo = () => {
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    SetPlaybackStatusForVideoVariables
+  >({
+    mutationFn: ({ axiosPrivate, videoId, status }) =>
+      setPlaybackProgressForVideo(axiosPrivate, videoId, status),
+  });
+};
+
+const getLastPlaybackVideos = async (
+  axiosPrivate: AxiosInstance,
+  count: number
+): Promise<LastPlaybackResponse> => {
+  const response = await axiosPrivate.get<ApiResponse<LastPlaybackResponse>>(
+    `/api/v1/playback/last`,
+    {
+      params: {
+        limit: count,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+const useGetLastPlaybackVideos = (
+  axiosPrivate: AxiosInstance,
+  count: number
+) => {
+  return useQuery({
+    queryKey: ["playback-videos", count],
+    queryFn: () => getLastPlaybackVideos(axiosPrivate, count),
+  });
+};
+
+const markVideoAsWatched = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/playback/status`, {
+    vod_id: videoId,
+    status: PlaybackStatus.Finished,
+  });
+  return response.data;
+};
+
+export interface MarkVideoAsWatchedInput {
+  axiosPrivate: AxiosInstance;
+  videoId: string;
+}
+
+export interface DeletePlaybackInput {
+  axiosPrivate: AxiosInstance;
+  videoId: string;
+}
+
+const useMarkVideoAsWatched = () => {
+  const queryClient = useQueryClient();
+  return useMutation<ApiResponse<NullResponse>, Error, MarkVideoAsWatchedInput>(
+    {
+      mutationFn: ({ axiosPrivate, videoId }) =>
+        markVideoAsWatched(axiosPrivate, videoId),
+      onSuccess: () => {
+        queryClient.invalidateQueries({ queryKey: ["playback-data"] });
+      },
+    }
+  );
+};
+
+const deletePlayback = async (axiosPrivate: AxiosInstance, videoId: string) => {
+  const response = await axiosPrivate.delete(`/api/v1/playback/${videoId}`);
+  return response.data;
+};
+
+const useDeletePlayback = () => {
+  const queryClient = useQueryClient();
+  return useMutation<ApiResponse<NullResponse>, Error, DeletePlaybackInput>({
+    mutationFn: ({ axiosPrivate, videoId }) =>
+      deletePlayback(axiosPrivate, videoId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["playback-data"] });
+    },
+  });
+};
+
+export {
+  useFetchPlaybackForVideo,
+  fetchPlaybackForVideo,
+  useStartPlaybackForVideo,
+  useUpdatePlaybackProgressForVideo,
+  useSetPlaybackProgressForVideo,
+  useGetLastPlaybackVideos,
+  useMarkVideoAsWatched,
+  useDeletePlayback,
+};
diff --git a/frontend/app/hooks/usePlaylist.ts b/frontend/app/hooks/usePlaylist.ts
new file mode 100644
index 00000000..24ca87c5
--- /dev/null
+++ b/frontend/app/hooks/usePlaylist.ts
@@ -0,0 +1,256 @@
+import {
+  keepPreviousData,
+  useMutation,
+  useQuery,
+  useQueryClient,
+} from "@tanstack/react-query";
+import useAxios, { ApiResponse } from "./useAxios";
+import { AxiosInstance } from "axios";
+import { NullResponse } from "./usePlayback";
+import { Video } from "./useVideos";
+
+export interface Playlist {
+  id: string;
+  name: string;
+  description: string;
+  thumbnail_path: string;
+  updated_at: string;
+  created_at: string;
+  edges: PlaylistEdges;
+}
+
+export interface PlaylistEdges {
+  vods: Array<Video>;
+  multistream_info: Array<PlaylistMultistreamInfo>;
+}
+
+export interface PlaylistMultistreamInfo {
+  id: string;
+  delay_ms: number;
+  edges: PlaylistMultistreamInfoEdges;
+}
+
+export interface PlaylistMultistreamInfoEdges {
+  vod: Video;
+}
+
+const getPlaylist = async (
+  id: string,
+  withMultistreamInfo: boolean
+): Promise<Playlist> => {
+  const response = await useAxios.get<ApiResponse<Playlist>>(
+    `/api/v1/playlist/${id}`,
+    {
+      params: {
+        with_multistream_info: withMultistreamInfo,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+const useGetPlaylist = (id: string, withMultistreamInfo: boolean) => {
+  return useQuery({
+    queryKey: ["playlist", id, withMultistreamInfo],
+    queryFn: () => getPlaylist(id, withMultistreamInfo),
+    placeholderData: keepPreviousData,
+  });
+};
+
+const getPlaylists = async (): Promise<Array<Playlist>> => {
+  const response = await useAxios.get<ApiResponse<Array<Playlist>>>(
+    `/api/v1/playlist`
+  );
+  return response.data.data;
+};
+
+const useGetPlaylists = () => {
+  return useQuery({
+    queryKey: ["playlists"],
+    queryFn: () => getPlaylists(),
+    placeholderData: keepPreviousData,
+  });
+};
+
+const createPlaylist = async (
+  axiosPrivate: AxiosInstance,
+  name: string,
+  description: string
+): Promise<Playlist> => {
+  const response = await axiosPrivate.post(`/api/v1/playlist`, {
+    name,
+    description,
+  });
+  return response.data.data;
+};
+
+interface CreatePlaylistVariables {
+  axiosPrivate: AxiosInstance;
+  name: string;
+  description: string;
+}
+
+const useCreatePlaylist = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Playlist, Error, CreatePlaylistVariables>({
+    mutationFn: ({ axiosPrivate, name, description }) =>
+      createPlaylist(axiosPrivate, name, description),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["playlists"] });
+    },
+  });
+};
+
+const editPlaylist = async (
+  axiosPrivate: AxiosInstance,
+  id: string,
+  name: string,
+  description: string
+): Promise<Playlist> => {
+  const response = await axiosPrivate.put(`/api/v1/playlist/${id}`, {
+    name,
+    description,
+  });
+  return response.data.data;
+};
+
+interface EditPlaylistVariables {
+  axiosPrivate: AxiosInstance;
+  id: string;
+  name: string;
+  description: string;
+}
+
+const useEditPlaylist = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Playlist, Error, EditPlaylistVariables>({
+    mutationFn: ({ axiosPrivate, id, name, description }) =>
+      editPlaylist(axiosPrivate, id, name, description),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["playlists"] });
+    },
+  });
+};
+
+const deletePlaylist = async (
+  axiosPrivate: AxiosInstance,
+  id: string
+): Promise<Playlist> => {
+  const response = await axiosPrivate.delete(`/api/v1/playlist/${id}`);
+  return response.data.data;
+};
+
+interface DeletePlaylistVariables {
+  axiosPrivate: AxiosInstance;
+  id: string;
+}
+
+const useDeletePlaylist = () => {
+  const queryClient = useQueryClient();
+  return useMutation<Playlist, Error, DeletePlaylistVariables>({
+    mutationFn: ({ axiosPrivate, id }) => deletePlaylist(axiosPrivate, id),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["playlists"] });
+    },
+  });
+};
+
+type AddVideoToPlaylistVariables = {
+  axiosPrivate: AxiosInstance;
+  playlistId: string;
+  videoId: string;
+};
+
+const addVideoToPlaylist = async (
+  axiosPrivate: AxiosInstance,
+  playlistId: string,
+  videoId: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/playlist/${playlistId}`, {
+    vod_id: videoId,
+  });
+  return response.data.data;
+};
+
+const useAddVideoToPlaylist = () => {
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    AddVideoToPlaylistVariables
+  >({
+    mutationFn: ({ axiosPrivate, playlistId, videoId }) =>
+      addVideoToPlaylist(axiosPrivate, playlistId, videoId),
+  });
+};
+
+type RemoveVideoFromPlaylist = {
+  axiosPrivate: AxiosInstance;
+  playlistId: string;
+  videoId: string;
+};
+
+const removeVideoFromPlaylist = async (
+  axiosPrivate: AxiosInstance,
+  playlistId: string,
+  videoId: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.delete(
+    `/api/v1/playlist/${playlistId}/vod`,
+    {
+      data: {
+        vod_id: videoId,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+const useRemoveVideoFromPlaylist = () => {
+  return useMutation<ApiResponse<NullResponse>, Error, RemoveVideoFromPlaylist>(
+    {
+      mutationFn: ({ axiosPrivate, playlistId, videoId }) =>
+        removeVideoFromPlaylist(axiosPrivate, playlistId, videoId),
+    }
+  );
+};
+
+const updateMultistreamVideoOffset = async (
+  axiosPrivate: AxiosInstance,
+  playlistId: string,
+  videoId: string,
+  delayMs: number
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.put(
+    `/api/v1/playlist/${playlistId}/multistream/delay`,
+    {
+      vod_id: videoId,
+      delay_ms: delayMs,
+    }
+  );
+  return response.data;
+};
+
+interface UpdateMultistreamVideoOffsetInput {
+  axiosPrivate: AxiosInstance;
+  playlistId: string;
+  videoId: string;
+  delayMs: number;
+}
+
+const useUpdateMultistreamVideoOffset = () => {
+  return useMutation<NullResponse, Error, UpdateMultistreamVideoOffsetInput>({
+    mutationFn: ({ axiosPrivate, playlistId, videoId, delayMs }) =>
+      updateMultistreamVideoOffset(axiosPrivate, playlistId, videoId, delayMs),
+  });
+};
+
+export {
+  useGetPlaylists,
+  useCreatePlaylist,
+  useEditPlaylist,
+  useDeletePlaylist,
+  useGetPlaylist,
+  useAddVideoToPlaylist,
+  useRemoveVideoFromPlaylist,
+  useUpdateMultistreamVideoOffset,
+};
diff --git a/frontend/app/hooks/useQueue.ts b/frontend/app/hooks/useQueue.ts
new file mode 100644
index 00000000..de2ba4dd
--- /dev/null
+++ b/frontend/app/hooks/useQueue.ts
@@ -0,0 +1,278 @@
+import { AxiosInstance } from "axios";
+import { ApiResponse } from "./useAxios";
+import {
+  useMutation,
+  useQuery,
+  useQueryClient,
+  UseQueryOptions,
+} from "@tanstack/react-query";
+import { NullResponse } from "./usePlayback";
+import { Video } from "./useVideos";
+
+export interface Queue {
+  id: string;
+  live_archive: boolean;
+  on_hold: boolean;
+  video_processing: boolean;
+  chat_processing: boolean;
+  processing: boolean;
+  task_vod_create_folder: QueueTaskStatus;
+  task_vod_download_thumbnail: QueueTaskStatus;
+  task_vod_save_info: QueueTaskStatus;
+  task_video_download: QueueTaskStatus;
+  task_video_convert: QueueTaskStatus;
+  task_video_move: QueueTaskStatus;
+  task_vprocessingideo_move: QueueTaskStatus;
+  task_chat_download: QueueTaskStatus;
+  task_chat_convert: QueueTaskStatus;
+  task_chat_render: QueueTaskStatus;
+  task_chat_move: QueueTaskStatus;
+  archive_chat: boolean;
+  render_chat: boolean;
+  updated_at: string;
+  created_at: string;
+  edges: QueueEdges;
+}
+
+export interface QueueEdges {
+  vod: Video;
+}
+
+export enum QueueTaskStatus {
+  Success = "success",
+  Running = "running",
+  Pending = "pending",
+  Failed = "failed",
+}
+
+export enum QueueTask {
+  TaskVodCreateFolder = "task_vod_create_folder",
+  TaskVodDownloadThumbnail = "task_vod_download_thumbnail",
+  TaskVodSaveInfo = "task_vod_save_info",
+  TaskVideoDownload = "task_video_download",
+  TaskVideoConvert = "task_video_convert",
+  TaskVideoMove = "task_video_move",
+  TaskChatDownload = "task_chat_download",
+  TaskChatConvert = "task_chat_convert",
+  TaskChatRender = "task_chat_render",
+  TaskChatMove = "task_chat_move",
+  TaskLiveChatDownload = "task_live_chat_download",
+  TaskLiveVideoDownload = "task_live_video_download",
+}
+
+export enum QueueLogType {
+  Video = "video",
+  VideoConvert = "video-convert",
+  Chat = "chat",
+  ChatRender = "chat-render",
+  ChatConvert = "chat-convert",
+}
+
+const getQueueItems = async (
+  axiosPrivate: AxiosInstance,
+  processingOnly: boolean
+): Promise<Array<Queue>> => {
+  const response = await axiosPrivate.get<ApiResponse<Array<Queue>>>(
+    `/api/v1/queue`,
+    {
+      params: {
+        processing: processingOnly,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+const useGetQueueItems = (
+  axiosPrivate: AxiosInstance,
+  processingOnly: boolean
+) => {
+  return useQuery({
+    queryKey: ["queue", processingOnly],
+    queryFn: () => getQueueItems(axiosPrivate, processingOnly),
+  });
+};
+
+const stopQueueItem = async (
+  axiosPrivate: AxiosInstance,
+  id: string
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.post(`/api/v1/queue/${id}/stop`);
+  return response.data.data;
+};
+
+interface StopQueueItemVariables {
+  axiosPrivate: AxiosInstance;
+  id: string;
+}
+
+const getQueueItem = async (
+  axiosPrivate: AxiosInstance,
+  id: string
+): Promise<Queue> => {
+  const response = await axiosPrivate.get<ApiResponse<Queue>>(
+    `/api/v1/queue/${id}`
+  );
+  return response.data.data;
+};
+
+type QueryFnType = typeof getQueueItem extends (
+  // eslint-disable-next-line @typescript-eslint/no-explicit-any
+  ...args: any[]
+) => Promise<infer T>
+  ? T
+  : never;
+
+type UseGetQueueItemOptions = Omit<
+  UseQueryOptions<QueryFnType, Error, QueryFnType, string[]>,
+  "queryKey" | "queryFn"
+>;
+
+const useGetQueueItem = (
+  axiosPrivate: AxiosInstance,
+  id: string,
+  options?: UseGetQueueItemOptions
+) => {
+  return useQuery({
+    queryKey: ["queue", id],
+    queryFn: () => getQueueItem(axiosPrivate, id),
+    ...options,
+  });
+};
+
+const useStopQueueItem = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, StopQueueItemVariables>({
+    mutationFn: ({ axiosPrivate, id }) => stopQueueItem(axiosPrivate, id),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["queue"] });
+    },
+  });
+};
+
+const startQueueTask = async (
+  axiosPrivate: AxiosInstance,
+  queueId: string,
+  taskName: QueueTask,
+  continueWithSubsequent: boolean
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.post(`/api/v1/queue/task/start`, {
+    queue_id: queueId,
+    task_name: taskName,
+    continue: continueWithSubsequent,
+  });
+  return response.data.data;
+};
+
+interface StartQueueTaskVariables {
+  axiosPrivate: AxiosInstance;
+  queueId: string;
+  taskName: QueueTask;
+  continueWithSubsequent: boolean;
+}
+
+const useStartQueueTask = () => {
+  return useMutation<NullResponse, Error, StartQueueTaskVariables>({
+    mutationFn: ({ axiosPrivate, queueId, taskName, continueWithSubsequent }) =>
+      startQueueTask(axiosPrivate, queueId, taskName, continueWithSubsequent),
+  });
+};
+
+const editQueue = async (
+  axiosPrivate: AxiosInstance,
+  queue: Queue
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.put(`/api/v1/queue/${queue.id}`, {
+    id: queue.id,
+    processing: queue.processing,
+    on_hold: queue.on_hold,
+    video_processing: queue.video_processing,
+    chat_processing: queue.chat_processing,
+    live_archive: queue.live_archive,
+    task_vod_create_folder: queue.task_vod_create_folder,
+    task_vod_download_thumbnail: queue.task_vod_download_thumbnail,
+    task_vod_save_info: queue.task_vod_save_info,
+    task_video_download: queue.task_video_download,
+    task_video_convert: queue.task_video_convert,
+    task_video_move: queue.task_video_move,
+    task_chat_download: queue.task_chat_download,
+    task_chat_convert: queue.task_chat_convert,
+    task_chat_render: queue.task_chat_render,
+    task_chat_move: queue.task_chat_move,
+  });
+  return response.data.data;
+};
+
+interface EditQueueVariables {
+  axiosPrivate: AxiosInstance;
+  queue: Queue;
+}
+
+const useEditQueue = () => {
+  const queryClient = useQueryClient();
+  return useMutation<ApiResponse<NullResponse>, Error, EditQueueVariables>({
+    mutationFn: ({ axiosPrivate, queue }) => editQueue(axiosPrivate, queue),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["queue"] });
+    },
+  });
+};
+
+const deleteQueue = async (axiosPrivate: AxiosInstance, queueId: string) => {
+  const response = await axiosPrivate.delete(`/api/v1/queue/${queueId}`);
+  return response.data;
+};
+
+interface DeleteQueueVariables {
+  axiosPrivate: AxiosInstance;
+  queueId: string;
+}
+
+const useDeleteQueue = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, DeleteQueueVariables>({
+    mutationFn: ({ axiosPrivate, queueId }) =>
+      deleteQueue(axiosPrivate, queueId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["queue"] });
+    },
+  });
+};
+
+const getQueueLogs = async (
+  axiosPrivate: AxiosInstance,
+  queueId: string,
+  type: QueueLogType
+): Promise<string> => {
+  const response = await axiosPrivate.get<ApiResponse<string>>(
+    `/api/v1/queue/${queueId}/tail`,
+    {
+      params: {
+        type: type,
+      },
+    }
+  );
+  return response.data.data;
+};
+
+const useGetQueueLogs = (
+  axiosPrivate: AxiosInstance,
+  queueId: string,
+  type: QueueLogType
+) => {
+  return useQuery({
+    queryKey: ["queue_logs", queueId, type],
+    queryFn: () => getQueueLogs(axiosPrivate, queueId, type),
+    refetchInterval: 1000,
+  });
+};
+
+export {
+  useGetQueueItems,
+  useStopQueueItem,
+  useGetQueueItem,
+  useStartQueueTask,
+  useEditQueue,
+  useDeleteQueue,
+  useGetQueueLogs,
+};
diff --git a/frontend/app/hooks/useTasks.ts b/frontend/app/hooks/useTasks.ts
new file mode 100644
index 00000000..5ca51938
--- /dev/null
+++ b/frontend/app/hooks/useTasks.ts
@@ -0,0 +1,37 @@
+import { useMutation } from "@tanstack/react-query";
+import { AxiosInstance } from "axios";
+
+export enum Task {
+  CheckLive = "check_live",
+  CheckVod = "check_vod",
+  CheckClips = "check_clips",
+  GetJWKS = "get_jwks",
+  StorageMigration = "storage_migration",
+  PruneVideo = "prune_videos",
+  SaveChapters = "save_chapters",
+  UpdateStreamVodIds = "update_stream_vod_ids",
+  GenerateSpriteThumbnails = "generate_sprite_thumbnails",
+}
+
+const startTask = async (
+  axiosPrivate: AxiosInstance,
+  task: Task
+): Promise<null> => {
+  await axiosPrivate.post(`/api/v1/task/start`, {
+    task: task,
+  });
+  return null;
+};
+
+type StartTaskVariables = {
+  axiosPrivate: AxiosInstance;
+  task: Task;
+};
+
+const useStartTask = () => {
+  return useMutation<null, Error, StartTaskVariables>({
+    mutationFn: ({ axiosPrivate, task }) => startTask(axiosPrivate, task),
+  });
+};
+
+export { useStartTask };
diff --git a/frontend/app/hooks/useUsers.ts b/frontend/app/hooks/useUsers.ts
new file mode 100644
index 00000000..da9894f5
--- /dev/null
+++ b/frontend/app/hooks/useUsers.ts
@@ -0,0 +1,84 @@
+import { useMutation, useQuery, useQueryClient } from "@tanstack/react-query";
+import { ApiResponse } from "./useAxios";
+import { AxiosInstance } from "axios";
+import { User } from "./useAuthentication";
+import { NullResponse } from "./usePlayback";
+
+const getUsers = async (axiosPrivate: AxiosInstance): Promise<Array<User>> => {
+  const response = await axiosPrivate.get<ApiResponse<Array<User>>>(
+    "/api/v1/user"
+  );
+  return response.data.data;
+};
+
+const getUserById = async (
+  axiosPrivate: AxiosInstance,
+  id: string
+): Promise<User> => {
+  const response = await axiosPrivate.get<ApiResponse<User>>(
+    `/api/v1/user/${id}`
+  );
+  return response.data.data;
+};
+
+const useGetUsers = (axiosPrivate: AxiosInstance) => {
+  return useQuery({
+    queryKey: ["users"],
+    queryFn: () => getUsers(axiosPrivate),
+  });
+};
+
+const useGetUserById = (axiosPrivate: AxiosInstance, id: string) => {
+  return useQuery({
+    queryKey: ["user", id],
+    queryFn: () => getUserById(axiosPrivate, id),
+  });
+};
+
+const editUser = async (
+  axiosPrivate: AxiosInstance,
+  user: User
+): Promise<User> => {
+  const response = await axiosPrivate.put(`/api/v1/user/${user.id}`, {
+    username: user.username,
+    role: user.role,
+  });
+  return response.data.data;
+};
+
+interface EditUserVariables {
+  axiosPrivate: AxiosInstance;
+  user: User;
+}
+
+const useEditUser = () => {
+  const queryClient = useQueryClient();
+  return useMutation<User, Error, EditUserVariables>({
+    mutationFn: ({ axiosPrivate, user }) => editUser(axiosPrivate, user),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["users"] });
+    },
+  });
+};
+
+const deleteUser = async (axiosPrivate: AxiosInstance, userId: string) => {
+  const response = await axiosPrivate.delete(`/api/v1/user/${userId}`);
+  return response.data;
+};
+
+interface DeleteUserVariables {
+  axiosPrivate: AxiosInstance;
+  userId: string;
+}
+
+const useDeleteUser = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, DeleteUserVariables>({
+    mutationFn: ({ axiosPrivate, userId }) => deleteUser(axiosPrivate, userId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["users"] });
+    },
+  });
+};
+
+export { useGetUserById, useGetUsers, useEditUser, useDeleteUser };
diff --git a/frontend/app/hooks/useVideos.ts b/frontend/app/hooks/useVideos.ts
new file mode 100644
index 00000000..cbe45c53
--- /dev/null
+++ b/frontend/app/hooks/useVideos.ts
@@ -0,0 +1,532 @@
+import {
+  keepPreviousData,
+  useMutation,
+  useQuery,
+  useQueryClient,
+} from "@tanstack/react-query";
+import useAxios, { ApiResponse } from "./useAxios";
+import { Channel } from "./useChannels";
+import { Playlist } from "./usePlaylist";
+import { AxiosInstance } from "axios";
+import { NullResponse } from "./usePlayback";
+
+export interface PaginationResponse<T> {
+  offset: number;
+  limit: number;
+  total_count: number;
+  pages: number;
+  data: T;
+}
+
+export interface Video {
+  id: string;
+  ext_id: string;
+  clip_ext_vod_id?: string;
+  platform: Platform;
+  type: VideoType;
+  title: string;
+  duration: number;
+  clip_vod_offset?: number;
+  views: number;
+  resolution: string;
+  thumbnail_path: string;
+  web_thumbnail_path: string;
+  video_path: string;
+  chat_path?: string;
+  live_chat_path?: string;
+  live_chat_convert_path?: string;
+  chat_video_path?: string;
+  info_path: string;
+  folder_name: string;
+  file_name: string;
+  tmp_video_download_path: string;
+  tmp_video_convert_path: string;
+  tmp_chat_download_path: string;
+  tmp_live_chat_download_path: string;
+  tmp_live_chat_convert_path: string;
+  tmp_chat_render_path: string;
+  processing: boolean;
+  streamed_at: Date;
+  updated_at: Date;
+  created_at: Date;
+  edges: VideoEdges;
+  local_views?: number;
+  locked: boolean;
+  caption_path: string;
+}
+
+export interface VideoEdges {
+  channel: Channel;
+  muted_segments?: MutedSegment[];
+  chapters?: Chapter[];
+}
+
+export enum Platform {
+  Twitch = "twitch",
+  Youtube = "youtube",
+}
+
+export enum VideoType {
+  Archive = "archive",
+  Clip = "clip",
+  Live = "live",
+  Highlight = "highlight",
+  Upload = "upload",
+}
+
+export interface MutedSegment {
+  id: string;
+  start: number;
+  end: number;
+}
+
+export interface Chapter {
+  id: string;
+  start: number;
+  end: number;
+  type?: string;
+  title?: string;
+}
+
+export interface CreateVodRequest {
+  id: string;
+  channel_id: string;
+  ext_id: string;
+  platform: Platform;
+  type: VideoType;
+  title: string;
+  duration: number;
+  views: number;
+  resolution?: string;
+  processing: boolean;
+  thumbnail_path?: string;
+  web_thumbnail_path: string;
+  video_path: string;
+  chat_path?: string;
+  chat_video_path?: string;
+  info_path?: string;
+  caption_path?: string;
+  streamed_at: string;
+  locked: boolean;
+}
+
+export interface ChatHistogramData {
+  [timestamp: string]: number;
+}
+
+type FetchVideoOptions = {
+  id: string;
+  with_channel: boolean;
+  with_muted_segments: boolean;
+  with_chapters: boolean;
+};
+
+const fetchVideo = async (
+  id: string,
+  withChannel: boolean,
+  withChapters: boolean,
+  withMutedSegments: boolean
+): Promise<Video> => {
+  const response = await useAxios.get<ApiResponse<Video>>(`/api/v1/vod/${id}`, {
+    params: {
+      with_channel: withChannel,
+      with_chapters: withChapters,
+      with_muted_segments: withMutedSegments,
+    },
+  });
+  return response.data.data;
+};
+
+type FetchVideosFilterOptions =
+  | {
+      channel_id: string;
+      playlist_id?: never;
+      types: Array<VideoType>;
+      limit: number;
+      offset: number;
+    }
+  | {
+      channel_id?: never;
+      playlist_id: string;
+      types: Array<VideoType>;
+      limit: number;
+      offset: number;
+    }
+  | {
+      limit: number;
+      offset: number;
+    };
+
+const fetchVideosFilter = async (
+  limit: number,
+  offset: number,
+  types?: Array<VideoType>,
+  channel_id?: string,
+  playlist_id?: string
+): Promise<PaginationResponse<Array<Video>>> => {
+  // eslint-disable-next-line @typescript-eslint/no-explicit-any
+  const queryParams: { [key: string]: any } = {};
+
+  // Add query parameters conditionally based on whether they are provided
+  if (channel_id) {
+    queryParams.channel_id = channel_id;
+  }
+  if (playlist_id) {
+    queryParams.playlist_id = playlist_id;
+  }
+  if (types && types.length > 0) {
+    queryParams.types = types.join(",");
+  }
+
+  const response = await useAxios.get<
+    ApiResponse<PaginationResponse<Array<Video>>>
+  >("/api/v1/vod/paginate", {
+    params: {
+      limit,
+      offset,
+      ...queryParams, // Spread the conditional query parameters
+    },
+  });
+
+  return response.data.data;
+};
+
+const useFetchVideosFilter = (params: FetchVideosFilterOptions) => {
+  // @ts-expect-error fine
+  const { limit, offset, types, channel_id, playlist_id } = params;
+
+  // eslint-disable-next-line @typescript-eslint/no-explicit-any
+  let queryKey: any[];
+  if (channel_id) {
+    queryKey = ["channel_videos", channel_id, limit, offset, types];
+  } else if (playlist_id) {
+    queryKey = ["playlist_videos", playlist_id, limit, offset, types];
+  } else {
+    queryKey = ["videos", limit, offset, types]; // Fetch videos without channel_id or playlist_id
+  }
+
+  return useQuery<PaginationResponse<Array<Video>>, Error>({
+    queryKey,
+    queryFn: () =>
+      fetchVideosFilter(limit, offset, types, channel_id, playlist_id),
+    placeholderData: keepPreviousData, // previous data is kept until the new data is swapped in. This prevents flashing when changing pages, filtering, etc.
+  });
+};
+
+const useFetchVideo = (params: FetchVideoOptions) => {
+  const { id, with_channel, with_chapters, with_muted_segments } = params;
+  return useQuery({
+    queryKey: ["video", id, with_channel, with_chapters, with_muted_segments],
+    queryFn: () =>
+      fetchVideo(id, with_channel, with_chapters, with_muted_segments),
+  });
+};
+
+const searchVideos = async (
+  limit: number,
+  offset: number,
+  query: string,
+  types?: Array<VideoType>
+): Promise<PaginationResponse<Array<Video>>> => {
+  const queryParams: { [key: string]: unknown } = {};
+  if (types && types.length > 0) {
+    queryParams.types = types.join(",");
+  }
+  const response = await useAxios.get<
+    ApiResponse<PaginationResponse<Array<Video>>>
+  >("/api/v1/vod/search", {
+    params: {
+      limit,
+      offset,
+      q: query,
+      ...queryParams,
+    },
+  });
+
+  return response.data.data;
+};
+
+interface SearchVideosOptions {
+  types: Array<VideoType>;
+  limit: number;
+  offset: number;
+  query: string;
+}
+
+const useSearchVideos = (params: SearchVideosOptions) => {
+  const { limit, offset, types, query } = params;
+  return useQuery<PaginationResponse<Array<Video>>, Error>({
+    queryKey: ["search", limit, offset, types, query],
+    queryFn: () => searchVideos(limit, offset, query, types),
+    placeholderData: keepPreviousData, // previous data is kept until the new data is swapped in. This prevents flashing when changing pages, filtering, etc.
+  });
+};
+
+const getPlaylistsForVideo = async (
+  video_id: string
+): Promise<Array<Playlist>> => {
+  const response = await useAxios.get<ApiResponse<Array<Playlist>>>(
+    `/api/v1/vod/${video_id}/playlist`
+  );
+  return response.data.data;
+};
+
+const useGetPlaylistsForVideo = (video_id: string) => {
+  return useQuery({
+    queryKey: ["video", "playlists", video_id],
+    queryFn: () => getPlaylistsForVideo(video_id),
+    placeholderData: keepPreviousData,
+  });
+};
+
+const deleteVideo = async (
+  axiosPrivate: AxiosInstance,
+  id: string,
+  deleteFiles: boolean
+): Promise<NullResponse> => {
+  const response = await axiosPrivate.delete(`/api/v1/vod/${id}`, {
+    params: {
+      delete_files: deleteFiles,
+    },
+  });
+  return response.data.data;
+};
+
+interface DeleteVideoVariables {
+  axiosPrivate: AxiosInstance;
+  id: string;
+  deleteFiles: boolean;
+}
+
+const useDeleteVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<NullResponse, Error, DeleteVideoVariables>({
+    mutationFn: ({ axiosPrivate, id, deleteFiles }) =>
+      deleteVideo(axiosPrivate, id, deleteFiles),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["videos"] });
+    },
+  });
+};
+
+const getVideosNoPaginate = async (): Promise<Array<Video>> => {
+  const response = await useAxios.get(`/api/v1/vod`);
+  return response.data.data;
+};
+
+const useGetVideosNoPaginate = () => {
+  return useQuery({
+    queryKey: ["videos"],
+    queryFn: () => getVideosNoPaginate(),
+  });
+};
+
+const createVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoData: CreateVodRequest
+): Promise<ApiResponse<Video>> => {
+  const response = await axiosPrivate.post("/api/v1/vod", videoData);
+  return response.data.data;
+};
+
+const editVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoData: CreateVodRequest,
+  videoId: string
+): Promise<ApiResponse<Video>> => {
+  const response = await axiosPrivate.put(`/api/v1/vod/${videoId}`, videoData);
+  return response.data.data;
+};
+
+const useCreateVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<Video>,
+    Error,
+    {
+      axiosPrivate: AxiosInstance;
+      videoData: CreateVodRequest;
+    }
+  >({
+    mutationFn: ({ axiosPrivate, videoData }) =>
+      createVideo(axiosPrivate, videoData),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["videos"] });
+    },
+  });
+};
+
+const useEditVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<Video>,
+    Error,
+    {
+      axiosPrivate: AxiosInstance;
+      videoData: CreateVodRequest;
+      videoId: string;
+    }
+  >({
+    mutationFn: ({ axiosPrivate, videoData, videoId }) =>
+      editVideo(axiosPrivate, videoData, videoId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["videos"] });
+    },
+  });
+};
+
+const lockVideo = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string,
+  locked: boolean
+) => {
+  const response = await axiosPrivate.post(
+    `/api/v1/vod/${videoId}/lock`,
+    {},
+    {
+      params: {
+        locked: locked,
+      },
+    }
+  );
+  return response.data;
+};
+
+const useLockVideo = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    {
+      axiosPrivate: AxiosInstance;
+      videoId: string;
+      locked: boolean;
+    }
+  >({
+    mutationFn: ({ axiosPrivate, videoId, locked }) =>
+      lockVideo(axiosPrivate, videoId, locked),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["video"] });
+    },
+  });
+};
+
+const generateStaticThumbnail = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string
+) => {
+  const response = await axiosPrivate.post(
+    `/api/v1/vod/${videoId}/generate-static-thumbnail`
+  );
+  return response.data;
+};
+
+const useGenerateStaticThumbnail = () => {
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    {
+      axiosPrivate: AxiosInstance;
+      videoId: string;
+    }
+  >({
+    mutationFn: ({ axiosPrivate, videoId }) =>
+      generateStaticThumbnail(axiosPrivate, videoId),
+  });
+};
+
+const generateSpriteThumbnails = async (
+  axiosPrivate: AxiosInstance,
+  videoId: string
+) => {
+  const response = await axiosPrivate.post(
+    `/api/v1/vod/${videoId}/generate-sprite-thumbnails`
+  );
+  return response.data;
+};
+
+const useGenerateSpriteThumbnails = () => {
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    {
+      axiosPrivate: AxiosInstance;
+      videoId: string;
+    }
+  >({
+    mutationFn: ({ axiosPrivate, videoId }) =>
+      generateSpriteThumbnails(axiosPrivate, videoId),
+  });
+};
+
+const getVideoByExternalId = async (extId: string): Promise<Video> => {
+  const response = await useAxios.get<ApiResponse<Video>>(
+    `/api/v1/vod/external_id/${extId}`
+  );
+  return response.data.data;
+};
+
+const useGetVideoByExternalId = (extId?: string) => {
+  return useQuery({
+    queryKey: ["video", extId],
+    queryFn: () => getVideoByExternalId(extId!),
+    enabled: !!extId,
+    refetchInterval: false,
+    refetchOnMount: false,
+    refetchIntervalInBackground: false,
+    retry: false,
+  });
+};
+
+const getVideoClips = async (id: string): Promise<Video[]> => {
+  const response = await useAxios.get<ApiResponse<Array<Video>>>(
+    `/api/v1/vod/${id}/clips`
+  );
+  return response.data.data;
+};
+
+const useGetVideoClips = (id: string) => {
+  return useQuery({
+    queryKey: ["video_clips", id],
+    queryFn: () => getVideoClips(id),
+  });
+};
+
+const getVideoChatHistogram = async (
+  id: string
+): Promise<ChatHistogramData> => {
+  const response = await useAxios.get<ApiResponse<ChatHistogramData>>(
+    `/api/v1/vod/${id}/chat/histogram`
+  );
+  return response.data.data;
+};
+
+const useGetVideoChatHistogram = (id: string) => {
+  return useQuery({
+    queryKey: ["video_chat_histogram", id],
+    queryFn: () => getVideoChatHistogram(id),
+    refetchInterval: false,
+    refetchOnMount: false,
+    refetchOnReconnect: false,
+    refetchIntervalInBackground: false,
+  });
+};
+
+export {
+  fetchVideosFilter,
+  useFetchVideosFilter,
+  fetchVideo,
+  useFetchVideo,
+  useGetPlaylistsForVideo,
+  useDeleteVideo,
+  useGetVideosNoPaginate,
+  useCreateVideo,
+  useEditVideo,
+  useLockVideo,
+  useGenerateStaticThumbnail,
+  useSearchVideos,
+  useGetVideoByExternalId,
+  useGetVideoClips,
+  useGenerateSpriteThumbnails,
+  useGetVideoChatHistogram,
+};
diff --git a/frontend/app/hooks/useWatchedChannels.ts b/frontend/app/hooks/useWatchedChannels.ts
new file mode 100644
index 00000000..3e8b0507
--- /dev/null
+++ b/frontend/app/hooks/useWatchedChannels.ts
@@ -0,0 +1,190 @@
+import { AxiosInstance } from "axios";
+import { Channel } from "./useChannels";
+import { useMutation, useQuery, useQueryClient } from "@tanstack/react-query";
+import { Category } from "./useCategory";
+import { ApiResponse } from "./useAxios";
+import { NullResponse } from "./usePlayback";
+
+export interface WatchedChannel {
+  id: string;
+  watch_live: boolean;
+  watch_vod: boolean;
+  download_archives: boolean;
+  download_highlights: boolean;
+  download_uploads: boolean;
+  download_sub_only: boolean;
+  is_live: boolean;
+  archive_chat: boolean;
+  resolution: string;
+  last_live: string;
+  render_chat: boolean;
+  max_age: number;
+  apply_categories_to_live: boolean;
+  watch_clips: boolean;
+  clips_limit: number;
+  clips_interval_days: number;
+  updated_at: string;
+  created_at: string;
+  edges: WatchedChannelEdges;
+}
+
+export interface WatchedChannelEdges {
+  channel: Channel;
+  categories: Category[];
+  title_regex: WatchedChannelTitleRegex[];
+}
+
+export interface WatchedChannelTitleRegex {
+  id: string;
+  negative: boolean;
+  regex: string;
+  apply_to_videos: boolean;
+}
+
+const getWatchedChannels = async (
+  axiosPrivate: AxiosInstance
+): Promise<Array<WatchedChannel>> => {
+  const response = await axiosPrivate.get(`/api/v1/live`);
+  return response.data.data;
+};
+
+const useGetWatchedChannesl = (axiosPrivate: AxiosInstance) => {
+  return useQuery({
+    queryKey: ["watched_channels"],
+    queryFn: () => getWatchedChannels(axiosPrivate),
+  });
+};
+
+const editWatchedChannel = async (
+  axiosPrivate: AxiosInstance,
+  watchedChannel: WatchedChannel,
+  categories: string[]
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.put(`/api/v1/live/${watchedChannel.id}`, {
+    resolution: watchedChannel.resolution,
+    archive_chat: watchedChannel.archive_chat,
+    watch_live: watchedChannel.watch_live,
+    watch_vod: watchedChannel.watch_vod,
+    download_archives: watchedChannel.download_archives,
+    download_highlights: watchedChannel.download_highlights,
+    download_uploads: watchedChannel.download_uploads,
+    render_chat: watchedChannel.render_chat,
+    download_sub_only: watchedChannel.download_sub_only,
+    categories: categories,
+    max_age: watchedChannel.max_age,
+    regex: watchedChannel.edges.title_regex,
+    apply_categories_to_live: watchedChannel.apply_categories_to_live,
+    watch_clips: watchedChannel.watch_clips,
+    clips_limit: watchedChannel.clips_limit,
+    clips_interval_days: watchedChannel.clips_interval_days,
+  });
+  return response.data.data;
+};
+
+const createWatchedChannel = async (
+  axiosPrivate: AxiosInstance,
+  channelId: string,
+  watchedChannel: WatchedChannel,
+  categories: string[]
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.post(`/api/v1/live`, {
+    channel_id: channelId,
+    resolution: watchedChannel.resolution,
+    archive_chat: watchedChannel.archive_chat,
+    watch_live: watchedChannel.watch_live,
+    watch_vod: watchedChannel.watch_vod,
+    download_archives: watchedChannel.download_archives,
+    download_highlights: watchedChannel.download_highlights,
+    download_uploads: watchedChannel.download_uploads,
+    render_chat: watchedChannel.render_chat,
+    download_sub_only: watchedChannel.download_sub_only,
+    categories: categories,
+    max_age: watchedChannel.max_age,
+    regex: watchedChannel.edges.title_regex,
+    apply_categories_to_live: watchedChannel.apply_categories_to_live,
+    watch_clips: watchedChannel.watch_clips,
+    clips_limit: watchedChannel.clips_limit,
+    clips_interval_days: watchedChannel.clips_interval_days,
+  });
+  return response.data.data;
+};
+
+interface EditWatchedChannelVariables {
+  axiosPrivate: AxiosInstance;
+  watchedChannel: WatchedChannel;
+  categories: string[];
+}
+
+const useEditWatchedChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    EditWatchedChannelVariables
+  >({
+    mutationFn: ({ axiosPrivate, watchedChannel, categories }) =>
+      editWatchedChannel(axiosPrivate, watchedChannel, categories),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["watched_channels"] });
+    },
+  });
+};
+
+const deleteWatchedChannel = async (
+  axiosPrivate: AxiosInstance,
+  watchedChannelId: string
+): Promise<ApiResponse<NullResponse>> => {
+  const response = await axiosPrivate.delete(
+    `/api/v1/live/${watchedChannelId}`
+  );
+  return response.data.data;
+};
+
+interface DeleteWatchedChannelVariables {
+  axiosPrivate: AxiosInstance;
+  watchedChannelId: string;
+}
+
+const useDeleteWatchedChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    DeleteWatchedChannelVariables
+  >({
+    mutationFn: ({ axiosPrivate, watchedChannelId }) =>
+      deleteWatchedChannel(axiosPrivate, watchedChannelId),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["watched_channels"] });
+    },
+  });
+};
+
+interface CreateWatchedChannelVariables {
+  axiosPrivate: AxiosInstance;
+  channelId: string;
+  watchedChannel: WatchedChannel;
+  categories: string[];
+}
+
+const useCreateWatchedChannel = () => {
+  const queryClient = useQueryClient();
+  return useMutation<
+    ApiResponse<NullResponse>,
+    Error,
+    CreateWatchedChannelVariables
+  >({
+    mutationFn: ({ axiosPrivate, channelId, watchedChannel, categories }) =>
+      createWatchedChannel(axiosPrivate, channelId, watchedChannel, categories),
+    onSuccess: () => {
+      queryClient.invalidateQueries({ queryKey: ["watched_channels"] });
+    },
+  });
+};
+
+export {
+  useGetWatchedChannesl,
+  useEditWatchedChannel,
+  useCreateWatchedChannel,
+  useDeleteWatchedChannel,
+};
diff --git a/frontend/app/layout.tsx b/frontend/app/layout.tsx
new file mode 100644
index 00000000..37b8b9f9
--- /dev/null
+++ b/frontend/app/layout.tsx
@@ -0,0 +1,39 @@
+import '@mantine/core/styles.layer.css';
+import '@mantine/notifications/styles.layer.css';
+import '@mantine/carousel/styles.layer.css';
+import '@mantine/charts/styles.layer.css';
+import 'mantine-datatable/styles.layer.css';
+import '@/app/global.css'
+
+import { ColorSchemeScript } from '@mantine/core';
+import type { Metadata } from "next";
+import Providers from './providers';
+import { PublicEnvScript } from 'next-runtime-env';
+
+export const metadata: Metadata = {
+  title: "Ganymede",
+  description: "A platform to archive live streams and videos.",
+};
+
+export default function RootLayout({
+  children,
+}: Readonly<{
+  children: React.ReactNode;
+}>) {
+
+  return (
+    <html lang="en" suppressHydrationWarning>
+      <head>
+        <PublicEnvScript />
+        <ColorSchemeScript defaultColorScheme='dark' />
+      </head>
+      <body>
+
+        <Providers>
+          {children}
+        </Providers>
+
+      </body>
+    </html>
+  );
+}
diff --git a/frontend/app/layout/Navbar.module.css b/frontend/app/layout/Navbar.module.css
new file mode 100644
index 00000000..20ae4c3b
--- /dev/null
+++ b/frontend/app/layout/Navbar.module.css
@@ -0,0 +1,58 @@
+.header {
+  height: rem(56px);
+  padding-left: rem(20px);
+  padding-right: rem(20px);
+  background-color: var(--mantine-color-body);
+  border-bottom: rem(1px) solid
+    light-dark(var(--mantine-color-gray-3), var(--mantine-color-dark-4));
+}
+
+.inner {
+  height: rem(56px);
+  display: flex;
+  justify-content: space-between;
+  align-items: center;
+}
+
+.link {
+  display: block;
+  line-height: 1;
+  height: 100%;
+  padding: rem(8px) rem(12px);
+  border-radius: var(--mantine-radius-sm);
+  text-decoration: none;
+  color: light-dark(var(--mantine-color-gray-7), var(--mantine-color-dark-0));
+  font-size: var(--mantine-font-size-sm);
+  font-weight: 500;
+
+  @mixin hover {
+    background-color: light-dark(
+      var(--mantine-color-gray-0),
+      var(--mantine-color-dark-6)
+    );
+  }
+}
+
+.linkLabel {
+  margin-right: rem(5px);
+}
+
+.dark {
+  @mixin dark {
+    display: none;
+  }
+
+  @mixin light {
+    display: block;
+  }
+}
+
+.light {
+  @mixin light {
+    display: none;
+  }
+
+  @mixin dark {
+    display: block;
+  }
+}
diff --git a/frontend/app/layout/Navbar.tsx b/frontend/app/layout/Navbar.tsx
new file mode 100644
index 00000000..59a1b286
--- /dev/null
+++ b/frontend/app/layout/Navbar.tsx
@@ -0,0 +1,255 @@
+"use client"
+import { Menu, Group, Center, Burger, rem, Drawer, ScrollArea, Divider, Button, ActionIcon, TextInput, useMantineColorScheme, useComputedColorScheme, UnstyledButton, Collapse } from '@mantine/core';
+import { useDisclosure } from '@mantine/hooks';
+import { IconChevronDown, IconChevronUp, IconMoon, IconSearch, IconSun, IconUserCircle } from '@tabler/icons-react';
+import classes from './Navbar.module.css';
+import useAuthStore from '../store/useAuthStore';
+import Link from 'next/link';
+import cx from "clsx"
+import Image from 'next/image';
+import { authLogout, UserRole } from '../hooks/useAuthentication';
+import { useRouter } from 'next/navigation';
+import { useState } from 'react';
+
+interface NavLink {
+  link: string;
+  label: string;
+  auth?: boolean;
+  role?: UserRole;
+  links?: NavLink[];
+}
+
+const links: NavLink[] = [
+  { link: '/', label: 'Home' },
+  { link: '/channels', label: 'Channels' },
+  {
+    link: '/archive',
+    label: 'Archive',
+    auth: true,
+    role: UserRole.Editor
+  },
+  { link: '/playlists', label: 'Playlists' },
+  { link: '/queue', label: 'Queue', auth: true, role: UserRole.Editor },
+  { link: '/riverui//', label: 'Tasks', auth: true, role: UserRole.Editor },
+  {
+    link: '#',
+    label: 'Admin',
+    auth: true,
+    role: UserRole.Admin,
+    links: [
+      { link: '/admin/channels', label: 'Channels' },
+      { link: '/admin/watched', label: 'Watched Channels' },
+      { link: '/admin/videos', label: 'Videos' },
+      { link: '/admin/blocked-videos', label: 'Blocked Videos' },
+      { link: '/admin/queue', label: 'Queue' },
+      { link: '/admin/users', label: 'Users' },
+      { link: '/admin/settings', label: 'Settings' },
+      { link: '/admin/tasks', label: 'Tasks' },
+      { link: '/admin/info', label: 'Information' },
+    ],
+  }
+];
+
+export function Navbar() {
+  const { isLoggedIn, user, logout, hasPermission } = useAuthStore();
+
+  const { setColorScheme } = useMantineColorScheme();
+  const computedColorScheme = useComputedColorScheme('light', { getInitialValueInEffect: true });
+
+  const router = useRouter();
+
+  const [drawerOpened, { toggle: toggleDrawer, close: closeDrawer }] = useDisclosure(false);
+  const [adminLinksOpened, { toggle: toggleAdminLinks }] = useDisclosure(false);
+  const [searchQuery, setSearchQuery] = useState("")
+
+  const handleLogout = async () => {
+    try {
+      await authLogout(); // server-side logout to clear session and cookies
+      logout(); // clear store
+      router.push("/");
+    } catch (error) {
+      console.error("Error logging out", error);
+    }
+  };
+
+  const filteredLinks = links.filter(link => {
+    if (!link.auth) return true;
+    if (isLoggedIn && (!link.role || hasPermission(link.role))) {
+      if (link.links) {
+        link.links = link.links.filter(subLink =>
+          !subLink.auth || (isLoggedIn && (!subLink.role || hasPermission(subLink.role)))
+        );
+        return link.links.length > 0;
+      }
+      return true;
+    }
+    return false;
+  });
+
+  const renderLinks = (links: NavLink[], className: string) => {
+    return links.map(link => {
+      if (link.links) {
+        return (
+          <Menu key={link.label} trigger="hover" transitionProps={{ exitDuration: 0 }} withinPortal>
+            {/* @ts-expect-error fine */}
+            <Menu.Target>
+              <a
+                href={link.link}
+                className={className}
+                onClick={(event) => event.preventDefault()}
+              >
+                <Center>
+                  <span className={classes.linkLabel}>{link.label}</span>
+                  <IconChevronDown size="0.9rem" stroke={1.5} />
+                </Center>
+              </a>
+            </Menu.Target>
+            <Menu.Dropdown>
+              {link.links.map(subLink => (
+                <Menu.Item key={subLink.label} component={Link} href={subLink.link}>
+                  {subLink.label}
+                </Menu.Item>
+              ))}
+            </Menu.Dropdown>
+          </Menu>
+        );
+      }
+
+      return (
+        <Link key={link.label} href={link.link} className={className}>
+          {link.label}
+        </Link>
+      );
+    });
+  };
+
+  const renderDrawerLinks = (links: NavLink[], className: string) => {
+    return links.map(link => {
+      if (link.links) {
+        return (
+          <div key={link.label}>
+            <UnstyledButton
+              onClick={toggleAdminLinks}
+              className={cx(className, classes.collapseToggle)}
+            >
+              <Group>
+                <span>{link.label}</span>
+                {adminLinksOpened ? <IconChevronUp size="0.9rem" /> : <IconChevronDown size="0.9rem" />}
+              </Group>
+            </UnstyledButton>
+            <Collapse in={adminLinksOpened}>
+              <div className={classes.collapseContent}>
+                {link.links.map(subLink => (
+                  <Link key={subLink.label} href={subLink.link} className={classes.link}>
+                    {subLink.label}
+                  </Link>
+                ))}
+              </div>
+            </Collapse>
+          </div>
+        );
+      }
+
+      return (
+        <Link key={link.label} href={link.link} className={className}>
+          {link.label}
+        </Link>
+      );
+    });
+  };
+
+  const mainLinks = renderLinks(filteredLinks, classes.link);
+
+  const drawerLinks = renderDrawerLinks(filteredLinks, classes.link);
+
+  return (
+    <header className={classes.header}>
+      <div className={classes.inner}>
+        <Group gap={5}>
+          <Image src="/images/ganymede_logo.png" height={32} width={32} alt="Ganymede logo" />
+          <Group visibleFrom="md">{mainLinks}</Group>
+        </Group>
+        <Group gap={5} visibleFrom="md">
+          <TextInput
+            value={searchQuery}
+            onChange={(event) => setSearchQuery(event.currentTarget.value)}
+            leftSectionPointerEvents="none"
+            leftSection={<IconSearch style={{ width: rem(16), height: rem(16) }} stroke={1.5} />}
+            placeholder="Search"
+            onKeyUp={(e) => {
+              if (e.key === "Enter") {
+                router.push(`/search?q=${encodeURI(searchQuery)}`)
+              }
+            }}
+          />
+          <ActionIcon
+            onClick={() => setColorScheme(computedColorScheme === 'light' ? 'dark' : 'light')}
+            variant="default"
+            size="lg"
+            aria-label="Toggle color scheme"
+          >
+            <IconSun className={cx(classes.icon, classes.light)} stroke={1.5} />
+            <IconMoon className={cx(classes.icon, classes.dark)} stroke={1.5} />
+          </ActionIcon>
+          {isLoggedIn ? (
+            <Menu shadow="md" width={200}>
+              {/* @ts-expect-error fine */}
+              <Menu.Target>
+                <ActionIcon variant="default" aria-label="Profile" size="lg">
+                  <IconUserCircle style={{ width: '70%', height: '70%' }} stroke={1.5} />
+                </ActionIcon>
+              </Menu.Target>
+              <Menu.Dropdown>
+                <Menu.Label>{user?.username}</Menu.Label>
+                <Menu.Item component={Link} href={`/profile`}>
+                  Profile
+                </Menu.Item>
+                <Menu.Item onClick={handleLogout}>
+                  Logout
+                </Menu.Item>
+              </Menu.Dropdown>
+            </Menu>
+          ) : (
+            <div>
+              <Button component={Link} href="/login" variant="default" mr={5}>
+                Log in
+              </Button>
+              <Button component={Link} href="/register" variant="default">Sign up</Button>
+            </div>
+          )}
+        </Group>
+        <Burger opened={drawerOpened} onClick={toggleDrawer} size="md" hiddenFrom="md" />
+      </div>
+      <Drawer
+        opened={drawerOpened}
+        onClose={closeDrawer}
+        size="100%"
+        padding="md"
+        title="Navigation"
+        hiddenFrom="md"
+        zIndex={1000000}
+      >
+        <ScrollArea h={`calc(100vh - ${rem(80)})`} mx="-md">
+          <Divider my="md" />
+          {drawerLinks}
+          <Divider my="md" />
+          <Group justify="center" grow pb="xl" px="md">
+            {isLoggedIn ? (
+              <>
+                <Button component={Link} href={`/profile`}>Profile</Button>
+                <Button onClick={handleLogout}>Logout</Button>
+              </>
+            ) : (
+              <>
+                <Button component={Link} href="/login" variant="default">
+                  Log in
+                </Button>
+                <Button component={Link} href="/register" variant="default">Sign up</Button>
+              </>
+            )}
+          </Group>
+        </ScrollArea>
+      </Drawer>
+    </header>
+  );
+}
diff --git a/frontend/app/login/page.tsx b/frontend/app/login/page.tsx
new file mode 100644
index 00000000..ca5d97ea
--- /dev/null
+++ b/frontend/app/login/page.tsx
@@ -0,0 +1,19 @@
+'use client'
+import { Container } from "@mantine/core";
+import { AuthenticationForm, AuthFormType } from "../components/authentication/AuthenticationForm";
+import { useEffect } from "react";
+
+const Loginpage = () => {
+  useEffect(() => {
+    document.title = "Login";
+  }, []);
+  return (
+    <div>
+      <Container mt={25}>
+        <AuthenticationForm type={AuthFormType.Login} />
+      </Container>
+    </div>
+  );
+}
+
+export default Loginpage;
\ No newline at end of file
diff --git a/frontend/app/manifest.ts b/frontend/app/manifest.ts
new file mode 100644
index 00000000..216f7c58
--- /dev/null
+++ b/frontend/app/manifest.ts
@@ -0,0 +1,25 @@
+import type { MetadataRoute } from "next";
+
+export default function manifest(): MetadataRoute.Manifest {
+  return {
+    name: "Ganymede",
+    short_name: "Ganymede",
+    description: "A platform to archive live streams and videos.",
+    start_url: "/",
+    display: "standalone",
+    background_color: "#141417",
+    theme_color: "#000000",
+    icons: [
+      {
+        src: "/android-chrome-192x192.png",
+        sizes: "192x192",
+        type: "image/png",
+      },
+      {
+        src: "/android-chrome-512x512.png",
+        sizes: "512x512",
+        type: "image/png",
+      },
+    ],
+  };
+}
diff --git a/frontend/app/oauth/page.tsx b/frontend/app/oauth/page.tsx
new file mode 100644
index 00000000..678a3d02
--- /dev/null
+++ b/frontend/app/oauth/page.tsx
@@ -0,0 +1,24 @@
+"use client"
+import { useRouter } from 'next/navigation';
+import useAuthStore from '@/app/store/useAuthStore';
+import { useEffect } from 'react';
+
+const OAuthPage = () => {
+  const router = useRouter()
+  const { fetchUser } = useAuthStore();
+
+  useEffect(() => {
+
+    const setUser = async () => {
+      await fetchUser()
+    }
+
+    setUser().catch(console.error).then(() => router.push('/'))
+  }, [fetchUser, router])
+
+  return (
+    <div></div>
+  );
+}
+
+export default OAuthPage;
\ No newline at end of file
diff --git a/frontend/app/page.tsx b/frontend/app/page.tsx
new file mode 100644
index 00000000..37621242
--- /dev/null
+++ b/frontend/app/page.tsx
@@ -0,0 +1,48 @@
+"use client"
+import { Box, Center, Container, Title } from "@mantine/core";
+import useAuthStore from "./store/useAuthStore";
+import { LandingHero } from "./components/landing/Hero";
+import ContinueWatching from "./components/landing/ContinueWatching";
+import RecentlyArchived from "./components/landing/RecentlyArchived";
+import { useEffect } from "react";
+
+export default function Home() {
+  const { isLoggedIn } = useAuthStore();
+
+  useEffect(() => {
+    document.title = "Ganymede";
+  }, []);
+
+  return (
+    <div>
+      {!isLoggedIn && (
+        <Box mb={5}>
+          <LandingHero />
+        </Box>
+      )}
+
+      {isLoggedIn && (
+        <Box>
+          <Center>
+            <Title>Continue Watching</Title>
+          </Center>
+          <Container mt={10} size={"7xl"}>
+            <ContinueWatching count={4} />
+          </Container>
+        </Box>
+      )}
+
+      <Box>
+        <Center>
+          <Title>Recently Archived</Title>
+        </Center>
+        <Container mt={10} size={"7xl"}>
+          <RecentlyArchived count={8} />
+        </Container>
+      </Box>
+
+
+
+    </div>
+  );
+}
diff --git a/frontend/app/playlists/PlaylistPage.module.css b/frontend/app/playlists/PlaylistPage.module.css
new file mode 100644
index 00000000..e69de29b
diff --git a/frontend/app/playlists/[id]/page.tsx b/frontend/app/playlists/[id]/page.tsx
new file mode 100644
index 00000000..226ea448
--- /dev/null
+++ b/frontend/app/playlists/[id]/page.tsx
@@ -0,0 +1,83 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import VideoGrid from "@/app/components/videos/Grid";
+import { useGetPlaylist } from "@/app/hooks/usePlaylist";
+import { useFetchVideosFilter, VideoType } from "@/app/hooks/useVideos";
+import useSettingsStore from "@/app/store/useSettingsStore";
+import { Center, Container, Title, Text, Button } from "@mantine/core";
+import { IconBorderAll } from "@tabler/icons-react";
+import Link from "next/link";
+import React, { useEffect, useState } from "react";
+interface Params {
+  id: string;
+}
+
+const PlaylistPage = ({ params }: { params: Promise<Params> }) => {
+  const { id } = React.use(params);
+  const {
+    data: playlist,
+    isPending: playlistPending,
+    isError: playlistError
+  } = useGetPlaylist(id, false);
+
+  useEffect(() => {
+    document.title = `${playlist?.name}`;
+  }, [playlist?.name]);
+
+  const [activePage, setActivePage] = useState(1);
+  const [videoTypes, setVideoTypes] = useState<VideoType[]>([]);
+
+  const videoLimit = useSettingsStore((state) => state.videoLimit);
+  const setVideoLimit = useSettingsStore((state) => state.setVideoLimit);
+
+  const {
+    data: videos,
+    isPending: videosPending,
+    isError: videosError
+  } = useFetchVideosFilter({
+    limit: videoLimit,
+    offset: (activePage - 1) * videoLimit,
+    types: videoTypes,
+    playlist_id: id
+  });
+
+  if (playlistPending || videosPending) {
+    return <GanymedeLoadingText message="Loading Videos" />;
+  }
+
+  if (playlistError || videosError) {
+    return <div>Error loading channel</div>;
+  }
+
+  return (
+    <Container size="xl" px="xl" fluid={true}>
+      <Center>
+        <Title>{playlist.name}</Title>
+      </Center>
+      <Center>
+        <Text>{playlist.description}</Text>
+      </Center>
+      <Center>
+        <Button
+          component={Link}
+          href={`/playlists/multistream/${playlist.id}`}
+          leftSection={<IconBorderAll size={14} />} variant="default">
+          Multistream View
+        </Button>
+      </Center>
+      <VideoGrid
+        videos={videos.data}
+        totalPages={videos.pages}
+        currentPage={activePage}
+        onPageChange={setActivePage}
+        isPending={videosPending}
+        videoLimit={videoLimit}
+        onVideoLimitChange={setVideoLimit}
+        onVideoTypeChange={setVideoTypes}
+        showChannel={false}
+      />
+    </Container>
+  );
+}
+
+export default PlaylistPage;
\ No newline at end of file
diff --git a/frontend/app/playlists/multistream/[id]/PlaylistMultistream.module.css b/frontend/app/playlists/multistream/[id]/PlaylistMultistream.module.css
new file mode 100644
index 00000000..0bcb469e
--- /dev/null
+++ b/frontend/app/playlists/multistream/[id]/PlaylistMultistream.module.css
@@ -0,0 +1,129 @@
+.pageWrapper {
+  height: calc(100vh - 60px);
+  display: flex;
+}
+
+.videosGrid {
+  flex: 1;
+  display: grid;
+  width: 100%;
+  height: 100%;
+  position: relative;
+  grid-template-columns: repeat(var(--grid-columns-count), minmax(0, 1fr));
+  grid-template-rows: repeat(var(--grid-rows-count), minmax(0, 1fr));
+
+  &.dropEnabled .dropTile {
+    pointer-events: auto;
+    opacity: 0.25;
+  }
+
+  &.dropEnabled > :not(.dropTile) {
+    pointer-events: none;
+  }
+
+  &.resizeMode > * {
+    pointer-events: none;
+  }
+}
+
+.resizeOverlay {
+  position: absolute;
+  left: calc(100% * var(--tile-x) / var(--grid-columns-count));
+  top: calc(100% * var(--tile-y) / var(--grid-rows-count));
+  width: calc(100% * var(--tile-width) / var(--grid-columns-count));
+  height: calc(100% * var(--tile-height) / var(--grid-rows-count));
+  opacity: 0.2;
+  background: var(--mantine-color-violet-5);
+  pointer-events: none;
+  transition: all 0.2s;
+  z-index: 150;
+}
+
+.resizableTile {
+  position: relative;
+
+  & > .topLeftHandle {
+    position: absolute;
+    top: 0;
+    left: 0;
+    width: 1rem;
+    height: 1rem;
+    user-select: none;
+    touch-action: none;
+    cursor: move;
+    z-index: 150;
+  }
+
+  & > .bottomRightHandle {
+    position: absolute;
+    bottom: 0;
+    right: 0;
+    width: 1rem;
+    height: 1rem;
+    user-select: none;
+    touch-action: none;
+    cursor: nwse-resize;
+    z-index: 150;
+  }
+
+  & > .topRightHandle {
+    position: absolute;
+    top: 0;
+    right: 0;
+    width: 1rem;
+    height: 1rem;
+    user-select: none;
+    touch-action: none;
+    cursor: not-allowed;
+    z-index: 150;
+  }
+}
+
+.playerTile {
+  grid-column: var(--tile-x);
+  grid-row: var(--tile-y);
+}
+
+.streamerOffline {
+  display: flex;
+  justify-content: center;
+  align-items: center;
+  text-align: center;
+  border: 0.125rem solid var(--mantine-color-dark-5);
+}
+
+.dropTile {
+  opacity: 0;
+  background: var(--mantine-color-dark-7);
+  border: 0.125rem solid var(--mantine-color-dark-5);
+  grid-column: var(--tile-x);
+  grid-row: var(--tile-y);
+  pointer-events: none;
+  transition: all 0.2s;
+  z-index: 150;
+}
+
+.dropTileHovered {
+  opacity: 0.5;
+  background: var(--mantine-color-violet-5);
+  border: 0.125rem solid var(--mantine-color-violet-7);
+}
+
+.timelineOpenButtonContainer {
+  display: flex;
+  justify-content: center;
+  position: fixed;
+  bottom: 0;
+  pointer-events: none;
+  z-index: 150;
+  width: 100vw;
+
+  & > * {
+    pointer-events: auto;
+  }
+}
+
+.timelineOpenButton {
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+}
diff --git a/frontend/app/playlists/multistream/[id]/page.tsx b/frontend/app/playlists/multistream/[id]/page.tsx
new file mode 100644
index 00000000..b6621c20
--- /dev/null
+++ b/frontend/app/playlists/multistream/[id]/page.tsx
@@ -0,0 +1,459 @@
+"use client"
+import Head from "next/head";
+import React, { ReactNode, useEffect, useState } from "react";
+import { escapeURL } from "../../../util/util";
+import classes from "./PlaylistMultistream.module.css"
+import { ActionIcon, Drawer, Text } from "@mantine/core";
+import { IconChevronUp } from "@tabler/icons-react";
+import { useDisclosure, useInterval } from "@mantine/hooks";
+import { useGetPlaylist, useUpdateMultistreamVideoOffset } from "@/app/hooks/usePlaylist";
+import GanymedeLoader from "@/app/components/utils/GanymedeLoader";
+import { MultistreamTimeline } from "@/app/components/videos/multistream/MultistreamTimeline";
+import SyncedVideoPlayer from "@/app/components/videos/multistream/SyncedVideoPlayer";
+import { env } from "next-runtime-env";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { Video } from "@/app/hooks/useVideos";
+
+interface Params {
+  id: string;
+}
+
+const PlaylistMultistream = ({ params }: { params: Promise<Params> }) => {
+  const { id } = React.use(params);
+  const axiosPrivate = useAxiosPrivate()
+  const videoGrid = React.createRef<HTMLDivElement>();
+  const [streamerViewState, setStreamerViewState] = useState<Record<string, { tileX: number; tileY: number; tileWidth: number; tileHeight: number } | null>>({});
+  const [vodPlaybackOffsets, setVodPlaybackOffsets] = useState<Record<string, number>>({});
+
+  const { data, isLoading, error } = useGetPlaylist(id, true)
+
+  const updateVideoOffsetMutate = useUpdateMultistreamVideoOffset()
+
+  const handleUpdateVideoOffset = async (vodId: string, offset: number) => {
+    try {
+      await updateVideoOffsetMutate.mutateAsync({ axiosPrivate, playlistId: id, videoId: vodId, delayMs: offset })
+    } catch (error) {
+      console.error("Error updating video offset", error)
+    }
+  }
+
+  const [playing, setPlaying] = useState<boolean>(false);
+  const [playStartAtDate, setPlayStartAtDate] = useState<number>(0);
+  const [globalTime, setGlobalTime] = useState<number>(0);
+  const [globalTimeUpdate, setGlobalTimeUpdate] = useState<number>(0);
+  const [startDateMs, setStartDateMs] = useState<number | null>(null);
+  const [endDateMs, setEndDateMs] = useState<number | null>(null);
+  const [streamers, setStreamers] = useState<Record<string, {
+    name: string
+    vods: Video[],
+    imagePath: string
+  }>>({});
+  const [gridWidth, setGridWidth] = useState<number>(2);
+  const [gridHeight, setGridHeight] = useState<number>(1);
+  const [dragOverTile, setDragOverTile] = useState<[number, number] | null>(null);
+  const [dropEnabled, setDropEnabled] = useState<boolean>(false);
+  // eslint-disable-next-line @typescript-eslint/no-unused-vars
+  const [enterEvents, setEnterEvents] = useState<number>(0);
+  const [resizeMode, setResizeMode] = useState<false | 'resize' | 'move'>(false);
+  const [resizeOverlayParams, setResizeOverlayParams] = useState<{ tileX: number; tileY: number; tileWidth: number; tileHeight: number, streamerId: string } | null>(null);
+
+  const [opened, { open, close }] = useDisclosure(true);
+
+  const videoCheckInterval = useInterval(() => {
+    setGlobalTimeUpdate((playing ? (Date.now() - playStartAtDate) : 0) + globalTime)
+  }, 1000)
+
+  // Update start and end of the timeline
+  useEffect(() => {
+    if (!data) {
+      return;
+    }
+    let _startDateMs: number | null = null;
+    let _endDateMs: number | null = null;
+    const _streamers: Record<string, {
+      name: string
+      vods: Video[],
+      imagePath: string
+    }> = {};
+    for (let i = 0; i < data.edges.vods.length; i++) {
+      const vod = data.edges.vods[i];
+      const vodStartDateMs = +new Date(getVodStartDate(vod))
+      if (_startDateMs == null || vodStartDateMs < _startDateMs) {
+        _startDateMs = vodStartDateMs;
+      }
+      const vodEndDateMs = vodStartDateMs + vod.duration * 1000;
+      if (_endDateMs == null || _endDateMs < vodEndDateMs) {
+        _endDateMs = vodEndDateMs;
+      }
+
+      if (!_streamers[vod.edges.channel.id]) {
+        _streamers[vod.edges.channel.id] = {
+          name: vod.edges.channel.name,
+          vods: [],
+          imagePath: vod.edges.channel.image_path,
+        }
+      }
+
+      _streamers[vod.edges.channel.id].vods.push(vod)
+    }
+
+    // COmpute default view
+    const streamersCount = Object.keys(_streamers).length;
+    let rows = 1;
+    if (streamersCount > 3) {
+      rows = 2;
+    }
+    const columns = Math.ceil(streamersCount / rows);
+    setGridWidth(columns);
+    setGridHeight(rows);
+    let i = 0;
+    const defaultViewState: Record<string, { tileX: number; tileY: number; tileWidth: number; tileHeight: number } | null> = {}
+    for (const streamerId in _streamers) {
+      defaultViewState[streamerId] = {
+        tileX: i % columns,
+        tileY: Math.floor(i / columns),
+        tileWidth: 1,
+        tileHeight: 1,
+      }
+      i++;
+    }
+    setStreamerViewState(defaultViewState);
+
+    setStartDateMs(_startDateMs)
+    setEndDateMs(_endDateMs)
+    setStreamers(_streamers)
+
+    setVodPlaybackOffsets((prevState) => {
+      const newState = { ...prevState };
+      if (data.edges.multistream_info) {
+        for (let i = 0; i < data.edges.multistream_info.length; i++) {
+          const multistreamInfo = data.edges.multistream_info[i];
+          newState[multistreamInfo.edges.vod.id] = multistreamInfo.delay_ms;
+        }
+      }
+      return newState;
+    })
+  }, [data])
+
+  useEffect(() => {
+    videoCheckInterval.stop()
+    if (!playing) {
+      return
+    }
+    videoCheckInterval.start();
+    return videoCheckInterval.stop;
+  }, [playing, videoCheckInterval]);
+
+  if (error) return <div>failed to load</div>;
+  if (isLoading) return <GanymedeLoader />;
+  if (!data || data.edges.vods.length === 0) return <div>Empty playlist, unable to start multistream.</div>;
+
+  const seek = (newGlobalTime: number) => {
+    setPlayStartAtDate(Date.now());
+    setGlobalTime(newGlobalTime);
+    setGlobalTimeUpdate(newGlobalTime);
+  }
+
+  if (startDateMs != null && globalTime < startDateMs) {
+    seek(startDateMs);
+  }
+
+  const onUserPlay = () => {
+    setPlayStartAtDate(Date.now());
+    setPlaying(true);
+  }
+
+  const onUserPause = (pausedAtGlobalTime: number) => {
+    setPlaying(false);
+    setGlobalTime(pausedAtGlobalTime)
+    setGlobalTimeUpdate(pausedAtGlobalTime);
+  }
+
+  const startMovingTile = (streamerId: string) => {
+    if (!streamerViewState[streamerId]) return
+    setResizeMode('move');
+    setResizeOverlayParams({ ...streamerViewState[streamerId], streamerId });
+  }
+
+  const startResizingTile = (streamerId: string) => {
+    if (!streamerViewState[streamerId]) return
+    setResizeMode('resize');
+    setResizeOverlayParams({ ...streamerViewState[streamerId], streamerId });
+  }
+
+  const checkResize = (event: React.PointerEvent) => {
+    if (!resizeOverlayParams || !resizeMode) return;
+    const gridRect = videoGrid.current?.getBoundingClientRect();
+    if (!gridRect) return;
+    const tileXUnderMouse = Math.floor((event.clientX - gridRect.left) / (gridRect.width / gridWidth));
+    const tileYUnderMouse = Math.floor((event.clientY - gridRect.top) / (gridRect.height / gridHeight));
+    switch (resizeMode) {
+      case 'move': {
+        setResizeOverlayParams((prevState) => {
+          if (!prevState) return null;
+          const newState = { ...prevState };
+          newState.tileX = Math.min(tileXUnderMouse, gridWidth - 1);
+          newState.tileY = Math.min(tileYUnderMouse, gridHeight - 1);
+          return newState;
+        })
+        break
+      }
+      case 'resize': {
+        setResizeOverlayParams((prevState) => {
+          if (!prevState) return null;
+          const newState = { ...prevState };
+          newState.tileWidth = Math.min(Math.max(1, tileXUnderMouse - prevState.tileX + 1), gridWidth - prevState.tileX);
+          newState.tileHeight = Math.min(Math.max(1, tileYUnderMouse - prevState.tileY + 1), gridHeight - prevState.tileY);
+          return newState;
+        })
+        break
+      }
+    }
+  }
+
+  const endTileResize = () => {
+    if (resizeMode) {
+      setResizeMode(false);
+    } else {
+      return
+    }
+    if (!resizeOverlayParams) return;
+    setStreamerViewState((prevState) => {
+      const newState = { ...prevState };
+      newState[resizeOverlayParams.streamerId] = {
+        tileX: resizeOverlayParams.tileX,
+        tileY: resizeOverlayParams.tileY,
+        tileWidth: resizeOverlayParams.tileWidth,
+        tileHeight: resizeOverlayParams.tileHeight,
+      };
+      return newState;
+    })
+  }
+
+  const playingVodForStreamer: Record<string, Video | null> = {};
+
+  const playerTiles = Object.keys(streamerViewState).map((streamerId) => {
+    const streamer = streamers[streamerId];
+    const viewState = streamerViewState[streamerId];
+    if (!viewState || !streamer) {
+      return null;
+    }
+    const playingVod = getVodAtTime(streamer.vods, vodPlaybackOffsets, globalTimeUpdate);
+    playingVodForStreamer[streamerId] = playingVod;
+    if (!playingVod) {
+      return <ResizableTile
+        className={`${classes.streamerOffline} ${classes.playerTile}`}
+        style={{ '--tile-x': `${viewState.tileX + 1} / ${viewState.tileX + viewState.tileWidth + 1}`, '--tile-y': `${viewState.tileY + 1} / ${viewState.tileY + viewState.tileHeight + 1}` } as React.CSSProperties}
+        key={streamer.name + "-no-playing-vod"}
+        startMoving={() => startMovingTile(streamerId)}
+        startResizing={() => startResizingTile(streamerId)}
+        remove={() => {
+          setStreamerViewState((prevState) => {
+            const newState = { ...prevState };
+            delete newState[streamerId];
+            return newState;
+          })
+        }}
+      >
+        <Text size="xl" span>
+          {streamer.name}<br />
+          <Text size="xl" fw={700} span>OFFLINE</Text>
+        </Text>
+      </ResizableTile>
+    }
+    const playbackOffset = (vodPlaybackOffsets[playingVod.id] || 0) / 1000;
+    const currentGlobalTime = (playing ? (Date.now() - playStartAtDate) : 0) + globalTime
+    const vodTime = (currentGlobalTime - (+new Date(getVodStartDate(playingVod)))) / 1000 + playbackOffset;
+    return (
+      <ResizableTile
+        className={classes.playerTile}
+        style={{ '--tile-x': `${viewState.tileX + 1} / ${viewState.tileX + viewState.tileWidth + 1}`, '--tile-y': `${viewState.tileY + 1} / ${viewState.tileY + viewState.tileHeight + 1}` } as React.CSSProperties}
+        key={playingVod.id + "-vod-player"}
+        startMoving={() => startMovingTile(streamerId)}
+        startResizing={() => startResizingTile(streamerId)}
+        remove={() => {
+          setStreamerViewState((prevState) => {
+            const newState = { ...prevState };
+            delete newState[streamerId];
+            return newState;
+          })
+        }}
+      >
+        <SyncedVideoPlayer
+          src={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(playingVod.video_path)}`}
+          vodId={playingVod.id}
+          title={playingVod.title}
+          poster={`${(env('NEXT_PUBLIC_CDN_URL') ?? '')}${escapeURL(playingVod.web_thumbnail_path)}`}
+          time={vodTime}
+          playing={playing}
+          muted={true}
+        />
+      </ResizableTile>
+    )
+  })
+
+  const checkDropData = (event: React.DragEvent) => {
+    if (!event.dataTransfer.types.includes('streamerid')) return
+    setDropEnabled(true);
+    setEnterEvents((prevState) => {
+      const newEnterEvents = Math.min(2, prevState + 1)
+      return newEnterEvents
+    })
+  }
+  const leaveDropZone = () => {
+    setEnterEvents((prevState) => {
+      const newEnterEvents = Math.max(0, prevState - 1)
+      if (newEnterEvents == 0) {
+        setDropEnabled(false)
+        setDragOverTile(null)
+      }
+      return newEnterEvents
+    })
+  }
+
+  const dragOverTileHandler = (x: number, y: number, event: React.DragEvent, immediate: boolean) => {
+    if (!event.dataTransfer.types.includes('streamerid')) return
+    event.preventDefault();
+    event.dataTransfer.dropEffect = 'move';
+    if (immediate) {
+      setDragOverTile([x, y])
+    } else {
+      setTimeout(() => {
+        setDragOverTile([x, y])
+      })
+    }
+  }
+
+  const dropOverTileHander = (x: number, y: number, event: React.DragEvent) => {
+    event.preventDefault();
+    const streamerId = event.dataTransfer.getData('streamerid');
+    setStreamerViewState((prevState) => {
+      const newState = { ...prevState };
+      newState[streamerId] = { tileX: x, tileY: y, tileWidth: 1, tileHeight: 1 };
+      return newState;
+    })
+    setEnterEvents(0)
+    setDropEnabled(false)
+    setDragOverTile(null)
+  }
+
+  const dropTiles: React.JSX.Element[] = []
+  for (let x = 0; x < gridWidth; x++) {
+    for (let y = 0; y < gridHeight; y++) {
+      dropTiles.push(<div
+        className={`${classes.dropTile} ${dragOverTile != null && dragOverTile[0] === x && dragOverTile[1] === y ? classes.dropTileHovered : ''}`}
+        style={{ '--tile-x': x + 1, '--tile-y': y + 1 } as React.CSSProperties}
+        key={`drop-tile-${x}-${y}`}
+        onDragEnter={(event) => { dragOverTileHandler(x, y, event, false) }}
+        onDragOver={(event) => { dragOverTileHandler(x, y, event, true) }}
+        onDrop={(event) => { dropOverTileHander(x, y, event) }}
+      ></div>)
+    }
+  }
+
+  return (
+    <div>
+      <Head>
+        <title>{data.name} - Ganymede Multistream</title>
+      </Head>
+
+      <div className={classes.pageWrapper}>
+        <div
+          ref={videoGrid}
+          className={`${classes.videosGrid} ${dropEnabled ? classes.dropEnabled : ''} ${resizeMode ? classes.resizeMode : ''}`}
+          style={{ '--grid-columns-count': gridWidth, '--grid-rows-count': gridHeight } as React.CSSProperties}
+          onDragLeave={() => { leaveDropZone(); }}
+          onDragEnter={(event) => { checkDropData(event); }}
+          onPointerUp={() => { endTileResize() }}
+          onPointerMove={(event) => { if (resizeMode) checkResize(event) }}
+        >
+          {playerTiles}
+          {dropTiles}
+          {resizeMode && <div className={`${classes.resizeOverlay}`} style={{ '--tile-x': resizeOverlayParams?.tileX, '--tile-y': resizeOverlayParams?.tileY, '--tile-width': resizeOverlayParams?.tileWidth, '--tile-height': resizeOverlayParams?.tileHeight } as React.CSSProperties}></div>}
+        </div>
+        <div className={classes.timelineOpenButtonContainer}>
+          <ActionIcon
+            onClick={open}
+            size="sm"
+            color="violet"
+            variant="light"
+          >
+            <IconChevronUp />
+          </ActionIcon>
+        </div>
+        <Drawer opened={opened} onClose={close} position="bottom" size="xs" overlayProps={{ backgroundOpacity: 0.1 }}>
+          <MultistreamTimeline
+            play={onUserPlay}
+            pause={() => { onUserPause(globalTime + Date.now() - playStartAtDate) }}
+            endDateMs={endDateMs}
+            startDateMs={startDateMs}
+            globalTime={globalTime}
+            playing={playing}
+            playingVodForStreamer={playingVodForStreamer}
+            streamers={streamers}
+            playStartAtDate={playStartAtDate}
+            seek={seek}
+            setVodOffset={(vodId, offset) => {
+              setVodPlaybackOffsets((prevState) => {
+                const newState = { ...prevState };
+                newState[vodId] = offset;
+                return newState;
+              })
+              handleUpdateVideoOffset(vodId, offset)
+            }}
+            vodPlaybackOffsets={vodPlaybackOffsets}
+            onStreamerDragStart={() => { close() }}
+            gridWidth={gridWidth}
+            gridHeight={gridHeight}
+            setGridWidth={(width) => { setGridWidth(width) }}
+            setGridHeight={(height) => { setGridHeight(height) }}
+          />
+        </Drawer>
+      </div>
+
+    </div>
+  )
+}
+
+function getVodStartDate(vod: Video): Date {
+  if (!vod) {
+    return new Date();
+  }
+  if (vod.type === 'live') {
+    return vod.created_at;
+  }
+  return vod.streamed_at;
+}
+
+function getVodAtTime(vods: Video[], vodPlaybackOffsets: Record<string, number>, time: number): Video | null {
+  for (let i = 0; i < vods.length; i++) {
+    const vod = vods[i];
+    const playbackOffset = (vodPlaybackOffsets[vod.id] || 0) / 1000
+    const offsettedTime = time + playbackOffset;
+    const vodStartDateMs = +new Date(getVodStartDate(vod))
+    const vodEndDateMs = vodStartDateMs + vod.duration * 1000;
+    if (vodStartDateMs <= offsettedTime && offsettedTime <= vodEndDateMs) {
+      return vod;
+    }
+  }
+  return null;
+}
+
+type ResizableTileProps = {
+  className: string;
+  style?: React.CSSProperties;
+  startMoving: () => void;
+  startResizing: () => void;
+  remove: () => void;
+  children: ReactNode
+}
+function ResizableTile(props: ResizableTileProps) {
+  return <div className={`${classes.resizableTile} ${props.className}`} style={props.style}>
+    {props.children}
+    <div className={classes.topLeftHandle} onPointerDown={() => props.startMoving()}></div>
+    <div className={classes.topRightHandle} onClick={() => props.remove()}></div>
+    <div className={classes.bottomRightHandle} onPointerDown={() => props.startResizing()}></div>
+  </div>
+}
+
+export default PlaylistMultistream;
\ No newline at end of file
diff --git a/frontend/app/playlists/page.tsx b/frontend/app/playlists/page.tsx
new file mode 100644
index 00000000..9ecf9323
--- /dev/null
+++ b/frontend/app/playlists/page.tsx
@@ -0,0 +1,160 @@
+"use client"
+import { Text, ActionIcon, Button, Container, Group, Title, Drawer, Modal, Code } from "@mantine/core";
+import { Playlist, useDeletePlaylist, useGetPlaylists } from "../hooks/usePlaylist";
+import GanymedeLoadingText from "../components/utils/GanymedeLoadingText";
+import useAuthStore from "../store/useAuthStore";
+import { IconEdit, IconTrash } from "@tabler/icons-react";
+import { UserRole } from "../hooks/useAuthentication";
+import { DataTable } from 'mantine-datatable';
+import Link from "next/link"
+import { useDisclosure } from "@mantine/hooks";
+import PlaylistEditForm, { PlaylistEditFormMode } from "../components/playlist/EditForm";
+import { useEffect, useState } from "react";
+import { showNotification } from "@mantine/notifications";
+import { useAxiosPrivate } from "../hooks/useAxios";
+import { useQueryClient } from "@tanstack/react-query";
+
+
+const PlaylistsPage = () => {
+  useEffect(() => {
+    document.title = "Playlists";
+  }, []);
+
+  const hasPermission = useAuthStore(state => state.hasPermission);
+
+  const { data: playlists, isPending, isError } = useGetPlaylists()
+
+  const [playlist, setPlaylist] = useState<Playlist | null>(null);
+  const [playlistEditMode, setPlaylistEditMode] = useState<PlaylistEditFormMode>(PlaylistEditFormMode.Edit)
+
+  const [playlistDrawerOpened, { open: openPlaylistDrawer, close: closePlaylistDrawer }] = useDisclosure(false);
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+
+  const axiosPrivate = useAxiosPrivate();
+  const deletePlaylistMutation = useDeletePlaylist()
+  const [deleteButtonLoading, setDeleteButtonLoading] = useState(false);
+
+  const queryClient = useQueryClient()
+
+  const handleDelete = async (id: string) => {
+    try {
+      setDeleteButtonLoading(true)
+
+      await deletePlaylistMutation.mutateAsync({ axiosPrivate, id })
+
+      setDeleteButtonLoading(false)
+
+      showNotification({
+        message: `Playlist deleted`
+      })
+
+      queryClient.invalidateQueries({ queryKey: ["queue"] })
+
+      closeDeleteModal()
+
+    } catch (error) {
+      console.error("Error deleting playlist", error)
+      setDeleteButtonLoading(false)
+    }
+  };
+
+  const closeDrawerCallback = () => {
+    closePlaylistDrawer()
+  }
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Playlists" />
+  )
+  if (isError) return <div>Error loading playlists</div>
+
+  return (
+    <div>
+      <Container size={"7xl"}>
+        <Group justify="space-between">
+          <Title>Playlists</Title>
+          {hasPermission(UserRole.Editor) && (
+            <div>
+              <Button variant="default" onClick={() => {
+                setPlaylistEditMode(PlaylistEditFormMode.Create)
+                setPlaylist(null)
+                openPlaylistDrawer()
+              }}>Create Playlist</Button>
+            </div>
+          )}
+        </Group>
+
+        {/* table */}
+        <DataTable
+          highlightOnHover
+          columns={[
+            {
+              accessor: "name",
+              title: "Name",
+              render: ({ name, id }) => (
+                <Link href={`/playlists/${id}`}>
+                  <Text>{name}</Text>
+                </Link>
+              ),
+            },
+            {
+              accessor: "description",
+              title: "Description",
+              render: ({ description }) => (
+                <Text lineClamp={1}>{description}</Text>
+              ),
+            },
+            {
+              accessor: '',
+              textAlign: 'right',
+              render: (playlist) => hasPermission(UserRole.Editor) && (
+                <Group gap={4} justify="right" wrap="nowrap">
+                  <ActionIcon
+                    size="sm"
+                    variant="subtle"
+                    color="blue"
+                    onClick={() => {
+                      setPlaylist(playlist)
+                      openPlaylistDrawer()
+                    }}
+                    title="Edit"
+                    aria-label="Edit"
+                  >
+                    <IconEdit size={16} />
+                  </ActionIcon>
+                  <ActionIcon
+                    size="sm"
+                    variant="subtle"
+                    color="red"
+                    onClick={() => {
+                      setPlaylist(playlist)
+                      openDeleteModal()
+                    }}
+                    title="Delete"
+                    arria-label="Delete"
+                  >
+                    <IconTrash size={16} />
+                  </ActionIcon>
+                </Group>
+              )
+            },
+          ]}
+          records={playlists}
+        />
+
+      </Container>
+
+      <Drawer opened={playlistDrawerOpened} onClose={closePlaylistDrawer} position="right" title="Playlist">
+        <PlaylistEditForm mode={playlistEditMode} playlist={playlist} handleClose={closeDrawerCallback} />
+      </Drawer>
+
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Delete Playlist" centered>
+        <div>
+          <Code block>{JSON.stringify(playlist, null, 2)}</Code>
+          <Button mt={10} fullWidth color="red" variant="filled" loading={deleteButtonLoading} onClick={() => handleDelete(playlist?.id || "")}>Delete</Button>
+        </div>
+      </Modal>
+    </div>
+  );
+}
+
+export default PlaylistsPage;
\ No newline at end of file
diff --git a/frontend/app/profile/page.tsx b/frontend/app/profile/page.tsx
new file mode 100644
index 00000000..9ac5b9e6
--- /dev/null
+++ b/frontend/app/profile/page.tsx
@@ -0,0 +1,94 @@
+"use client"
+import { Box, Button, Card, Center, Checkbox, Container, Divider, Drawer, Text, Title } from "@mantine/core";
+import useAuthStore from "../store/useAuthStore";
+import { useRouter } from "next/navigation";
+import { useEffect } from "react";
+import useSettingsStore from "../store/useSettingsStore";
+import { useDisclosure } from "@mantine/hooks";
+import AuthChangePassword from "../components/auth/ChangePassword";
+
+const ProfilePage = () => {
+  useEffect(() => {
+    document.title = "Profile";
+  }, []);
+  const { user, isLoading, isLoggedIn } = useAuthStore()
+  const router = useRouter();
+
+  const [passwordDrawerOpened, { open: openPasswordDrawer, close: closePasswordDrawer }] = useDisclosure(false);
+
+  const {
+    chatPlaybackSmoothScroll,
+    setChatPlaybackSmoothScroll,
+    showChatHistogram,
+    setShowChatHistogram
+  } = useSettingsStore();
+
+  const toggleSmoothScroll = () => {
+    setChatPlaybackSmoothScroll(!chatPlaybackSmoothScroll);
+  };
+
+  const toggleChatHistogram = () => {
+    setShowChatHistogram(!showChatHistogram);
+  }
+
+  useEffect(() => {
+    if (!isLoading && !isLoggedIn) {
+      router.push("/login");
+    }
+  }, [isLoggedIn, isLoading, router]);
+
+  return (
+    <div>
+      <Container mt={15}>
+        <Card withBorder p="xl" radius={"sm"}>
+          <>
+            <Center>
+              <Title>{user?.username}</Title>
+            </Center>
+            <Center>
+              <Text mr={5}>Role:</Text><Text>{user?.role}</Text>
+            </Center>
+
+            <Divider my={20} />
+
+            <Title>Settings</Title>
+            <Text size="sm">Settings are persisted in local browser storage.</Text>
+
+            <Box mt={10}>
+              <Checkbox
+                label="Smooth chat scrolling"
+                description="Enable smooth scrolling for new chat messages. May look bad if there is a large volume of messages per second."
+                checked={chatPlaybackSmoothScroll}
+                onChange={toggleSmoothScroll}
+              />
+              <Checkbox
+                label="Show Chat Histogram"
+                description="Display a visual representation of chat message throughout the video below the video player."
+                checked={showChatHistogram}
+                onChange={toggleChatHistogram}
+              />
+            </Box>
+
+
+
+            <Divider my={20} />
+
+            {!user?.oauth && (
+              <Button onClick={openPasswordDrawer} fullWidth>
+                Change Password
+              </Button>
+            )}
+
+          </>
+        </Card>
+      </Container>
+
+      <Drawer opened={passwordDrawerOpened} onClose={closePasswordDrawer} position="right" title="Change Password">
+        <AuthChangePassword handleClose={closePasswordDrawer} />
+      </Drawer>
+
+    </div >
+  );
+}
+
+export default ProfilePage;
\ No newline at end of file
diff --git a/frontend/app/providers.tsx b/frontend/app/providers.tsx
new file mode 100644
index 00000000..6c3bbad3
--- /dev/null
+++ b/frontend/app/providers.tsx
@@ -0,0 +1,99 @@
+'use client'
+import { QueryClientProvider } from '@tanstack/react-query'
+import { ReactQueryDevtools } from '@tanstack/react-query-devtools'
+import { getQueryClient } from '@/app/get-query-client'
+import type * as React from 'react'
+import { Container, createTheme, MantineProvider, rem } from '@mantine/core'
+import { Notifications } from '@mantine/notifications'
+import { Navbar } from './layout/Navbar';
+import useSettingsStore from './store/useSettingsStore';
+import { useEffect } from 'react';
+import useAuthStore from './store/useAuthStore'
+import { Inter } from 'next/font/google'
+
+const inter = Inter({
+  subsets: ['latin'],
+  display: 'swap',
+})
+
+const CONTAINER_SIZES: Record<string, string> = {
+  xxs: rem(300),
+  xs: rem(400),
+  sm: rem(500),
+  md: rem(600),
+  lg: rem(700),
+  xl: rem(800),
+  xxl: rem(900),
+  "3xl": rem(1000),
+  "4xl": rem(1100),
+  "5xl": rem(1200),
+  "6xl": rem(1300),
+  "7xl": rem(1400),
+};
+
+const theme = createTheme({
+  fontFamily: inter.style.fontFamily,
+  breakpoints: {
+    xs: "30em",
+    sm: "48em",
+    md: "64em",
+    lg: "74em",
+    xl: "90em",
+    xxl: "100em",
+    "3xl": "116em",
+    "4xl": "130em",
+    "5xl": "146em",
+    "6xl": "160em"
+  },
+  components: {
+    Container: Container.extend({
+      vars: (_, { size, fluid }) => ({
+        root: {
+          '--container-size': fluid
+            ? '100%'
+            : size !== undefined && size in CONTAINER_SIZES
+              ? CONTAINER_SIZES[size]
+              : rem(size),
+        },
+      }),
+    }),
+  },
+  colors: {
+    dark: [
+      '#C1C2C5',
+      '#A6A7AB',
+      '#909296',
+      '#5c5f66',
+      '#373A40',
+      '#2C2E33',
+      '#18181C',
+      '#141417',
+      '#141517',
+      '#101113',
+    ],
+  },
+});
+
+export default function Providers({ children }: { children: React.ReactNode }) {
+  const { fetchUser } = useAuthStore()
+  const queryClient = getQueryClient()
+
+  const videoTheaterMode = useSettingsStore((state) => state.videoTheaterMode);
+
+  // Attempt to authenticate user on initial page load
+  useEffect(() => {
+    fetchUser()
+    // eslint-disable-next-line react-hooks/exhaustive-deps
+  }, [])
+
+  return (
+    <MantineProvider defaultColorScheme="dark" theme={theme}>
+      <Notifications />
+      <QueryClientProvider client={queryClient}>
+        {!videoTheaterMode && <Navbar />}
+        {children}
+        <ReactQueryDevtools />
+      </QueryClientProvider>
+    </MantineProvider>
+  )
+}
diff --git a/frontend/app/queue/QueuePage.module.css b/frontend/app/queue/QueuePage.module.css
new file mode 100644
index 00000000..c732fcb1
--- /dev/null
+++ b/frontend/app/queue/QueuePage.module.css
@@ -0,0 +1,8 @@
+.errBadge {
+  background-color: var(--mantine-color-red-6);
+  width: auto;
+  padding: 0.25rem;
+  color: var(--mantine-color-white);
+  border-radius: 0.25rem;
+  text-align: center;
+}
diff --git a/frontend/app/queue/[id]/QueueIdPage.module.css b/frontend/app/queue/[id]/QueueIdPage.module.css
new file mode 100644
index 00000000..6040dce4
--- /dev/null
+++ b/frontend/app/queue/[id]/QueueIdPage.module.css
@@ -0,0 +1,7 @@
+.timelineBottom {
+  display: flex;
+  gap: 25rem;
+  @media (max-width: $mantine-breakpoint-sm) {
+    display: block;
+  }
+}
diff --git a/frontend/app/queue/[id]/page.tsx b/frontend/app/queue/[id]/page.tsx
new file mode 100644
index 00000000..de151eaf
--- /dev/null
+++ b/frontend/app/queue/[id]/page.tsx
@@ -0,0 +1,59 @@
+"use client"
+import QueueGeneralTimeline from "@/app/components/queue/GeneralTimeline";
+import QueueHeader from "@/app/components/queue/Header";
+import QueueVideoTimeline from "@/app/components/queue/VideoTimeline";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { useGetQueueItem } from "@/app/hooks/useQueue";
+import { Center } from "@mantine/core";
+import React, { useEffect } from "react";
+import classes from "./QueueIdPage.module.css"
+import QueueChatTimeline from "@/app/components/queue/ChatTimeline";
+
+interface Params {
+  id: string;
+}
+
+const QueueIdPage = ({ params }: { params: Promise<Params> }) => {
+  const { id } = React.use(params);
+  useEffect(() => {
+    document.title = `Queue - ${id}`;
+  }, [id]);
+
+  const axiosPrivate = useAxiosPrivate()
+
+  const { data, isPending, isError } = useGetQueueItem(axiosPrivate, id, {
+    refetchInterval: 1000
+  })
+
+  if (isPending) return (
+    <GanymedeLoadingText message="Loading Queue" />
+  )
+  if (isError) return <div>Error loading queue</div>
+
+  return (
+    <div>
+      <QueueHeader queue={data} />
+      <div>
+        <Center pt={25}>
+          <QueueGeneralTimeline queue={data} />
+        </Center>
+      </div>
+      <Center>
+        <div className={classes.timelineBottom}>
+          <div
+            style={{ paddingTop: "25px" }}
+            className={classes.videoTimeline}
+          >
+            <QueueVideoTimeline queue={data} />
+          </div>
+          <div style={{ paddingTop: "25px" }}>
+            <QueueChatTimeline queue={data} />
+          </div>
+        </div>
+      </Center>
+    </div>
+  );
+}
+
+export default QueueIdPage;
\ No newline at end of file
diff --git a/frontend/app/queue/logs/[id]/QueueLogsPage.module.css b/frontend/app/queue/logs/[id]/QueueLogsPage.module.css
new file mode 100644
index 00000000..563d6da0
--- /dev/null
+++ b/frontend/app/queue/logs/[id]/QueueLogsPage.module.css
@@ -0,0 +1,10 @@
+.logPage {
+  background-color: black;
+  color: white;
+  overflow-y: scroll;
+  height: calc(100vh - rem(56px));
+  max-height: calc(100vh - rem(56px));
+}
+.logLine {
+  white-space: pre;
+}
diff --git a/frontend/app/queue/logs/[id]/page.tsx b/frontend/app/queue/logs/[id]/page.tsx
new file mode 100644
index 00000000..3ac72e4c
--- /dev/null
+++ b/frontend/app/queue/logs/[id]/page.tsx
@@ -0,0 +1,55 @@
+"use client"
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import { useAxiosPrivate } from "@/app/hooks/useAxios";
+import { QueueLogType, useGetQueueLogs } from "@/app/hooks/useQueue";
+import { Box } from "@mantine/core";
+import { useSearchParams } from "next/navigation";
+import React, { useEffect, useRef } from "react";
+import classes from "./QueueLogsPage.module.css"
+
+interface Params {
+  id: string;
+}
+
+const QueueLogsPage = ({ params }: { params: Promise<Params> }) => {
+  const { id } = React.use(params);
+  useEffect(() => {
+    document.title = `Queue Logs - ${id}`;
+  }, [id]);
+
+  const searchParams = useSearchParams()
+  const logEndRef = useRef<HTMLDivElement>(null);
+  const logType: QueueLogType = (searchParams.get('log') as QueueLogType) ?? 'video';
+
+  const axiosPrivate = useAxiosPrivate()
+
+
+
+  const { data, isPending, isError } = useGetQueueLogs(axiosPrivate, id, logType)
+
+  useEffect(() => {
+    const logScrollInterval = setInterval(() => {
+      if (logEndRef.current) {
+        logEndRef.current.scrollIntoView();
+      }
+    }, 1000);
+    return () => clearInterval(logScrollInterval);
+  });
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading logs" />
+  }
+
+  if (isError) {
+    return <div>Error loading logs</div>
+  }
+
+  return (
+    <Box className={classes.logPage}>
+      <div className={classes.logLine} dangerouslySetInnerHTML={{ __html: data }}></div>
+      <div ref={logEndRef}></div>
+    </Box>
+  );
+}
+
+export default QueueLogsPage;
\ No newline at end of file
diff --git a/frontend/app/queue/page.tsx b/frontend/app/queue/page.tsx
new file mode 100644
index 00000000..01d9309e
--- /dev/null
+++ b/frontend/app/queue/page.tsx
@@ -0,0 +1,256 @@
+"use client"
+import { useEffect, useState } from "react";
+import { useAxiosPrivate } from "../hooks/useAxios";
+import { Queue, QueueTaskStatus, useGetQueueItems, useStopQueueItem } from "../hooks/useQueue";
+import GanymedeLoadingText from "../components/utils/GanymedeLoadingText";
+import { DataTable } from "mantine-datatable";
+import { Tooltip, Text, ThemeIcon, ActionIcon, Loader, Container, Modal, Switch, Button } from "@mantine/core";
+import { IconEye, IconPlayerPause, IconSquareX } from "@tabler/icons-react";
+import Link from "next/link";
+import classes from "./QueuePage.module.css"
+import { useDisclosure } from "@mantine/hooks";
+import { useDeleteVideo } from "../hooks/useVideos";
+import { useBlockVideo } from "../hooks/useBlockedVideos";
+import { useQueryClient } from "@tanstack/react-query";
+import { showNotification } from "@mantine/notifications";
+
+const QueuePage = () => {
+  useEffect(() => {
+    document.title = "Queue";
+  }, []);
+
+  const [page, setPage] = useState(1);
+  const [perPage, setPerPage] = useState(10);
+  const [records, setRecords] = useState<Queue[]>([]);
+  const [initialRecords, setInitialRecords] = useState(false);
+  const [activeQueue, setActiveQueue] = useState<Queue | null>(null);
+
+  // delete state
+  const [deleteModalOpened, { open: openDeleteModal, close: closeDeleteModal }] = useDisclosure(false);
+  const [cancelQueueLoading, setCancelQueueLoading] = useState(false);
+  const [deleteVideoAndFiles, setDeleteVideoAndFiles] = useState(false);
+  const [blockVideoId, setBlockVideoId] = useState(false);
+
+  const axiosPrivate = useAxiosPrivate()
+  const queryClient = useQueryClient()
+
+  const stopQueueItemMutate = useStopQueueItem()
+  const deleteVideoMutate = useDeleteVideo()
+  const blockVideoMutate = useBlockVideo()
+
+  const { data: queueItems, isPending: queueIsPending, isError: queueIsError } = useGetQueueItems(axiosPrivate, true)
+
+  useEffect(() => {
+    if (queueItems && !initialRecords) {
+      setRecords(queueItems.slice(0, perPage));
+      setInitialRecords(true);
+    }
+    if (queueItems) {
+      const from = (page - 1) * perPage;
+      const to = from + perPage;
+      setRecords(queueItems.slice(from, to));
+    }
+  }, [queueItems, page, perPage, initialRecords]);
+
+  const checkFailed = (record: Queue) => {
+    if (
+      record.task_vod_create_folder == QueueTaskStatus.Failed ||
+      record.task_vod_save_info == QueueTaskStatus.Failed ||
+      record.task_video_download == QueueTaskStatus.Failed ||
+      record.task_video_convert == QueueTaskStatus.Failed ||
+      record.task_video_move == QueueTaskStatus.Failed ||
+      record.task_chat_download == QueueTaskStatus.Failed ||
+      record.task_chat_convert == QueueTaskStatus.Failed ||
+      record.task_chat_render == QueueTaskStatus.Failed ||
+      record.task_chat_move == QueueTaskStatus.Failed
+    ) {
+      return true;
+    }
+    return false;
+  };
+
+  const cancelQueueItem = async () => {
+    try {
+
+      if (activeQueue == null) return;
+
+      setCancelQueueLoading(true)
+
+      // cancel queue item
+      stopQueueItemMutate.mutateAsync({
+        axiosPrivate: axiosPrivate,
+        id: activeQueue.id
+      })
+
+      // delete video and files if requested
+      if (deleteVideoAndFiles) {
+        deleteVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          id: activeQueue.edges.vod.id,
+          deleteFiles: true
+        })
+      }
+
+      // block video id if requested
+      if (blockVideoId) {
+        blockVideoMutate.mutateAsync({
+          axiosPrivate: axiosPrivate,
+          id: activeQueue.edges.vod.ext_id
+        })
+      }
+
+      queryClient.invalidateQueries({ queryKey: ["queue"] })
+
+      showNotification({
+        message: "Queue item has been cancelled"
+      })
+
+      closeDeleteModal()
+    } catch (error) {
+      console.log(error)
+    } finally {
+      setCancelQueueLoading(false)
+      setActiveQueue(null)
+    }
+
+  }
+
+  if (queueIsPending) return (
+    <GanymedeLoadingText message="Loading Queue" />
+  )
+  if (queueIsError) return <div>Error loading queue</div>
+
+  return (
+
+    <div>
+      <Container mt={10} size="7xl">
+        <DataTable
+          withTableBorder
+          borderRadius="sm"
+          withColumnBorders
+          striped
+          highlightOnHover
+          records={records}
+          columns={[
+            {
+              accessor: "id",
+              title: "ID",
+            },
+            { accessor: "edges.vod.edges.channel.name", title: "Channel" },
+            { accessor: "edges.vod.ext_id", title: "External ID" },
+            {
+              accessor: "processing",
+              title: "Status",
+              render: (value) => (
+                <div>
+                  {checkFailed(value) && (
+                    <div>
+                      <Tooltip label="Task in 'failed' state">
+                        <Text className={classes.errBadge}>ERROR</Text>
+                      </Tooltip>
+                    </div>
+                  )}
+                  {value.processing && !checkFailed(value) && !value.on_hold && (
+                    <div>
+                      <Tooltip label="Processing">
+                        <Loader mt={2} color="green" size="sm" />
+                      </Tooltip>
+                    </div>
+                  )}
+                  {value.processing && !checkFailed(value) && value.on_hold && (
+                    <div>
+                      <Tooltip label="On Hold">
+                        <ThemeIcon variant="outline" color="orange">
+                          <IconPlayerPause />
+                        </ThemeIcon>
+                      </Tooltip>
+                    </div>
+                  )}
+                </div>
+              ),
+            },
+
+            {
+              accessor: "live_archive",
+              title: "Live Archive",
+              render: ({ live_archive }) => (
+                <Text>{live_archive ? "✅" : "❌"}</Text>
+              ),
+            },
+            {
+              accessor: "created_at",
+              title: "Created At",
+              render: ({ created_at }) => (
+                <Text>{new Date(created_at).toLocaleString()}</Text>
+              ),
+            },
+            {
+              accessor: "actions",
+              title: "Actions",
+              render: (record) => (
+                <div
+                  style={{
+                    display: "flex",
+                    justifyContent: "space-between",
+                    alignItems: "center",
+                  }}
+                >
+                  <Link href={"/queue/" + record.id}>
+                    <Tooltip label="View queue item" withinPortal>
+                      <ActionIcon variant="light">
+                        <IconEye size="1.125rem" />
+                      </ActionIcon>
+                    </Tooltip>
+                  </Link>
+                  <Tooltip label="Stop queue item" withinPortal>
+                    <ActionIcon
+                      variant="light"
+                      color="red"
+                      onClick={() => {
+                        setActiveQueue(record);
+                        openDeleteModal();
+                      }}
+                    >
+                      <IconSquareX size="1.125rem" />
+                    </ActionIcon>
+                  </Tooltip>
+                </div>
+              ),
+            },
+          ]}
+          totalRecords={queueItems.length}
+          page={page}
+          recordsPerPage={perPage}
+          onPageChange={(p) => setPage(p)}
+          recordsPerPageOptions={[10, 20, 50]}
+          onRecordsPerPageChange={setPerPage}
+        />
+      </Container>
+      <Modal opened={deleteModalOpened} onClose={closeDeleteModal} title="Cancel Queue Item">
+        <div>
+          <Text>Are you sure you want to cancel the queue item?</Text>
+          <Text size="sm" fs="italic">For live archives this will stop the video and chat download then proceed with post-processing. For VOD archives this will stop all the tasks.</Text>
+          <Switch
+            mt={5}
+            defaultChecked
+            color="red"
+            label="Delete video and video files"
+            checked={deleteVideoAndFiles}
+            onChange={(event) => setDeleteVideoAndFiles(event.currentTarget.checked)}
+          />
+          {(activeQueue != null && !activeQueue.live_archive) && (<Switch
+            mt={5}
+            defaultChecked
+            color="violet"
+            label="Block video ID"
+            checked={blockVideoId}
+            onChange={(event) => setBlockVideoId(event.currentTarget.checked)}
+          />)}
+          <Button variant="filled" color="orange" fullWidth loading={cancelQueueLoading} mt={10} onClick={cancelQueueItem}>Cancel Queue Item</Button>
+        </div>
+      </Modal>
+    </div>
+  );
+}
+
+export default QueuePage;
\ No newline at end of file
diff --git a/frontend/app/register/page.tsx b/frontend/app/register/page.tsx
new file mode 100644
index 00000000..da18e931
--- /dev/null
+++ b/frontend/app/register/page.tsx
@@ -0,0 +1,19 @@
+'use client'
+import { Container } from "@mantine/core";
+import { AuthenticationForm, AuthFormType } from "../components/authentication/AuthenticationForm";
+import { useEffect } from "react";
+
+const Loginpage = () => {
+  useEffect(() => {
+    document.title = "Register";
+  }, []);
+  return (
+    <div>
+      <Container mt={25}>
+        <AuthenticationForm type={AuthFormType.Register} />
+      </Container>
+    </div>
+  );
+}
+
+export default Loginpage;
\ No newline at end of file
diff --git a/frontend/app/search/page.tsx b/frontend/app/search/page.tsx
new file mode 100644
index 00000000..abfb3d74
--- /dev/null
+++ b/frontend/app/search/page.tsx
@@ -0,0 +1,77 @@
+"use client";
+
+import { useSearchParams } from "next/navigation";
+import { useEffect, useRef, useState } from "react";
+import { useSearchVideos, VideoType } from "../hooks/useVideos";
+import useSettingsStore from "../store/useSettingsStore";
+import GanymedeLoadingText from "../components/utils/GanymedeLoadingText";
+import VideoGrid from "../components/videos/Grid";
+import { Center, Container, Title } from "@mantine/core";
+
+const SearchPage = () => {
+  const searchParams = useSearchParams();
+  const queryParam = searchParams.get("q");
+
+  useEffect(() => {
+    document.title = `Search - ${queryParam}`;
+  }, [queryParam]);
+
+  // State and ref for search query
+  const [searchQuery, setSearchQuery] = useState(queryParam || "");
+  const defaultSearchQuery = useRef("");
+
+  useEffect(() => {
+    if (queryParam && queryParam.length > 0) {
+      setSearchQuery(queryParam)
+    } else {
+      defaultSearchQuery.current = ""
+    }
+  }, [queryParam]);
+
+  const [activePage, setActivePage] = useState(1);
+  const [videoTypes, setVideoTypes] = useState<VideoType[]>([]);
+
+  const videoLimit = useSettingsStore((state) => state.videoLimit);
+  const setVideoLimit = useSettingsStore((state) => state.setVideoLimit);
+
+  const { data: videos, isPending, isError } = useSearchVideos({
+    limit: videoLimit,
+    offset: (activePage - 1) * videoLimit,
+    query: searchQuery || defaultSearchQuery.current, // Use state or ref
+    types: videoTypes,
+  });
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading Videos" />;
+  }
+
+  if (isError) {
+    return <div>Error loading videos</div>;
+  }
+
+  return (
+    <div>
+      <Center mt={10}>
+        <Title>Search</Title>
+      </Center>
+
+
+
+      <Container size="xl" px="xl" fluid={true}>
+        <VideoGrid
+          videos={videos.data}
+          totalPages={videos.pages}
+          currentPage={activePage}
+          onPageChange={setActivePage}
+          isPending={isPending}
+          videoLimit={videoLimit}
+          onVideoLimitChange={setVideoLimit}
+          onVideoTypeChange={setVideoTypes}
+          showChannel={true}
+        />
+      </Container>
+    </div>
+  );
+};
+
+export default SearchPage;
diff --git a/frontend/app/store/useAuthStore.ts b/frontend/app/store/useAuthStore.ts
new file mode 100644
index 00000000..1ce19c90
--- /dev/null
+++ b/frontend/app/store/useAuthStore.ts
@@ -0,0 +1,116 @@
+import { create } from "zustand";
+import { persist } from "zustand/middleware";
+import { getUserInfo, User, UserRole } from "../hooks/useAuthentication";
+
+const roleHierarchy: { [key in UserRole]: number } = {
+  [UserRole.Admin]: 4,
+  [UserRole.Editor]: 3,
+  [UserRole.Archiver]: 2,
+  [UserRole.User]: 1,
+};
+
+interface AuthState {
+  user: User | null;
+  isLoggedIn: boolean;
+  isLoading: boolean;
+  error: string | null;
+
+  // Actions
+  fetchUser: () => Promise<void>;
+  setUser: (user: User | null) => void;
+  logout: () => void;
+  clearError: () => void;
+
+  // Permission checking
+  hasPermission: (requiredRole: UserRole) => boolean;
+  isAdmin: () => boolean;
+  isEditor: () => boolean;
+  isArchiver: () => boolean;
+}
+
+// Create store
+const useAuthStore = create<AuthState>()(
+  persist(
+    (set, get) => ({
+      // Initial state
+      user: null,
+      isLoggedIn: false,
+      isLoading: true,
+      error: null,
+
+      // Fetch user data from API
+      fetchUser: async () => {
+        try {
+          set({ isLoading: true, error: null });
+          const data = await getUserInfo();
+          set({
+            user: data.data,
+            isLoggedIn: true,
+            isLoading: false,
+          });
+        } catch (err) {
+          set({
+            error: err instanceof Error ? err.message : "Failed to fetch user",
+            isLoading: false,
+          });
+        }
+      },
+
+      // Manually set user data
+      setUser: (user) => {
+        set({
+          user,
+          isLoggedIn: !!user,
+          error: null,
+        });
+      },
+
+      // Clear user data on logout
+      logout: () => {
+        set({
+          user: null,
+          isLoggedIn: false,
+          error: null,
+        });
+      },
+
+      // Clear any error messages
+      clearError: () => {
+        set({ error: null });
+      },
+
+      // Check if current user has required role permissions
+      hasPermission: (requiredRole: UserRole) => {
+        const { user } = get();
+        if (!user) return false;
+        return roleHierarchy[user.role] >= roleHierarchy[requiredRole];
+      },
+
+      // Convenience methods for common role checks
+      isAdmin: () => {
+        const { user } = get();
+        return user?.role === UserRole.Admin;
+      },
+
+      isEditor: () => {
+        const { hasPermission } = get();
+        return hasPermission(UserRole.Editor);
+      },
+
+      isArchiver: () => {
+        const { hasPermission } = get();
+        return hasPermission(UserRole.Archiver);
+      },
+    }),
+    {
+      name: "auth-storage", // localStorage key
+      // Only persist certain fields
+      partialize: (state) => ({
+        user: state.user,
+        isLoggedIn: state.isLoggedIn,
+      }),
+    }
+  )
+);
+
+export default useAuthStore;
diff --git a/frontend/app/store/usePlayerSore.ts b/frontend/app/store/usePlayerSore.ts
new file mode 100644
index 00000000..f98b0c7f
--- /dev/null
+++ b/frontend/app/store/usePlayerSore.ts
@@ -0,0 +1,26 @@
+import { create } from "zustand";
+
+interface VideoPlayerState {
+  time: number;
+  isPlaying: boolean;
+  isPaused: boolean;
+  updatePlayerState: (state: {
+    time?: number;
+    isPlaying?: boolean;
+    isPaused?: boolean;
+  }) => void;
+}
+
+const useVideoPlayerStore = create<VideoPlayerState>((set) => ({
+  time: 0,
+  isPlaying: false,
+  isPaused: true,
+  updatePlayerState: (newState) =>
+    set((currentState) => ({
+      time: newState.time ?? currentState.time,
+      isPlaying: newState.isPlaying ?? currentState.isPlaying,
+      isPaused: newState.isPaused ?? currentState.isPaused,
+    })),
+}));
+
+export default useVideoPlayerStore;
diff --git a/frontend/app/store/useSettingsStore.ts b/frontend/app/store/useSettingsStore.ts
new file mode 100644
index 00000000..2b7a8e57
--- /dev/null
+++ b/frontend/app/store/useSettingsStore.ts
@@ -0,0 +1,46 @@
+import { create } from "zustand";
+import { persist } from "zustand/middleware";
+
+interface SettingsState {
+  videoLimit: number;
+  chatPlaybackSmoothScroll: boolean;
+  videoTheaterMode: boolean;
+  showChatHistogram: boolean;
+  setVideoLimit: (limit: number) => void;
+  setChatPlaybackSmoothScroll: (smooth: boolean) => void;
+  setVideoTheaterMode: (theaterMode: boolean) => void;
+  setShowChatHistogram: (show: boolean) => void;
+}
+
+// Create the store with persist middleware
+const useSettingsStore = create<SettingsState>()(
+  persist(
+    (set) => ({
+      // Initial state
+      videoLimit: 24,
+      chatPlaybackSmoothScroll: false,
+      videoTheaterMode: false,
+      showChatHistogram: true,
+
+      setVideoLimit: (limit: number) => set({ videoLimit: limit }),
+
+      setChatPlaybackSmoothScroll: (smooth: boolean) =>
+        set({ chatPlaybackSmoothScroll: smooth }),
+
+      setVideoTheaterMode: (theaterMode: boolean) =>
+        set({ videoTheaterMode: theaterMode }),
+
+      setShowChatHistogram: (show: boolean) => set({ showChatHistogram: show }),
+    }),
+    {
+      name: "settings-storage",
+      partialize: (state) => ({
+        videoLimit: state.videoLimit,
+        chatPlaybackSmoothScroll: state.chatPlaybackSmoothScroll,
+        showChatHistogram: state.showChatHistogram,
+      }),
+    }
+  )
+);
+
+export default useSettingsStore;
diff --git a/frontend/app/store/useStore.ts b/frontend/app/store/useStore.ts
new file mode 100644
index 00000000..22aaf28b
--- /dev/null
+++ b/frontend/app/store/useStore.ts
@@ -0,0 +1,17 @@
+import { useState, useEffect } from "react";
+
+const useStore = <T, F>(
+  store: (callback: (state: T) => unknown) => unknown,
+  callback: (state: T) => F
+) => {
+  const result = store(callback) as F;
+  const [data, setData] = useState<F>();
+
+  useEffect(() => {
+    setData(result);
+  }, [result]);
+
+  return data;
+};
+
+export default useStore;
diff --git a/frontend/app/util/VideoEventBus.ts b/frontend/app/util/VideoEventBus.ts
new file mode 100644
index 00000000..e1b59ff2
--- /dev/null
+++ b/frontend/app/util/VideoEventBus.ts
@@ -0,0 +1,28 @@
+interface Data {
+  time: number;
+  isPlaying: boolean;
+  isPaused: boolean;
+}
+
+class VideoEventBus {
+  data: Data;
+
+  constructor() {
+    this.data = {
+      time: 0,
+      isPlaying: false,
+      isPaused: true,
+    };
+  }
+
+  setData(data: Data) {
+    this.data = data;
+  }
+
+  getData() {
+    return this.data;
+  }
+}
+
+const videoEventBusInstance = new VideoEventBus();
+export default videoEventBusInstance;
diff --git a/frontend/app/util/chat.ts b/frontend/app/util/chat.ts
new file mode 100644
index 00000000..e69de29b
diff --git a/frontend/app/util/queue.ts b/frontend/app/util/queue.ts
new file mode 100644
index 00000000..88065ed2
--- /dev/null
+++ b/frontend/app/util/queue.ts
@@ -0,0 +1,12 @@
+import { QueueLogType } from "../hooks/useQueue";
+
+const windowFeatures = "left=100,top=100,width=720,height=620";
+
+// open a queue task's log in a new window
+export const openQueueTaskLog = (queueId: string, logName: QueueLogType) => {
+  window.open(
+    `/queue/logs/${queueId}?log=${logName}`,
+    "Queue Task Log",
+    windowFeatures
+  );
+};
diff --git a/frontend/app/util/util.ts b/frontend/app/util/util.ts
new file mode 100644
index 00000000..13c1db36
--- /dev/null
+++ b/frontend/app/util/util.ts
@@ -0,0 +1,14 @@
+export function escapeURL(str: string): string {
+  return str.replace(/#/g, "%23");
+}
+
+// saves an npm depedency - can't use the crypto API as that is not available over HTTP
+// https://stackoverflow.com/questions/105034/how-do-i-create-a-guid-uuid
+export function uuidv4() {
+  return "10000000-1000-4000-8000-100000000000".replace(/[018]/g, (c) =>
+    (
+      +c ^
+      (crypto.getRandomValues(new Uint8Array(1))[0] & (15 >> (+c / 4)))
+    ).toString(16)
+  );
+}
diff --git a/frontend/app/videos/[id]/VideoPage.module.css b/frontend/app/videos/[id]/VideoPage.module.css
new file mode 100644
index 00000000..fc0e8f4b
--- /dev/null
+++ b/frontend/app/videos/[id]/VideoPage.module.css
@@ -0,0 +1,64 @@
+.container {
+  display: flex;
+}
+
+.leftColumn {
+  flex-grow: 1;
+  width: calc(100vw - 340px);
+}
+
+.leftColumnNoChat {
+  flex-grow: 1;
+  width: 100vw;
+}
+
+.rightColumn {
+  min-width: 340px;
+  width: 340px;
+  max-width: 340px;
+}
+
+.videoPlayer {
+  width: 100%;
+  height: calc(100vh - rem(56px) - 60px);
+  max-height: calc(100vh - rem(56px) - 60px);
+
+  @media (max-width: em(1000px)) {
+    height: auto !important;
+    max-height: auto !important;
+  }
+}
+.videoPlayerTheaterMode {
+  width: 100%;
+  height: 100vh;
+  max-height: 100vh;
+}
+
+.chatColumn {
+  width: 100%;
+  height: calc(100vh - rem(56px) - 60px);
+  max-height: calc(100vh - rem(56px) - 60px);
+}
+.chatColumnTheaterMode {
+  width: 100%;
+  height: 100vh;
+  max-height: 100vh;
+}
+
+.containerMobile {
+  display: flex;
+  width: 100vw;
+
+  @media (max-aspect-ratio: 1/1) {
+    /* Portrait mode */
+    flex-direction: column;
+    height: calc(100vh - 60px);
+    max-height: calc(100vh - 60px);
+  }
+}
+
+.chatColumnMobile {
+  flex-grow: 1;
+  overflow-y: auto;
+  max-height: 100%;
+}
diff --git a/frontend/app/videos/[id]/page.tsx b/frontend/app/videos/[id]/page.tsx
new file mode 100644
index 00000000..d59cfab8
--- /dev/null
+++ b/frontend/app/videos/[id]/page.tsx
@@ -0,0 +1,155 @@
+"use client"
+import { useFetchVideo, useGetVideoClips, VideoType } from "@/app/hooks/useVideos";
+import React, { useEffect } from "react";
+import classes from "./VideoPage.module.css"
+import { Box, Container, useMantineTheme } from "@mantine/core";
+import VideoPlayer from "@/app/components/videos/Player";
+import VideoTitleBar from "@/app/components/videos/TitleBar";
+import ChatPlayer from "@/app/components/videos/ChatPlayer";
+import GanymedeLoadingText from "@/app/components/utils/GanymedeLoadingText";
+import useSettingsStore from "@/app/store/useSettingsStore";
+import { useFullscreen, useMediaQuery } from "@mantine/hooks";
+import { env } from "next-runtime-env";
+import VideoLoginRequired from "@/app/components/videos/LoginRequired";
+import useAuthStore from "@/app/store/useAuthStore";
+import VideoPageClips from "@/app/components/videos/VideoClips";
+import VideoChatHistogram from "@/app/components/videos/ChatHistogram";
+
+interface Params {
+  id: string;
+}
+
+const VideoPage = ({ params }: { params: Promise<Params> }) => {
+  const theme = useMantineTheme()
+  const { id } = React.use(params);
+  const { isLoggedIn } = useAuthStore()
+
+  const isMobile = useMediaQuery(`(max-width: ${theme.breakpoints.sm})`);
+
+  const videoTheaterMode = useSettingsStore((state) => state.videoTheaterMode);
+  const showChatHistogram = useSettingsStore((state) => state.showChatHistogram);
+  // eslint-disable-next-line @typescript-eslint/no-unused-vars
+  const { ref, toggle, fullscreen } = useFullscreen();
+
+  const { data, isPending, isError } = useFetchVideo({ id, with_channel: true, with_chapters: true, with_muted_segments: true })
+
+  // need to fetch clips here to dynamically render the clips section
+  const { data: videoClips, isPending: videoClipsPending, isError: videoClipsError } = useGetVideoClips(id)
+
+  useEffect(() => {
+    document.title = `${data?.title}`;
+  }, [data?.title]);
+
+  // check if login is required
+  const isLoginRequired = () => {
+    if (
+      env('NEXT_PUBLIC_REQUIRE_LOGIN') == "true" && !isLoggedIn
+    ) {
+      return true
+    }
+    return false
+  }
+
+  if (isPending) {
+    return <GanymedeLoadingText message="Loading Video" />
+  }
+  if (isError) {
+    return <div>Error loading video</div>
+  }
+
+
+  if (isLoginRequired()) {
+    return <VideoLoginRequired video={data} />
+  }
+
+  if (isMobile) {
+    return (
+      <Box className={classes.containerMobile}>
+
+        {/* Video player */}
+        <div>
+          <VideoPlayer video={data} />
+        </div>
+
+        {/* Chat player */}
+        {data.chat_path && (
+          <div className={classes.chatColumnMobile}>
+            <ChatPlayer video={data} />
+          </div>
+        )}
+
+        {/* Title bar */}
+        {!videoTheaterMode && <VideoTitleBar video={data} />}
+
+        {/* Items below the player are not available in mobile */}
+
+      </Box>
+    )
+  }
+
+  return (
+    <div>
+      {/* Hide navbar. I don't like doing this but the navbar ruins the experience */}
+      <style jsx>{`
+        :global(html)::-webkit-scrollbar {
+          display: none;
+        }
+        :global(html) {
+          -ms-overflow-style: none; /* IE and Edge */
+          scrollbar-width: none; /* Firefox */
+        }
+      `}</style>
+
+      {/* Player and chat section */}
+      <Box className={classes.container}>
+        {/* Player */}
+        <div className={!data.chat_path ? classes.leftColumnNoChat : classes.leftColumn}>
+          <div className={
+            videoTheaterMode || fullscreen ? classes.videoPlayerTheaterMode : classes.videoPlayer
+          }>
+            <VideoPlayer video={data} />
+          </div>
+        </div>
+
+
+        {/* Chat */}
+        {data.chat_path && (
+          <div className={classes.rightColumn} style={{ height: "auto", maxHeight: "auto" }}>
+            <div className={
+              videoTheaterMode || fullscreen
+                ? classes.chatColumnTheaterMode
+                : classes.chatColumn
+            }
+            >
+              <ChatPlayer video={data} />
+            </div>
+          </div>
+        )}
+
+      </Box>
+
+      {/* Title bar */}
+      {!videoTheaterMode && <VideoTitleBar video={data} />}
+
+      {/* Video clips */}
+      <Container size="7xl" fluid={true} >
+        {videoClipsError && (
+          <div>Error loading clips</div>
+        )}
+        {((!videoClipsPending) && (videoClips && videoClips.length > 0)) && (
+          <VideoPageClips clips={videoClips} />
+        )}
+      </Container>
+
+      {/* Chat Histogram */}
+      {(data.chat_path && (data.type != VideoType.Clip) && !isMobile && showChatHistogram) && (
+        <Container size="7xl" fluid={true} >
+          <VideoChatHistogram videoId={data.id} />
+        </Container>
+      )}
+
+    </div>
+  );
+}
+
+export default VideoPage;
\ No newline at end of file
diff --git a/frontend/next.config.ts b/frontend/next.config.ts
new file mode 100644
index 00000000..aa3a377f
--- /dev/null
+++ b/frontend/next.config.ts
@@ -0,0 +1,16 @@
+import type { NextConfig } from "next";
+import { makeEnvPublic } from "next-runtime-env";
+
+makeEnvPublic([
+  "API_URL",
+  "CDN_URL",
+  "SHOW_SSO_LOGIN_BUTTON",
+  "FORCE_SSO_AUTH",
+  "REQUIRE_LOGIN",
+]);
+
+const nextConfig: NextConfig = {
+  output: "standalone",
+};
+
+export default nextConfig;
diff --git a/frontend/package-lock.json b/frontend/package-lock.json
new file mode 100644
index 00000000..79831de9
--- /dev/null
+++ b/frontend/package-lock.json
@@ -0,0 +1,6175 @@
+{
+  "name": "ganymede-frontend-nextjs",
+  "version": "0.1.0",
+  "lockfileVersion": 3,
+  "requires": true,
+  "packages": {
+    "": {
+      "name": "ganymede-frontend-nextjs",
+      "version": "0.1.0",
+      "dependencies": {
+        "@mantine/carousel": "^7.15.1",
+        "@mantine/charts": "^7.15.1",
+        "@mantine/core": "^7.15.1",
+        "@mantine/dates": "^7.15.1",
+        "@mantine/form": "^7.15.1",
+        "@mantine/hooks": "^7.15.1",
+        "@mantine/notifications": "^7.15.1",
+        "@tabler/icons-react": "^3.26.0",
+        "@tanstack/react-query": "^5.62.8",
+        "@tanstack/react-query-devtools": "^5.62.8",
+        "@vidstack/react": "^1.11.30",
+        "axios": "^1.7.9",
+        "clsx": "^2.1.1",
+        "dayjs": "^1.11.13",
+        "embla-carousel-react": "^7.1.0",
+        "lodash": "^4.17.21",
+        "mantine-datatable": "^7.15.1",
+        "mantine-form-zod-resolver": "^1.1.0",
+        "next": "^15.1.2",
+        "next-runtime-env": "^3.2.2",
+        "react": "^19.0.0",
+        "react-dom": "^19.0.0",
+        "recharts": "^2.15.0",
+        "zod": "^3.24.1",
+        "zustand": "^5.0.2"
+      },
+      "devDependencies": {
+        "@tanstack/eslint-plugin-query": "^5.62.1",
+        "@types/lodash": "^4.17.13",
+        "@types/node": "^22",
+        "@types/react": "^19",
+        "@types/react-dom": "^19",
+        "eslint": "^8",
+        "eslint-config-next": "^15.1.2",
+        "postcss": "^8.4.49",
+        "postcss-preset-mantine": "^1.17.0",
+        "postcss-simple-vars": "^7.0.1",
+        "typescript": "^5"
+      }
+    },
+    "node_modules/@babel/runtime": {
+      "version": "7.26.0",
+      "resolved": "https://registry.npmjs.org/@babel/runtime/-/runtime-7.26.0.tgz",
+      "integrity": "sha512-FDSOghenHTiToteC/QRlv2q3DhPZ/oOXTBoirfWNx1Cx3TMVcGWQtMMmQcSvb/JjpNeGzx8Pq/b4fKEJuWm1sw==",
+      "dependencies": {
+        "regenerator-runtime": "^0.14.0"
+      },
+      "engines": {
+        "node": ">=6.9.0"
+      }
+    },
+    "node_modules/@emnapi/runtime": {
+      "version": "1.3.1",
+      "resolved": "https://registry.npmjs.org/@emnapi/runtime/-/runtime-1.3.1.tgz",
+      "integrity": "sha512-kEBmG8KyqtxJZv+ygbEim+KCGtIq1fC22Ms3S4ziXmYKm8uyoLX0MHONVKwp+9opg390VaKRNt4a7A9NwmpNhw==",
+      "optional": true,
+      "dependencies": {
+        "tslib": "^2.4.0"
+      }
+    },
+    "node_modules/@eslint-community/eslint-utils": {
+      "version": "4.4.1",
+      "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.4.1.tgz",
+      "integrity": "sha512-s3O3waFUrMV8P/XaF/+ZTp1X9XBZW1a4B97ZnjQF2KYWaFD2A8KyFBsrsfSjEmjn3RGWAIuvlneuZm3CUK3jbA==",
+      "dev": true,
+      "dependencies": {
+        "eslint-visitor-keys": "^3.4.3"
+      },
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      },
+      "peerDependencies": {
+        "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0"
+      }
+    },
+    "node_modules/@eslint-community/regexpp": {
+      "version": "4.12.1",
+      "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.12.1.tgz",
+      "integrity": "sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==",
+      "dev": true,
+      "engines": {
+        "node": "^12.0.0 || ^14.0.0 || >=16.0.0"
+      }
+    },
+    "node_modules/@eslint/eslintrc": {
+      "version": "2.1.4",
+      "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.4.tgz",
+      "integrity": "sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==",
+      "dev": true,
+      "dependencies": {
+        "ajv": "^6.12.4",
+        "debug": "^4.3.2",
+        "espree": "^9.6.0",
+        "globals": "^13.19.0",
+        "ignore": "^5.2.0",
+        "import-fresh": "^3.2.1",
+        "js-yaml": "^4.1.0",
+        "minimatch": "^3.1.2",
+        "strip-json-comments": "^3.1.1"
+      },
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/@eslint/js": {
+      "version": "8.57.1",
+      "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.57.1.tgz",
+      "integrity": "sha512-d9zaMRSTIKDLhctzH12MtXvJKSSUhaHcjV+2Z+GK+EEY7XKpP5yR4x+N3TAcHTcu963nIr+TMcCb4DBCYX1z6Q==",
+      "dev": true,
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      }
+    },
+    "node_modules/@floating-ui/core": {
+      "version": "1.6.8",
+      "resolved": "https://registry.npmjs.org/@floating-ui/core/-/core-1.6.8.tgz",
+      "integrity": "sha512-7XJ9cPU+yI2QeLS+FCSlqNFZJq8arvswefkZrYI1yQBbftw6FyrZOxYSh+9S7z7TpeWlRt9zJ5IhM1WIL334jA==",
+      "dependencies": {
+        "@floating-ui/utils": "^0.2.8"
+      }
+    },
+    "node_modules/@floating-ui/dom": {
+      "version": "1.6.12",
+      "resolved": "https://registry.npmjs.org/@floating-ui/dom/-/dom-1.6.12.tgz",
+      "integrity": "sha512-NP83c0HjokcGVEMeoStg317VD9W7eDlGK7457dMBANbKA6GJZdc7rjujdgqzTaz93jkGgc5P/jeWbaCHnMNc+w==",
+      "dependencies": {
+        "@floating-ui/core": "^1.6.0",
+        "@floating-ui/utils": "^0.2.8"
+      }
+    },
+    "node_modules/@floating-ui/react": {
+      "version": "0.26.28",
+      "resolved": "https://registry.npmjs.org/@floating-ui/react/-/react-0.26.28.tgz",
+      "integrity": "sha512-yORQuuAtVpiRjpMhdc0wJj06b9JFjrYF4qp96j++v2NBpbi6SEGF7donUJ3TMieerQ6qVkAv1tgr7L4r5roTqw==",
+      "license": "MIT",
+      "dependencies": {
+        "@floating-ui/react-dom": "^2.1.2",
+        "@floating-ui/utils": "^0.2.8",
+        "tabbable": "^6.0.0"
+      },
+      "peerDependencies": {
+        "react": ">=16.8.0",
+        "react-dom": ">=16.8.0"
+      }
+    },
+    "node_modules/@floating-ui/react-dom": {
+      "version": "2.1.2",
+      "resolved": "https://registry.npmjs.org/@floating-ui/react-dom/-/react-dom-2.1.2.tgz",
+      "integrity": "sha512-06okr5cgPzMNBy+Ycse2A6udMi4bqwW/zgBF/rwjcNqWkyr82Mcg8b0vjX8OJpZFy/FKjJmw6wV7t44kK6kW7A==",
+      "license": "MIT",
+      "dependencies": {
+        "@floating-ui/dom": "^1.0.0"
+      },
+      "peerDependencies": {
+        "react": ">=16.8.0",
+        "react-dom": ">=16.8.0"
+      }
+    },
+    "node_modules/@floating-ui/utils": {
+      "version": "0.2.8",
+      "resolved": "https://registry.npmjs.org/@floating-ui/utils/-/utils-0.2.8.tgz",
+      "integrity": "sha512-kym7SodPp8/wloecOpcmSnWJsK7M0E5Wg8UcFA+uO4B9s5d0ywXOEro/8HM9x0rW+TljRzul/14UYz3TleT3ig=="
+    },
+    "node_modules/@humanwhocodes/config-array": {
+      "version": "0.13.0",
+      "resolved": "https://registry.npmjs.org/@humanwhocodes/config-array/-/config-array-0.13.0.tgz",
+      "integrity": "sha512-DZLEEqFWQFiyK6h5YIeynKx7JlvCYWL0cImfSRXZ9l4Sg2efkFGTuFf6vzXjK1cq6IYkU+Eg/JizXw+TD2vRNw==",
+      "deprecated": "Use @eslint/config-array instead",
+      "dev": true,
+      "dependencies": {
+        "@humanwhocodes/object-schema": "^2.0.3",
+        "debug": "^4.3.1",
+        "minimatch": "^3.0.5"
+      },
+      "engines": {
+        "node": ">=10.10.0"
+      }
+    },
+    "node_modules/@humanwhocodes/module-importer": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz",
+      "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==",
+      "dev": true,
+      "engines": {
+        "node": ">=12.22"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/nzakas"
+      }
+    },
+    "node_modules/@humanwhocodes/object-schema": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/@humanwhocodes/object-schema/-/object-schema-2.0.3.tgz",
+      "integrity": "sha512-93zYdMES/c1D69yZiKDBj0V24vqNzB/koF26KPaagAfd3P/4gUlh3Dys5ogAK+Exi9QyzlD8x/08Zt7wIKcDcA==",
+      "deprecated": "Use @eslint/object-schema instead",
+      "dev": true
+    },
+    "node_modules/@img/sharp-darwin-arm64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-darwin-arm64/-/sharp-darwin-arm64-0.33.5.tgz",
+      "integrity": "sha512-UT4p+iz/2H4twwAoLCqfA9UH5pI6DggwKEGuaPy7nCVQ8ZsiY5PIcrRvD1DzuY3qYL07NtIQcWnBSY/heikIFQ==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-darwin-arm64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-darwin-x64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-darwin-x64/-/sharp-darwin-x64-0.33.5.tgz",
+      "integrity": "sha512-fyHac4jIc1ANYGRDxtiqelIbdWkIuQaI84Mv45KvGRRxSAa7o7d1ZKAOBaYbnepLC1WqxfpimdeWfvqqSGwR2Q==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-darwin-x64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-libvips-darwin-arm64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-darwin-arm64/-/sharp-libvips-darwin-arm64-1.0.4.tgz",
+      "integrity": "sha512-XblONe153h0O2zuFfTAbQYAX2JhYmDHeWikp1LM9Hul9gVPjFY427k6dFEcOL72O01QxQsWi761svJ/ev9xEDg==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-darwin-x64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-darwin-x64/-/sharp-libvips-darwin-x64-1.0.4.tgz",
+      "integrity": "sha512-xnGR8YuZYfJGmWPvmlunFaWJsb9T/AO2ykoP3Fz/0X5XV2aoYBPkX6xqCQvUTKKiLddarLaxpzNe+b1hjeWHAQ==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linux-arm": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linux-arm/-/sharp-libvips-linux-arm-1.0.5.tgz",
+      "integrity": "sha512-gvcC4ACAOPRNATg/ov8/MnbxFDJqf/pDePbBnuBDcjsI8PssmjoKMAz4LtLaVi+OnSb5FK/yIOamqDwGmXW32g==",
+      "cpu": [
+        "arm"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linux-arm64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linux-arm64/-/sharp-libvips-linux-arm64-1.0.4.tgz",
+      "integrity": "sha512-9B+taZ8DlyyqzZQnoeIvDVR/2F4EbMepXMc/NdVbkzsJbzkUjhXv/70GQJ7tdLA4YJgNP25zukcxpX2/SueNrA==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linux-s390x": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linux-s390x/-/sharp-libvips-linux-s390x-1.0.4.tgz",
+      "integrity": "sha512-u7Wz6ntiSSgGSGcjZ55im6uvTrOxSIS8/dgoVMoiGE9I6JAfU50yH5BoDlYA1tcuGS7g/QNtetJnxA6QEsCVTA==",
+      "cpu": [
+        "s390x"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linux-x64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linux-x64/-/sharp-libvips-linux-x64-1.0.4.tgz",
+      "integrity": "sha512-MmWmQ3iPFZr0Iev+BAgVMb3ZyC4KeFc3jFxnNbEPas60e1cIfevbtuyf9nDGIzOaW9PdnDciJm+wFFaTlj5xYw==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linuxmusl-arm64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linuxmusl-arm64/-/sharp-libvips-linuxmusl-arm64-1.0.4.tgz",
+      "integrity": "sha512-9Ti+BbTYDcsbp4wfYib8Ctm1ilkugkA/uscUn6UXK1ldpC1JjiXbLfFZtRlBhjPZ5o1NCLiDbg8fhUPKStHoTA==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-libvips-linuxmusl-x64": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/@img/sharp-libvips-linuxmusl-x64/-/sharp-libvips-linuxmusl-x64-1.0.4.tgz",
+      "integrity": "sha512-viYN1KX9m+/hGkJtvYYp+CCLgnJXwiQB39damAO7WMdKWlIhmYTfHjwSbQeUK/20vY154mwezd9HflVFM1wVSw==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-linux-arm": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linux-arm/-/sharp-linux-arm-0.33.5.tgz",
+      "integrity": "sha512-JTS1eldqZbJxjvKaAkxhZmBqPRGmxgu+qFKSInv8moZ2AmT5Yib3EQ1c6gp493HvrvV8QgdOXdyaIBrhvFhBMQ==",
+      "cpu": [
+        "arm"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linux-arm": "1.0.5"
+      }
+    },
+    "node_modules/@img/sharp-linux-arm64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linux-arm64/-/sharp-linux-arm64-0.33.5.tgz",
+      "integrity": "sha512-JMVv+AMRyGOHtO1RFBiJy/MBsgz0x4AWrT6QoEVVTyh1E39TrCUpTRI7mx9VksGX4awWASxqCYLCV4wBZHAYxA==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linux-arm64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-linux-s390x": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linux-s390x/-/sharp-linux-s390x-0.33.5.tgz",
+      "integrity": "sha512-y/5PCd+mP4CA/sPDKl2961b+C9d+vPAveS33s6Z3zfASk2j5upL6fXVPZi7ztePZ5CuH+1kW8JtvxgbuXHRa4Q==",
+      "cpu": [
+        "s390x"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linux-s390x": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-linux-x64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linux-x64/-/sharp-linux-x64-0.33.5.tgz",
+      "integrity": "sha512-opC+Ok5pRNAzuvq1AG0ar+1owsu842/Ab+4qvU879ippJBHvyY5n2mxF1izXqkPYlGuP/M556uh53jRLJmzTWA==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linux-x64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-linuxmusl-arm64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linuxmusl-arm64/-/sharp-linuxmusl-arm64-0.33.5.tgz",
+      "integrity": "sha512-XrHMZwGQGvJg2V/oRSUfSAfjfPxO+4DkiRh6p2AFjLQztWUuY/o8Mq0eMQVIY7HJ1CDQUJlxGGZRw1a5bqmd1g==",
+      "cpu": [
+        "arm64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linuxmusl-arm64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-linuxmusl-x64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-linuxmusl-x64/-/sharp-linuxmusl-x64-0.33.5.tgz",
+      "integrity": "sha512-WT+d/cgqKkkKySYmqoZ8y3pxx7lx9vVejxW/W4DOFMYVSkErR+w7mf2u8m/y4+xHe7yY9DAXQMWQhpnMuFfScw==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-libvips-linuxmusl-x64": "1.0.4"
+      }
+    },
+    "node_modules/@img/sharp-wasm32": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-wasm32/-/sharp-wasm32-0.33.5.tgz",
+      "integrity": "sha512-ykUW4LVGaMcU9lu9thv85CbRMAwfeadCJHRsg2GmeRa/cJxsVY9Rbd57JcMxBkKHag5U/x7TSBpScF4U8ElVzg==",
+      "cpu": [
+        "wasm32"
+      ],
+      "optional": true,
+      "dependencies": {
+        "@emnapi/runtime": "^1.2.0"
+      },
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-win32-ia32": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-win32-ia32/-/sharp-win32-ia32-0.33.5.tgz",
+      "integrity": "sha512-T36PblLaTwuVJ/zw/LaH0PdZkRz5rd3SmMHX8GSmR7vtNSP5Z6bQkExdSK7xGWyxLw4sUknBuugTelgw2faBbQ==",
+      "cpu": [
+        "ia32"
+      ],
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@img/sharp-win32-x64": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/@img/sharp-win32-x64/-/sharp-win32-x64-0.33.5.tgz",
+      "integrity": "sha512-MpY/o8/8kj+EcnxwvrP4aTJSWw/aZ7JIGR4aBeZkZw5B7/Jn+tY9/VNwtcoGmdT7GfggGIU4kygOMSbYnOrAbg==",
+      "cpu": [
+        "x64"
+      ],
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      }
+    },
+    "node_modules/@mantine/carousel": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/carousel/-/carousel-7.15.1.tgz",
+      "integrity": "sha512-FQaxESq+uydaat4r3NC7x1/XKKGlr8PIawGEqkZXmzPLagOI6D+K3vSDzYK0n1fC6eIVPmd5bSiexBRVxXMm4Q==",
+      "license": "MIT",
+      "peerDependencies": {
+        "@mantine/core": "7.15.1",
+        "@mantine/hooks": "7.15.1",
+        "embla-carousel-react": ">=7.0.0",
+        "react": "^18.x || ^19.x",
+        "react-dom": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/charts": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/charts/-/charts-7.15.1.tgz",
+      "integrity": "sha512-GBV2cG+FSfNyTUUr7XPTPFSsR82hD6M3E1xV8Nwj954e4e9+67bYpAMoqjy6CN8jpFUY2vDMsk2OMTVc6OL3VA==",
+      "license": "MIT",
+      "peerDependencies": {
+        "@mantine/core": "7.15.1",
+        "@mantine/hooks": "7.15.1",
+        "react": "^18.x || ^19.x",
+        "react-dom": "^18.x || ^19.x",
+        "recharts": "^2.13.3"
+      }
+    },
+    "node_modules/@mantine/core": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/core/-/core-7.15.1.tgz",
+      "integrity": "sha512-MKHrByqgpu+vzhauX0X9EH+BOgJqyjHwk4E0sfIIX9CXC9pziLMc4aL8pua0KaXiRuQiskTl/DuGX31saHBH5g==",
+      "license": "MIT",
+      "dependencies": {
+        "@floating-ui/react": "^0.26.28",
+        "clsx": "^2.1.1",
+        "react-number-format": "^5.4.2",
+        "react-remove-scroll": "^2.6.0",
+        "react-textarea-autosize": "8.5.5",
+        "type-fest": "^4.27.0"
+      },
+      "peerDependencies": {
+        "@mantine/hooks": "7.15.1",
+        "react": "^18.x || ^19.x",
+        "react-dom": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/core/node_modules/@types/react": {
+      "version": "18.3.14",
+      "resolved": "https://registry.npmjs.org/@types/react/-/react-18.3.14.tgz",
+      "integrity": "sha512-NzahNKvjNhVjuPBQ+2G7WlxstQ+47kXZNHlUvFakDViuIEfGY926GqhMueQFZ7woG+sPiQKlF36XfrIUVSUfFg==",
+      "license": "MIT",
+      "optional": true,
+      "peer": true,
+      "dependencies": {
+        "@types/prop-types": "*",
+        "csstype": "^3.0.2"
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-number-format": {
+      "version": "5.4.2",
+      "resolved": "https://registry.npmjs.org/react-number-format/-/react-number-format-5.4.2.tgz",
+      "integrity": "sha512-cg//jVdS49PYDgmcYoBnMMHl4XNTMuV723ZnHD2aXYtWWWqbVF3hjQ8iB+UZEuXapLbeA8P8H+1o6ZB1lcw3vg==",
+      "license": "MIT",
+      "peerDependencies": {
+        "react": "^0.14 || ^15.0.0 || ^16.0.0 || ^17.0.0 || ^18.0.0",
+        "react-dom": "^0.14 || ^15.0.0 || ^16.0.0 || ^17.0.0 || ^18.0.0"
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-remove-scroll": {
+      "version": "2.6.0",
+      "resolved": "https://registry.npmjs.org/react-remove-scroll/-/react-remove-scroll-2.6.0.tgz",
+      "integrity": "sha512-I2U4JVEsQenxDAKaVa3VZ/JeJZe0/2DxPWL8Tj8yLKctQJQiZM52pn/GWFpSp8dftjM3pSAHVJZscAnC/y+ySQ==",
+      "dependencies": {
+        "react-remove-scroll-bar": "^2.3.6",
+        "react-style-singleton": "^2.2.1",
+        "tslib": "^2.1.0",
+        "use-callback-ref": "^1.3.0",
+        "use-sidecar": "^1.1.2"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "@types/react": "^16.8.0 || ^17.0.0 || ^18.0.0",
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-remove-scroll/node_modules/react-remove-scroll-bar": {
+      "version": "2.3.6",
+      "resolved": "https://registry.npmjs.org/react-remove-scroll-bar/-/react-remove-scroll-bar-2.3.6.tgz",
+      "integrity": "sha512-DtSYaao4mBmX+HDo5YWYdBWQwYIQQshUV/dVxFxK+KM26Wjwp1gZ6rv6OC3oujI6Bfu6Xyg3TwK533AQutsn/g==",
+      "dependencies": {
+        "react-style-singleton": "^2.2.1",
+        "tslib": "^2.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "@types/react": "^16.8.0 || ^17.0.0 || ^18.0.0",
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-remove-scroll/node_modules/react-style-singleton": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/react-style-singleton/-/react-style-singleton-2.2.1.tgz",
+      "integrity": "sha512-ZWj0fHEMyWkHzKYUr2Bs/4zU6XLmq9HsgBURm7g5pAVfyn49DgUiNgY2d4lXRlYSiCif9YBGpQleewkcqddc7g==",
+      "dependencies": {
+        "get-nonce": "^1.0.0",
+        "invariant": "^2.2.4",
+        "tslib": "^2.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "@types/react": "^16.8.0 || ^17.0.0 || ^18.0.0",
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-remove-scroll/node_modules/use-callback-ref": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/use-callback-ref/-/use-callback-ref-1.3.2.tgz",
+      "integrity": "sha512-elOQwe6Q8gqZgDA8mrh44qRTQqpIHDcZ3hXTLjBe1i4ph8XpNJnO+aQf3NaG+lriLopI4HMx9VjQLfPQ6vhnoA==",
+      "dependencies": {
+        "tslib": "^2.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "@types/react": "^16.8.0 || ^17.0.0 || ^18.0.0",
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-remove-scroll/node_modules/use-sidecar": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/use-sidecar/-/use-sidecar-1.1.2.tgz",
+      "integrity": "sha512-epTbsLuzZ7lPClpz2TyryBfztm7m+28DlEv2ZCQ3MDr5ssiwyOwGH/e5F9CkfWjJ1t4clvI58yF822/GUkjjhw==",
+      "dependencies": {
+        "detect-node-es": "^1.1.0",
+        "tslib": "^2.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "@types/react": "^16.9.0 || ^17.0.0 || ^18.0.0",
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-textarea-autosize": {
+      "version": "8.5.5",
+      "resolved": "https://registry.npmjs.org/react-textarea-autosize/-/react-textarea-autosize-8.5.5.tgz",
+      "integrity": "sha512-CVA94zmfp8m4bSHtWwmANaBR8EPsKy2aZ7KwqhoS4Ftib87F9Kvi7XQhOixypPLMc6kVYgOXvKFuuzZDpHGRPg==",
+      "license": "MIT",
+      "dependencies": {
+        "@babel/runtime": "^7.20.13",
+        "use-composed-ref": "^1.3.0",
+        "use-latest": "^1.2.1"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-textarea-autosize/node_modules/use-composed-ref": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/use-composed-ref/-/use-composed-ref-1.3.0.tgz",
+      "integrity": "sha512-GLMG0Jc/jiKov/3Ulid1wbv3r54K9HlMW29IWcDFPEqFkSO2nS0MuefWgMJpeHQ9YJeXDL3ZUF+P3jdXlZX/cQ==",
+      "license": "MIT",
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      }
+    },
+    "node_modules/@mantine/core/node_modules/react-textarea-autosize/node_modules/use-latest": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/use-latest/-/use-latest-1.2.1.tgz",
+      "integrity": "sha512-xA+AVm/Wlg3e2P/JiItTziwS7FK92LWrDB0p+hgXloIMuVCeJJ8v6f0eeHyPZaJrM+usM1FkFfbNCrJGs8A/zw==",
+      "license": "MIT",
+      "dependencies": {
+        "use-isomorphic-layout-effect": "^1.1.1"
+      },
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@mantine/core/node_modules/type-fest": {
+      "version": "4.29.0",
+      "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-4.29.0.tgz",
+      "integrity": "sha512-RPYt6dKyemXJe7I6oNstcH24myUGSReicxcHTvCLgzm4e0n8y05dGvcGB15/SoPRBmhlMthWQ9pvKyL81ko8nQ==",
+      "license": "(MIT OR CC0-1.0)",
+      "engines": {
+        "node": ">=16"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/@mantine/dates": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/dates/-/dates-7.15.1.tgz",
+      "integrity": "sha512-3WXTq841Em4+e1VLm+t+1mQvfgNkgIAN8/puGg7lljf+Nl6moiI1qekjE1lg2q8EkqI+5uUOgLamlOYX411j5g==",
+      "license": "MIT",
+      "dependencies": {
+        "clsx": "^2.1.1"
+      },
+      "peerDependencies": {
+        "@mantine/core": "7.15.1",
+        "@mantine/hooks": "7.15.1",
+        "dayjs": ">=1.0.0",
+        "react": "^18.x || ^19.x",
+        "react-dom": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/form": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/form/-/form-7.15.1.tgz",
+      "integrity": "sha512-DA2syNlPsG1f+UtnbEG+pf4Pc/DoZUgcdvZn3LsCRxJZYNuwz8qQ16oL/wQ6UIk3klGlJI/RDzRJ9rvn6E28YQ==",
+      "license": "MIT",
+      "dependencies": {
+        "fast-deep-equal": "^3.1.3",
+        "klona": "^2.0.6"
+      },
+      "peerDependencies": {
+        "react": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/hooks": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/hooks/-/hooks-7.15.1.tgz",
+      "integrity": "sha512-jrpjA5JhVSgUi0expfZpvNplMgvwdvrCIcKiDjQ16p/KiWngvTVfmJMtBOVxQ6hWrn500nLmZIDEcTmV9Dvb7g==",
+      "license": "MIT",
+      "peerDependencies": {
+        "react": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/notifications": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/notifications/-/notifications-7.15.1.tgz",
+      "integrity": "sha512-HcaePf1Ss0PuLugEsa57w8w5mxh9d/ZeByqn96DXWsN0HtRZ+ElqSFO9nY6G2zQGV7AzB0fqQXhGX4ffdz5zuA==",
+      "license": "MIT",
+      "dependencies": {
+        "@mantine/store": "7.15.1",
+        "react-transition-group": "4.4.5"
+      },
+      "peerDependencies": {
+        "@mantine/core": "7.15.1",
+        "@mantine/hooks": "7.15.1",
+        "react": "^18.x || ^19.x",
+        "react-dom": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@mantine/store": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/@mantine/store/-/store-7.15.1.tgz",
+      "integrity": "sha512-+jwsCE0x0BoeNYhto/Y9PQtHu86BxBNsc3Jw+dNwPP2oeVCbpspopHN+JsTrLR9ZCvsy8N8hxOX7T3ZUGZLYFQ==",
+      "license": "MIT",
+      "peerDependencies": {
+        "react": "^18.x || ^19.x"
+      }
+    },
+    "node_modules/@next/env": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/env/-/env-15.1.2.tgz",
+      "integrity": "sha512-Hm3jIGsoUl6RLB1vzY+dZeqb+/kWPZ+h34yiWxW0dV87l8Im/eMOwpOA+a0L78U0HM04syEjXuRlCozqpwuojQ==",
+      "license": "MIT"
+    },
+    "node_modules/@next/eslint-plugin-next": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/eslint-plugin-next/-/eslint-plugin-next-15.1.2.tgz",
+      "integrity": "sha512-sgfw3+WdaYOGPKCvM1L+UucBmRfh8V2Ygefp7ELON0+0vY7uohQwXXnVWg3rY7mXDKharQR3o7uedpfvnU2hlQ==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "fast-glob": "3.3.1"
+      }
+    },
+    "node_modules/@next/swc-darwin-arm64": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-15.1.2.tgz",
+      "integrity": "sha512-b9TN7q+j5/7+rGLhFAVZiKJGIASuo8tWvInGfAd8wsULjB1uNGRCj1z1WZwwPWzVQbIKWFYqc+9L7W09qwt52w==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-darwin-x64": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-15.1.2.tgz",
+      "integrity": "sha512-caR62jNDUCU+qobStO6YJ05p9E+LR0EoXh1EEmyU69cYydsAy7drMcOlUlRtQihM6K6QfvNwJuLhsHcCzNpqtA==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-linux-arm64-gnu": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-15.1.2.tgz",
+      "integrity": "sha512-fHHXBusURjBmN6VBUtu6/5s7cCeEkuGAb/ZZiGHBLVBXMBy4D5QpM8P33Or8JD1nlOjm/ZT9sEE5HouQ0F+hUA==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-linux-arm64-musl": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-15.1.2.tgz",
+      "integrity": "sha512-9CF1Pnivij7+M3G74lxr+e9h6o2YNIe7QtExWq1KUK4hsOLTBv6FJikEwCaC3NeYTflzrm69E5UfwEAbV2U9/g==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-linux-x64-gnu": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-15.1.2.tgz",
+      "integrity": "sha512-tINV7WmcTUf4oM/eN3Yuu/f8jQ5C6AkueZPKeALs/qfdfX57eNv4Ij7rt0SA6iZ8+fMobVfcFVv664Op0caCCg==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-linux-x64-musl": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-15.1.2.tgz",
+      "integrity": "sha512-jf2IseC4WRsGkzeUw/cK3wci9pxR53GlLAt30+y+B+2qAQxMw6WAC3QrANIKxkcoPU3JFh/10uFfmoMDF9JXKg==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-win32-arm64-msvc": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-15.1.2.tgz",
+      "integrity": "sha512-wvg7MlfnaociP7k8lxLX4s2iBJm4BrNiNFhVUY+Yur5yhAJHfkS8qPPeDEUH8rQiY0PX3u/P7Q/wcg6Mv6GSAA==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-win32-ia32-msvc": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-ia32-msvc/-/swc-win32-ia32-msvc-14.2.20.tgz",
+      "integrity": "sha512-igQW/JWciTGJwj3G1ipalD2V20Xfx3ywQy17IV0ciOUBbFhNfyU1DILWsTi32c8KmqgIDviUEulW/yPb2FF90w==",
+      "cpu": [
+        "ia32"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@next/swc-win32-x64-msvc": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-15.1.2.tgz",
+      "integrity": "sha512-D3cNA8NoT3aWISWmo7HF5Eyko/0OdOO+VagkoJuiTk7pyX3P/b+n8XA/MYvyR+xSVcbKn68B1rY9fgqjNISqzQ==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/@nodelib/fs.scandir": {
+      "version": "2.1.5",
+      "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz",
+      "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==",
+      "dev": true,
+      "dependencies": {
+        "@nodelib/fs.stat": "2.0.5",
+        "run-parallel": "^1.1.9"
+      },
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/@nodelib/fs.stat": {
+      "version": "2.0.5",
+      "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz",
+      "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==",
+      "dev": true,
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/@nodelib/fs.walk": {
+      "version": "1.2.8",
+      "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz",
+      "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==",
+      "dev": true,
+      "dependencies": {
+        "@nodelib/fs.scandir": "2.1.5",
+        "fastq": "^1.6.0"
+      },
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/@nolyfill/is-core-module": {
+      "version": "1.0.39",
+      "resolved": "https://registry.npmjs.org/@nolyfill/is-core-module/-/is-core-module-1.0.39.tgz",
+      "integrity": "sha512-nn5ozdjYQpUCZlWGuxcJY/KpxkWQs4DcbMCmKojjyrYDEAGy4Ce19NN4v5MduafTwJlbKc99UA8YhSVqq9yPZA==",
+      "dev": true,
+      "engines": {
+        "node": ">=12.4.0"
+      }
+    },
+    "node_modules/@rtsao/scc": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/@rtsao/scc/-/scc-1.1.0.tgz",
+      "integrity": "sha512-zt6OdqaDoOnJ1ZYsCYGt9YmWzDXl4vQdKTyJev62gFhRGKdx7mcT54V9KIjg+d2wi9EXsPvAPKe7i7WjfVWB8g==",
+      "dev": true
+    },
+    "node_modules/@rushstack/eslint-patch": {
+      "version": "1.10.4",
+      "resolved": "https://registry.npmjs.org/@rushstack/eslint-patch/-/eslint-patch-1.10.4.tgz",
+      "integrity": "sha512-WJgX9nzTqknM393q1QJDJmoW28kUfEnybeTfVNcNAPnIx210RXm2DiXiHzfNPJNIUUb1tJnz/l4QGtJ30PgWmA==",
+      "dev": true
+    },
+    "node_modules/@swc/counter": {
+      "version": "0.1.3",
+      "resolved": "https://registry.npmjs.org/@swc/counter/-/counter-0.1.3.tgz",
+      "integrity": "sha512-e2BR4lsJkkRlKZ/qCHPw9ZaSxc0MVUd7gtbtaB7aMvHeJVYe8sOB8DBZkP2DtISHGSku9sCK6T6cnY0CtXrOCQ=="
+    },
+    "node_modules/@swc/helpers": {
+      "version": "0.5.15",
+      "resolved": "https://registry.npmjs.org/@swc/helpers/-/helpers-0.5.15.tgz",
+      "integrity": "sha512-JQ5TuMi45Owi4/BIMAJBoSQoOJu12oOk/gADqlcUL9JEdHB8vyjUSsxqeNXnmXHjYKMi2WcYtezGEEhqUI/E2g==",
+      "license": "Apache-2.0",
+      "dependencies": {
+        "tslib": "^2.8.0"
+      }
+    },
+    "node_modules/@tabler/icons": {
+      "version": "3.26.0",
+      "resolved": "https://registry.npmjs.org/@tabler/icons/-/icons-3.26.0.tgz",
+      "integrity": "sha512-oO3D4ss+DxzxqU1aDy0f1HmToyrO0gcQWIMpzHAfV1quPUx0BZYvNm5xz1DQb4DxNm/+xNvbBGLJy4pzTLYWag==",
+      "license": "MIT",
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/codecalm"
+      }
+    },
+    "node_modules/@tabler/icons-react": {
+      "version": "3.26.0",
+      "resolved": "https://registry.npmjs.org/@tabler/icons-react/-/icons-react-3.26.0.tgz",
+      "integrity": "sha512-t18Zmu1ROktB7M8hWQ6vJw+mNpI/LPk5PPxLuE+kNB+4Zzf38GfETL8VF98inhzcfHohsggdROzMzwSAfjcAxw==",
+      "license": "MIT",
+      "dependencies": {
+        "@tabler/icons": "3.26.0"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/codecalm"
+      },
+      "peerDependencies": {
+        "react": ">= 16"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query": {
+      "version": "5.62.1",
+      "resolved": "https://registry.npmjs.org/@tanstack/eslint-plugin-query/-/eslint-plugin-query-5.62.1.tgz",
+      "integrity": "sha512-1886D5U+re1TW0wSH4/kUGG36yIoW5Wkz4twVEzlk3ZWmjF3XkRSWgB+Sc7n+Lyzt8usNV8ZqkZE6DA7IC47fQ==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@typescript-eslint/utils": "^8.15.0"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/tannerlinsley"
+      },
+      "peerDependencies": {
+        "eslint": "^8.57.0 || ^9.0.0"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/@typescript-eslint/scope-manager": {
+      "version": "8.16.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-8.16.0.tgz",
+      "integrity": "sha512-mwsZWubQvBki2t5565uxF0EYvG+FwdFb8bMtDuGQLdCCnGPrDEDvm1gtfynuKlnpzeBRqdFCkMf9jg1fnAK8sg==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@typescript-eslint/types": "8.16.0",
+        "@typescript-eslint/visitor-keys": "8.16.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/@typescript-eslint/types": {
+      "version": "8.16.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-8.16.0.tgz",
+      "integrity": "sha512-NzrHj6thBAOSE4d9bsuRNMvk+BvaQvmY4dDglgkgGC0EW/tB3Kelnp3tAKH87GEwzoxgeQn9fNGRyFJM/xd+GQ==",
+      "dev": true,
+      "license": "MIT",
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/@typescript-eslint/typescript-estree": {
+      "version": "8.16.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-8.16.0.tgz",
+      "integrity": "sha512-E2+9IzzXMc1iaBy9zmo+UYvluE3TW7bCGWSF41hVWUE01o8nzr1rvOQYSxelxr6StUvRcTMe633eY8mXASMaNw==",
+      "dev": true,
+      "license": "BSD-2-Clause",
+      "dependencies": {
+        "@typescript-eslint/types": "8.16.0",
+        "@typescript-eslint/visitor-keys": "8.16.0",
+        "debug": "^4.3.4",
+        "fast-glob": "^3.3.2",
+        "is-glob": "^4.0.3",
+        "minimatch": "^9.0.4",
+        "semver": "^7.6.0",
+        "ts-api-utils": "^1.3.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/@typescript-eslint/utils": {
+      "version": "8.16.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/utils/-/utils-8.16.0.tgz",
+      "integrity": "sha512-C1zRy/mOL8Pj157GiX4kaw7iyRLKfJXBR3L82hk5kS/GyHcOFmy4YUq/zfZti72I9wnuQtA/+xzft4wCC8PJdA==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@eslint-community/eslint-utils": "^4.4.0",
+        "@typescript-eslint/scope-manager": "8.16.0",
+        "@typescript-eslint/types": "8.16.0",
+        "@typescript-eslint/typescript-estree": "8.16.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependencies": {
+        "eslint": "^8.57.0 || ^9.0.0"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/@typescript-eslint/visitor-keys": {
+      "version": "8.16.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-8.16.0.tgz",
+      "integrity": "sha512-pq19gbaMOmFE3CbL0ZB8J8BFCo2ckfHBfaIsaOZgBIF4EoISJIdLX5xRhd0FGB0LlHReNRuzoJoMGpTjq8F2CQ==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@typescript-eslint/types": "8.16.0",
+        "eslint-visitor-keys": "^4.2.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/brace-expansion": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz",
+      "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "balanced-match": "^1.0.0"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/eslint-visitor-keys": {
+      "version": "4.2.0",
+      "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz",
+      "integrity": "sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==",
+      "dev": true,
+      "license": "Apache-2.0",
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/fast-glob": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz",
+      "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@nodelib/fs.stat": "^2.0.2",
+        "@nodelib/fs.walk": "^1.2.3",
+        "glob-parent": "^5.1.2",
+        "merge2": "^1.3.0",
+        "micromatch": "^4.0.4"
+      },
+      "engines": {
+        "node": ">=8.6.0"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/glob-parent": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+      "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+      "dev": true,
+      "license": "ISC",
+      "dependencies": {
+        "is-glob": "^4.0.1"
+      },
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/@tanstack/eslint-plugin-query/node_modules/minimatch": {
+      "version": "9.0.5",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.5.tgz",
+      "integrity": "sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==",
+      "dev": true,
+      "license": "ISC",
+      "dependencies": {
+        "brace-expansion": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=16 || 14 >=14.17"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/isaacs"
+      }
+    },
+    "node_modules/@tanstack/query-core": {
+      "version": "5.62.8",
+      "resolved": "https://registry.npmjs.org/@tanstack/query-core/-/query-core-5.62.8.tgz",
+      "integrity": "sha512-4fV31vDsUyvNGrKIOUNPrZztoyL187bThnoQOvAXEVlZbSiuPONpfx53634MKKdvsDir5NyOGm80ShFaoHS/mw==",
+      "license": "MIT",
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/tannerlinsley"
+      }
+    },
+    "node_modules/@tanstack/query-devtools": {
+      "version": "5.61.4",
+      "resolved": "https://registry.npmjs.org/@tanstack/query-devtools/-/query-devtools-5.61.4.tgz",
+      "integrity": "sha512-21Tw+u8E3IJJj4A/Bct4H0uBaDTEu7zBrR79FeSyY+mS2gx5/m316oDtJiKkILc819VSTYt+sFzODoJNcpPqZQ==",
+      "license": "MIT",
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/tannerlinsley"
+      }
+    },
+    "node_modules/@tanstack/react-query": {
+      "version": "5.62.8",
+      "resolved": "https://registry.npmjs.org/@tanstack/react-query/-/react-query-5.62.8.tgz",
+      "integrity": "sha512-8TUstKxF/fysHonZsWg/hnlDVgasTdHx6Q+f1/s/oPKJBJbKUWPZEHwLTMOZgrZuroLMiqYKJ9w69Abm8mWP0Q==",
+      "license": "MIT",
+      "dependencies": {
+        "@tanstack/query-core": "5.62.8"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/tannerlinsley"
+      },
+      "peerDependencies": {
+        "react": "^18 || ^19"
+      }
+    },
+    "node_modules/@tanstack/react-query-devtools": {
+      "version": "5.62.8",
+      "resolved": "https://registry.npmjs.org/@tanstack/react-query-devtools/-/react-query-devtools-5.62.8.tgz",
+      "integrity": "sha512-SwjXjQTRONd9WPeKVQQ9framG7YNqPV8PS+EGNVNXAyz2XThulMRCvZnh2+3DggnjcYM7YcpnuoZ4RH7q13p0g==",
+      "license": "MIT",
+      "dependencies": {
+        "@tanstack/query-devtools": "5.61.4"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/tannerlinsley"
+      },
+      "peerDependencies": {
+        "@tanstack/react-query": "^5.62.8",
+        "react": "^18 || ^19"
+      }
+    },
+    "node_modules/@types/d3-array": {
+      "version": "3.2.1",
+      "resolved": "https://registry.npmjs.org/@types/d3-array/-/d3-array-3.2.1.tgz",
+      "integrity": "sha512-Y2Jn2idRrLzUfAKV2LyRImR+y4oa2AntrgID95SHJxuMUrkNXmanDSed71sRNZysveJVt1hLLemQZIady0FpEg==",
+      "license": "MIT"
+    },
+    "node_modules/@types/d3-color": {
+      "version": "3.1.3",
+      "resolved": "https://registry.npmjs.org/@types/d3-color/-/d3-color-3.1.3.tgz",
+      "integrity": "sha512-iO90scth9WAbmgv7ogoq57O9YpKmFBbmoEoCHDB2xMBY0+/KVrqAaCDyCE16dUspeOvIxFFRI+0sEtqDqy2b4A==",
+      "license": "MIT"
+    },
+    "node_modules/@types/d3-ease": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/@types/d3-ease/-/d3-ease-3.0.2.tgz",
+      "integrity": "sha512-NcV1JjO5oDzoK26oMzbILE6HW7uVXOHLQvHshBUW4UMdZGfiY6v5BeQwh9a9tCzv+CeefZQHJt5SRgK154RtiA==",
+      "license": "MIT"
+    },
+    "node_modules/@types/d3-interpolate": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/@types/d3-interpolate/-/d3-interpolate-3.0.4.tgz",
+      "integrity": "sha512-mgLPETlrpVV1YRJIglr4Ez47g7Yxjl1lj7YKsiMCb27VJH9W8NVM6Bb9d8kkpG/uAQS5AmbA48q2IAolKKo1MA==",
+      "license": "MIT",
+      "dependencies": {
+        "@types/d3-color": "*"
+      }
+    },
+    "node_modules/@types/d3-path": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/@types/d3-path/-/d3-path-3.1.0.tgz",
+      "integrity": "sha512-P2dlU/q51fkOc/Gfl3Ul9kicV7l+ra934qBFXCFhrZMOL6du1TM0pm1ThYvENukyOn5h9v+yMJ9Fn5JK4QozrQ==",
+      "license": "MIT"
+    },
+    "node_modules/@types/d3-scale": {
+      "version": "4.0.8",
+      "resolved": "https://registry.npmjs.org/@types/d3-scale/-/d3-scale-4.0.8.tgz",
+      "integrity": "sha512-gkK1VVTr5iNiYJ7vWDI+yUFFlszhNMtVeneJ6lUTKPjprsvLLI9/tgEGiXJOnlINJA8FyA88gfnQsHbybVZrYQ==",
+      "license": "MIT",
+      "dependencies": {
+        "@types/d3-time": "*"
+      }
+    },
+    "node_modules/@types/d3-shape": {
+      "version": "3.1.6",
+      "resolved": "https://registry.npmjs.org/@types/d3-shape/-/d3-shape-3.1.6.tgz",
+      "integrity": "sha512-5KKk5aKGu2I+O6SONMYSNflgiP0WfZIQvVUMan50wHsLG1G94JlxEVnCpQARfTtzytuY0p/9PXXZb3I7giofIA==",
+      "license": "MIT",
+      "dependencies": {
+        "@types/d3-path": "*"
+      }
+    },
+    "node_modules/@types/d3-time": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/@types/d3-time/-/d3-time-3.0.4.tgz",
+      "integrity": "sha512-yuzZug1nkAAaBlBBikKZTgzCeA+k1uy4ZFwWANOfKw5z5LRhV0gNA7gNkKm7HoK+HRN0wX3EkxGk0fpbWhmB7g==",
+      "license": "MIT"
+    },
+    "node_modules/@types/d3-timer": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/@types/d3-timer/-/d3-timer-3.0.2.tgz",
+      "integrity": "sha512-Ps3T8E8dZDam6fUyNiMkekK3XUsaUEik+idO9/YjPtfj2qruF8tFBXS7XhtE4iIXBLxhmLjP3SXpLhVf21I9Lw==",
+      "license": "MIT"
+    },
+    "node_modules/@types/json5": {
+      "version": "0.0.29",
+      "resolved": "https://registry.npmjs.org/@types/json5/-/json5-0.0.29.tgz",
+      "integrity": "sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ==",
+      "dev": true
+    },
+    "node_modules/@types/lodash": {
+      "version": "4.17.13",
+      "resolved": "https://registry.npmjs.org/@types/lodash/-/lodash-4.17.13.tgz",
+      "integrity": "sha512-lfx+dftrEZcdBPczf9d0Qv0x+j/rfNCMuC6OcfXmO8gkfeNAY88PgKUbvG56whcN23gc27yenwF6oJZXGFpYxg==",
+      "dev": true,
+      "license": "MIT"
+    },
+    "node_modules/@types/node": {
+      "version": "22.9.0",
+      "resolved": "https://registry.npmjs.org/@types/node/-/node-22.9.0.tgz",
+      "integrity": "sha512-vuyHg81vvWA1Z1ELfvLko2c8f34gyA0zaic0+Rllc5lbCnbSyuvb2Oxpm6TAUAC/2xZN3QGqxBNggD1nNR2AfQ==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "undici-types": "~6.19.8"
+      }
+    },
+    "node_modules/@types/prop-types": {
+      "version": "15.7.14",
+      "resolved": "https://registry.npmjs.org/@types/prop-types/-/prop-types-15.7.14.tgz",
+      "integrity": "sha512-gNMvNH49DJ7OJYv+KAKn0Xp45p8PLl6zo2YnvDIbTd4J6MER2BmWN49TG7n9LvkyihINxeKW8+3bfS2yDC9dzQ==",
+      "license": "MIT",
+      "optional": true,
+      "peer": true
+    },
+    "node_modules/@types/react": {
+      "version": "19.0.1",
+      "resolved": "https://registry.npmjs.org/@types/react/-/react-19.0.1.tgz",
+      "integrity": "sha512-YW6614BDhqbpR5KtUYzTA+zlA7nayzJRA9ljz9CQoxthR0sDisYZLuvSMsil36t4EH/uAt8T52Xb4sVw17G+SQ==",
+      "license": "MIT",
+      "dependencies": {
+        "csstype": "^3.0.2"
+      }
+    },
+    "node_modules/@types/react-dom": {
+      "version": "19.0.2",
+      "resolved": "https://registry.npmjs.org/@types/react-dom/-/react-dom-19.0.2.tgz",
+      "integrity": "sha512-c1s+7TKFaDRRxr1TxccIX2u7sfCnc3RxkVyBIUA2lCpyqCF+QoAwQ/CBg7bsMdVwP120HEH143VQezKtef5nCg==",
+      "dev": true,
+      "license": "MIT",
+      "peerDependencies": {
+        "@types/react": "^19.0.0"
+      }
+    },
+    "node_modules/@typescript-eslint/eslint-plugin": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/eslint-plugin/-/eslint-plugin-8.13.0.tgz",
+      "integrity": "sha512-nQtBLiZYMUPkclSeC3id+x4uVd1SGtHuElTxL++SfP47jR0zfkZBJHc+gL4qPsgTuypz0k8Y2GheaDYn6Gy3rg==",
+      "dev": true,
+      "dependencies": {
+        "@eslint-community/regexpp": "^4.10.0",
+        "@typescript-eslint/scope-manager": "8.13.0",
+        "@typescript-eslint/type-utils": "8.13.0",
+        "@typescript-eslint/utils": "8.13.0",
+        "@typescript-eslint/visitor-keys": "8.13.0",
+        "graphemer": "^1.4.0",
+        "ignore": "^5.3.1",
+        "natural-compare": "^1.4.0",
+        "ts-api-utils": "^1.3.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependencies": {
+        "@typescript-eslint/parser": "^8.0.0 || ^8.0.0-alpha.0",
+        "eslint": "^8.57.0 || ^9.0.0"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@typescript-eslint/parser": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/parser/-/parser-8.13.0.tgz",
+      "integrity": "sha512-w0xp+xGg8u/nONcGw1UXAr6cjCPU1w0XVyBs6Zqaj5eLmxkKQAByTdV/uGgNN5tVvN/kKpoQlP2cL7R+ajZZIQ==",
+      "dev": true,
+      "dependencies": {
+        "@typescript-eslint/scope-manager": "8.13.0",
+        "@typescript-eslint/types": "8.13.0",
+        "@typescript-eslint/typescript-estree": "8.13.0",
+        "@typescript-eslint/visitor-keys": "8.13.0",
+        "debug": "^4.3.4"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependencies": {
+        "eslint": "^8.57.0 || ^9.0.0"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@typescript-eslint/scope-manager": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/scope-manager/-/scope-manager-8.13.0.tgz",
+      "integrity": "sha512-XsGWww0odcUT0gJoBZ1DeulY1+jkaHUciUq4jKNv4cpInbvvrtDoyBH9rE/n2V29wQJPk8iCH1wipra9BhmiMA==",
+      "dev": true,
+      "dependencies": {
+        "@typescript-eslint/types": "8.13.0",
+        "@typescript-eslint/visitor-keys": "8.13.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@typescript-eslint/type-utils": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/type-utils/-/type-utils-8.13.0.tgz",
+      "integrity": "sha512-Rqnn6xXTR316fP4D2pohZenJnp+NwQ1mo7/JM+J1LWZENSLkJI8ID8QNtlvFeb0HnFSK94D6q0cnMX6SbE5/vA==",
+      "dev": true,
+      "dependencies": {
+        "@typescript-eslint/typescript-estree": "8.13.0",
+        "@typescript-eslint/utils": "8.13.0",
+        "debug": "^4.3.4",
+        "ts-api-utils": "^1.3.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@typescript-eslint/types": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/types/-/types-8.13.0.tgz",
+      "integrity": "sha512-4cyFErJetFLckcThRUFdReWJjVsPCqyBlJTi6IDEpc1GWCIIZRFxVppjWLIMcQhNGhdWJJRYFHpHoDWvMlDzng==",
+      "dev": true,
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@typescript-eslint/typescript-estree": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/typescript-estree/-/typescript-estree-8.13.0.tgz",
+      "integrity": "sha512-v7SCIGmVsRK2Cy/LTLGN22uea6SaUIlpBcO/gnMGT/7zPtxp90bphcGf4fyrCQl3ZtiBKqVTG32hb668oIYy1g==",
+      "dev": true,
+      "dependencies": {
+        "@typescript-eslint/types": "8.13.0",
+        "@typescript-eslint/visitor-keys": "8.13.0",
+        "debug": "^4.3.4",
+        "fast-glob": "^3.3.2",
+        "is-glob": "^4.0.3",
+        "minimatch": "^9.0.4",
+        "semver": "^7.6.0",
+        "ts-api-utils": "^1.3.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/@typescript-eslint/typescript-estree/node_modules/brace-expansion": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz",
+      "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==",
+      "dev": true,
+      "dependencies": {
+        "balanced-match": "^1.0.0"
+      }
+    },
+    "node_modules/@typescript-eslint/typescript-estree/node_modules/fast-glob": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz",
+      "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==",
+      "dev": true,
+      "dependencies": {
+        "@nodelib/fs.stat": "^2.0.2",
+        "@nodelib/fs.walk": "^1.2.3",
+        "glob-parent": "^5.1.2",
+        "merge2": "^1.3.0",
+        "micromatch": "^4.0.4"
+      },
+      "engines": {
+        "node": ">=8.6.0"
+      }
+    },
+    "node_modules/@typescript-eslint/typescript-estree/node_modules/glob-parent": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+      "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+      "dev": true,
+      "dependencies": {
+        "is-glob": "^4.0.1"
+      },
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/@typescript-eslint/typescript-estree/node_modules/minimatch": {
+      "version": "9.0.5",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.5.tgz",
+      "integrity": "sha512-G6T0ZX48xgozx7587koeX9Ys2NYy6Gmv//P89sEte9V9whIapMNF4idKxnW2QtCcLiTWlb/wfCabAtAFWhhBow==",
+      "dev": true,
+      "dependencies": {
+        "brace-expansion": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=16 || 14 >=14.17"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/isaacs"
+      }
+    },
+    "node_modules/@typescript-eslint/utils": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/utils/-/utils-8.13.0.tgz",
+      "integrity": "sha512-A1EeYOND6Uv250nybnLZapeXpYMl8tkzYUxqmoKAWnI4sei3ihf2XdZVd+vVOmHGcp3t+P7yRrNsyyiXTvShFQ==",
+      "dev": true,
+      "dependencies": {
+        "@eslint-community/eslint-utils": "^4.4.0",
+        "@typescript-eslint/scope-manager": "8.13.0",
+        "@typescript-eslint/types": "8.13.0",
+        "@typescript-eslint/typescript-estree": "8.13.0"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      },
+      "peerDependencies": {
+        "eslint": "^8.57.0 || ^9.0.0"
+      }
+    },
+    "node_modules/@typescript-eslint/visitor-keys": {
+      "version": "8.13.0",
+      "resolved": "https://registry.npmjs.org/@typescript-eslint/visitor-keys/-/visitor-keys-8.13.0.tgz",
+      "integrity": "sha512-7N/+lztJqH4Mrf0lb10R/CbI1EaAMMGyF5y0oJvFoAhafwgiRA7TXyd8TFn8FC8k5y2dTsYogg238qavRGNnlw==",
+      "dev": true,
+      "dependencies": {
+        "@typescript-eslint/types": "8.13.0",
+        "eslint-visitor-keys": "^3.4.3"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^20.9.0 || >=21.1.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/typescript-eslint"
+      }
+    },
+    "node_modules/@ungap/structured-clone": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/@ungap/structured-clone/-/structured-clone-1.2.0.tgz",
+      "integrity": "sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==",
+      "dev": true
+    },
+    "node_modules/@vidstack/react": {
+      "version": "1.11.30",
+      "resolved": "https://registry.npmjs.org/@vidstack/react/-/react-1.11.30.tgz",
+      "integrity": "sha512-Y9Xx4Y+bXRtlZKR+PfUGl6UX0rH6Lui5sHzdh0Jj4MZFCWv+hM9h5BaV2k97vLGEYpGDl/11imENCrHFWgR3HA==",
+      "license": "MIT",
+      "dependencies": {
+        "@floating-ui/dom": "^1.4.4",
+        "media-captions": "^1.0.1"
+      },
+      "engines": {
+        "node": ">=18"
+      },
+      "peerDependencies": {
+        "@types/react": "^18.0.0",
+        "react": "^18.0.0"
+      }
+    },
+    "node_modules/acorn": {
+      "version": "8.14.0",
+      "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.14.0.tgz",
+      "integrity": "sha512-cl669nCJTZBsL97OF4kUQm5g5hC2uihk0NxY3WENAC0TYdILVkAyHymAntgxGkl7K+t0cXIrH5siy5S4XkFycA==",
+      "dev": true,
+      "bin": {
+        "acorn": "bin/acorn"
+      },
+      "engines": {
+        "node": ">=0.4.0"
+      }
+    },
+    "node_modules/acorn-jsx": {
+      "version": "5.3.2",
+      "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz",
+      "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==",
+      "dev": true,
+      "peerDependencies": {
+        "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0"
+      }
+    },
+    "node_modules/ajv": {
+      "version": "6.12.6",
+      "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz",
+      "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==",
+      "dev": true,
+      "dependencies": {
+        "fast-deep-equal": "^3.1.1",
+        "fast-json-stable-stringify": "^2.0.0",
+        "json-schema-traverse": "^0.4.1",
+        "uri-js": "^4.2.2"
+      },
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/epoberezkin"
+      }
+    },
+    "node_modules/ansi-regex": {
+      "version": "5.0.1",
+      "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz",
+      "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/ansi-styles": {
+      "version": "4.3.0",
+      "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz",
+      "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==",
+      "dev": true,
+      "dependencies": {
+        "color-convert": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=8"
+      },
+      "funding": {
+        "url": "https://github.com/chalk/ansi-styles?sponsor=1"
+      }
+    },
+    "node_modules/argparse": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz",
+      "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==",
+      "dev": true
+    },
+    "node_modules/aria-query": {
+      "version": "5.3.2",
+      "resolved": "https://registry.npmjs.org/aria-query/-/aria-query-5.3.2.tgz",
+      "integrity": "sha512-COROpnaoap1E2F000S62r6A60uHZnmlvomhfyT2DlTcrY1OrBKn2UhH7qn5wTC9zMvD0AY7csdPSNwKP+7WiQw==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/array-buffer-byte-length": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/array-buffer-byte-length/-/array-buffer-byte-length-1.0.1.tgz",
+      "integrity": "sha512-ahC5W1xgou+KTXix4sAO8Ki12Q+jf4i0+tmk3sC+zgcynshkHxzpXdImBehiUYKKKDwvfFiJl1tZt6ewscS1Mg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.5",
+        "is-array-buffer": "^3.0.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array-includes": {
+      "version": "3.1.8",
+      "resolved": "https://registry.npmjs.org/array-includes/-/array-includes-3.1.8.tgz",
+      "integrity": "sha512-itaWrbYbqpGXkGhZPGUulwnhVf5Hpy1xiCFsGqyIGglbBxmG5vSjxQen3/WGOjPpNEv1RtBLKxbmVXm8HpJStQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2",
+        "es-object-atoms": "^1.0.0",
+        "get-intrinsic": "^1.2.4",
+        "is-string": "^1.0.7"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array.prototype.findlast": {
+      "version": "1.2.5",
+      "resolved": "https://registry.npmjs.org/array.prototype.findlast/-/array.prototype.findlast-1.2.5.tgz",
+      "integrity": "sha512-CVvd6FHg1Z3POpBLxO6E6zr+rSKEQ9L6rZHAaY7lLfhKsWYUBBOuMs0e9o24oopj6H+geRCX0YJ+TJLBK2eHyQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2",
+        "es-errors": "^1.3.0",
+        "es-object-atoms": "^1.0.0",
+        "es-shim-unscopables": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array.prototype.findlastindex": {
+      "version": "1.2.5",
+      "resolved": "https://registry.npmjs.org/array.prototype.findlastindex/-/array.prototype.findlastindex-1.2.5.tgz",
+      "integrity": "sha512-zfETvRFA8o7EiNn++N5f/kaCw221hrpGsDmcpndVupkPzEc1Wuf3VgC0qby1BbHs7f5DVYjgtEU2LLh5bqeGfQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2",
+        "es-errors": "^1.3.0",
+        "es-object-atoms": "^1.0.0",
+        "es-shim-unscopables": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array.prototype.flat": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/array.prototype.flat/-/array.prototype.flat-1.3.2.tgz",
+      "integrity": "sha512-djYB+Zx2vLewY8RWlNCUdHjDXs2XOgm602S9E7P/UpHgfeHL00cRiIF+IN/G/aUJ7kGPb6yO/ErDI5V2s8iycA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "define-properties": "^1.2.0",
+        "es-abstract": "^1.22.1",
+        "es-shim-unscopables": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array.prototype.flatmap": {
+      "version": "1.3.2",
+      "resolved": "https://registry.npmjs.org/array.prototype.flatmap/-/array.prototype.flatmap-1.3.2.tgz",
+      "integrity": "sha512-Ewyx0c9PmpcsByhSW4r+9zDU7sGjFc86qf/kKtuSCRdhfbk0SNLLkaT5qvcHnRGgc5NP/ly/y+qkXkqONX54CQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "define-properties": "^1.2.0",
+        "es-abstract": "^1.22.1",
+        "es-shim-unscopables": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/array.prototype.tosorted": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/array.prototype.tosorted/-/array.prototype.tosorted-1.1.4.tgz",
+      "integrity": "sha512-p6Fx8B7b7ZhL/gmUsAy0D15WhvDccw3mnGNbZpi3pmeJdxtWsj2jEaI4Y6oo3XiHfzuSgPwKc04MYt6KgvC/wA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.3",
+        "es-errors": "^1.3.0",
+        "es-shim-unscopables": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/arraybuffer.prototype.slice": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/arraybuffer.prototype.slice/-/arraybuffer.prototype.slice-1.0.3.tgz",
+      "integrity": "sha512-bMxMKAjg13EBSVscxTaYA4mRc5t1UAXa2kXiGTNfZ079HIWXEkKmkgFrh/nJqamaLSrXO5H4WFFkPEaLJWbs3A==",
+      "dev": true,
+      "dependencies": {
+        "array-buffer-byte-length": "^1.0.1",
+        "call-bind": "^1.0.5",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.22.3",
+        "es-errors": "^1.2.1",
+        "get-intrinsic": "^1.2.3",
+        "is-array-buffer": "^3.0.4",
+        "is-shared-array-buffer": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/ast-types-flow": {
+      "version": "0.0.8",
+      "resolved": "https://registry.npmjs.org/ast-types-flow/-/ast-types-flow-0.0.8.tgz",
+      "integrity": "sha512-OH/2E5Fg20h2aPrbe+QL8JZQFko0YZaF+j4mnQ7BGhfavO7OpSLa8a0y9sBwomHdSbkhTS8TQNayBfnW5DwbvQ==",
+      "dev": true
+    },
+    "node_modules/asynckit": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+      "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q=="
+    },
+    "node_modules/available-typed-arrays": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.7.tgz",
+      "integrity": "sha512-wvUjBtSGN7+7SjNpq/9M2Tg350UZD3q62IFZLbRAR1bSMlCo1ZaeW+BJ+D090e4hIIZLBcTDWe4Mh4jvUDajzQ==",
+      "dev": true,
+      "dependencies": {
+        "possible-typed-array-names": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/axe-core": {
+      "version": "4.10.2",
+      "resolved": "https://registry.npmjs.org/axe-core/-/axe-core-4.10.2.tgz",
+      "integrity": "sha512-RE3mdQ7P3FRSe7eqCWoeQ/Z9QXrtniSjp1wUjt5nRC3WIpz5rSCve6o3fsZ2aCpJtrZjSZgjwXAoTO5k4tEI0w==",
+      "dev": true,
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/axios": {
+      "version": "1.7.9",
+      "resolved": "https://registry.npmjs.org/axios/-/axios-1.7.9.tgz",
+      "integrity": "sha512-LhLcE7Hbiryz8oMDdDptSrWowmB4Bl6RCt6sIJKpRB4XtVf0iEgewX3au/pJqm+Py1kCASkb/FFKjxQaLtxJvw==",
+      "license": "MIT",
+      "dependencies": {
+        "follow-redirects": "^1.15.6",
+        "form-data": "^4.0.0",
+        "proxy-from-env": "^1.1.0"
+      }
+    },
+    "node_modules/axobject-query": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/axobject-query/-/axobject-query-4.1.0.tgz",
+      "integrity": "sha512-qIj0G9wZbMGNLjLmg1PT6v2mE9AH2zlnADJD/2tC6E00hgmhUOfEB6greHPAfLRSufHqROIUTkw6E+M3lH0PTQ==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/balanced-match": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz",
+      "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==",
+      "dev": true
+    },
+    "node_modules/brace-expansion": {
+      "version": "1.1.11",
+      "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz",
+      "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==",
+      "dev": true,
+      "dependencies": {
+        "balanced-match": "^1.0.0",
+        "concat-map": "0.0.1"
+      }
+    },
+    "node_modules/braces": {
+      "version": "3.0.3",
+      "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz",
+      "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==",
+      "dev": true,
+      "dependencies": {
+        "fill-range": "^7.1.1"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/busboy": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/busboy/-/busboy-1.6.0.tgz",
+      "integrity": "sha512-8SFQbg/0hQ9xy3UNTB0YEnsNBbWfhf7RtnzpL7TkBiTBRfrQ9Fxcnz7VJsleJpyp6rVLvXiuORqjlHi5q+PYuA==",
+      "dependencies": {
+        "streamsearch": "^1.1.0"
+      },
+      "engines": {
+        "node": ">=10.16.0"
+      }
+    },
+    "node_modules/call-bind": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.7.tgz",
+      "integrity": "sha512-GHTSNSYICQ7scH7sZ+M2rFopRoLh8t2bLSW6BbgrtLsahOIB5iyAVJf9GjWK3cYTDaMj4XdBpM1cA6pIS0Kv2w==",
+      "dev": true,
+      "dependencies": {
+        "es-define-property": "^1.0.0",
+        "es-errors": "^1.3.0",
+        "function-bind": "^1.1.2",
+        "get-intrinsic": "^1.2.4",
+        "set-function-length": "^1.2.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/callsites": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz",
+      "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/camelcase-css": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz",
+      "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==",
+      "dev": true,
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/caniuse-lite": {
+      "version": "1.0.30001679",
+      "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001679.tgz",
+      "integrity": "sha512-j2YqID/YwpLnKzCmBOS4tlZdWprXm3ZmQLBH9ZBXFOhoxLA46fwyBvx6toCBWBmnuwUY/qB3kEU6gFx8qgCroA==",
+      "funding": [
+        {
+          "type": "opencollective",
+          "url": "https://opencollective.com/browserslist"
+        },
+        {
+          "type": "tidelift",
+          "url": "https://tidelift.com/funding/github/npm/caniuse-lite"
+        },
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ]
+    },
+    "node_modules/chalk": {
+      "version": "4.1.2",
+      "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz",
+      "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==",
+      "dev": true,
+      "dependencies": {
+        "ansi-styles": "^4.1.0",
+        "supports-color": "^7.1.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/chalk/chalk?sponsor=1"
+      }
+    },
+    "node_modules/client-only": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/client-only/-/client-only-0.0.1.tgz",
+      "integrity": "sha512-IV3Ou0jSMzZrd3pZ48nLkT9DA7Ag1pnPzaiQhpW7c3RbcqqzvzzVu+L8gfqMp/8IM2MQtSiqaCxrrcfu8I8rMA=="
+    },
+    "node_modules/clsx": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/clsx/-/clsx-2.1.1.tgz",
+      "integrity": "sha512-eYm0QWBtUrBWZWG0d386OGAw16Z995PiOVo2B7bjWSbHedGl5e0ZWaq65kOGgUSNesEIDkB9ISbTg/JK9dhCZA==",
+      "license": "MIT",
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/color": {
+      "version": "4.2.3",
+      "resolved": "https://registry.npmjs.org/color/-/color-4.2.3.tgz",
+      "integrity": "sha512-1rXeuUUiGGrykh+CeBdu5Ie7OJwinCgQY0bc7GCRxy5xVHy+moaqkpL/jqQq0MtQOeYcrqEz4abc5f0KtU7W4A==",
+      "optional": true,
+      "dependencies": {
+        "color-convert": "^2.0.1",
+        "color-string": "^1.9.0"
+      },
+      "engines": {
+        "node": ">=12.5.0"
+      }
+    },
+    "node_modules/color-convert": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz",
+      "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==",
+      "devOptional": true,
+      "dependencies": {
+        "color-name": "~1.1.4"
+      },
+      "engines": {
+        "node": ">=7.0.0"
+      }
+    },
+    "node_modules/color-name": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz",
+      "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==",
+      "devOptional": true
+    },
+    "node_modules/color-string": {
+      "version": "1.9.1",
+      "resolved": "https://registry.npmjs.org/color-string/-/color-string-1.9.1.tgz",
+      "integrity": "sha512-shrVawQFojnZv6xM40anx4CkoDP+fZsw/ZerEMsW/pyzsRbElpsL/DBVW7q3ExxwusdNXI3lXpuhEZkzs8p5Eg==",
+      "optional": true,
+      "dependencies": {
+        "color-name": "^1.0.0",
+        "simple-swizzle": "^0.2.2"
+      }
+    },
+    "node_modules/combined-stream": {
+      "version": "1.0.8",
+      "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz",
+      "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==",
+      "dependencies": {
+        "delayed-stream": "~1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.8"
+      }
+    },
+    "node_modules/concat-map": {
+      "version": "0.0.1",
+      "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz",
+      "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==",
+      "dev": true
+    },
+    "node_modules/cross-spawn": {
+      "version": "7.0.5",
+      "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.5.tgz",
+      "integrity": "sha512-ZVJrKKYunU38/76t0RMOulHOnUcbU9GbpWKAOZ0mhjr7CX6FVrH+4FrAapSOekrgFQ3f/8gwMEuIft0aKq6Hug==",
+      "dev": true,
+      "dependencies": {
+        "path-key": "^3.1.0",
+        "shebang-command": "^2.0.0",
+        "which": "^2.0.1"
+      },
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/cssesc": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz",
+      "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==",
+      "dev": true,
+      "bin": {
+        "cssesc": "bin/cssesc"
+      },
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/csstype": {
+      "version": "3.1.3",
+      "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz",
+      "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw=="
+    },
+    "node_modules/d3-array": {
+      "version": "3.2.4",
+      "resolved": "https://registry.npmjs.org/d3-array/-/d3-array-3.2.4.tgz",
+      "integrity": "sha512-tdQAmyA18i4J7wprpYq8ClcxZy3SC31QMeByyCFyRt7BVHdREQZ5lpzoe5mFEYZUWe+oq8HBvk9JjpibyEV4Jg==",
+      "license": "ISC",
+      "dependencies": {
+        "internmap": "1 - 2"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-color": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/d3-color/-/d3-color-3.1.0.tgz",
+      "integrity": "sha512-zg/chbXyeBtMQ1LbD/WSoW2DpC3I0mpmPdW+ynRTj/x2DAWYrIY7qeZIHidozwV24m4iavr15lNwIwLxRmOxhA==",
+      "license": "ISC",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-ease": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/d3-ease/-/d3-ease-3.0.1.tgz",
+      "integrity": "sha512-wR/XK3D3XcLIZwpbvQwQ5fK+8Ykds1ip7A2Txe0yxncXSdq1L9skcG7blcedkOX+ZcgxGAmLX1FrRGbADwzi0w==",
+      "license": "BSD-3-Clause",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-format": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/d3-format/-/d3-format-3.1.0.tgz",
+      "integrity": "sha512-YyUI6AEuY/Wpt8KWLgZHsIU86atmikuoOmCfommt0LYHiQSPjvX2AcFc38PX0CBpr2RCyZhjex+NS/LPOv6YqA==",
+      "license": "ISC",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-interpolate": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/d3-interpolate/-/d3-interpolate-3.0.1.tgz",
+      "integrity": "sha512-3bYs1rOD33uo8aqJfKP3JWPAibgw8Zm2+L9vBKEHJ2Rg+viTR7o5Mmv5mZcieN+FRYaAOWX5SJATX6k1PWz72g==",
+      "license": "ISC",
+      "dependencies": {
+        "d3-color": "1 - 3"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-path": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/d3-path/-/d3-path-3.1.0.tgz",
+      "integrity": "sha512-p3KP5HCf/bvjBSSKuXid6Zqijx7wIfNW+J/maPs+iwR35at5JCbLUT0LzF1cnjbCHWhqzQTIN2Jpe8pRebIEFQ==",
+      "license": "ISC",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-scale": {
+      "version": "4.0.2",
+      "resolved": "https://registry.npmjs.org/d3-scale/-/d3-scale-4.0.2.tgz",
+      "integrity": "sha512-GZW464g1SH7ag3Y7hXjf8RoUuAFIqklOAq3MRl4OaWabTFJY9PN/E1YklhXLh+OQ3fM9yS2nOkCoS+WLZ6kvxQ==",
+      "license": "ISC",
+      "dependencies": {
+        "d3-array": "2.10.0 - 3",
+        "d3-format": "1 - 3",
+        "d3-interpolate": "1.2.0 - 3",
+        "d3-time": "2.1.1 - 3",
+        "d3-time-format": "2 - 4"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-shape": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/d3-shape/-/d3-shape-3.2.0.tgz",
+      "integrity": "sha512-SaLBuwGm3MOViRq2ABk3eLoxwZELpH6zhl3FbAoJ7Vm1gofKx6El1Ib5z23NUEhF9AsGl7y+dzLe5Cw2AArGTA==",
+      "license": "ISC",
+      "dependencies": {
+        "d3-path": "^3.1.0"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-time": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/d3-time/-/d3-time-3.1.0.tgz",
+      "integrity": "sha512-VqKjzBLejbSMT4IgbmVgDjpkYrNWUYJnbCGo874u7MMKIWsILRX+OpX/gTk8MqjpT1A/c6HY2dCA77ZN0lkQ2Q==",
+      "license": "ISC",
+      "dependencies": {
+        "d3-array": "2 - 3"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-time-format": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/d3-time-format/-/d3-time-format-4.1.0.tgz",
+      "integrity": "sha512-dJxPBlzC7NugB2PDLwo9Q8JiTR3M3e4/XANkreKSUxF8vvXKqm1Yfq4Q5dl8budlunRVlUUaDUgFt7eA8D6NLg==",
+      "license": "ISC",
+      "dependencies": {
+        "d3-time": "1 - 3"
+      },
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/d3-timer": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/d3-timer/-/d3-timer-3.0.1.tgz",
+      "integrity": "sha512-ndfJ/JxxMd3nw31uyKoY2naivF+r29V+Lc0svZxe1JvvIRmi8hUsrMvdOwgS1o6uBHmiz91geQ0ylPP0aj1VUA==",
+      "license": "ISC",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/damerau-levenshtein": {
+      "version": "1.0.8",
+      "resolved": "https://registry.npmjs.org/damerau-levenshtein/-/damerau-levenshtein-1.0.8.tgz",
+      "integrity": "sha512-sdQSFB7+llfUcQHUQO3+B8ERRj0Oa4w9POWMI/puGtuf7gFywGmkaLCElnudfTiKZV+NvHqL0ifzdrI8Ro7ESA==",
+      "dev": true
+    },
+    "node_modules/data-view-buffer": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/data-view-buffer/-/data-view-buffer-1.0.1.tgz",
+      "integrity": "sha512-0lht7OugA5x3iJLOWFhWK/5ehONdprk0ISXqVFn/NFrDu+cuc8iADFrGQz5BnRK7LLU3JmkbXSxaqX+/mXYtUA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.6",
+        "es-errors": "^1.3.0",
+        "is-data-view": "^1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/data-view-byte-length": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/data-view-byte-length/-/data-view-byte-length-1.0.1.tgz",
+      "integrity": "sha512-4J7wRJD3ABAzr8wP+OcIcqq2dlUKp4DVflx++hs5h5ZKydWMI6/D/fAot+yh6g2tHh8fLFTvNOaVN357NvSrOQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "es-errors": "^1.3.0",
+        "is-data-view": "^1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/data-view-byte-offset": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/data-view-byte-offset/-/data-view-byte-offset-1.0.0.tgz",
+      "integrity": "sha512-t/Ygsytq+R995EJ5PZlD4Cu56sWa8InXySaViRzw9apusqsOO2bQP+SbYzAhR0pFKoB+43lYy8rWban9JSuXnA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.6",
+        "es-errors": "^1.3.0",
+        "is-data-view": "^1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/dayjs": {
+      "version": "1.11.13",
+      "resolved": "https://registry.npmjs.org/dayjs/-/dayjs-1.11.13.tgz",
+      "integrity": "sha512-oaMBel6gjolK862uaPQOVTA7q3TZhuSvuMQAAglQDOWYO9A91IrAOUJEyKVlqJlHE0vq5p5UXxzdPfMH/x6xNg==",
+      "license": "MIT"
+    },
+    "node_modules/debug": {
+      "version": "4.3.7",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.7.tgz",
+      "integrity": "sha512-Er2nc/H7RrMXZBFCEim6TCmMk02Z8vLC2Rbi1KEBggpo0fS6l0S1nnapwmIi3yW/+GOJap1Krg4w0Hg80oCqgQ==",
+      "dev": true,
+      "dependencies": {
+        "ms": "^2.1.3"
+      },
+      "engines": {
+        "node": ">=6.0"
+      },
+      "peerDependenciesMeta": {
+        "supports-color": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/decimal.js-light": {
+      "version": "2.5.1",
+      "resolved": "https://registry.npmjs.org/decimal.js-light/-/decimal.js-light-2.5.1.tgz",
+      "integrity": "sha512-qIMFpTMZmny+MMIitAB6D7iVPEorVw6YQRWkvarTkT4tBeSLLiHzcwj6q0MmYSFCiVpiqPJTJEYIrpcPzVEIvg==",
+      "license": "MIT"
+    },
+    "node_modules/deep-is": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz",
+      "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==",
+      "dev": true
+    },
+    "node_modules/define-data-property": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.4.tgz",
+      "integrity": "sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==",
+      "dev": true,
+      "dependencies": {
+        "es-define-property": "^1.0.0",
+        "es-errors": "^1.3.0",
+        "gopd": "^1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/define-properties": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.2.1.tgz",
+      "integrity": "sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==",
+      "dev": true,
+      "dependencies": {
+        "define-data-property": "^1.0.1",
+        "has-property-descriptors": "^1.0.0",
+        "object-keys": "^1.1.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/delayed-stream": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+      "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==",
+      "engines": {
+        "node": ">=0.4.0"
+      }
+    },
+    "node_modules/detect-libc": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.3.tgz",
+      "integrity": "sha512-bwy0MGW55bG41VqxxypOsdSdGqLwXPI/focwgTYCFMbdUiBAxLg9CFzG08sz2aqzknwiX7Hkl0bQENjg8iLByw==",
+      "optional": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/detect-node-es": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/detect-node-es/-/detect-node-es-1.1.0.tgz",
+      "integrity": "sha512-ypdmJU/TbBby2Dxibuv7ZLW3Bs1QEmM7nHjEANfohJLvE0XVujisn1qPJcZxg+qDucsr+bP6fLD1rPS3AhJ7EQ=="
+    },
+    "node_modules/doctrine": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-3.0.0.tgz",
+      "integrity": "sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==",
+      "dev": true,
+      "dependencies": {
+        "esutils": "^2.0.2"
+      },
+      "engines": {
+        "node": ">=6.0.0"
+      }
+    },
+    "node_modules/dom-helpers": {
+      "version": "5.2.1",
+      "resolved": "https://registry.npmjs.org/dom-helpers/-/dom-helpers-5.2.1.tgz",
+      "integrity": "sha512-nRCa7CK3VTrM2NmGkIy4cbK7IZlgBE/PYMn55rrXefr5xXDP0LdtfPnblFDoVdcAfslJ7or6iqAUnx0CCGIWQA==",
+      "license": "MIT",
+      "dependencies": {
+        "@babel/runtime": "^7.8.7",
+        "csstype": "^3.0.2"
+      }
+    },
+    "node_modules/embla-carousel": {
+      "version": "7.1.0",
+      "resolved": "https://registry.npmjs.org/embla-carousel/-/embla-carousel-7.1.0.tgz",
+      "integrity": "sha512-Bh8Pa8NWzgugLkf8sAGexQlBCNDFaej5BXiKgQdRJ1mUC9NWBrw9Z23YVPVGkguWoz5LMjZXXFVGCobl3UPt/Q==",
+      "license": "MIT"
+    },
+    "node_modules/embla-carousel-react": {
+      "version": "7.1.0",
+      "resolved": "https://registry.npmjs.org/embla-carousel-react/-/embla-carousel-react-7.1.0.tgz",
+      "integrity": "sha512-tbYRPRZSDNd2QLNqYDcArAakGIxtUbhS7tkP0dGXktXHGgcX+3ji3VrOUTOftBiujZrMV8kRxtrRUe/1soloIQ==",
+      "license": "MIT",
+      "dependencies": {
+        "embla-carousel": "7.1.0"
+      },
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.1 || ^18.0.0"
+      }
+    },
+    "node_modules/emoji-regex": {
+      "version": "9.2.2",
+      "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz",
+      "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==",
+      "dev": true
+    },
+    "node_modules/enhanced-resolve": {
+      "version": "5.17.1",
+      "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-5.17.1.tgz",
+      "integrity": "sha512-LMHl3dXhTcfv8gM4kEzIUeTQ+7fpdA0l2tUf34BddXPkz2A5xJ5L/Pchd5BL6rdccM9QGvu0sWZzK1Z1t4wwyg==",
+      "dev": true,
+      "dependencies": {
+        "graceful-fs": "^4.2.4",
+        "tapable": "^2.2.0"
+      },
+      "engines": {
+        "node": ">=10.13.0"
+      }
+    },
+    "node_modules/es-abstract": {
+      "version": "1.23.3",
+      "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.23.3.tgz",
+      "integrity": "sha512-e+HfNH61Bj1X9/jLc5v1owaLYuHdeHHSQlkhCBiTK8rBvKaULl/beGMxwrMXjpYrv4pz22BlY570vVePA2ho4A==",
+      "dev": true,
+      "dependencies": {
+        "array-buffer-byte-length": "^1.0.1",
+        "arraybuffer.prototype.slice": "^1.0.3",
+        "available-typed-arrays": "^1.0.7",
+        "call-bind": "^1.0.7",
+        "data-view-buffer": "^1.0.1",
+        "data-view-byte-length": "^1.0.1",
+        "data-view-byte-offset": "^1.0.0",
+        "es-define-property": "^1.0.0",
+        "es-errors": "^1.3.0",
+        "es-object-atoms": "^1.0.0",
+        "es-set-tostringtag": "^2.0.3",
+        "es-to-primitive": "^1.2.1",
+        "function.prototype.name": "^1.1.6",
+        "get-intrinsic": "^1.2.4",
+        "get-symbol-description": "^1.0.2",
+        "globalthis": "^1.0.3",
+        "gopd": "^1.0.1",
+        "has-property-descriptors": "^1.0.2",
+        "has-proto": "^1.0.3",
+        "has-symbols": "^1.0.3",
+        "hasown": "^2.0.2",
+        "internal-slot": "^1.0.7",
+        "is-array-buffer": "^3.0.4",
+        "is-callable": "^1.2.7",
+        "is-data-view": "^1.0.1",
+        "is-negative-zero": "^2.0.3",
+        "is-regex": "^1.1.4",
+        "is-shared-array-buffer": "^1.0.3",
+        "is-string": "^1.0.7",
+        "is-typed-array": "^1.1.13",
+        "is-weakref": "^1.0.2",
+        "object-inspect": "^1.13.1",
+        "object-keys": "^1.1.1",
+        "object.assign": "^4.1.5",
+        "regexp.prototype.flags": "^1.5.2",
+        "safe-array-concat": "^1.1.2",
+        "safe-regex-test": "^1.0.3",
+        "string.prototype.trim": "^1.2.9",
+        "string.prototype.trimend": "^1.0.8",
+        "string.prototype.trimstart": "^1.0.8",
+        "typed-array-buffer": "^1.0.2",
+        "typed-array-byte-length": "^1.0.1",
+        "typed-array-byte-offset": "^1.0.2",
+        "typed-array-length": "^1.0.6",
+        "unbox-primitive": "^1.0.2",
+        "which-typed-array": "^1.1.15"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/es-define-property": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.0.tgz",
+      "integrity": "sha512-jxayLKShrEqqzJ0eumQbVhTYQM27CfT1T35+gCgDFoL82JLsXqTJ76zv6A0YLOgEnLUMvLzsDsGIrl8NFpT2gQ==",
+      "dev": true,
+      "dependencies": {
+        "get-intrinsic": "^1.2.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/es-errors": {
+      "version": "1.3.0",
+      "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz",
+      "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/es-iterator-helpers": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/es-iterator-helpers/-/es-iterator-helpers-1.2.0.tgz",
+      "integrity": "sha512-tpxqxncxnpw3c93u8n3VOzACmRFoVmWJqbWXvX/JfKbkhBw1oslgPrUfeSt2psuqyEJFD6N/9lg5i7bsKpoq+Q==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.3",
+        "es-errors": "^1.3.0",
+        "es-set-tostringtag": "^2.0.3",
+        "function-bind": "^1.1.2",
+        "get-intrinsic": "^1.2.4",
+        "globalthis": "^1.0.4",
+        "gopd": "^1.0.1",
+        "has-property-descriptors": "^1.0.2",
+        "has-proto": "^1.0.3",
+        "has-symbols": "^1.0.3",
+        "internal-slot": "^1.0.7",
+        "iterator.prototype": "^1.1.3",
+        "safe-array-concat": "^1.1.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/es-object-atoms": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.0.0.tgz",
+      "integrity": "sha512-MZ4iQ6JwHOBQjahnjwaC1ZtIBH+2ohjamzAO3oaHcXYup7qxjF2fixyH+Q71voWHeOkI2q/TnJao/KfXYIZWbw==",
+      "dev": true,
+      "dependencies": {
+        "es-errors": "^1.3.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/es-set-tostringtag": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.0.3.tgz",
+      "integrity": "sha512-3T8uNMC3OQTHkFUsFq8r/BwAXLHvU/9O9mE0fBc/MY5iq/8H7ncvO947LmYA6ldWw9Uh8Yhf25zu6n7nML5QWQ==",
+      "dev": true,
+      "dependencies": {
+        "get-intrinsic": "^1.2.4",
+        "has-tostringtag": "^1.0.2",
+        "hasown": "^2.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/es-shim-unscopables": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/es-shim-unscopables/-/es-shim-unscopables-1.0.2.tgz",
+      "integrity": "sha512-J3yBRXCzDu4ULnQwxyToo/OjdMx6akgVC7K6few0a7F/0wLtmKKN7I73AH5T2836UuXRqN7Qg+IIUw/+YJksRw==",
+      "dev": true,
+      "dependencies": {
+        "hasown": "^2.0.0"
+      }
+    },
+    "node_modules/es-to-primitive": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz",
+      "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==",
+      "dev": true,
+      "dependencies": {
+        "is-callable": "^1.1.4",
+        "is-date-object": "^1.0.1",
+        "is-symbol": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/escape-string-regexp": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz",
+      "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==",
+      "dev": true,
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/eslint": {
+      "version": "8.57.1",
+      "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.57.1.tgz",
+      "integrity": "sha512-ypowyDxpVSYpkXr9WPv2PAZCtNip1Mv5KTW0SCurXv/9iOpcrH9PaqUElksqEB6pChqHGDRCFTyrZlGhnLNGiA==",
+      "deprecated": "This version is no longer supported. Please see https://eslint.org/version-support for other options.",
+      "dev": true,
+      "dependencies": {
+        "@eslint-community/eslint-utils": "^4.2.0",
+        "@eslint-community/regexpp": "^4.6.1",
+        "@eslint/eslintrc": "^2.1.4",
+        "@eslint/js": "8.57.1",
+        "@humanwhocodes/config-array": "^0.13.0",
+        "@humanwhocodes/module-importer": "^1.0.1",
+        "@nodelib/fs.walk": "^1.2.8",
+        "@ungap/structured-clone": "^1.2.0",
+        "ajv": "^6.12.4",
+        "chalk": "^4.0.0",
+        "cross-spawn": "^7.0.2",
+        "debug": "^4.3.2",
+        "doctrine": "^3.0.0",
+        "escape-string-regexp": "^4.0.0",
+        "eslint-scope": "^7.2.2",
+        "eslint-visitor-keys": "^3.4.3",
+        "espree": "^9.6.1",
+        "esquery": "^1.4.2",
+        "esutils": "^2.0.2",
+        "fast-deep-equal": "^3.1.3",
+        "file-entry-cache": "^6.0.1",
+        "find-up": "^5.0.0",
+        "glob-parent": "^6.0.2",
+        "globals": "^13.19.0",
+        "graphemer": "^1.4.0",
+        "ignore": "^5.2.0",
+        "imurmurhash": "^0.1.4",
+        "is-glob": "^4.0.0",
+        "is-path-inside": "^3.0.3",
+        "js-yaml": "^4.1.0",
+        "json-stable-stringify-without-jsonify": "^1.0.1",
+        "levn": "^0.4.1",
+        "lodash.merge": "^4.6.2",
+        "minimatch": "^3.1.2",
+        "natural-compare": "^1.4.0",
+        "optionator": "^0.9.3",
+        "strip-ansi": "^6.0.1",
+        "text-table": "^0.2.0"
+      },
+      "bin": {
+        "eslint": "bin/eslint.js"
+      },
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/eslint-config-next": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/eslint-config-next/-/eslint-config-next-15.1.2.tgz",
+      "integrity": "sha512-PrMm1/4zWSJ689wd/ypWIR5ZF1uvmp3EkgpgBV1Yu6PhEobBjXMGgT8bVNelwl17LXojO8D5ePFRiI4qXjsPRA==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "@next/eslint-plugin-next": "15.1.2",
+        "@rushstack/eslint-patch": "^1.10.3",
+        "@typescript-eslint/eslint-plugin": "^5.4.2 || ^6.0.0 || ^7.0.0 || ^8.0.0",
+        "@typescript-eslint/parser": "^5.4.2 || ^6.0.0 || ^7.0.0 || ^8.0.0",
+        "eslint-import-resolver-node": "^0.3.6",
+        "eslint-import-resolver-typescript": "^3.5.2",
+        "eslint-plugin-import": "^2.31.0",
+        "eslint-plugin-jsx-a11y": "^6.10.0",
+        "eslint-plugin-react": "^7.37.0",
+        "eslint-plugin-react-hooks": "^5.0.0"
+      },
+      "peerDependencies": {
+        "eslint": "^7.23.0 || ^8.0.0 || ^9.0.0",
+        "typescript": ">=3.3.1"
+      },
+      "peerDependenciesMeta": {
+        "typescript": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/eslint-import-resolver-node": {
+      "version": "0.3.9",
+      "resolved": "https://registry.npmjs.org/eslint-import-resolver-node/-/eslint-import-resolver-node-0.3.9.tgz",
+      "integrity": "sha512-WFj2isz22JahUv+B788TlO3N6zL3nNJGU8CcZbPZvVEkBPaJdCV4vy5wyghty5ROFbCRnm132v8BScu5/1BQ8g==",
+      "dev": true,
+      "dependencies": {
+        "debug": "^3.2.7",
+        "is-core-module": "^2.13.0",
+        "resolve": "^1.22.4"
+      }
+    },
+    "node_modules/eslint-import-resolver-node/node_modules/debug": {
+      "version": "3.2.7",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz",
+      "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==",
+      "dev": true,
+      "dependencies": {
+        "ms": "^2.1.1"
+      }
+    },
+    "node_modules/eslint-import-resolver-typescript": {
+      "version": "3.6.3",
+      "resolved": "https://registry.npmjs.org/eslint-import-resolver-typescript/-/eslint-import-resolver-typescript-3.6.3.tgz",
+      "integrity": "sha512-ud9aw4szY9cCT1EWWdGv1L1XR6hh2PaRWif0j2QjQ0pgTY/69iw+W0Z4qZv5wHahOl8isEr+k/JnyAqNQkLkIA==",
+      "dev": true,
+      "dependencies": {
+        "@nolyfill/is-core-module": "1.0.39",
+        "debug": "^4.3.5",
+        "enhanced-resolve": "^5.15.0",
+        "eslint-module-utils": "^2.8.1",
+        "fast-glob": "^3.3.2",
+        "get-tsconfig": "^4.7.5",
+        "is-bun-module": "^1.0.2",
+        "is-glob": "^4.0.3"
+      },
+      "engines": {
+        "node": "^14.18.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/unts/projects/eslint-import-resolver-ts"
+      },
+      "peerDependencies": {
+        "eslint": "*",
+        "eslint-plugin-import": "*",
+        "eslint-plugin-import-x": "*"
+      },
+      "peerDependenciesMeta": {
+        "eslint-plugin-import": {
+          "optional": true
+        },
+        "eslint-plugin-import-x": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/eslint-import-resolver-typescript/node_modules/fast-glob": {
+      "version": "3.3.2",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz",
+      "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==",
+      "dev": true,
+      "dependencies": {
+        "@nodelib/fs.stat": "^2.0.2",
+        "@nodelib/fs.walk": "^1.2.3",
+        "glob-parent": "^5.1.2",
+        "merge2": "^1.3.0",
+        "micromatch": "^4.0.4"
+      },
+      "engines": {
+        "node": ">=8.6.0"
+      }
+    },
+    "node_modules/eslint-import-resolver-typescript/node_modules/glob-parent": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+      "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+      "dev": true,
+      "dependencies": {
+        "is-glob": "^4.0.1"
+      },
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/eslint-module-utils": {
+      "version": "2.12.0",
+      "resolved": "https://registry.npmjs.org/eslint-module-utils/-/eslint-module-utils-2.12.0.tgz",
+      "integrity": "sha512-wALZ0HFoytlyh/1+4wuZ9FJCD/leWHQzzrxJ8+rebyReSLk7LApMyd3WJaLVoN+D5+WIdJyDK1c6JnE65V4Zyg==",
+      "dev": true,
+      "dependencies": {
+        "debug": "^3.2.7"
+      },
+      "engines": {
+        "node": ">=4"
+      },
+      "peerDependenciesMeta": {
+        "eslint": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/eslint-module-utils/node_modules/debug": {
+      "version": "3.2.7",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz",
+      "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==",
+      "dev": true,
+      "dependencies": {
+        "ms": "^2.1.1"
+      }
+    },
+    "node_modules/eslint-plugin-import": {
+      "version": "2.31.0",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-import/-/eslint-plugin-import-2.31.0.tgz",
+      "integrity": "sha512-ixmkI62Rbc2/w8Vfxyh1jQRTdRTF52VxwRVHl/ykPAmqG+Nb7/kNn+byLP0LxPgI7zWA16Jt82SybJInmMia3A==",
+      "dev": true,
+      "dependencies": {
+        "@rtsao/scc": "^1.1.0",
+        "array-includes": "^3.1.8",
+        "array.prototype.findlastindex": "^1.2.5",
+        "array.prototype.flat": "^1.3.2",
+        "array.prototype.flatmap": "^1.3.2",
+        "debug": "^3.2.7",
+        "doctrine": "^2.1.0",
+        "eslint-import-resolver-node": "^0.3.9",
+        "eslint-module-utils": "^2.12.0",
+        "hasown": "^2.0.2",
+        "is-core-module": "^2.15.1",
+        "is-glob": "^4.0.3",
+        "minimatch": "^3.1.2",
+        "object.fromentries": "^2.0.8",
+        "object.groupby": "^1.0.3",
+        "object.values": "^1.2.0",
+        "semver": "^6.3.1",
+        "string.prototype.trimend": "^1.0.8",
+        "tsconfig-paths": "^3.15.0"
+      },
+      "engines": {
+        "node": ">=4"
+      },
+      "peerDependencies": {
+        "eslint": "^2 || ^3 || ^4 || ^5 || ^6 || ^7.2.0 || ^8 || ^9"
+      }
+    },
+    "node_modules/eslint-plugin-import/node_modules/debug": {
+      "version": "3.2.7",
+      "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz",
+      "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==",
+      "dev": true,
+      "dependencies": {
+        "ms": "^2.1.1"
+      }
+    },
+    "node_modules/eslint-plugin-import/node_modules/doctrine": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-2.1.0.tgz",
+      "integrity": "sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==",
+      "dev": true,
+      "dependencies": {
+        "esutils": "^2.0.2"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/eslint-plugin-import/node_modules/semver": {
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
+      "dev": true,
+      "bin": {
+        "semver": "bin/semver.js"
+      }
+    },
+    "node_modules/eslint-plugin-jsx-a11y": {
+      "version": "6.10.2",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-jsx-a11y/-/eslint-plugin-jsx-a11y-6.10.2.tgz",
+      "integrity": "sha512-scB3nz4WmG75pV8+3eRUQOHZlNSUhFNq37xnpgRkCCELU3XMvXAxLk1eqWWyE22Ki4Q01Fnsw9BA3cJHDPgn2Q==",
+      "dev": true,
+      "dependencies": {
+        "aria-query": "^5.3.2",
+        "array-includes": "^3.1.8",
+        "array.prototype.flatmap": "^1.3.2",
+        "ast-types-flow": "^0.0.8",
+        "axe-core": "^4.10.0",
+        "axobject-query": "^4.1.0",
+        "damerau-levenshtein": "^1.0.8",
+        "emoji-regex": "^9.2.2",
+        "hasown": "^2.0.2",
+        "jsx-ast-utils": "^3.3.5",
+        "language-tags": "^1.0.9",
+        "minimatch": "^3.1.2",
+        "object.fromentries": "^2.0.8",
+        "safe-regex-test": "^1.0.3",
+        "string.prototype.includes": "^2.0.1"
+      },
+      "engines": {
+        "node": ">=4.0"
+      },
+      "peerDependencies": {
+        "eslint": "^3 || ^4 || ^5 || ^6 || ^7 || ^8 || ^9"
+      }
+    },
+    "node_modules/eslint-plugin-react": {
+      "version": "7.37.2",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.37.2.tgz",
+      "integrity": "sha512-EsTAnj9fLVr/GZleBLFbj/sSuXeWmp1eXIN60ceYnZveqEaUCyW4X+Vh4WTdUhCkW4xutXYqTXCUSyqD4rB75w==",
+      "dev": true,
+      "dependencies": {
+        "array-includes": "^3.1.8",
+        "array.prototype.findlast": "^1.2.5",
+        "array.prototype.flatmap": "^1.3.2",
+        "array.prototype.tosorted": "^1.1.4",
+        "doctrine": "^2.1.0",
+        "es-iterator-helpers": "^1.1.0",
+        "estraverse": "^5.3.0",
+        "hasown": "^2.0.2",
+        "jsx-ast-utils": "^2.4.1 || ^3.0.0",
+        "minimatch": "^3.1.2",
+        "object.entries": "^1.1.8",
+        "object.fromentries": "^2.0.8",
+        "object.values": "^1.2.0",
+        "prop-types": "^15.8.1",
+        "resolve": "^2.0.0-next.5",
+        "semver": "^6.3.1",
+        "string.prototype.matchall": "^4.0.11",
+        "string.prototype.repeat": "^1.0.0"
+      },
+      "engines": {
+        "node": ">=4"
+      },
+      "peerDependencies": {
+        "eslint": "^3 || ^4 || ^5 || ^6 || ^7 || ^8 || ^9.7"
+      }
+    },
+    "node_modules/eslint-plugin-react-hooks": {
+      "version": "5.0.0",
+      "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-5.0.0.tgz",
+      "integrity": "sha512-hIOwI+5hYGpJEc4uPRmz2ulCjAGD/N13Lukkh8cLV0i2IRk/bdZDYjgLVHj+U9Z704kLIdIO6iueGvxNur0sgw==",
+      "dev": true,
+      "engines": {
+        "node": ">=10"
+      },
+      "peerDependencies": {
+        "eslint": "^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0 || ^9.0.0"
+      }
+    },
+    "node_modules/eslint-plugin-react/node_modules/doctrine": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-2.1.0.tgz",
+      "integrity": "sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==",
+      "dev": true,
+      "dependencies": {
+        "esutils": "^2.0.2"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/eslint-plugin-react/node_modules/resolve": {
+      "version": "2.0.0-next.5",
+      "resolved": "https://registry.npmjs.org/resolve/-/resolve-2.0.0-next.5.tgz",
+      "integrity": "sha512-U7WjGVG9sH8tvjW5SmGbQuui75FiyjAX72HX15DwBBwF9dNiQZRQAg9nnPhYy+TUnE0+VcrttuvNI8oSxZcocA==",
+      "dev": true,
+      "dependencies": {
+        "is-core-module": "^2.13.0",
+        "path-parse": "^1.0.7",
+        "supports-preserve-symlinks-flag": "^1.0.0"
+      },
+      "bin": {
+        "resolve": "bin/resolve"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/eslint-plugin-react/node_modules/semver": {
+      "version": "6.3.1",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz",
+      "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==",
+      "dev": true,
+      "bin": {
+        "semver": "bin/semver.js"
+      }
+    },
+    "node_modules/eslint-scope": {
+      "version": "7.2.2",
+      "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz",
+      "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==",
+      "dev": true,
+      "dependencies": {
+        "esrecurse": "^4.3.0",
+        "estraverse": "^5.2.0"
+      },
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/eslint-visitor-keys": {
+      "version": "3.4.3",
+      "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz",
+      "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==",
+      "dev": true,
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/espree": {
+      "version": "9.6.1",
+      "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz",
+      "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==",
+      "dev": true,
+      "dependencies": {
+        "acorn": "^8.9.0",
+        "acorn-jsx": "^5.3.2",
+        "eslint-visitor-keys": "^3.4.1"
+      },
+      "engines": {
+        "node": "^12.22.0 || ^14.17.0 || >=16.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/eslint"
+      }
+    },
+    "node_modules/esquery": {
+      "version": "1.6.0",
+      "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.6.0.tgz",
+      "integrity": "sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==",
+      "dev": true,
+      "dependencies": {
+        "estraverse": "^5.1.0"
+      },
+      "engines": {
+        "node": ">=0.10"
+      }
+    },
+    "node_modules/esrecurse": {
+      "version": "4.3.0",
+      "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz",
+      "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==",
+      "dev": true,
+      "dependencies": {
+        "estraverse": "^5.2.0"
+      },
+      "engines": {
+        "node": ">=4.0"
+      }
+    },
+    "node_modules/estraverse": {
+      "version": "5.3.0",
+      "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz",
+      "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==",
+      "dev": true,
+      "engines": {
+        "node": ">=4.0"
+      }
+    },
+    "node_modules/esutils": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz",
+      "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/eventemitter3": {
+      "version": "4.0.7",
+      "resolved": "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.7.tgz",
+      "integrity": "sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw==",
+      "license": "MIT"
+    },
+    "node_modules/fast-deep-equal": {
+      "version": "3.1.3",
+      "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz",
+      "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q=="
+    },
+    "node_modules/fast-equals": {
+      "version": "5.0.1",
+      "resolved": "https://registry.npmjs.org/fast-equals/-/fast-equals-5.0.1.tgz",
+      "integrity": "sha512-WF1Wi8PwwSY7/6Kx0vKXtw8RwuSGoM1bvDaJbu7MxDlR1vovZjIAKrnzyrThgAjm6JDTu0fVgWXDlMGspodfoQ==",
+      "license": "MIT",
+      "engines": {
+        "node": ">=6.0.0"
+      }
+    },
+    "node_modules/fast-glob": {
+      "version": "3.3.1",
+      "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.1.tgz",
+      "integrity": "sha512-kNFPyjhh5cKjrUltxs+wFx+ZkbRaxxmZ+X0ZU31SOsxCEtP9VPgtq2teZw1DebupL5GmDaNQ6yKMMVcM41iqDg==",
+      "dev": true,
+      "dependencies": {
+        "@nodelib/fs.stat": "^2.0.2",
+        "@nodelib/fs.walk": "^1.2.3",
+        "glob-parent": "^5.1.2",
+        "merge2": "^1.3.0",
+        "micromatch": "^4.0.4"
+      },
+      "engines": {
+        "node": ">=8.6.0"
+      }
+    },
+    "node_modules/fast-glob/node_modules/glob-parent": {
+      "version": "5.1.2",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz",
+      "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==",
+      "dev": true,
+      "dependencies": {
+        "is-glob": "^4.0.1"
+      },
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/fast-json-stable-stringify": {
+      "version": "2.1.0",
+      "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz",
+      "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==",
+      "dev": true
+    },
+    "node_modules/fast-levenshtein": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz",
+      "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==",
+      "dev": true
+    },
+    "node_modules/fastq": {
+      "version": "1.17.1",
+      "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.17.1.tgz",
+      "integrity": "sha512-sRVD3lWVIXWg6By68ZN7vho9a1pQcN/WBFaAAsDDFzlJjvoGx0P8z7V1t72grFJfJhu3YPZBuu25f7Kaw2jN1w==",
+      "dev": true,
+      "dependencies": {
+        "reusify": "^1.0.4"
+      }
+    },
+    "node_modules/file-entry-cache": {
+      "version": "6.0.1",
+      "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-6.0.1.tgz",
+      "integrity": "sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==",
+      "dev": true,
+      "dependencies": {
+        "flat-cache": "^3.0.4"
+      },
+      "engines": {
+        "node": "^10.12.0 || >=12.0.0"
+      }
+    },
+    "node_modules/fill-range": {
+      "version": "7.1.1",
+      "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz",
+      "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==",
+      "dev": true,
+      "dependencies": {
+        "to-regex-range": "^5.0.1"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/find-up": {
+      "version": "5.0.0",
+      "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz",
+      "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==",
+      "dev": true,
+      "dependencies": {
+        "locate-path": "^6.0.0",
+        "path-exists": "^4.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/flat-cache": {
+      "version": "3.2.0",
+      "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-3.2.0.tgz",
+      "integrity": "sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==",
+      "dev": true,
+      "dependencies": {
+        "flatted": "^3.2.9",
+        "keyv": "^4.5.3",
+        "rimraf": "^3.0.2"
+      },
+      "engines": {
+        "node": "^10.12.0 || >=12.0.0"
+      }
+    },
+    "node_modules/flatted": {
+      "version": "3.3.1",
+      "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.3.1.tgz",
+      "integrity": "sha512-X8cqMLLie7KsNUDSdzeN8FYK9rEt4Dt67OsG/DNGnYTSDBG4uFAJFBnUeiV+zCVAvwFy56IjM9sH51jVaEhNxw==",
+      "dev": true
+    },
+    "node_modules/follow-redirects": {
+      "version": "1.15.9",
+      "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.9.tgz",
+      "integrity": "sha512-gew4GsXizNgdoRyqmyfMHyAmXsZDk6mHkSxZFCzW9gwlbtOW44CDtYavM+y+72qD/Vq2l550kMF52DT8fOLJqQ==",
+      "funding": [
+        {
+          "type": "individual",
+          "url": "https://github.com/sponsors/RubenVerborgh"
+        }
+      ],
+      "engines": {
+        "node": ">=4.0"
+      },
+      "peerDependenciesMeta": {
+        "debug": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/for-each": {
+      "version": "0.3.3",
+      "resolved": "https://registry.npmjs.org/for-each/-/for-each-0.3.3.tgz",
+      "integrity": "sha512-jqYfLp7mo9vIyQf8ykW2v7A+2N4QjeCeI5+Dz9XraiO1ign81wjiH7Fb9vSOWvQfNtmSa4H2RoQTrrXivdUZmw==",
+      "dev": true,
+      "dependencies": {
+        "is-callable": "^1.1.3"
+      }
+    },
+    "node_modules/form-data": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.1.tgz",
+      "integrity": "sha512-tzN8e4TX8+kkxGPK8D5u0FNmjPUjw3lwC9lSLxxoB/+GtsJG91CO8bSWy73APlgAZzZbXEYZJuxjkHH2w+Ezhw==",
+      "dependencies": {
+        "asynckit": "^0.4.0",
+        "combined-stream": "^1.0.8",
+        "mime-types": "^2.1.12"
+      },
+      "engines": {
+        "node": ">= 6"
+      }
+    },
+    "node_modules/fs.realpath": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz",
+      "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==",
+      "dev": true
+    },
+    "node_modules/function-bind": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+      "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+      "dev": true,
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/function.prototype.name": {
+      "version": "1.1.6",
+      "resolved": "https://registry.npmjs.org/function.prototype.name/-/function.prototype.name-1.1.6.tgz",
+      "integrity": "sha512-Z5kx79swU5P27WEayXM1tBi5Ze/lbIyiNgU3qyXUOf9b2rgXYyF9Dy9Cx+IQv/Lc8WCG6L82zwUPpSS9hGehIg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "define-properties": "^1.2.0",
+        "es-abstract": "^1.22.1",
+        "functions-have-names": "^1.2.3"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/functions-have-names": {
+      "version": "1.2.3",
+      "resolved": "https://registry.npmjs.org/functions-have-names/-/functions-have-names-1.2.3.tgz",
+      "integrity": "sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==",
+      "dev": true,
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/get-intrinsic": {
+      "version": "1.2.4",
+      "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.4.tgz",
+      "integrity": "sha512-5uYhsJH8VJBTv7oslg4BznJYhDoRI6waYCxMmCdnTrcCrHA/fCFKoTFz2JKKE0HdDFUF7/oQuhzumXJK7paBRQ==",
+      "dev": true,
+      "dependencies": {
+        "es-errors": "^1.3.0",
+        "function-bind": "^1.1.2",
+        "has-proto": "^1.0.1",
+        "has-symbols": "^1.0.3",
+        "hasown": "^2.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/get-nonce": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/get-nonce/-/get-nonce-1.0.1.tgz",
+      "integrity": "sha512-FJhYRoDaiatfEkUK8HKlicmu/3SGFD51q3itKDGoSTysQJBnfOcxU5GxnhE1E6soB76MbT0MBtnKJuXyAx+96Q==",
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/get-symbol-description": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/get-symbol-description/-/get-symbol-description-1.0.2.tgz",
+      "integrity": "sha512-g0QYk1dZBxGwk+Ngc+ltRH2IBp2f7zBkBMBJZCDerh6EhlhSR6+9irMCuT/09zD6qkarHUSn529sK/yL4S27mg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.5",
+        "es-errors": "^1.3.0",
+        "get-intrinsic": "^1.2.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/get-tsconfig": {
+      "version": "4.8.1",
+      "resolved": "https://registry.npmjs.org/get-tsconfig/-/get-tsconfig-4.8.1.tgz",
+      "integrity": "sha512-k9PN+cFBmaLWtVz29SkUoqU5O0slLuHJXt/2P+tMVFT+phsSGXGkp9t3rQIqdz0e+06EHNGs3oM6ZX1s2zHxRg==",
+      "dev": true,
+      "dependencies": {
+        "resolve-pkg-maps": "^1.0.0"
+      },
+      "funding": {
+        "url": "https://github.com/privatenumber/get-tsconfig?sponsor=1"
+      }
+    },
+    "node_modules/glob": {
+      "version": "7.2.3",
+      "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz",
+      "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==",
+      "deprecated": "Glob versions prior to v9 are no longer supported",
+      "dev": true,
+      "dependencies": {
+        "fs.realpath": "^1.0.0",
+        "inflight": "^1.0.4",
+        "inherits": "2",
+        "minimatch": "^3.1.1",
+        "once": "^1.3.0",
+        "path-is-absolute": "^1.0.0"
+      },
+      "engines": {
+        "node": "*"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/isaacs"
+      }
+    },
+    "node_modules/glob-parent": {
+      "version": "6.0.2",
+      "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz",
+      "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==",
+      "dev": true,
+      "dependencies": {
+        "is-glob": "^4.0.3"
+      },
+      "engines": {
+        "node": ">=10.13.0"
+      }
+    },
+    "node_modules/globals": {
+      "version": "13.24.0",
+      "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz",
+      "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==",
+      "dev": true,
+      "dependencies": {
+        "type-fest": "^0.20.2"
+      },
+      "engines": {
+        "node": ">=8"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/globalthis": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/globalthis/-/globalthis-1.0.4.tgz",
+      "integrity": "sha512-DpLKbNU4WylpxJykQujfCcwYWiV/Jhm50Goo0wrVILAv5jOr9d+H+UR3PhSCD2rCCEIg0uc+G+muBTwD54JhDQ==",
+      "dev": true,
+      "dependencies": {
+        "define-properties": "^1.2.1",
+        "gopd": "^1.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/gopd": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz",
+      "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==",
+      "dev": true,
+      "dependencies": {
+        "get-intrinsic": "^1.1.3"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/graceful-fs": {
+      "version": "4.2.11",
+      "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz",
+      "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ=="
+    },
+    "node_modules/graphemer": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/graphemer/-/graphemer-1.4.0.tgz",
+      "integrity": "sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==",
+      "dev": true
+    },
+    "node_modules/has-bigints": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.2.tgz",
+      "integrity": "sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ==",
+      "dev": true,
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has-flag": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz",
+      "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/has-property-descriptors": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.2.tgz",
+      "integrity": "sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==",
+      "dev": true,
+      "dependencies": {
+        "es-define-property": "^1.0.0"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has-proto": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.3.tgz",
+      "integrity": "sha512-SJ1amZAJUiZS+PhsVLf5tGydlaVB8EdFpaSO4gmiUKUOxk8qzn5AIy4ZeJUmh22znIdk/uMAUT2pl3FxzVUH+Q==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has-symbols": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz",
+      "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/has-tostringtag": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.2.tgz",
+      "integrity": "sha512-NqADB8VjPFLM2V0VvHUewwwsw0ZWBaIdgo+ieHtK3hasLz4qeCRjYcqfB6AQrBggRKppKF8L52/VqdVsO47Dlw==",
+      "dev": true,
+      "dependencies": {
+        "has-symbols": "^1.0.3"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/hasown": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz",
+      "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==",
+      "dev": true,
+      "dependencies": {
+        "function-bind": "^1.1.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/ignore": {
+      "version": "5.3.2",
+      "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.2.tgz",
+      "integrity": "sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==",
+      "dev": true,
+      "engines": {
+        "node": ">= 4"
+      }
+    },
+    "node_modules/import-fresh": {
+      "version": "3.3.0",
+      "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz",
+      "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==",
+      "dev": true,
+      "dependencies": {
+        "parent-module": "^1.0.0",
+        "resolve-from": "^4.0.0"
+      },
+      "engines": {
+        "node": ">=6"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/imurmurhash": {
+      "version": "0.1.4",
+      "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
+      "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.8.19"
+      }
+    },
+    "node_modules/inflight": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz",
+      "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==",
+      "deprecated": "This module is not supported, and leaks memory. Do not use it. Check out lru-cache if you want a good and tested way to coalesce async requests by a key value, which is much more comprehensive and powerful.",
+      "dev": true,
+      "dependencies": {
+        "once": "^1.3.0",
+        "wrappy": "1"
+      }
+    },
+    "node_modules/inherits": {
+      "version": "2.0.4",
+      "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+      "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==",
+      "dev": true
+    },
+    "node_modules/internal-slot": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/internal-slot/-/internal-slot-1.0.7.tgz",
+      "integrity": "sha512-NGnrKwXzSms2qUUih/ILZ5JBqNTSa1+ZmP6flaIp6KmSElgE9qdndzS3cqjrDovwFdmwsGsLdeFgB6suw+1e9g==",
+      "dev": true,
+      "dependencies": {
+        "es-errors": "^1.3.0",
+        "hasown": "^2.0.0",
+        "side-channel": "^1.0.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/internmap": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/internmap/-/internmap-2.0.3.tgz",
+      "integrity": "sha512-5Hh7Y1wQbvY5ooGgPbDaL5iYLAPzMTUrjMulskHLH6wnv/A+1q5rgEaiuqEjB+oxGXIVZs1FF+R/KPN3ZSQYYg==",
+      "license": "ISC",
+      "engines": {
+        "node": ">=12"
+      }
+    },
+    "node_modules/invariant": {
+      "version": "2.2.4",
+      "resolved": "https://registry.npmjs.org/invariant/-/invariant-2.2.4.tgz",
+      "integrity": "sha512-phJfQVBuaJM5raOpJjSfkiD6BpbCE4Ns//LaXl6wGYtUBY83nWS6Rf9tXm2e8VaK60JEjYldbPif/A2B1C2gNA==",
+      "dependencies": {
+        "loose-envify": "^1.0.0"
+      }
+    },
+    "node_modules/is-array-buffer": {
+      "version": "3.0.4",
+      "resolved": "https://registry.npmjs.org/is-array-buffer/-/is-array-buffer-3.0.4.tgz",
+      "integrity": "sha512-wcjaerHw0ydZwfhiKbXJWLDY8A7yV7KhjQOpb83hGgGfId/aQa4TOvwyzn2PuswW2gPCYEL/nEAiSVpdOj1lXw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "get-intrinsic": "^1.2.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-arrayish": {
+      "version": "0.3.2",
+      "resolved": "https://registry.npmjs.org/is-arrayish/-/is-arrayish-0.3.2.tgz",
+      "integrity": "sha512-eVRqCvVlZbuw3GrM63ovNSNAeA1K16kaR/LRY/92w0zxQ5/1YzwblUX652i4Xs9RwAGjW9d9y6X88t8OaAJfWQ==",
+      "optional": true
+    },
+    "node_modules/is-async-function": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/is-async-function/-/is-async-function-2.0.0.tgz",
+      "integrity": "sha512-Y1JXKrfykRJGdlDwdKlLpLyMIiWqWvuSd17TvZk68PLAOGOoF4Xyav1z0Xhoi+gCYjZVeC5SI+hYFOfvXmGRCA==",
+      "dev": true,
+      "dependencies": {
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-bigint": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.4.tgz",
+      "integrity": "sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg==",
+      "dev": true,
+      "dependencies": {
+        "has-bigints": "^1.0.1"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-boolean-object": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.2.tgz",
+      "integrity": "sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-bun-module": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/is-bun-module/-/is-bun-module-1.2.1.tgz",
+      "integrity": "sha512-AmidtEM6D6NmUiLOvvU7+IePxjEjOzra2h0pSrsfSAcXwl/83zLLXDByafUJy9k/rKK0pvXMLdwKwGHlX2Ke6Q==",
+      "dev": true,
+      "dependencies": {
+        "semver": "^7.6.3"
+      }
+    },
+    "node_modules/is-callable": {
+      "version": "1.2.7",
+      "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.7.tgz",
+      "integrity": "sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-core-module": {
+      "version": "2.15.1",
+      "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.15.1.tgz",
+      "integrity": "sha512-z0vtXSwucUJtANQWldhbtbt7BnL0vxiFjIdDLAatwhDYty2bad6s+rijD6Ri4YuYJubLzIJLUidCh09e1djEVQ==",
+      "dev": true,
+      "dependencies": {
+        "hasown": "^2.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-data-view": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/is-data-view/-/is-data-view-1.0.1.tgz",
+      "integrity": "sha512-AHkaJrsUVW6wq6JS8y3JnM/GJF/9cf+k20+iDzlSaJrinEo5+7vRiteOSwBhHRiAyQATN1AmY4hwzxJKPmYf+w==",
+      "dev": true,
+      "dependencies": {
+        "is-typed-array": "^1.1.13"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-date-object": {
+      "version": "1.0.5",
+      "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.5.tgz",
+      "integrity": "sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ==",
+      "dev": true,
+      "dependencies": {
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-extglob": {
+      "version": "2.1.1",
+      "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz",
+      "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/is-finalizationregistry": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/is-finalizationregistry/-/is-finalizationregistry-1.0.2.tgz",
+      "integrity": "sha512-0by5vtUJs8iFQb5TYUHHPudOR+qXYIMKtiUzvLIZITZUjknFmziyBJuLhVRc+Ds0dREFlskDNJKYIdIzu/9pfw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-generator-function": {
+      "version": "1.0.10",
+      "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.10.tgz",
+      "integrity": "sha512-jsEjy9l3yiXEQ+PsXdmBwEPcOxaXWLspKdplFUVI9vq1iZgIekeC0L167qeu86czQaxed3q/Uzuw0swL0irL8A==",
+      "dev": true,
+      "dependencies": {
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-glob": {
+      "version": "4.0.3",
+      "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz",
+      "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==",
+      "dev": true,
+      "dependencies": {
+        "is-extglob": "^2.1.1"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/is-map": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/is-map/-/is-map-2.0.3.tgz",
+      "integrity": "sha512-1Qed0/Hr2m+YqxnM09CjA2d/i6YZNfF6R2oRAOj36eUdS6qIV/huPJNSEpKbupewFs+ZsJlxsjjPbc0/afW6Lw==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-negative-zero": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.3.tgz",
+      "integrity": "sha512-5KoIu2Ngpyek75jXodFvnafB6DJgr3u8uuK0LEZJjrU19DrMD3EVERaR8sjz8CCGgpZvxPl9SuE1GMVPFHx1mw==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-number": {
+      "version": "7.0.0",
+      "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz",
+      "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.12.0"
+      }
+    },
+    "node_modules/is-number-object": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.7.tgz",
+      "integrity": "sha512-k1U0IRzLMo7ZlYIfzRu23Oh6MiIFasgpb9X76eqfFZAqwH44UI4KTBvBYIZ1dSL9ZzChTB9ShHfLkR4pdW5krQ==",
+      "dev": true,
+      "dependencies": {
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-path-inside": {
+      "version": "3.0.3",
+      "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz",
+      "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/is-regex": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.4.tgz",
+      "integrity": "sha512-kvRdxDsxZjhzUX07ZnLydzS1TU/TJlTUHHY4YLL87e37oUA49DfkLqgy+VjFocowy29cKvcSiu+kIv728jTTVg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-set": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/is-set/-/is-set-2.0.3.tgz",
+      "integrity": "sha512-iPAjerrse27/ygGLxw+EBR9agv9Y6uLeYVJMu+QNCoouJ1/1ri0mGrcWpfCqFZuzzx3WjtwxG098X+n4OuRkPg==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-shared-array-buffer": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/is-shared-array-buffer/-/is-shared-array-buffer-1.0.3.tgz",
+      "integrity": "sha512-nA2hv5XIhLR3uVzDDfCIknerhx8XUKnstuOERPNNIinXG7v9u+ohXF67vxm4TPTEPU6lm61ZkwP3c9PCB97rhg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-string": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.7.tgz",
+      "integrity": "sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg==",
+      "dev": true,
+      "dependencies": {
+        "has-tostringtag": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-symbol": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz",
+      "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==",
+      "dev": true,
+      "dependencies": {
+        "has-symbols": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-typed-array": {
+      "version": "1.1.13",
+      "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.13.tgz",
+      "integrity": "sha512-uZ25/bUAlUY5fR4OKT4rZQEBrzQWYV9ZJYGGsUmEJ6thodVJ1HX64ePQ6Z0qPWP+m+Uq6e9UugrE38jeYsDSMw==",
+      "dev": true,
+      "dependencies": {
+        "which-typed-array": "^1.1.14"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-weakmap": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/is-weakmap/-/is-weakmap-2.0.2.tgz",
+      "integrity": "sha512-K5pXYOm9wqY1RgjpL3YTkF39tni1XajUIkawTLUo9EZEVUFga5gSQJF8nNS7ZwJQ02y+1YCNYcMh+HIf1ZqE+w==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-weakref": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/is-weakref/-/is-weakref-1.0.2.tgz",
+      "integrity": "sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/is-weakset": {
+      "version": "2.0.3",
+      "resolved": "https://registry.npmjs.org/is-weakset/-/is-weakset-2.0.3.tgz",
+      "integrity": "sha512-LvIm3/KWzS9oRFHugab7d+M/GcBXuXX5xZkzPmN+NxihdQlZUQ4dWuSV1xR/sq6upL1TJEDrfBgRepHFdBtSNQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "get-intrinsic": "^1.2.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/isarray": {
+      "version": "2.0.5",
+      "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.5.tgz",
+      "integrity": "sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==",
+      "dev": true
+    },
+    "node_modules/isexe": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz",
+      "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==",
+      "dev": true
+    },
+    "node_modules/iterator.prototype": {
+      "version": "1.1.3",
+      "resolved": "https://registry.npmjs.org/iterator.prototype/-/iterator.prototype-1.1.3.tgz",
+      "integrity": "sha512-FW5iMbeQ6rBGm/oKgzq2aW4KvAGpxPzYES8N4g4xNXUKpL1mclMvOe+76AcLDTvD+Ze+sOpVhgdAQEKF4L9iGQ==",
+      "dev": true,
+      "dependencies": {
+        "define-properties": "^1.2.1",
+        "get-intrinsic": "^1.2.1",
+        "has-symbols": "^1.0.3",
+        "reflect.getprototypeof": "^1.0.4",
+        "set-function-name": "^2.0.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/js-tokens": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz",
+      "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ=="
+    },
+    "node_modules/js-yaml": {
+      "version": "4.1.0",
+      "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz",
+      "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==",
+      "dev": true,
+      "dependencies": {
+        "argparse": "^2.0.1"
+      },
+      "bin": {
+        "js-yaml": "bin/js-yaml.js"
+      }
+    },
+    "node_modules/json-buffer": {
+      "version": "3.0.1",
+      "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz",
+      "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==",
+      "dev": true
+    },
+    "node_modules/json-schema-traverse": {
+      "version": "0.4.1",
+      "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz",
+      "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==",
+      "dev": true
+    },
+    "node_modules/json-stable-stringify-without-jsonify": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz",
+      "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==",
+      "dev": true
+    },
+    "node_modules/json5": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/json5/-/json5-1.0.2.tgz",
+      "integrity": "sha512-g1MWMLBiz8FKi1e4w0UyVL3w+iJceWAFBAaBnnGKOpNa5f8TLktkbre1+s6oICydWAm+HRUGTmI+//xv2hvXYA==",
+      "dev": true,
+      "dependencies": {
+        "minimist": "^1.2.0"
+      },
+      "bin": {
+        "json5": "lib/cli.js"
+      }
+    },
+    "node_modules/jsx-ast-utils": {
+      "version": "3.3.5",
+      "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.5.tgz",
+      "integrity": "sha512-ZZow9HBI5O6EPgSJLUb8n2NKgmVWTwCvHGwFuJlMjvLFqlGG6pjirPhtdsseaLZjSibD8eegzmYpUZwoIlj2cQ==",
+      "dev": true,
+      "dependencies": {
+        "array-includes": "^3.1.6",
+        "array.prototype.flat": "^1.3.1",
+        "object.assign": "^4.1.4",
+        "object.values": "^1.1.6"
+      },
+      "engines": {
+        "node": ">=4.0"
+      }
+    },
+    "node_modules/keyv": {
+      "version": "4.5.4",
+      "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz",
+      "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==",
+      "dev": true,
+      "dependencies": {
+        "json-buffer": "3.0.1"
+      }
+    },
+    "node_modules/klona": {
+      "version": "2.0.6",
+      "resolved": "https://registry.npmjs.org/klona/-/klona-2.0.6.tgz",
+      "integrity": "sha512-dhG34DXATL5hSxJbIexCft8FChFXtmskoZYnoPWjXQuebWYCNkVeV3KkGegCK9CP1oswI/vQibS2GY7Em/sJJA==",
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/language-subtag-registry": {
+      "version": "0.3.23",
+      "resolved": "https://registry.npmjs.org/language-subtag-registry/-/language-subtag-registry-0.3.23.tgz",
+      "integrity": "sha512-0K65Lea881pHotoGEa5gDlMxt3pctLi2RplBb7Ezh4rRdLEOtgi7n4EwK9lamnUCkKBqaeKRVebTq6BAxSkpXQ==",
+      "dev": true
+    },
+    "node_modules/language-tags": {
+      "version": "1.0.9",
+      "resolved": "https://registry.npmjs.org/language-tags/-/language-tags-1.0.9.tgz",
+      "integrity": "sha512-MbjN408fEndfiQXbFQ1vnd+1NoLDsnQW41410oQBXiyXDMYH5z505juWa4KUE1LqxRC7DgOgZDbKLxHIwm27hA==",
+      "dev": true,
+      "dependencies": {
+        "language-subtag-registry": "^0.3.20"
+      },
+      "engines": {
+        "node": ">=0.10"
+      }
+    },
+    "node_modules/levn": {
+      "version": "0.4.1",
+      "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz",
+      "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==",
+      "dev": true,
+      "dependencies": {
+        "prelude-ls": "^1.2.1",
+        "type-check": "~0.4.0"
+      },
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/locate-path": {
+      "version": "6.0.0",
+      "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz",
+      "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==",
+      "dev": true,
+      "dependencies": {
+        "p-locate": "^5.0.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/lodash": {
+      "version": "4.17.21",
+      "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.21.tgz",
+      "integrity": "sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==",
+      "license": "MIT"
+    },
+    "node_modules/lodash.merge": {
+      "version": "4.6.2",
+      "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz",
+      "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==",
+      "dev": true
+    },
+    "node_modules/loose-envify": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz",
+      "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==",
+      "dependencies": {
+        "js-tokens": "^3.0.0 || ^4.0.0"
+      },
+      "bin": {
+        "loose-envify": "cli.js"
+      }
+    },
+    "node_modules/mantine-datatable": {
+      "version": "7.15.1",
+      "resolved": "https://registry.npmjs.org/mantine-datatable/-/mantine-datatable-7.15.1.tgz",
+      "integrity": "sha512-MwehjtkdT6FQfuPgTXmGA2Y3DmHdCdLzcl4G4LoccSpG2ul2RwEdCO/dQmrPBsNo4mMepNN9dE3/1vSuYsU+7Q==",
+      "license": "MIT",
+      "funding": {
+        "type": "github",
+        "url": "https://github.com/sponsors/icflorescu"
+      },
+      "peerDependencies": {
+        "@mantine/core": ">=7.14",
+        "@mantine/hooks": ">=7.14",
+        "clsx": ">=2",
+        "react": ">=18.2"
+      }
+    },
+    "node_modules/mantine-form-zod-resolver": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/mantine-form-zod-resolver/-/mantine-form-zod-resolver-1.1.0.tgz",
+      "integrity": "sha512-hidTuYq6agSF5XbkcVVcr0mkGs9ki/x8OC9ldZMxGLVGja6bdl+x4k1hCNrigCG90DBoMDnu0bo3hprGBBlUZA==",
+      "engines": {
+        "node": ">=16.6.0"
+      },
+      "peerDependencies": {
+        "@mantine/form": ">=7.0.0",
+        "zod": ">=3.0.0"
+      }
+    },
+    "node_modules/media-captions": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/media-captions/-/media-captions-1.0.4.tgz",
+      "integrity": "sha512-cyDNmuZvvO4H27rcBq2Eudxo9IZRDCOX/I7VEyqbxsEiD2Ei7UYUhG/Sc5fvMZjmathgz3fEK7iAKqvpY+Ux1w==",
+      "license": "MIT",
+      "engines": {
+        "node": ">=16"
+      }
+    },
+    "node_modules/merge2": {
+      "version": "1.4.1",
+      "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz",
+      "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==",
+      "dev": true,
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/micromatch": {
+      "version": "4.0.8",
+      "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.8.tgz",
+      "integrity": "sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==",
+      "dev": true,
+      "dependencies": {
+        "braces": "^3.0.3",
+        "picomatch": "^2.3.1"
+      },
+      "engines": {
+        "node": ">=8.6"
+      }
+    },
+    "node_modules/mime-db": {
+      "version": "1.52.0",
+      "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+      "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/mime-types": {
+      "version": "2.1.35",
+      "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+      "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+      "dependencies": {
+        "mime-db": "1.52.0"
+      },
+      "engines": {
+        "node": ">= 0.6"
+      }
+    },
+    "node_modules/minimatch": {
+      "version": "3.1.2",
+      "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz",
+      "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==",
+      "dev": true,
+      "dependencies": {
+        "brace-expansion": "^1.1.7"
+      },
+      "engines": {
+        "node": "*"
+      }
+    },
+    "node_modules/minimist": {
+      "version": "1.2.8",
+      "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.8.tgz",
+      "integrity": "sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA==",
+      "dev": true,
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/ms": {
+      "version": "2.1.3",
+      "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+      "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==",
+      "dev": true
+    },
+    "node_modules/nanoid": {
+      "version": "3.3.7",
+      "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz",
+      "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==",
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ],
+      "bin": {
+        "nanoid": "bin/nanoid.cjs"
+      },
+      "engines": {
+        "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1"
+      }
+    },
+    "node_modules/natural-compare": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz",
+      "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==",
+      "dev": true
+    },
+    "node_modules/next": {
+      "version": "15.1.2",
+      "resolved": "https://registry.npmjs.org/next/-/next-15.1.2.tgz",
+      "integrity": "sha512-nLJDV7peNy+0oHlmY2JZjzMfJ8Aj0/dd3jCwSZS8ZiO5nkQfcZRqDrRN3U5rJtqVTQneIOGZzb6LCNrk7trMCQ==",
+      "license": "MIT",
+      "dependencies": {
+        "@next/env": "15.1.2",
+        "@swc/counter": "0.1.3",
+        "@swc/helpers": "0.5.15",
+        "busboy": "1.6.0",
+        "caniuse-lite": "^1.0.30001579",
+        "postcss": "8.4.31",
+        "styled-jsx": "5.1.6"
+      },
+      "bin": {
+        "next": "dist/bin/next"
+      },
+      "engines": {
+        "node": "^18.18.0 || ^19.8.0 || >= 20.0.0"
+      },
+      "optionalDependencies": {
+        "@next/swc-darwin-arm64": "15.1.2",
+        "@next/swc-darwin-x64": "15.1.2",
+        "@next/swc-linux-arm64-gnu": "15.1.2",
+        "@next/swc-linux-arm64-musl": "15.1.2",
+        "@next/swc-linux-x64-gnu": "15.1.2",
+        "@next/swc-linux-x64-musl": "15.1.2",
+        "@next/swc-win32-arm64-msvc": "15.1.2",
+        "@next/swc-win32-x64-msvc": "15.1.2",
+        "sharp": "^0.33.5"
+      },
+      "peerDependencies": {
+        "@opentelemetry/api": "^1.1.0",
+        "@playwright/test": "^1.41.2",
+        "babel-plugin-react-compiler": "*",
+        "react": "^18.2.0 || 19.0.0-rc-de68d2f4-20241204 || ^19.0.0",
+        "react-dom": "^18.2.0 || 19.0.0-rc-de68d2f4-20241204 || ^19.0.0",
+        "sass": "^1.3.0"
+      },
+      "peerDependenciesMeta": {
+        "@opentelemetry/api": {
+          "optional": true
+        },
+        "@playwright/test": {
+          "optional": true
+        },
+        "babel-plugin-react-compiler": {
+          "optional": true
+        },
+        "sass": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/next-runtime-env": {
+      "version": "3.2.2",
+      "resolved": "https://registry.npmjs.org/next-runtime-env/-/next-runtime-env-3.2.2.tgz",
+      "integrity": "sha512-S5S6NxIf3XeaVc9fLBN2L5Jzu+6dLYCXeOaPQa1RzKRYlG2BBayxXOj6A4VsciocyNkJMazW1VAibtbb1/ZjAw==",
+      "dependencies": {
+        "next": "^14",
+        "react": "^18"
+      },
+      "peerDependencies": {
+        "next": "^14",
+        "react": "^18"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/env": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/env/-/env-14.2.20.tgz",
+      "integrity": "sha512-JfDpuOCB0UBKlEgEy/H6qcBSzHimn/YWjUHzKl1jMeUO+QVRdzmTTl8gFJaNO87c8DXmVKhFCtwxQ9acqB3+Pw==",
+      "license": "MIT"
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-darwin-arm64": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-arm64/-/swc-darwin-arm64-14.2.20.tgz",
+      "integrity": "sha512-WDfq7bmROa5cIlk6ZNonNdVhKmbCv38XteVFYsxea1vDJt3SnYGgxLGMTXQNfs5OkFvAhmfKKrwe7Y0Hs+rWOg==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-darwin-x64": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-darwin-x64/-/swc-darwin-x64-14.2.20.tgz",
+      "integrity": "sha512-XIQlC+NAmJPfa2hruLvr1H1QJJeqOTDV+v7tl/jIdoFvqhoihvSNykLU/G6NMgoeo+e/H7p/VeWSOvMUHKtTIg==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "darwin"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-linux-arm64-gnu": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-gnu/-/swc-linux-arm64-gnu-14.2.20.tgz",
+      "integrity": "sha512-pnzBrHTPXIMm5QX3QC8XeMkpVuoAYOmyfsO4VlPn+0NrHraNuWjdhe+3xLq01xR++iCvX+uoeZmJDKcOxI201Q==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-linux-arm64-musl": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-arm64-musl/-/swc-linux-arm64-musl-14.2.20.tgz",
+      "integrity": "sha512-WhJJAFpi6yqmUx1momewSdcm/iRXFQS0HU2qlUGlGE/+98eu7JWLD5AAaP/tkK1mudS/rH2f9E3WCEF2iYDydQ==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-linux-x64-gnu": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-gnu/-/swc-linux-x64-gnu-14.2.20.tgz",
+      "integrity": "sha512-ao5HCbw9+iG1Kxm8XsGa3X174Ahn17mSYBQlY6VGsdsYDAbz/ZP13wSLfvlYoIDn1Ger6uYA+yt/3Y9KTIupRg==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-linux-x64-musl": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-linux-x64-musl/-/swc-linux-x64-musl-14.2.20.tgz",
+      "integrity": "sha512-CXm/kpnltKTT7945np6Td3w7shj/92TMRPyI/VvveFe8+YE+/YOJ5hyAWK5rpx711XO1jBCgXl211TWaxOtkaA==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "linux"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-win32-arm64-msvc": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-arm64-msvc/-/swc-win32-arm64-msvc-14.2.20.tgz",
+      "integrity": "sha512-upJn2HGQgKNDbXVfIgmqT2BN8f3z/mX8ddoyi1I565FHbfowVK5pnMEwauvLvaJf4iijvuKq3kw/b6E9oIVRWA==",
+      "cpu": [
+        "arm64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@next/swc-win32-x64-msvc": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/@next/swc-win32-x64-msvc/-/swc-win32-x64-msvc-14.2.20.tgz",
+      "integrity": "sha512-AFmqeLW6LtxeFTuoB+MXFeM5fm5052i3MU6xD0WzJDOwku6SkZaxb1bxjBaRC8uNqTRTSPl0yMFtjNowIVI67w==",
+      "cpu": [
+        "x64"
+      ],
+      "license": "MIT",
+      "optional": true,
+      "os": [
+        "win32"
+      ],
+      "engines": {
+        "node": ">= 10"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/@swc/helpers": {
+      "version": "0.5.5",
+      "resolved": "https://registry.npmjs.org/@swc/helpers/-/helpers-0.5.5.tgz",
+      "integrity": "sha512-KGYxvIOXcceOAbEk4bi/dVLEK9z8sZ0uBB3Il5b1rhfClSpcX0yfRO0KmTkqR2cnQDymwLB+25ZyMzICg/cm/A==",
+      "license": "Apache-2.0",
+      "dependencies": {
+        "@swc/counter": "^0.1.3",
+        "tslib": "^2.4.0"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/next": {
+      "version": "14.2.20",
+      "resolved": "https://registry.npmjs.org/next/-/next-14.2.20.tgz",
+      "integrity": "sha512-yPvIiWsiyVYqJlSQxwmzMIReXn5HxFNq4+tlVQ812N1FbvhmE+fDpIAD7bcS2mGYQwPJ5vAsQouyme2eKsxaug==",
+      "license": "MIT",
+      "dependencies": {
+        "@next/env": "14.2.20",
+        "@swc/helpers": "0.5.5",
+        "busboy": "1.6.0",
+        "caniuse-lite": "^1.0.30001579",
+        "graceful-fs": "^4.2.11",
+        "postcss": "8.4.31",
+        "styled-jsx": "5.1.1"
+      },
+      "bin": {
+        "next": "dist/bin/next"
+      },
+      "engines": {
+        "node": ">=18.17.0"
+      },
+      "optionalDependencies": {
+        "@next/swc-darwin-arm64": "14.2.20",
+        "@next/swc-darwin-x64": "14.2.20",
+        "@next/swc-linux-arm64-gnu": "14.2.20",
+        "@next/swc-linux-arm64-musl": "14.2.20",
+        "@next/swc-linux-x64-gnu": "14.2.20",
+        "@next/swc-linux-x64-musl": "14.2.20",
+        "@next/swc-win32-arm64-msvc": "14.2.20",
+        "@next/swc-win32-ia32-msvc": "14.2.20",
+        "@next/swc-win32-x64-msvc": "14.2.20"
+      },
+      "peerDependencies": {
+        "@opentelemetry/api": "^1.1.0",
+        "@playwright/test": "^1.41.2",
+        "react": "^18.2.0",
+        "react-dom": "^18.2.0",
+        "sass": "^1.3.0"
+      },
+      "peerDependenciesMeta": {
+        "@opentelemetry/api": {
+          "optional": true
+        },
+        "@playwright/test": {
+          "optional": true
+        },
+        "sass": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/postcss": {
+      "version": "8.4.31",
+      "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.31.tgz",
+      "integrity": "sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ==",
+      "funding": [
+        {
+          "type": "opencollective",
+          "url": "https://opencollective.com/postcss/"
+        },
+        {
+          "type": "tidelift",
+          "url": "https://tidelift.com/funding/github/npm/postcss"
+        },
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ],
+      "license": "MIT",
+      "dependencies": {
+        "nanoid": "^3.3.6",
+        "picocolors": "^1.0.0",
+        "source-map-js": "^1.0.2"
+      },
+      "engines": {
+        "node": "^10 || ^12 || >=14"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/react": {
+      "version": "18.3.1",
+      "resolved": "https://registry.npmjs.org/react/-/react-18.3.1.tgz",
+      "integrity": "sha512-wS+hAgJShR0KhEvPJArfuPVN1+Hz1t0Y6n5jLrGQbkb4urgPE/0Rve+1kMB1v/oWgHgm4WIcV+i7F2pTVj+2iQ==",
+      "license": "MIT",
+      "dependencies": {
+        "loose-envify": "^1.1.0"
+      },
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/react-dom": {
+      "version": "18.3.1",
+      "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-18.3.1.tgz",
+      "integrity": "sha512-5m4nQKp+rZRb09LNH59GM4BxTh9251/ylbKIbpe7TpGxfJ+9kv6BLkLBXIjjspbgbnIBNqlI23tRnTWT0snUIw==",
+      "license": "MIT",
+      "peer": true,
+      "dependencies": {
+        "loose-envify": "^1.1.0",
+        "scheduler": "^0.23.2"
+      },
+      "peerDependencies": {
+        "react": "^18.3.1"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/scheduler": {
+      "version": "0.23.2",
+      "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.23.2.tgz",
+      "integrity": "sha512-UOShsPwz7NrMUqhR6t0hWjFduvOzbtv7toDH1/hIrfRNIDBnnBWd0CwJTGvTpngVlmwGCdP9/Zl/tVrDqcuYzQ==",
+      "license": "MIT",
+      "peer": true,
+      "dependencies": {
+        "loose-envify": "^1.1.0"
+      }
+    },
+    "node_modules/next-runtime-env/node_modules/styled-jsx": {
+      "version": "5.1.1",
+      "resolved": "https://registry.npmjs.org/styled-jsx/-/styled-jsx-5.1.1.tgz",
+      "integrity": "sha512-pW7uC1l4mBZ8ugbiZrcIsiIvVx1UmTfw7UkC3Um2tmfUq9Bhk8IiyEIPl6F8agHgjzku6j0xQEZbfA5uSgSaCw==",
+      "license": "MIT",
+      "dependencies": {
+        "client-only": "0.0.1"
+      },
+      "engines": {
+        "node": ">= 12.0.0"
+      },
+      "peerDependencies": {
+        "react": ">= 16.8.0 || 17.x.x || ^18.0.0-0"
+      },
+      "peerDependenciesMeta": {
+        "@babel/core": {
+          "optional": true
+        },
+        "babel-plugin-macros": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/next/node_modules/postcss": {
+      "version": "8.4.31",
+      "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.31.tgz",
+      "integrity": "sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ==",
+      "funding": [
+        {
+          "type": "opencollective",
+          "url": "https://opencollective.com/postcss/"
+        },
+        {
+          "type": "tidelift",
+          "url": "https://tidelift.com/funding/github/npm/postcss"
+        },
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ],
+      "dependencies": {
+        "nanoid": "^3.3.6",
+        "picocolors": "^1.0.0",
+        "source-map-js": "^1.0.2"
+      },
+      "engines": {
+        "node": "^10 || ^12 || >=14"
+      }
+    },
+    "node_modules/object-assign": {
+      "version": "4.1.1",
+      "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+      "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/object-inspect": {
+      "version": "1.13.3",
+      "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.3.tgz",
+      "integrity": "sha512-kDCGIbxkDSXE3euJZZXzc6to7fCrKHNI/hSRQnRuQ+BWjFNzZwiFF8fj/6o2t2G9/jTj8PSIYTfCLelLZEeRpA==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/object-keys": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz",
+      "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/object.assign": {
+      "version": "4.1.5",
+      "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.5.tgz",
+      "integrity": "sha512-byy+U7gp+FVwmyzKPYhW2h5l3crpmGsxl7X2s8y43IgxvG4g3QZ6CffDtsNQy1WsmZpQbO+ybo0AlW7TY6DcBQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.5",
+        "define-properties": "^1.2.1",
+        "has-symbols": "^1.0.3",
+        "object-keys": "^1.1.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/object.entries": {
+      "version": "1.1.8",
+      "resolved": "https://registry.npmjs.org/object.entries/-/object.entries-1.1.8.tgz",
+      "integrity": "sha512-cmopxi8VwRIAw/fkijJohSfpef5PdN0pMQJN6VC/ZKvn0LIknWD8KtgY6KlQdEc4tIjcQ3HxSMmnvtzIscdaYQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-object-atoms": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/object.fromentries": {
+      "version": "2.0.8",
+      "resolved": "https://registry.npmjs.org/object.fromentries/-/object.fromentries-2.0.8.tgz",
+      "integrity": "sha512-k6E21FzySsSK5a21KRADBd/NGneRegFO5pLHfdQLpRDETUNJueLXs3WCzyQ3tFRDYgbq3KHGXfTbi2bs8WQ6rQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2",
+        "es-object-atoms": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/object.groupby": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/object.groupby/-/object.groupby-1.0.3.tgz",
+      "integrity": "sha512-+Lhy3TQTuzXI5hevh8sBGqbmurHbbIjAi0Z4S63nthVLmLxfbj4T54a4CfZrXIrt9iP4mVAPYMo/v99taj3wjQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/object.values": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/object.values/-/object.values-1.2.0.tgz",
+      "integrity": "sha512-yBYjY9QX2hnRmZHAjG/f13MzmBzxzYgQhFrke06TTyKY5zSTEqkOeukBzIdVA3j3ulu8Qa3MbVFShV7T2RmGtQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-object-atoms": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/once": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz",
+      "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==",
+      "dev": true,
+      "dependencies": {
+        "wrappy": "1"
+      }
+    },
+    "node_modules/optionator": {
+      "version": "0.9.4",
+      "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.4.tgz",
+      "integrity": "sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==",
+      "dev": true,
+      "dependencies": {
+        "deep-is": "^0.1.3",
+        "fast-levenshtein": "^2.0.6",
+        "levn": "^0.4.1",
+        "prelude-ls": "^1.2.1",
+        "type-check": "^0.4.0",
+        "word-wrap": "^1.2.5"
+      },
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/p-limit": {
+      "version": "3.1.0",
+      "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz",
+      "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==",
+      "dev": true,
+      "dependencies": {
+        "yocto-queue": "^0.1.0"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/p-locate": {
+      "version": "5.0.0",
+      "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz",
+      "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==",
+      "dev": true,
+      "dependencies": {
+        "p-limit": "^3.0.2"
+      },
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/parent-module": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz",
+      "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==",
+      "dev": true,
+      "dependencies": {
+        "callsites": "^3.0.0"
+      },
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/path-exists": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz",
+      "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/path-is-absolute": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz",
+      "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/path-key": {
+      "version": "3.1.1",
+      "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz",
+      "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/path-parse": {
+      "version": "1.0.7",
+      "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz",
+      "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==",
+      "dev": true
+    },
+    "node_modules/picocolors": {
+      "version": "1.1.1",
+      "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz",
+      "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA=="
+    },
+    "node_modules/picomatch": {
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz",
+      "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==",
+      "dev": true,
+      "engines": {
+        "node": ">=8.6"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/jonschlinkert"
+      }
+    },
+    "node_modules/possible-typed-array-names": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/possible-typed-array-names/-/possible-typed-array-names-1.0.0.tgz",
+      "integrity": "sha512-d7Uw+eZoloe0EHDIYoe+bQ5WXnGMOpmiZFTuMWCwpjzzkL2nTjcKiAk4hh8TjnGye2TwWOk3UXucZ+3rbmBa8Q==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/postcss": {
+      "version": "8.4.49",
+      "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.49.tgz",
+      "integrity": "sha512-OCVPnIObs4N29kxTjzLfUryOkvZEq+pf8jTF0lg8E7uETuWHA+v7j3c/xJmiqpX450191LlmZfUKkXxkTry7nA==",
+      "dev": true,
+      "funding": [
+        {
+          "type": "opencollective",
+          "url": "https://opencollective.com/postcss/"
+        },
+        {
+          "type": "tidelift",
+          "url": "https://tidelift.com/funding/github/npm/postcss"
+        },
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ],
+      "license": "MIT",
+      "dependencies": {
+        "nanoid": "^3.3.7",
+        "picocolors": "^1.1.1",
+        "source-map-js": "^1.2.1"
+      },
+      "engines": {
+        "node": "^10 || ^12 || >=14"
+      }
+    },
+    "node_modules/postcss-js": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz",
+      "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==",
+      "dev": true,
+      "dependencies": {
+        "camelcase-css": "^2.0.1"
+      },
+      "engines": {
+        "node": "^12 || ^14 || >= 16"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/postcss/"
+      },
+      "peerDependencies": {
+        "postcss": "^8.4.21"
+      }
+    },
+    "node_modules/postcss-mixins": {
+      "version": "9.0.4",
+      "resolved": "https://registry.npmjs.org/postcss-mixins/-/postcss-mixins-9.0.4.tgz",
+      "integrity": "sha512-XVq5jwQJDRu5M1XGkdpgASqLk37OqkH4JCFDXl/Dn7janOJjCTEKL+36cnRVy7bMtoBzALfO7bV7nTIsFnUWLA==",
+      "dev": true,
+      "dependencies": {
+        "fast-glob": "^3.2.11",
+        "postcss-js": "^4.0.0",
+        "postcss-simple-vars": "^7.0.0",
+        "sugarss": "^4.0.1"
+      },
+      "engines": {
+        "node": ">=14.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/postcss/"
+      },
+      "peerDependencies": {
+        "postcss": "^8.2.14"
+      }
+    },
+    "node_modules/postcss-nested": {
+      "version": "6.2.0",
+      "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.2.0.tgz",
+      "integrity": "sha512-HQbt28KulC5AJzG+cZtj9kvKB93CFCdLvog1WFLf1D+xmMvPGlBstkpTEZfK5+AN9hfJocyBFCNiqyS48bpgzQ==",
+      "dev": true,
+      "funding": [
+        {
+          "type": "opencollective",
+          "url": "https://opencollective.com/postcss/"
+        },
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/ai"
+        }
+      ],
+      "dependencies": {
+        "postcss-selector-parser": "^6.1.1"
+      },
+      "engines": {
+        "node": ">=12.0"
+      },
+      "peerDependencies": {
+        "postcss": "^8.2.14"
+      }
+    },
+    "node_modules/postcss-preset-mantine": {
+      "version": "1.17.0",
+      "resolved": "https://registry.npmjs.org/postcss-preset-mantine/-/postcss-preset-mantine-1.17.0.tgz",
+      "integrity": "sha512-ji1PMDBUf2Vsx/HE5faMSs1+ff6qE6YRulTr4Ja+6HD3gop8rSMTCYdpN7KrdsEg079kfBKkO/PaKhG9uR0zwQ==",
+      "dev": true,
+      "license": "MIT",
+      "dependencies": {
+        "postcss-mixins": "^9.0.4",
+        "postcss-nested": "^6.0.1"
+      },
+      "peerDependencies": {
+        "postcss": ">=8.0.0"
+      }
+    },
+    "node_modules/postcss-selector-parser": {
+      "version": "6.1.2",
+      "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.1.2.tgz",
+      "integrity": "sha512-Q8qQfPiZ+THO/3ZrOrO0cJJKfpYCagtMUkXbnEfmgUjwXg6z/WBeOyS9APBBPCTSiDV+s4SwQGu8yFsiMRIudg==",
+      "dev": true,
+      "dependencies": {
+        "cssesc": "^3.0.0",
+        "util-deprecate": "^1.0.2"
+      },
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/postcss-simple-vars": {
+      "version": "7.0.1",
+      "resolved": "https://registry.npmjs.org/postcss-simple-vars/-/postcss-simple-vars-7.0.1.tgz",
+      "integrity": "sha512-5GLLXaS8qmzHMOjVxqkk1TZPf1jMqesiI7qLhnlyERalG0sMbHIbJqrcnrpmZdKCLglHnRHoEBB61RtGTsj++A==",
+      "dev": true,
+      "license": "MIT",
+      "engines": {
+        "node": ">=14.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/postcss/"
+      },
+      "peerDependencies": {
+        "postcss": "^8.2.1"
+      }
+    },
+    "node_modules/prelude-ls": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz",
+      "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/prop-types": {
+      "version": "15.8.1",
+      "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.8.1.tgz",
+      "integrity": "sha512-oj87CgZICdulUohogVAR7AjlC0327U4el4L6eAvOqCeudMDVU0NThNaV+b9Df4dXgSP1gXMTnPdhfe/2qDH5cg==",
+      "dependencies": {
+        "loose-envify": "^1.4.0",
+        "object-assign": "^4.1.1",
+        "react-is": "^16.13.1"
+      }
+    },
+    "node_modules/proxy-from-env": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz",
+      "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg=="
+    },
+    "node_modules/punycode": {
+      "version": "2.3.1",
+      "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz",
+      "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==",
+      "dev": true,
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/queue-microtask": {
+      "version": "1.2.3",
+      "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz",
+      "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==",
+      "dev": true,
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/feross"
+        },
+        {
+          "type": "patreon",
+          "url": "https://www.patreon.com/feross"
+        },
+        {
+          "type": "consulting",
+          "url": "https://feross.org/support"
+        }
+      ]
+    },
+    "node_modules/react": {
+      "version": "19.0.0",
+      "resolved": "https://registry.npmjs.org/react/-/react-19.0.0.tgz",
+      "integrity": "sha512-V8AVnmPIICiWpGfm6GLzCR/W5FXLchHop40W4nXBmdlEceh16rCN8O8LNWm5bh5XUX91fh7KpA+W0TgMKmgTpQ==",
+      "license": "MIT",
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/react-dom": {
+      "version": "19.0.0",
+      "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-19.0.0.tgz",
+      "integrity": "sha512-4GV5sHFG0e/0AD4X+ySy6UJd3jVl1iNsNHdpad0qhABJ11twS3TTBnseqsKurKcsNqCEFeGL3uLpVChpIO3QfQ==",
+      "license": "MIT",
+      "dependencies": {
+        "scheduler": "^0.25.0"
+      },
+      "peerDependencies": {
+        "react": "^19.0.0"
+      }
+    },
+    "node_modules/react-is": {
+      "version": "16.13.1",
+      "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz",
+      "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ=="
+    },
+    "node_modules/react-smooth": {
+      "version": "4.0.4",
+      "resolved": "https://registry.npmjs.org/react-smooth/-/react-smooth-4.0.4.tgz",
+      "integrity": "sha512-gnGKTpYwqL0Iii09gHobNolvX4Kiq4PKx6eWBCYYix+8cdw+cGo3do906l1NBPKkSWx1DghC1dlWG9L2uGd61Q==",
+      "license": "MIT",
+      "dependencies": {
+        "fast-equals": "^5.0.1",
+        "prop-types": "^15.8.1",
+        "react-transition-group": "^4.4.5"
+      },
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0 || ^19.0.0",
+        "react-dom": "^16.8.0 || ^17.0.0 || ^18.0.0 || ^19.0.0"
+      }
+    },
+    "node_modules/react-transition-group": {
+      "version": "4.4.5",
+      "resolved": "https://registry.npmjs.org/react-transition-group/-/react-transition-group-4.4.5.tgz",
+      "integrity": "sha512-pZcd1MCJoiKiBR2NRxeCRg13uCXbydPnmB4EOeRrY7480qNWO8IIgQG6zlDkm6uRMsURXPuKq0GWtiM59a5Q6g==",
+      "license": "BSD-3-Clause",
+      "dependencies": {
+        "@babel/runtime": "^7.5.5",
+        "dom-helpers": "^5.0.1",
+        "loose-envify": "^1.4.0",
+        "prop-types": "^15.6.2"
+      },
+      "peerDependencies": {
+        "react": ">=16.6.0",
+        "react-dom": ">=16.6.0"
+      }
+    },
+    "node_modules/recharts": {
+      "version": "2.15.0",
+      "resolved": "https://registry.npmjs.org/recharts/-/recharts-2.15.0.tgz",
+      "integrity": "sha512-cIvMxDfpAmqAmVgc4yb7pgm/O1tmmkl/CjrvXuW+62/+7jj/iF9Ykm+hb/UJt42TREHMyd3gb+pkgoa2MxgDIw==",
+      "license": "MIT",
+      "dependencies": {
+        "clsx": "^2.0.0",
+        "eventemitter3": "^4.0.1",
+        "lodash": "^4.17.21",
+        "react-is": "^18.3.1",
+        "react-smooth": "^4.0.0",
+        "recharts-scale": "^0.4.4",
+        "tiny-invariant": "^1.3.1",
+        "victory-vendor": "^36.6.8"
+      },
+      "engines": {
+        "node": ">=14"
+      },
+      "peerDependencies": {
+        "react": "^16.0.0 || ^17.0.0 || ^18.0.0 || ^19.0.0",
+        "react-dom": "^16.0.0 || ^17.0.0 || ^18.0.0 || ^19.0.0"
+      }
+    },
+    "node_modules/recharts-scale": {
+      "version": "0.4.5",
+      "resolved": "https://registry.npmjs.org/recharts-scale/-/recharts-scale-0.4.5.tgz",
+      "integrity": "sha512-kivNFO+0OcUNu7jQquLXAxz1FIwZj8nrj+YkOKc5694NbjCvcT6aSZiIzNzd2Kul4o4rTto8QVR9lMNtxD4G1w==",
+      "license": "MIT",
+      "dependencies": {
+        "decimal.js-light": "^2.4.1"
+      }
+    },
+    "node_modules/recharts/node_modules/react-is": {
+      "version": "18.3.1",
+      "resolved": "https://registry.npmjs.org/react-is/-/react-is-18.3.1.tgz",
+      "integrity": "sha512-/LLMVyas0ljjAtoYiPqYiL8VWXzUUdThrmU5+n20DZv+a+ClRoevUzw5JxU+Ieh5/c87ytoTBV9G1FiKfNJdmg==",
+      "license": "MIT"
+    },
+    "node_modules/reflect.getprototypeof": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/reflect.getprototypeof/-/reflect.getprototypeof-1.0.6.tgz",
+      "integrity": "sha512-fmfw4XgoDke3kdI6h4xcUz1dG8uaiv5q9gcEwLS4Pnth2kxT+GZ7YehS1JTMGBQmtV7Y4GFGbs2re2NqhdozUg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.1",
+        "es-errors": "^1.3.0",
+        "get-intrinsic": "^1.2.4",
+        "globalthis": "^1.0.3",
+        "which-builtin-type": "^1.1.3"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/regenerator-runtime": {
+      "version": "0.14.1",
+      "resolved": "https://registry.npmjs.org/regenerator-runtime/-/regenerator-runtime-0.14.1.tgz",
+      "integrity": "sha512-dYnhHh0nJoMfnkZs6GmmhFknAGRrLznOu5nc9ML+EJxGvrx6H7teuevqVqCuPcPK//3eDrrjQhehXVx9cnkGdw=="
+    },
+    "node_modules/regexp.prototype.flags": {
+      "version": "1.5.3",
+      "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.5.3.tgz",
+      "integrity": "sha512-vqlC04+RQoFalODCbCumG2xIOvapzVMHwsyIGM/SIE8fRhFFsXeH8/QQ+s0T0kDAhKc4k30s73/0ydkHQz6HlQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-errors": "^1.3.0",
+        "set-function-name": "^2.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/resolve": {
+      "version": "1.22.8",
+      "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz",
+      "integrity": "sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==",
+      "dev": true,
+      "dependencies": {
+        "is-core-module": "^2.13.0",
+        "path-parse": "^1.0.7",
+        "supports-preserve-symlinks-flag": "^1.0.0"
+      },
+      "bin": {
+        "resolve": "bin/resolve"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/resolve-from": {
+      "version": "4.0.0",
+      "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz",
+      "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==",
+      "dev": true,
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/resolve-pkg-maps": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/resolve-pkg-maps/-/resolve-pkg-maps-1.0.0.tgz",
+      "integrity": "sha512-seS2Tj26TBVOC2NIc2rOe2y2ZO7efxITtLZcGSOnHHNOQ7CkiUBfw0Iw2ck6xkIhPwLhKNLS8BO+hEpngQlqzw==",
+      "dev": true,
+      "funding": {
+        "url": "https://github.com/privatenumber/resolve-pkg-maps?sponsor=1"
+      }
+    },
+    "node_modules/reusify": {
+      "version": "1.0.4",
+      "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz",
+      "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==",
+      "dev": true,
+      "engines": {
+        "iojs": ">=1.0.0",
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/rimraf": {
+      "version": "3.0.2",
+      "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz",
+      "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==",
+      "deprecated": "Rimraf versions prior to v4 are no longer supported",
+      "dev": true,
+      "dependencies": {
+        "glob": "^7.1.3"
+      },
+      "bin": {
+        "rimraf": "bin.js"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/isaacs"
+      }
+    },
+    "node_modules/run-parallel": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz",
+      "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==",
+      "dev": true,
+      "funding": [
+        {
+          "type": "github",
+          "url": "https://github.com/sponsors/feross"
+        },
+        {
+          "type": "patreon",
+          "url": "https://www.patreon.com/feross"
+        },
+        {
+          "type": "consulting",
+          "url": "https://feross.org/support"
+        }
+      ],
+      "dependencies": {
+        "queue-microtask": "^1.2.2"
+      }
+    },
+    "node_modules/safe-array-concat": {
+      "version": "1.1.2",
+      "resolved": "https://registry.npmjs.org/safe-array-concat/-/safe-array-concat-1.1.2.tgz",
+      "integrity": "sha512-vj6RsCsWBCf19jIeHEfkRMw8DPiBb+DMXklQ/1SGDHOMlHdPUkZXFQ2YdplS23zESTijAcurb1aSgJA3AgMu1Q==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "get-intrinsic": "^1.2.4",
+        "has-symbols": "^1.0.3",
+        "isarray": "^2.0.5"
+      },
+      "engines": {
+        "node": ">=0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/safe-regex-test": {
+      "version": "1.0.3",
+      "resolved": "https://registry.npmjs.org/safe-regex-test/-/safe-regex-test-1.0.3.tgz",
+      "integrity": "sha512-CdASjNJPvRa7roO6Ra/gLYBTzYzzPyyBXxIMdGW3USQLyjWEls2RgW5UBTXaQVp+OrpeCK3bLem8smtmheoRuw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.6",
+        "es-errors": "^1.3.0",
+        "is-regex": "^1.1.4"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/scheduler": {
+      "version": "0.25.0",
+      "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.25.0.tgz",
+      "integrity": "sha512-xFVuu11jh+xcO7JOAGJNOXld8/TcEHK/4CituBUeUb5hqxJLj9YuemAEuvm9gQ/+pgXYfbQuqAkiYu+u7YEsNA==",
+      "license": "MIT"
+    },
+    "node_modules/semver": {
+      "version": "7.6.3",
+      "resolved": "https://registry.npmjs.org/semver/-/semver-7.6.3.tgz",
+      "integrity": "sha512-oVekP1cKtI+CTDvHWYFUcMtsK/00wmAEfyqKfNdARm8u1wNVhSgaX7A8d4UuIlUI5e84iEwOhs7ZPYRmzU9U6A==",
+      "devOptional": true,
+      "bin": {
+        "semver": "bin/semver.js"
+      },
+      "engines": {
+        "node": ">=10"
+      }
+    },
+    "node_modules/set-function-length": {
+      "version": "1.2.2",
+      "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.2.2.tgz",
+      "integrity": "sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==",
+      "dev": true,
+      "dependencies": {
+        "define-data-property": "^1.1.4",
+        "es-errors": "^1.3.0",
+        "function-bind": "^1.1.2",
+        "get-intrinsic": "^1.2.4",
+        "gopd": "^1.0.1",
+        "has-property-descriptors": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/set-function-name": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/set-function-name/-/set-function-name-2.0.2.tgz",
+      "integrity": "sha512-7PGFlmtwsEADb0WYyvCMa1t+yke6daIG4Wirafur5kcf+MhUnPms1UeR0CKQdTZD81yESwMHbtn+TR+dMviakQ==",
+      "dev": true,
+      "dependencies": {
+        "define-data-property": "^1.1.4",
+        "es-errors": "^1.3.0",
+        "functions-have-names": "^1.2.3",
+        "has-property-descriptors": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/sharp": {
+      "version": "0.33.5",
+      "resolved": "https://registry.npmjs.org/sharp/-/sharp-0.33.5.tgz",
+      "integrity": "sha512-haPVm1EkS9pgvHrQ/F3Xy+hgcuMV0Wm9vfIBSiwZ05k+xgb0PkBQpGsAA/oWdDobNaZTH5ppvHtzCFbnSEwHVw==",
+      "hasInstallScript": true,
+      "optional": true,
+      "dependencies": {
+        "color": "^4.2.3",
+        "detect-libc": "^2.0.3",
+        "semver": "^7.6.3"
+      },
+      "engines": {
+        "node": "^18.17.0 || ^20.3.0 || >=21.0.0"
+      },
+      "funding": {
+        "url": "https://opencollective.com/libvips"
+      },
+      "optionalDependencies": {
+        "@img/sharp-darwin-arm64": "0.33.5",
+        "@img/sharp-darwin-x64": "0.33.5",
+        "@img/sharp-libvips-darwin-arm64": "1.0.4",
+        "@img/sharp-libvips-darwin-x64": "1.0.4",
+        "@img/sharp-libvips-linux-arm": "1.0.5",
+        "@img/sharp-libvips-linux-arm64": "1.0.4",
+        "@img/sharp-libvips-linux-s390x": "1.0.4",
+        "@img/sharp-libvips-linux-x64": "1.0.4",
+        "@img/sharp-libvips-linuxmusl-arm64": "1.0.4",
+        "@img/sharp-libvips-linuxmusl-x64": "1.0.4",
+        "@img/sharp-linux-arm": "0.33.5",
+        "@img/sharp-linux-arm64": "0.33.5",
+        "@img/sharp-linux-s390x": "0.33.5",
+        "@img/sharp-linux-x64": "0.33.5",
+        "@img/sharp-linuxmusl-arm64": "0.33.5",
+        "@img/sharp-linuxmusl-x64": "0.33.5",
+        "@img/sharp-wasm32": "0.33.5",
+        "@img/sharp-win32-ia32": "0.33.5",
+        "@img/sharp-win32-x64": "0.33.5"
+      }
+    },
+    "node_modules/shebang-command": {
+      "version": "2.0.0",
+      "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz",
+      "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==",
+      "dev": true,
+      "dependencies": {
+        "shebang-regex": "^3.0.0"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/shebang-regex": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz",
+      "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/side-channel": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.6.tgz",
+      "integrity": "sha512-fDW/EZ6Q9RiO8eFG8Hj+7u/oW+XrPTIChwCOM2+th2A6OblDtYYIpve9m+KvI9Z4C9qSEXlaGR6bTEYHReuglA==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "es-errors": "^1.3.0",
+        "get-intrinsic": "^1.2.4",
+        "object-inspect": "^1.13.1"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/simple-swizzle": {
+      "version": "0.2.2",
+      "resolved": "https://registry.npmjs.org/simple-swizzle/-/simple-swizzle-0.2.2.tgz",
+      "integrity": "sha512-JA//kQgZtbuY83m+xT+tXJkmJncGMTFT+C+g2h2R9uxkYIrE2yy9sgmcLhCnw57/WSD+Eh3J97FPEDFnbXnDUg==",
+      "optional": true,
+      "dependencies": {
+        "is-arrayish": "^0.3.1"
+      }
+    },
+    "node_modules/source-map-js": {
+      "version": "1.2.1",
+      "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.1.tgz",
+      "integrity": "sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==",
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/streamsearch": {
+      "version": "1.1.0",
+      "resolved": "https://registry.npmjs.org/streamsearch/-/streamsearch-1.1.0.tgz",
+      "integrity": "sha512-Mcc5wHehp9aXz1ax6bZUyY5afg9u2rv5cqQI3mRrYkGC8rW2hM02jWuwjtL++LS5qinSyhj2QfLyNsuc+VsExg==",
+      "engines": {
+        "node": ">=10.0.0"
+      }
+    },
+    "node_modules/string.prototype.includes": {
+      "version": "2.0.1",
+      "resolved": "https://registry.npmjs.org/string.prototype.includes/-/string.prototype.includes-2.0.1.tgz",
+      "integrity": "sha512-o7+c9bW6zpAdJHTtujeePODAhkuicdAryFsfVKwA+wGw89wJ4GTY484WTucM9hLtDEOpOvI+aHnzqnC5lHp4Rg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.3"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/string.prototype.matchall": {
+      "version": "4.0.11",
+      "resolved": "https://registry.npmjs.org/string.prototype.matchall/-/string.prototype.matchall-4.0.11.tgz",
+      "integrity": "sha512-NUdh0aDavY2og7IbBPenWqR9exH+E26Sv8e0/eTe1tltDGZL+GtBkDAnnyBtmekfK6/Dq3MkcGtzXFEd1LQrtg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.2",
+        "es-errors": "^1.3.0",
+        "es-object-atoms": "^1.0.0",
+        "get-intrinsic": "^1.2.4",
+        "gopd": "^1.0.1",
+        "has-symbols": "^1.0.3",
+        "internal-slot": "^1.0.7",
+        "regexp.prototype.flags": "^1.5.2",
+        "set-function-name": "^2.0.2",
+        "side-channel": "^1.0.6"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/string.prototype.repeat": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/string.prototype.repeat/-/string.prototype.repeat-1.0.0.tgz",
+      "integrity": "sha512-0u/TldDbKD8bFCQ/4f5+mNRrXwZ8hg2w7ZR8wa16e8z9XpePWl3eGEcUD0OXpEH/VJH/2G3gjUtR3ZOiBe2S/w==",
+      "dev": true,
+      "dependencies": {
+        "define-properties": "^1.1.3",
+        "es-abstract": "^1.17.5"
+      }
+    },
+    "node_modules/string.prototype.trim": {
+      "version": "1.2.9",
+      "resolved": "https://registry.npmjs.org/string.prototype.trim/-/string.prototype.trim-1.2.9.tgz",
+      "integrity": "sha512-klHuCNxiMZ8MlsOihJhJEBJAiMVqU3Z2nEXWfWnIqjN0gEFS9J9+IxKozWWtQGcgoa1WUZzLjKPTr4ZHNFTFxw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-abstract": "^1.23.0",
+        "es-object-atoms": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/string.prototype.trimend": {
+      "version": "1.0.8",
+      "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.8.tgz",
+      "integrity": "sha512-p73uL5VCHCO2BZZ6krwwQE3kCzM7NKmis8S//xEC6fQonchbum4eP6kR4DLEjQFO3Wnj3Fuo8NM0kOSjVdHjZQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-object-atoms": "^1.0.0"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/string.prototype.trimstart": {
+      "version": "1.0.8",
+      "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.8.tgz",
+      "integrity": "sha512-UXSH262CSZY1tfu3G3Secr6uGLCFVPMhIqHjlgCUtCCcgihYc/xKs9djMTMUOb2j1mVSeU8EU6NWc/iQKU6Gfg==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "define-properties": "^1.2.1",
+        "es-object-atoms": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/strip-ansi": {
+      "version": "6.0.1",
+      "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz",
+      "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==",
+      "dev": true,
+      "dependencies": {
+        "ansi-regex": "^5.0.1"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/strip-bom": {
+      "version": "3.0.0",
+      "resolved": "https://registry.npmjs.org/strip-bom/-/strip-bom-3.0.0.tgz",
+      "integrity": "sha512-vavAMRXOgBVNF6nyEEmL3DBK19iRpDcoIwW+swQ+CbGiu7lju6t+JklA1MHweoWtadgt4ISVUsXLyDq34ddcwA==",
+      "dev": true,
+      "engines": {
+        "node": ">=4"
+      }
+    },
+    "node_modules/strip-json-comments": {
+      "version": "3.1.1",
+      "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz",
+      "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==",
+      "dev": true,
+      "engines": {
+        "node": ">=8"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/styled-jsx": {
+      "version": "5.1.6",
+      "resolved": "https://registry.npmjs.org/styled-jsx/-/styled-jsx-5.1.6.tgz",
+      "integrity": "sha512-qSVyDTeMotdvQYoHWLNGwRFJHC+i+ZvdBRYosOFgC+Wg1vx4frN2/RG/NA7SYqqvKNLf39P2LSRA2pu6n0XYZA==",
+      "dependencies": {
+        "client-only": "0.0.1"
+      },
+      "engines": {
+        "node": ">= 12.0.0"
+      },
+      "peerDependencies": {
+        "react": ">= 16.8.0 || 17.x.x || ^18.0.0-0 || ^19.0.0-0"
+      },
+      "peerDependenciesMeta": {
+        "@babel/core": {
+          "optional": true
+        },
+        "babel-plugin-macros": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/sugarss": {
+      "version": "4.0.1",
+      "resolved": "https://registry.npmjs.org/sugarss/-/sugarss-4.0.1.tgz",
+      "integrity": "sha512-WCjS5NfuVJjkQzK10s8WOBY+hhDxxNt/N6ZaGwxFZ+wN3/lKKFSaaKUNecULcTTvE4urLcKaZFQD8vO0mOZujw==",
+      "dev": true,
+      "engines": {
+        "node": ">=12.0"
+      },
+      "funding": {
+        "type": "opencollective",
+        "url": "https://opencollective.com/postcss/"
+      },
+      "peerDependencies": {
+        "postcss": "^8.3.3"
+      }
+    },
+    "node_modules/supports-color": {
+      "version": "7.2.0",
+      "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz",
+      "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==",
+      "dev": true,
+      "dependencies": {
+        "has-flag": "^4.0.0"
+      },
+      "engines": {
+        "node": ">=8"
+      }
+    },
+    "node_modules/supports-preserve-symlinks-flag": {
+      "version": "1.0.0",
+      "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz",
+      "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==",
+      "dev": true,
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/tabbable": {
+      "version": "6.2.0",
+      "resolved": "https://registry.npmjs.org/tabbable/-/tabbable-6.2.0.tgz",
+      "integrity": "sha512-Cat63mxsVJlzYvN51JmVXIgNoUokrIaT2zLclCXjRd8boZ0004U4KCs/sToJ75C6sdlByWxpYnb5Boif1VSFew==",
+      "license": "MIT"
+    },
+    "node_modules/tapable": {
+      "version": "2.2.1",
+      "resolved": "https://registry.npmjs.org/tapable/-/tapable-2.2.1.tgz",
+      "integrity": "sha512-GNzQvQTOIP6RyTfE2Qxb8ZVlNmw0n88vp1szwWRimP02mnTsx3Wtn5qRdqY9w2XduFNUgvOwhNnQsjwCp+kqaQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=6"
+      }
+    },
+    "node_modules/text-table": {
+      "version": "0.2.0",
+      "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz",
+      "integrity": "sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==",
+      "dev": true
+    },
+    "node_modules/tiny-invariant": {
+      "version": "1.3.3",
+      "resolved": "https://registry.npmjs.org/tiny-invariant/-/tiny-invariant-1.3.3.tgz",
+      "integrity": "sha512-+FbBPE1o9QAYvviau/qC5SE3caw21q3xkvWKBtja5vgqOWIHHJ3ioaq1VPfn/Szqctz2bU/oYeKd9/z5BL+PVg==",
+      "license": "MIT"
+    },
+    "node_modules/to-regex-range": {
+      "version": "5.0.1",
+      "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz",
+      "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==",
+      "dev": true,
+      "dependencies": {
+        "is-number": "^7.0.0"
+      },
+      "engines": {
+        "node": ">=8.0"
+      }
+    },
+    "node_modules/ts-api-utils": {
+      "version": "1.4.0",
+      "resolved": "https://registry.npmjs.org/ts-api-utils/-/ts-api-utils-1.4.0.tgz",
+      "integrity": "sha512-032cPxaEKwM+GT3vA5JXNzIaizx388rhsSW79vGRNGXfRRAdEAn2mvk36PvK5HnOchyWZ7afLEXqYCvPCrzuzQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=16"
+      },
+      "peerDependencies": {
+        "typescript": ">=4.2.0"
+      }
+    },
+    "node_modules/tsconfig-paths": {
+      "version": "3.15.0",
+      "resolved": "https://registry.npmjs.org/tsconfig-paths/-/tsconfig-paths-3.15.0.tgz",
+      "integrity": "sha512-2Ac2RgzDe/cn48GvOe3M+o82pEFewD3UPbyoUHHdKasHwJKjds4fLXWf/Ux5kATBKN20oaFGu+jbElp1pos0mg==",
+      "dev": true,
+      "dependencies": {
+        "@types/json5": "^0.0.29",
+        "json5": "^1.0.2",
+        "minimist": "^1.2.6",
+        "strip-bom": "^3.0.0"
+      }
+    },
+    "node_modules/tslib": {
+      "version": "2.8.1",
+      "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.8.1.tgz",
+      "integrity": "sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w=="
+    },
+    "node_modules/type-check": {
+      "version": "0.4.0",
+      "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz",
+      "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==",
+      "dev": true,
+      "dependencies": {
+        "prelude-ls": "^1.2.1"
+      },
+      "engines": {
+        "node": ">= 0.8.0"
+      }
+    },
+    "node_modules/type-fest": {
+      "version": "0.20.2",
+      "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz",
+      "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==",
+      "dev": true,
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/typed-array-buffer": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/typed-array-buffer/-/typed-array-buffer-1.0.2.tgz",
+      "integrity": "sha512-gEymJYKZtKXzzBzM4jqa9w6Q1Jjm7x2d+sh19AdsD4wqnMPDYyvwpsIc2Q/835kHuo3BEQ7CjelGhfTsoBb2MQ==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "es-errors": "^1.3.0",
+        "is-typed-array": "^1.1.13"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      }
+    },
+    "node_modules/typed-array-byte-length": {
+      "version": "1.0.1",
+      "resolved": "https://registry.npmjs.org/typed-array-byte-length/-/typed-array-byte-length-1.0.1.tgz",
+      "integrity": "sha512-3iMJ9q0ao7WE9tWcaYKIptkNBuOIcZCCT0d4MRvuuH88fEoEH62IuQe0OtraD3ebQEoTRk8XCBoknUNc1Y67pw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "for-each": "^0.3.3",
+        "gopd": "^1.0.1",
+        "has-proto": "^1.0.3",
+        "is-typed-array": "^1.1.13"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/typed-array-byte-offset": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.2.tgz",
+      "integrity": "sha512-Ous0vodHa56FviZucS2E63zkgtgrACj7omjwd/8lTEMEPFFyjfixMZ1ZXenpgCFBBt4EC1J2XsyVS2gkG0eTFA==",
+      "dev": true,
+      "dependencies": {
+        "available-typed-arrays": "^1.0.7",
+        "call-bind": "^1.0.7",
+        "for-each": "^0.3.3",
+        "gopd": "^1.0.1",
+        "has-proto": "^1.0.3",
+        "is-typed-array": "^1.1.13"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/typed-array-length": {
+      "version": "1.0.6",
+      "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.6.tgz",
+      "integrity": "sha512-/OxDN6OtAk5KBpGb28T+HZc2M+ADtvRxXrKKbUwtsLgdoxgX13hyy7ek6bFRl5+aBs2yZzB0c4CnQfAtVypW/g==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.7",
+        "for-each": "^0.3.3",
+        "gopd": "^1.0.1",
+        "has-proto": "^1.0.3",
+        "is-typed-array": "^1.1.13",
+        "possible-typed-array-names": "^1.0.0"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/typescript": {
+      "version": "5.6.3",
+      "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.6.3.tgz",
+      "integrity": "sha512-hjcS1mhfuyi4WW8IWtjP7brDrG2cuDZukyrYrSauoXGNgx0S7zceP07adYkJycEr56BOUTNPzbInooiN3fn1qw==",
+      "dev": true,
+      "bin": {
+        "tsc": "bin/tsc",
+        "tsserver": "bin/tsserver"
+      },
+      "engines": {
+        "node": ">=14.17"
+      }
+    },
+    "node_modules/unbox-primitive": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.2.tgz",
+      "integrity": "sha512-61pPlCD9h51VoreyJ0BReideM3MDKMKnh6+V9L08331ipq6Q8OFXZYiqP6n/tbHx4s5I9uRhcye6BrbkizkBDw==",
+      "dev": true,
+      "dependencies": {
+        "call-bind": "^1.0.2",
+        "has-bigints": "^1.0.2",
+        "has-symbols": "^1.0.3",
+        "which-boxed-primitive": "^1.0.2"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/undici-types": {
+      "version": "6.19.8",
+      "resolved": "https://registry.npmjs.org/undici-types/-/undici-types-6.19.8.tgz",
+      "integrity": "sha512-ve2KP6f/JnbPBFyobGHuerC9g1FYGn/F8n1LWTwNxCEzd6IfqTwUQcNXgEtmmQ6DlRrC1hrSrBnCZPokRrDHjw==",
+      "dev": true
+    },
+    "node_modules/uri-js": {
+      "version": "4.4.1",
+      "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz",
+      "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==",
+      "dev": true,
+      "dependencies": {
+        "punycode": "^2.1.0"
+      }
+    },
+    "node_modules/use-isomorphic-layout-effect": {
+      "version": "1.2.0",
+      "resolved": "https://registry.npmjs.org/use-isomorphic-layout-effect/-/use-isomorphic-layout-effect-1.2.0.tgz",
+      "integrity": "sha512-q6ayo8DWoPZT0VdG4u3D3uxcgONP3Mevx2i2b0434cwWBoL+aelL1DzkXI6w3PhTZzUeR2kaVlZn70iCiseP6w==",
+      "license": "MIT",
+      "peerDependencies": {
+        "react": "^16.8.0 || ^17.0.0 || ^18.0.0 || ^19.0.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        }
+      }
+    },
+    "node_modules/util-deprecate": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz",
+      "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==",
+      "dev": true
+    },
+    "node_modules/victory-vendor": {
+      "version": "36.9.2",
+      "resolved": "https://registry.npmjs.org/victory-vendor/-/victory-vendor-36.9.2.tgz",
+      "integrity": "sha512-PnpQQMuxlwYdocC8fIJqVXvkeViHYzotI+NJrCuav0ZYFoq912ZHBk3mCeuj+5/VpodOjPe1z0Fk2ihgzlXqjQ==",
+      "license": "MIT AND ISC",
+      "dependencies": {
+        "@types/d3-array": "^3.0.3",
+        "@types/d3-ease": "^3.0.0",
+        "@types/d3-interpolate": "^3.0.1",
+        "@types/d3-scale": "^4.0.2",
+        "@types/d3-shape": "^3.1.0",
+        "@types/d3-time": "^3.0.0",
+        "@types/d3-timer": "^3.0.0",
+        "d3-array": "^3.1.6",
+        "d3-ease": "^3.0.1",
+        "d3-interpolate": "^3.0.1",
+        "d3-scale": "^4.0.2",
+        "d3-shape": "^3.1.0",
+        "d3-time": "^3.0.0",
+        "d3-timer": "^3.0.1"
+      }
+    },
+    "node_modules/which": {
+      "version": "2.0.2",
+      "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz",
+      "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==",
+      "dev": true,
+      "dependencies": {
+        "isexe": "^2.0.0"
+      },
+      "bin": {
+        "node-which": "bin/node-which"
+      },
+      "engines": {
+        "node": ">= 8"
+      }
+    },
+    "node_modules/which-boxed-primitive": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz",
+      "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==",
+      "dev": true,
+      "dependencies": {
+        "is-bigint": "^1.0.1",
+        "is-boolean-object": "^1.1.0",
+        "is-number-object": "^1.0.4",
+        "is-string": "^1.0.5",
+        "is-symbol": "^1.0.3"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/which-builtin-type": {
+      "version": "1.1.4",
+      "resolved": "https://registry.npmjs.org/which-builtin-type/-/which-builtin-type-1.1.4.tgz",
+      "integrity": "sha512-bppkmBSsHFmIMSl8BO9TbsyzsvGjVoppt8xUiGzwiu/bhDCGxnpOKCxgqj6GuyHE0mINMDecBFPlOm2hzY084w==",
+      "dev": true,
+      "dependencies": {
+        "function.prototype.name": "^1.1.6",
+        "has-tostringtag": "^1.0.2",
+        "is-async-function": "^2.0.0",
+        "is-date-object": "^1.0.5",
+        "is-finalizationregistry": "^1.0.2",
+        "is-generator-function": "^1.0.10",
+        "is-regex": "^1.1.4",
+        "is-weakref": "^1.0.2",
+        "isarray": "^2.0.5",
+        "which-boxed-primitive": "^1.0.2",
+        "which-collection": "^1.0.2",
+        "which-typed-array": "^1.1.15"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/which-collection": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/which-collection/-/which-collection-1.0.2.tgz",
+      "integrity": "sha512-K4jVyjnBdgvc86Y6BkaLZEN933SwYOuBFkdmBu9ZfkcAbdVbpITnDmjvZ/aQjRXQrv5EPkTnD1s39GiiqbngCw==",
+      "dev": true,
+      "dependencies": {
+        "is-map": "^2.0.3",
+        "is-set": "^2.0.3",
+        "is-weakmap": "^2.0.2",
+        "is-weakset": "^2.0.3"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/which-typed-array": {
+      "version": "1.1.15",
+      "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.15.tgz",
+      "integrity": "sha512-oV0jmFtUky6CXfkqehVvBP/LSWJ2sy4vWMioiENyJLePrBO/yKyV9OyJySfAKosh+RYkIl5zJCNZ8/4JncrpdA==",
+      "dev": true,
+      "dependencies": {
+        "available-typed-arrays": "^1.0.7",
+        "call-bind": "^1.0.7",
+        "for-each": "^0.3.3",
+        "gopd": "^1.0.1",
+        "has-tostringtag": "^1.0.2"
+      },
+      "engines": {
+        "node": ">= 0.4"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/ljharb"
+      }
+    },
+    "node_modules/word-wrap": {
+      "version": "1.2.5",
+      "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.5.tgz",
+      "integrity": "sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==",
+      "dev": true,
+      "engines": {
+        "node": ">=0.10.0"
+      }
+    },
+    "node_modules/wrappy": {
+      "version": "1.0.2",
+      "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz",
+      "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==",
+      "dev": true
+    },
+    "node_modules/yocto-queue": {
+      "version": "0.1.0",
+      "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz",
+      "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==",
+      "dev": true,
+      "engines": {
+        "node": ">=10"
+      },
+      "funding": {
+        "url": "https://github.com/sponsors/sindresorhus"
+      }
+    },
+    "node_modules/zod": {
+      "version": "3.24.1",
+      "resolved": "https://registry.npmjs.org/zod/-/zod-3.24.1.tgz",
+      "integrity": "sha512-muH7gBL9sI1nciMZV67X5fTKKBLtwpZ5VBp1vsOQzj1MhrBZ4wlVCm3gedKZWLp0Oyel8sIGfeiz54Su+OVT+A==",
+      "license": "MIT",
+      "funding": {
+        "url": "https://github.com/sponsors/colinhacks"
+      }
+    },
+    "node_modules/zustand": {
+      "version": "5.0.2",
+      "resolved": "https://registry.npmjs.org/zustand/-/zustand-5.0.2.tgz",
+      "integrity": "sha512-8qNdnJVJlHlrKXi50LDqqUNmUbuBjoKLrYQBnoChIbVph7vni+sY+YpvdjXG9YLd/Bxr6scMcR+rm5H3aSqPaw==",
+      "license": "MIT",
+      "engines": {
+        "node": ">=12.20.0"
+      },
+      "peerDependencies": {
+        "@types/react": ">=18.0.0",
+        "immer": ">=9.0.6",
+        "react": ">=18.0.0",
+        "use-sync-external-store": ">=1.2.0"
+      },
+      "peerDependenciesMeta": {
+        "@types/react": {
+          "optional": true
+        },
+        "immer": {
+          "optional": true
+        },
+        "react": {
+          "optional": true
+        },
+        "use-sync-external-store": {
+          "optional": true
+        }
+      }
+    }
+  }
+}
diff --git a/frontend/package.json b/frontend/package.json
new file mode 100644
index 00000000..840d24ce
--- /dev/null
+++ b/frontend/package.json
@@ -0,0 +1,51 @@
+{
+  "name": "ganymede-frontend-nextjs",
+  "version": "0.1.0",
+  "private": true,
+  "scripts": {
+    "dev": "next dev --turbopack",
+    "build": "next build",
+    "start": "next start",
+    "lint": "next lint"
+  },
+  "dependencies": {
+    "@mantine/carousel": "^7.15.1",
+    "@mantine/charts": "^7.15.1",
+    "@mantine/core": "^7.15.1",
+    "@mantine/dates": "^7.15.1",
+    "@mantine/form": "^7.15.1",
+    "@mantine/hooks": "^7.15.1",
+    "@mantine/notifications": "^7.15.1",
+    "@tabler/icons-react": "^3.26.0",
+    "@tanstack/react-query": "^5.62.8",
+    "@tanstack/react-query-devtools": "^5.62.8",
+    "@vidstack/react": "^1.11.30",
+    "axios": "^1.7.9",
+    "clsx": "^2.1.1",
+    "dayjs": "^1.11.13",
+    "embla-carousel-react": "^7.1.0",
+    "lodash": "^4.17.21",
+    "mantine-datatable": "^7.15.1",
+    "mantine-form-zod-resolver": "^1.1.0",
+    "next": "^15.1.2",
+    "next-runtime-env": "^3.2.2",
+    "react": "^19.0.0",
+    "react-dom": "^19.0.0",
+    "recharts": "^2.15.0",
+    "zod": "^3.24.1",
+    "zustand": "^5.0.2"
+  },
+  "devDependencies": {
+    "@tanstack/eslint-plugin-query": "^5.62.1",
+    "@types/lodash": "^4.17.13",
+    "@types/node": "^22",
+    "@types/react": "^19",
+    "@types/react-dom": "^19",
+    "eslint": "^8",
+    "eslint-config-next": "^15.1.2",
+    "postcss": "^8.4.49",
+    "postcss-preset-mantine": "^1.17.0",
+    "postcss-simple-vars": "^7.0.1",
+    "typescript": "^5"
+  }
+}
diff --git a/frontend/postcss.config.cjs b/frontend/postcss.config.cjs
new file mode 100644
index 00000000..bfba0ddf
--- /dev/null
+++ b/frontend/postcss.config.cjs
@@ -0,0 +1,14 @@
+module.exports = {
+  plugins: {
+    'postcss-preset-mantine': {},
+    'postcss-simple-vars': {
+      variables: {
+        'mantine-breakpoint-xs': '36em',
+        'mantine-breakpoint-sm': '48em',
+        'mantine-breakpoint-md': '62em',
+        'mantine-breakpoint-lg': '75em',
+        'mantine-breakpoint-xl': '88em',
+      },
+    },
+  },
+};
diff --git a/frontend/public/android-chrome-192x192.png b/frontend/public/android-chrome-192x192.png
new file mode 100644
index 00000000..0f9bff61
Binary files /dev/null and b/frontend/public/android-chrome-192x192.png differ
diff --git a/frontend/public/android-chrome-512x512.png b/frontend/public/android-chrome-512x512.png
new file mode 100644
index 00000000..299a6fac
Binary files /dev/null and b/frontend/public/android-chrome-512x512.png differ
diff --git a/frontend/public/apple-touch-icon.png b/frontend/public/apple-touch-icon.png
new file mode 100644
index 00000000..38a5685e
Binary files /dev/null and b/frontend/public/apple-touch-icon.png differ
diff --git a/frontend/public/favicon-16x16.png b/frontend/public/favicon-16x16.png
new file mode 100644
index 00000000..dcc3325e
Binary files /dev/null and b/frontend/public/favicon-16x16.png differ
diff --git a/frontend/public/favicon-32x32.png b/frontend/public/favicon-32x32.png
new file mode 100644
index 00000000..ea98c5d4
Binary files /dev/null and b/frontend/public/favicon-32x32.png differ
diff --git a/frontend/public/favicon.ico b/frontend/public/favicon.ico
new file mode 100644
index 00000000..0e9d5426
Binary files /dev/null and b/frontend/public/favicon.ico differ
diff --git a/frontend/public/images/ganymede-thumbnail.webp b/frontend/public/images/ganymede-thumbnail.webp
new file mode 100644
index 00000000..9c5e65f8
Binary files /dev/null and b/frontend/public/images/ganymede-thumbnail.webp differ
diff --git a/frontend/public/images/ganymede_logo.png b/frontend/public/images/ganymede_logo.png
new file mode 100644
index 00000000..e549c4c9
Binary files /dev/null and b/frontend/public/images/ganymede_logo.png differ
diff --git a/frontend/tsconfig.json b/frontend/tsconfig.json
new file mode 100644
index 00000000..2c145a2d
--- /dev/null
+++ b/frontend/tsconfig.json
@@ -0,0 +1,27 @@
+{
+  "compilerOptions": {
+    "target": "ES2020",
+    "lib": ["dom", "dom.iterable", "esnext"],
+    "allowJs": true,
+    "skipLibCheck": true,
+    "strict": true,
+    "noEmit": true,
+    "esModuleInterop": true,
+    "module": "esnext",
+    "moduleResolution": "bundler",
+    "resolveJsonModule": true,
+    "isolatedModules": true,
+    "jsx": "preserve",
+    "incremental": true,
+    "plugins": [
+      {
+        "name": "next"
+      }
+    ],
+    "paths": {
+      "@/*": ["./*"]
+    }
+  },
+  "include": ["next-env.d.ts", "**/*.ts", "**/*.tsx", ".next/types/**/*.ts"],
+  "exclude": ["node_modules"]
+}
diff --git a/go.mod b/go.mod
index 2e76e494..e8d1c2a1 100644
--- a/go.mod
+++ b/go.mod
@@ -1,98 +1,114 @@
 module github.com/zibbp/ganymede
 
-go 1.22.5
+go 1.23.0
+
+toolchain go1.23.2
 
 require (
-	entgo.io/ent v0.13.1
-	github.com/MicahParks/keyfunc v1.9.0
+	entgo.io/ent v0.14.1
+	github.com/alexedwards/scs/pgxstore v0.0.0-20240316134038-7e11d57e8885
+	github.com/alexedwards/scs/v2 v2.8.0
+	github.com/canidam/echo-scs-session v1.0.0
 	github.com/coreos/go-oidc/v3 v3.11.0
-	github.com/go-co-op/gocron v1.37.0
 	github.com/go-jose/go-jose/v4 v4.0.4
-	github.com/go-playground/validator/v10 v10.22.0
-	github.com/golang-jwt/jwt/v4 v4.5.0
+	github.com/go-playground/validator/v10 v10.23.0
+	github.com/golang-jwt/jwt/v4 v4.5.1
 	github.com/google/uuid v1.6.0
-	github.com/labstack/echo/v4 v4.12.0
+	github.com/labstack/echo/v4 v4.13.3
 	github.com/lib/pq v1.10.9
 	github.com/patrickmn/go-cache v2.1.0+incompatible
-	github.com/prometheus/client_golang v1.20.4
-	github.com/riverqueue/river v0.11.4
-	github.com/riverqueue/river/rivertype v0.11.4
+	github.com/prometheus/client_golang v1.20.5
+	github.com/riverqueue/river v0.14.3
+	github.com/riverqueue/river/rivertype v0.14.3
 	github.com/rs/zerolog v1.33.0
 	github.com/sethvargo/go-envconfig v1.1.0
-	github.com/swaggo/swag v1.16.3
-	github.com/testcontainers/testcontainers-go v0.33.0
-	github.com/testcontainers/testcontainers-go/modules/postgres v0.33.0
-	golang.org/x/crypto v0.26.0
-	golang.org/x/oauth2 v0.23.0
+	github.com/swaggo/swag v1.16.4
+	github.com/testcontainers/testcontainers-go v0.34.0
+	github.com/testcontainers/testcontainers-go/modules/postgres v0.34.0
+	golang.org/x/crypto v0.31.0
+	golang.org/x/oauth2 v0.24.0
+	riverqueue.com/riverui v0.7.0
 )
 
 require (
-	dario.cat/mergo v1.0.0 // indirect
-	github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 // indirect
+	dario.cat/mergo v1.0.1 // indirect
+	github.com/AdaLogics/go-fuzz-headers v0.0.0-20230811130428-ced1acdcaa24 // indirect
+	github.com/Azure/go-ansiterm v0.0.0-20230124172434-306776ec8161 // indirect
 	github.com/KyleBanks/depth v1.2.1 // indirect
 	github.com/Microsoft/go-winio v0.6.2 // indirect
 	github.com/apparentlymart/go-textseg/v15 v15.0.0 // indirect
-	github.com/cenkalti/backoff/v4 v4.2.1 // indirect
-	github.com/containerd/containerd v1.7.18 // indirect
+	github.com/bmatcuk/doublestar v1.3.4 // indirect
+	github.com/cenkalti/backoff/v4 v4.3.0 // indirect
 	github.com/containerd/log v0.1.0 // indirect
 	github.com/containerd/platforms v0.2.1 // indirect
-	github.com/cpuguy83/dockercfg v0.3.1 // indirect
+	github.com/cpuguy83/dockercfg v0.3.2 // indirect
 	github.com/distribution/reference v0.6.0 // indirect
-	github.com/docker/docker v27.1.1+incompatible // indirect
+	github.com/docker/docker v27.4.1+incompatible // indirect
 	github.com/docker/go-connections v0.5.0 // indirect
 	github.com/docker/go-units v0.5.0 // indirect
 	github.com/felixge/httpsnoop v1.0.4 // indirect
-	github.com/gabriel-vasile/mimetype v1.4.4 // indirect
+	github.com/fsnotify/fsnotify v1.4.9 // indirect
+	github.com/gabriel-vasile/mimetype v1.4.7 // indirect
 	github.com/ghodss/yaml v1.0.0 // indirect
-	github.com/go-logr/logr v1.4.1 // indirect
+	github.com/go-logr/logr v1.4.2 // indirect
 	github.com/go-logr/stdr v1.2.2 // indirect
-	github.com/go-ole/go-ole v1.2.6 // indirect
+	github.com/go-ole/go-ole v1.3.0 // indirect
 	github.com/go-openapi/jsonpointer v0.21.0 // indirect
 	github.com/go-openapi/jsonreference v0.21.0 // indirect
 	github.com/go-openapi/spec v0.21.0 // indirect
 	github.com/go-openapi/swag v0.23.0 // indirect
 	github.com/gogo/protobuf v1.3.2 // indirect
+	github.com/jackc/pgerrcode v0.0.0-20240316143900-6e2875d9b438 // indirect
 	github.com/jackc/pgpassfile v1.0.0 // indirect
 	github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761 // indirect
-	github.com/jackc/puddle/v2 v2.2.1 // indirect
+	github.com/jackc/puddle/v2 v2.2.2 // indirect
 	github.com/josharian/intern v1.0.0 // indirect
-	github.com/klauspost/compress v1.17.9 // indirect
-	github.com/lufia/plan9stats v0.0.0-20211012122336-39d0f177ccd0 // indirect
-	github.com/magiconair/properties v1.8.7 // indirect
-	github.com/mailru/easyjson v0.7.7 // indirect
+	github.com/klauspost/compress v1.17.11 // indirect
+	github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 // indirect
+	github.com/magiconair/properties v1.8.9 // indirect
+	github.com/mailru/easyjson v0.9.0 // indirect
+	github.com/mitchellh/copystructure v1.2.0 // indirect
+	github.com/mitchellh/mapstructure v1.5.0 // indirect
+	github.com/mitchellh/reflectwalk v1.0.2 // indirect
 	github.com/moby/docker-image-spec v1.3.1 // indirect
 	github.com/moby/patternmatcher v0.6.0 // indirect
-	github.com/moby/sys/sequential v0.5.0 // indirect
-	github.com/moby/sys/user v0.1.0 // indirect
+	github.com/moby/sys/sequential v0.6.0 // indirect
+	github.com/moby/sys/user v0.3.0 // indirect
+	github.com/moby/sys/userns v0.1.0 // indirect
 	github.com/moby/term v0.5.0 // indirect
 	github.com/morikuni/aec v1.0.0 // indirect
 	github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 // indirect
 	github.com/opencontainers/go-digest v1.0.0 // indirect
 	github.com/opencontainers/image-spec v1.1.0 // indirect
-	github.com/power-devops/perfstat v0.0.0-20210106213030-5aafc221ea8c // indirect
-	github.com/riverqueue/river/riverdriver v0.11.4 // indirect
-	github.com/riverqueue/river/rivershared v0.11.4 // indirect
-	github.com/shirou/gopsutil/v3 v3.23.12 // indirect
+	github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 // indirect
+	github.com/riverqueue/river/riverdriver v0.14.3 // indirect
+	github.com/riverqueue/river/rivershared v0.14.3 // indirect
+	github.com/shirou/gopsutil/v3 v3.24.5 // indirect
 	github.com/shoenig/go-m1cpu v0.1.6 // indirect
 	github.com/sirupsen/logrus v1.9.3 // indirect
-	github.com/stretchr/objx v0.5.2 // indirect
 	github.com/swaggo/files/v2 v2.0.1 // indirect
-	github.com/tklauser/go-sysconf v0.3.12 // indirect
-	github.com/tklauser/numcpus v0.6.1 // indirect
-	github.com/yusufpapurcu/wmi v1.2.3 // indirect
-	go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.49.0 // indirect
-	go.opentelemetry.io/otel v1.24.0 // indirect
-	go.opentelemetry.io/otel/metric v1.24.0 // indirect
-	go.opentelemetry.io/otel/trace v1.24.0 // indirect
-	go.uber.org/atomic v1.11.0 // indirect
+	github.com/tidwall/gjson v1.18.0 // indirect
+	github.com/tidwall/match v1.1.1 // indirect
+	github.com/tidwall/pretty v1.2.1 // indirect
+	github.com/tidwall/sjson v1.2.5 // indirect
+	github.com/tklauser/go-sysconf v0.3.14 // indirect
+	github.com/tklauser/numcpus v0.9.0 // indirect
+	github.com/yusufpapurcu/wmi v1.2.4 // indirect
+	go.opentelemetry.io/auto/sdk v1.1.0 // indirect
+	go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.58.0 // indirect
+	go.opentelemetry.io/otel v1.33.0 // indirect
+	go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.19.0 // indirect
+	go.opentelemetry.io/otel/metric v1.33.0 // indirect
+	go.opentelemetry.io/otel/sdk v1.21.0 // indirect
+	go.opentelemetry.io/otel/trace v1.33.0 // indirect
 	go.uber.org/goleak v1.3.0 // indirect
-	golang.org/x/sync v0.8.0 // indirect
-	golang.org/x/tools v0.23.0 // indirect
+	golang.org/x/sync v0.10.0 // indirect
+	golang.org/x/tools v0.28.0 // indirect
 	gopkg.in/yaml.v2 v2.4.0 // indirect
 )
 
 require (
-	ariga.io/atlas v0.25.0 // indirect
+	ariga.io/atlas v0.29.1 // indirect
 	github.com/agext/levenshtein v1.2.3 // indirect
 	github.com/beorn7/perks v1.0.1 // indirect
 	github.com/cespare/xxhash/v2 v2.3.0 // indirect
@@ -100,11 +116,10 @@ require (
 	github.com/go-openapi/inflect v0.21.0 // indirect
 	github.com/go-playground/locales v0.14.1 // indirect
 	github.com/go-playground/universal-translator v0.18.1 // indirect
-	github.com/golang-jwt/jwt v3.2.2+incompatible // indirect
-	github.com/golang-jwt/jwt/v5 v5.2.1
 	github.com/google/go-cmp v0.6.0 // indirect
-	github.com/hashicorp/hcl/v2 v2.21.0 // indirect
-	github.com/jackc/pgx/v5 v5.7.0
+	github.com/hashicorp/hcl/v2 v2.23.0 // indirect
+	github.com/jackc/pgx/v5 v5.7.2
+	github.com/knadh/koanf v1.5.0
 	github.com/labstack/gommon v0.4.2 // indirect
 	github.com/leodido/go-urn v1.4.0 // indirect
 	github.com/mattn/go-colorable v0.1.13 // indirect
@@ -114,20 +129,20 @@ require (
 	github.com/pkg/errors v0.9.1 // indirect
 	github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 // indirect
 	github.com/prometheus/client_model v0.6.1 // indirect
-	github.com/prometheus/common v0.55.0 // indirect
+	github.com/prometheus/common v0.61.0 // indirect
 	github.com/prometheus/procfs v0.15.1 // indirect
-	github.com/riverqueue/river/riverdriver/riverpgxv5 v0.11.4
+	github.com/riverqueue/river/riverdriver/riverpgxv5 v0.14.3
 	github.com/robfig/cron/v3 v3.0.1
-	github.com/stretchr/testify v1.9.0
+	github.com/stretchr/testify v1.10.0
 	github.com/swaggo/echo-swagger v1.4.1
 	github.com/valyala/bytebufferpool v1.0.0 // indirect
 	github.com/valyala/fasttemplate v1.2.2 // indirect
-	github.com/zclconf/go-cty v1.15.0 // indirect
-	golang.org/x/mod v0.20.0 // indirect
-	golang.org/x/net v0.27.0 // indirect
-	golang.org/x/sys v0.23.0 // indirect
-	golang.org/x/text v0.17.0 // indirect
-	golang.org/x/time v0.5.0 // indirect
-	google.golang.org/protobuf v1.34.2 // indirect
+	github.com/zclconf/go-cty v1.15.1 // indirect
+	golang.org/x/mod v0.22.0 // indirect
+	golang.org/x/net v0.33.0 // indirect
+	golang.org/x/sys v0.28.0 // indirect
+	golang.org/x/text v0.21.0 // indirect
+	golang.org/x/time v0.8.0 // indirect
+	google.golang.org/protobuf v1.36.0 // indirect
 	gopkg.in/yaml.v3 v3.0.1 // indirect
 )
diff --git a/go.sum b/go.sum
index 22c787c9..bc5deebe 100644
--- a/go.sum
+++ b/go.sum
@@ -1,42 +1,79 @@
-ariga.io/atlas v0.25.0 h1:5bGawA2jx4krrhehfUBGSoqb1olC7qEIndzDj3NFSJw=
-ariga.io/atlas v0.25.0/go.mod h1:KPLc7Zj+nzoXfWshrcY1RwlOh94dsATQEy4UPrF2RkM=
-dario.cat/mergo v1.0.0 h1:AGCNq9Evsj31mOgNPcLyXc+4PNABt905YmuqPYYpBWk=
-dario.cat/mergo v1.0.0/go.mod h1:uNxQE+84aUszobStD9th8a29P2fMDhsBdgRYvZOxGmk=
-entgo.io/ent v0.13.1 h1:uD8QwN1h6SNphdCCzmkMN3feSUzNnVvV/WIkHKMbzOE=
-entgo.io/ent v0.13.1/go.mod h1:qCEmo+biw3ccBn9OyL4ZK5dfpwg++l1Gxwac5B1206A=
+ariga.io/atlas v0.29.1 h1:7gB8XRFTnJeZ7ZiccNCJqwBtUv3yjFyxRFDMzu0AmRg=
+ariga.io/atlas v0.29.1/go.mod h1:lkLAw/t2/P7g5CFYlYmHvNuShlmGujwm3OGsW00xowI=
+cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+cloud.google.com/go v0.34.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw=
+dario.cat/mergo v1.0.1 h1:Ra4+bf83h2ztPIQYNP99R6m+Y7KfnARDfID+a+vLl4s=
+dario.cat/mergo v1.0.1/go.mod h1:uNxQE+84aUszobStD9th8a29P2fMDhsBdgRYvZOxGmk=
+entgo.io/ent v0.14.1 h1:fUERL506Pqr92EPHJqr8EYxbPioflJo6PudkrEA8a/s=
+entgo.io/ent v0.14.1/go.mod h1:MH6XLG0KXpkcDQhKiHfANZSzR55TJyPL5IGNpI8wpco=
 github.com/AdaLogics/go-fuzz-headers v0.0.0-20230811130428-ced1acdcaa24 h1:bvDV9vkmnHYOMsOr4WLk+Vo07yKIzd94sVoIqshQ4bU=
 github.com/AdaLogics/go-fuzz-headers v0.0.0-20230811130428-ced1acdcaa24/go.mod h1:8o94RPi1/7XTJvwPpRSzSUedZrtlirdB3r9Z20bi2f8=
-github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1 h1:UQHMgLO+TxOElx5B5HZ4hJQsoJ/PvUvKRhJHDQXO8P8=
-github.com/Azure/go-ansiterm v0.0.0-20210617225240-d185dfc1b5a1/go.mod h1:xomTg63KZ2rFqZQzSB4Vz2SUXa1BpHTVz9L5PTmPC4E=
+github.com/Azure/go-ansiterm v0.0.0-20230124172434-306776ec8161 h1:L/gRVlceqvL25UVaW/CKtUDjefjrs0SPonmDGUVOYP0=
+github.com/Azure/go-ansiterm v0.0.0-20230124172434-306776ec8161/go.mod h1:xomTg63KZ2rFqZQzSB4Vz2SUXa1BpHTVz9L5PTmPC4E=
+github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU=
 github.com/DATA-DOG/go-sqlmock v1.5.0 h1:Shsta01QNfFxHCfpW6YH2STWB0MudeXXEWMr20OEh60=
 github.com/DATA-DOG/go-sqlmock v1.5.0/go.mod h1:f/Ixk793poVmq4qj/V1dPUg2JEAKC73Q5eFN3EC/SaM=
 github.com/KyleBanks/depth v1.2.1 h1:5h8fQADFrWtarTdtDudMmGsC7GPbOAu6RVB3ffsVFHc=
 github.com/KyleBanks/depth v1.2.1/go.mod h1:jzSb9d0L43HxTQfT+oSA1EEp2q+ne2uh6XgeJcm8brE=
-github.com/MicahParks/keyfunc v1.9.0 h1:lhKd5xrFHLNOWrDc4Tyb/Q1AJ4LCzQ48GVJyVIID3+o=
-github.com/MicahParks/keyfunc v1.9.0/go.mod h1:IdnCilugA0O/99dW+/MkvlyrsX8+L8+x95xuVNtM5jw=
 github.com/Microsoft/go-winio v0.6.2 h1:F2VQgta7ecxGYO8k3ZZz3RS8fVIXVxONVUPlNERoyfY=
 github.com/Microsoft/go-winio v0.6.2/go.mod h1:yd8OoFMLzJbo9gZq8j5qaps8bJ9aShtEA8Ipt1oGCvU=
 github.com/agext/levenshtein v1.2.3 h1:YB2fHEn0UJagG8T1rrWknE3ZQzWM06O8AMAatNn7lmo=
 github.com/agext/levenshtein v1.2.3/go.mod h1:JEDfjyjHDjOF/1e4FlBE/PkbqA9OfWu2ki2W0IB5558=
+github.com/alecthomas/template v0.0.0-20160405071501-a0175ee3bccc/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
+github.com/alecthomas/template v0.0.0-20190718012654-fb15b899a751/go.mod h1:LOuyumcjzFXgccqObfd/Ljyb9UuFJ6TxHnclSeseNhc=
+github.com/alecthomas/units v0.0.0-20151022065526-2efee857e7cf/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
+github.com/alecthomas/units v0.0.0-20190717042225-c3de453c63f4/go.mod h1:ybxpYRFXyAe+OPACYpWeL0wqObRcbAqCMya13uyzqw0=
+github.com/alecthomas/units v0.0.0-20190924025748-f65c72e2690d/go.mod h1:rBZYJk541a8SKzHPHnH3zbiI+7dagKZ0cgpgrD7Fyho=
+github.com/alexedwards/scs/pgxstore v0.0.0-20240316134038-7e11d57e8885 h1:I5Z6bSLjKuh99H9JLN35Ep9+GOYp2Cg0Jy+HhykoQf8=
+github.com/alexedwards/scs/pgxstore v0.0.0-20240316134038-7e11d57e8885/go.mod h1:hwveArYcjyOK66EViVgVU5Iqj7zyEsWjKXMQhDJrTLI=
+github.com/alexedwards/scs/v2 v2.8.0 h1:h31yUYoycPuL0zt14c0gd+oqxfRwIj6SOjHdKRZxhEw=
+github.com/alexedwards/scs/v2 v2.8.0/go.mod h1:ToaROZxyKukJKT/xLcVQAChi5k6+Pn1Gvmdl7h3RRj8=
+github.com/antihax/optional v1.0.0/go.mod h1:uupD/76wgC+ih3iEmQUL+0Ugr19nfwCT1kdvxnR2qWY=
 github.com/apparentlymart/go-textseg/v15 v15.0.0 h1:uYvfpb3DyLSCGWnctWKGj857c6ew1u1fNQOlOtuGxQY=
 github.com/apparentlymart/go-textseg/v15 v15.0.0/go.mod h1:K8XmNZdhEBkdlyDdvbmmsvpAG721bKi0joRfFdHIWJ4=
+github.com/armon/circbuf v0.0.0-20150827004946-bbbad097214e/go.mod h1:3U/XgcO3hCbHZ8TKRvWD2dDTCfh9M9ya+I9JpbB7O8o=
+github.com/armon/go-metrics v0.0.0-20180917152333-f0300d1749da/go.mod h1:Q73ZrmVTwzkszR9V5SSuryQ31EELlFMUz1kKyl939pY=
+github.com/armon/go-radix v0.0.0-20180808171621-7fddfc383310/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8=
+github.com/armon/go-radix v1.0.0/go.mod h1:ufUuZ+zHj4x4TnLV4JWEpy2hxWSpsRywHrMgIH9cCH8=
+github.com/aws/aws-sdk-go-v2 v1.9.2/go.mod h1:cK/D0BBs0b/oWPIcX/Z/obahJK1TT7IPVjy53i/mX/4=
+github.com/aws/aws-sdk-go-v2/config v1.8.3/go.mod h1:4AEiLtAb8kLs7vgw2ZV3p2VZ1+hBavOc84hqxVNpCyw=
+github.com/aws/aws-sdk-go-v2/credentials v1.4.3/go.mod h1:FNNC6nQZQUuyhq5aE5c7ata8o9e4ECGmS4lAXC7o1mQ=
+github.com/aws/aws-sdk-go-v2/feature/ec2/imds v1.6.0/go.mod h1:gqlclDEZp4aqJOancXK6TN24aKhT0W0Ae9MHk3wzTMM=
+github.com/aws/aws-sdk-go-v2/internal/ini v1.2.4/go.mod h1:ZcBrrI3zBKlhGFNYWvju0I3TR93I7YIgAfy82Fh4lcQ=
+github.com/aws/aws-sdk-go-v2/service/appconfig v1.4.2/go.mod h1:FZ3HkCe+b10uFZZkFdvf98LHW21k49W8o8J366lqVKY=
+github.com/aws/aws-sdk-go-v2/service/internal/presigned-url v1.3.2/go.mod h1:72HRZDLMtmVQiLG2tLfQcaWLCssELvGl+Zf2WVxMmR8=
+github.com/aws/aws-sdk-go-v2/service/sso v1.4.2/go.mod h1:NBvT9R1MEF+Ud6ApJKM0G+IkPchKS7p7c2YPKwHmBOk=
+github.com/aws/aws-sdk-go-v2/service/sts v1.7.2/go.mod h1:8EzeIqfWt2wWT4rJVu3f21TfrhJ8AEMzVybRNSb/b4g=
+github.com/aws/smithy-go v1.8.0/go.mod h1:SObp3lf9smib00L/v3U2eAKG8FyQ7iLrJnQiAmR5n+E=
+github.com/beorn7/perks v0.0.0-20180321164747-3a771d992973/go.mod h1:Dwedo/Wpr24TaqPxmxbtue+5NUziq4I4S80YR8gNf3Q=
+github.com/beorn7/perks v1.0.0/go.mod h1:KWe93zE9D1o94FZ5RNwFwVgaQK1VOXiVxmqh+CedLV8=
 github.com/beorn7/perks v1.0.1 h1:VlbKKnNfV8bJzeqoa4cOKqO6bYr3WgKZxO8Z16+hsOM=
 github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw=
-github.com/cenkalti/backoff/v4 v4.2.1 h1:y4OZtCnogmCPw98Zjyt5a6+QwPLGkiQsYW5oUqylYbM=
-github.com/cenkalti/backoff/v4 v4.2.1/go.mod h1:Y3VNntkOUPxTVeUxJ/G5vcM//AlwfmyYozVcomhLiZE=
+github.com/bgentry/speakeasy v0.1.0/go.mod h1:+zsyZBPWlz7T6j88CTgSN5bM796AkVf0kBD4zp0CCIs=
+github.com/bmatcuk/doublestar v1.3.4 h1:gPypJ5xD31uhX6Tf54sDPUOBXTqKH4c9aPY66CyQrS0=
+github.com/bmatcuk/doublestar v1.3.4/go.mod h1:wiQtGV+rzVYxB7WIlirSN++5HPtPlXEo9MEoZQC/PmE=
+github.com/canidam/echo-scs-session v1.0.0 h1:ubWTgxTQJwJjxNcvVzVlHk0x5Wd7+AeoGyT2+iYXiZE=
+github.com/canidam/echo-scs-session v1.0.0/go.mod h1:6JEctnOSWsw2G2yEOZy+/jYDquP06yVCjNx3YBaZXVA=
+github.com/cenkalti/backoff/v4 v4.3.0 h1:MyRJ/UdXutAwSAT+s3wNd7MfTIcy71VQueUuFK343L8=
+github.com/cenkalti/backoff/v4 v4.3.0/go.mod h1:Y3VNntkOUPxTVeUxJ/G5vcM//AlwfmyYozVcomhLiZE=
+github.com/census-instrumentation/opencensus-proto v0.2.1/go.mod h1:f6KPmirojxKA12rnyqOA5BBL4O983OfeGPqjHWSTneU=
+github.com/cespare/xxhash/v2 v2.1.1/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
 github.com/cespare/xxhash/v2 v2.3.0 h1:UL815xU9SqsFlibzuggzjXhog7bL6oX9BbNZnL2UFvs=
 github.com/cespare/xxhash/v2 v2.3.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs=
-github.com/containerd/containerd v1.7.18 h1:jqjZTQNfXGoEaZdW1WwPU0RqSn1Bm2Ay/KJPUuO8nao=
-github.com/containerd/containerd v1.7.18/go.mod h1:IYEk9/IO6wAPUz2bCMVUbsfXjzw5UNP5fLz4PsUygQ4=
+github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw=
+github.com/cncf/udpa/go v0.0.0-20191209042840-269d4d468f6f/go.mod h1:M8M6+tZqaGXZJjfX53e64911xZQV5JYwmTeXPW+k8Sc=
+github.com/cncf/udpa/go v0.0.0-20201120205902-5459f2c99403/go.mod h1:WmhPx2Nbnhtbo57+VJT5O0JRkEi1Wbu0z5j0R8u5Hbk=
 github.com/containerd/log v0.1.0 h1:TCJt7ioM2cr/tfR8GPbGf9/VRAX8D2B4PjzCpfX540I=
 github.com/containerd/log v0.1.0/go.mod h1:VRRf09a7mHDIRezVKTRCrOq78v577GXq3bSa3EhrzVo=
 github.com/containerd/platforms v0.2.1 h1:zvwtM3rz2YHPQsF2CHYM8+KtB5dvhISiXh5ZpSBQv6A=
 github.com/containerd/platforms v0.2.1/go.mod h1:XHCb+2/hzowdiut9rkudds9bE5yJ7npe7dG/wG+uFPw=
 github.com/coreos/go-oidc/v3 v3.11.0 h1:Ia3MxdwpSw702YW0xgfmP1GVCMA9aEFWu12XUZ3/OtI=
 github.com/coreos/go-oidc/v3 v3.11.0/go.mod h1:gE3LgjOgFoHi9a4ce4/tJczr0Ai2/BoDhf0r5lltWI0=
+github.com/coreos/go-semver v0.3.0/go.mod h1:nnelYz7RCh+5ahJtPPxZlU+153eP4D4r3EedlOD2RNk=
+github.com/coreos/go-systemd/v22 v22.3.2/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc=
 github.com/coreos/go-systemd/v22 v22.5.0/go.mod h1:Y58oyj3AT4RCenI/lSvhwexgC+NSVTIJ3seZv2GcEnc=
-github.com/cpuguy83/dockercfg v0.3.1 h1:/FpZ+JaygUR/lZP2NlFI2DVfrOEMAIKP5wWEJdoYe9E=
-github.com/cpuguy83/dockercfg v0.3.1/go.mod h1:sugsbF4//dDlL/i+S+rtpIWp+5h0BHJHfjj5/jFyUJc=
+github.com/cpuguy83/dockercfg v0.3.2 h1:DlJTyZGBDlXqUZ2Dk2Q3xHs/FtnooJJVaad2S9GKorA=
+github.com/cpuguy83/dockercfg v0.3.2/go.mod h1:sugsbF4//dDlL/i+S+rtpIWp+5h0BHJHfjj5/jFyUJc=
 github.com/creack/pty v1.1.9/go.mod h1:oKZEueFk5CKHvIhNR5MUki03XCEU+Q6VDXinZuGJ33E=
 github.com/creack/pty v1.1.18 h1:n56/Zwd5o6whRC5PMGretI4IdRLlmBXYNjScPaBgsbY=
 github.com/creack/pty v1.1.18/go.mod h1:MOBLtS5ELjhRRrroQr9kyvTxUAFNvYEK993ew/Vr4O4=
@@ -46,29 +83,46 @@ github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc h1:U9qPSI2PIWSS1
 github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38=
 github.com/distribution/reference v0.6.0 h1:0IXCQ5g4/QMHHkarYzh5l+u8T3t73zM5QvfrDyIgxBk=
 github.com/distribution/reference v0.6.0/go.mod h1:BbU0aIcezP1/5jX/8MP0YiH4SdvB5Y4f/wlDRiLyi3E=
-github.com/docker/docker v27.1.1+incompatible h1:hO/M4MtV36kzKldqnA37IWhebRA+LnqqcqDja6kVaKY=
-github.com/docker/docker v27.1.1+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
+github.com/docker/docker v27.4.1+incompatible h1:ZJvcY7gfwHn1JF48PfbyXg7Jyt9ZCWDW+GGXOIxEwp4=
+github.com/docker/docker v27.4.1+incompatible/go.mod h1:eEKB0N0r5NX/I1kEveEz05bcu8tLC/8azJZsviup8Sk=
 github.com/docker/go-connections v0.5.0 h1:USnMq7hx7gwdVZq1L49hLXaFtUdTADjXGp+uj1Br63c=
 github.com/docker/go-connections v0.5.0/go.mod h1:ov60Kzw0kKElRwhNs9UlUHAE/F9Fe6GLaXnqyDdmEXc=
 github.com/docker/go-units v0.5.0 h1:69rxXcBk27SvSaaxTtLh/8llcHD8vYHT7WSdRZ/jvr4=
 github.com/docker/go-units v0.5.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk=
+github.com/dustin/go-humanize v1.0.0/go.mod h1:HtrtbFcZ19U5GC7JDqmcUSB87Iq5E25KnS6fMYU6eOk=
+github.com/envoyproxy/go-control-plane v0.9.0/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.1-0.20191026205805-5f8ba28d4473/go.mod h1:YTl/9mNaCwkRvm6d1a2C3ymFceY/DCBVvsKhRF0iEA4=
+github.com/envoyproxy/go-control-plane v0.9.4/go.mod h1:6rpuAdCZL397s3pYoYcLgu1mIlRU8Am5FuJP05cCM98=
+github.com/envoyproxy/go-control-plane v0.9.9-0.20210217033140-668b12f5399d/go.mod h1:cXg6YxExXjJnVBQHBLXeUAgxn2UodCpnH306RInaBQk=
+github.com/envoyproxy/protoc-gen-validate v0.1.0/go.mod h1:iSmxcyjqTsJpI2R4NaDN7+kN2VEUnK/pcBlmesArF7c=
+github.com/fatih/color v1.7.0/go.mod h1:Zm6kSWBoL9eyXnKyktHP6abPY2pDugNf5KwzbycvMj4=
+github.com/fatih/color v1.9.0/go.mod h1:eQcE1qtQxscV5RaZvpXrrb8Drkc3/DdQ+uUYCNjL+zU=
+github.com/fatih/structs v1.1.0/go.mod h1:9NiDSp5zOcgEDl+j00MP/WkGVPOlPRLejGD8Ga6PJ7M=
 github.com/felixge/httpsnoop v1.0.4 h1:NFTV2Zj1bL4mc9sqWACXbQFVBBg2W3GPvqp8/ESS2Wg=
 github.com/felixge/httpsnoop v1.0.4/go.mod h1:m8KPJKqk1gH5J9DgRY2ASl2lWCfGKXixSwevea8zH2U=
-github.com/gabriel-vasile/mimetype v1.4.4 h1:QjV6pZ7/XZ7ryI2KuyeEDE8wnh7fHP9YnQy+R0LnH8I=
-github.com/gabriel-vasile/mimetype v1.4.4/go.mod h1:JwLei5XPtWdGiMFB5Pjle1oEeoSeEuJfJE+TtfvdB/s=
+github.com/fsnotify/fsnotify v1.4.9 h1:hsms1Qyu0jgnwNXIxa+/V/PDsU6CfLf6CNO8H7IWoS4=
+github.com/fsnotify/fsnotify v1.4.9/go.mod h1:znqG4EE+3YCdAaPaxE2ZRY/06pZUdp0tY4IgpuI1SZQ=
+github.com/gabriel-vasile/mimetype v1.4.7 h1:SKFKl7kD0RiPdbht0s7hFtjl489WcQ1VyPW8ZzUMYCA=
+github.com/gabriel-vasile/mimetype v1.4.7/go.mod h1:GDlAgAyIRT27BhFl53XNAFtfjzOkLaF35JdEG0P7LtU=
 github.com/ghodss/yaml v1.0.0 h1:wQHKEahhL6wmXdzwWG11gIVCkOv05bNOh+Rxn0yngAk=
 github.com/ghodss/yaml v1.0.0/go.mod h1:4dBDuWmgqj2HViK6kFavaiC9ZROes6MMH2rRYeMEF04=
-github.com/go-co-op/gocron v1.37.0 h1:ZYDJGtQ4OMhTLKOKMIch+/CY70Brbb1dGdooLEhh7b0=
-github.com/go-co-op/gocron v1.37.0/go.mod h1:3L/n6BkO7ABj+TrfSVXLRzsP26zmikL4ISkLQ0O8iNY=
 github.com/go-jose/go-jose/v4 v4.0.4 h1:VsjPI33J0SB9vQM6PLmNjoHqMQNGPiZ0rHL7Ni7Q6/E=
 github.com/go-jose/go-jose/v4 v4.0.4/go.mod h1:NKb5HO1EZccyMpiZNbdUw/14tiXNyUJh188dfnMCAfc=
+github.com/go-kit/kit v0.8.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
+github.com/go-kit/kit v0.9.0/go.mod h1:xBxKIO96dXMWWy0MnWVtmwkA9/13aqxPnvrjFYMA2as=
+github.com/go-kit/log v0.1.0/go.mod h1:zbhenjAZHb184qTLMA9ZjW7ThYL0H2mk7Q6pNt4vbaY=
+github.com/go-ldap/ldap v3.0.2+incompatible/go.mod h1:qfd9rJvER9Q0/D/Sqn1DfHRoBp40uXYvFoEVrNEPqRc=
+github.com/go-logfmt/logfmt v0.3.0/go.mod h1:Qt1PoO58o5twSAckw1HlFXLmHsOX5/0LbT9GBnD5lWE=
+github.com/go-logfmt/logfmt v0.4.0/go.mod h1:3RMwSq7FuexP4Kalkev3ejPJsZTpXXBr9+V4qmtdjCk=
+github.com/go-logfmt/logfmt v0.5.0/go.mod h1:wCYkCAKZfumFQihp8CzCvQ3paCTfi41vtzG1KdI/P7A=
 github.com/go-logr/logr v1.2.2/go.mod h1:jdQByPbusPIv2/zmleS9BjJVeZ6kBagPoEUsqbVz/1A=
-github.com/go-logr/logr v1.4.1 h1:pKouT5E8xu9zeFC39JXRDukb6JFQPXM5p5I91188VAQ=
-github.com/go-logr/logr v1.4.1/go.mod h1:9T104GzyrTigFIr8wt5mBrctHMim0Nb2HLGrmQ40KvY=
+github.com/go-logr/logr v1.4.2 h1:6pFjapn8bFcIbiKo3XT4j/BhANplGihG6tvd+8rYgrY=
+github.com/go-logr/logr v1.4.2/go.mod h1:9T104GzyrTigFIr8wt5mBrctHMim0Nb2HLGrmQ40KvY=
 github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag=
 github.com/go-logr/stdr v1.2.2/go.mod h1:mMo/vtBO5dYbehREoey6XUKy/eSumjCCveDpRre4VKE=
-github.com/go-ole/go-ole v1.2.6 h1:/Fpf6oFPoeFik9ty7siob0G6Ke8QvQEuVcuChpwXzpY=
 github.com/go-ole/go-ole v1.2.6/go.mod h1:pprOEPIfldk/42T2oK7lQ4v4JSDwmV0As9GaiUsvbm0=
+github.com/go-ole/go-ole v1.3.0 h1:Dt6ye7+vXGIKZ7Xtk4s6/xVdGDQynvom7xCFEdWr6uE=
+github.com/go-ole/go-ole v1.3.0/go.mod h1:5LS6F96DhAwUc7C+1HLexzMXY1xGRSryjyPPKW6zv78=
 github.com/go-openapi/inflect v0.21.0 h1:FoBjBTQEcbg2cJUWX6uwL9OyIW8eqc9k4KhN4lfbeYk=
 github.com/go-openapi/inflect v0.21.0/go.mod h1:INezMuUu7SJQc2AyR3WO0DqqYUJSj8Kb4hBd7WtjlAw=
 github.com/go-openapi/jsonpointer v0.21.0 h1:YgdVicSA9vH5RiHs9TZW5oyafXZFc6+2Vc1rr/O9oNQ=
@@ -85,48 +139,130 @@ github.com/go-playground/locales v0.14.1 h1:EWaQ/wswjilfKLTECiXz7Rh+3BjFhfDFKv/o
 github.com/go-playground/locales v0.14.1/go.mod h1:hxrqLVvrK65+Rwrd5Fc6F2O76J/NuW9t0sjnWqG1slY=
 github.com/go-playground/universal-translator v0.18.1 h1:Bcnm0ZwsGyWbCzImXv+pAJnYK9S473LQFuzCbDbfSFY=
 github.com/go-playground/universal-translator v0.18.1/go.mod h1:xekY+UJKNuX9WP91TpwSH2VMlDf28Uj24BCp08ZFTUY=
-github.com/go-playground/validator/v10 v10.22.0 h1:k6HsTZ0sTnROkhS//R0O+55JgM8C4Bx7ia+JlgcnOao=
-github.com/go-playground/validator/v10 v10.22.0/go.mod h1:dbuPbCMFw/DrkbEynArYaCwl3amGuJotoKCe95atGMM=
+github.com/go-playground/validator/v10 v10.23.0 h1:/PwmTwZhS0dPkav3cdK9kV1FsAmrL8sThn8IHr/sO+o=
+github.com/go-playground/validator/v10 v10.23.0/go.mod h1:dbuPbCMFw/DrkbEynArYaCwl3amGuJotoKCe95atGMM=
+github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY=
+github.com/go-test/deep v1.0.2-0.20181118220953-042da051cf31/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA=
 github.com/go-test/deep v1.0.3 h1:ZrJSEWsXzPOxaZnFteGEfooLba+ju3FYIbOrS+rQd68=
 github.com/go-test/deep v1.0.3/go.mod h1:wGDj63lr65AM2AQyKZd/NYHGb0R+1RLqB8NKt3aSFNA=
 github.com/godbus/dbus/v5 v5.0.4/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA=
+github.com/gogo/protobuf v1.1.1/go.mod h1:r8qH/GZQm5c6nD/R0oafs1akxWv10x8SbQlK7atdtwQ=
 github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q=
 github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q=
 github.com/golang-jwt/jwt v3.2.2+incompatible h1:IfV12K8xAKAnZqdXVzCZ+TOjboZ2keLg81eXfW3O+oY=
-github.com/golang-jwt/jwt v3.2.2+incompatible/go.mod h1:8pz2t5EyA70fFQQSrl6XZXzqecmYZeUEB8OUGHkxJ+I=
-github.com/golang-jwt/jwt/v4 v4.4.2/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0=
-github.com/golang-jwt/jwt/v4 v4.5.0 h1:7cYmW1XlMY7h7ii7UhUyChSgS5wUJEnm9uZVTGqOWzg=
-github.com/golang-jwt/jwt/v4 v4.5.0/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0=
-github.com/golang-jwt/jwt/v5 v5.2.1 h1:OuVbFODueb089Lh128TAcimifWaLhJwVflnrgM17wHk=
-github.com/golang-jwt/jwt/v5 v5.2.1/go.mod h1:pqrtFR0X4osieyHYxtmOUWsAWrfe1Q5UVIyoH402zdk=
+github.com/golang-jwt/jwt/v4 v4.5.1 h1:JdqV9zKUdtaa9gdPlywC3aeoEsR681PlKC+4F5gQgeo=
+github.com/golang-jwt/jwt/v4 v4.5.1/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0=
+github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q=
+github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A=
+github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U=
+github.com/golang/protobuf v1.3.3/go.mod h1:vzj43D7+SQXF/4pzW/hwtAqwc6iTitCiVSaWz5lYuqw=
+github.com/golang/protobuf v1.4.0-rc.1/go.mod h1:ceaxUfeHdC40wWswd/P6IGgMaK3YpKi5j83Wpe3EHw8=
+github.com/golang/protobuf v1.4.0-rc.1.0.20200221234624-67d41d38c208/go.mod h1:xKAWHe0F5eneWXFV3EuXVDTCmh+JuBKY0li0aMyXATA=
+github.com/golang/protobuf v1.4.0-rc.2/go.mod h1:LlEzMj4AhA7rCAGe4KMBDvJI+AwstrUpVNzEA03Pprs=
+github.com/golang/protobuf v1.4.0-rc.4.0.20200313231945-b860323f09d0/go.mod h1:WU3c8KckQ9AFe+yFwt9sWVRKCVIyN9cPHBJSNnbL67w=
+github.com/golang/protobuf v1.4.0/go.mod h1:jodUvKwWbYaEsadDk5Fwe5c77LiNKVO9IDvqG2KuDX0=
+github.com/golang/protobuf v1.4.1/go.mod h1:U8fpvMrcmy5pZrNK1lt4xCsGvpyWQ/VVv6QDs8UjoX8=
+github.com/golang/protobuf v1.4.2/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.4.3/go.mod h1:oDoupMAO8OvCJWAcko0GGGIgR6R6ocIYbsSw735rRwI=
+github.com/golang/protobuf v1.5.0/go.mod h1:FsONVRAS9T7sI+LIUmWTfcYkHO4aIWwzhcaSAoJOfIk=
+github.com/golang/protobuf v1.5.2/go.mod h1:XVQd3VNwM+JqD3oG2Ue2ip4fOMUkwXdXDdiuN0vRsmY=
+github.com/golang/snappy v0.0.1/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q=
+github.com/google/btree v0.0.0-20180813153112-4030bb1f1f0c/go.mod h1:lNA+9X1NB3Zf8V7Ke586lFgjr2dZNuvo3lPJSGZ5JPQ=
+github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M=
+github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.3.1/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU=
+github.com/google/go-cmp v0.4.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.0/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
+github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
 github.com/google/go-cmp v0.5.6/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE=
-github.com/google/go-cmp v0.5.9/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY=
+github.com/google/go-cmp v0.5.7/go.mod h1:n+brtR0CgQNWTVd5ZUFpTBC8YFBDLK/h/bpaJ8/DtOE=
 github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI=
 github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY=
-github.com/google/uuid v1.4.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/google/gofuzz v1.0.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg=
+github.com/google/uuid v1.1.2/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
 github.com/google/uuid v1.6.0 h1:NIvaJDMOsjHA8n1jAhLSgzrAzy1Hgr+hNrb57e+94F0=
 github.com/google/uuid v1.6.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo=
+github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0/go.mod h1:8NvIoxWQoOIhqOTXgfV/d3M/q6VIi02HzZEHgUlZvzk=
+github.com/grpc-ecosystem/grpc-gateway v1.16.0/go.mod h1:BDjrQk3hbvj6Nolgz8mAMFbcEtjT1g+wF4CSlocrBnw=
 github.com/grpc-ecosystem/grpc-gateway/v2 v2.16.0 h1:YBftPWNWd4WwGqtY2yeZL2ef8rHAxPBD8KFhJpmcqms=
 github.com/grpc-ecosystem/grpc-gateway/v2 v2.16.0/go.mod h1:YN5jB8ie0yfIUg6VvR9Kz84aCaG7AsGZnLjhHbUqwPg=
-github.com/hashicorp/hcl/v2 v2.21.0 h1:lve4q/o/2rqwYOgUg3y3V2YPyD1/zkCLGjIV74Jit14=
-github.com/hashicorp/hcl/v2 v2.21.0/go.mod h1:62ZYHrXgPoX8xBnzl8QzbWq4dyDsDtfCRgIq1rbJEvA=
-github.com/jackc/pgerrcode v0.0.0-20220416144525-469b46aa5efa h1:s+4MhCQ6YrzisK6hFJUX53drDT4UsSW3DEhKn0ifuHw=
-github.com/jackc/pgerrcode v0.0.0-20220416144525-469b46aa5efa/go.mod h1:a/s9Lp5W7n/DD0VrVoyJ00FbP2ytTPDVOivvn2bMlds=
+github.com/hashicorp/consul/api v1.13.0/go.mod h1:ZlVrynguJKcYr54zGaDbaL3fOvKC9m72FhPvA8T35KQ=
+github.com/hashicorp/consul/sdk v0.8.0/go.mod h1:GBvyrGALthsZObzUGsfgHZQDXjg4lOjagTIwIR1vPms=
+github.com/hashicorp/errwrap v1.0.0/go.mod h1:YH+1FKiLXxHSkmPseP+kNlulaMuP3n2brvKWEqk/Jc4=
+github.com/hashicorp/go-cleanhttp v0.5.0/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80=
+github.com/hashicorp/go-cleanhttp v0.5.1/go.mod h1:JpRdi6/HCYpAwUzNwuwqhbovhLtngrth3wmdIIUrZ80=
+github.com/hashicorp/go-hclog v0.0.0-20180709165350-ff2cf002a8dd/go.mod h1:9bjs9uLqI8l75knNv3lV1kA55veR+WUPSiKIWcQHudI=
+github.com/hashicorp/go-hclog v0.8.0/go.mod h1:5CU+agLiy3J7N7QjHK5d05KxGsuXiQLrjA0H7acj2lQ=
+github.com/hashicorp/go-hclog v0.12.0/go.mod h1:whpDNt7SSdeAju8AWKIWsul05p54N/39EeqMAyrmvFQ=
+github.com/hashicorp/go-immutable-radix v1.0.0/go.mod h1:0y9vanUI8NX6FsYoO3zeMjhV/C5i9g4Q3DwcSNZ4P60=
+github.com/hashicorp/go-msgpack v0.5.3/go.mod h1:ahLV/dePpqEmjfWmKiqvPkv/twdG7iPBM1vqhUKIvfM=
+github.com/hashicorp/go-multierror v1.0.0/go.mod h1:dHtQlpGsu+cZNNAkkCN/P3hoUDHhCYQXV3UM06sGGrk=
+github.com/hashicorp/go-multierror v1.1.0/go.mod h1:spPvp8C1qA32ftKqdAHm4hHTbPw+vmowP0z+KUhOZdA=
+github.com/hashicorp/go-plugin v1.0.1/go.mod h1:++UyYGoz3o5w9ZzAdZxtQKrWWP+iqPBn3cQptSMzBuY=
+github.com/hashicorp/go-retryablehttp v0.5.4/go.mod h1:9B5zBasrRhHXnJnui7y6sL7es7NDiJgTc6Er0maI1Xs=
+github.com/hashicorp/go-rootcerts v1.0.1/go.mod h1:pqUvnprVnM5bf7AOirdbb01K4ccR319Vf4pU3K5EGc8=
+github.com/hashicorp/go-rootcerts v1.0.2/go.mod h1:pqUvnprVnM5bf7AOirdbb01K4ccR319Vf4pU3K5EGc8=
+github.com/hashicorp/go-sockaddr v1.0.0/go.mod h1:7Xibr9yA9JjQq1JpNB2Vw7kxv8xerXegt+ozgdvDeDU=
+github.com/hashicorp/go-sockaddr v1.0.2/go.mod h1:rB4wwRAUzs07qva3c5SdrY/NEtAUjGlgmH/UkBUC97A=
+github.com/hashicorp/go-syslog v1.0.0/go.mod h1:qPfqrKkXGihmCqbJM2mZgkZGvKG1dFdvsLplgctolz4=
+github.com/hashicorp/go-uuid v1.0.0/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
+github.com/hashicorp/go-uuid v1.0.1/go.mod h1:6SBZvOh/SIDV7/2o3Jml5SYk/TvGqwFJ/bN7x4byOro=
+github.com/hashicorp/go-version v1.1.0/go.mod h1:fltr4n8CU8Ke44wwGCBoEymUuxUHl09ZGVZPK5anwXA=
+github.com/hashicorp/golang-lru v0.5.0/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8=
+github.com/hashicorp/hcl v1.0.0 h1:0Anlzjpi4vEasTeNFn2mLJgTSwt0+6sfsiTG8qcWGx4=
+github.com/hashicorp/hcl v1.0.0/go.mod h1:E5yfLk+7swimpb2L/Alb/PJmXilQ/rhwaUYs4T20WEQ=
+github.com/hashicorp/hcl/v2 v2.23.0 h1:Fphj1/gCylPxHutVSEOf2fBOh1VE4AuLV7+kbJf3qos=
+github.com/hashicorp/hcl/v2 v2.23.0/go.mod h1:62ZYHrXgPoX8xBnzl8QzbWq4dyDsDtfCRgIq1rbJEvA=
+github.com/hashicorp/logutils v1.0.0/go.mod h1:QIAnNjmIWmVIIkWDTG1z5v++HQmx9WQRO+LraFDTW64=
+github.com/hashicorp/mdns v1.0.4/go.mod h1:mtBihi+LeNXGtG8L9dX59gAEa12BDtBQSp4v/YAJqrc=
+github.com/hashicorp/memberlist v0.3.0/go.mod h1:MS2lj3INKhZjWNqd3N0m3J+Jxf3DAOnAH9VT3Sh9MUE=
+github.com/hashicorp/serf v0.9.6/go.mod h1:TXZNMjZQijwlDvp+r0b63xZ45H7JmCmgg4gpTwn9UV4=
+github.com/hashicorp/vault/api v1.0.4/go.mod h1:gDcqh3WGcR1cpF5AJz/B1UFheUEneMoIospckxBxk6Q=
+github.com/hashicorp/vault/sdk v0.1.13/go.mod h1:B+hVj7TpuQY1Y/GPbCpffmgd+tSEwvhkWnjtSYCaS2M=
+github.com/hashicorp/yamux v0.0.0-20180604194846-3520598351bb/go.mod h1:+NfK9FKeTrX5uv1uIXGdwYDTeHna2qgaIlx54MXqjAM=
+github.com/hashicorp/yamux v0.0.0-20181012175058-2f1d1f20f75d/go.mod h1:+NfK9FKeTrX5uv1uIXGdwYDTeHna2qgaIlx54MXqjAM=
+github.com/hjson/hjson-go/v4 v4.0.0/go.mod h1:KaYt3bTw3zhBjYqnXkYywcYctk0A2nxeEFTse3rH13E=
+github.com/jackc/pgerrcode v0.0.0-20240316143900-6e2875d9b438 h1:Dj0L5fhJ9F82ZJyVOmBx6msDp/kfd1t9GRfny/mfJA0=
+github.com/jackc/pgerrcode v0.0.0-20240316143900-6e2875d9b438/go.mod h1:a/s9Lp5W7n/DD0VrVoyJ00FbP2ytTPDVOivvn2bMlds=
 github.com/jackc/pgpassfile v1.0.0 h1:/6Hmqy13Ss2zCq62VdNG8tM1wchn8zjSGOBJ6icpsIM=
 github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5eyVu/W2HEg=
+github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a/go.mod h1:5TJZWKEWniPve33vlWYSoGYefn3gLQRzjfDlhSJ9ZKM=
 github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761 h1:iCEnooe7UlwOQYpKFhBabPMi4aNAfoODPEFNiAnClxo=
 github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761/go.mod h1:5TJZWKEWniPve33vlWYSoGYefn3gLQRzjfDlhSJ9ZKM=
-github.com/jackc/pgx/v5 v5.7.0 h1:FG6VLIdzvAPhnYqP14sQ2xhFLkiUQHCs6ySqO91kF4g=
-github.com/jackc/pgx/v5 v5.7.0/go.mod h1:awP1KNnjylvpxHuHP63gzjhnGkI1iw+PMoIwvoleN/8=
-github.com/jackc/puddle/v2 v2.2.1 h1:RhxXJtFG022u4ibrCSMSiu5aOq1i77R3OHKNJj77OAk=
+github.com/jackc/pgx/v5 v5.5.4/go.mod h1:ez9gk+OAat140fv9ErkZDYFWmXLfV+++K0uAOiwgm1A=
+github.com/jackc/pgx/v5 v5.7.1 h1:x7SYsPBYDkHDksogeSmZZ5xzThcTgRz++I5E+ePFUcs=
+github.com/jackc/pgx/v5 v5.7.1/go.mod h1:e7O26IywZZ+naJtWWos6i6fvWK+29etgITqrqHLfoZA=
+github.com/jackc/pgx/v5 v5.7.2 h1:mLoDLV6sonKlvjIEsV56SkWNCnuNv531l94GaIzO+XI=
+github.com/jackc/pgx/v5 v5.7.2/go.mod h1:ncY89UGWxg82EykZUwSpUKEfccBGGYq1xjrOpsbsfGQ=
 github.com/jackc/puddle/v2 v2.2.1/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4=
+github.com/jackc/puddle/v2 v2.2.2 h1:PR8nw+E/1w0GLuRFSmiioY6UooMp6KJv0/61nB7icHo=
+github.com/jackc/puddle/v2 v2.2.2/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4=
+github.com/jmespath/go-jmespath v0.4.0/go.mod h1:T8mJZnbsbmF+m6zOOFylbeCJqk5+pHWvzYPziyZiYoo=
+github.com/jmespath/go-jmespath/internal/testify v1.5.1/go.mod h1:L3OGu8Wl2/fWfCI6z80xFu9LTZmf1ZRjMHUOPmWr69U=
+github.com/joho/godotenv v1.3.0/go.mod h1:7hK45KPybAkOC6peb+G5yklZfMxEjkZhHbwpqxOKXbg=
 github.com/josharian/intern v1.0.0 h1:vlS4z54oSdjm0bgjRigI+G1HpF+tI+9rE5LLzOg8HmY=
 github.com/josharian/intern v1.0.0/go.mod h1:5DoeVV0s6jJacbCEi61lwdGj/aVlrQvzHFFd8Hwg//Y=
+github.com/jpillora/backoff v1.0.0/go.mod h1:J/6gKK9jxlEcS3zixgDgUAsiuZ7yrSoa/FX5e0EB2j4=
+github.com/json-iterator/go v1.1.6/go.mod h1:+SdeFBvtyEkXs7REEP0seUULqWtbJapLOCVDaaPEHmU=
+github.com/json-iterator/go v1.1.10/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4=
+github.com/json-iterator/go v1.1.11/go.mod h1:KdQUCv79m/52Kvf8AW2vK1V8akMuk1QjK/uOdHXbAo4=
+github.com/julienschmidt/httprouter v1.2.0/go.mod h1:SYymIcj16QtmaHHD7aYtjjsJG7VTCxuUUipMqKk8s4w=
+github.com/julienschmidt/httprouter v1.3.0/go.mod h1:JR6WtHb+2LUe8TCKY3cZOxFyyO8IZAc4RVcycCCAKdM=
 github.com/kisielk/errcheck v1.5.0/go.mod h1:pFxgyoBC7bSaBwPgfKdkLd5X25qrDl4LWUI2bnpBCr8=
 github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck=
-github.com/klauspost/compress v1.17.9 h1:6KIumPrER1LHsvBVuDa0r5xaG0Es51mhhB9BQB2qeMA=
-github.com/klauspost/compress v1.17.9/go.mod h1:Di0epgTjJY877eYKx5yC51cX2A2Vl2ibi7bDH9ttBbw=
+github.com/klauspost/compress v1.17.11 h1:In6xLpyWOi1+C7tXUUWv2ot1QvBjxevKAaI6IXrJmUc=
+github.com/klauspost/compress v1.17.11/go.mod h1:pMDklpSncoRMuLFrf1W9Ss9KT+0rH90U12bZKk7uwG0=
+github.com/knadh/koanf v1.5.0 h1:q2TSd/3Pyc/5yP9ldIrSdIz26MCcyNQzW0pEAugLPNs=
+github.com/knadh/koanf v1.5.0/go.mod h1:Hgyjp4y8v44hpZtPzs7JZfRAW5AhN7KfZcwv1RYggDs=
+github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
+github.com/konsorten/go-windows-terminal-sequences v1.0.3/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ=
+github.com/kr/logfmt v0.0.0-20140226030751-b84e30acd515/go.mod h1:+0opPa2QZZtGFBFZlji/RkVcI2GknAs/DXo4wKdlNEc=
 github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo=
+github.com/kr/pretty v0.2.0/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
 github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI=
 github.com/kr/pretty v0.3.0/go.mod h1:640gp4NfQd8pI5XOwp5fnNeVWj67G7CFk/SaSQn7NBk=
 github.com/kr/pretty v0.3.1 h1:flRD4NNwYAUpkphVc1HcthR4KEIFJ65n8Mw5qdRn3LE=
@@ -137,238 +273,455 @@ github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY=
 github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE=
 github.com/kylelemons/godebug v1.1.0 h1:RPNrshWIDI6G2gRW9EHilWtl7Z6Sb1BR0xunSBf0SNc=
 github.com/kylelemons/godebug v1.1.0/go.mod h1:9/0rRGxNHcop5bhtWyNeEfOS8JIWk580+fNqagV/RAw=
-github.com/labstack/echo/v4 v4.12.0 h1:IKpw49IMryVB2p1a4dzwlhP1O2Tf2E0Ir/450lH+kI0=
-github.com/labstack/echo/v4 v4.12.0/go.mod h1:UP9Cr2DJXbOK3Kr9ONYzNowSh7HP0aG0ShAyycHSJvM=
+github.com/labstack/echo/v4 v4.13.3 h1:pwhpCPrTl5qry5HRdM5FwdXnhXSLSY+WE+YQSeCaafY=
+github.com/labstack/echo/v4 v4.13.3/go.mod h1:o90YNEeQWjDozo584l7AwhJMHN0bOC4tAfg+Xox9q5g=
 github.com/labstack/gommon v0.4.2 h1:F8qTUNXgG1+6WQmqoUWnz8WiEU60mXVVw0P4ht1WRA0=
 github.com/labstack/gommon v0.4.2/go.mod h1:QlUFxVM+SNXhDL/Z7YhocGIBYOiwB0mXm1+1bAPHPyU=
 github.com/leodido/go-urn v1.4.0 h1:WT9HwE9SGECu3lg4d/dIA+jxlljEa1/ffXKmRjqdmIQ=
 github.com/leodido/go-urn v1.4.0/go.mod h1:bvxc+MVxLKB4z00jd1z+Dvzr47oO32F/QSNjSBOlFxI=
 github.com/lib/pq v1.10.9 h1:YXG7RB+JIjhP29X+OtkiDnYaXQwpS4JEWq7dtCCRUEw=
 github.com/lib/pq v1.10.9/go.mod h1:AlVN5x4E4T544tWzH6hKfbfQvm3HdbOxrmggDNAPY9o=
-github.com/lufia/plan9stats v0.0.0-20211012122336-39d0f177ccd0 h1:6E+4a0GO5zZEnZ81pIr0yLvtUWk2if982qA3F3QD6H4=
-github.com/lufia/plan9stats v0.0.0-20211012122336-39d0f177ccd0/go.mod h1:zJYVVT2jmtg6P3p1VtQj7WsuWi/y4VnjVBn7F8KPB3I=
-github.com/magiconair/properties v1.8.7 h1:IeQXZAiQcpL9mgcAe1Nu6cX9LLw6ExEHKjN0VQdvPDY=
-github.com/magiconair/properties v1.8.7/go.mod h1:Dhd985XPs7jluiymwWYZ0G4Z61jb3vdS329zhj2hYo0=
-github.com/mailru/easyjson v0.7.7 h1:UGYAvKxe3sBsEDzO8ZeWOSlIQfWFlxbzLZe7hwFURr0=
-github.com/mailru/easyjson v0.7.7/go.mod h1:xzfreul335JAWq5oZzymOObrkdz5UnU4kGfJJLY9Nlc=
+github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 h1:7UMa6KCCMjZEMDtTVdcGu0B1GmmC7QJKiCCjyTAWQy0=
+github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683/go.mod h1:ilwx/Dta8jXAgpFYFvSWEMwxmbWXyiUHkd5FwyKhb5k=
+github.com/magiconair/properties v1.8.9 h1:nWcCbLq1N2v/cpNsy5WvQ37Fb+YElfq20WJ/a8RkpQM=
+github.com/magiconair/properties v1.8.9/go.mod h1:Dhd985XPs7jluiymwWYZ0G4Z61jb3vdS329zhj2hYo0=
+github.com/mailru/easyjson v0.9.0 h1:PrnmzHw7262yW8sTBwxi1PdJA3Iw/EKBa8psRf7d9a4=
+github.com/mailru/easyjson v0.9.0/go.mod h1:1+xMtQp2MRNVL/V1bOzuP3aP8VNwRW55fQUto+XFtTU=
+github.com/mattn/go-colorable v0.0.9/go.mod h1:9vuHe8Xs5qXnSaW/c/ABM9alt+Vo+STaOChaDxuIBZU=
+github.com/mattn/go-colorable v0.1.4/go.mod h1:U0ppj6V5qS13XJ6of8GYAs25YV2eR4EVcfRqFIhoBtE=
+github.com/mattn/go-colorable v0.1.6/go.mod h1:u6P/XSegPjTcexA+o6vUJrdnUu04hMope9wVRipJSqc=
 github.com/mattn/go-colorable v0.1.13 h1:fFA4WZxdEF4tXPZVKMLwD8oUnCTTo08duU7wxecdEvA=
 github.com/mattn/go-colorable v0.1.13/go.mod h1:7S9/ev0klgBDR4GtXTXX8a3vIGJpMovkB8vQcUbaXHg=
+github.com/mattn/go-isatty v0.0.3/go.mod h1:M+lRXTBqGeGNdLjl/ufCoiOlB5xdOkqRJdNxMWT7Zi4=
+github.com/mattn/go-isatty v0.0.8/go.mod h1:Iq45c/XA43vh69/j3iqttzPXn0bhXyGjM0Hdxcsrc5s=
+github.com/mattn/go-isatty v0.0.10/go.mod h1:qgIWMr58cqv1PHHyhnkY9lrL7etaEgOFcMEpPG5Rm84=
+github.com/mattn/go-isatty v0.0.11/go.mod h1:PhnuNfih5lzO57/f3n+odYbM4JtupLOxQOAqxQCu2WE=
+github.com/mattn/go-isatty v0.0.12/go.mod h1:cbi8OIDigv2wuxKPP5vlRcQ1OAZbq2CE4Kysco4FUpU=
 github.com/mattn/go-isatty v0.0.16/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM=
 github.com/mattn/go-isatty v0.0.19/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
 github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY=
 github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y=
-github.com/mattn/go-runewidth v0.0.9 h1:Lm995f3rfxdpd6TSmuVCHVb/QhupuXlYr8sCI/QdE+0=
-github.com/mattn/go-runewidth v0.0.9/go.mod h1:H031xJmbD/WCDINGzjvQ9THkh0rPKHF+m2gUSrubnMI=
 github.com/mattn/go-sqlite3 v1.14.22 h1:2gZY6PC6kBnID23Tichd1K+Z0oS6nE/XwU+Vz/5o4kU=
 github.com/mattn/go-sqlite3 v1.14.22/go.mod h1:Uh1q+B4BYcTPb+yiD3kU8Ct7aC0hY9fxUwlHK0RXw+Y=
+github.com/matttproud/golang_protobuf_extensions v1.0.1/go.mod h1:D8He9yQNgCq6Z5Ld7szi9bcBfOoFv/3dc6xSMkL2PC0=
+github.com/miekg/dns v1.1.26/go.mod h1:bPDLeHnStXmXAq1m/Ch/hvfNHr14JKNPMBo3VZKjuso=
+github.com/miekg/dns v1.1.41/go.mod h1:p6aan82bvRIyn+zDIv9xYNUpwa73JcSh9BKwknJysuI=
+github.com/mitchellh/cli v1.0.0/go.mod h1:hNIlj7HEI86fIcpObd7a0FcrxTWetlwJDGcceTlRvqc=
+github.com/mitchellh/cli v1.1.0/go.mod h1:xcISNoH86gajksDmfB23e/pu+B+GeFRMYmoHXxx3xhI=
+github.com/mitchellh/copystructure v1.0.0/go.mod h1:SNtv71yrdKgLRyLFxmLdkAbkKEFWgYaq1OVrnRcwhnw=
+github.com/mitchellh/copystructure v1.2.0 h1:vpKXTN4ewci03Vljg/q9QvCGUDttBOGBIa15WveJJGw=
+github.com/mitchellh/copystructure v1.2.0/go.mod h1:qLl+cE2AmVv+CoeAwDPye/v+N2HKCj9FbZEVFJRxO9s=
+github.com/mitchellh/go-homedir v1.1.0/go.mod h1:SfyaCUpYCn1Vlf4IUYiD9fPX4A5wJrkLzIz1N1q0pr0=
+github.com/mitchellh/go-testing-interface v0.0.0-20171004221916-a61a99592b77/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI=
+github.com/mitchellh/go-testing-interface v1.0.0/go.mod h1:kRemZodwjscx+RGhAo8eIhFbs2+BFgRtFPeD/KE+zxI=
+github.com/mitchellh/go-wordwrap v1.0.0/go.mod h1:ZXFpozHsX6DPmq2I0TCekCxypsnAUbP2oI0UX1GXzOo=
 github.com/mitchellh/go-wordwrap v1.0.1 h1:TLuKupo69TCn6TQSyGxwI1EblZZEsQ0vMlAFQflz0v0=
 github.com/mitchellh/go-wordwrap v1.0.1/go.mod h1:R62XHJLzvMFRBbcrT7m7WgmE1eOyTSsCt+hzestvNj0=
+github.com/mitchellh/mapstructure v0.0.0-20160808181253-ca63d7c062ee/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
+github.com/mitchellh/mapstructure v1.1.2/go.mod h1:FVVH3fgwuzCH5S8UJGiWEs2h04kUh9fWfEaFds41c1Y=
+github.com/mitchellh/mapstructure v1.5.0 h1:jeMsZIYE/09sWLaz43PL7Gy6RuMjD2eJVyuac5Z2hdY=
+github.com/mitchellh/mapstructure v1.5.0/go.mod h1:bFUtVrKA4DC2yAKiSyO/QUcy7e+RRV2QTWOzhPopBRo=
+github.com/mitchellh/reflectwalk v1.0.0/go.mod h1:mSTlrgnPZtwu0c4WaC2kGObEpuNDbx0jmZXqmk4esnw=
+github.com/mitchellh/reflectwalk v1.0.2 h1:G2LzWKi524PWgd3mLHV8Y5k7s6XUvT0Gef6zxSIeXaQ=
+github.com/mitchellh/reflectwalk v1.0.2/go.mod h1:mSTlrgnPZtwu0c4WaC2kGObEpuNDbx0jmZXqmk4esnw=
 github.com/moby/docker-image-spec v1.3.1 h1:jMKff3w6PgbfSa69GfNg+zN/XLhfXJGnEx3Nl2EsFP0=
 github.com/moby/docker-image-spec v1.3.1/go.mod h1:eKmb5VW8vQEh/BAr2yvVNvuiJuY6UIocYsFu/DxxRpo=
 github.com/moby/patternmatcher v0.6.0 h1:GmP9lR19aU5GqSSFko+5pRqHi+Ohk1O69aFiKkVGiPk=
 github.com/moby/patternmatcher v0.6.0/go.mod h1:hDPoyOpDY7OrrMDLaYoY3hf52gNCR/YOUYxkhApJIxc=
-github.com/moby/sys/sequential v0.5.0 h1:OPvI35Lzn9K04PBbCLW0g4LcFAJgHsvXsRyewg5lXtc=
-github.com/moby/sys/sequential v0.5.0/go.mod h1:tH2cOOs5V9MlPiXcQzRC+eEyab644PWKGRYaaV5ZZlo=
-github.com/moby/sys/user v0.1.0 h1:WmZ93f5Ux6het5iituh9x2zAG7NFY9Aqi49jjE1PaQg=
-github.com/moby/sys/user v0.1.0/go.mod h1:fKJhFOnsCN6xZ5gSfbM6zaHGgDJMrqt9/reuj4T7MmU=
+github.com/moby/sys/sequential v0.6.0 h1:qrx7XFUd/5DxtqcoH1h438hF5TmOvzC/lspjy7zgvCU=
+github.com/moby/sys/sequential v0.6.0/go.mod h1:uyv8EUTrca5PnDsdMGXhZe6CCe8U/UiTWd+lL+7b/Ko=
+github.com/moby/sys/user v0.3.0 h1:9ni5DlcW5an3SvRSx4MouotOygvzaXbaSrc/wGDFWPo=
+github.com/moby/sys/user v0.3.0/go.mod h1:bG+tYYYJgaMtRKgEmuueC0hJEAZWwtIbZTB+85uoHjs=
+github.com/moby/sys/userns v0.1.0 h1:tVLXkFOxVu9A64/yh59slHVv9ahO9UIev4JZusOLG/g=
+github.com/moby/sys/userns v0.1.0/go.mod h1:IHUYgu/kao6N8YZlp9Cf444ySSvCmDlmzUcYfDHOl28=
 github.com/moby/term v0.5.0 h1:xt8Q1nalod/v7BqbG21f8mQPqH+xAaC9C3N3wfWbVP0=
 github.com/moby/term v0.5.0/go.mod h1:8FzsFHVUBGZdbDsJw/ot+X+d5HLUbvklYLJ9uGfcI3Y=
+github.com/modern-go/concurrent v0.0.0-20180228061459-e0a39a4cb421/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
+github.com/modern-go/concurrent v0.0.0-20180306012644-bacd9c7ef1dd/go.mod h1:6dJC0mAP4ikYIbvyc7fijjWJddQyLn8Ig3JB5CqoB9Q=
+github.com/modern-go/reflect2 v0.0.0-20180701023420-4b7aa43c6742/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
+github.com/modern-go/reflect2 v1.0.1/go.mod h1:bx2lNnkwVCuqBIxFjflWJWanXIb3RllmbCylyMrvgv0=
 github.com/morikuni/aec v1.0.0 h1:nP9CBfwrvYnBRgY6qfDQkygYDmYwOilePFkwzv4dU8A=
 github.com/morikuni/aec v1.0.0/go.mod h1:BbKIizmSmc5MMPqRYbxO4ZU0S0+P200+tUnFx7PXmsc=
 github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 h1:C3w9PqII01/Oq1c1nUAm88MOHcQC9l5mIlSMApZMrHA=
 github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ=
-github.com/olekukonko/tablewriter v0.0.5 h1:P2Ga83D34wi1o9J6Wh1mRuqd4mF/x/lgBS7N7AbDhec=
-github.com/olekukonko/tablewriter v0.0.5/go.mod h1:hPp6KlRPjbx+hW8ykQs1w3UBbZlj6HuIJcUGPhkA7kY=
+github.com/mwitkow/go-conntrack v0.0.0-20161129095857-cc309e4a2223/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
+github.com/mwitkow/go-conntrack v0.0.0-20190716064945-2f068394615f/go.mod h1:qRWi+5nqEBWmkhHvq77mSJWrCKwh8bxhgT7d/eI7P4U=
+github.com/npillmayer/nestext v0.1.3/go.mod h1:h2lrijH8jpicr25dFY+oAJLyzlya6jhnuG+zWp9L0Uk=
+github.com/oklog/run v1.0.0/go.mod h1:dlhp/R75TPv97u0XWUtDeV/lRKWPKSdTuV0TZvrmrQA=
 github.com/opencontainers/go-digest v1.0.0 h1:apOUWs51W5PlhuyGyz9FCeeBIOUDA/6nW8Oi/yOhh5U=
 github.com/opencontainers/go-digest v1.0.0/go.mod h1:0JzlMkj0TRzQZfJkVvzbP0HBR3IKzErnv2BNG4W4MAM=
 github.com/opencontainers/image-spec v1.1.0 h1:8SG7/vwALn54lVB/0yZ/MMwhFrPYtpEHQb2IpWsCzug=
 github.com/opencontainers/image-spec v1.1.0/go.mod h1:W4s4sFTMaBeK1BQLXbG4AdM2szdn85PY75RI83NrTrM=
+github.com/pascaldekloe/goe v0.0.0-20180627143212-57f6aae5913c/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc=
+github.com/pascaldekloe/goe v0.1.0/go.mod h1:lzWF7FIEvWOWxwDKqyGYQf6ZUaNfKdP144TG7ZOy1lc=
 github.com/patrickmn/go-cache v2.1.0+incompatible h1:HRMgzkcYKYpi3C8ajMPV8OFXaaRUnok+kx1WdO15EQc=
 github.com/patrickmn/go-cache v2.1.0+incompatible/go.mod h1:3Qf8kWWT7OJRJbdiICTKqZju1ZixQ/KpMGzzAfe6+WQ=
-github.com/pkg/diff v0.0.0-20210226163009-20ebb0f2a09e/go.mod h1:pJLUxLENpZxwdsKMEsNbx1VGcRFpLqf3715MtcvvzbA=
+github.com/pelletier/go-toml v1.7.0/go.mod h1:vwGMzjaWMwyfHwgIBhI2YUM4fB6nL6lVAvS1LBMMhTE=
+github.com/pierrec/lz4 v2.0.5+incompatible/go.mod h1:pdkljMzZIN41W+lC3N2tnIh5sFi+IEE17M5jbnwPHcY=
+github.com/pkg/errors v0.8.0/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
+github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
 github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4=
 github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0=
 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
 github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2 h1:Jamvg5psRIccs7FGNTlIRMkT8wgtp5eCXdBlqhYGL6U=
 github.com/pmezard/go-difflib v1.0.1-0.20181226105442-5d4384ee4fb2/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4=
-github.com/power-devops/perfstat v0.0.0-20210106213030-5aafc221ea8c h1:ncq/mPwQF4JjgDlrVEn3C11VoGHZN7m8qihwgMEtzYw=
-github.com/power-devops/perfstat v0.0.0-20210106213030-5aafc221ea8c/go.mod h1:OmDBASR4679mdNQnz2pUhc2G8CO2JrUAVFDRBDP/hJE=
-github.com/prometheus/client_golang v1.20.4 h1:Tgh3Yr67PaOv/uTqloMsCEdeuFTatm5zIq5+qNN23vI=
-github.com/prometheus/client_golang v1.20.4/go.mod h1:PIEt8X02hGcP8JWbeHyeZ53Y/jReSnHgO035n//V5WE=
+github.com/posener/complete v1.1.1/go.mod h1:em0nMJCgc9GFtwrmVmEMR/ZL6WyhyjMBndrE9hABlRI=
+github.com/posener/complete v1.2.3/go.mod h1:WZIdtGGp+qx0sLrYKtIRAruyNpv6hFCicSgv7Sy7s/s=
+github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 h1:o4JXh1EVt9k/+g42oCprj/FisM4qX9L3sZB3upGN2ZU=
+github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55/go.mod h1:OmDBASR4679mdNQnz2pUhc2G8CO2JrUAVFDRBDP/hJE=
+github.com/prometheus/client_golang v0.9.1/go.mod h1:7SWBe2y4D6OKWSNQJUaRYU/AaXPKyh/dDVn+NZz0KFw=
+github.com/prometheus/client_golang v1.0.0/go.mod h1:db9x61etRT2tGnBNRi70OPL5FsnadC4Ky3P0J6CfImo=
+github.com/prometheus/client_golang v1.7.1/go.mod h1:PY5Wy2awLA44sXw4AOSfFBetzPP4j5+D6mVACh+pe2M=
+github.com/prometheus/client_golang v1.11.1/go.mod h1:Z6t4BnS23TR94PD6BsDNk8yVqroYurpAkEiz0P2BEV0=
+github.com/prometheus/client_golang v1.20.5 h1:cxppBPuYhUnsO6yo/aoRol4L7q7UFfdm+bR9r+8l63Y=
+github.com/prometheus/client_golang v1.20.5/go.mod h1:PIEt8X02hGcP8JWbeHyeZ53Y/jReSnHgO035n//V5WE=
+github.com/prometheus/client_model v0.0.0-20180712105110-5c3871d89910/go.mod h1:MbSGuTsp3dbXC40dX6PRTWyKYBIrTGTE9sqQNg2J8bo=
+github.com/prometheus/client_model v0.0.0-20190129233127-fd36f4220a90/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/prometheus/client_model v0.0.0-20190812154241-14fe0d1b01d4/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
+github.com/prometheus/client_model v0.2.0/go.mod h1:xMI15A0UPsDsEKsMN9yxemIoYk6Tm2C1GtYGdfGttqA=
 github.com/prometheus/client_model v0.6.1 h1:ZKSh/rekM+n3CeS952MLRAdFwIKqeY8b62p8ais2e9E=
 github.com/prometheus/client_model v0.6.1/go.mod h1:OrxVMOVHjw3lKMa8+x6HeMGkHMQyHDk9E3jmP2AmGiY=
-github.com/prometheus/common v0.55.0 h1:KEi6DK7lXW/m7Ig5i47x0vRzuBsHuvJdi5ee6Y3G1dc=
-github.com/prometheus/common v0.55.0/go.mod h1:2SECS4xJG1kd8XF9IcM1gMX6510RAEL65zxzNImwdc8=
+github.com/prometheus/common v0.4.1/go.mod h1:TNfzLD0ON7rHzMJeJkieUDPYmFC7Snx/y86RQel1bk4=
+github.com/prometheus/common v0.10.0/go.mod h1:Tlit/dnDKsSWFlCLTWaA1cyBgKHSMdTB80sz/V91rCo=
+github.com/prometheus/common v0.26.0/go.mod h1:M7rCNAaPfAosfx8veZJCuw84e35h3Cfd9VFqTh1DIvc=
+github.com/prometheus/common v0.61.0 h1:3gv/GThfX0cV2lpO7gkTUwZru38mxevy90Bj8YFSRQQ=
+github.com/prometheus/common v0.61.0/go.mod h1:zr29OCN/2BsJRaFwG8QOBr41D6kkchKbpeNH7pAjb/s=
+github.com/prometheus/procfs v0.0.0-20181005140218-185b4288413d/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk=
+github.com/prometheus/procfs v0.0.2/go.mod h1:TjEm7ze935MbeOT/UhFTIMYKhuLP4wbCsTZCD3I8kEA=
+github.com/prometheus/procfs v0.1.3/go.mod h1:lV6e/gmhEcM9IjHGsFOCxxuZ+z1YqCvr4OA4YeYWdaU=
+github.com/prometheus/procfs v0.6.0/go.mod h1:cz+aTbrPOrUb4q7XlbU9ygM+/jj0fzG6c1xBZuNvfVA=
 github.com/prometheus/procfs v0.15.1 h1:YagwOFzUgYfKKHX6Dr+sHT7km/hxC76UB0learggepc=
 github.com/prometheus/procfs v0.15.1/go.mod h1:fB45yRUv8NstnjriLhBQLuOUt+WW4BsoGhij/e3PBqk=
-github.com/riverqueue/river v0.11.4 h1:NMRsODhRgFztf080RMCjI377jldLXsx41E2r7+c0lPE=
-github.com/riverqueue/river v0.11.4/go.mod h1:HvgBkqon7lYKm9Su4lVOnn1qx8Q4FnSMJjf5auVial4=
-github.com/riverqueue/river/riverdriver v0.11.4 h1:kBg68vfTnRuSwsgcZ7UbKC4ocZ+KSCGnuZw/GwMMMP4=
-github.com/riverqueue/river/riverdriver v0.11.4/go.mod h1:+NxTrldRYYsdTbZSxX7L2LuWU/B0IAtAActDJcNbcPs=
-github.com/riverqueue/river/riverdriver/riverdatabasesql v0.11.4 h1:QBegZQrB59dafWaiNphJC85KTA0CmeGYcpCqu52qbnI=
-github.com/riverqueue/river/riverdriver/riverdatabasesql v0.11.4/go.mod h1:CQC2a/+GRtN6b67IA7jFCvcCtOBWRz3lWqyNxDggKSM=
-github.com/riverqueue/river/riverdriver/riverpgxv5 v0.11.4 h1:rRY8WabllXRsLp8U+gxUpYgTgI8dveF3UWnZJu965Lg=
-github.com/riverqueue/river/riverdriver/riverpgxv5 v0.11.4/go.mod h1:GgWsTnC7V7lanQLyj8W1UuYuzyDoJZc4bhhDomtYr30=
-github.com/riverqueue/river/rivershared v0.11.4 h1:XGfzJKG7hhwd0MwImF/4r+t6F9aq2Q7e6NNYifStnus=
-github.com/riverqueue/river/rivershared v0.11.4/go.mod h1:vZc9tRvSZ9spLqcz9UUuKbZGuDRwBhS3LuzLY7d/jkw=
-github.com/riverqueue/river/rivertype v0.11.4 h1:TAdi4CQEYukveYneAqm5LupRVZjvSfB8tL3xKR13wi4=
-github.com/riverqueue/river/rivertype v0.11.4/go.mod h1:3WRQEDlLKZky/vGwFcZC3uKjC+/8izE6ucHwCsuir98=
+github.com/rhnvrm/simples3 v0.6.1/go.mod h1:Y+3vYm2V7Y4VijFoJHHTrja6OgPrJ2cBti8dPGkC3sA=
+github.com/riverqueue/river v0.14.3 h1:TkrGV40M7bYnEdfPviNmd4ide4Tn4n7ql3YUHclfO8c=
+github.com/riverqueue/river v0.14.3/go.mod h1:RktlGq99TfIcByhZfecO7wHV6tPHmx8pqEGBEAWtN5o=
+github.com/riverqueue/river/riverdriver v0.14.3 h1:1cB5oR9p9YNXwnjXKLaB4OOyLHXS1zY03IaT0b0nsV0=
+github.com/riverqueue/river/riverdriver v0.14.3/go.mod h1:uMpL544T3/0lWsvm9fSehvAw+E9AVOaJlZGgWxJEa7U=
+github.com/riverqueue/river/riverdriver/riverdatabasesql v0.14.3 h1:ArFg/2WfvUnb8U3AgpW3jWCoc7V2Gqj4l6HNRP1/vtw=
+github.com/riverqueue/river/riverdriver/riverdatabasesql v0.14.3/go.mod h1:Y8A5y4DqHZmHKAyXINEDRZ0PBxOYGQdSZtV9AWK/SLU=
+github.com/riverqueue/river/riverdriver/riverpgxv5 v0.14.3 h1:WyT3+ToZbMvlfZqFVfX9L+EZB6e88/+L7PGhUqscPSU=
+github.com/riverqueue/river/riverdriver/riverpgxv5 v0.14.3/go.mod h1:jvfJsqQPAWPifx8QuYnhhou/qV6DDE88ZooqbE5uiUE=
+github.com/riverqueue/river/rivershared v0.14.3 h1:dthcCxuL25EELDNvSJJl0Xl5GxMSxFPcQyc1I40BEH0=
+github.com/riverqueue/river/rivershared v0.14.3/go.mod h1:wANyk6uuq0zi+6MYqj9NERQjws7w8rgqaUgsLqsG/sY=
+github.com/riverqueue/river/rivertype v0.14.3 h1:kKYmgZ0w7YLCQoFTtr4iVyBP/+w8UeleCHQ2qWMrlvs=
+github.com/riverqueue/river/rivertype v0.14.3/go.mod h1:4vpt5ZSdZ35mFbRAV4oXgeRdH3Mq5h1pUzQTvaGfCUA=
 github.com/robfig/cron/v3 v3.0.1 h1:WdRxkvbJztn8LMz/QEvLN5sBU+xKpSqwwUO1Pjr4qDs=
 github.com/robfig/cron/v3 v3.0.1/go.mod h1:eQICP3HwyT7UooqI/z+Ov+PtYAWygg1TEWWzGIFLtro=
+github.com/rogpeppe/fastuuid v1.2.0/go.mod h1:jVj6XXZzXRy/MSR5jhDC/2q6DgLz+nrA6LYCDYWNEvQ=
 github.com/rogpeppe/go-internal v1.6.1/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc=
-github.com/rogpeppe/go-internal v1.8.1/go.mod h1:JeRgkft04UBgHMgCIwADu4Pn6Mtm5d4nPKWu0nJ5d+o=
-github.com/rogpeppe/go-internal v1.12.0 h1:exVL4IDcn6na9z1rAb56Vxr+CgyK3nn3O+epU5NdKM8=
-github.com/rogpeppe/go-internal v1.12.0/go.mod h1:E+RYuTGaKKdloAfM02xzb0FW3Paa99yedzYV+kq4uf4=
+github.com/rogpeppe/go-internal v1.13.1 h1:KvO1DLK/DRN07sQ1LQKScxyZJuNnedQ5/wKSR38lUII=
+github.com/rogpeppe/go-internal v1.13.1/go.mod h1:uMEvuHeurkdAXX61udpOXGD/AzZDWNMNyH2VO9fmH0o=
 github.com/rs/xid v1.5.0/go.mod h1:trrq9SKmegXys3aeAKXMUTdJsYXVwGY3RLcfgqegfbg=
 github.com/rs/zerolog v1.33.0 h1:1cU2KZkvPxNyfgEmhHAz/1A9Bz+llsdYzklWFzgp0r8=
 github.com/rs/zerolog v1.33.0/go.mod h1:/7mN4D5sKwJLZQ2b/znpjC3/GQWY/xaDXUM0kKWRHss=
+github.com/ryanuber/columnize v0.0.0-20160712163229-9b3edd62028f/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts=
+github.com/ryanuber/columnize v2.1.0+incompatible/go.mod h1:sm1tb6uqfes/u+d4ooFouqFdy9/2g9QGwK3SQygK0Ts=
+github.com/ryanuber/go-glob v1.0.0/go.mod h1:807d1WSdnB0XRJzKNil9Om6lcp/3a0v4qIHxIXzX/Yc=
+github.com/sean-/seed v0.0.0-20170313163322-e2103e2c3529/go.mod h1:DxrIzT+xaE7yg65j358z/aeFdxmN0P9QXhEzd20vsDc=
 github.com/sethvargo/go-envconfig v1.1.0 h1:cWZiJxeTm7AlCvzGXrEXaSTCNgip5oJepekh/BOQuog=
 github.com/sethvargo/go-envconfig v1.1.0/go.mod h1:JLd0KFWQYzyENqnEPWWZ49i4vzZo/6nRidxI8YvGiHw=
-github.com/shirou/gopsutil/v3 v3.23.12 h1:z90NtUkp3bMtmICZKpC4+WaknU1eXtp5vtbQ11DgpE4=
-github.com/shirou/gopsutil/v3 v3.23.12/go.mod h1:1FrWgea594Jp7qmjHUUPlJDTPgcsb9mGnXDxavtikzM=
+github.com/shirou/gopsutil/v3 v3.24.5 h1:i0t8kL+kQTvpAYToeuiVk3TgDeKOFioZO3Ztz/iZ9pI=
+github.com/shirou/gopsutil/v3 v3.24.5/go.mod h1:bsoOS1aStSs9ErQ1WWfxllSeS1K5D+U30r2NfcubMVk=
 github.com/shoenig/go-m1cpu v0.1.6 h1:nxdKQNcEB6vzgA2E2bvzKIYRuNj7XNJ4S/aRSwKzFtM=
 github.com/shoenig/go-m1cpu v0.1.6/go.mod h1:1JJMcUBvfNwpq05QDQVAnx3gUHr9IYF7GNg9SUEw2VQ=
 github.com/shoenig/test v0.6.4 h1:kVTaSd7WLz5WZ2IaoM0RSzRsUD+m8wRR+5qvntpn4LU=
 github.com/shoenig/test v0.6.4/go.mod h1:byHiCGXqrVaflBLAMq/srcZIHynQPQgeyvkvXnjqq0k=
+github.com/sirupsen/logrus v1.2.0/go.mod h1:LxeOpSwHxABJmUn/MG1IvRgCAasNZTLOkJPxbbu5VWo=
+github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE=
+github.com/sirupsen/logrus v1.6.0/go.mod h1:7uNnSEd1DgxDLC74fIahvMZmmYsHGZGEOFrfsX/uA88=
 github.com/sirupsen/logrus v1.9.3 h1:dueUQJ1C2q9oE3F7wvmSGAaVtTmUizReu6fjN8uqzbQ=
 github.com/sirupsen/logrus v1.9.3/go.mod h1:naHLuLoDiP4jHNo9R0sCBMtWGeIprob74mVsIT4qYEQ=
-github.com/spf13/cobra v1.7.0 h1:hyqWnYt1ZQShIddO5kBpj3vu05/++x6tJ6dg8EC572I=
-github.com/spf13/cobra v1.7.0/go.mod h1:uLxZILRyS/50WlhOIKD7W6V5bgeIt+4sICxh6uRMrb0=
-github.com/spf13/pflag v1.0.5 h1:iy+VFUOCP1a+8yFto/drg2CJ5u0yRoB7fZw3DKv/JXA=
 github.com/spf13/pflag v1.0.5/go.mod h1:McXfInJRrz4CZXVZOBLb0bTZqETkiAhM9Iw0y3An2Bg=
 github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
+github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME=
 github.com/stretchr/objx v0.4.0/go.mod h1:YvHI0jy2hoMjB+UWwv71VJQ9isScKT/TqJzVSSt89Yw=
 github.com/stretchr/objx v0.5.0/go.mod h1:Yh+to48EsGEfYuaHDzXPcE3xhTkx73EhmCGUpEOglKo=
 github.com/stretchr/objx v0.5.2 h1:xuMeJ0Sdp5ZMRXx/aWO6RZxdr3beISkG5/G/aIRr3pY=
 github.com/stretchr/objx v0.5.2/go.mod h1:FRsXN1f5AsAjCGJKqEizvkpNtU+EGNCLh3NxZ/8L+MA=
+github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs=
 github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI=
+github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4=
+github.com/stretchr/testify v1.5.1/go.mod h1:5W2xD1RspED5o8YsWQXVCued0rvSQ+mT+I5cxcmMvtA=
 github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
 github.com/stretchr/testify v1.7.1/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg=
 github.com/stretchr/testify v1.8.0/go.mod h1:yNjHg4UonilssWZ8iaSj1OCr/vHnekPRkoO+kdMU+MU=
-github.com/stretchr/testify v1.8.2/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
-github.com/stretchr/testify v1.8.4/go.mod h1:sz/lmYIOXD/1dqDmKjjqLyZ2RngseejIcXlSw2iwfAo=
-github.com/stretchr/testify v1.9.0 h1:HtqpIVDClZ4nwg75+f6Lvsy/wHu+3BoSGCbBAcpTsTg=
-github.com/stretchr/testify v1.9.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
+github.com/stretchr/testify v1.8.1/go.mod h1:w2LPCIKwWwSfY2zedu0+kehJoqGctiVI29o6fzry7u4=
+github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA=
+github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY=
 github.com/swaggo/echo-swagger v1.4.1 h1:Yf0uPaJWp1uRtDloZALyLnvdBeoEL5Kc7DtnjzO/TUk=
 github.com/swaggo/echo-swagger v1.4.1/go.mod h1:C8bSi+9yH2FLZsnhqMZLIZddpUxZdBYuNHbtaS1Hljc=
 github.com/swaggo/files/v2 v2.0.1 h1:XCVJO/i/VosCDsJu1YLpdejGsGnBE9deRMpjN4pJLHk=
 github.com/swaggo/files/v2 v2.0.1/go.mod h1:24kk2Y9NYEJ5lHuCra6iVwkMjIekMCaFq/0JQj66kyM=
-github.com/swaggo/swag v1.16.3 h1:PnCYjPCah8FK4I26l2F/KQ4yz3sILcVUN3cTlBFA9Pg=
-github.com/swaggo/swag v1.16.3/go.mod h1:DImHIuOFXKpMFAQjcC7FG4m3Dg4+QuUgUzJmKjI/gRk=
-github.com/testcontainers/testcontainers-go v0.33.0 h1:zJS9PfXYT5O0ZFXM2xxXfk4J5UMw/kRiISng037Gxdw=
-github.com/testcontainers/testcontainers-go v0.33.0/go.mod h1:W80YpTa8D5C3Yy16icheD01UTDu+LmXIA2Keo+jWtT8=
-github.com/testcontainers/testcontainers-go/modules/postgres v0.33.0 h1:c+Gt+XLJjqFAejgX4hSpnHIpC9eAhvgI/TFWL/PbrFI=
-github.com/testcontainers/testcontainers-go/modules/postgres v0.33.0/go.mod h1:I4DazHBoWDyf69ByOIyt3OdNjefiUx372459txOpQ3o=
-github.com/tklauser/go-sysconf v0.3.12 h1:0QaGUFOdQaIVdPgfITYzaTegZvdCjmYO52cSFAEVmqU=
-github.com/tklauser/go-sysconf v0.3.12/go.mod h1:Ho14jnntGE1fpdOqQEEaiKRpvIavV0hSfmBq8nJbHYI=
-github.com/tklauser/numcpus v0.6.1 h1:ng9scYS7az0Bk4OZLvrNXNSAO2Pxr1XXRAPyjhIx+Fk=
-github.com/tklauser/numcpus v0.6.1/go.mod h1:1XfjsgE2zo8GVw7POkMbHENHzVg3GzmoZ9fESEdAacY=
+github.com/swaggo/swag v1.16.4 h1:clWJtd9LStiG3VeijiCfOVODP6VpHtKdQy9ELFG3s1A=
+github.com/swaggo/swag v1.16.4/go.mod h1:VBsHJRsDvfYvqoiMKnsdwhNV9LEMHgEDZcyVYX0sxPg=
+github.com/testcontainers/testcontainers-go v0.34.0 h1:5fbgF0vIN5u+nD3IWabQwRybuB4GY8G2HHgCkbMzMHo=
+github.com/testcontainers/testcontainers-go v0.34.0/go.mod h1:6P/kMkQe8yqPHfPWNulFGdFHTD8HB2vLq/231xY2iPQ=
+github.com/testcontainers/testcontainers-go/modules/postgres v0.34.0 h1:c51aBXT3v2HEBVarmaBnsKzvgZjC5amn0qsj8Naqi50=
+github.com/testcontainers/testcontainers-go/modules/postgres v0.34.0/go.mod h1:EWP75ogLQU4M4L8U+20mFipjV4WIR9WtlMXSB6/wiuc=
+github.com/tidwall/gjson v1.14.2/go.mod h1:/wbyibRr2FHMks5tjHJ5F8dMZh3AcwJEMf5vlfC0lxk=
+github.com/tidwall/gjson v1.18.0 h1:FIDeeyB800efLX89e5a8Y0BNH+LOngJyGrIWxG2FKQY=
+github.com/tidwall/gjson v1.18.0/go.mod h1:/wbyibRr2FHMks5tjHJ5F8dMZh3AcwJEMf5vlfC0lxk=
+github.com/tidwall/match v1.1.1 h1:+Ho715JplO36QYgwN9PGYNhgZvoUSc9X2c80KVTi+GA=
+github.com/tidwall/match v1.1.1/go.mod h1:eRSPERbgtNPcGhD8UCthc6PmLEQXEWd3PRB5JTxsfmM=
+github.com/tidwall/pretty v1.2.0/go.mod h1:ITEVvHYasfjBbM0u2Pg8T2nJnzm8xPwvNhhsoaGGjNU=
+github.com/tidwall/pretty v1.2.1 h1:qjsOFOWWQl+N3RsoF5/ssm1pHmJJwhjlSbZ51I6wMl4=
+github.com/tidwall/pretty v1.2.1/go.mod h1:ITEVvHYasfjBbM0u2Pg8T2nJnzm8xPwvNhhsoaGGjNU=
+github.com/tidwall/sjson v1.2.5 h1:kLy8mja+1c9jlljvWTlSazM7cKDRfJuR/bOJhcY5NcY=
+github.com/tidwall/sjson v1.2.5/go.mod h1:Fvgq9kS/6ociJEDnK0Fk1cpYF4FIW6ZF7LAe+6jwd28=
+github.com/tklauser/go-sysconf v0.3.14 h1:g5vzr9iPFFz24v2KZXs/pvpvh8/V9Fw6vQK5ZZb78yU=
+github.com/tklauser/go-sysconf v0.3.14/go.mod h1:1ym4lWMLUOhuBOPGtRcJm7tEGX4SCYNEEEtghGG/8uY=
+github.com/tklauser/numcpus v0.9.0 h1:lmyCHtANi8aRUgkckBgoDk1nHCux3n2cgkJLXdQGPDo=
+github.com/tklauser/numcpus v0.9.0/go.mod h1:SN6Nq1O3VychhC1npsWostA+oW+VOQTxZrS604NSRyI=
 github.com/valyala/bytebufferpool v1.0.0 h1:GqA5TC/0021Y/b9FG4Oi9Mr3q7XYx6KllzawFIhcdPw=
 github.com/valyala/bytebufferpool v1.0.0/go.mod h1:6bBcMArwyJ5K/AmCkWv1jt77kVWyCJ6HpOuEn7z0Csc=
 github.com/valyala/fasttemplate v1.2.2 h1:lxLXG0uE3Qnshl9QyaK6XJxMXlQZELvChBOCmQD0Loo=
 github.com/valyala/fasttemplate v1.2.2/go.mod h1:KHLXt3tVN2HBp8eijSv/kGJopbvo7S+qRAEEKiv+SiQ=
 github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
 github.com/yuin/goldmark v1.2.1/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74=
-github.com/yusufpapurcu/wmi v1.2.3 h1:E1ctvB7uKFMOJw3fdOW32DwGE9I7t++CRUEMKvFoFiw=
-github.com/yusufpapurcu/wmi v1.2.3/go.mod h1:SBZ9tNy3G9/m5Oi98Zks0QjeHVDvuK0qfxQmPyzfmi0=
-github.com/zclconf/go-cty v1.15.0 h1:tTCRWxsexYUmtt/wVxgDClUe+uQusuI443uL6e+5sXQ=
-github.com/zclconf/go-cty v1.15.0/go.mod h1:VvMs5i0vgZdhYawQNq5kePSpLAoz8u1xvZgrPIxfnZE=
+github.com/yuin/goldmark v1.3.5/go.mod h1:mwnBkeHKe2W/ZEtQ+71ViKU8L12m81fl3OWwC1Zlc8k=
+github.com/yuin/goldmark v1.4.13/go.mod h1:6yULJ656Px+3vBD8DxQVa3kxgyrAnzto9xy5taEt/CY=
+github.com/yusufpapurcu/wmi v1.2.4 h1:zFUKzehAFReQwLys1b/iSMl+JQGSCSjtVqQn9bBrPo0=
+github.com/yusufpapurcu/wmi v1.2.4/go.mod h1:SBZ9tNy3G9/m5Oi98Zks0QjeHVDvuK0qfxQmPyzfmi0=
+github.com/zclconf/go-cty v1.15.1 h1:RgQYm4j2EvoBRXOPxhUvxPzRrGDo1eCOhHXuGfrj5S0=
+github.com/zclconf/go-cty v1.15.1/go.mod h1:VvMs5i0vgZdhYawQNq5kePSpLAoz8u1xvZgrPIxfnZE=
 github.com/zclconf/go-cty-debug v0.0.0-20240509010212-0d6042c53940 h1:4r45xpDWB6ZMSMNJFMOjqrGHynW3DIBuR2H9j0ug+Mo=
 github.com/zclconf/go-cty-debug v0.0.0-20240509010212-0d6042c53940/go.mod h1:CmBdvvj3nqzfzJ6nTCIwDTPZ56aVGvDrmztiO5g3qrM=
-go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.49.0 h1:jq9TW8u3so/bN+JPT166wjOI6/vQPF6Xe7nMNIltagk=
-go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.49.0/go.mod h1:p8pYQP+m5XfbZm9fxtSKAbM6oIllS7s2AfxrChvc7iw=
-go.opentelemetry.io/otel v1.24.0 h1:0LAOdjNmQeSTzGBzduGe/rU4tZhMwL5rWgtp9Ku5Jfo=
-go.opentelemetry.io/otel v1.24.0/go.mod h1:W7b9Ozg4nkF5tWI5zsXkaKKDjdVjpD4oAt9Qi/MArHo=
+go.etcd.io/etcd/api/v3 v3.5.4/go.mod h1:5GB2vv4A4AOn3yk7MftYGHkUfGtDHnEraIjym4dYz5A=
+go.etcd.io/etcd/client/pkg/v3 v3.5.4/go.mod h1:IJHfcCEKxYu1Os13ZdwCwIUTUVGYTSAM3YSwc9/Ac1g=
+go.etcd.io/etcd/client/v3 v3.5.4/go.mod h1:ZaRkVgBZC+L+dLCjTcF1hRXpgZXQPOvnA/Ak/gq3kiY=
+go.opentelemetry.io/auto/sdk v1.1.0 h1:cH53jehLUN6UFLY71z+NDOiNJqDdPRaXzTel0sJySYA=
+go.opentelemetry.io/auto/sdk v1.1.0/go.mod h1:3wSPjt5PWp2RhlCcmmOial7AvC4DQqZb7a7wCow3W8A=
+go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.58.0 h1:yd02MEjBdJkG3uabWP9apV+OuWRIXGDuJEUJbOHmCFU=
+go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.58.0/go.mod h1:umTcuxiv1n/s/S6/c2AT/g2CQ7u5C59sHDNmfSwgz7Q=
+go.opentelemetry.io/otel v1.33.0 h1:/FerN9bax5LoK51X/sI0SVYrjSE0/yUL7DpxW4K3FWw=
+go.opentelemetry.io/otel v1.33.0/go.mod h1:SUUkR6csvUQl+yjReHu5uM3EtVV7MBm5FHKRlNx4I8I=
 go.opentelemetry.io/otel/exporters/otlp/otlptrace v1.19.0 h1:Mne5On7VWdx7omSrSSZvM4Kw7cS7NQkOOmLcgscI51U=
 go.opentelemetry.io/otel/exporters/otlp/otlptrace v1.19.0/go.mod h1:IPtUMKL4O3tH5y+iXVyAXqpAwMuzC1IrxVS81rummfE=
 go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.19.0 h1:IeMeyr1aBvBiPVYihXIaeIZba6b8E1bYp7lbdxK8CQg=
 go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp v1.19.0/go.mod h1:oVdCUtjq9MK9BlS7TtucsQwUcXcymNiEDjgDD2jMtZU=
-go.opentelemetry.io/otel/metric v1.24.0 h1:6EhoGWWK28x1fbpA4tYTOWBkPefTDQnb8WSGXlc88kI=
-go.opentelemetry.io/otel/metric v1.24.0/go.mod h1:VYhLe1rFfxuTXLgj4CBiyz+9WYBA8pNGJgDcSFRKBco=
-go.opentelemetry.io/otel/sdk v1.19.0 h1:6USY6zH+L8uMH8L3t1enZPR3WFEmSTADlqldyHtJi3o=
-go.opentelemetry.io/otel/sdk v1.19.0/go.mod h1:NedEbbS4w3C6zElbLdPJKOpJQOrGUJ+GfzpjUvI0v1A=
-go.opentelemetry.io/otel/trace v1.24.0 h1:CsKnnL4dUAr/0llH9FKuc698G04IrpWV0MQA/Y1YELI=
-go.opentelemetry.io/otel/trace v1.24.0/go.mod h1:HPc3Xr/cOApsBI154IU0OI0HJexz+aw5uPdbs3UCjNU=
+go.opentelemetry.io/otel/metric v1.33.0 h1:r+JOocAyeRVXD8lZpjdQjzMadVZp2M4WmQ+5WtEnklQ=
+go.opentelemetry.io/otel/metric v1.33.0/go.mod h1:L9+Fyctbp6HFTddIxClbQkjtubW6O9QS3Ann/M82u6M=
+go.opentelemetry.io/otel/sdk v1.21.0 h1:FTt8qirL1EysG6sTQRZ5TokkU8d0ugCj8htOgThZXQ8=
+go.opentelemetry.io/otel/sdk v1.21.0/go.mod h1:Nna6Yv7PWTdgJHVRD9hIYywQBRx7pbox6nwBnZIxl/E=
+go.opentelemetry.io/otel/trace v1.33.0 h1:cCJuF7LRjUFso9LPnEAHJDB2pqzp+hbO8eu1qqW2d/s=
+go.opentelemetry.io/otel/trace v1.33.0/go.mod h1:uIcdVUZMpTAmz0tI1z04GoVSezK37CbGV4fr1f2nBck=
 go.opentelemetry.io/proto/otlp v1.0.0 h1:T0TX0tmXU8a3CbNXzEKGeU5mIVOdf0oykP+u2lIVU/I=
 go.opentelemetry.io/proto/otlp v1.0.0/go.mod h1:Sy6pihPLfYHkr3NkUbEhGHFhINUSI/v80hjKIs5JXpM=
-go.uber.org/atomic v1.9.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc=
-go.uber.org/atomic v1.11.0 h1:ZvwS0R+56ePWxUNi+Atn9dWONBPp/AUETXlHW0DxSjE=
-go.uber.org/atomic v1.11.0/go.mod h1:LUxbIzbOniOlMKjJjyPfpl4v+PKK2cNJn91OQbhoJI0=
+go.uber.org/atomic v1.7.0/go.mod h1:fEN4uk6kAWBTFdckzkM89CLk9XfWZrxpCo0nPH17wJc=
 go.uber.org/goleak v1.3.0 h1:2K3zAYmnTNqV73imy9J1T3WC+gmCePx2hEGkimedGto=
 go.uber.org/goleak v1.3.0/go.mod h1:CoHD4mav9JJNrW/WLlf7HGZPjdw8EucARQHekz1X6bE=
+go.uber.org/multierr v1.6.0/go.mod h1:cdWPpRnG4AhwMwsgIHip0KRBQjJy5kYEpYjJxpXp9iU=
+go.uber.org/zap v1.17.0/go.mod h1:MXVU+bhUf/A7Xi2HNOnopQOrmycQ5Ih87HtOu4q5SSo=
+golang.org/x/crypto v0.0.0-20180904163835-0709b304e793/go.mod h1:6SG95UA2DQfeDnfUPMdvaQW0Q7yPrPDi9nlGo2tz2b4=
 golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w=
+golang.org/x/crypto v0.0.0-20190923035154-9ee001bba392/go.mod h1:/lpIB1dKB+9EgE3H3cr1v9wB50oz8l4C4h62xy7jSTY=
 golang.org/x/crypto v0.0.0-20191011191535-87dc89f01550/go.mod h1:yigFU9vqHzYiE8UmvKecakEJjdnWj3jj499lnFckfCI=
 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto=
-golang.org/x/crypto v0.26.0 h1:RrRspgV4mU+YwB4FYnuBoKsUapNIL5cohGAmSH3azsw=
-golang.org/x/crypto v0.26.0/go.mod h1:GY7jblb9wI+FOo5y8/S2oY4zWP07AkOJ4+jxCqdqn54=
+golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc=
+golang.org/x/crypto v0.17.0/go.mod h1:gCAAfMLgwOJRpTjQ2zCCt2OcSfYMTeZVSRtQlPC7Nq4=
+golang.org/x/crypto v0.31.0 h1:ihbySMvVjLAeSH1IbfcRTkD/iNscyz8rGzjF/E5hV6U=
+golang.org/x/crypto v0.31.0/go.mod h1:kDsLvtWBEx7MV9tJOj9bnXsPbxwJQ6csT/x4KIN4Ssk=
+golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA=
+golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE=
+golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU=
+golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc=
+golang.org/x/lint v0.0.0-20210508222113-6edffad5e616/go.mod h1:3xt1FjdF8hUf6vQPIChWIBhFzV8gjjsPE/fR3IyQdNY=
+golang.org/x/mod v0.1.1-0.20191105210325-c90efee705ee/go.mod h1:QqPTAvyqsEbceGzBzNggFXnrqF1CaUcvgkdR5Ot7KZg=
 golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
 golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
-golang.org/x/mod v0.20.0 h1:utOm6MM3R3dnawAiJgn0y+xvuYRsm1RKM/4giyfDgV0=
-golang.org/x/mod v0.20.0/go.mod h1:hTbmBsO62+eylJbnUtE2MGJUyE7QWk4xUqPFrRgJ+7c=
+golang.org/x/mod v0.4.2/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA=
+golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4=
+golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs=
+golang.org/x/mod v0.22.0 h1:D4nJWe9zXqHOmWqj4VMOJhvzj7bEZg4wEYa759z1pH4=
+golang.org/x/mod v0.22.0/go.mod h1:6SkKJ3Xj0I0BrPOZoBy3bdMptDDU9oJrpohJ3eWZ1fY=
+golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20181114220301-adae6a3d119a/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190108225652-1e06a53dbb7e/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4=
+golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
 golang.org/x/net v0.0.0-20190404232315-eb5bcb51f2a3/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg=
+golang.org/x/net v0.0.0-20190613194153-d28f0bde5980/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
 golang.org/x/net v0.0.0-20190620200207-3b0461eec859/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20190923162816-aa69164e4478/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
 golang.org/x/net v0.0.0-20200226121028-0de0cce0169b/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s=
+golang.org/x/net v0.0.0-20200625001655-4c5254603344/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
+golang.org/x/net v0.0.0-20200822124328-c89045814202/go.mod h1:/O7V0waA8r7cgGh81Ro3o1hOxt32SMVPicZroKQ2sZA=
 golang.org/x/net v0.0.0-20201021035429-f5854403a974/go.mod h1:sp8m0HH+o8qH0wwXwYZr8TS3Oi6o0r6Gce1SSxlDquU=
-golang.org/x/net v0.27.0 h1:5K3Njcw06/l2y9vpGCSdcxWOYHOUk3dVNGDXN+FvAys=
-golang.org/x/net v0.27.0/go.mod h1:dDi0PyhWNoiUOrAS8uXv/vnScO4wnHQO4mj9fn/RytE=
-golang.org/x/oauth2 v0.23.0 h1:PbgcYx2W7i4LvjJWEbf0ngHV6qJYr86PkAV3bXdLEbs=
-golang.org/x/oauth2 v0.23.0/go.mod h1:XYTD2NtWslqkgxebSiOHnXEap4TF09sJSc7H1sXbhtI=
+golang.org/x/net v0.0.0-20210226172049-e18ecbb05110/go.mod h1:m0MpNAwzfU5UDzcl9v0D8zg8gWTRqZa9RBIspLL5mdg=
+golang.org/x/net v0.0.0-20210405180319-a5a99cb37ef4/go.mod h1:p54w0d4576C0XHj96bSt6lcn1PtDYWL6XObtHCRCNQM=
+golang.org/x/net v0.0.0-20210410081132-afb366fc7cd1/go.mod h1:9tjilg8BloeKEkVJvy7fQ90B1CfIiPueXVOjqfkSzI8=
+golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c=
+golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs=
+golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg=
+golang.org/x/net v0.33.0 h1:74SYHlV8BIgHIFC/LrYkOGIwL19eTYXQ5wc6TBuO36I=
+golang.org/x/net v0.33.0/go.mod h1:HXLR5J+9DxmrqMwG9qjGCxZ+zKXxBru04zlTvWlWuN4=
+golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U=
+golang.org/x/oauth2 v0.0.0-20190226205417-e64efc72b421/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.0.0-20200107190931-bf48bf16ab8d/go.mod h1:gOpvHmFTYa4IltrdGE7lF6nIHvwfUNPOp7c8zoXwtLw=
+golang.org/x/oauth2 v0.24.0 h1:KTBBxWqUa0ykRPLtV69rRto9TLXcqYkeswu48x/gvNE=
+golang.org/x/oauth2 v0.24.0/go.mod h1:XYTD2NtWslqkgxebSiOHnXEap4TF09sJSc7H1sXbhtI=
+golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20181221193216-37e7f081c4d4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
-golang.org/x/sync v0.8.0 h1:3NFvSEYkUoMifnESzZl15y791HH1qU2xm6eCJU5ZPXQ=
-golang.org/x/sync v0.8.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk=
+golang.org/x/sync v0.0.0-20201207232520-09787c993a3a/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM=
+golang.org/x/sync v0.10.0 h1:3NQrjDixjgGwUOCaF8w2+VYHv0Ve/vGYSbdkTa98gmQ=
+golang.org/x/sync v0.10.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk=
+golang.org/x/sys v0.0.0-20180823144017-11551d06cbcc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20181116152217-5ac8a444bdc5/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190129075346-302c3dd5f1cc/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190222072716-a9d3bda3a223/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY=
+golang.org/x/sys v0.0.0-20190403152447-81d4e9dc473e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190922100055-0a153f010e69/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20190924154521-2837fb4f24fe/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191005200804-aed5e4c7ecf9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191008105621-543471e840be/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20191026070338-33540a1f6037/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200106162015-b016eb3dc98e/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200116001909-b77594299b42/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200124204421-9fbb57f87de9/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200223170610-d5e6a3e2c0ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200323222414-85ca7c5b95cd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200615200032-f1bc736245b1/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20200625212154-ddb9806d33ae/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20201119102817-f84b799fce68/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
 golang.org/x/sys v0.0.0-20201204225414-ed752295db88/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210124154548-22da62e12c0c/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210303074136-134d130e1a04/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210330210617-4fbd30eecc44/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210403161142-5e06dd20ab57/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs=
+golang.org/x/sys v0.0.0-20210510120138-977fb7262007/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210603081109-ebe580a85c40/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20210615035016-665e8c7367d1/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20210616094352-59db8d763f22/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220715151400-c0bba94af5f8/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.0.0-20220811171246-fbc7d0a398ab/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
+golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
-golang.org/x/sys v0.11.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.12.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg=
 golang.org/x/sys v0.15.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
-golang.org/x/sys v0.23.0 h1:YfKFowiIMvtgl1UERQoTPPToxltDeZfbj4H7dVUCwmM=
-golang.org/x/sys v0.23.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
-golang.org/x/term v0.23.0 h1:F6D4vR+EHoL9/sWAWgAR1H2DcHr4PareCbAaCo1RpuU=
-golang.org/x/term v0.23.0/go.mod h1:DgV24QBUrK6jhZXl+20l6UWznPlwAHm1Q1mGHtydmSk=
+golang.org/x/sys v0.28.0 h1:Fksou7UEQUWlKvIdsqzJmUmCX3cZuD2+P3XyyzwMhlA=
+golang.org/x/sys v0.28.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA=
+golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo=
+golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8=
+golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k=
+golang.org/x/term v0.8.0/go.mod h1:xPskH00ivmX89bAKVGSKKtLOWNx2+17Eiy94tnKShWo=
+golang.org/x/term v0.15.0/go.mod h1:BDl952bC7+uMoWR75FIrCDx79TPU9oHkTZ9yRbYOrX0=
+golang.org/x/term v0.27.0 h1:WP60Sv1nlK1T6SupCHbXzSaN0b9wUmsPoRS9b61A23Q=
+golang.org/x/term v0.27.0/go.mod h1:iMsnZpn0cago0GOrHO2+Y7u7JPn5AylBrcoWkElMTSM=
 golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ=
+golang.org/x/text v0.3.1-0.20181227161524-e6919f6577db/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
+golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk=
 golang.org/x/text v0.3.3/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
-golang.org/x/text v0.17.0 h1:XtiM5bkSOt+ewxlOE/aE/AKEHibwj/6gvWMl9Rsh0Qc=
-golang.org/x/text v0.17.0/go.mod h1:BuEKDfySbSR4drPmRPG/7iBdf8hvFMuRexcpahXilzY=
-golang.org/x/time v0.5.0 h1:o7cqy6amK/52YcAKIPlM3a+Fpj35zvRj2TP+e1xFSfk=
-golang.org/x/time v0.5.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM=
+golang.org/x/text v0.3.5/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.6/go.mod h1:5Zoc/QRtKVWzQhOtBMvqHzDpF6irO9z98xDceosuGiQ=
+golang.org/x/text v0.3.7/go.mod h1:u+2+/6zg+i71rQMx5EYifcz6MCKuco9NR6JIITiCfzQ=
+golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8=
+golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8=
+golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU=
+golang.org/x/text v0.21.0 h1:zyQAAkrwaneQ066sspRyJaG9VNi/YJ1NfzcGB3hZ/qo=
+golang.org/x/text v0.21.0/go.mod h1:4IBbMaMmOPCJ8SecivzSH54+73PCFmPWxNTLm+vZkEQ=
+golang.org/x/time v0.0.0-20190308202827-9d24e82272b4/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ=
+golang.org/x/time v0.8.0 h1:9i3RxcPv3PZnitoVGMPDKZSq1xW1gK1Xy3ArNOGZfEg=
+golang.org/x/time v0.8.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM=
 golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ=
+golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY=
+golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs=
+golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q=
+golang.org/x/tools v0.0.0-20190907020128-2ca718005c18/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
 golang.org/x/tools v0.0.0-20191119224855-298f0cb1881e/go.mod h1:b+2E5dAYhXwXZwtnZ6UAqBI28+e2cm9otk0dWdXHAEo=
+golang.org/x/tools v0.0.0-20200130002326-2f3ba24bd6e7/go.mod h1:TB2adYChydJhpapKDTa4BR/hXlZSLoq2Wpct/0txZ28=
 golang.org/x/tools v0.0.0-20200619180055-7c47624df98f/go.mod h1:EkVYQZoAsY45+roYkvgYkIh4xh/qjgUK9TdY2XT94GE=
 golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA=
-golang.org/x/tools v0.23.0 h1:SGsXPZ+2l4JsgaCKkx+FQ9YZ5XEtA1GZYuoDjenLjvg=
-golang.org/x/tools v0.23.0/go.mod h1:pnu6ufv6vQkll6szChhK3C3L/ruaIv5eBeztNG8wtsI=
+golang.org/x/tools v0.1.2/go.mod h1:o0xws9oXOQQZyjljx8fwUC0k7L1pTE6eaCbjGeHmOkk=
+golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc=
+golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU=
+golang.org/x/tools v0.28.0 h1:WuB6qZ4RPCQo5aP3WdKZS7i595EdWqWR8vqJTlwTVK8=
+golang.org/x/tools v0.28.0/go.mod h1:dcIOrVd3mfQKTgrDVQHqCPMWy6lnhfhtX3hLXYVLfRw=
 golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.org/x/xerrors v0.0.0-20191011141410-1b5146add898/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.org/x/xerrors v0.0.0-20191204190536-9bdfabe68543/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0=
-google.golang.org/genproto v0.0.0-20230920204549-e6e6cdab5c13 h1:vlzZttNJGVqTsRFU9AmdnrcO1Znh8Ew9kCD//yjigk0=
+google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM=
+google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4=
+google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc=
+google.golang.org/genproto v0.0.0-20190404172233-64821d5d2107/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE=
+google.golang.org/genproto v0.0.0-20190819201941-24fa4b261c55/go.mod h1:DMBHOl98Agz4BDEuKkezgsaosCRResVns1a3J2ZsMNc=
+google.golang.org/genproto v0.0.0-20200513103714-09dca8ec2884/go.mod h1:55QSHmfGQM9UVYDPBsyGGes0y52j32PQ3BqQfXhyH3c=
+google.golang.org/genproto v0.0.0-20200526211855-cb27e3aa2013/go.mod h1:NbSheEEYHJ7i3ixzK3sjbqSGDJWnxyFXZblF3eUsNvo=
+google.golang.org/genproto v0.0.0-20210602131652-f16073e35f0c/go.mod h1:UODoCrxHCcBojKKwX1terBiRUaqAsFqJiF615XL43r0=
 google.golang.org/genproto/googleapis/api v0.0.0-20240318140521-94a12d6c2237 h1:RFiFrvy37/mpSpdySBDrUdipW/dHwsRwh3J3+A9VgT4=
 google.golang.org/genproto/googleapis/api v0.0.0-20240318140521-94a12d6c2237/go.mod h1:Z5Iiy3jtmioajWHDGFk7CeugTyHtPvMHA4UTmUkyalE=
 google.golang.org/genproto/googleapis/rpc v0.0.0-20240318140521-94a12d6c2237 h1:NnYq6UN9ReLM9/Y01KWNOWyI5xQ9kbIms5GGJVwS/Yc=
 google.golang.org/genproto/googleapis/rpc v0.0.0-20240318140521-94a12d6c2237/go.mod h1:WtryC6hu0hhx87FDGxWCDptyssuo68sk10vYjF+T9fY=
+google.golang.org/grpc v1.14.0/go.mod h1:yo6s7OP7yaDglbqo1J04qKzAhqBH6lvTonzMVmEdcZw=
+google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c=
+google.golang.org/grpc v1.22.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
+google.golang.org/grpc v1.23.0/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg=
+google.golang.org/grpc v1.25.1/go.mod h1:c3i+UQWmh7LiEpx4sFZnkU36qjEYZ0imhYfXVyQciAY=
+google.golang.org/grpc v1.27.0/go.mod h1:qbnxyOmOxrQa7FizSgH+ReBfzJrCY1pSN7KXBS8abTk=
+google.golang.org/grpc v1.33.1/go.mod h1:fr5YgcSWrqhRRxogOsw7RzIpsmvOZ6IcH4kBYTpR3n0=
+google.golang.org/grpc v1.38.0/go.mod h1:NREThFqKR1f3iQ6oBuvc5LadQuXVGo9rkm5ZGrQdJfM=
 google.golang.org/grpc v1.64.1 h1:LKtvyfbX3UGVPFcGqJ9ItpVWW6oN/2XqTxfAnwRRXiA=
 google.golang.org/grpc v1.64.1/go.mod h1:hiQF4LFZelK2WKaP6W0L92zGHtiQdZxk8CrSdvyjeP0=
-google.golang.org/protobuf v1.34.2 h1:6xV6lTsCfpGD21XK49h7MhtcApnLqkfYgPcdHftf6hg=
-google.golang.org/protobuf v1.34.2/go.mod h1:qYOHts0dSfpeUzUFpOMr/WGzszTmLH+DiWniOlNbLDw=
+google.golang.org/protobuf v0.0.0-20200109180630-ec00e32a8dfd/go.mod h1:DFci5gLYBciE7Vtevhsrf46CRTquxDuWsQurQQe4oz8=
+google.golang.org/protobuf v0.0.0-20200221191635-4d8936d0db64/go.mod h1:kwYJMbMJ01Woi6D6+Kah6886xMZcty6N08ah7+eCXa0=
+google.golang.org/protobuf v0.0.0-20200228230310-ab0ca4ff8a60/go.mod h1:cfTl7dwQJ+fmap5saPgwCLgHXTUD7jkjRqWcaiX5VyM=
+google.golang.org/protobuf v1.20.1-0.20200309200217-e05f789c0967/go.mod h1:A+miEFZTKqfCUM6K7xSMQL9OKL/b6hQv+e19PK+JZNE=
+google.golang.org/protobuf v1.21.0/go.mod h1:47Nbq4nVaFHyn7ilMalzfO3qCViNmqZ2kzikPIcrTAo=
+google.golang.org/protobuf v1.22.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.0/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.23.1-0.20200526195155-81db48ad09cc/go.mod h1:EGpADcykh3NcUnDUJcl1+ZksZNG86OlYog2l/sGQquU=
+google.golang.org/protobuf v1.25.0/go.mod h1:9JNX74DMeImyA3h4bdi1ymwjUzf21/xIlbajtzgsN7c=
+google.golang.org/protobuf v1.26.0-rc.1/go.mod h1:jlhhOSvTdKEhbULTjvd4ARK9grFBp09yW+WbY/TyQbw=
+google.golang.org/protobuf v1.26.0/go.mod h1:9q0QmTI4eRPtz6boOQmLYwt+qCgq0jsYwAQnmE0givc=
+google.golang.org/protobuf v1.36.0 h1:mjIs9gYtt56AzC4ZaffQuh88TZurBGhIJMBZGSxNerQ=
+google.golang.org/protobuf v1.36.0/go.mod h1:9fA7Ob0pmnwhb644+1+CVWFRbNajQ6iRojtC/QF5bRE=
+gopkg.in/alecthomas/kingpin.v2 v2.2.6/go.mod h1:FMv+mEhP44yOT+4EoQTLFTRgOQ1FBLkstjWtayDeSgw=
+gopkg.in/asn1-ber.v1 v1.0.0-20181015200546-f715ec2f112d/go.mod h1:cuepJuh7vyXfUyUwEgHQXw849cJrilpS5NeIjOWESAw=
 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
+gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0=
 gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=
 gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q=
 gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI=
+gopkg.in/square/go-jose.v2 v2.3.1/go.mod h1:M9dMgbHiYLoDGQrXy7OpJDJWiKiU//h+vD76mk0e1AI=
+gopkg.in/yaml.v2 v2.2.1/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.3/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.4/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.5/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
+gopkg.in/yaml.v2 v2.3.0/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI=
 gopkg.in/yaml.v2 v2.4.0 h1:D8xgwECY7CYvx+Y2n4sBz93Jn9JRvxdiyyo8CTfuKaY=
 gopkg.in/yaml.v2 v2.4.0/go.mod h1:RDklbk79AGWmwhnvt/jBztapEOGDOx6ZbXqjP6csGnQ=
 gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
+gopkg.in/yaml.v3 v3.0.0-20210107192922-496545a6307b/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA=
 gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM=
 gotest.tools/v3 v3.5.1 h1:EENdUnS3pdur5nybKYIh2Vfgc8IUNBjxDPSjtiJcOzU=
 gotest.tools/v3 v3.5.1/go.mod h1:isy3WKz7GK6uNw/sbHzfKBLvlvXwUyV06n6brMxxopU=
+honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
+riverqueue.com/riverui v0.7.0 h1:K1maQJtgtL1FhE7vOFc3T56JHrKcibQBx3vhVbKc+pk=
+riverqueue.com/riverui v0.7.0/go.mod h1:5bpSwSmb3zQbvvRspuWn28LY58cds7NFP9r8yJ5pAfU=
+sigs.k8s.io/yaml v1.2.0/go.mod h1:yfXDCHCao9+ENCvLSE62v9VSji2MKu5jeNfTrofGhJc=
diff --git a/internal/archive/archive.go b/internal/archive/archive.go
index e73e0d6b..59e5ad63 100644
--- a/internal/archive/archive.go
+++ b/internal/archive/archive.go
@@ -278,6 +278,203 @@ func (s *Service) ArchiveVideo(ctx context.Context, input ArchiveVideoInput) err
 	return nil
 }
 
+type ArchiveClipInput struct {
+	ID          string
+	ChannelId   uuid.UUID
+	Quality     utils.VodQuality
+	ArchiveChat bool
+	RenderChat  bool
+}
+
+// ArchiveClip archives a clip from a platform
+func (s *Service) ArchiveClip(ctx context.Context, input ArchiveClipInput) error {
+
+	envConfig := config.GetEnvConfig()
+
+	// check if video is blocked
+	blocked, err := s.BlockedVodsService.IsVideoBlocked(ctx, input.ID)
+	if err != nil {
+		return fmt.Errorf("error checking if clip is blocked: %v", err)
+	}
+	if blocked {
+		return fmt.Errorf("clip id is blocked")
+	}
+
+	// get clip
+	clip, err := s.PlatformTwitch.GetClip(context.Background(), input.ID)
+	if err != nil {
+		return err
+	}
+
+	// Check if video is already archived
+	vCheck, err := s.VodService.CheckVodExists(clip.ID)
+	if err != nil {
+		return fmt.Errorf("error checking if clip exists: %v", err)
+	}
+	if vCheck {
+		return fmt.Errorf("clip already exists")
+	}
+
+	// Check if channel exists
+	cCheck := s.ChannelService.CheckChannelExistsByExtId(clip.ChannelID)
+	if !cCheck {
+		log.Debug().Msg("channel does not exist: %s while archiving clip. creating now")
+		_, err := s.ArchiveChannel(ctx, *clip.ChannelName)
+		if err != nil {
+			return fmt.Errorf("error creating channel: %v", err)
+		}
+	}
+
+	// Fetch channel
+	channel, err := s.ChannelService.GetChannelByExtId(clip.ChannelID)
+	if err != nil {
+		return fmt.Errorf("error fetching channel: %v", err)
+	}
+
+	// Generate Ganymede video ID for directory and file naming
+	vUUID, err := uuid.NewUUID()
+	if err != nil {
+		return fmt.Errorf("error creating vod uuid: %v", err)
+	}
+
+	storageTemplateInput := StorageTemplateInput{
+		UUID:    vUUID,
+		ID:      clip.ID,
+		Channel: channel.Name,
+		Title:   clip.Title,
+		Type:    string(utils.Clip),
+		Date:    clip.CreatedAt.Format("2006-01-02"),
+	}
+	// Create directory paths
+	folderName, err := GetFolderName(vUUID, storageTemplateInput)
+	if err != nil {
+		log.Error().Err(err).Msg("error using template to create folder name, falling back to default")
+		folderName = fmt.Sprintf("%s-%s", clip.ID, vUUID.String())
+	}
+	fileName, err := GetFileName(vUUID, storageTemplateInput)
+	if err != nil {
+		log.Error().Err(err).Msg("error using template to create file name, falling back to default")
+		fileName = clip.ID
+	}
+
+	// set facts
+	rootVideoPath := fmt.Sprintf("%s/%s/%s", envConfig.VideosDir, channel.Name, folderName)
+	chatPath := ""
+	chatVideoPath := ""
+	liveChatPath := ""
+	liveChatConvertPath := ""
+
+	// Disable chat archive if the clip doesn't have a VOD to fetch the chat from
+	if clip.VideoID == "" {
+		input.ArchiveChat = false
+	}
+
+	if input.ArchiveChat {
+		chatPath = fmt.Sprintf("%s/%s-chat.json", rootVideoPath, fileName)
+		chatVideoPath = fmt.Sprintf("%s/%s-chat.mp4", rootVideoPath, fileName)
+		liveChatPath = fmt.Sprintf("%s/%s-live-chat.json", rootVideoPath, fileName)
+		liveChatConvertPath = fmt.Sprintf("%s/%s-chat-convert.json", rootVideoPath, fileName)
+	}
+
+	videoExtension := "mp4"
+
+	// Create VOD in DB
+	vodDTO := vod.Vod{
+		ID:                  vUUID,
+		ExtID:               clip.ID,
+		ClipExtVodID:        clip.VideoID,
+		Platform:            "twitch",
+		Type:                utils.Clip,
+		Title:               clip.Title,
+		Duration:            clip.Duration,
+		ClipVodOffset:       *clip.VodOffset,
+		Views:               int(clip.ViewCount),
+		Resolution:          input.Quality.String(),
+		Processing:          true,
+		ThumbnailPath:       fmt.Sprintf("%s/%s-thumbnail.jpg", rootVideoPath, fileName),
+		WebThumbnailPath:    fmt.Sprintf("%s/%s-web_thumbnail.jpg", rootVideoPath, fileName),
+		VideoPath:           fmt.Sprintf("%s/%s-video.%s", rootVideoPath, fileName, videoExtension),
+		ChatPath:            chatPath,
+		LiveChatPath:        liveChatPath,
+		ChatVideoPath:       chatVideoPath,
+		LiveChatConvertPath: liveChatConvertPath,
+		InfoPath:            fmt.Sprintf("%s/%s-info.json", rootVideoPath, fileName),
+		StreamedAt:          clip.CreatedAt,
+		FolderName:          folderName,
+		FileName:            fileName,
+		// create temporary paths
+		TmpVideoDownloadPath:    fmt.Sprintf("%s/%s_%s-video.%s", envConfig.TempDir, clip.ID, vUUID, videoExtension),
+		TmpVideoConvertPath:     fmt.Sprintf("%s/%s_%s-video-convert.%s", envConfig.TempDir, clip.ID, vUUID, videoExtension),
+		TmpChatDownloadPath:     fmt.Sprintf("%s/%s_%s-chat.json", envConfig.TempDir, clip.ID, vUUID),
+		TmpLiveChatDownloadPath: fmt.Sprintf("%s/%s_%s-live-chat.json", envConfig.TempDir, clip.ID, vUUID),
+		TmpLiveChatConvertPath:  fmt.Sprintf("%s/%s_%s-chat-convert.json", envConfig.TempDir, clip.ID, vUUID),
+		TmpChatRenderPath:       fmt.Sprintf("%s/%s_%s-chat.mp4", envConfig.TempDir, clip.ID, vUUID),
+	}
+
+	if config.Get().Archive.SaveAsHls {
+		vodDTO.TmpVideoHLSPath = fmt.Sprintf("%s/%s_%s-video_hls0", envConfig.TempDir, clip.ID, vUUID)
+		vodDTO.VideoHLSPath = fmt.Sprintf("%s/%s-video_hls", rootVideoPath, fileName)
+		vodDTO.VideoPath = fmt.Sprintf("%s/%s-video_hls/%s-video.m3u8", rootVideoPath, fileName, clip.ID)
+	}
+
+	v, err := s.VodService.CreateVod(vodDTO, channel.ID)
+	if err != nil {
+		return fmt.Errorf("error creating vod: %v", err)
+	}
+
+	// Create queue item
+	q, err := s.QueueService.CreateQueueItem(queue.Queue{LiveArchive: false, ArchiveChat: input.ArchiveChat, RenderChat: input.RenderChat}, v.ID)
+	if err != nil {
+		return fmt.Errorf("error creating queue item: %v", err)
+	}
+
+	// If chat is disabled update queue
+	if !input.ArchiveChat {
+		_, err := q.Update().SetChatProcessing(false).SetTaskChatDownload(utils.Success).SetTaskChatRender(utils.Success).SetTaskChatMove(utils.Success).Save(context.Background())
+		if err != nil {
+			return fmt.Errorf("error updating queue item: %v", err)
+		}
+		_, err = v.Update().SetChatPath("").SetChatVideoPath("").Save(context.Background())
+		if err != nil {
+			return fmt.Errorf("error updating vod: %v", err)
+		}
+	}
+
+	// If render chat is disabled update queue
+	if !input.RenderChat {
+		_, err := q.Update().SetTaskChatRender(utils.Success).SetRenderChat(false).Save(context.Background())
+		if err != nil {
+			return fmt.Errorf("error updating queue item: %v", err)
+		}
+		_, err = v.Update().SetChatVideoPath("").Save(context.Background())
+		if err != nil {
+			return fmt.Errorf("error updating vod: %v", err)
+		}
+	}
+
+	// Re-query queue from DB for updated values
+	q, err = s.QueueService.GetQueueItem(q.ID)
+	if err != nil {
+		return fmt.Errorf("error fetching queue item: %v", err)
+	}
+
+	taskInput := tasks.ArchiveVideoInput{
+		QueueId: q.ID,
+	}
+
+	// enqueue first task
+	_, err = s.RiverClient.Client.Insert(ctx, tasks.CreateDirectoryArgs{
+		Continue: true,
+		Input:    taskInput,
+	}, nil)
+
+	if err != nil {
+		return fmt.Errorf("error enqueueing task: %v", err)
+	}
+
+	return nil
+}
+
 func (s *Service) ArchiveLivestream(ctx context.Context, input ArchiveVideoInput) error {
 	envConfig := config.GetEnvConfig()
 
diff --git a/internal/auth/auth.go b/internal/auth/auth.go
index c57d7b3f..73f49310 100644
--- a/internal/auth/auth.go
+++ b/internal/auth/auth.go
@@ -4,12 +4,9 @@ import (
 	"context"
 	"fmt"
 	"strings"
-	"time"
 
 	"github.com/coreos/go-oidc/v3/oidc"
-	"github.com/golang-jwt/jwt/v4"
 	"github.com/google/uuid"
-	"github.com/labstack/echo/v4"
 	"github.com/rs/zerolog/log"
 	"github.com/zibbp/ganymede/ent"
 	entUser "github.com/zibbp/ganymede/ent/user"
@@ -27,9 +24,10 @@ type Service struct {
 		Provider *oidc.Provider
 		Config   oauth2.Config
 	}
+	EnvConfig *config.EnvConfig
 }
 
-func NewService(store *database.Database) *Service {
+func NewService(store *database.Database, envConfig *config.EnvConfig) *Service {
 	ctx := context.Background()
 	env := config.GetEnvConfig()
 
@@ -52,7 +50,11 @@ func NewService(store *database.Database) *Service {
 			ClientSecret: oauthClientSecret,
 			RedirectURL:  oauthRedirectURL,
 			Endpoint:     provider.Endpoint(),
-			Scopes:       []string{oidc.ScopeOpenID, "profile", oidc.ScopeOfflineAccess},
+			Scopes: []string{
+				oidc.ScopeOpenID,
+				"profile",
+				"groups",
+			},
 		}
 
 		err = FetchJWKS(ctx)
@@ -69,17 +71,13 @@ func NewService(store *database.Database) *Service {
 				Provider: provider,
 				Config:   config,
 			},
+			EnvConfig: envConfig,
 		}
 	} else {
 		return &Service{Store: store}
 	}
 }
 
-type ChangePassword struct {
-	OldPassword string `json:"old_password"`
-	NewPassword string `json:"new_password"`
-}
-
 func (s *Service) Register(ctx context.Context, user user.User) (*ent.User, error) {
 	if !config.Get().RegistrationEnabled {
 		return nil, fmt.Errorf("registration is disabled")
@@ -100,8 +98,8 @@ func (s *Service) Register(ctx context.Context, user user.User) (*ent.User, erro
 	return u, nil
 }
 
-func (s *Service) Login(c echo.Context, uDto user.User) (*ent.User, error) {
-	u, err := s.Store.Client.User.Query().Where(entUser.Username(uDto.Username)).Only(c.Request().Context())
+func (s *Service) Login(ctx context.Context, uDto user.User) (*ent.User, error) {
+	u, err := s.Store.Client.User.Query().Where(entUser.Username(uDto.Username)).Only(ctx)
 	if err != nil {
 		return nil, fmt.Errorf("invalid credentials")
 	}
@@ -110,94 +108,57 @@ func (s *Service) Login(c echo.Context, uDto user.User) (*ent.User, error) {
 		return nil, fmt.Errorf("invalid credentials")
 	}
 
-	uDto = user.User{
-		ID:       u.ID,
-		Username: u.Username,
-		Role:     u.Role,
-	}
+	// uDto = user.User{
+	// 	ID:       u.ID,
+	// 	Username: u.Username,
+	// 	Role:     u.Role,
+	// }
 
-	// generate access token
-	accessToken, exp, err := generateJWTToken(&uDto, time.Now().Add(1*time.Hour), []byte(GetJWTSecret()))
-	if err != nil {
-		return nil, fmt.Errorf("error generating access token: %v", err)
-	}
+	// // generate access token
+	// accessToken, exp, err := generateJWTToken(&uDto, time.Now().Add(1*time.Hour), []byte(GetJWTSecret()))
+	// if err != nil {
+	// 	return nil, fmt.Errorf("error generating access token: %v", err)
+	// }
 
-	// set access token cookie
-	setTokenCookie(c, accessTokenCookieName, accessToken, exp)
+	// // set access token cookie
+	// setTokenCookie(c, accessTokenCookieName, accessToken, exp)
 
-	// generate refresh token
-	refreshToken, exp, err := generateJWTToken(&uDto, time.Now().Add(30*24*time.Hour), []byte(GetJWTRefreshSecret()))
-	if err != nil {
-		return nil, fmt.Errorf("error generating refresh token: %v", err)
-	}
+	// // generate refresh token
+	// refreshToken, exp, err := generateJWTToken(&uDto, time.Now().Add(30*24*time.Hour), []byte(GetJWTRefreshSecret()))
+	// if err != nil {
+	// 	return nil, fmt.Errorf("error generating refresh token: %v", err)
+	// }
 
-	// set refresh token cookie
-	setTokenCookie(c, refreshTokenCookieName, refreshToken, exp)
+	// // set refresh token cookie
+	// setTokenCookie(c, refreshTokenCookieName, refreshToken, exp)
 
 	return u, nil
 }
 
-func (s *Service) Refresh(c echo.Context, refreshToken string) error {
-
-	tkn, err := jwt.Parse(refreshToken, func(token *jwt.Token) (interface{}, error) {
-		if _, ok := token.Method.(*jwt.SigningMethodHMAC); !ok {
-			return nil, fmt.Errorf("unexpected signing method: %v", token.Header["alg"])
-		}
-		return []byte(GetJWTRefreshSecret()), nil
-	})
-	if err != nil {
-		if err == jwt.ErrSignatureInvalid {
-			return fmt.Errorf("invalid refresh token")
-		}
-		return fmt.Errorf("error parsing refresh token: %v", err)
-	}
-
-	if claims, ok := tkn.Claims.(jwt.MapClaims); ok && tkn.Valid {
-		uID := claims["user_id"].(string)
-		uUUID, err := uuid.Parse(uID)
-		if err != nil {
-			return fmt.Errorf("error parsing user id: %v", err)
-		}
-		u, err := s.Store.Client.User.Query().Where(entUser.ID(uUUID)).Only(c.Request().Context())
-		if err != nil {
-			return fmt.Errorf("error getting user: %v", err)
-		}
-
-		// generate access token
-		accessToken, exp, err := generateJWTToken(&user.User{ID: u.ID, Username: u.Username, Role: u.Role}, time.Now().Add(1*time.Hour), []byte(GetJWTSecret()))
-		if err != nil {
-			return fmt.Errorf("error generating access token: %v", err)
-		}
-
-		// set access token cookie
-		setTokenCookie(c, accessTokenCookieName, accessToken, exp)
-
-		return nil
+func (s *Service) ChangePassword(ctx context.Context, userId uuid.UUID, oldPassword, newPassword string) error {
+	// sanity check
+	if oldPassword == newPassword {
+		return fmt.Errorf("new password must be different from old password")
 	}
 
-	return err
-}
-
-func (s *Service) Me(c *CustomContext) (*ent.User, error) {
-	return c.User, nil
-}
-
-func (s *Service) ChangePassword(c *CustomContext, passwordDto ChangePassword) error {
-	u, err := s.Store.Client.User.Query().Where(entUser.ID(c.User.ID)).Only(c.Request().Context())
+	// fetch user
+	u, err := s.Store.Client.User.Query().Where(entUser.ID(userId)).Only(ctx)
 	if err != nil {
 		return fmt.Errorf("error getting user: %v", err)
 	}
-	err = bcrypt.CompareHashAndPassword([]byte(u.Password), []byte(passwordDto.OldPassword))
+
+	// validate old password is correct
+	err = bcrypt.CompareHashAndPassword([]byte(u.Password), []byte(oldPassword))
 	if err != nil {
 		return fmt.Errorf("invalid credentials")
 	}
 
-	hashedPassword, err := bcrypt.GenerateFromPassword([]byte(passwordDto.NewPassword), 14)
+	hashedPassword, err := bcrypt.GenerateFromPassword([]byte(newPassword), 14)
 	if err != nil {
 		return fmt.Errorf("error hashing password: %v", err)
 	}
 
-	_, err = s.Store.Client.User.Update().Where(entUser.ID(c.User.ID)).SetPassword(string(hashedPassword)).Save(c.Request().Context())
+	_, err = u.Update().SetPassword(string(hashedPassword)).Save(ctx)
 	if err != nil {
 		return fmt.Errorf("error changing password: %v", err)
 	}
@@ -205,48 +166,64 @@ func (s *Service) ChangePassword(c *CustomContext, passwordDto ChangePassword) e
 	return nil
 }
 
-func (s *Service) OAuthUserCheck(c echo.Context, idTokenClaims UserInfo) error {
-	// Check if user exists, if not create it or update it
-	log.Debug().Msgf("Checking if oauth user exists: %v", idTokenClaims.NickName)
-	u, err := s.Store.Client.User.Query().Where(entUser.Sub(idTokenClaims.Sub)).Only(c.Request().Context())
+// OAuthUserCheck checks if the user from an OIDC flow needs to be created or updated.
+func (s *Service) OAuthUserCheck(ctx context.Context, userClaims OIDCCLaims) (*ent.User, error) {
+	log.Debug().Msgf("Checking if OAuth user exists: %v", userClaims.PreferredUsername)
+
+	// Check if user exists
+	user, err := s.Store.Client.User.Query().Where(entUser.Sub(userClaims.Sub)).Only(ctx)
 	if err != nil {
-		if ent.IsNotFound(err) {
-			log.Debug().Msgf("OAuth user not found, creating user: %v", idTokenClaims.NickName)
-			role := utils.Role("user")
-			// Check what groups the user is in
-			var groups []string
-			groups = append(groups, idTokenClaims.Groups...)
-			// If groups contain ganymede-*
-			if len(groups) > 0 {
-				for _, group := range groups {
-					if strings.Contains(group, "ganymede-") {
-						// Extract the role from the group
-						groupRole := strings.Replace(group, "ganymede-", "", 1)
-
-						// Check if role is exists in utils.Role enum
-						// TODO: make this use utils.Role enum
-						if groupRole == "admin" || groupRole == "editor" || groupRole == "archiver" || groupRole == "user" {
-							log.Debug().Msgf("Found Ganymede role in user group %v", group)
-							role = utils.Role(groupRole)
-						}
-					}
+		if !ent.IsNotFound(err) {
+			return nil, fmt.Errorf("failed to query user: %w", err)
+		}
+
+		log.Debug().Msgf("OAuth user not found, creating user: %v", userClaims.PreferredUsername)
+
+		// Determine role from groups
+		role := utils.UserRole
+		for _, group := range userClaims.Groups {
+			if strings.HasPrefix(group, "ganymede-") {
+				groupRole := strings.TrimPrefix(group, "ganymede-")
+				if utils.IsValidRole(groupRole) {
+					log.Debug().Msgf("Found Ganymede role in user group %v", group)
+					role = utils.Role(groupRole)
+					break
 				}
 			}
+		}
 
-			// Create user
-			_, err = s.Store.Client.User.Create().SetSub(idTokenClaims.Sub).SetUsername(idTokenClaims.NickName).SetRole(utils.Role(role)).SetOauth(true).Save(c.Request().Context())
-			if err != nil {
-				return fmt.Errorf("failed to create user: %w", err)
-			}
-		} else {
-			return fmt.Errorf("failed to query user: %w", err)
+		// Create new user
+		if _, err := s.Store.Client.User.Create().
+			SetSub(userClaims.Sub).
+			SetUsername(userClaims.PreferredUsername).
+			SetRole(role).
+			SetOauth(true).
+			Save(ctx); err != nil {
+			return nil, fmt.Errorf("failed to create user: %w", err)
 		}
-	} else {
-		// Update user
-		_, err = s.Store.Client.User.UpdateOne(u).SetUsername(idTokenClaims.NickName).Save(c.Request().Context())
-		if err != nil {
-			return fmt.Errorf("failed to update user: %w", err)
+		return user, nil
+	}
+
+	// Determine role from groups
+	newRole := utils.UserRole
+	for _, group := range userClaims.Groups {
+		if strings.HasPrefix(group, "ganymede-") {
+			groupRole := strings.TrimPrefix(group, "ganymede-")
+			if utils.IsValidRole(groupRole) {
+				log.Debug().Msgf("Found Ganymede role in user group %v", group)
+				newRole = utils.Role(groupRole)
+				break
+			}
 		}
 	}
-	return nil
+
+	// Update existing user
+	if _, err := s.Store.Client.User.UpdateOne(user).
+		SetUsername(userClaims.PreferredUsername).
+		SetRole(newRole).
+		Save(ctx); err != nil {
+		return nil, fmt.Errorf("failed to update user: %w", err)
+	}
+
+	return user, nil
 }
diff --git a/internal/auth/auth_test.go b/internal/auth/auth_test.go
deleted file mode 100644
index 2bbf68f0..00000000
--- a/internal/auth/auth_test.go
+++ /dev/null
@@ -1,73 +0,0 @@
-package auth_test
-
-import (
-	"context"
-	"encoding/base64"
-	"encoding/json"
-	"net/http/httptest"
-	"strings"
-	"testing"
-
-	"github.com/golang-jwt/jwt/v4"
-	"github.com/labstack/echo/v4"
-	"github.com/stretchr/testify/assert"
-	"github.com/zibbp/ganymede/internal/user"
-	"github.com/zibbp/ganymede/tests"
-)
-
-func TestRegister(t *testing.T) {
-	ctx := context.Background()
-	app, err := tests.Setup(t)
-	assert.NoError(t, err)
-
-	// test Register
-	usr, err := app.AuthService.Register(ctx, user.User{Username: "test_user", Password: "password"})
-	assert.NoError(t, err)
-	assert.Equal(t, "test_user", usr.Username)
-}
-
-func TestLogin(t *testing.T) {
-	ctx := context.Background()
-	app, err := tests.Setup(t)
-	assert.NoError(t, err)
-
-	e := echo.New()
-	req := httptest.NewRequest("POST", "/api/v1/auth/login", nil)
-	rec := httptest.NewRecorder()
-
-	echoCtx := e.NewContext(req, rec)
-
-	_, err = app.AuthService.Register(ctx, user.User{Username: "test_user", Password: "password"})
-	assert.NoError(t, err)
-
-	// test Login
-	usr, err := app.AuthService.Login(echoCtx, user.User{Username: "admin", Password: "ganymede"})
-	assert.NoError(t, err)
-	assert.Equal(t, "admin", usr.Username)
-
-	setCookies := rec.Header().Values("Set-Cookie")
-
-	// test cookies are valid jwt tokens
-	for _, cookie := range setCookies {
-		// example cookie:
-		// refresh-token=eyJhbGciOiJIUzI1NiIsInR5cCI6IkpXVCJ9.eyJ1c2VyX2lkIjoiNmRmNWFiNDctMzNiOC00ZWFjLWE2M2QtYjlhZjhlMmRiNWRjIiwidXNlcm5hbWUiOiJhZG1pbiIsInJvbGUiOiJhZG1pbiIsImV4cCI6MTcyNTg1NDM0NX0.wltMCYWMwbV6BqU2PM7PLIWIy9uqJmGN5N50oNLpWSY; Path=/; Expires=Mon, 09 Sep 2024 03:59:05 GMT; SameSite=Lax
-		split := strings.Split(cookie, ";")
-		token := strings.Split(split[0], "=")[1]
-
-		assert.NotEmpty(t, token)
-
-		parts := strings.Split(token, ".")
-
-		assert.Equal(t, 3, len(parts))
-
-		payload, err := base64.RawURLEncoding.DecodeString(parts[1])
-		assert.NoError(t, err)
-
-		var claims jwt.MapClaims
-		err = json.Unmarshal(payload, &claims)
-		assert.NoError(t, err)
-		assert.Equal(t, usr.ID.String(), claims["user_id"])
-		assert.Equal(t, usr.Username, claims["username"])
-		assert.Equal(t, string(usr.Role), claims["role"])
-	}
-}
diff --git a/internal/auth/jwt.go b/internal/auth/jwt.go
deleted file mode 100644
index 4662de12..00000000
--- a/internal/auth/jwt.go
+++ /dev/null
@@ -1,106 +0,0 @@
-package auth
-
-import (
-	"net/http"
-	"time"
-
-	"github.com/golang-jwt/jwt/v5"
-	"github.com/google/uuid"
-	"github.com/labstack/echo/v4"
-	"github.com/zibbp/ganymede/internal/config"
-	"github.com/zibbp/ganymede/internal/user"
-	"github.com/zibbp/ganymede/internal/utils"
-)
-
-const (
-	accessTokenCookieName  = "access-token"
-	refreshTokenCookieName = "refresh-token"
-)
-
-type Claims struct {
-	UserID   uuid.UUID  `json:"user_id"`
-	Username string     `json:"username"`
-	Role     utils.Role `json:"role"`
-	jwt.RegisteredClaims
-}
-
-func GetJWTSecret() string {
-	env := config.GetEnvApplicationConfig()
-	jwtSecret := env.JWTSecret
-	return jwtSecret
-}
-func GetJWTRefreshSecret() string {
-	env := config.GetEnvApplicationConfig()
-	jwtRefreshSecret := env.JWTRefreshSecret
-	return jwtRefreshSecret
-}
-
-// generateJWTToken generates a new JWT token for the user.
-func generateJWTToken(user *user.User, expirationTime time.Time, secret []byte) (string, time.Time, error) {
-	// Create the JWT claims, which includes the username and expiry time.
-	claims := &Claims{
-		UserID:   user.ID,
-		Username: user.Username,
-		Role:     user.Role,
-		RegisteredClaims: jwt.RegisteredClaims{
-			// In JWT, the expiry time is expressed as unix milliseconds.
-			ExpiresAt: jwt.NewNumericDate(expirationTime),
-		},
-	}
-
-	// Declare the token with the HS256 algorithm used for signing, and the claims.
-	token := jwt.NewWithClaims(jwt.SigningMethodHS256, claims)
-
-	// Create the JWT string.
-	tokenString, err := token.SignedString(secret)
-	if err != nil {
-		return "", time.Now(), err
-	}
-
-	return tokenString, expirationTime, nil
-}
-
-// setTokenCookie sets the cookie with the token.
-func setTokenCookie(c echo.Context, name string, token string, expiration time.Time) {
-	// Get optional cookie domain name
-	env := config.GetEnvConfig()
-	cookieDomain := env.CookieDomain
-	cookie := new(http.Cookie)
-	cookie.Name = name
-	cookie.Value = token
-	cookie.Expires = expiration
-	cookie.Path = "/"
-	// Frontend uses the contents of the cookie - not the best but it works.
-	cookie.HttpOnly = false
-	cookie.SameSite = http.SameSiteLaxMode
-	if cookieDomain != "" {
-		cookie.Domain = cookieDomain
-	}
-
-	c.SetCookie(cookie)
-}
-
-// checkAccessToken checks if the JWT access token is valid.
-func checkAccessToken(accessToken string) (*Claims, error) {
-	// Parse the token.
-	token, err := jwt.ParseWithClaims(accessToken, &Claims{}, func(token *jwt.Token) (interface{}, error) {
-		return []byte(GetJWTSecret()), nil
-	})
-	if err != nil {
-		return nil, err
-	}
-
-	// Validate the token and return the custom claims.
-	claims, ok := token.Claims.(*Claims)
-	if !ok || !token.Valid {
-		return nil, err
-	}
-
-	return claims, nil
-}
-
-// JWTErrorChecker will be executed when user try to access a protected path.
-func JWTErrorChecker(err error, c echo.Context) error {
-	// Redirects to the signIn form.
-	return echo.NewHTTPError(http.StatusUnauthorized, "unauthorized")
-}
diff --git a/internal/auth/middleware.go b/internal/auth/middleware.go
deleted file mode 100644
index 650fee3e..00000000
--- a/internal/auth/middleware.go
+++ /dev/null
@@ -1,136 +0,0 @@
-package auth
-
-import (
-	"github.com/google/uuid"
-	"github.com/labstack/echo/v4"
-	"github.com/rs/zerolog/log"
-	"github.com/zibbp/ganymede/ent"
-	entUser "github.com/zibbp/ganymede/ent/user"
-	"github.com/zibbp/ganymede/internal/database"
-	"github.com/zibbp/ganymede/internal/utils"
-	"net/http"
-)
-
-type CustomContext struct {
-	echo.Context
-	User *ent.User
-}
-
-func GuardMiddleware(next echo.HandlerFunc) echo.HandlerFunc {
-	return func(c echo.Context) error {
-		// Check if user has a valid access token
-		accessToken, err := c.Cookie("access-token")
-		if err != nil {
-			// Check if user has oauth2 token
-			oauthAccessToken, err := c.Cookie("oauth_access_token")
-			if err != nil {
-				return echo.NewHTTPError(http.StatusUnauthorized, "Invalid access token")
-			}
-
-			if oauthAccessToken.Value == "" {
-				return echo.NewHTTPError(http.StatusUnauthorized, "Invalid access token")
-			}
-
-			// Check if user has a valid access token
-			userClaims, err := CheckOAuthAccessToken(c, oauthAccessToken.Value)
-			if err != nil {
-				log.Debug().Err(err).Msg("OAuth access token is invalid")
-				return echo.NewHTTPError(http.StatusUnauthorized, "Invalid access token")
-			}
-
-			c.Set("auth_method", "oauth")
-			c.Set("user.sub", userClaims.Sub)
-			c.Set("user.username", userClaims.NickName)
-			c.Set("access_token", oauthAccessToken.Value)
-			return next(c)
-		}
-
-		// Check if user has a valid refresh token
-		userClaims, err := checkAccessToken(accessToken.Value)
-		if err != nil {
-			log.Debug().Err(err).Msg("Access token is invalid")
-			return echo.NewHTTPError(http.StatusUnauthorized, "Invalid access token")
-		}
-
-		c.Set("auth_method", "local")
-		c.Set("user.id", userClaims.UserID)
-		c.Set("user.username", userClaims.Username)
-		c.Set("access_token", accessToken.Value)
-		return next(c)
-	}
-}
-
-func GetUserMiddleware(next echo.HandlerFunc) echo.HandlerFunc {
-	return func(c echo.Context) error {
-		authMethod := c.Get("auth_method").(string)
-		if authMethod == "local" {
-			id := c.Get("user.id").(uuid.UUID)
-
-			user, err := database.DB().Client.User.Query().Where(entUser.ID(id)).Only(c.Request().Context())
-			if err != nil {
-				// If user not found throw the same error as to not give hints about issue
-				return echo.NewHTTPError(http.StatusUnauthorized, "Invalid access token")
-			}
-			cc := &CustomContext{
-				Context: c,
-				User:    user,
-			}
-			return next(cc)
-		}
-		if authMethod == "oauth" {
-			sub := c.Get("user.sub").(string)
-			// Get user
-			user, err := database.DB().Client.User.Query().Where(entUser.Sub(sub)).Only(c.Request().Context())
-			if err != nil {
-				// If user not found throw the same error as to not give hints about issue
-				return echo.NewHTTPError(http.StatusInternalServerError, "Invalid access token")
-			}
-
-			cc := &CustomContext{
-				Context: c,
-				User:    user,
-			}
-			return next(cc)
-		}
-		return next(c)
-	}
-}
-
-func UserRoleMiddleware(role utils.Role) echo.MiddlewareFunc {
-	return func(next echo.HandlerFunc) echo.HandlerFunc {
-		return func(c echo.Context) error {
-			cc := c.(*CustomContext)
-
-			switch role {
-			case utils.AdminRole:
-				if cc.User.Role == utils.AdminRole {
-					return next(c)
-				}
-				return echo.NewHTTPError(http.StatusForbidden, "You are not authorized to access this resource")
-			case utils.EditorRole:
-				if cc.User.Role == utils.EditorRole || cc.User.Role == utils.AdminRole {
-					return next(c)
-				}
-				return echo.NewHTTPError(http.StatusForbidden, "You are not authorized to access this resource")
-			case utils.ArchiverRole:
-				if cc.User.Role == utils.ArchiverRole || cc.User.Role == utils.EditorRole || cc.User.Role == utils.AdminRole {
-					return next(c)
-				}
-				return echo.NewHTTPError(http.StatusForbidden, "You are not authorized to access this resource")
-			case utils.UserRole:
-				if cc.User.Role == utils.UserRole || cc.User.Role == utils.ArchiverRole || cc.User.Role == utils.EditorRole || cc.User.Role == utils.AdminRole {
-					return next(c)
-				}
-				return echo.NewHTTPError(http.StatusForbidden, "You are not authorized to access this resource")
-			default:
-				return echo.NewHTTPError(http.StatusForbidden, "You are not authorized to access this resource")
-			}
-		}
-	}
-}
-
-// GetUserClaims - returns user's claims
-func GetUserClaims(c echo.Context) *ent.User {
-	cc := c.(*CustomContext)
-	return cc.User
-}
diff --git a/internal/auth/oauth.go b/internal/auth/oauth.go
index 39ac0a82..6916ac04 100644
--- a/internal/auth/oauth.go
+++ b/internal/auth/oauth.go
@@ -8,15 +8,13 @@ import (
 	"fmt"
 	"io"
 	"net/http"
-	"strings"
-	"time"
 
-	"github.com/MicahParks/keyfunc"
 	"github.com/coreos/go-oidc/v3/oidc"
 	"github.com/go-jose/go-jose/v4"
 	"github.com/golang-jwt/jwt/v4"
 	"github.com/labstack/echo/v4"
 	"github.com/rs/zerolog/log"
+	"github.com/zibbp/ganymede/ent"
 	"github.com/zibbp/ganymede/internal/config"
 	"github.com/zibbp/ganymede/internal/kv"
 	"golang.org/x/oauth2"
@@ -26,6 +24,16 @@ type OAuthClaims struct {
 	jwt.RegisteredClaims
 }
 
+type OIDCCLaims struct {
+	Sub               string   `json:"sub"`
+	Nonce             string   `json:"nonce"`
+	Name              string   `json:"name"`
+	GivenName         string   `json:"given_name"`
+	PreferredUsername string   `json:"preferred_username"`
+	Nickname          string   `json:"nickname"`
+	Groups            []string `json:"groups"`
+}
+
 type UserInfo struct {
 	Sub               string   `json:"sub"`
 	Exp               int64    `json:"exp"`
@@ -43,138 +51,147 @@ type OAuthResponse struct {
 	UserInfo    UserInfo
 }
 
+func generateSecureRandomString() (string, error) {
+	b := make([]byte, 32)
+	_, err := rand.Read(b)
+	if err != nil {
+		return "", err
+	}
+	return base64.URLEncoding.EncodeToString(b), nil
+}
+
 func (s *Service) OAuthRedirect(c echo.Context) error {
-	state, err := randString(32)
+	// generate state and nonce
+	state, err := generateSecureRandomString()
 	if err != nil {
 		return err
 	}
-	nonce, err := randString(32)
+	nonce, err := generateSecureRandomString()
 	if err != nil {
 		return err
 	}
-	setCallbackCookie(c, "oauth_state", state)
-	setCallbackCookie(c, "oauth_nonce", nonce)
 
-	url := s.OAuth.Config.AuthCodeURL(state, oidc.Nonce(nonce))
-	err = c.Redirect(http.StatusTemporaryRedirect, url)
+	stateCookie := new(http.Cookie)
+	stateCookie.Name = "oidc_state"
+	stateCookie.Value = state
+	stateCookie.Path = "/"
+	stateCookie.HttpOnly = true
+	stateCookie.SameSite = http.SameSiteLaxMode
+	c.SetCookie(stateCookie)
+
+	nonceCookie := new(http.Cookie)
+	nonceCookie.Name = "oidc_nonce"
+	nonceCookie.Value = nonce
+	nonceCookie.Path = "/"
+	nonceCookie.HttpOnly = true
+	nonceCookie.SameSite = http.SameSiteLaxMode
+	c.SetCookie(nonceCookie)
+
+	authURL := s.OAuth.Config.AuthCodeURL(state,
+		oauth2.SetAuthURLParam("nonce", nonce),
+		oauth2.AccessTypeOffline,
+	)
+	err = c.Redirect(http.StatusTemporaryRedirect, authURL)
 	if err != nil {
 		return err
 	}
 	return nil
 }
 
-func (s *Service) OAuthCallback(c echo.Context) error {
-	state, err := c.Cookie("oauth_state")
+func (s *Service) OAuthCallback(c echo.Context) (*ent.User, error) {
+	// Retrieve and validate state
+	stateCookie, err := c.Cookie("oidc_state")
 	if err != nil {
-		return fmt.Errorf("state cookie not found: %w", err)
+		return nil, fmt.Errorf("state cookie not found: %w", err)
 	}
-	// Validate state
-	if state.Value != c.QueryParam("state") {
-		return fmt.Errorf("invalid oauth state, expected '%s', got '%s'", state.Value, c.QueryParam("state"))
+
+	// Retrieve and validate nonce
+	nonceCookie, err := c.Cookie("oidc_nonce")
+	if err != nil {
+		return nil, fmt.Errorf("nonce cookie not found: %w", err)
 	}
-	// Exchange code for token
+
+	// Verify state to prevent CSRF
+	urlState := c.QueryParam("state")
+	if urlState != stateCookie.Value {
+		return nil, fmt.Errorf("invalid state parameter")
+	}
+
+	// Exchange authorization code for tokens
 	oauth2Token, err := s.OAuth.Config.Exchange(c.Request().Context(), c.QueryParam("code"))
 	if err != nil {
-		return fmt.Errorf("failed to exchange token: %w", err)
+		return nil, fmt.Errorf("failed to exchange token: %w", err)
 	}
 
-	verifier := s.OAuth.Provider.Verifier(&oidc.Config{ClientID: s.OAuth.Config.ClientID})
-
+	// Extract the ID token
 	rawIDToken, ok := oauth2Token.Extra("id_token").(string)
 	if !ok {
-		return fmt.Errorf("no id_token field in oauth2 token")
+		return nil, fmt.Errorf("no ID token")
 	}
 
+	// Verify ID token
+	verifier := s.OAuth.Provider.Verifier(&oidc.Config{ClientID: s.OAuth.Config.ClientID})
 	idToken, err := verifier.Verify(c.Request().Context(), rawIDToken)
 	if err != nil {
-		return fmt.Errorf("failed to verify ID token: %w", err)
-	}
-	nonce, err := c.Cookie("oauth_nonce")
-	if err != nil {
-		return fmt.Errorf("nonce cookie not found: %w", err)
+		return nil, fmt.Errorf("failed to verify ID token: %w", err)
 	}
 
-	if idToken.Nonce != nonce.Value {
-		return fmt.Errorf("invalid nonce, expected '%s', got '%s'", nonce.Value, idToken.Nonce)
+	var claims OIDCCLaims
+
+	if err := idToken.Claims(&claims); err != nil {
+		return nil, fmt.Errorf("failed to parse claims: %w", err)
 	}
 
-	resp := struct {
-		OAuth2Token   *oauth2.Token
-		IDTokenClaims *json.RawMessage
-	}{oauth2Token, new(json.RawMessage)}
-	if err := idToken.Claims(&resp.IDTokenClaims); err != nil {
-		return fmt.Errorf("failed to decode ID token claims: %w", err)
+	// Debug claims in dev
+	if s.EnvConfig.Development {
+		err := debugOidcClaims(idToken)
+		if err != nil {
+			return nil, err
+		}
 	}
 
-	// Do we need to verify the token??
-	// Verify
-	//err = idToken.VerifyAccessToken(oauth2Token.AccessToken)
-	//if err != nil {
-	//	return fmt.Errorf("failed to verify access token: %w", err)
-	//}
+	// Verify nonce to prevent replay attack
+	if claims.Nonce != nonceCookie.Value {
+		return nil, fmt.Errorf("invalid nonce")
+	}
 
-	// User check
-	var userInfo UserInfo
-	err = idToken.Claims(&userInfo)
+	// Clear cookies
+	clearCookie(c, "oidc_state")
+	clearCookie(c, "oidc_nonce")
 
-	// some providers don't return nickname
-	if userInfo.NickName == "" {
-		userInfo.NickName = userInfo.PreferredUsername
-	}
-	if userInfo.Sub == "" || userInfo.NickName == "" {
-		return fmt.Errorf("invalid user info: %w", err)
+	// assert required fields
+	if claims.PreferredUsername == "" {
+		return nil, fmt.Errorf("preferred_username required, ensure your idP is returning this claim")
 	}
 
-	err = s.OAuthUserCheck(c, userInfo)
+	// create or update user
+	user, err := s.OAuthUserCheck(c.Request().Context(), claims)
 	if err != nil {
-		return fmt.Errorf("failed to check user: %w", err)
+		return nil, fmt.Errorf("error creating or updating users: %v", err)
 	}
 
-	// Get access token expiry
-	accessTokenExpire := time.Now().Add(time.Duration(oauth2Token.Expiry.Unix()-time.Now().Unix()) * time.Second)
-	// Get refresh token expiry
-	refreshTokenExpire := time.Now().Add(30 * 24 * time.Hour)
-
-	// Set cookies
-	setOauthCookie(c, "oauth_access_token", oauth2Token.AccessToken, accessTokenExpire)
-	setOauthCookie(c, "oauth_refresh_token", oauth2Token.RefreshToken, refreshTokenExpire)
-
-	return nil
+	return user, nil
 }
 
-func (s *Service) OAuthTokenRefresh(c echo.Context, refreshToken string) error {
-	token := &oauth2.Token{
-		RefreshToken: refreshToken,
-	}
+func debugOidcClaims(idToken *oidc.IDToken) error {
+	var claimsDebug map[string]interface{}
 
-	newToken, err := s.OAuth.Config.TokenSource(c.Request().Context(), token).Token()
-	if err != nil {
-		return fmt.Errorf("failed to refresh token: %w", err)
+	// Extract all claims into the map
+	if err := idToken.Claims(&claimsDebug); err != nil {
+		return fmt.Errorf("failed to parse claims: %v", err)
 	}
-	accessTokenExpire := time.Now().Add(time.Duration(newToken.Expiry.Unix()-time.Now().Unix()) * time.Second)
-	refreshTokenExpire := time.Now().Add(30 * 24 * time.Hour)
-	setOauthCookie(c, "oauth_access_token", newToken.AccessToken, accessTokenExpire)
-	setOauthCookie(c, "oauth_refresh_token", newToken.RefreshToken, refreshTokenExpire)
-	return nil
-}
 
-func (s *Service) OAuthLogout(c echo.Context) error {
-	// Session end
-	// https://openid.net/specs/openid-connect-session-1_0.html#RPLogout
+	// Pretty print all claims
+	fmt.Println("=== DEBUG: ALL TOKEN CLAIMS ===")
 
-	var endpoints struct {
-		RevocationEndpoint string `json:"revocation_endpoint"`
-		EndSessionEndpoint string `json:"end_session_endpoint"`
-	}
-	err := s.OAuth.Provider.Claims(&endpoints)
+	// Use JSON marshaling for a nice, readable output
+	prettyJSON, err := json.MarshalIndent(claimsDebug, "", "  ")
 	if err != nil {
-		return fmt.Errorf("failed to get endpoints: %w", err)
+		return fmt.Errorf("failed to format claims: %v", err)
 	}
 
-	clearCookie(c, "oauth_access_token")
-	clearCookie(c, "oauth_refresh_token")
-	clearCookie(c, "oauth_state")
-	clearCookie(c, "oauth_nonce")
+	fmt.Println(string(prettyJSON))
+	fmt.Println("=== END OF CLAIMS ===")
 
 	return nil
 }
@@ -183,96 +200,8 @@ func clearCookie(c echo.Context, name string) {
 	cookie := new(http.Cookie)
 	cookie.Name = name
 	cookie.Value = ""
-	cookie.Expires = time.Now().Add(-1 * time.Hour)
-	cookie.Path = "/"
-	c.SetCookie(cookie)
-}
-
-func CheckOAuthAccessToken(c echo.Context, accessToken string) (*UserInfo, error) {
-	env := config.GetEnvConfig()
-	// Get JWKS from KV store
-	jwksString := kv.DB().Get("jwks")
-	if jwksString == "" {
-		return nil, fmt.Errorf("jwks not found")
-	}
-	// Parse JWKS
-	jwks, err := keyfunc.NewJSON(json.RawMessage(jwksString))
-	if err != nil {
-		return nil, fmt.Errorf("failed to parse jwks: %w", err)
-	}
-	// Remove new line characters from access token
-	newAccessToken := strings.Replace(accessToken, "\n", "", -1)
-
-	// Parse token - this will also verify the signature
-	token, err := jwt.Parse(newAccessToken, jwks.Keyfunc)
-	if err != nil {
-		return nil, fmt.Errorf("failed to parse access token: %w", err)
-	}
-
-	if !token.Valid {
-		return nil, fmt.Errorf("invalid access token")
-	}
-
-	// Check aud
-	aud := token.Claims.(jwt.MapClaims)["aud"]
-	if aud != env.OAuthClientID {
-		return nil, fmt.Errorf("invalid aud claim")
-	}
-
-	claims, ok := token.Claims.(jwt.MapClaims)
-	if !ok {
-		return nil, fmt.Errorf("failed to parse claims")
-	}
-
-	userInfo := UserInfo{
-		Sub:      claims["sub"].(string),
-		NickName: claims["nickname"].(string),
-	}
-
-	return &userInfo, nil
-}
-
-func randString(nByte int) (string, error) {
-	b := make([]byte, nByte)
-	if _, err := io.ReadFull(rand.Reader, b); err != nil {
-		return "", err
-	}
-	return base64.RawURLEncoding.EncodeToString(b), nil
-}
-
-func setCallbackCookie(c echo.Context, name, value string) {
-	env := config.GetEnvConfig()
-	cookieDomain := env.CookieDomain
-	cookie := new(http.Cookie)
-	cookie.Name = name
-	cookie.Value = value
-	cookie.Expires = time.Now().Add(1 * time.Hour)
-	cookie.Path = "/"
-	// Http-only helps mitigate the risk of client side script accessing the protected cookie.
-	cookie.HttpOnly = false
-	cookie.SameSite = http.SameSiteLaxMode
-	if cookieDomain != "" {
-		cookie.Domain = cookieDomain
-	}
-
-	c.SetCookie(cookie)
-}
-
-func setOauthCookie(c echo.Context, name, value string, time time.Time) {
-	env := config.GetEnvConfig()
-	cookieDomain := env.CookieDomain
-	cookie := new(http.Cookie)
-	cookie.Name = name
-	cookie.Value = value
-	cookie.Expires = time
+	cookie.MaxAge = -1
 	cookie.Path = "/"
-	// Http-only helps mitigate the risk of client side script accessing the protected cookie.
-	cookie.HttpOnly = false
-	cookie.SameSite = http.SameSiteLaxMode
-	if cookieDomain != "" {
-		cookie.Domain = cookieDomain
-	}
-
 	c.SetCookie(cookie)
 }
 
diff --git a/internal/channel/channel.go b/internal/channel/channel.go
index 3c96365c..97dfae7d 100644
--- a/internal/channel/channel.go
+++ b/internal/channel/channel.go
@@ -88,6 +88,21 @@ func (s *Service) GetChannelByName(cName string) (*ent.Channel, error) {
 	return cha, nil
 }
 
+// GetChannelByExtId returns the channel by it's external (platform) ID.
+func (s *Service) GetChannelByExtId(id string) (*ent.Channel, error) {
+	cha, err := s.Store.Client.Channel.Query().Where(channel.ExtID(id)).Only(context.Background())
+	if err != nil {
+		// if channel not found
+		if _, ok := err.(*ent.NotFoundError); ok {
+			return nil, fmt.Errorf("channel not found")
+		}
+		log.Debug().Err(err).Msg("error getting channel")
+		return nil, fmt.Errorf("error getting channel: %v", err)
+	}
+
+	return cha, nil
+}
+
 func (s *Service) DeleteChannel(channelID uuid.UUID) error {
 	err := s.Store.Client.Channel.DeleteOneID(channelID).Exec(context.Background())
 	if err != nil {
@@ -131,6 +146,22 @@ func (s *Service) CheckChannelExists(cName string) bool {
 	return true
 }
 
+// CheckChannelExistsByExtId returns a bool whether a channel exists using the external (platform) ID
+func (s *Service) CheckChannelExistsByExtId(id string) bool {
+	_, err := s.Store.Client.Channel.Query().Where(channel.ExtID(id)).Only(context.Background())
+	if err != nil {
+		fmt.Println(err)
+		// if channel not found
+		if _, ok := err.(*ent.NotFoundError); ok {
+			return false
+		}
+		log.Error().Err(err).Msg("error checking channel exists")
+		return false
+	}
+
+	return true
+}
+
 func (s *Service) PopulateExternalChannelID(ctx context.Context) {
 	channels, err := database.DB().Client.Channel.Query().All(context.Background())
 	if err != nil {
diff --git a/internal/config/env.go b/internal/config/env.go
index 364510e1..88364374 100644
--- a/internal/config/env.go
+++ b/internal/config/env.go
@@ -15,16 +15,13 @@ type EnvApplicationConfig struct {
 	DB_NAME          string `env:"DB_NAME, required"`
 	DB_SSL           string `env:"DB_SSL, default=disable"`
 	DB_SSL_ROOT_CERT string `env:"DB_SSL_ROOT_CERT, default="`
-	JWTSecret        string `env:"JWT_SECRET, required"`
-	JWTRefreshSecret string `env:"JWT_REFRESH_SECRET, required"`
-	FrontendHost     string `env:"FRONTEND_HOST, required"`
 }
 
 // EnvConfig represents the environment variables for the application
 type EnvConfig struct {
 	// application
-	DEBUG        bool   `env:"DEBUG, default=false"`
-	CookieDomain string `env:"COOKIE_DOMAIN, default="`
+	Development bool `env:"DEVELOPMENT"`
+	DEBUG       bool `env:"DEBUG, default=false"`
 	// customizable paths
 	VideosDir            string `env:"VIDEOS_DIR, default=/data/videos"`
 	TempDir              string `env:"TEMP_DIR, default=/data/temp"`
diff --git a/internal/config/env_test.go b/internal/config/env_test.go
index db4ac569..0bcdf5e6 100644
--- a/internal/config/env_test.go
+++ b/internal/config/env_test.go
@@ -34,17 +34,12 @@ func TestGetEnvRequiredConfig(t *testing.T) {
 	assert.Equal(t, "postgres", env.DB_USER)
 	assert.Equal(t, "password", env.DB_PASS)
 	assert.Equal(t, "ganymede", env.DB_NAME)
-	assert.Equal(t, "secret", env.JWTSecret)
-	assert.Equal(t, "refresh_secret", env.JWTRefreshSecret)
-	assert.Equal(t, "localhost", env.FrontendHost)
 
 	os.Unsetenv("DB_HOST")
 	os.Unsetenv("DB_PORT")
 	os.Unsetenv("DB_USER")
 	os.Unsetenv("DB_PASS")
 	os.Unsetenv("DB_NAME")
-	os.Unsetenv("JWT_SECRET")
-	os.Unsetenv("JWT_REFRESH_SECRET")
 	os.Unsetenv("FRONTEND_HOST")
 }
 
diff --git a/internal/exec/exec.go b/internal/exec/exec.go
index 33ebd046..56361ee7 100644
--- a/internal/exec/exec.go
+++ b/internal/exec/exec.go
@@ -32,8 +32,19 @@ func DownloadTwitchVideo(ctx context.Context, video ent.Vod) error {
 	defer file.Close()
 	log.Debug().Str("video_id", video.ID.String()).Msgf("logging streamlink output to %s", logFilePath)
 
+	videoURL := fmt.Sprintf("https://twitch.tv/videos/%s", video.ExtID)
+	// clip requires a different URL schema
+	if video.Type == utils.Clip {
+		vC := video.QueryChannel()
+		channel, err := vC.Only(ctx)
+		if err != nil {
+			return err
+		}
+		videoURL = fmt.Sprintf("https://twitch.tv/%s/clip/%s", channel.DisplayName, video.ExtID)
+	}
+
 	var cmdArgs []string
-	cmdArgs = append(cmdArgs, fmt.Sprintf("https://twitch.tv/videos/%s", video.ExtID), fmt.Sprintf("%s,best", video.Resolution), "--progress=force", "--force")
+	cmdArgs = append(cmdArgs, videoURL, fmt.Sprintf("%s,best", video.Resolution), "--progress=force", "--force")
 
 	// check if user has twitch token set
 	// if so, set token in streamlink command
diff --git a/internal/exec/thumbnails.go b/internal/exec/thumbnails.go
new file mode 100644
index 00000000..a23ff77e
--- /dev/null
+++ b/internal/exec/thumbnails.go
@@ -0,0 +1,138 @@
+package exec
+
+import (
+	"fmt"
+	"image"
+	"image/draw"
+	"image/jpeg"
+	"os"
+	"os/exec"
+	"path/filepath"
+	"strconv"
+	"strings"
+)
+
+type GenerateThumbnailsInput struct {
+	Video        string
+	Interval     int
+	ThumbnailDir string
+	Width        int
+	Height       int
+}
+
+type CreateSpritesInput struct {
+	SpriteDir    string
+	ThumbnailDir string
+	Width        int
+	Height       int
+	TilesX       int
+	TilesY       int
+}
+
+// GenerateThumbnails extracts frames from the video at specified intervals.
+func GenerateThumbnails(config GenerateThumbnailsInput) error {
+	// Get video duration using ffprobe
+	cmd := exec.Command("ffprobe", "-v", "error", "-show_entries", "format=duration", "-of", "csv=p=0", config.Video)
+	output, err := cmd.Output()
+	if err != nil {
+		return fmt.Errorf("failed to get video duration: %w", err)
+	}
+
+	// Parse duration and calculate frames
+	duration, err := strconv.ParseFloat(strings.TrimSpace(string(output)), 64)
+	if err != nil {
+		return fmt.Errorf("failed to parse video duration: %w", err)
+	}
+
+	// Extract frames at intervals
+	format := fmt.Sprintf("frame%%0%dd.jpg", 8)
+	for t := 0; t < int(duration); t += config.Interval {
+		outputPath := filepath.Join(config.ThumbnailDir, fmt.Sprintf(format, t))
+		ffmpegArgs := []string{
+			"-hide_banner", "-an", "-ss", strconv.Itoa(t), "-i", config.Video,
+			"-frames:v", "1",
+			"-q:v", "10",
+			"-vf", fmt.Sprintf("scale=%d:%d", config.Width, config.Height),
+			"-y",
+			outputPath,
+		}
+		cmd := exec.Command("ffmpeg", ffmpegArgs...)
+		ffmpegOutput, err := cmd.CombinedOutput()
+		if err != nil {
+			return fmt.Errorf(
+				"failed to extract frame at %ds: %w\nCommand: ffmpeg %s\nOutput: %s",
+				t, err, strings.Join(ffmpegArgs, " "), string(ffmpegOutput),
+			)
+		}
+	}
+	return nil
+}
+
+// CreateSprites generates multiple sprite images, each containing a maximum of tilesX * tilesY thumbnails.
+func CreateSprites(config CreateSpritesInput) ([]string, error) {
+	// Read thumbnail files
+	thumbFiles, err := filepath.Glob(filepath.Join(config.ThumbnailDir, "frame*.jpg"))
+	if err != nil {
+		return nil, fmt.Errorf("failed to read thumbnails: %w", err)
+	}
+
+	if len(thumbFiles) == 0 {
+		return nil, fmt.Errorf("no thumbnails found in %s", config.ThumbnailDir)
+	}
+
+	// Calculate max thumbnails per sprite
+	maxThumbnails := config.TilesX * config.TilesY
+	spriteIndex := 0
+
+	var spritePaths []string
+
+	for i := 0; i < len(thumbFiles); i += maxThumbnails {
+		end := i + maxThumbnails
+		if end > len(thumbFiles) {
+			end = len(thumbFiles)
+		}
+
+		// Create a sprite for the current batch
+		spriteWidth := config.Width * config.TilesX
+		spriteHeight := config.Height * config.TilesY
+		sprite := image.NewRGBA(image.Rect(0, 0, spriteWidth, spriteHeight))
+
+		for j, thumbPath := range thumbFiles[i:end] {
+			// Open thumbnail
+			file, err := os.Open(thumbPath)
+			if err != nil {
+				return nil, fmt.Errorf("failed to open thumbnail %s: %w", thumbPath, err)
+			}
+			defer file.Close()
+
+			img, _, err := image.Decode(file)
+			if err != nil {
+				return nil, fmt.Errorf("failed to decode thumbnail %s: %w", thumbPath, err)
+			}
+
+			// Calculate position in sprite
+			x := (j % config.TilesX) * config.Width
+			y := (j / config.TilesX) * config.Height
+			rect := image.Rect(x, y, x+config.Width, y+config.Height)
+			draw.Draw(sprite, rect, img, image.Point{}, draw.Src)
+		}
+
+		// Save the sprite image
+		spritePath := filepath.Join(config.SpriteDir, fmt.Sprintf("sprite-%03d.jpg", spriteIndex))
+		spriteFile, err := os.Create(spritePath)
+		if err != nil {
+			return nil, fmt.Errorf("failed to create sprite file %s: %w", spritePath, err)
+		}
+		defer spriteFile.Close()
+
+		if err := jpeg.Encode(spriteFile, sprite, &jpeg.Options{Quality: 90}); err != nil {
+			return nil, fmt.Errorf("failed to save sprite image %s: %w", spritePath, err)
+		}
+
+		spritePaths = append(spritePaths, spritePath)
+
+		spriteIndex++
+	}
+
+	return spritePaths, nil
+}
diff --git a/internal/live/clip.go b/internal/live/clip.go
new file mode 100644
index 00000000..830fb479
--- /dev/null
+++ b/internal/live/clip.go
@@ -0,0 +1,107 @@
+package live
+
+import (
+	"context"
+	"time"
+
+	"github.com/rs/zerolog"
+	"github.com/rs/zerolog/log"
+	"github.com/zibbp/ganymede/ent/channel"
+	"github.com/zibbp/ganymede/ent/live"
+	"github.com/zibbp/ganymede/ent/vod"
+	"github.com/zibbp/ganymede/internal/archive"
+	"github.com/zibbp/ganymede/internal/platform"
+	"github.com/zibbp/ganymede/internal/utils"
+)
+
+// CheckWatchedChannelClips checks watched channels for clips to arhive
+func (s *Service) CheckWatchedChannelClips(ctx context.Context, logger zerolog.Logger) error {
+	// Get channels from DB
+	channels, err := s.Store.Client.Live.Query().Where(live.WatchClips(true)).WithChannel().All(context.Background())
+	if err != nil {
+		return err
+	}
+
+	if len(channels) == 0 {
+		logger.Info().Msg("no channels to check")
+		return nil
+	}
+
+	logger.Info().Msgf("checking %d channels for new clips", len(channels))
+
+	for _, watchedChannel := range channels {
+
+		if watchedChannel.ClipsLimit == 0 || watchedChannel.ClipsIntervalDays == 0 {
+			logger.Error().Err(err).Str("channel", watchedChannel.Edges.Channel.Name).Msg("clip limit and clips interval must be greater than 0")
+			continue
+		}
+
+		// Check if clips need to be checked for channel
+		now := time.Now()
+		lastChecked := watchedChannel.ClipsLastChecked
+
+		// Round times down to the nearest hour to avoid partial hour comparisons
+		roundedNow := now.Truncate(time.Hour)
+		roundedLastChecked := lastChecked.Truncate(time.Hour)
+
+		// Calculate full hours between checks
+		diffHours := roundedNow.Sub(roundedLastChecked).Hours()
+		channelIntervalHours := watchedChannel.ClipsIntervalDays * 24
+
+		if diffHours < float64(channelIntervalHours) {
+			logger.Info().
+				Str("channel", watchedChannel.Edges.Channel.DisplayName).
+				Float64("hours_passed", diffHours).
+				Int("hours_required", channelIntervalHours).
+				Msg("skipping clip check, not enough time has passed")
+			continue
+		}
+
+		startedAt := now.AddDate(0, 0, -watchedChannel.ClipsIntervalDays)
+
+		// Get clips
+		clips, err := s.PlatformTwitch.GetChannelClips(ctx, watchedChannel.Edges.Channel.ExtID, platform.ClipsFilter{
+			Limit:     watchedChannel.ClipsLimit,
+			StartedAt: startedAt,
+			EndedAt:   now,
+		})
+		if err != nil {
+			logger.Error().Err(err).Str("channel", watchedChannel.Edges.Channel.Name).Msg("error getting clips for channel")
+			continue
+		}
+
+		// Fetch all videos from DB
+		dbVideos, err := s.Store.Client.Vod.Query().Where(vod.HasChannelWith(channel.ID(watchedChannel.Edges.Channel.ID))).All(context.Background())
+		if err != nil {
+			logger.Error().Str("channel", watchedChannel.Edges.Channel.Name).Err(err).Msg("error getting videos from database")
+			continue
+		}
+
+		// Check if video is already in DB
+		for _, clip := range clips {
+			// Video is not in DB
+			if !contains(dbVideos, clip.ID) {
+				// Archive clip
+				input := archive.ArchiveClipInput{
+					ID:          clip.ID,
+					Quality:     utils.VodQuality(watchedChannel.Resolution),
+					ArchiveChat: watchedChannel.ArchiveChat,
+					RenderChat:  watchedChannel.RenderChat,
+				}
+				err = s.ArchiveService.ArchiveClip(ctx, input)
+				if err != nil {
+					log.Error().Err(err).Str("clip_id", clip.ID).Msgf("error archiving clip")
+					continue
+				}
+				logger.Info().Str("clip_id", clip.ID).Msgf("archiving clip")
+			}
+		}
+
+		// Set clip last checked time on channel
+		err = s.Store.Client.Live.Update().Where(live.ID(watchedChannel.ID)).SetClipsLastChecked(now).Exec(ctx)
+		if err != nil {
+			logger.Error().Err(err).Str("channe", watchedChannel.Edges.Channel.Name).Msg("error setting clip last check time on channel")
+		}
+	}
+	return nil
+}
diff --git a/internal/live/live.go b/internal/live/live.go
index 3bf0e1fc..243026e5 100644
--- a/internal/live/live.go
+++ b/internal/live/live.go
@@ -49,6 +49,9 @@ type Live struct {
 	ApplyCategoriesToLive bool                 `json:"apply_categories_to_live"`
 	MaxAge                int64                `json:"max_age"`
 	TitleRegex            []ent.LiveTitleRegex `json:"title_regex"`
+	WatchClips            bool                 `json:"watch_clips"`
+	ClipsLimit            int                  `json:"clips_limit"`
+	ClipsIntervalDays     int                  `json:"clips_interval_days"`
 }
 
 type ConvertChat struct {
@@ -89,7 +92,7 @@ func (s *Service) AddLiveWatchedChannel(c echo.Context, liveDto Live) (*ent.Live
 		return nil, fmt.Errorf("channel already watched")
 	}
 
-	l, err := s.Store.Client.Live.Create().SetChannelID(liveDto.ID).SetWatchLive(liveDto.WatchLive).SetWatchVod(liveDto.WatchVod).SetDownloadArchives(liveDto.DownloadArchives).SetDownloadHighlights(liveDto.DownloadHighlights).SetDownloadUploads(liveDto.DownloadUploads).SetResolution(liveDto.Resolution).SetArchiveChat(liveDto.ArchiveChat).SetRenderChat(liveDto.RenderChat).SetDownloadSubOnly(liveDto.DownloadSubOnly).SetVideoAge(liveDto.MaxAge).SetApplyCategoriesToLive(liveDto.ApplyCategoriesToLive).Save(c.Request().Context())
+	l, err := s.Store.Client.Live.Create().SetChannelID(liveDto.ID).SetWatchLive(liveDto.WatchLive).SetWatchVod(liveDto.WatchVod).SetDownloadArchives(liveDto.DownloadArchives).SetDownloadHighlights(liveDto.DownloadHighlights).SetDownloadUploads(liveDto.DownloadUploads).SetResolution(liveDto.Resolution).SetArchiveChat(liveDto.ArchiveChat).SetRenderChat(liveDto.RenderChat).SetDownloadSubOnly(liveDto.DownloadSubOnly).SetVideoAge(liveDto.MaxAge).SetApplyCategoriesToLive(liveDto.ApplyCategoriesToLive).SetWatchClips(liveDto.WatchClips).SetClipsLimit(liveDto.ClipsLimit).SetClipsIntervalDays(liveDto.ClipsIntervalDays).Save(c.Request().Context())
 	if err != nil {
 		return nil, fmt.Errorf("error adding watched channel: %v", err)
 	}
@@ -115,7 +118,7 @@ func (s *Service) AddLiveWatchedChannel(c echo.Context, liveDto Live) (*ent.Live
 }
 
 func (s *Service) UpdateLiveWatchedChannel(c echo.Context, liveDto Live) (*ent.Live, error) {
-	l, err := s.Store.Client.Live.UpdateOneID(liveDto.ID).SetWatchLive(liveDto.WatchLive).SetWatchVod(liveDto.WatchVod).SetDownloadArchives(liveDto.DownloadArchives).SetDownloadHighlights(liveDto.DownloadHighlights).SetDownloadUploads(liveDto.DownloadUploads).SetResolution(liveDto.Resolution).SetArchiveChat(liveDto.ArchiveChat).SetRenderChat(liveDto.RenderChat).SetDownloadSubOnly(liveDto.DownloadSubOnly).SetVideoAge(liveDto.MaxAge).SetApplyCategoriesToLive(liveDto.ApplyCategoriesToLive).Save(c.Request().Context())
+	l, err := s.Store.Client.Live.UpdateOneID(liveDto.ID).SetWatchLive(liveDto.WatchLive).SetWatchVod(liveDto.WatchVod).SetDownloadArchives(liveDto.DownloadArchives).SetDownloadHighlights(liveDto.DownloadHighlights).SetDownloadUploads(liveDto.DownloadUploads).SetResolution(liveDto.Resolution).SetArchiveChat(liveDto.ArchiveChat).SetRenderChat(liveDto.RenderChat).SetDownloadSubOnly(liveDto.DownloadSubOnly).SetVideoAge(liveDto.MaxAge).SetApplyCategoriesToLive(liveDto.ApplyCategoriesToLive).SetClipsLimit(liveDto.ClipsLimit).SetClipsIntervalDays(liveDto.ClipsIntervalDays).SetWatchClips(liveDto.WatchClips).Save(c.Request().Context())
 	if err != nil {
 		return nil, fmt.Errorf("error updating watched channel: %v", err)
 	}
diff --git a/internal/platform/interfaces.go b/internal/platform/interfaces.go
index dda9db90..0c0265e5 100644
--- a/internal/platform/interfaces.go
+++ b/internal/platform/interfaces.go
@@ -8,26 +8,27 @@ import (
 )
 
 type VideoInfo struct {
-	ID            string            `json:"id"`
-	StreamID      string            `json:"stream_id"`
-	UserID        string            `json:"user_id"`
-	UserLogin     string            `json:"user_login"`
-	UserName      string            `json:"user_name"`
-	Title         string            `json:"title"`
-	Description   string            `json:"description"`
-	CreatedAt     time.Time         `json:"created_at"`
-	PublishedAt   time.Time         `json:"published_at"`
-	URL           string            `json:"url"`
-	ThumbnailURL  string            `json:"thumbnail_url"`
-	Viewable      string            `json:"viewable"`
-	ViewCount     int64             `json:"view_count"`
-	Language      string            `json:"language"`
-	Type          string            `json:"type"`
-	Duration      time.Duration     `json:"duration"`
-	Category      *string           `json:"category"`    // the default/main category of the video
-	Restriction   *string           `json:"restriction"` // video restriction
-	Chapters      []chapter.Chapter `json:"chapters"`
-	MutedSegments []MutedSegment    `json:"muted_segments"`
+	ID                          string            `json:"id"`
+	StreamID                    string            `json:"stream_id"`
+	UserID                      string            `json:"user_id"`
+	UserLogin                   string            `json:"user_login"`
+	UserName                    string            `json:"user_name"`
+	Title                       string            `json:"title"`
+	Description                 string            `json:"description"`
+	CreatedAt                   time.Time         `json:"created_at"`
+	PublishedAt                 time.Time         `json:"published_at"`
+	URL                         string            `json:"url"`
+	ThumbnailURL                string            `json:"thumbnail_url"`
+	Viewable                    string            `json:"viewable"`
+	ViewCount                   int64             `json:"view_count"`
+	Language                    string            `json:"language"`
+	Type                        string            `json:"type"`
+	Duration                    time.Duration     `json:"duration"`
+	Category                    *string           `json:"category"`    // the default/main category of the video
+	Restriction                 *string           `json:"restriction"` // video restriction
+	Chapters                    []chapter.Chapter `json:"chapters"`
+	MutedSegments               []MutedSegment    `json:"muted_segments"`
+	SpriteThumbnailsManifestUrl *string           `json:"sprite_thumbnails_manifest_url"`
 }
 
 type VideoRestriction string
@@ -64,6 +65,24 @@ type ChannelInfo struct {
 	CreatedAt       time.Time `json:"created_at"`
 }
 
+type ClipInfo struct {
+	ID           string    `json:"id"`
+	URL          string    `json:"url"`
+	ChannelID    string    `json:"channel_id"`
+	ChannelName  *string   `json:"channel_name"`
+	CreatorID    *string   `json:"creator_id"`
+	CreatorName  *string   `json:"creator_name"`
+	VideoID      string    `json:"video_id"`
+	GameID       *string   `json:"game_id"`
+	Language     *string   `json:"language"`
+	Title        string    `json:"title"`
+	ViewCount    int       `json:"view_count"`
+	CreatedAt    time.Time `json:"created_at"`
+	ThumbnailURL string    `json:"thumbnail_url"`
+	Duration     int       `json:"duration"`
+	VodOffset    *int      `json:"vod_offset"`
+}
+
 type Category struct {
 	ID   string `json:"id"`
 	Name string `json:"name"`
@@ -75,6 +94,13 @@ type ConnectionInfo struct {
 	AccessToken  string
 }
 
+// ClipsFilter a filter used when fetching clips from the platform
+type ClipsFilter struct {
+	StartedAt time.Time // start date
+	EndedAt   time.Time // end date
+	Limit     int       // number of clips to return
+}
+
 type VideoType string
 
 const (
@@ -105,4 +131,6 @@ type Platform interface {
 	GetChannelBadges(ctx context.Context, channelId string) ([]Badge, error)
 	GetGlobalEmotes(ctx context.Context) ([]Emote, error)
 	GetChannelEmotes(ctx context.Context, channelId string) ([]Emote, error)
+	GetChannelClips(ctx context.Context, channelId string, filter ClipsFilter) ([]ClipInfo, error)
+	GetClip(ctx context.Context, id string) (*ClipInfo, error)
 }
diff --git a/internal/platform/twitch.go b/internal/platform/twitch.go
index df4a34de..e41de195 100644
--- a/internal/platform/twitch.go
+++ b/internal/platform/twitch.go
@@ -9,6 +9,7 @@ import (
 	"strings"
 	"time"
 
+	"github.com/rs/zerolog/log"
 	"github.com/zibbp/ganymede/internal/chapter"
 	"github.com/zibbp/ganymede/internal/dto"
 	"github.com/zibbp/ganymede/internal/utils"
@@ -57,23 +58,24 @@ func (c *TwitchConnection) GetVideo(ctx context.Context, id string, withChapters
 	}
 
 	info := VideoInfo{
-		ID:           videoResponse.Data[0].ID,
-		StreamID:     videoResponse.Data[0].StreamID,
-		UserID:       videoResponse.Data[0].UserID,
-		UserLogin:    videoResponse.Data[0].UserLogin,
-		UserName:     videoResponse.Data[0].UserName,
-		Title:        videoResponse.Data[0].Title,
-		Description:  videoResponse.Data[0].Description,
-		CreatedAt:    createdAt,
-		PublishedAt:  publishedAt,
-		URL:          videoResponse.Data[0].URL,
-		ThumbnailURL: videoResponse.Data[0].ThumbnailURL,
-		Viewable:     videoResponse.Data[0].Viewable,
-		ViewCount:    videoResponse.Data[0].ViewCount,
-		Language:     videoResponse.Data[0].Language,
-		Type:         videoResponse.Data[0].Type,
-		Duration:     duration,
-		Category:     &gqlVideo.Game.Name,
+		ID:                          videoResponse.Data[0].ID,
+		StreamID:                    videoResponse.Data[0].StreamID,
+		UserID:                      videoResponse.Data[0].UserID,
+		UserLogin:                   videoResponse.Data[0].UserLogin,
+		UserName:                    videoResponse.Data[0].UserName,
+		Title:                       videoResponse.Data[0].Title,
+		Description:                 videoResponse.Data[0].Description,
+		CreatedAt:                   createdAt,
+		PublishedAt:                 publishedAt,
+		URL:                         videoResponse.Data[0].URL,
+		ThumbnailURL:                videoResponse.Data[0].ThumbnailURL,
+		Viewable:                    videoResponse.Data[0].Viewable,
+		ViewCount:                   videoResponse.Data[0].ViewCount,
+		Language:                    videoResponse.Data[0].Language,
+		Type:                        videoResponse.Data[0].Type,
+		Duration:                    duration,
+		Category:                    &gqlVideo.Game.Name,
+		SpriteThumbnailsManifestUrl: &gqlVideo.SeekPreviewsURL,
 	}
 
 	// get chapters
@@ -601,3 +603,142 @@ func twitchTemplateEmoteURL(id, format, themeMode string, scale string) string {
 func ArchiveVideoActivity(ctx context.Context, input dto.ArchiveVideoInput) error {
 	return nil
 }
+
+// GetChannelClips gets a Twitch channel's clip with some filter options. Twitch returns the clips sorted by view count descending.
+func (c *TwitchConnection) GetChannelClips(ctx context.Context, channelId string, filter ClipsFilter) ([]ClipInfo, error) {
+
+	// todo: allow more than 100 clips
+	if filter.Limit > 100 {
+		return nil, fmt.Errorf("clips limited to a max of 100")
+	}
+	limitStr := strconv.Itoa(filter.Limit)
+	params := url.Values{
+		"broadcaster_id": []string{channelId},
+		"started_at":     []string{filter.StartedAt.Format(time.RFC3339)},
+		"ended_at":       []string{filter.EndedAt.Format(time.RFC3339)},
+		"first":          []string{limitStr},
+	}
+
+	body, err := c.twitchMakeHTTPRequest("GET", "clips", params, nil)
+	if err != nil {
+		return nil, err
+	}
+
+	var resp TwitchGetClipsResponse
+	err = json.Unmarshal(body, &resp)
+	if err != nil {
+		return nil, err
+	}
+
+	var clips []TwitchClip
+	clips = append(clips, resp.Data...)
+
+	var info []ClipInfo
+	for _, clip := range clips {
+		// parse dates
+		createdAt, err := time.Parse(time.RFC3339, clip.CreatedAt)
+		if err != nil {
+			return nil, err
+		}
+
+		offset := 0
+		if clip.VodOffset != nil {
+			if vodOffset, ok := clip.VodOffset.(int); ok {
+				offset = vodOffset
+			}
+		}
+
+		info = append(info, ClipInfo{
+			ID:           clip.ID,
+			URL:          clip.URL,
+			ChannelID:    clip.BroadcasterID,
+			ChannelName:  &clip.BroadcasterName,
+			CreatorID:    &clip.CreatorID,
+			CreatorName:  &clip.CreatorName,
+			VideoID:      clip.VideoID,
+			GameID:       &clip.GameID,
+			Language:     &clip.Language,
+			Title:        clip.Title,
+			ViewCount:    clip.ViewCount,
+			CreatedAt:    createdAt,
+			ThumbnailURL: clip.ThumbnailURL,
+			Duration:     int(clip.Duration),
+			VodOffset:    &offset,
+		})
+	}
+
+	return info, nil
+}
+
+// GetClip gets a Twitch clip given it's ID
+func (c *TwitchConnection) GetClip(ctx context.Context, id string) (*ClipInfo, error) {
+	params := url.Values{
+		"id": []string{id},
+	}
+
+	body, err := c.twitchMakeHTTPRequest("GET", "clips", params, nil)
+	if err != nil {
+		return nil, err
+	}
+
+	var resp TwitchGetClipsResponse
+	err = json.Unmarshal(body, &resp)
+	if err != nil {
+		return nil, err
+	}
+
+	var clips []TwitchClip
+	clips = append(clips, resp.Data...)
+
+	if len(clips) == 0 {
+		return nil, fmt.Errorf("clip not found")
+	}
+
+	var info ClipInfo
+	for _, clip := range clips {
+		// parse dates
+		createdAt, err := time.Parse(time.RFC3339, clip.CreatedAt)
+		if err != nil {
+			return nil, err
+		}
+
+		// Parse clip vod offset
+		offset := 0
+		if clip.VodOffset != nil {
+			switch v := clip.VodOffset.(type) {
+			case int:
+				offset = v
+			case float64: // If VodOffset might be a float
+				offset = int(v) // Convert to int
+			case string:
+				if parsed, err := strconv.Atoi(v); err == nil {
+					offset = parsed
+				} else {
+					log.Warn().Msgf("failed to convert VodOffset string to int: %v", err)
+				}
+			default:
+				log.Warn().Msgf("VodOffset is an unsupported type, unable to convert:  %T\n", v)
+			}
+		}
+
+		info = ClipInfo{
+			ID:           clip.ID,
+			URL:          clip.URL,
+			ChannelID:    clip.BroadcasterID,
+			ChannelName:  &clip.BroadcasterName,
+			CreatorID:    &clip.CreatorID,
+			CreatorName:  &clip.CreatorName,
+			VideoID:      clip.VideoID,
+			GameID:       &clip.GameID,
+			Language:     &clip.Language,
+			Title:        clip.Title,
+			ViewCount:    clip.ViewCount,
+			CreatedAt:    createdAt,
+			ThumbnailURL: clip.ThumbnailURL,
+			Duration:     int(clip.Duration),
+			VodOffset:    &offset,
+		}
+	}
+
+	return &info, nil
+}
diff --git a/internal/platform/twitch_api.go b/internal/platform/twitch_api.go
index 16ca8ff9..77627991 100644
--- a/internal/platform/twitch_api.go
+++ b/internal/platform/twitch_api.go
@@ -99,6 +99,31 @@ type TwitchCategory struct {
 	IgdbID    string `json:"igdb_id"`
 }
 
+type TwitchClip struct {
+	ID              string  `json:"id"`
+	URL             string  `json:"url"`
+	EmbedURL        string  `json:"embed_url"`
+	BroadcasterID   string  `json:"broadcaster_id"`
+	BroadcasterName string  `json:"broadcaster_name"`
+	CreatorID       string  `json:"creator_id"`
+	CreatorName     string  `json:"creator_name"`
+	VideoID         string  `json:"video_id"`
+	GameID          string  `json:"game_id"`
+	Language        string  `json:"language"`
+	Title           string  `json:"title"`
+	ViewCount       int     `json:"view_count"`
+	CreatedAt       string  `json:"created_at"`
+	ThumbnailURL    string  `json:"thumbnail_url"`
+	Duration        float64 `json:"duration"`
+	VodOffset       any     `json:"vod_offset"`
+	IsFeatured      bool    `json:"is_featured"`
+}
+
+type TwitchGetClipsResponse struct {
+	Data       []TwitchClip     `json:"data"`
+	Pagination TwitchPagination `json:"pagination"`
+}
+
 type TwitchPagination struct {
 	Cursor string `json:"cursor"`
 }
@@ -136,6 +161,17 @@ type TwitchGlobalEmoteResponse struct {
 	Template string `json:"template"`
 }
 
+type TwitchSpriteManifest []struct {
+	Count    int      `json:"count"`
+	Width    int      `json:"width"`
+	Rows     int      `json:"rows"`
+	Images   []string `json:"images"`
+	Interval int      `json:"interval"`
+	Quality  string   `json:"quality"`
+	Cols     int      `json:"cols"`
+	Height   int      `json:"height"`
+}
+
 // authenticate sends a POST request to Twitch for authentication using client credentials. An AuthenTokenResponse is returned on success containing the access token.
 func twitchAuthenticate(clientId string, clientSecret string) (*AuthTokenResponse, error) {
 	client := &http.Client{}
diff --git a/internal/platform/twitch_connection.go b/internal/platform/twitch_connection.go
index 22bd807a..55749943 100644
--- a/internal/platform/twitch_connection.go
+++ b/internal/platform/twitch_connection.go
@@ -1,6 +1,8 @@
 package platform
 
-import "context"
+import (
+	"context"
+)
 
 type TwitchConnection struct {
 	ClientId     string
@@ -9,7 +11,6 @@ type TwitchConnection struct {
 }
 
 func (c *TwitchConnection) Authenticate(ctx context.Context) (*ConnectionInfo, error) {
-
 	info := ConnectionInfo{
 		ClientId:     c.ClientId,
 		ClientSecret: c.ClientSecret,
@@ -21,6 +22,5 @@ func (c *TwitchConnection) Authenticate(ctx context.Context) (*ConnectionInfo, e
 	}
 	info.AccessToken = authResponse.AccessToken
 	c.AccessToken = authResponse.AccessToken
-
 	return &info, nil
 }
diff --git a/internal/platform/twitch_gql.go b/internal/platform/twitch_gql.go
index b7f08243..314188b6 100644
--- a/internal/platform/twitch_gql.go
+++ b/internal/platform/twitch_gql.go
@@ -25,6 +25,7 @@ type TwitchGQLVideo struct {
 	Game                TwitchGQLGame             `json:"game"`
 	Title               string                    `json:"title"`
 	CreatedAt           string                    `json:"createdAt"`
+	SeekPreviewsURL     string                    `json:"seekPreviewsURL"` // storyboard thumbnails manifest
 }
 
 type TwitchGQLGame struct {
@@ -175,7 +176,7 @@ func (c *TwitchConnection) TwitchGQLGetMutedSegments(id string) ([]TwitchGQLMute
 }
 
 func (c *TwitchConnection) TwitchGQLGetVideo(id string) (*TwitchGQLVideo, error) {
-	body := fmt.Sprintf(`{"query": "query{video(id:\"%s\"){broadcastType,resourceRestriction{id,type},game{id,name},title,createdAt}}"}`, id)
+	body := fmt.Sprintf(`{"query": "query{video(id:\"%s\"){broadcastType,resourceRestriction{id,type},game{id,name},title,createdAt,seekPreviewsURL}}"}`, id)
 	respBytes, err := twitchGQLRequest(body)
 	if err != nil {
 		return nil, fmt.Errorf("error getting video muted segments: %w", err)
diff --git a/internal/playback/playback.go b/internal/playback/playback.go
index b9211c9c..8a2128e1 100644
--- a/internal/playback/playback.go
+++ b/internal/playback/playback.go
@@ -1,15 +1,16 @@
 package playback
 
 import (
+	"context"
 	"fmt"
 
+	"entgo.io/ent/dialect/sql"
 	"github.com/google/uuid"
 	"github.com/labstack/echo/v4"
 	"github.com/zibbp/ganymede/ent"
 	"github.com/zibbp/ganymede/ent/playback"
 	entPlayback "github.com/zibbp/ganymede/ent/playback"
 	entVod "github.com/zibbp/ganymede/ent/vod"
-	"github.com/zibbp/ganymede/internal/auth"
 	"github.com/zibbp/ganymede/internal/database"
 	"github.com/zibbp/ganymede/internal/utils"
 )
@@ -34,14 +35,12 @@ type GetPlayback struct {
 
 var ErrorPlaybackNotFound = fmt.Errorf("playback not found")
 
-func (s *Service) UpdateProgress(c *auth.CustomContext, vID uuid.UUID, time int) error {
-	uID := c.User.ID
-
-	check, err := s.Store.Client.Playback.Query().Where(playback.UserID(uID)).Where(playback.VodID(vID)).Only(c.Request().Context())
+func (s *Service) UpdateProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID, time int) error {
+	check, err := s.Store.Client.Playback.Query().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).Order(playback.ByUpdatedAt(sql.OrderAsc())).First(ctx)
 	if err != nil {
 		if _, ok := err.(*ent.NotFoundError); ok {
 
-			_, err = s.Store.Client.Playback.Create().SetUserID(uID).SetVodID(vID).SetTime(time).Save(c.Request().Context())
+			_, err = s.Store.Client.Playback.Create().SetUserID(userId).SetVodID(videoId).SetTime(time).Save(ctx)
 			if err != nil {
 				return fmt.Errorf("error creating playback: %v", err)
 			}
@@ -51,7 +50,7 @@ func (s *Service) UpdateProgress(c *auth.CustomContext, vID uuid.UUID, time int)
 		return fmt.Errorf("error checking playback: %v", err)
 	}
 	if check != nil {
-		_, err = s.Store.Client.Playback.Update().Where(playback.UserID(uID)).Where(playback.VodID(vID)).SetTime(time).Save(c.Request().Context())
+		_, err = s.Store.Client.Playback.Update().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).SetTime(time).Save(ctx)
 		if err != nil {
 			return fmt.Errorf("error updating playback: %v", err)
 		}
@@ -60,10 +59,8 @@ func (s *Service) UpdateProgress(c *auth.CustomContext, vID uuid.UUID, time int)
 	return nil
 }
 
-func (s *Service) GetProgress(c *auth.CustomContext, vID uuid.UUID) (*ent.Playback, error) {
-	uID := c.User.ID
-
-	playbackEntry, err := s.Store.Client.Playback.Query().Where(playback.UserID(uID)).Where(playback.VodID(vID)).Only(c.Request().Context())
+func (s *Service) GetProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID) (*ent.Playback, error) {
+	playbackEntry, err := s.Store.Client.Playback.Query().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).Order(playback.ByUpdatedAt(sql.OrderAsc())).First(ctx)
 	if err != nil {
 		if _, ok := err.(*ent.NotFoundError); ok {
 			return nil, ErrorPlaybackNotFound
@@ -74,10 +71,8 @@ func (s *Service) GetProgress(c *auth.CustomContext, vID uuid.UUID) (*ent.Playba
 	return playbackEntry, nil
 }
 
-func (s *Service) GetAllProgress(c *auth.CustomContext) ([]*ent.Playback, error) {
-	uID := c.User.ID
-
-	playbackEntries, err := s.Store.Client.Playback.Query().Where(playback.UserID(uID)).All(c.Request().Context())
+func (s *Service) GetAllProgress(ctx context.Context, userId uuid.UUID) ([]*ent.Playback, error) {
+	playbackEntries, err := s.Store.Client.Playback.Query().Where(playback.UserID(userId)).All(ctx)
 	if err != nil {
 		return nil, fmt.Errorf("error getting all playback: %v", err)
 	}
@@ -85,14 +80,12 @@ func (s *Service) GetAllProgress(c *auth.CustomContext) ([]*ent.Playback, error)
 	return playbackEntries, nil
 }
 
-func (s *Service) UpdateStatus(c *auth.CustomContext, vID uuid.UUID, status string) error {
-	uID := c.User.ID
-
-	_, err := s.Store.Client.Playback.Query().Where(playback.UserID(uID)).Where(playback.VodID(vID)).Only(c.Request().Context())
+func (s *Service) UpdateStatus(ctx context.Context, userId uuid.UUID, videoId uuid.UUID, status string) error {
+	_, err := s.Store.Client.Playback.Query().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).Order(playback.ByUpdatedAt(sql.OrderAsc())).First(ctx)
 	if err != nil {
 		if _, ok := err.(*ent.NotFoundError); ok {
 
-			_, err = s.Store.Client.Playback.Create().SetUserID(uID).SetVodID(vID).SetStatus(utils.PlaybackStatus(status)).Save(c.Request().Context())
+			_, err = s.Store.Client.Playback.Create().SetUserID(userId).SetVodID(videoId).SetStatus(utils.PlaybackStatus(status)).Save(ctx)
 			if err != nil {
 				return fmt.Errorf("error creating playback: %v", err)
 			}
@@ -102,7 +95,7 @@ func (s *Service) UpdateStatus(c *auth.CustomContext, vID uuid.UUID, status stri
 		return fmt.Errorf("error checking playback: %v", err)
 	}
 
-	_, err = s.Store.Client.Playback.Update().Where(playback.UserID(uID)).Where(playback.VodID(vID)).SetStatus(utils.PlaybackStatus(status)).Save(c.Request().Context())
+	_, err = s.Store.Client.Playback.Update().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).SetStatus(utils.PlaybackStatus(status)).Save(ctx)
 	if err != nil {
 		if _, ok := err.(*ent.NotFoundError); ok {
 			return fmt.Errorf("playback not found")
@@ -113,10 +106,8 @@ func (s *Service) UpdateStatus(c *auth.CustomContext, vID uuid.UUID, status stri
 	return nil
 }
 
-func (s *Service) DeleteProgress(c *auth.CustomContext, vID uuid.UUID) error {
-	uID := c.User.ID
-
-	_, err := s.Store.Client.Playback.Delete().Where(playback.UserID(uID)).Where(playback.VodID(vID)).Exec(c.Request().Context())
+func (s *Service) DeleteProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID) error {
+	_, err := s.Store.Client.Playback.Delete().Where(playback.UserID(userId)).Where(playback.VodID(videoId)).Exec(ctx)
 	if err != nil {
 		if _, ok := err.(*ent.NotFoundError); ok {
 			return fmt.Errorf("playback not found")
@@ -127,11 +118,9 @@ func (s *Service) DeleteProgress(c *auth.CustomContext, vID uuid.UUID) error {
 	return nil
 }
 
-func (s *Service) GetLastPlaybacks(c *auth.CustomContext, limit int) (*GetPlaybackResp, error) {
-	uID := c.User.ID
-
+func (s *Service) GetLastPlaybacks(ctx context.Context, userId uuid.UUID, limit int) (*GetPlaybackResp, error) {
 	// Fetch all playbacks for the user
-	playbackEntries, err := s.Store.Client.Playback.Query().Where(playback.UserID(uID)).Where(entPlayback.StatusEQ("in_progress")).Order(ent.Desc(playback.FieldUpdatedAt)).All(c.Request().Context())
+	playbackEntries, err := s.Store.Client.Playback.Query().Where(playback.UserID(userId)).Where(entPlayback.StatusEQ("in_progress")).Order(ent.Desc(playback.FieldUpdatedAt)).All(ctx)
 	if err != nil {
 		return nil, fmt.Errorf("error getting last playbacks: %v", err)
 	}
@@ -144,7 +133,7 @@ func (s *Service) GetLastPlaybacks(c *auth.CustomContext, limit int) (*GetPlayba
 
 	// Process the fetched playbacks
 	for _, playbackEntry := range playbackEntries {
-		vod, err := s.Store.Client.Vod.Query().Where(entVod.ID(playbackEntry.VodID)).WithChannel().Only(c.Request().Context())
+		vod, err := s.Store.Client.Vod.Query().Where(entVod.ID(playbackEntry.VodID)).WithChannel().Only(ctx)
 		if err != nil {
 			// Skip if vod not found
 			continue
diff --git a/internal/playlist/playlist.go b/internal/playlist/playlist.go
index a3e390e2..73f87fc7 100644
--- a/internal/playlist/playlist.go
+++ b/internal/playlist/playlist.go
@@ -76,15 +76,15 @@ func (s *Service) GetPlaylist(c echo.Context, playlistID uuid.UUID, withMultistr
 		playlistQuery.WithMultistreamInfo(func(miq *ent.MultistreamInfoQuery) { miq.WithVod() })
 	}
 	rPlaylist, err := playlistQuery.Order(ent.Desc(playlist.FieldCreatedAt)).Only(c.Request().Context())
+	if err != nil {
+		return nil, fmt.Errorf("error getting playlist: %v", err)
+	}
 	// Order VODs by date streamed
 	tmpVods := rPlaylist.Edges.Vods
 	sort.Slice(tmpVods, func(i, j int) bool {
 		return tmpVods[i].StreamedAt.After(tmpVods[j].StreamedAt)
 	})
 	rPlaylist.Edges.Vods = tmpVods
-	if err != nil {
-		return nil, fmt.Errorf("error getting playlist: %v", err)
-	}
 
 	return rPlaylist, nil
 }
@@ -172,7 +172,6 @@ func (s *Service) SetVodDelayOnPlaylist(c echo.Context, playlistID uuid.UUID, vo
 			return fmt.Errorf("error updating multistream info: %v", err)
 		}
 	}
-
 	return nil
 }
 
diff --git a/internal/queue/queue.go b/internal/queue/queue.go
index 5de5b7cc..83a8675a 100644
--- a/internal/queue/queue.go
+++ b/internal/queue/queue.go
@@ -136,7 +136,7 @@ func (s *Service) ReadLogFile(c echo.Context, qID uuid.UUID, logType string) ([]
 		return nil, err
 	}
 	path := fmt.Sprintf("%s/%s-%s.log", env.LogsDir, q.Edges.Vod.ID, logType)
-	logLines, err := utils.ReadLastLines(path, 20)
+	logLines, err := utils.ReadLastLines(path, 30)
 	if err != nil {
 		return nil, err
 	}
diff --git a/internal/scheduler/scheduler.go b/internal/scheduler/scheduler.go
deleted file mode 100644
index f25a9671..00000000
--- a/internal/scheduler/scheduler.go
+++ /dev/null
@@ -1,47 +0,0 @@
-package scheduler
-
-import (
-	"context"
-	"time"
-
-	"github.com/go-co-op/gocron"
-	"github.com/rs/zerolog/log"
-	"github.com/zibbp/ganymede/internal/archive"
-	"github.com/zibbp/ganymede/internal/config"
-	"github.com/zibbp/ganymede/internal/live"
-)
-
-type Service struct {
-	LiveService    *live.Service
-	ArchiveService *archive.Service
-}
-
-func NewService(liveService *live.Service, archiveService *archive.Service) *Service {
-	return &Service{LiveService: liveService, ArchiveService: archiveService}
-}
-
-func (s *Service) StartLiveScheduler() {
-	time.Sleep(time.Second * 5)
-	scheduler := gocron.NewScheduler(time.UTC)
-
-	s.checkLiveStreamSchedule(scheduler)
-
-	scheduler.StartAsync()
-}
-
-func (s *Service) checkLiveStreamSchedule(scheduler *gocron.Scheduler) {
-	log.Debug().Msg("setting up check live stream schedule")
-	config := config.Get()
-	log.Debug().Msgf("setting live check interval to run every %d seconds", config.LiveCheckInterval)
-	_, err := scheduler.Every(config.LiveCheckInterval).Seconds().Do(func() {
-		ctx := context.Background()
-		log.Debug().Msg("running check live stream schedule")
-		err := s.LiveService.Check(ctx)
-		if err != nil {
-			log.Error().Err(err).Msg("failed to check live streams")
-		}
-	})
-	if err != nil {
-		log.Error().Err(err).Msg("failed to set up check live stream schedule")
-	}
-}
diff --git a/internal/server/server.go b/internal/server/server.go
index d46d6b07..53f96d64 100644
--- a/internal/server/server.go
+++ b/internal/server/server.go
@@ -3,6 +3,8 @@ package server
 import (
 	"context"
 	"fmt"
+	"log/slog"
+	"os"
 
 	"github.com/rs/zerolog"
 	"github.com/rs/zerolog/log"
@@ -23,12 +25,12 @@ import (
 	"github.com/zibbp/ganymede/internal/playback"
 	"github.com/zibbp/ganymede/internal/playlist"
 	"github.com/zibbp/ganymede/internal/queue"
-	"github.com/zibbp/ganymede/internal/scheduler"
 	"github.com/zibbp/ganymede/internal/task"
 	tasks_client "github.com/zibbp/ganymede/internal/tasks/client"
 	transportHttp "github.com/zibbp/ganymede/internal/transport/http"
 	"github.com/zibbp/ganymede/internal/user"
 	"github.com/zibbp/ganymede/internal/vod"
+	"riverqueue.com/riverui"
 )
 
 type Application struct {
@@ -44,7 +46,6 @@ type Application struct {
 	QueueService      *queue.Service
 	UserService       *user.Service
 	LiveService       *live.Service
-	SchedulerService  *scheduler.Service
 	PlaybackService   *playback.Service
 	MetricsService    *metrics.Service
 	PlaylistService   *playlist.Service
@@ -52,6 +53,7 @@ type Application struct {
 	ChapterService    *chapter.Service
 	CategoryService   *category.Service
 	BlockedVodService *blocked.Service
+	RiverUIServer     *riverui.Server
 }
 
 func SetupApplication(ctx context.Context) (*Application, error) {
@@ -101,6 +103,24 @@ func SetupApplication(ctx context.Context) (*Application, error) {
 		return nil, fmt.Errorf("error running migrations: %v", err)
 	}
 
+	// Setup RiverUI server
+	riverUIOpts := &riverui.ServerOpts{
+		Client: riverClient.Client,
+		DB:     riverClient.PgxPool,
+		Logger: slog.New(slog.NewTextHandler(os.Stderr, nil)),
+		Prefix: "/riverui",
+	}
+	riverUIServer, err := riverui.NewServer(riverUIOpts)
+	if err != nil {
+		return nil, fmt.Errorf("error creating riverui server: %v", err)
+	}
+
+	go func() {
+		if err := riverUIServer.Start(ctx); err != nil {
+			log.Error().Err(err).Msg("error running riverui server")
+		}
+	}()
+
 	var platformTwitch platform.Platform
 	// setup twitch platform
 	if envConfig.TwitchClientId != "" && envConfig.TwitchClientSecret != "" {
@@ -114,7 +134,7 @@ func SetupApplication(ctx context.Context) (*Application, error) {
 		}
 	}
 
-	authService := auth.NewService(db)
+	authService := auth.NewService(db, &envConfig)
 	channelService := channel.NewService(db, platformTwitch)
 	vodService := vod.NewService(db, riverClient, platformTwitch)
 	queueService := queue.NewService(db, vodService, channelService, riverClient)
@@ -123,7 +143,6 @@ func SetupApplication(ctx context.Context) (*Application, error) {
 	adminService := admin.NewService(db)
 	userService := user.NewService(db)
 	liveService := live.NewService(db, archiveService, platformTwitch)
-	schedulerService := scheduler.NewService(liveService, archiveService)
 	playbackService := playback.NewService(db)
 	metricsService := metrics.NewService(db, riverClient)
 	playlistService := playlist.NewService(db)
@@ -143,7 +162,6 @@ func SetupApplication(ctx context.Context) (*Application, error) {
 		AdminService:      adminService,
 		UserService:       userService,
 		LiveService:       liveService,
-		SchedulerService:  schedulerService,
 		PlaybackService:   playbackService,
 		MetricsService:    metricsService,
 		PlaylistService:   playlistService,
@@ -151,6 +169,7 @@ func SetupApplication(ctx context.Context) (*Application, error) {
 		ChapterService:    chapterService,
 		CategoryService:   categoryService,
 		PlatformTwitch:    platformTwitch,
+		RiverUIServer:     riverUIServer,
 	}, nil
 }
 
@@ -161,7 +180,7 @@ func Run(ctx context.Context) error {
 		return err
 	}
 
-	httpHandler := transportHttp.NewHandler(app.AuthService, app.ChannelService, app.VodService, app.QueueService, app.ArchiveService, app.AdminService, app.UserService, app.LiveService, app.SchedulerService, app.PlaybackService, app.MetricsService, app.PlaylistService, app.TaskService, app.ChapterService, app.CategoryService, app.BlockedVodService, app.PlatformTwitch)
+	httpHandler := transportHttp.NewHandler(app.Database, app.AuthService, app.ChannelService, app.VodService, app.QueueService, app.ArchiveService, app.AdminService, app.UserService, app.LiveService, app.PlaybackService, app.MetricsService, app.PlaylistService, app.TaskService, app.ChapterService, app.CategoryService, app.BlockedVodService, app.PlatformTwitch, app.RiverUIServer)
 
 	if err := httpHandler.Serve(ctx); err != nil {
 		return err
diff --git a/internal/task/task.go b/internal/task/task.go
index b6064e84..89323d69 100644
--- a/internal/task/task.go
+++ b/internal/task/task.go
@@ -9,6 +9,7 @@ import (
 
 	"github.com/google/uuid"
 	"github.com/rs/zerolog/log"
+	"github.com/zibbp/ganymede/ent/vod"
 	"github.com/zibbp/ganymede/internal/archive"
 	"github.com/zibbp/ganymede/internal/config"
 	"github.com/zibbp/ganymede/internal/database"
@@ -45,6 +46,13 @@ func (s *Service) StartTask(ctx context.Context, task string) error {
 		}
 		log.Info().Str("task_id", fmt.Sprintf("%d", task.Job.ID)).Msgf("task created")
 
+	case "check_clips":
+		task, err := s.RiverClient.Client.Insert(ctx, tasks_periodic.TaskCheckChannelForNewClipsArgs{}, nil)
+		if err != nil {
+			return fmt.Errorf("error inserting task: %v", err)
+		}
+		log.Info().Str("task_id", fmt.Sprintf("%d", task.Job.ID)).Msgf("task created")
+
 	case "get_jwks":
 		task, err := s.RiverClient.Client.Insert(ctx, tasks_periodic.FetchJWKSArgs{}, nil)
 		if err != nil {
@@ -81,6 +89,20 @@ func (s *Service) StartTask(ctx context.Context, task string) error {
 		}
 		log.Info().Str("task_id", fmt.Sprintf("%d", task.Job.ID)).Msgf("task created")
 
+	case "generate_sprite_thumbnails":
+		videos, err := s.Store.Client.Vod.Query().Where(vod.SpriteThumbnailsEnabledEQ(false)).All(ctx)
+		if err != nil {
+			return fmt.Errorf("error getting videos: %v", err)
+		}
+
+		for _, video := range videos {
+			_, err := s.RiverClient.Client.Insert(ctx, tasks.GenerateSpriteThumbnailArgs{VideoId: video.ID.String()}, nil)
+			if err != nil {
+				return fmt.Errorf("error inserting task: %v", err)
+			}
+		}
+
+		log.Info().Msgf("created %d sprite thumbnail tasks", len(videos))
 	}
 
 	return nil
diff --git a/internal/tasks/client/client.go b/internal/tasks/client/client.go
index 0f062111..a66f948f 100644
--- a/internal/tasks/client/client.go
+++ b/internal/tasks/client/client.go
@@ -69,9 +69,12 @@ func (rc *RiverClient) Stop() error {
 
 // Run river database migrations
 func (rc *RiverClient) RunMigrations() error {
-	migrator := rivermigrate.New(rc.RiverPgxDriver, nil)
+	migrator, err := rivermigrate.New(rc.RiverPgxDriver, nil)
+	if err != nil {
+		return fmt.Errorf("error creating river migrations: %v", err)
+	}
 
-	_, err := migrator.Migrate(rc.Ctx, rivermigrate.DirectionUp, &rivermigrate.MigrateOpts{})
+	_, err = migrator.Migrate(rc.Ctx, rivermigrate.DirectionUp, &rivermigrate.MigrateOpts{})
 	if err != nil {
 		return fmt.Errorf("error running river migrations: %v", err)
 	}
diff --git a/internal/tasks/common.go b/internal/tasks/common.go
index 14651b67..0f6e887e 100644
--- a/internal/tasks/common.go
+++ b/internal/tasks/common.go
@@ -2,7 +2,11 @@ package tasks
 
 import (
 	"context"
+	"encoding/json"
 	"fmt"
+	"io"
+	"net/http"
+	"strings"
 	"time"
 
 	"github.com/google/uuid"
@@ -177,6 +181,11 @@ func (w SaveVideoInfoWorker) Work(ctx context.Context, job *river.Job[SaveVideoI
 		if err != nil {
 			return err
 		}
+	} else if dbItems.Video.Type == utils.Clip {
+		info, err = platformService.GetClip(ctx, dbItems.Video.ExtID)
+		if err != nil {
+			return err
+		}
 	} else {
 		videoInfo, err := platformService.GetVideo(ctx, dbItems.Video.ExtID, true, true)
 		if err != nil {
@@ -245,6 +254,16 @@ func (w SaveVideoInfoWorker) Work(ctx context.Context, job *river.Job[SaveVideoI
 	return nil
 }
 
+// getBasePath returns provided url except for everything after the last /
+func getBasePath(url string) string {
+	url = strings.TrimSuffix(url, "/")
+	lastSlashIndex := strings.LastIndex(url, "/")
+	if lastSlashIndex == -1 {
+		return url
+	}
+	return url[:lastSlashIndex]
+}
+
 // //////////////////////
 // Download Thumbnails //
 // //////////////////////
@@ -272,6 +291,7 @@ type DownloadTumbnailsWorker struct {
 }
 
 func (w DownloadTumbnailsWorker) Work(ctx context.Context, job *river.Job[DownloadThumbnailArgs]) error {
+	logger := log.With().Str("task", job.Kind).Str("job_id", fmt.Sprintf("%d", job.ID)).Logger()
 	// get store from context
 	store, err := StoreFromContext(ctx)
 	if err != nil {
@@ -294,6 +314,8 @@ func (w DownloadTumbnailsWorker) Work(ctx context.Context, job *river.Job[Downlo
 		conn:   store.ConnPool,
 	})
 
+	envConfig := config.GetEnvConfig()
+
 	dbItems, err := getDatabaseItems(ctx, store.Client, job.Args.Input.QueueId)
 	if err != nil {
 		return err
@@ -305,25 +327,37 @@ func (w DownloadTumbnailsWorker) Work(ctx context.Context, job *river.Job[Downlo
 	}
 
 	var thumbnailUrl string
+	var fullResThumbnailUrl string
+	var webResThumbnailUrl string
 
+	// create the correct URL for each thumbnail type
 	if dbItems.Queue.LiveArchive {
 		info, err := platformService.GetLiveStream(ctx, dbItems.Channel.Name)
 		if err != nil {
 			return err
 		}
 		thumbnailUrl = info.ThumbnailURL
+		fullResThumbnailUrl = replaceThumbnailPlaceholders(thumbnailUrl, "1920", "1080", dbItems.Queue.LiveArchive)
+		webResThumbnailUrl = replaceThumbnailPlaceholders(thumbnailUrl, "640", "360", dbItems.Queue.LiveArchive)
 
+	} else if dbItems.Video.Type == utils.Clip {
+		info, err := platformService.GetClip(ctx, dbItems.Video.ExtID)
+		if err != nil {
+			return err
+		}
+		thumbnailUrl = info.ThumbnailURL
+		fullResThumbnailUrl = thumbnailUrl
+		webResThumbnailUrl = thumbnailUrl
 	} else {
 		info, err := platformService.GetVideo(ctx, dbItems.Video.ExtID, false, false)
 		if err != nil {
 			return err
 		}
 		thumbnailUrl = info.ThumbnailURL
+		fullResThumbnailUrl = replaceThumbnailPlaceholders(thumbnailUrl, "1920", "1080", dbItems.Queue.LiveArchive)
+		webResThumbnailUrl = replaceThumbnailPlaceholders(thumbnailUrl, "640", "360", dbItems.Queue.LiveArchive)
 	}
 
-	fullResThumbnailUrl := replaceThumbnailPlaceholders(thumbnailUrl, "1920", "1080", dbItems.Queue.LiveArchive)
-	webResThumbnailUrl := replaceThumbnailPlaceholders(thumbnailUrl, "640", "360", dbItems.Queue.LiveArchive)
-
 	err = utils.DownloadAndSaveFile(fullResThumbnailUrl, dbItems.Video.ThumbnailPath)
 	if err != nil {
 		return err
@@ -333,6 +367,74 @@ func (w DownloadTumbnailsWorker) Work(ctx context.Context, job *river.Job[Downlo
 		return err
 	}
 
+	// download sprite (seek preview) thumbnails if available
+	// only available for archives
+	if dbItems.Video.Type == utils.Archive && dbItems.Video.Platform == utils.PlatformTwitch {
+		// get video
+		videoInfo, err := platformService.GetVideo(ctx, dbItems.Video.ExtID, true, true)
+		if err != nil {
+			return err
+		}
+
+		if videoInfo.SpriteThumbnailsManifestUrl != nil {
+			logger.Debug().Msg("twitch video has sprite thumbnails, attempting to parse and download")
+
+			// download manifest
+			res, err := http.Get(*videoInfo.SpriteThumbnailsManifestUrl)
+			if err != nil {
+				return fmt.Errorf("error downloading sprite thumbnails manifest: %v", err)
+			}
+			if res.Body != nil {
+				defer res.Body.Close()
+			}
+			body, err := io.ReadAll(res.Body)
+			if err != nil {
+				return fmt.Errorf("error reading download body: %v", err)
+			}
+			spriteManifest := platform.TwitchSpriteManifest{}
+			err = json.Unmarshal(body, &spriteManifest)
+			if err != nil {
+				return fmt.Errorf("error unmarsharling sprite thumbnails manifest: %v", err)
+			}
+			// attempt to find high quality thumbnails
+			for _, manifest := range spriteManifest {
+				if manifest.Quality == "high" {
+					// set paths
+					rootVideoPath := fmt.Sprintf("%s/%s/%s", envConfig.VideosDir, dbItems.Channel.Name, dbItems.Video.FolderName)
+
+					spritesPath := fmt.Sprintf("%s/sprites", rootVideoPath)
+					err = utils.CreateDirectory(spritesPath)
+					if err != nil {
+						return fmt.Errorf("error creating sprites path: %v", err)
+					}
+
+					var spritePaths []string
+
+					// get the base url
+					baseUrl := getBasePath(*videoInfo.SpriteThumbnailsManifestUrl)
+
+					// download each sprite to rootVideoPath/sprites/name
+					for _, image := range manifest.Images {
+						spritePath := fmt.Sprintf("%s/%s", spritesPath, image)
+						spriteUrl := fmt.Sprintf("%s/%s", baseUrl, image)
+						logger.Debug().Str("url", spriteUrl).Msg("downloading thumbnail sprite")
+						err = utils.DownloadAndSaveFile(spriteUrl, spritePath)
+						if err != nil {
+							return fmt.Errorf("error downloading sprite thumbnail image: %v", err)
+						}
+						spritePaths = append(spritePaths, spritePath)
+					}
+
+					// enable sprite thumbnails for video
+					_, err = dbItems.Video.Update().SetSpriteThumbnailsEnabled(true).SetSpriteThumbnailsImages(spritePaths).SetSpriteThumbnailsInterval(manifest.Interval).SetSpriteThumbnailsRows(manifest.Rows).SetSpriteThumbnailsColumns(manifest.Cols).SetSpriteThumbnailsWidth(manifest.Width).SetSpriteThumbnailsHeight(manifest.Height).Save(ctx)
+					if err != nil {
+						return err
+					}
+				}
+			}
+		}
+	}
+
 	// set queue status to completed
 	err = setQueueStatus(ctx, store.Client, QueueStatusInput{
 		Status:  utils.Success,
diff --git a/internal/tasks/heartbeat.go b/internal/tasks/heartbeat.go
index 3c1560b3..1cfccf80 100644
--- a/internal/tasks/heartbeat.go
+++ b/internal/tasks/heartbeat.go
@@ -19,6 +19,7 @@ type RiverJobRow struct {
 }
 
 type RiverJobArgs struct {
+	VideoId  string            `json:"video_id"`
 	Input    ArchiveVideoInput `json:"input"`
 	Continue bool              `json:"continue"`
 }
@@ -98,7 +99,7 @@ func getRiverJobById(ctx context.Context, conn *pgxpool.Pool, id int64) (*RiverJ
 
 	if err != nil {
 		if errors.Is(err, pgx.ErrNoRows) {
-			return nil, fmt.Errorf("no riber job found with id %d", id)
+			return nil, fmt.Errorf("no river job found with id %d", id)
 		}
 		return nil, fmt.Errorf("error querying for river job: %w", err)
 	}
diff --git a/internal/tasks/periodic/periodic.go b/internal/tasks/periodic/periodic.go
index 1ea7fa8d..e7a6f99b 100644
--- a/internal/tasks/periodic/periodic.go
+++ b/internal/tasks/periodic/periodic.go
@@ -25,10 +25,48 @@ func liveServiceFromContext(ctx context.Context) (*live.Service, error) {
 	return liveService, nil
 }
 
+// Check watched channels for live streams
+type CheckChannelsForLivestreamsArgs struct{}
+
+func (CheckChannelsForLivestreamsArgs) Kind() string { return tasks.TaskCheckChannelsForLivestreams }
+
+func (w CheckChannelsForLivestreamsArgs) InsertOpts() river.InsertOpts {
+	return river.InsertOpts{
+		MaxAttempts: 5,
+	}
+}
+
+func (w CheckChannelsForLivestreamsArgs) Timeout(job *river.Job[CheckChannelsForLivestreamsArgs]) time.Duration {
+	return 10 * time.Minute
+}
+
+type CheckChannelsForLivestreamsWorker struct {
+	river.WorkerDefaults[CheckChannelsForLivestreamsArgs]
+}
+
+func (w CheckChannelsForLivestreamsWorker) Work(ctx context.Context, job *river.Job[CheckChannelsForLivestreamsArgs]) error {
+	logger := log.With().Str("task", job.Kind).Str("job_id", fmt.Sprintf("%d", job.ID)).Logger()
+	logger.Info().Msg("starting task")
+
+	liveService, err := liveServiceFromContext(ctx)
+	if err != nil {
+		return err
+	}
+
+	err = liveService.Check(ctx)
+	if err != nil {
+		return err
+	}
+
+	logger.Info().Msg("task completed")
+
+	return nil
+}
+
 // Check watched channels for new videos
 type CheckChannelsForNewVideosArgs struct{}
 
-func (CheckChannelsForNewVideosArgs) Kind() string { return tasks.TaskCheckChannelForNewVideos }
+func (CheckChannelsForNewVideosArgs) Kind() string { return tasks.TaskCheckChannelsForNewVideos }
 
 func (w CheckChannelsForNewVideosArgs) InsertOpts() river.InsertOpts {
 	return river.InsertOpts{
@@ -63,6 +101,44 @@ func (w CheckChannelsForNewVideosWorker) Work(ctx context.Context, job *river.Jo
 	return nil
 }
 
+// Check watched channels for new clips
+type TaskCheckChannelForNewClipsArgs struct{}
+
+func (TaskCheckChannelForNewClipsArgs) Kind() string { return tasks.TaskCheckChannelsForNewClips }
+
+func (w TaskCheckChannelForNewClipsArgs) InsertOpts() river.InsertOpts {
+	return river.InsertOpts{
+		MaxAttempts: 5,
+	}
+}
+
+func (w TaskCheckChannelForNewClipsArgs) Timeout(job *river.Job[TaskCheckChannelForNewClipsArgs]) time.Duration {
+	return 10 * time.Minute
+}
+
+type TaskCheckChannelForNewClipsWorker struct {
+	river.WorkerDefaults[TaskCheckChannelForNewClipsArgs]
+}
+
+func (w TaskCheckChannelForNewClipsWorker) Work(ctx context.Context, job *river.Job[TaskCheckChannelForNewClipsArgs]) error {
+	logger := log.With().Str("task", job.Kind).Str("job_id", fmt.Sprintf("%d", job.ID)).Logger()
+	logger.Info().Msg("starting task")
+
+	liveService, err := liveServiceFromContext(ctx)
+	if err != nil {
+		return err
+	}
+
+	err = liveService.CheckWatchedChannelClips(ctx, logger)
+	if err != nil {
+		return err
+	}
+
+	logger.Info().Msg("task completed")
+
+	return nil
+}
+
 // Prune videos
 type PruneVideosArgs struct{}
 
diff --git a/internal/tasks/periodic/process.go b/internal/tasks/periodic/process.go
index 0e4c8565..14e1c4ca 100644
--- a/internal/tasks/periodic/process.go
+++ b/internal/tasks/periodic/process.go
@@ -54,7 +54,7 @@ func (w SaveVideoChaptersWorker) Work(ctx context.Context, job *river.Job[SaveVi
 	}
 
 	for _, video := range videos {
-		if video.Type == utils.Live {
+		if video.Type == utils.Live || video.Type == utils.Clip {
 			continue
 		}
 		if video.ExtID == "" {
diff --git a/internal/tasks/shared.go b/internal/tasks/shared.go
index 953a8cb7..5ae5d8d5 100644
--- a/internal/tasks/shared.go
+++ b/internal/tasks/shared.go
@@ -29,27 +29,31 @@ var archive_tag = "archive"
 var allow_fail_tag = "allow_fail"
 
 var (
-	TaskUpdateStreamVideoId      = "update_stream_video_id"
-	TaskGenerateStaticThumbnails = "generate_static_thumbnails"
-	TaskArchiveWatchdog          = "archive_watchdog"
-	TaskCheckChannelForNewVideos = "check_channel_for_new_videos"
-	TaskPruneVideos              = "prune_videos"
-	TaskImportVideos             = "import_videos"
-	TaskAuthenticatePlatform     = "authenticate_platform"
-	TaskFetchJWKS                = "fetch_jwks"
-	TaskSaveVideoChapters        = "save_video_chapters"
+	TaskUpdateStreamVideoId         = "update_stream_video_id"
+	TaskGenerateStaticThumbnails    = "generate_static_thumbnails"
+	TaskGenerateSpriteThumbnails    = "generate_sprite_thumbnails"
+	TaskArchiveWatchdog             = "archive_watchdog"
+	TaskCheckChannelsForLivestreams = "chanel_channels_for_livestreams"
+	TaskCheckChannelsForNewVideos   = "check_channels_for_new_videos"
+	TaskCheckChannelsForNewClips    = "check_channels_for_new_clips"
+	TaskPruneVideos                 = "prune_videos"
+	TaskImportVideos                = "import_videos"
+	TaskAuthenticatePlatform        = "authenticate_platform"
+	TaskFetchJWKS                   = "fetch_jwks"
+	TaskSaveVideoChapters           = "save_video_chapters"
 )
 
 var (
-	QueueVideoDownload    = "video-download"
-	QueueVideoPostProcess = "video-postprocess"
-	QueueChatDownload     = "chat-download"
-	QueueChatRender       = "chat-render"
+	QueueVideoDownload            = "video-download"
+	QueueVideoPostProcess         = "video-postprocess"
+	QueueChatDownload             = "chat-download"
+	QueueChatRender               = "chat-render"
+	QueueGenerateThumbnailSprites = "generate-thumbnail-sprites"
 )
 
 type ArchiveVideoInput struct {
-	QueueId       uuid.UUID
-	HeartBeatTime time.Time // do not set this field
+	QueueId       uuid.UUID `json:"queue_id"`
+	HeartBeatTime time.Time `json:"heartbeat_time"` // do not set this field
 }
 
 type GetDatabaseItemsResponse struct {
diff --git a/internal/tasks/thumbnail.go b/internal/tasks/thumbnail.go
index d9293d35..94a59058 100644
--- a/internal/tasks/thumbnail.go
+++ b/internal/tasks/thumbnail.go
@@ -2,11 +2,15 @@ package tasks
 
 import (
 	"context"
+	"fmt"
 	"math/rand"
+	"os"
 	"time"
 
 	"github.com/google/uuid"
 	"github.com/riverqueue/river"
+	"github.com/rs/zerolog/log"
+	"github.com/zibbp/ganymede/internal/config"
 	"github.com/zibbp/ganymede/internal/exec"
 )
 
@@ -64,3 +68,134 @@ func (w GenerateStaticThubmnailWorker) Work(ctx context.Context, job *river.Job[
 
 	return nil
 }
+
+type GenerateSpriteThumbnailArgs struct {
+	VideoId string `json:"video_id"`
+}
+
+func (GenerateSpriteThumbnailArgs) Kind() string { return TaskGenerateSpriteThumbnails }
+
+func (args GenerateSpriteThumbnailArgs) InsertOpts() river.InsertOpts {
+	return river.InsertOpts{
+		MaxAttempts: 1,
+		Queue:       QueueGenerateThumbnailSprites,
+	}
+}
+
+func (w GenerateSpriteThumbnailArgs) Timeout(job *river.Job[GenerateSpriteThumbnailArgs]) time.Duration {
+	return 1 * time.Hour
+}
+
+type GenerateSpriteThumbnailWorker struct {
+	river.WorkerDefaults[GenerateSpriteThumbnailArgs]
+}
+
+func (w GenerateSpriteThumbnailWorker) Work(ctx context.Context, job *river.Job[GenerateSpriteThumbnailArgs]) error {
+	logger := log.With().Str("task", job.Kind).Str("job_id", fmt.Sprintf("%d", job.ID)).Logger()
+	// Get store from context
+	store, err := StoreFromContext(ctx)
+	if err != nil {
+		return err
+	}
+
+	// Start task heartbeat
+	go startHeartBeatForTask(ctx, HeartBeatInput{
+		TaskId: job.ID,
+		conn:   store.ConnPool,
+	})
+
+	videoUUID, err := uuid.Parse(job.Args.VideoId)
+	if err != nil {
+		return err
+	}
+
+	video, err := store.Client.Vod.Get(ctx, videoUUID)
+	if err != nil {
+		return err
+	}
+	videoChannel := video.QueryChannel()
+	channel, err := videoChannel.Only(ctx)
+	if err != nil {
+		return err
+	}
+
+	logger.Info().Str("video_id", video.ID.String()).Msg("generating sprite thumbnails for video")
+
+	env := config.GetEnvConfig()
+
+	// Create temp directory
+	tmpThumbnailsDirectory, err := os.MkdirTemp(env.TempDir, video.ID.String())
+	if err != nil {
+		return err
+	}
+
+	rootVideoPath := fmt.Sprintf("%s/%s/%s", env.VideosDir, channel.Name, video.FolderName)
+	spritesDirectory := fmt.Sprintf("%s/sprites", rootVideoPath)
+
+	err = os.MkdirAll(spritesDirectory, os.ModePerm)
+	if err != nil {
+		return err
+	}
+
+	thumbnailWidth := 220
+	thumbnailHeight := 124
+	spriteTilesX := 5
+	spriteTilesY := 10
+	thumbnailInterval := 60 // default to thumbnails every 60 seconds
+
+	switch {
+	case video.Duration < 60:
+		thumbnailInterval = 1 // thumbnails every 1 second for <60 seconds
+	case video.Duration < 300:
+		thumbnailInterval = 2 // thumbnails every 2 seconds for <5 minutes
+	case video.Duration < 900:
+		thumbnailInterval = 10 // thumbnails every 10 seconds for <15 minutes
+	case video.Duration < 1800:
+		thumbnailInterval = 30 // thumbnails every 30 seconds for <30 minutes
+	}
+
+	logger.Debug().Str("video_id", video.ID.String()).Str("thumbnails", tmpThumbnailsDirectory).Str("sprites", spritesDirectory).Msg("sprite thumbnail paths")
+
+	// Create thumbnails
+	generateThumbnailsConfig := exec.GenerateThumbnailsInput{
+		Video:        video.VideoPath,
+		ThumbnailDir: tmpThumbnailsDirectory,
+		Interval:     thumbnailInterval,
+		Width:        thumbnailWidth,
+		Height:       thumbnailHeight,
+	}
+	err = exec.GenerateThumbnails(generateThumbnailsConfig)
+	if err != nil {
+		return fmt.Errorf("error generating thumbnails: %v", err)
+	}
+
+	// Create sprites with thumbnails
+	createSpritesConfig := exec.CreateSpritesInput{
+		SpriteDir:    spritesDirectory,
+		ThumbnailDir: tmpThumbnailsDirectory,
+		Width:        thumbnailWidth,
+		Height:       thumbnailHeight,
+		TilesX:       spriteTilesX,
+		TilesY:       spriteTilesY,
+	}
+	spritePaths, err := exec.CreateSprites(createSpritesConfig)
+	if err != nil {
+		return fmt.Errorf("error generating sprites: %v", err)
+	}
+
+	// Enable sprite thumbnails for video
+	_, err = video.Update().SetSpriteThumbnailsEnabled(true).SetSpriteThumbnailsImages(spritePaths).SetSpriteThumbnailsInterval(thumbnailInterval).SetSpriteThumbnailsRows(spriteTilesY).SetSpriteThumbnailsColumns(spriteTilesX).SetSpriteThumbnailsWidth(thumbnailWidth).SetSpriteThumbnailsHeight(thumbnailHeight).Save(ctx)
+	if err != nil {
+		return fmt.Errorf("error updating video: %v", err)
+	}
+
+	// Delete temporary thumbnail directory
+	err = os.RemoveAll(tmpThumbnailsDirectory)
+	if err != nil {
+		return err
+	}
+
+	logger.Info().Str("video_id", video.ID.String()).Msg("generated video thumbnail sprites")
+
+	return nil
+}
diff --git a/internal/tasks/video.go b/internal/tasks/video.go
index c551931c..9ec86404 100644
--- a/internal/tasks/video.go
+++ b/internal/tasks/video.go
@@ -319,5 +319,26 @@ func (w MoveVideoWorker) Work(ctx context.Context, job *river.Job[MoveVideoArgs]
 		return err
 	}
 
+	// Queue extra tasks that are not critical to the archive process
+	// queue task to regenerate thumbnail if livestream
+	client := river.ClientFromContext[pgx.Tx](ctx)
+	if dbItems.Video.Type == utils.Live {
+		_, err = client.Insert(ctx, GenerateStaticThumbnailArgs{
+			VideoId: dbItems.Video.ID.String(),
+		}, nil)
+		if err != nil {
+			return err
+		}
+	}
+	// // queue task to generate sprite thumbnails if enabled
+	// if !dbItems.Video.SpriteThumbnailsEnabled && config.Get().Archive.GenerateSpriteThumbnails {
+	// 	_, err = client.Insert(ctx, GenerateSpriteThumbnailArgs{
+	// 		VideoId: dbItems.Video.ID.String(),
+	// 	}, nil)
+	// 	if err != nil {
+	// 		return err
+	// 	}
+	// }
+
 	return nil
 }
diff --git a/internal/tasks/worker/worker.go b/internal/tasks/worker/worker.go
index b2a4ca70..f0706a6e 100644
--- a/internal/tasks/worker/worker.go
+++ b/internal/tasks/worker/worker.go
@@ -106,6 +106,15 @@ func NewRiverWorker(input RiverWorkerInput) (*RiverWorkerClient, error) {
 	if err := river.AddWorkerSafely(workers, &tasks.GenerateStaticThubmnailWorker{}); err != nil {
 		return rc, err
 	}
+	if err := river.AddWorkerSafely(workers, &tasks.GenerateSpriteThumbnailWorker{}); err != nil {
+		return rc, err
+	}
+	if err := river.AddWorkerSafely(workers, &tasks_periodic.TaskCheckChannelForNewClipsWorker{}); err != nil {
+		return rc, err
+	}
+	if err := river.AddWorkerSafely(workers, &tasks_periodic.CheckChannelsForLivestreamsWorker{}); err != nil {
+		return rc, err
+	}
 
 	rc.Ctx = context.Background()
 
@@ -122,11 +131,12 @@ func NewRiverWorker(input RiverWorkerInput) (*RiverWorkerClient, error) {
 	// create river client
 	riverClient, err := river.NewClient(rc.RiverPgxDriver, &river.Config{
 		Queues: map[string]river.QueueConfig{
-			river.QueueDefault:          {MaxWorkers: 100}, // non-resource intensive tasks or time sensitive tasks (live videos and chat)
-			tasks.QueueVideoDownload:    {MaxWorkers: input.VideoDownloadWorkers},
-			tasks.QueueVideoPostProcess: {MaxWorkers: input.VideoPostProcessWorkers},
-			tasks.QueueChatDownload:     {MaxWorkers: input.ChatDownloadWorkers},
-			tasks.QueueChatRender:       {MaxWorkers: input.ChatRenderWorkers},
+			river.QueueDefault:                  {MaxWorkers: 100}, // non-resource intensive tasks or time sensitive tasks (live videos and chat)
+			tasks.QueueVideoDownload:            {MaxWorkers: input.VideoDownloadWorkers},
+			tasks.QueueVideoPostProcess:         {MaxWorkers: input.VideoPostProcessWorkers},
+			tasks.QueueChatDownload:             {MaxWorkers: input.ChatDownloadWorkers},
+			tasks.QueueChatRender:               {MaxWorkers: input.ChatRenderWorkers},
+			tasks.QueueGenerateThumbnailSprites: {MaxWorkers: 1},
 		},
 		Workers:              workers,
 		JobTimeout:           -1,
@@ -175,8 +185,12 @@ func (rc *RiverWorkerClient) GetPeriodicTasks(liveService *live.Service) ([]*riv
 	// put services in ctx for workers
 	rc.Ctx = context.WithValue(rc.Ctx, tasks_shared.LiveServiceKey, liveService)
 
-	// check videos interval
+	// get interval configs
+	configCheckLiveInterval := config.Get().LiveCheckInterval
 	configCheckVideoInterval := config.Get().VideoCheckInterval
+	if configCheckLiveInterval < 15 {
+		log.Warn().Msg("Live check interval should not be less than 15 seconds.")
+	}
 
 	periodicJobs := []*river.PeriodicJob{
 		// archive watchdog
@@ -189,6 +203,16 @@ func (rc *RiverWorkerClient) GetPeriodicTasks(liveService *live.Service) ([]*riv
 			&river.PeriodicJobOpts{RunOnStart: true},
 		),
 
+		// check watched channels for live streams
+		// run at specified interval
+		river.NewPeriodicJob(
+			river.PeriodicInterval(time.Duration(configCheckLiveInterval)*time.Second),
+			func() (river.JobArgs, *river.InsertOpts) {
+				return tasks_periodic.CheckChannelsForLivestreamsArgs{}, nil
+			},
+			&river.PeriodicJobOpts{RunOnStart: false},
+		),
+
 		// check watched channels for new videos
 		// run at specified interval
 		river.NewPeriodicJob(
@@ -199,6 +223,16 @@ func (rc *RiverWorkerClient) GetPeriodicTasks(liveService *live.Service) ([]*riv
 			&river.PeriodicJobOpts{RunOnStart: false},
 		),
 
+		// check watched channels for new clips
+		// runs once a day at midnight
+		river.NewPeriodicJob(
+			midnightCron,
+			func() (river.JobArgs, *river.InsertOpts) {
+				return tasks_periodic.TaskCheckChannelForNewClipsArgs{}, nil
+			},
+			&river.PeriodicJobOpts{RunOnStart: true},
+		),
+
 		// prune videos
 		// runs once a day at midnight
 		river.NewPeriodicJob(
@@ -226,7 +260,7 @@ func (rc *RiverWorkerClient) GetPeriodicTasks(liveService *live.Service) ([]*riv
 			func() (river.JobArgs, *river.InsertOpts) {
 				return tasks_periodic.AuthenticatePlatformArgs{}, nil
 			},
-			&river.PeriodicJobOpts{RunOnStart: false},
+			&river.PeriodicJobOpts{RunOnStart: true},
 		),
 	}
 
diff --git a/internal/transport/http/admin.go b/internal/transport/http/admin.go
index aa1ea95f..11638127 100644
--- a/internal/transport/http/admin.go
+++ b/internal/transport/http/admin.go
@@ -2,6 +2,7 @@ package http
 
 import (
 	"context"
+	"fmt"
 	"net/http"
 
 	"github.com/labstack/echo/v4"
@@ -27,9 +28,9 @@ type AdminService interface {
 func (h *Handler) GetStats(c echo.Context) error {
 	resp, err := h.Service.AdminService.GetStats(c.Request().Context())
 	if err != nil {
-		return err
+		return ErrorResponse(c, http.StatusInternalServerError, fmt.Sprintf("Error retrieving stats: %v", err))
 	}
-	return c.JSON(http.StatusOK, resp)
+	return SuccessResponse(c, resp, "Statistics")
 }
 
 // GetInfo godoc
@@ -46,7 +47,7 @@ func (h *Handler) GetStats(c echo.Context) error {
 func (h *Handler) GetInfo(c echo.Context) error {
 	resp, err := h.Service.AdminService.GetInfo(c.Request().Context())
 	if err != nil {
-		return c.JSON(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, fmt.Sprintf("Error retrieving Ganymede information: %v", err))
 	}
-	return c.JSON(http.StatusOK, resp)
+	return SuccessResponse(c, resp, "Ganymede information")
 }
diff --git a/internal/transport/http/admin_test.go b/internal/transport/http/admin_test.go
deleted file mode 100644
index d1eec33e..00000000
--- a/internal/transport/http/admin_test.go
+++ /dev/null
@@ -1,110 +0,0 @@
-package http_test
-
-import (
-	"context"
-	"encoding/json"
-	"net/http"
-	"net/http/httptest"
-	"testing"
-
-	"github.com/labstack/echo/v4"
-	"github.com/stretchr/testify/assert"
-	"github.com/stretchr/testify/mock"
-	"github.com/zibbp/ganymede/internal/admin"
-	httpHandler "github.com/zibbp/ganymede/internal/transport/http"
-)
-
-type MockAdminService struct {
-	mock.Mock
-}
-
-func (m *MockAdminService) GetStats(ctx context.Context) (admin.GetStatsResp, error) {
-	args := m.Called(ctx)
-	return args.Get(0).(admin.GetStatsResp), args.Error(1)
-}
-
-func (m *MockAdminService) GetInfo(ctx context.Context) (admin.InfoResp, error) {
-	args := m.Called(ctx)
-	return args.Get(0).(admin.InfoResp), args.Error(1)
-}
-
-func setupAdminHandler() *httpHandler.Handler {
-	e := setupEcho()
-	mockAdminService := new(MockAdminService)
-
-	services := httpHandler.Services{
-		AdminService: mockAdminService,
-	}
-
-	handler := &httpHandler.Handler{
-		Server:  e,
-		Service: services,
-	}
-
-	return handler
-}
-
-// TestGetStats is a test function for getting the ganymede stats.
-func TestGetStats(t *testing.T) {
-	handler := setupAdminHandler()
-	e := handler.Server
-	mockService := handler.Service.AdminService.(*MockAdminService)
-
-	expected := admin.GetStatsResp{
-		VodCount:     0,
-		ChannelCount: 0,
-	}
-
-	mockService.On("GetStats", mock.Anything).Return(expected, nil)
-
-	req := httptest.NewRequest(http.MethodPost, "/admin/stats", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.GetStats(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		var response admin.GetStatsResp
-		err := json.Unmarshal(rec.Body.Bytes(), &response)
-		assert.NoError(t, err)
-		assert.Equal(t, expected, response)
-	}
-
-	mockService.AssertExpectations(t)
-}
-
-// TestGetInfo is a test function for getting the ganymede info.
-func TestGetInfo(t *testing.T) {
-	handler := setupAdminHandler()
-	e := handler.Server
-	mockService := handler.Service.AdminService.(*MockAdminService)
-
-	expected := admin.InfoResp{
-		CommitHash: "test",
-		BuildTime:  "test",
-		Uptime:     "test",
-		ProgramVersions: admin.ProgramVersions{
-			FFmpeg:           "test",
-			TwitchDownloader: "test",
-			ChatDownloader:   "test",
-			Streamlink:       "test",
-		},
-	}
-
-	mockService.On("GetInfo", mock.Anything).Return(expected, nil)
-
-	req := httptest.NewRequest(http.MethodPost, "/admin/info", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.GetInfo(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		var response admin.InfoResp
-		err := json.Unmarshal(rec.Body.Bytes(), &response)
-		assert.NoError(t, err)
-		assert.Equal(t, expected, response)
-	}
-
-	mockService.AssertExpectations(t)
-}
diff --git a/internal/transport/http/archive.go b/internal/transport/http/archive.go
index 1475b541..35ccfa45 100644
--- a/internal/transport/http/archive.go
+++ b/internal/transport/http/archive.go
@@ -4,6 +4,7 @@ import (
 	"context"
 	"fmt"
 	"net/http"
+	"regexp"
 	"strconv"
 	"time"
 
@@ -19,6 +20,7 @@ type ArchiveService interface {
 	ArchiveChannel(ctx context.Context, channelName string) (*ent.Channel, error)
 	ArchiveVideo(ctx context.Context, input archive.ArchiveVideoInput) error
 	ArchiveLivestream(ctx context.Context, input archive.ArchiveVideoInput) error
+	ArchiveClip(ctx context.Context, input archive.ArchiveClipInput) error
 }
 
 type ArchiveChannelRequest struct {
@@ -32,6 +34,22 @@ type ArchiveVideoRequest struct {
 	RenderChat  bool             `json:"render_chat"`
 }
 
+// CheckIDType checks if the provided ID is a video id (numeric) or clip (alphanumeric)
+func CheckIDType(id string) string {
+	// Try to parse as a number
+	if _, err := strconv.ParseUint(id, 10, 64); err == nil {
+		return "numeric"
+	}
+
+	// Check for alphanumeric pattern
+	alphanumericRegex := regexp.MustCompile(`^[a-zA-Z0-9\-_]+$`)
+	if alphanumericRegex.MatchString(id) {
+		return "alphanumeric"
+	}
+
+	return "unknown"
+}
+
 // ArchiveChannel godoc
 //
 //	@Summary		Archive a twitch channel
@@ -48,16 +66,16 @@ type ArchiveVideoRequest struct {
 func (h *Handler) ArchiveChannel(c echo.Context) error {
 	body := new(ArchiveChannelRequest)
 	if err := c.Bind(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	channel, err := h.Service.ArchiveService.ArchiveChannel(c.Request().Context(), body.ChannelName)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, channel)
+	return SuccessResponse(c, channel, "twitch channel created")
 }
 
 // ArchiveVideo godoc
@@ -76,25 +94,25 @@ func (h *Handler) ArchiveChannel(c echo.Context) error {
 func (h *Handler) ArchiveVideo(c echo.Context) error {
 	body := new(ArchiveVideoRequest)
 	if err := c.Bind(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	if body.VideoId == "" && body.ChannelId == "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "either channel_id or video_id must be set")
+		return ErrorResponse(c, http.StatusBadRequest, "either channel_id or video_id must be set")
 	}
 
 	if body.VideoId != "" && body.ChannelId != "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "either channel_id or video_id must be set")
+		return ErrorResponse(c, http.StatusBadRequest, "either channel_id or video_id must be set")
 	}
 
 	if body.ChannelId != "" {
 		// validate channel id
 		parsedChannelId, err := uuid.Parse(body.ChannelId)
 		if err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
 		}
 
 		err = h.Service.ArchiveService.ArchiveLivestream(c.Request().Context(), archive.ArchiveVideoInput{
@@ -104,21 +122,39 @@ func (h *Handler) ArchiveVideo(c echo.Context) error {
 			RenderChat:  body.RenderChat,
 		})
 		if err != nil {
-			return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+			return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 		}
 	} else if body.VideoId != "" {
-		err := h.Service.ArchiveService.ArchiveVideo(c.Request().Context(), archive.ArchiveVideoInput{
-			VideoId:     body.VideoId,
-			Quality:     body.Quality,
-			ArchiveChat: body.ArchiveChat,
-			RenderChat:  body.RenderChat,
-		})
-		if err != nil {
-			return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		idType := CheckIDType(body.VideoId)
+
+		if idType == "numeric" {
+			err := h.Service.ArchiveService.ArchiveVideo(c.Request().Context(), archive.ArchiveVideoInput{
+				VideoId:     body.VideoId,
+				Quality:     body.Quality,
+				ArchiveChat: body.ArchiveChat,
+				RenderChat:  body.RenderChat,
+			})
+			if err != nil {
+				return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+			}
+
+		} else if idType == "alphanumeric" {
+			err := h.Service.ArchiveService.ArchiveClip(c.Request().Context(), archive.ArchiveClipInput{
+				ID:          body.VideoId,
+				Quality:     body.Quality,
+				ArchiveChat: body.ArchiveChat,
+				RenderChat:  body.RenderChat,
+			})
+			if err != nil {
+				return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+			}
+		} else {
+			return ErrorResponse(c, http.StatusBadRequest, "Unknown Video ID")
 		}
+
 	}
 
-	return c.JSON(http.StatusOK, nil)
+	return SuccessResponse(c, "", "archive started")
 }
 
 // debug route to test converting chat files
diff --git a/internal/transport/http/archive_test.go b/internal/transport/http/archive_test.go
deleted file mode 100644
index a2b22bac..00000000
--- a/internal/transport/http/archive_test.go
+++ /dev/null
@@ -1,164 +0,0 @@
-package http_test
-
-import (
-	"bytes"
-	"context"
-	"encoding/json"
-	"net/http"
-	"net/http/httptest"
-	"testing"
-
-	"github.com/go-playground/validator/v10"
-	"github.com/google/uuid"
-	"github.com/labstack/echo/v4"
-	"github.com/stretchr/testify/assert"
-	"github.com/stretchr/testify/mock"
-	"github.com/zibbp/ganymede/ent"
-	"github.com/zibbp/ganymede/internal/archive"
-	httpHandler "github.com/zibbp/ganymede/internal/transport/http"
-
-	"github.com/zibbp/ganymede/internal/utils"
-)
-
-type MockArchiveService struct {
-	mock.Mock
-}
-
-func (m *MockArchiveService) ArchiveChannel(ctx context.Context, channelName string) (*ent.Channel, error) {
-	args := m.Called(ctx, channelName)
-	return args.Get(0).(*ent.Channel), args.Error(1)
-}
-
-func (m *MockArchiveService) ArchiveVideo(ctx context.Context, input archive.ArchiveVideoInput) error {
-	args := m.Called(ctx, input)
-	return args.Error(0)
-}
-
-func (m *MockArchiveService) ArchiveLivestream(ctx context.Context, input archive.ArchiveVideoInput) error {
-	args := m.Called(ctx, input)
-	return args.Error(0)
-}
-
-func setupEcho() *echo.Echo {
-	e := echo.New()
-	e.Validator = &utils.CustomValidator{Validator: validator.New()}
-	return e
-}
-
-func setupArchiveHandler() *httpHandler.Handler {
-	e := setupEcho()
-	mockArchiveService := new(MockArchiveService)
-
-	services := httpHandler.Services{
-		ArchiveService: mockArchiveService,
-	}
-
-	handler := &httpHandler.Handler{
-		Server:  e,
-		Service: services,
-	}
-
-	return handler
-}
-
-// TestArchiveChannel is a test function for archiving a channel.
-//
-// It tests the functionality of archiving a channel by sending a POST request with the channel name and verifying the response.
-func TestArchiveChannel(t *testing.T) {
-	handler := setupArchiveHandler()
-	e := handler.Server
-	mockService := handler.Service.ArchiveService.(*MockArchiveService)
-
-	channelName := "test_channel"
-	mockChannel := &ent.Channel{Name: channelName}
-
-	mockService.On("ArchiveChannel", mock.Anything, channelName).Return(mockChannel, nil)
-
-	reqBody, _ := json.Marshal(httpHandler.ArchiveChannelRequest{ChannelName: channelName})
-	req := httptest.NewRequest(http.MethodPost, "/archive/channel", bytes.NewBuffer(reqBody))
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.ArchiveChannel(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		var responseChannel ent.Channel
-		err := json.Unmarshal(rec.Body.Bytes(), &responseChannel)
-		assert.NoError(t, err)
-		assert.Equal(t, mockChannel.Name, responseChannel.Name)
-	}
-
-	mockService.AssertExpectations(t)
-}
-
-func TestArchiveVideo(t *testing.T) {
-	handler := setupArchiveHandler()
-	e := handler.Server
-	mockService := handler.Service.ArchiveService.(*MockArchiveService)
-
-	// test archive video
-	archiveVideoBody := httpHandler.ArchiveVideoRequest{
-		VideoId:     "123456789",
-		Quality:     "best",
-		ArchiveChat: true,
-		RenderChat:  false,
-	}
-
-	expectedInput := archive.ArchiveVideoInput{
-		VideoId:     "123456789",
-		Quality:     "best",
-		ArchiveChat: true,
-		RenderChat:  false,
-	}
-
-	mockService.On("ArchiveVideo", mock.Anything, expectedInput).Return(nil)
-
-	reqBody, _ := json.Marshal(archiveVideoBody)
-	req := httptest.NewRequest(http.MethodPost, "/archive/video", bytes.NewBuffer(reqBody))
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.ArchiveVideo(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-	}
-
-	mockService.AssertExpectations(t)
-}
-
-func TestArchiveLivestream(t *testing.T) {
-	handler := setupArchiveHandler()
-	e := handler.Server
-	mockService := handler.Service.ArchiveService.(*MockArchiveService)
-
-	channelId := uuid.New()
-
-	// test archive livestream
-	archiveLivestreamBody := httpHandler.ArchiveVideoRequest{
-		ChannelId:   channelId.String(),
-		Quality:     "best",
-		ArchiveChat: true,
-		RenderChat:  false,
-	}
-
-	expectedInput := archive.ArchiveVideoInput{
-		ChannelId:   channelId,
-		Quality:     "best",
-		ArchiveChat: true,
-		RenderChat:  false,
-	}
-
-	mockService.On("ArchiveLivestream", mock.Anything, expectedInput).Return(nil)
-
-	reqBody, _ := json.Marshal(archiveLivestreamBody)
-	req := httptest.NewRequest(http.MethodPost, "/archive/livestream", bytes.NewBuffer(reqBody))
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.ArchiveVideo(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-	}
-
-	mockService.AssertExpectations(t)
-}
diff --git a/internal/transport/http/auth.go b/internal/transport/http/auth.go
index e71dcd2d..a6f3dc73 100644
--- a/internal/transport/http/auth.go
+++ b/internal/transport/http/auth.go
@@ -4,27 +4,23 @@ import (
 	"context"
 	"net/http"
 
+	"github.com/google/uuid"
 	"github.com/labstack/echo/v4"
 	"github.com/zibbp/ganymede/ent"
-	"github.com/zibbp/ganymede/internal/auth"
 	"github.com/zibbp/ganymede/internal/config"
 	"github.com/zibbp/ganymede/internal/user"
 )
 
 type AuthService interface {
 	Register(ctx context.Context, userDto user.User) (*ent.User, error)
-	Login(c echo.Context, userDto user.User) (*ent.User, error)
-	Refresh(c echo.Context, refreshToken string) error
-	Me(c *auth.CustomContext) (*ent.User, error)
-	ChangePassword(c *auth.CustomContext, passwordDto auth.ChangePassword) error
+	Login(ctx context.Context, userDto user.User) (*ent.User, error)
+	ChangePassword(ctx context.Context, userId uuid.UUID, oldPassword, newPassword string) error
 	OAuthRedirect(c echo.Context) error
-	OAuthCallback(c echo.Context) error
-	OAuthTokenRefresh(c echo.Context, refreshToken string) error
-	OAuthLogout(c echo.Context) error
+	OAuthCallback(c echo.Context) (*ent.User, error)
 }
 
 type RegisterRequest struct {
-	Username string `json:"username" validate:"required,min=3,max=20"`
+	Username string `json:"username" validate:"required,min=3,max=50"`
 	Password string `json:"password" validate:"required,min=8"`
 }
 
@@ -55,10 +51,10 @@ type ChangePasswordRequest struct {
 func (h *Handler) Register(c echo.Context) error {
 	rr := new(RegisterRequest)
 	if err := c.Bind(rr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(rr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	userDto := user.User{
@@ -68,9 +64,9 @@ func (h *Handler) Register(c echo.Context) error {
 
 	u, err := h.Service.AuthService.Register(c.Request().Context(), userDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, u)
+	return SuccessResponse(c, u, "successfully registered")
 }
 
 // Login godoc
@@ -89,10 +85,10 @@ func (h *Handler) Register(c echo.Context) error {
 func (h *Handler) Login(c echo.Context) error {
 	lr := new(LoginRequest)
 	if err := c.Bind(lr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(lr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	userDto := user.User{
@@ -100,11 +96,26 @@ func (h *Handler) Login(c echo.Context) error {
 		Password: lr.Password,
 	}
 
-	u, err := h.Service.AuthService.Login(c, userDto)
+	u, err := h.Service.AuthService.Login(c.Request().Context(), userDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
-	return c.JSON(http.StatusOK, u)
+
+	if err := h.SessionManager.RenewToken(c.Request().Context()); err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+
+	h.SessionManager.Put(c.Request().Context(), "user_id", u.ID.String())
+
+	return SuccessResponse(c, u, "successfully logged in")
+}
+
+func (h *Handler) Logout(c echo.Context) error {
+	if err := h.SessionManager.Destroy(c.Request().Context()); err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, "error deleting session")
+	}
+
+	return SuccessResponse(c, "", "logged out")
 }
 
 // OAuthLogin godoc
@@ -122,44 +133,16 @@ func (h *Handler) Login(c echo.Context) error {
 func (h *Handler) OAuthLogin(c echo.Context) error {
 	env := config.GetEnvConfig()
 	if !env.OAuthEnabled {
-		return echo.NewHTTPError(http.StatusForbidden, "OAuth is disabled")
+		return ErrorResponse(c, http.StatusForbidden, "OAuth is disabled")
 	}
 	// Redirect to OAuth provider
 	err := h.Service.AuthService.OAuthRedirect(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 	return c.JSON(http.StatusOK, "oAuth redirect")
 }
 
-// Refresh godoc
-//
-//	@Summary		Refresh access-token and refresh-token
-//	@Description	Refresh access-token and refresh-token (sets access-token and refresh-token cookies)
-//	@Tags			auth
-//	@Accept			json
-//	@Produce		json
-//	@Success		200	{object}	string
-//	@Failure		400	{object}	utils.ErrorResponse
-//	@Failure		401	{object}	utils.ErrorResponse
-//	@Failure		500	{object}	utils.ErrorResponse
-//	@Router			/auth/refresh [post]
-func (h *Handler) Refresh(c echo.Context) error {
-
-	refreshCookie, err := c.Cookie("refresh-token")
-	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
-	}
-	refreshToken := refreshCookie.Value
-
-	err = h.Service.AuthService.Refresh(c, refreshToken)
-	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
-	}
-
-	return c.JSON(http.StatusOK, "tokens refreshed")
-}
-
 // Me godoc
 //
 //	@Summary		Get current user
@@ -174,13 +157,9 @@ func (h *Handler) Refresh(c echo.Context) error {
 //	@Router			/auth/me [get]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) Me(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
+	user := userFromContext(c)
 
-	u, err := h.Service.AuthService.Me(cc)
-	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
-	}
-	return c.JSON(http.StatusOK, u)
+	return SuccessResponse(c, user, "you")
 }
 
 // ChangePassword godoc
@@ -198,29 +177,22 @@ func (h *Handler) Me(c echo.Context) error {
 //	@Router			/auth/change-password [post]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) ChangePassword(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
-	cp := new(ChangePasswordRequest)
-	if err := c.Bind(cp); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-	}
-	if err := c.Validate(cp); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-	}
-	if cp.OldPassword == cp.NewPassword {
-		return echo.NewHTTPError(http.StatusBadRequest, "new password must be different from old password")
-	}
+	user := userFromContext(c)
 
-	passwordDto := auth.ChangePassword{
-		OldPassword: cp.OldPassword,
-		NewPassword: cp.NewPassword,
+	changePasswordRequest := new(ChangePasswordRequest)
+	if err := c.Bind(changePasswordRequest); err != nil {
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
+	}
+	if err := c.Validate(changePasswordRequest); err != nil {
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
-	err := h.Service.AuthService.ChangePassword(cc, passwordDto)
+	err := h.Service.AuthService.ChangePassword(c.Request().Context(), user.ID, changePasswordRequest.OldPassword, changePasswordRequest.NewPassword)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, "password changed")
+	return SuccessResponse(c, "", "password changed")
 }
 
 // OAuthCallback godoc
@@ -236,58 +208,13 @@ func (h *Handler) ChangePassword(c echo.Context) error {
 //	@Failure		500	{object}	utils.ErrorResponse
 //	@Router			/auth/oauth/callback [get]
 func (h *Handler) OAuthCallback(c echo.Context) error {
-	env := config.GetEnvApplicationConfig()
-	err := h.Service.AuthService.OAuthCallback(c)
-	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
-	}
-	return c.Redirect(http.StatusFound, env.FrontendHost)
-}
-
-// OAuthTokenRefresh godoc
-//
-//	@Summary		Refresh access-token and refresh-token
-//	@Description	Refresh access-token and refresh-token (sets access-token and refresh-token cookies)
-//	@Tags			auth
-//	@Accept			json
-//	@Produce		json
-//	@Success		200	{object}	string
-//	@Failure		400	{object}	utils.ErrorResponse
-//	@Failure		401	{object}	utils.ErrorResponse
-//	@Failure		500	{object}	utils.ErrorResponse
-//	@Router			/auth/oauth/refresh [get]
-func (h *Handler) OAuthTokenRefresh(c echo.Context) error {
-	refreshCookie, err := c.Cookie("oauth_refresh_token")
+	user, err := h.Service.AuthService.OAuthCallback(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	refreshToken := refreshCookie.Value
 
-	err = h.Service.AuthService.OAuthTokenRefresh(c, refreshToken)
-	if err != nil {
-		return echo.NewHTTPError(http.StatusUnauthorized, err.Error())
-	}
-
-	return c.JSON(http.StatusOK, "tokens refreshed")
-}
+	h.SessionManager.Put(c.Request().Context(), "user_id", user.ID.String())
 
-// OAuthLogout godoc
-//
-//	@Summary		Logout
-//	@Description	Logout
-//	@Tags			auth
-//	@Accept			json
-//	@Produce		json
-//	@Success		200	{object}	string
-//	@Failure		400	{object}	utils.ErrorResponse
-//	@Failure		401	{object}	utils.ErrorResponse
-//	@Failure		500	{object}	utils.ErrorResponse
-//	@Router			/auth/oauth/logout [get]
-func (h *Handler) OAuthLogout(c echo.Context) error {
-	env := config.GetEnvApplicationConfig()
-	err := h.Service.AuthService.OAuthLogout(c)
-	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
-	}
-	return c.Redirect(http.StatusFound, env.FrontendHost)
+	// redirect to frontend /oauth page to set state in frontend
+	return c.Redirect(http.StatusFound, "/")
 }
diff --git a/internal/transport/http/auth_test.go b/internal/transport/http/auth_test.go
deleted file mode 100644
index bf6ac96d..00000000
--- a/internal/transport/http/auth_test.go
+++ /dev/null
@@ -1,164 +0,0 @@
-package http_test
-
-import (
-	"bytes"
-	"context"
-	"encoding/json"
-	"net/http"
-	"net/http/httptest"
-	"testing"
-
-	"github.com/labstack/echo/v4"
-	"github.com/stretchr/testify/assert"
-	"github.com/stretchr/testify/mock"
-	"github.com/zibbp/ganymede/ent"
-	"github.com/zibbp/ganymede/internal/auth"
-	httpHandler "github.com/zibbp/ganymede/internal/transport/http"
-	"github.com/zibbp/ganymede/internal/user"
-)
-
-type MockAuthService struct {
-	mock.Mock
-}
-
-func (m *MockAuthService) Register(ctx context.Context, userDto user.User) (*ent.User, error) {
-	args := m.Called(ctx, userDto)
-	return args.Get(0).(*ent.User), args.Error(1)
-}
-
-func (m *MockAuthService) Login(c echo.Context, userDto user.User) (*ent.User, error) {
-	args := m.Called(c, userDto)
-	return args.Get(0).(*ent.User), args.Error(1)
-}
-
-func (m *MockAuthService) Refresh(c echo.Context, refreshToken string) error {
-	args := m.Called(c, refreshToken)
-	return args.Error(0)
-}
-
-func (m *MockAuthService) Me(c *auth.CustomContext) (*ent.User, error) {
-	args := m.Called(c)
-	return args.Get(0).(*ent.User), args.Error(1)
-}
-
-func (m *MockAuthService) ChangePassword(c *auth.CustomContext, passwordDto auth.ChangePassword) error {
-	args := m.Called(c, passwordDto)
-	return args.Error(0)
-}
-
-func (m *MockAuthService) OAuthRedirect(c echo.Context) error {
-	args := m.Called(c)
-	return args.Error(0)
-}
-
-func (m *MockAuthService) OAuthCallback(c echo.Context) error {
-	args := m.Called(c)
-	return args.Error(0)
-}
-
-func (m *MockAuthService) OAuthTokenRefresh(c echo.Context, refreshToken string) error {
-	args := m.Called(c, refreshToken)
-	return args.Error(0)
-}
-
-func (m *MockAuthService) OAuthLogout(c echo.Context) error {
-	args := m.Called(c)
-	return args.Error(0)
-}
-
-func setupAuthHandler() *httpHandler.Handler {
-	e := setupEcho()
-	mockAuthService := new(MockAuthService)
-
-	services := httpHandler.Services{
-		AuthService: mockAuthService,
-	}
-
-	handler := &httpHandler.Handler{
-		Server:  e,
-		Service: services,
-	}
-
-	return handler
-}
-
-func TestRegister(t *testing.T) {
-	handler := setupAuthHandler()
-	e := handler.Server
-	mockService := handler.Service.AuthService.(*MockAuthService)
-
-	// test register
-	registerBody := httpHandler.RegisterRequest{
-		Username: "username",
-		Password: "password",
-	}
-
-	expectedInput := user.User{
-		Username: "username",
-		Password: "password",
-	}
-
-	expectedOutput := &ent.User{
-		Username: "username",
-	}
-
-	mockService.On("Register", mock.Anything, expectedInput).Return(expectedOutput, nil)
-
-	b, err := json.Marshal(registerBody)
-	if err != nil {
-		t.Fatal(err)
-	}
-	req := httptest.NewRequest(http.MethodPost, "/auth/register", bytes.NewBuffer(b))
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.Register(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		var response *ent.User
-		err := json.Unmarshal(rec.Body.Bytes(), &response)
-		assert.NoError(t, err)
-		assert.Equal(t, expectedOutput, response)
-	}
-}
-
-// TestLogin is a test function for login.
-func TestLogin(t *testing.T) {
-	handler := setupAuthHandler()
-	e := handler.Server
-	mockService := handler.Service.AuthService.(*MockAuthService)
-
-	// test login
-	loginBody := httpHandler.LoginRequest{
-		Username: "username",
-		Password: "password",
-	}
-
-	expectedInput := user.User{
-		Username: "username",
-		Password: "password",
-	}
-
-	expectedOutput := &ent.User{
-		Username: "username",
-	}
-
-	mockService.On("Login", mock.Anything, expectedInput).Return(expectedOutput, nil)
-
-	b, err := json.Marshal(loginBody)
-	if err != nil {
-		t.Fatal(err)
-	}
-	req := httptest.NewRequest(http.MethodPost, "/auth/login", bytes.NewBuffer(b))
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.Login(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		var response *ent.User
-		err := json.Unmarshal(rec.Body.Bytes(), &response)
-		assert.NoError(t, err)
-		assert.Equal(t, expectedOutput, response)
-	}
-}
diff --git a/internal/transport/http/blocked.go b/internal/transport/http/blocked.go
index 866fc82c..01acd750 100644
--- a/internal/transport/http/blocked.go
+++ b/internal/transport/http/blocked.go
@@ -16,7 +16,7 @@ type BlockedVideoService interface {
 }
 
 type ID struct {
-	ID string `json:"id" validate:"required,alphanum"`
+	ID string `json:"id" validate:"required"`
 }
 
 func (h *Handler) IsVideoBlocked(c echo.Context) error {
@@ -24,14 +24,14 @@ func (h *Handler) IsVideoBlocked(c echo.Context) error {
 
 	err := h.Server.Validator.Validate(ID{ID: id})
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	blocked, err := h.Service.BlockedVideoService.IsVideoBlocked(c.Request().Context(), id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, blocked)
+	return SuccessResponse(c, blocked, "is video blocked")
 }
 
 func (h *Handler) CreateBlockedVideo(c echo.Context) error {
@@ -39,14 +39,14 @@ func (h *Handler) CreateBlockedVideo(c echo.Context) error {
 
 	err := h.Server.Validator.Validate(ID{ID: id})
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	err = h.Service.BlockedVideoService.CreateBlockedVideo(c.Request().Context(), id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, nil)
+	return SuccessResponse(c, "", "blocked video")
 }
 
 func (h *Handler) DeleteBlockedVideo(c echo.Context) error {
@@ -54,20 +54,20 @@ func (h *Handler) DeleteBlockedVideo(c echo.Context) error {
 
 	err := h.Server.Validator.Validate(ID{ID: id})
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	err = h.Service.BlockedVideoService.DeleteBlockedVideo(c.Request().Context(), id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, nil)
+	return SuccessResponse(c, "", "unblocked video")
 }
 
 func (h *Handler) GetBlockedVideos(c echo.Context) error {
 	videos, err := h.Service.BlockedVideoService.GetBlockedVideos(c.Request().Context())
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, videos)
+	return SuccessResponse(c, videos, "blocked videos")
 }
diff --git a/internal/transport/http/blocked_test.go b/internal/transport/http/blocked_test.go
deleted file mode 100644
index 6e0a8da8..00000000
--- a/internal/transport/http/blocked_test.go
+++ /dev/null
@@ -1,133 +0,0 @@
-package http_test
-
-import (
-	"context"
-	"net/http"
-	"net/http/httptest"
-	"testing"
-
-	"github.com/labstack/echo/v4"
-	"github.com/stretchr/testify/assert"
-	"github.com/stretchr/testify/mock"
-	"github.com/zibbp/ganymede/ent"
-	httpHandler "github.com/zibbp/ganymede/internal/transport/http"
-)
-
-type MockBlockedVideoService struct {
-	mock.Mock
-}
-
-func (m *MockBlockedVideoService) IsVideoBlocked(ctx context.Context, id string) (bool, error) {
-	args := m.Called(ctx, id)
-	return args.Get(0).(bool), args.Error(1)
-}
-
-func (m *MockBlockedVideoService) CreateBlockedVideo(ctx context.Context, id string) error {
-	args := m.Called(ctx, id)
-	return args.Error(0)
-}
-
-func (m *MockBlockedVideoService) DeleteBlockedVideo(ctx context.Context, id string) error {
-	args := m.Called(ctx, id)
-	return args.Error(0)
-}
-
-func (m *MockBlockedVideoService) GetBlockedVideos(ctx context.Context) ([]*ent.BlockedVideos, error) {
-	args := m.Called(ctx)
-	return args.Get(0).([]*ent.BlockedVideos), args.Error(1)
-}
-
-func setupBlockedVideoHandler() *httpHandler.Handler {
-	e := setupEcho()
-
-	MockBlockedVideoService := new(MockBlockedVideoService)
-
-	services := httpHandler.Services{
-		BlockedVideoService: MockBlockedVideoService,
-	}
-
-	handler := &httpHandler.Handler{
-		Server:  e,
-		Service: services,
-	}
-
-	return handler
-}
-
-func TestIsVideoBlocked(t *testing.T) {
-	handler := setupBlockedVideoHandler()
-	e := handler.Server
-	mockService := handler.Service.BlockedVideoService.(*MockBlockedVideoService)
-
-	mockService.On("IsVideoBlocked", mock.Anything, mock.Anything).Return(true, nil)
-
-	req := httptest.NewRequest(http.MethodGet, "/blocked-video/123", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-	c.SetParamNames("id")
-	c.SetParamValues("123")
-
-	if assert.NoError(t, handler.IsVideoBlocked(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		mockService.AssertExpectations(t)
-	}
-}
-
-func TestCreateBlockedVideo(t *testing.T) {
-	handler := setupBlockedVideoHandler()
-	e := handler.Server
-	mockService := handler.Service.BlockedVideoService.(*MockBlockedVideoService)
-
-	mockService.On("CreateBlockedVideo", mock.Anything, mock.Anything).Return(nil)
-
-	req := httptest.NewRequest(http.MethodPost, "/blocked-video/123", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-	c.SetParamNames("id")
-	c.SetParamValues("123")
-
-	if assert.NoError(t, handler.CreateBlockedVideo(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		mockService.AssertExpectations(t)
-	}
-}
-
-func TestDeleteBlockedVideo(t *testing.T) {
-	handler := setupBlockedVideoHandler()
-	e := handler.Server
-	mockService := handler.Service.BlockedVideoService.(*MockBlockedVideoService)
-
-	mockService.On("DeleteBlockedVideo", mock.Anything, mock.Anything).Return(nil)
-
-	req := httptest.NewRequest(http.MethodDelete, "/blocked-video/123", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-	c.SetParamNames("id")
-	c.SetParamValues("123")
-
-	if assert.NoError(t, handler.DeleteBlockedVideo(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		mockService.AssertExpectations(t)
-	}
-}
-
-func TestGetBlockedVideos(t *testing.T) {
-	handler := setupBlockedVideoHandler()
-	e := handler.Server
-	mockService := handler.Service.BlockedVideoService.(*MockBlockedVideoService)
-
-	mockService.On("GetBlockedVideos", mock.Anything).Return([]*ent.BlockedVideos{}, nil)
-
-	req := httptest.NewRequest(http.MethodGet, "/blocked", nil)
-	req.Header.Set(echo.HeaderContentType, echo.MIMEApplicationJSON)
-	rec := httptest.NewRecorder()
-	c := e.NewContext(req, rec)
-
-	if assert.NoError(t, handler.GetBlockedVideos(c)) {
-		assert.Equal(t, http.StatusOK, rec.Code)
-		mockService.AssertExpectations(t)
-	}
-}
diff --git a/internal/transport/http/category.go b/internal/transport/http/category.go
index c1f17625..4c7edb0d 100644
--- a/internal/transport/http/category.go
+++ b/internal/transport/http/category.go
@@ -15,7 +15,7 @@ type CategoryService interface {
 func (h *Handler) GetCategories(c echo.Context) error {
 	categories, err := h.Service.CategoryService.GetCategories(c.Request().Context())
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, categories)
+	return SuccessResponse(c, categories, "twitch categories")
 }
diff --git a/internal/transport/http/channel.go b/internal/transport/http/channel.go
index 4b15fcc4..8382b8bd 100644
--- a/internal/transport/http/channel.go
+++ b/internal/transport/http/channel.go
@@ -47,10 +47,10 @@ type CreateChannelRequest struct {
 func (h *Handler) CreateChannel(c echo.Context) error {
 	ccr := new(CreateChannelRequest)
 	if err := c.Bind(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	if ccr.ExternalID == "" {
@@ -67,10 +67,10 @@ func (h *Handler) CreateChannel(c echo.Context) error {
 
 	cha, err := h.Service.ChannelService.CreateChannel(ccDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, cha)
+	return SuccessResponse(c, cha, "channel created")
 }
 
 // GetChannels godoc
@@ -87,10 +87,10 @@ func (h *Handler) CreateChannel(c echo.Context) error {
 func (h *Handler) GetChannels(c echo.Context) error {
 	channels, err := h.Service.ChannelService.GetChannels()
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, channels)
+	return SuccessResponse(c, channels, "channels")
 }
 
 // GetChannel godoc
@@ -110,16 +110,16 @@ func (h *Handler) GetChannel(c echo.Context) error {
 	id := c.Param("id")
 	cUUID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	cha, err := h.Service.ChannelService.GetChannel(cUUID)
 	if err != nil {
 		if err.Error() == "channel not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, cha)
+	return SuccessResponse(c, cha, "channel")
 }
 
 // DeleteChannel godoc
@@ -140,14 +140,14 @@ func (h *Handler) DeleteChannel(c echo.Context) error {
 	id := c.Param("id")
 	cUUID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	err = h.Service.ChannelService.DeleteChannel(cUUID)
 	if err != nil {
 		if err.Error() == "channel not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 	return c.NoContent(http.StatusOK)
 }
@@ -171,14 +171,14 @@ func (h *Handler) UpdateChannel(c echo.Context) error {
 	id := c.Param("id")
 	cUUID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	ccr := new(CreateChannelRequest)
 	if err := c.Bind(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	ccDto := channel.Channel{
@@ -192,11 +192,11 @@ func (h *Handler) UpdateChannel(c echo.Context) error {
 	cha, err := h.Service.ChannelService.UpdateChannel(cUUID, ccDto)
 	if err != nil {
 		if err.Error() == "channel not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, cha)
+	return SuccessResponse(c, cha, "channel updated")
 }
 
 // GetChannelByName godoc
@@ -217,23 +217,23 @@ func (h *Handler) GetChannelByName(c echo.Context) error {
 	cha, err := h.Service.ChannelService.GetChannelByName(name)
 	if err != nil {
 		if err.Error() == "channel not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, cha)
+	return SuccessResponse(c, cha, "channel")
 }
 
 func (h *Handler) UpdateChannelImage(c echo.Context) error {
-	id := c.QueryParam("id")
+	id := c.Param("id")
 	cUUID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	err = h.Service.ChannelService.UpdateChannelImage(c.Request().Context(), cUUID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "channel image updated")
 }
diff --git a/internal/transport/http/chapter.go b/internal/transport/http/chapter.go
index 45e70b75..05ed3f93 100644
--- a/internal/transport/http/chapter.go
+++ b/internal/transport/http/chapter.go
@@ -19,15 +19,15 @@ func (h *Handler) GetVideoChapters(c echo.Context) error {
 	// parse uuid
 	vid, err := uuid.Parse(videoId)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	chapters, err := h.Service.ChapterService.GetVideoChapters(vid)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, chapters)
+	return SuccessResponse(c, chapters, "video chapters")
 }
 
 func (h *Handler) GetWebVTTChapters(c echo.Context) error {
@@ -36,17 +36,17 @@ func (h *Handler) GetWebVTTChapters(c echo.Context) error {
 	// parse uuid
 	vid, err := uuid.Parse(videoId)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	chapters, err := h.Service.ChapterService.GetVideoChapters(vid)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
 	webVtt, err := h.Service.ChapterService.CreateWebVtt(chapters)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
 	return c.String(http.StatusOK, webVtt)
diff --git a/internal/transport/http/config.go b/internal/transport/http/config.go
index 8ce4b07c..82c460f3 100644
--- a/internal/transport/http/config.go
+++ b/internal/transport/http/config.go
@@ -7,54 +7,6 @@ import (
 	"github.com/zibbp/ganymede/internal/config"
 )
 
-// type ConfigService interface {
-// 	GetConfig(ctx context.Context) (*config.Conf, error)
-// 	UpdateConfig(c echo.Context, conf *config.Conf) error
-// 	GetNotificationConfig(c echo.Context) (*config.Notification, error)
-// 	UpdateNotificationConfig(c echo.Context, conf *config.Notification) error
-// 	GetStorageTemplateConfig(c echo.Context) (*config.StorageTemplate, error)
-// 	UpdateStorageTemplateConfig(c echo.Context, conf *config.StorageTemplate) error
-// }
-
-// type UpdateConfigRequest struct {
-// 	RegistrationEnabled bool `json:"registration_enabled"`
-// 	Parameters          struct {
-// 		TwitchToken    string `json:"twitch_token"`
-// 		VideoConvert   string `json:"video_convert" validate:"required"`
-// 		ChatRender     string `json:"chat_render" validate:"required"`
-// 		StreamlinkLive string `json:"streamlink_live"`
-// 	} `json:"parameters"`
-// 	Archive struct {
-// 		SaveAsHls bool `json:"save_as_hls"`
-// 	} `json:"archive"`
-// 	Livestream struct {
-// 		Proxies         []config.ProxyListItem `json:"proxies"`
-// 		ProxyEnabled    bool                   `json:"proxy_enabled"`
-// 		ProxyParameters string                 `json:"proxy_parameters"`
-// 		ProxyWhitelist  []string               `json:"proxy_whitelist"`
-// 	} `json:"livestream"`
-// }
-
-// type UpdateNotificationRequest struct {
-// 	VideoSuccessWebhookUrl string `json:"video_success_webhook_url"`
-// 	VideoSuccessTemplate   string `json:"video_success_template"`
-// 	VideoSuccessEnabled    bool   `json:"video_success_enabled"`
-// 	LiveSuccessWebhookUrl  string `json:"live_success_webhook_url"`
-// 	LiveSuccessTemplate    string `json:"live_success_template"`
-// 	LiveSuccessEnabled     bool   `json:"live_success_enabled"`
-// 	ErrorWebhookUrl        string `json:"error_webhook_url"`
-// 	ErrorTemplate          string `json:"error_template"`
-// 	ErrorEnabled           bool   `json:"error_enabled"`
-// 	IsLiveWebhookUrl       string `json:"is_live_webhook_url"`
-// 	IsLiveTemplate         string `json:"is_live_template"`
-// 	IsLiveEnabled          bool   `json:"is_live_enabled"`
-// }
-
-// type UpdateStorageTemplateRequest struct {
-// 	FolderTemplate string `json:"folder_template" validate:"required"`
-// 	FileTemplate   string `json:"file_template" validate:"required"`
-// }
-
 // GetConfig godoc
 //
 //	@Summary		Get config
@@ -68,7 +20,7 @@ import (
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) GetConfig(c echo.Context) error {
 	config := config.Get()
-	return c.JSON(http.StatusOK, config)
+	return SuccessResponse(c, config, "config")
 }
 
 // UpdateConfig godoc
@@ -87,17 +39,17 @@ func (h *Handler) GetConfig(c echo.Context) error {
 func (h *Handler) UpdateConfig(c echo.Context) error {
 	conf := new(config.Config)
 	if err := c.Bind(conf); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	if err := c.Validate(conf); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	err := config.UpdateConfig(conf)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, conf)
+	return SuccessResponse(c, conf, "config updated")
 }
diff --git a/internal/transport/http/handler.go b/internal/transport/http/handler.go
index 9f50ce1e..cfcb4c06 100644
--- a/internal/transport/http/handler.go
+++ b/internal/transport/http/handler.go
@@ -3,8 +3,14 @@ package http
 import (
 	"context"
 	"net/http"
+	"net/http/httputil"
+	"net/url"
+	"strings"
 	"time"
 
+	"github.com/alexedwards/scs/pgxstore"
+	"github.com/alexedwards/scs/v2"
+	session "github.com/canidam/echo-scs-session"
 	"github.com/go-playground/validator/v10"
 	"github.com/labstack/echo/v4"
 	"github.com/labstack/echo/v4/middleware"
@@ -12,10 +18,11 @@ import (
 	"github.com/rs/zerolog/log"
 	echoSwagger "github.com/swaggo/echo-swagger"
 	_ "github.com/zibbp/ganymede/docs"
-	"github.com/zibbp/ganymede/internal/auth"
 	"github.com/zibbp/ganymede/internal/config"
+	"github.com/zibbp/ganymede/internal/database"
 	"github.com/zibbp/ganymede/internal/platform"
 	"github.com/zibbp/ganymede/internal/utils"
+	"riverqueue.com/riverui"
 )
 
 type Services struct {
@@ -27,7 +34,6 @@ type Services struct {
 	AdminService        AdminService
 	UserService         UserService
 	LiveService         LiveService
-	SchedulerService    SchedulerService
 	PlaybackService     PlaybackService
 	MetricsService      MetricsService
 	PlaylistService     PlaylistService
@@ -39,13 +45,24 @@ type Services struct {
 }
 
 type Handler struct {
-	Server  *echo.Echo
-	Service Services
+	Server         *echo.Echo
+	Service        Services
+	SessionManager *scs.SessionManager
+	RiverUIServer  *riverui.Server
 }
 
-func NewHandler(authService AuthService, channelService ChannelService, vodService VodService, queueService QueueService, archiveService ArchiveService, adminService AdminService, userService UserService, liveService LiveService, schedulerService SchedulerService, playbackService PlaybackService, metricsService MetricsService, playlistService PlaylistService, taskService TaskService, chapterService ChapterService, categoryService CategoryService, blockedVideoService BlockedVideoService, platformTwitch platform.Platform) *Handler {
-	log.Debug().Msg("creating new handler")
-	env := config.GetEnvApplicationConfig()
+var sessionManager *scs.SessionManager
+
+func NewHandler(database *database.Database, authService AuthService, channelService ChannelService, vodService VodService, queueService QueueService, archiveService ArchiveService, adminService AdminService, userService UserService, liveService LiveService, playbackService PlaybackService, metricsService MetricsService, playlistService PlaylistService, taskService TaskService, chapterService ChapterService, categoryService CategoryService, blockedVideoService BlockedVideoService, platformTwitch platform.Platform, riverUIServer *riverui.Server) *Handler {
+	log.Debug().Msg("creating route handler")
+	envConfig := config.GetEnvConfig()
+
+	sessionManager = scs.New()
+	sessionManager.Store = pgxstore.New(database.ConnPool)
+	// 30 days session lifetime
+	sessionManager.Lifetime = (24 * time.Hour) * 30
+	// Expire session if no activity for 7 days
+	sessionManager.IdleTimeout = (24 * time.Hour) * 7
 
 	h := &Handler{
 		Server: echo.New(),
@@ -58,7 +75,6 @@ func NewHandler(authService AuthService, channelService ChannelService, vodServi
 			AdminService:        adminService,
 			UserService:         userService,
 			LiveService:         liveService,
-			SchedulerService:    schedulerService,
 			PlaybackService:     playbackService,
 			MetricsService:      metricsService,
 			PlaylistService:     playlistService,
@@ -68,23 +84,45 @@ func NewHandler(authService AuthService, channelService ChannelService, vodServi
 			BlockedVideoService: blockedVideoService,
 			PlatformTwitch:      platformTwitch,
 		},
+		SessionManager: sessionManager,
+		RiverUIServer:  riverUIServer,
 	}
 
+	// Use sessions
+	h.Server.Use(session.LoadAndSave(sessionManager))
+
 	// Middleware
 	h.Server.Validator = &utils.CustomValidator{Validator: validator.New()}
 
 	h.Server.HideBanner = true
 
+	// If frontend is external then allow cors
 	h.Server.Use(middleware.CORSWithConfig(middleware.CORSConfig{
-		AllowOrigins:     []string{env.FrontendHost},
 		AllowMethods:     []string{http.MethodGet, http.MethodHead, http.MethodPut, http.MethodPatch, http.MethodPost, http.MethodDelete},
 		AllowCredentials: true,
 	}))
 
-	h.mapRoutes()
+	// Enable request logging in debug
+	if envConfig.DEBUG {
+		logger := log.Logger
+		h.Server.Use(middleware.RequestLoggerWithConfig(middleware.RequestLoggerConfig{
+			LogURI:    true,
+			LogStatus: true,
+			LogValuesFunc: func(c echo.Context, v middleware.RequestLoggerValues) error {
+				if !strings.Contains(v.URI, "/api") {
+					return nil
+				}
+				logger.Info().
+					Str("URI", v.URI).
+					Int("status", v.Status).
+					Msg("request")
+
+				return nil
+			},
+		}))
+	}
 
-	// Start scheduler
-	go h.Service.SchedulerService.StartLiveScheduler()
+	h.mapRoutes()
 
 	return h
 }
@@ -92,14 +130,12 @@ func NewHandler(authService AuthService, channelService ChannelService, vodServi
 func (h *Handler) mapRoutes() {
 	log.Debug().Msg("mapping routes")
 
-	h.Server.GET("/", func(c echo.Context) error {
-		return c.String(200, "Ganymede API")
-	})
-
+	// Basic health route
 	h.Server.GET("/health", func(c echo.Context) error {
 		return c.String(200, "OK")
 	})
 
+	// Setup Prometheus metrics route
 	h.Server.GET("/metrics", func(c echo.Context) error {
 		r, err := h.GatherMetrics()
 		if err != nil {
@@ -111,81 +147,81 @@ func (h *Handler) mapRoutes() {
 		return nil
 	})
 
-	// Static files
+	// Static files if not using nginx
 	envConfig := config.GetEnvConfig()
 	h.Server.Static(envConfig.VideosDir, envConfig.VideosDir)
 
+	// RiverUI
+	h.Server.Any("/riverui/", echo.WrapHandler(h.RiverUIServer), AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	h.Server.Any("/riverui/*", echo.WrapHandler(h.RiverUIServer), AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+
 	// Swagger
 	h.Server.GET("/swagger/*", echoSwagger.WrapHandler)
 
+	// Proxy frontend server
+	frontendURL, _ := url.Parse("http://127.0.0.1:3000")
+	h.Server.Any("/*", echo.WrapHandler(http.StripPrefix("/", httputil.NewSingleHostReverseProxy(frontendURL))))
+
+	// create v1 group and setup v1 routes
 	v1 := h.Server.Group("/api/v1")
 	groupV1Routes(v1, h)
 }
 
 func groupV1Routes(e *echo.Group, h *Handler) {
 
-	//auth.GuardMiddleware := middleware.JWTWithConfig(middleware.JWTConfig{
-	//	Claims:                  &auth.Claims{},
-	//	SigningKey:              []byte(auth.GetJWTSecret()),
-	//	TokenLookup:             "cookie:access-token",
-	//	ErrorHandlerWithContext: auth.JWTErrorChecker,
-	//})
-
-	// Demo route for testing JWT and roles
-	e.GET("/demo", func(c echo.Context) error {
-		return c.JSON(http.StatusOK, "Demo Route")
-	}, auth.GuardMiddleware)
-
 	// Auth
 	authGroup := e.Group("/auth")
 	authGroup.POST("/register", h.Register)
 	authGroup.POST("/login", h.Login)
-	authGroup.POST("/refresh", h.Refresh)
-	authGroup.GET("/me", h.Me, auth.GuardMiddleware, auth.GetUserMiddleware)
-	authGroup.POST("/change-password", h.ChangePassword, auth.GuardMiddleware, auth.GetUserMiddleware)
+	authGroup.POST("/logout", h.Logout, AuthGuardMiddleware)
+	authGroup.GET("/me", h.Me, AuthGuardMiddleware, AuthGetUserMiddleware)
+	authGroup.POST("/change-password", h.ChangePassword, AuthGuardMiddleware, AuthGetUserMiddleware)
 	authGroup.GET("/oauth/login", h.OAuthLogin)
 	authGroup.GET("/oauth/callback", h.OAuthCallback)
-	authGroup.GET("/oauth/refresh", h.OAuthTokenRefresh)
-	authGroup.GET("/oauth/logout", h.OAuthLogout)
 
 	// Channel
 	channelGroup := e.Group("/channel")
-	channelGroup.POST("", h.CreateChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	channelGroup.POST("", h.CreateChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
 	channelGroup.GET("", h.GetChannels)
 	channelGroup.GET("/:id", h.GetChannel)
 	channelGroup.GET("/name/:name", h.GetChannelByName)
-	channelGroup.PUT("/:id", h.UpdateChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	channelGroup.DELETE("/:id", h.DeleteChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	channelGroup.POST("/update-image", h.UpdateChannelImage, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	channelGroup.PUT("/:id", h.UpdateChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	channelGroup.DELETE("/:id", h.DeleteChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	channelGroup.POST("/:id/update-image", h.UpdateChannelImage, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
 
 	// VOD
 	vodGroup := e.Group("/vod")
-	vodGroup.POST("", h.CreateVod, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	vodGroup.POST("", h.CreateVod, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
 	vodGroup.GET("", h.GetVods)
 	vodGroup.GET("/:id", h.GetVod)
+	vodGroup.GET("/external_id/:external_id", h.GetVod)
 	vodGroup.GET("/search", h.SearchVods)
-	vodGroup.PUT("/:id", h.UpdateVod, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	vodGroup.DELETE("/:id", h.DeleteVod, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	vodGroup.PUT("/:id", h.UpdateVod, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	vodGroup.DELETE("/:id", h.DeleteVod, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 	vodGroup.GET("/:id/playlist", h.GetVodPlaylists)
+	vodGroup.GET("/:id/clips", h.GetVodClips)
 	vodGroup.GET("/paginate", h.GetVodsPagination)
 	vodGroup.GET("/:id/chat", h.GetVodChatComments)
 	vodGroup.GET("/:id/chat/seek", h.GetNumberOfVodChatCommentsFromTime)
 	vodGroup.GET("/:id/chat/userid", h.GetUserIdFromChat)
 	vodGroup.GET("/:id/chat/emotes", h.GetChatEmotes)
 	vodGroup.GET("/:id/chat/badges", h.GetChatBadges)
-	vodGroup.POST("/:id/lock", h.LockVod, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	vodGroup.POST("/:id/generate-static-thumbnail", h.GenerateStaticThumbnail, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	vodGroup.GET("/:id/chat/histogram", h.GetVodChatHistogram)
+	vodGroup.POST("/:id/lock", h.LockVod, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	vodGroup.POST("/:id/generate-static-thumbnail", h.GenerateStaticThumbnail, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	vodGroup.POST("/:id/generate-sprite-thumbnails", h.GenerateSpriteThumbnails, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	vodGroup.GET("/:id/thumbnails/vtt", h.GetVodSpriteThumbnails)
 
 	// Queue
 	queueGroup := e.Group("/queue")
-	queueGroup.POST("", h.CreateQueueItem, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	queueGroup.GET("", h.GetQueueItems, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
-	queueGroup.GET("/:id", h.GetQueueItem, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
-	queueGroup.PUT("/:id", h.UpdateQueueItem, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	queueGroup.DELETE("/:id", h.DeleteQueueItem, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	queueGroup.GET("/:id/tail", h.ReadQueueLogFile, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
-	queueGroup.POST("/:id/stop", h.StopQueueItem, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	queueGroup.POST("/task/start", h.StartQueueTask, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
+	queueGroup.POST("", h.CreateQueueItem, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	queueGroup.GET("", h.GetQueueItems, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
+	queueGroup.GET("/:id", h.GetQueueItem, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
+	queueGroup.PUT("/:id", h.UpdateQueueItem, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	queueGroup.DELETE("/:id", h.DeleteQueueItem, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	queueGroup.GET("/:id/tail", h.ReadQueueLogFile, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
+	queueGroup.POST("/:id/stop", h.StopQueueItem, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	queueGroup.POST("/task/start", h.StartQueueTask, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
 
 	// Twitch
 	twitchGroup := e.Group("/twitch")
@@ -196,70 +232,69 @@ func groupV1Routes(e *echo.Group, h *Handler) {
 
 	// Archive
 	archiveGroup := e.Group("/archive")
-	archiveGroup.POST("/channel", h.ArchiveChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
-	archiveGroup.POST("/video", h.ArchiveVideo, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
-	archiveGroup.POST("/convert-twitch-live-chat", h.ConvertTwitchChat, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	archiveGroup.POST("/channel", h.ArchiveChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
+	archiveGroup.POST("/video", h.ArchiveVideo, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
+	archiveGroup.POST("/convert-twitch-live-chat", h.ConvertTwitchChat, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// Admin
 	adminGroup := e.Group("/admin")
-	adminGroup.GET("/stats", h.GetStats, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	adminGroup.GET("/info", h.GetInfo, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	adminGroup.GET("/stats", h.GetStats, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	adminGroup.GET("/info", h.GetInfo, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// User
 	userGroup := e.Group("/user")
-	userGroup.GET("", h.GetUsers, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	userGroup.GET("/:id", h.GetUser, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	userGroup.PUT("/:id", h.UpdateUser, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	userGroup.DELETE("/:id", h.DeleteUser, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	userGroup.GET("", h.GetUsers, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	userGroup.GET("/:id", h.GetUser, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	userGroup.PUT("/:id", h.UpdateUser, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	userGroup.DELETE("/:id", h.DeleteUser, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// Config
 	configGroup := e.Group("/config")
-	configGroup.GET("", h.GetConfig, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
-	configGroup.PUT("", h.UpdateConfig, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	configGroup.GET("", h.GetConfig, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
+	configGroup.PUT("", h.UpdateConfig, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// Live
 	liveGroup := e.Group("/live")
-	liveGroup.GET("", h.GetLiveWatchedChannels, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	liveGroup.POST("", h.AddLiveWatchedChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	liveGroup.POST("/multiple", h.AddMultipleLiveWatchedChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	liveGroup.PUT("/:id", h.UpdateLiveWatchedChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	liveGroup.DELETE("/:id", h.DeleteLiveWatchedChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	liveGroup.GET("/check", h.Check, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	// liveGroup.GET("/vod", h.CheckVodWatchedChannels, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	// liveGroup.POST("/archive", h.ArchiveLiveChannel, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
+	liveGroup.GET("", h.GetLiveWatchedChannels, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	liveGroup.POST("", h.AddLiveWatchedChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	liveGroup.PUT("/:id", h.UpdateLiveWatchedChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	liveGroup.DELETE("/:id", h.DeleteLiveWatchedChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	liveGroup.GET("/check", h.Check, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	// liveGroup.GET("/vod", h.CheckVodWatchedChannels, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	// liveGroup.POST("/archive", h.ArchiveLiveChannel, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
 
 	// Playback
 	playbackGroup := e.Group("/playback")
-	playbackGroup.GET("", h.GetAllProgress, auth.GuardMiddleware, auth.GetUserMiddleware)
-	playbackGroup.GET("/:id", h.GetProgress, auth.GuardMiddleware, auth.GetUserMiddleware)
-	playbackGroup.POST("/progress", h.UpdateProgress, auth.GuardMiddleware, auth.GetUserMiddleware)
-	playbackGroup.POST("/status", h.UpdateStatus, auth.GuardMiddleware, auth.GetUserMiddleware)
-	playbackGroup.DELETE("/:id", h.DeleteProgress, auth.GuardMiddleware, auth.GetUserMiddleware)
-	playbackGroup.GET("/last", h.GetLastPlaybacks, auth.GuardMiddleware, auth.GetUserMiddleware)
+	playbackGroup.GET("", h.GetAllProgress, AuthGuardMiddleware, AuthGetUserMiddleware)
+	playbackGroup.GET("/:id", h.GetProgress, AuthGuardMiddleware, AuthGetUserMiddleware)
+	playbackGroup.POST("/progress", h.UpdateProgress, AuthGuardMiddleware, AuthGetUserMiddleware)
+	playbackGroup.POST("/status", h.UpdateStatus, AuthGuardMiddleware, AuthGetUserMiddleware)
+	playbackGroup.DELETE("/:id", h.DeleteProgress, AuthGuardMiddleware, AuthGetUserMiddleware)
+	playbackGroup.GET("/last", h.GetLastPlaybacks, AuthGuardMiddleware, AuthGetUserMiddleware)
 	playbackGroup.POST("/start", h.StartPlayback)
 
 	// Playlist
 	playlistGroup := e.Group("/playlist")
 	playlistGroup.GET("/:id", h.GetPlaylist)
 	playlistGroup.GET("", h.GetPlaylists)
-	playlistGroup.POST("", h.CreatePlaylist, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	playlistGroup.POST("/:id", h.AddVodToPlaylist, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	playlistGroup.DELETE("/:id/vod", h.DeleteVodFromPlaylist, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	playlistGroup.DELETE("/:id", h.DeletePlaylist, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	playlistGroup.PUT("/:id/multistream/delay", h.SetVodDelayOnPlaylistMultistream, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	playlistGroup.PUT("/:id", h.UpdatePlaylist, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	playlistGroup.POST("", h.CreatePlaylist, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	playlistGroup.POST("/:id", h.AddVodToPlaylist, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	playlistGroup.DELETE("/:id/vod", h.DeleteVodFromPlaylist, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	playlistGroup.DELETE("/:id", h.DeletePlaylist, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	playlistGroup.PUT("/:id", h.UpdatePlaylist, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	playlistGroup.PUT("/:id/multistream/delay", h.SetVodDelayOnPlaylistMultistream, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
 
 	// Exec
 	execGroup := e.Group("/exec")
-	execGroup.POST("/ffprobe", h.GetFfprobeData, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.ArchiverRole))
+	execGroup.POST("/ffprobe", h.GetFfprobeData, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.ArchiverRole))
 
 	// Task
 	taskGroup := e.Group("/task")
-	taskGroup.POST("/start", h.StartTask, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	taskGroup.POST("/start", h.StartTask, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// Notification
 	notificationGroup := e.Group("/notification")
-	notificationGroup.POST("/test", h.TestNotification, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.AdminRole))
+	notificationGroup.POST("/test", h.TestNotification, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.AdminRole))
 
 	// Chapter
 	chapterGroup := e.Group("/chapter")
@@ -273,8 +308,8 @@ func groupV1Routes(e *echo.Group, h *Handler) {
 	// Blocked
 	blockedGroup := e.Group("/blocked-video")
 	blockedGroup.GET("", h.GetBlockedVideos)
-	blockedGroup.POST("/:id", h.CreateBlockedVideo, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
-	blockedGroup.DELETE("/:id", h.DeleteBlockedVideo, auth.GuardMiddleware, auth.GetUserMiddleware, auth.UserRoleMiddleware(utils.EditorRole))
+	blockedGroup.POST("/:id", h.CreateBlockedVideo, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
+	blockedGroup.DELETE("/:id", h.DeleteBlockedVideo, AuthGuardMiddleware, AuthGetUserMiddleware, AuthUserRoleMiddleware(utils.EditorRole))
 	blockedGroup.GET("/:id", h.IsVideoBlocked)
 }
 
diff --git a/internal/transport/http/live.go b/internal/transport/http/live.go
index 92790331..05c2173a 100644
--- a/internal/transport/http/live.go
+++ b/internal/transport/http/live.go
@@ -34,6 +34,9 @@ type AddWatchedChannelRequest struct {
 	ApplyCategoriesToLive bool                `json:"apply_categories_to_live" validate:"boolean"`
 	MaxAge                int64               `json:"max_age"`
 	Regex                 []AddLiveTitleRegex `json:"regex"`
+	WatchClips            bool                `json:"watch_clips" validate:"boolean"`
+	ClipsLimit            int                 `json:"clips_limit" validate:"number,gte=1"`
+	ClipsIntervalDays     int                 `json:"clips_interval_days" validate:"number,gte=1"`
 }
 
 type AddLiveTitleRegex struct {
@@ -42,22 +45,6 @@ type AddLiveTitleRegex struct {
 	ApplyToVideos bool   `json:"apply_to_videos" validate:"boolean"`
 }
 
-type AddMultipleWatchedChannelRequest struct {
-	WatchLive             bool     `json:"watch_live" `
-	WatchVod              bool     `json:"watch_vod" `
-	DownloadArchives      bool     `json:"download_archives" `
-	DownloadHighlights    bool     `json:"download_highlights" `
-	DownloadUploads       bool     `json:"download_uploads"`
-	ChannelID             []string `json:"channel_id" validate:"required"`
-	Resolution            string   `json:"resolution" validate:"required,oneof=best source 720p60 480p 360p 160p 480p30 360p30 160p30 audio"`
-	ArchiveChat           bool     `json:"archive_chat"`
-	RenderChat            bool     `json:"render_chat"`
-	DownloadSubOnly       bool     `json:"download_sub_only"`
-	Categories            []string `json:"categories"`
-	ApplyCategoriesToLive bool     `json:"apply_categories_to_live"`
-	MaxAge                int64    `json:"max_age"`
-}
-
 type UpdateWatchedChannelRequest struct {
 	WatchLive             bool                `json:"watch_live" validate:"boolean"`
 	WatchVod              bool                `json:"watch_vod" validate:"boolean"`
@@ -72,6 +59,9 @@ type UpdateWatchedChannelRequest struct {
 	ApplyCategoriesToLive bool                `json:"apply_categories_to_live" validate:"boolean"`
 	MaxAge                int64               `json:"max_age"`
 	Regex                 []AddLiveTitleRegex `json:"regex"`
+	WatchClips            bool                `json:"watch_clips" validate:"boolean"`
+	ClipsLimit            int                 `json:"clips_limit" validate:"number,gte=1"`
+	ClipsIntervalDays     int                 `json:"clips_interval_days" validate:"number,gte=1"`
 }
 
 type ConvertChatRequest struct {
@@ -84,10 +74,13 @@ type ConvertChatRequest struct {
 }
 
 type ArchiveLiveChannelRequest struct {
-	ChannelID   string `json:"channel_id" validate:"required"`
-	Resolution  string `json:"resolution" validate:"required,oneof=best source 720p60 480p 360p 160p 480p30 360p30 160p30 audio"`
-	ArchiveChat bool   `json:"archive_chat"`
-	RenderChat  bool   `json:"render_chat"`
+	ChannelID         string `json:"channel_id" validate:"required"`
+	Resolution        string `json:"resolution" validate:"required,oneof=best source 720p60 480p 360p 160p 480p30 360p30 160p30 audio"`
+	ArchiveChat       bool   `json:"archive_chat"`
+	RenderChat        bool   `json:"render_chat"`
+	WatchClips        bool   `json:"watch_clips" validate:"boolean"`
+	ClipsLimit        int    `json:"clips_limit" validate:"number,gte=1"`
+	ClipsIntervalDays int    `json:"clips_interval_days" validate:"number,gte=1"`
 }
 
 // GetLiveWatchedChannels godoc
@@ -104,10 +97,10 @@ type ArchiveLiveChannelRequest struct {
 func (h *Handler) GetLiveWatchedChannels(c echo.Context) error {
 	channels, err := h.Service.LiveService.GetLiveWatchedChannels(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, channels)
+	return SuccessResponse(c, channels, "wathed channels")
 }
 
 // AddLiveWatchedChannel godoc
@@ -126,18 +119,18 @@ func (h *Handler) GetLiveWatchedChannels(c echo.Context) error {
 func (h *Handler) AddLiveWatchedChannel(c echo.Context) error {
 	ccr := new(AddWatchedChannelRequest)
 	if err := c.Bind(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	cUUID, err := uuid.Parse(ccr.ChannelID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	if len(ccr.Categories) == 0 && ccr.ApplyCategoriesToLive {
-		return echo.NewHTTPError(http.StatusBadRequest, "categories cannot be empty if apply_categories_to_live is true")
+		return ErrorResponse(c, http.StatusBadRequest, "categories cannot be empty if apply_categories_to_live is true")
 	}
 
 	liveDto := live.Live{
@@ -155,11 +148,14 @@ func (h *Handler) AddLiveWatchedChannel(c echo.Context) error {
 		Categories:            ccr.Categories,
 		ApplyCategoriesToLive: ccr.ApplyCategoriesToLive,
 		MaxAge:                ccr.MaxAge,
+		WatchClips:            ccr.WatchClips,
+		ClipsLimit:            ccr.ClipsLimit,
+		ClipsIntervalDays:     ccr.ClipsIntervalDays,
 	}
 
 	for _, regex := range ccr.Regex {
 		if err := c.Validate(regex); err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
 		}
 		liveDto.TitleRegex = append(liveDto.TitleRegex, ent.LiveTitleRegex{
 			Negative:      regex.Negative,
@@ -170,69 +166,10 @@ func (h *Handler) AddLiveWatchedChannel(c echo.Context) error {
 
 	l, err := h.Service.LiveService.AddLiveWatchedChannel(c, liveDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, l)
-}
-
-// AddMultipleLiveWatchedChannel godoc
-//
-//	@Summary		Add multiple watched channels at once
-//	@Description	This is useful to add multiple channels at once if they all have the same settings
-//	@Tags			Live
-//	@Accept			json
-//	@Produce		json
-//	@Param			body	body		AddMultipleWatchedChannelRequest	true	"Add watched channel"
-//	@Success		200		{object}	ent.Live
-//	@Failure		400		{object}	utils.ErrorResponse
-//	@Failure		500		{object}	utils.ErrorResponse
-//	@Router			/live/multiple [post]
-//	@Security		ApiKeyCookieAuth
-func (h *Handler) AddMultipleLiveWatchedChannel(c echo.Context) error {
-	ccr := new(AddMultipleWatchedChannelRequest)
-	if err := c.Bind(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-	}
-	if err := c.Validate(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-	}
-
-	var response []*ent.Live
-	for _, cID := range ccr.ChannelID {
-		cUUID, err := uuid.Parse(cID)
-		if err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-		}
-
-		if len(ccr.Categories) == 0 && ccr.ApplyCategoriesToLive {
-			return echo.NewHTTPError(http.StatusBadRequest, "categories cannot be empty if apply_categories_to_live is true")
-		}
-
-		liveDto := live.Live{
-			ID:                    cUUID,
-			WatchLive:             ccr.WatchLive,
-			WatchVod:              ccr.WatchVod,
-			DownloadArchives:      ccr.DownloadArchives,
-			DownloadHighlights:    ccr.DownloadHighlights,
-			DownloadUploads:       ccr.DownloadUploads,
-			IsLive:                false,
-			ArchiveChat:           ccr.ArchiveChat,
-			Resolution:            ccr.Resolution,
-			RenderChat:            ccr.RenderChat,
-			DownloadSubOnly:       ccr.DownloadSubOnly,
-			Categories:            ccr.Categories,
-			ApplyCategoriesToLive: ccr.ApplyCategoriesToLive,
-			MaxAge:                ccr.MaxAge,
-		}
-		l, err := h.Service.LiveService.AddLiveWatchedChannel(c, liveDto)
-		if err != nil {
-			return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
-		}
-		response = append(response, l)
-	}
-
-	return c.JSON(http.StatusOK, response)
+	return SuccessResponse(c, l, "created watched channel")
 }
 
 // UpdateLiveWatchedChannel godoc
@@ -253,18 +190,18 @@ func (h *Handler) UpdateLiveWatchedChannel(c echo.Context) error {
 	id := c.Param("id")
 	lID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	ccr := new(UpdateWatchedChannelRequest)
 	if err := c.Bind(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(ccr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	if len(ccr.Categories) == 0 && ccr.ApplyCategoriesToLive {
-		return echo.NewHTTPError(http.StatusBadRequest, "categories cannot be empty if apply_categories_to_live is true")
+		return ErrorResponse(c, http.StatusBadRequest, "categories cannot be empty if apply_categories_to_live is true")
 	}
 
 	liveDto := live.Live{
@@ -281,11 +218,14 @@ func (h *Handler) UpdateLiveWatchedChannel(c echo.Context) error {
 		Categories:            ccr.Categories,
 		ApplyCategoriesToLive: ccr.ApplyCategoriesToLive,
 		MaxAge:                ccr.MaxAge,
+		WatchClips:            ccr.WatchClips,
+		ClipsLimit:            ccr.ClipsLimit,
+		ClipsIntervalDays:     ccr.ClipsIntervalDays,
 	}
 
 	for _, regex := range ccr.Regex {
 		if err := c.Validate(regex); err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
 		}
 		liveDto.TitleRegex = append(liveDto.TitleRegex, ent.LiveTitleRegex{
 			Negative:      regex.Negative,
@@ -296,10 +236,10 @@ func (h *Handler) UpdateLiveWatchedChannel(c echo.Context) error {
 
 	l, err := h.Service.LiveService.UpdateLiveWatchedChannel(c, liveDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, l)
+	return SuccessResponse(c, l, "updated watched channel")
 }
 
 // DeleteLiveWatchedChannel godoc
@@ -319,12 +259,12 @@ func (h *Handler) DeleteLiveWatchedChannel(c echo.Context) error {
 	id := c.Param("id")
 	lID, err := uuid.Parse(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	err = h.Service.LiveService.DeleteLiveWatchedChannel(c, lID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
 	return c.NoContent(http.StatusOK)
@@ -333,66 +273,7 @@ func (h *Handler) DeleteLiveWatchedChannel(c echo.Context) error {
 func (h *Handler) Check(c echo.Context) error {
 	err := h.Service.LiveService.Check(c.Request().Context())
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "deleted watched channel")
 }
-
-// CheckVodWatchedChannels godoc
-//
-//	@Summary		Check watched channels
-//	@Description	Check watched channels if they are live. This is what runs every X seconds in the config.
-//	@Tags			Live
-//	@Accept			json
-//	@Produce		json
-//	@Success		200	{object}	string
-//	@Failure		400	{object}	utils.ErrorResponse
-//	@Failure		500	{object}	utils.ErrorResponse
-//	@Router			/live/check [get]
-//	@Security		ApiKeyCookieAuth
-// func (h *Handler) CheckVodWatchedChannels(c echo.Context) error {
-// 	go h.Service.LiveService.CheckVodWatchedChannels()
-
-// 	return c.JSON(http.StatusOK, "ok")
-// }
-
-// ArchiveLiveChannel godoc
-//
-//	@Summary		Archive a channel's live stream
-//	@Description	Adhoc archive a channel's live stream.
-//	@Tags			Live
-//	@Accept			json
-//	@Produce		json
-//	@Success		200	{object}	string
-//	@Failure		400	{object}	utils.ErrorResponse
-//	@Failure		500	{object}	utils.ErrorResponse
-//	@Router			/live/archive [post]
-//	@Security		ApiKeyCookieAuth
-// func (h *Handler) ArchiveLiveChannel(c echo.Context) error {
-// 	alcr := new(ArchiveLiveChannelRequest)
-// 	if err := c.Bind(alcr); err != nil {
-// 		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-// 	}
-// 	if err := c.Validate(alcr); err != nil {
-// 		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-// 	}
-// 	// validate channel uuid
-// 	cID, err := uuid.Parse(alcr.ChannelID)
-// 	if err != nil {
-// 		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
-// 	}
-
-// 	archiveLiveDto := live.ArchiveLive{
-// 		ChannelID:   cID,
-// 		Resolution:  alcr.Resolution,
-// 		ArchiveChat: alcr.ArchiveChat,
-// 		RenderChat:  alcr.RenderChat,
-// 	}
-
-// 	err = h.Service.LiveService.ArchiveLiveChannel(c, archiveLiveDto)
-// 	if err != nil {
-// 		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
-// 	}
-
-// 	return c.JSON(http.StatusOK, "ok")
-// }
diff --git a/internal/transport/http/middleware.go b/internal/transport/http/middleware.go
new file mode 100644
index 00000000..9836cfa8
--- /dev/null
+++ b/internal/transport/http/middleware.go
@@ -0,0 +1,104 @@
+package http
+
+import (
+	"github.com/google/uuid"
+	"github.com/labstack/echo/v4"
+	"github.com/rs/zerolog/log"
+	"github.com/zibbp/ganymede/ent"
+	"github.com/zibbp/ganymede/ent/user"
+	"github.com/zibbp/ganymede/internal/database"
+	"github.com/zibbp/ganymede/internal/utils"
+)
+
+// AuthGuardMiddleware is a middleware that enforces authentication. If the request does not contain a vaild session a 403 error is returned.
+func AuthGuardMiddleware(next echo.HandlerFunc) echo.HandlerFunc {
+	return func(c echo.Context) error {
+
+		userID, ok := sessionManager.Get(c.Request().Context(), "user_id").(string)
+		if !ok {
+			return ErrorInvalidAccessTokenResponse(c)
+		}
+
+		c.Set("auth_method", "local")
+		c.Set("user.id", userID)
+
+		return next(c)
+	}
+}
+
+// AuthGetUserMiddleware is a middleware that fetches the user from the database and sets it in the request context. AuthGuardMiddleware is expected to run before this to set the user ID from a session token.
+func AuthGetUserMiddleware(next echo.HandlerFunc) echo.HandlerFunc {
+	return func(c echo.Context) error {
+		authMethod := c.Get("auth_method").(string)
+		if authMethod == "local" {
+			idStr, ok := c.Get("user.id").(string)
+			if !ok {
+				log.Error().Msg("user id missing from context")
+				return ErrorInvalidAccessTokenResponse(c)
+			}
+
+			id, err := uuid.Parse(idStr)
+			if err != nil {
+				log.Error().Err(err).Msg("error parsing user id as uuid")
+				return ErrorInvalidAccessTokenResponse(c)
+			}
+
+			user, err := database.DB().Client.User.Query().Where(user.ID(id)).Only(c.Request().Context())
+			if err != nil {
+				return ErrorInvalidAccessTokenResponse(c)
+			}
+
+			c.Set("user", user)
+
+			return next(c)
+		}
+
+		return next(c)
+	}
+}
+
+func AuthUserRoleMiddleware(role utils.Role) echo.MiddlewareFunc {
+	return func(next echo.HandlerFunc) echo.HandlerFunc {
+		return func(c echo.Context) error {
+			user := userFromContext(c)
+
+			switch role {
+			case utils.AdminRole:
+				if user.Role == utils.AdminRole {
+					return next(c)
+				}
+				return ErrorUnauthorizedResponse(c)
+			case utils.EditorRole:
+				if user.Role == utils.EditorRole || user.Role == utils.AdminRole {
+					return next(c)
+				}
+				return ErrorUnauthorizedResponse(c)
+			case utils.ArchiverRole:
+				if user.Role == utils.ArchiverRole || user.Role == utils.EditorRole || user.Role == utils.AdminRole {
+					return next(c)
+				}
+				return ErrorUnauthorizedResponse(c)
+			case utils.UserRole:
+				if user.Role == utils.UserRole || user.Role == utils.ArchiverRole || user.Role == utils.EditorRole || user.Role == utils.AdminRole {
+					return next(c)
+				}
+				return ErrorUnauthorizedResponse(c)
+			default:
+				return ErrorUnauthorizedResponse(c)
+			}
+		}
+	}
+}
+
+// userFromContext parses the user from the request context as a *ent.User.
+func userFromContext(c echo.Context) *ent.User {
+	userStr := c.Get("user")
+	user, ok := userStr.(*ent.User)
+	if !ok {
+		err := ErrorInvalidAccessTokenResponse(c)
+		if err != nil {
+			return nil
+		}
+	}
+	return user
+}
diff --git a/internal/transport/http/notification.go b/internal/transport/http/notification.go
index 72a42e43..fa8b7eb4 100644
--- a/internal/transport/http/notification.go
+++ b/internal/transport/http/notification.go
@@ -26,7 +26,7 @@ func (h *Handler) TestNotification(c echo.Context) error {
 
 	notificationType := c.QueryParam("type")
 	if notificationType == "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "type is required")
+		return ErrorResponse(c, http.StatusBadRequest, "type is required")
 	}
 
 	testChannel := ent.Channel{
@@ -62,8 +62,8 @@ func (h *Handler) TestNotification(c echo.Context) error {
 	case "is_live":
 		notification.SendLiveNotification(&testChannel, &testVod, &testQueue)
 	default:
-		return echo.NewHTTPError(http.StatusBadRequest, "type is invalid")
+		return ErrorResponse(c, http.StatusBadRequest, "type is invalid")
 	}
 
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "sent")
 }
diff --git a/internal/transport/http/playback.go b/internal/transport/http/playback.go
index 2ff6d847..0c60f203 100644
--- a/internal/transport/http/playback.go
+++ b/internal/transport/http/playback.go
@@ -1,6 +1,7 @@
 package http
 
 import (
+	"context"
 	"errors"
 	"fmt"
 	"net/http"
@@ -9,17 +10,16 @@ import (
 	"github.com/google/uuid"
 	"github.com/labstack/echo/v4"
 	"github.com/zibbp/ganymede/ent"
-	"github.com/zibbp/ganymede/internal/auth"
 	"github.com/zibbp/ganymede/internal/playback"
 )
 
 type PlaybackService interface {
-	UpdateProgress(c *auth.CustomContext, vID uuid.UUID, time int) error
-	GetProgress(c *auth.CustomContext, vID uuid.UUID) (*ent.Playback, error)
-	GetAllProgress(c *auth.CustomContext) ([]*ent.Playback, error)
-	UpdateStatus(c *auth.CustomContext, vID uuid.UUID, status string) error
-	DeleteProgress(c *auth.CustomContext, vID uuid.UUID) error
-	GetLastPlaybacks(c *auth.CustomContext, limit int) (*playback.GetPlaybackResp, error)
+	UpdateProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID, time int) error
+	GetProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID) (*ent.Playback, error)
+	GetAllProgress(ctx context.Context, userId uuid.UUID) ([]*ent.Playback, error)
+	UpdateStatus(ctx context.Context, userId uuid.UUID, videoId uuid.UUID, status string) error
+	DeleteProgress(ctx context.Context, userId uuid.UUID, videoId uuid.UUID) error
+	GetLastPlaybacks(ctx context.Context, userId uuid.UUID, limit int) (*playback.GetPlaybackResp, error)
 	StartPlayback(c echo.Context, videoId uuid.UUID) error
 }
 
@@ -47,23 +47,23 @@ type UpdateStatusRequest struct {
 //	@Router			/playback/progress [post]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) UpdateProgress(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
+	user := userFromContext(c)
 	upr := new(UpdateProgressRequest)
 	if err := c.Bind(upr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(upr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(upr.VodID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
-	err = h.Service.PlaybackService.UpdateProgress(cc, vID, upr.Time)
+	err = h.Service.PlaybackService.UpdateProgress(c.Request().Context(), user.ID, vID, upr.Time)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "ok")
 }
 
 // GetProgress godoc
@@ -80,17 +80,17 @@ func (h *Handler) UpdateProgress(c echo.Context) error {
 //	@Router			/playback/progress/{id} [get]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) GetProgress(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
+	user := userFromContext(c)
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
-	playbackEntry, err := h.Service.PlaybackService.GetProgress(cc, vID)
+	playbackEntry, err := h.Service.PlaybackService.GetProgress(c.Request().Context(), user.ID, vID)
 	if err != nil {
 		if errors.Is(err, playback.ErrorPlaybackNotFound) {
 			return ErrorResponse(c, http.StatusOK, "playback not found")
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
 	return SuccessResponse(c, playbackEntry, fmt.Sprintf("playback data for %s", vID))
@@ -108,12 +108,12 @@ func (h *Handler) GetProgress(c echo.Context) error {
 //	@Router			/playback [get]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) GetAllProgress(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
-	playbackEntries, err := h.Service.PlaybackService.GetAllProgress(cc)
+	user := userFromContext(c)
+	playbackEntries, err := h.Service.PlaybackService.GetAllProgress(c.Request().Context(), user.ID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, playbackEntries)
+	return SuccessResponse(c, playbackEntries, "playback entries")
 }
 
 // UpdateStatus godoc
@@ -130,23 +130,24 @@ func (h *Handler) GetAllProgress(c echo.Context) error {
 //	@Router			/playback/status [post]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) UpdateStatus(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
+	user := userFromContext(c)
 	usr := new(UpdateStatusRequest)
 	if err := c.Bind(usr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(usr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(usr.VodID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
-	err = h.Service.PlaybackService.UpdateStatus(cc, vID, usr.Status)
+	err = h.Service.PlaybackService.UpdateStatus(c.Request().Context(), user.ID, vID, usr.Status)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+
+	return SuccessResponse(c, "", "ok")
 }
 
 // DeleteProgress godoc
@@ -163,31 +164,32 @@ func (h *Handler) UpdateStatus(c echo.Context) error {
 //	@Router			/playback/{id} [delete]
 //	@Security		ApiKeyCookieAuth
 func (h *Handler) DeleteProgress(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
+	user := userFromContext(c)
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
-	err = h.Service.PlaybackService.DeleteProgress(cc, vID)
+	err = h.Service.PlaybackService.DeleteProgress(c.Request().Context(), user.ID, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+
+	return SuccessResponse(c, "", "ok")
 }
 
 func (h *Handler) GetLastPlaybacks(c echo.Context) error {
-	cc := c.(*auth.CustomContext)
-
+	user := userFromContext(c)
 	limit, err := strconv.Atoi(c.QueryParam("limit"))
 	if err != nil {
 		return echo.NewHTTPError(http.StatusBadRequest, "invalid limit")
 	}
 
-	playbackEntries, err := h.Service.PlaybackService.GetLastPlaybacks(cc, limit)
+	playbackEntries, err := h.Service.PlaybackService.GetLastPlaybacks(c.Request().Context(), user.ID, limit)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, playbackEntries)
+
+	return SuccessResponse(c, playbackEntries, "playback entries")
 }
 
 // StartPlayback godoc
@@ -211,8 +213,8 @@ func (h *Handler) StartPlayback(c echo.Context) error {
 
 	err = h.Service.PlaybackService.StartPlayback(c, videoId)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "ok")
 }
diff --git a/internal/transport/http/playlist.go b/internal/transport/http/playlist.go
index ca38ddb5..2f261328 100644
--- a/internal/transport/http/playlist.go
+++ b/internal/transport/http/playlist.go
@@ -50,10 +50,10 @@ type SetVodDelayPlaylistRequest struct {
 func (h *Handler) CreatePlaylist(c echo.Context) error {
 	cpr := new(CreatePlaylistRequest)
 	if err := c.Bind(cpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(cpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	playlistDto := playlist.Playlist{
 		Name:        cpr.Name,
@@ -61,9 +61,9 @@ func (h *Handler) CreatePlaylist(c echo.Context) error {
 	}
 	createdPlaylist, err := h.Service.PlaylistService.CreatePlaylist(c, playlistDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, createdPlaylist)
+	return SuccessResponse(c, createdPlaylist, "created playlist")
 
 }
 
@@ -84,24 +84,24 @@ func (h *Handler) CreatePlaylist(c echo.Context) error {
 func (h *Handler) AddVodToPlaylist(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	avtpr := new(AddVodToPlaylistRequest)
 	if err := c.Bind(avtpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(avtpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(avtpr.VodID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
 	err = h.Service.PlaylistService.AddVodToPlaylist(c, pID, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "video added to playlist")
 }
 
 // GetPlaylists godoc
@@ -117,9 +117,9 @@ func (h *Handler) AddVodToPlaylist(c echo.Context) error {
 func (h *Handler) GetPlaylists(c echo.Context) error {
 	playlists, err := h.Service.PlaylistService.GetPlaylists(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, playlists)
+	return SuccessResponse(c, playlists, "playlists")
 }
 
 // GetPlaylist godoc
@@ -138,13 +138,13 @@ func (h *Handler) GetPlaylists(c echo.Context) error {
 func (h *Handler) GetPlaylist(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	rPlaylist, err := h.Service.PlaylistService.GetPlaylist(c, pID, c.QueryParams().Get("with_multistream_info") == "true")
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, rPlaylist)
+	return SuccessResponse(c, rPlaylist, "playlist")
 }
 
 // UpdatePlaylist godoc
@@ -164,14 +164,14 @@ func (h *Handler) GetPlaylist(c echo.Context) error {
 func (h *Handler) UpdatePlaylist(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	upr := new(CreatePlaylistRequest)
 	if err := c.Bind(upr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(upr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	playlistDto := playlist.Playlist{
 		Name:        upr.Name,
@@ -179,9 +179,9 @@ func (h *Handler) UpdatePlaylist(c echo.Context) error {
 	}
 	updatedPlaylist, err := h.Service.PlaylistService.UpdatePlaylist(c, pID, playlistDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, updatedPlaylist)
+	return SuccessResponse(c, updatedPlaylist, "playlist updated")
 }
 
 // SetVodDelayOnPlaylistMultistream godoc
@@ -201,24 +201,24 @@ func (h *Handler) UpdatePlaylist(c echo.Context) error {
 func (h *Handler) SetVodDelayOnPlaylistMultistream(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	svdpr := new(SetVodDelayPlaylistRequest)
 	if err := c.Bind(svdpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(svdpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(svdpr.VodID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
 	err = h.Service.PlaylistService.SetVodDelayOnPlaylist(c, pID, vID, svdpr.DelayMs)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "ok")
 }
 
 // DeletePlaylist godoc
@@ -237,13 +237,13 @@ func (h *Handler) SetVodDelayOnPlaylistMultistream(c echo.Context) error {
 func (h *Handler) DeletePlaylist(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	err = h.Service.PlaylistService.DeletePlaylist(c, pID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "playlist deleted")
 }
 
 // DeleteVodFromPlaylist godoc
@@ -263,22 +263,22 @@ func (h *Handler) DeletePlaylist(c echo.Context) error {
 func (h *Handler) DeleteVodFromPlaylist(c echo.Context) error {
 	pID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid playlist id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid playlist id")
 	}
 	avtpr := new(AddVodToPlaylistRequest)
 	if err := c.Bind(avtpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(avtpr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(avtpr.VodID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid vod id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid vod id")
 	}
 	err = h.Service.PlaylistService.DeleteVodFromPlaylist(c, pID, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, "ok")
+	return SuccessResponse(c, "", "video removed from playlist")
 }
diff --git a/internal/transport/http/queue.go b/internal/transport/http/queue.go
index cca5aa09..cd3f88b8 100644
--- a/internal/transport/http/queue.go
+++ b/internal/transport/http/queue.go
@@ -2,6 +2,7 @@ package http
 
 import (
 	"context"
+	"fmt"
 	"net/http"
 
 	"github.com/google/uuid"
@@ -69,10 +70,10 @@ type UpdateQueueRequest struct {
 func (h *Handler) CreateQueueItem(c echo.Context) error {
 	cqt := new(CreateQueueRequest)
 	if err := c.Bind(cqt); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(cqt); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	vID, err := uuid.Parse(cqt.VodID)
 	if err != nil {
@@ -83,9 +84,9 @@ func (h *Handler) CreateQueueItem(c echo.Context) error {
 
 	que, err := h.Service.QueueService.CreateQueueItem(cqtDto, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusCreated, que)
+	return SuccessResponse(c, que, "created queue entry")
 }
 
 // GetQueueItems godoc
@@ -112,15 +113,15 @@ func (h *Handler) GetQueueItems(c echo.Context) error {
 	if len(processing) > 0 {
 		qFilter, err := h.Service.QueueService.GetQueueItemsFilter(c, pro)
 		if err != nil {
-			return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+			return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 		}
-		return c.JSON(http.StatusOK, qFilter)
+		return SuccessResponse(c, qFilter, "queue items")
 	}
 	q, err := h.Service.QueueService.GetQueueItems(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, q)
+	return SuccessResponse(c, q, "queue items")
 }
 
 // GetQueueItem godoc
@@ -139,13 +140,13 @@ func (h *Handler) GetQueueItems(c echo.Context) error {
 func (h *Handler) GetQueueItem(c echo.Context) error {
 	id, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	q, err := h.Service.QueueService.GetQueueItem(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, q)
+	return SuccessResponse(c, q, "queue item")
 }
 
 // UpdateQueueItem godoc
@@ -165,14 +166,14 @@ func (h *Handler) GetQueueItem(c echo.Context) error {
 func (h *Handler) UpdateQueueItem(c echo.Context) error {
 	id, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	uqr := new(UpdateQueueRequest)
 	if err := c.Bind(uqr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(uqr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	queueDto := queue.Queue{
@@ -195,9 +196,9 @@ func (h *Handler) UpdateQueueItem(c echo.Context) error {
 
 	que, err := h.Service.QueueService.UpdateQueueItem(queueDto, id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, que)
+	return SuccessResponse(c, que, "updated queue item")
 }
 
 // DeleteQueueItem godoc
@@ -216,13 +217,13 @@ func (h *Handler) UpdateQueueItem(c echo.Context) error {
 func (h *Handler) DeleteQueueItem(c echo.Context) error {
 	id, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	err = h.Service.QueueService.DeleteQueueItem(c, id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.NoContent(http.StatusNoContent)
+	return SuccessResponse(c, "", "queue item deleted")
 }
 
 // ReadQueueLogFile godoc
@@ -244,24 +245,24 @@ func (h *Handler) ReadQueueLogFile(c echo.Context) error {
 
 	uuid, err := utils.IsValidUUID(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid id")
 	}
 
 	logType := c.QueryParam("type")
 	if len(logType) == 0 {
-		return echo.NewHTTPError(http.StatusBadRequest, "type is required: video, video-convert, chat, chat-render, or chat-convert")
+		return ErrorResponse(c, http.StatusBadRequest, "type is required: video, video-convert, chat, chat-render, or chat-convert")
 	}
 	// Validate logType
 	validLogType, err := utils.ValidateLogType(logType)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	log, err := h.Service.QueueService.ReadLogFile(c, uuid, validLogType)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, string(log))
+	return SuccessResponse(c, string(log), fmt.Sprintf("%s log file for %s", logType, uuid))
 }
 
 // StopQueueItem godoc
@@ -282,14 +283,14 @@ func (h *Handler) StopQueueItem(c echo.Context) error {
 
 	uuid, err := utils.IsValidUUID(id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid id")
 	}
 
 	err = h.Service.QueueService.StopQueueItem(c.Request().Context(), uuid)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.NoContent(http.StatusNoContent)
+	return SuccessResponse(c, "", "queue item stopped")
 }
 
 // StartQueueTask godoc
@@ -307,10 +308,10 @@ func (h *Handler) StopQueueItem(c echo.Context) error {
 func (h *Handler) StartQueueTask(c echo.Context) error {
 	body := new(StartQueueTaskRequest)
 	if err := c.Bind(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(body); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	_, err := h.Service.QueueService.StartQueueTask(c.Request().Context(), queue.StartQueueTaskInput{
@@ -320,8 +321,8 @@ func (h *Handler) StartQueueTask(c echo.Context) error {
 	})
 
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.NoContent(http.StatusOK)
+	return SuccessResponse(c, "", fmt.Sprintf("started %s for %s", body.TaskName, body.QueueId))
 }
diff --git a/internal/transport/http/response.go b/internal/transport/http/response.go
index 0f556de9..4292b631 100644
--- a/internal/transport/http/response.go
+++ b/internal/transport/http/response.go
@@ -27,3 +27,11 @@ func ErrorResponse(c echo.Context, statusCode int, message string) error {
 		Message: message,
 	})
 }
+
+func ErrorInvalidAccessTokenResponse(c echo.Context) error {
+	return ErrorResponse(c, http.StatusUnauthorized, "Invalid access token")
+}
+
+func ErrorUnauthorizedResponse(c echo.Context) error {
+	return ErrorResponse(c, http.StatusForbidden, "You are not authorized to access this resource")
+}
diff --git a/internal/transport/http/task.go b/internal/transport/http/task.go
index f5b74039..e7b3e796 100644
--- a/internal/transport/http/task.go
+++ b/internal/transport/http/task.go
@@ -12,7 +12,7 @@ type TaskService interface {
 }
 
 type StartTaskRequest struct {
-	Task string `json:"task" validate:"required,oneof=check_live check_vod get_jwks storage_migration prune_videos save_chapters update_stream_vod_ids"`
+	Task string `json:"task" validate:"required,oneof=check_live check_vod check_clips get_jwks storage_migration prune_videos save_chapters update_stream_vod_ids generate_sprite_thumbnails"`
 }
 
 // StartTask godoc
diff --git a/internal/transport/http/twitch.go b/internal/transport/http/twitch.go
index 63fce664..e9952204 100644
--- a/internal/transport/http/twitch.go
+++ b/internal/transport/http/twitch.go
@@ -27,13 +27,13 @@ type TwitchService interface {
 func (h *Handler) GetTwitchChannel(c echo.Context) error {
 	name := c.QueryParam("name")
 	if name == "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "channel name query param is required")
+		return ErrorResponse(c, http.StatusBadRequest, "channel name query param is required")
 	}
 	channel, err := h.Service.PlatformTwitch.GetChannel(c.Request().Context(), name)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, channel)
+	return SuccessResponse(c, channel, "channel")
 }
 
 // GetTwitchVideo godoc
@@ -51,14 +51,14 @@ func (h *Handler) GetTwitchChannel(c echo.Context) error {
 func (h *Handler) GetTwitchVideo(c echo.Context) error {
 	vodID := c.QueryParam("id")
 	if vodID == "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "id query param is required")
+		return ErrorResponse(c, http.StatusBadRequest, "id query param is required")
 	}
 	vod, err := h.Service.PlatformTwitch.GetVideo(c.Request().Context(), vodID, true, true)
 	if err != nil {
 		if err.Error() == "vod not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, vod)
+	return SuccessResponse(c, vod, "video")
 }
diff --git a/internal/transport/http/user.go b/internal/transport/http/user.go
index 6d19effa..635b3888 100644
--- a/internal/transport/http/user.go
+++ b/internal/transport/http/user.go
@@ -1,6 +1,7 @@
 package http
 
 import (
+	"context"
 	"net/http"
 
 	"github.com/google/uuid"
@@ -37,9 +38,9 @@ type UpdateChannelRequest struct {
 func (h *Handler) GetUsers(c echo.Context) error {
 	users, err := h.Service.UserService.AdminGetUsers(c)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, users)
+	return SuccessResponse(c, users, "users")
 }
 
 // GetUser godoc
@@ -58,13 +59,13 @@ func (h *Handler) GetUsers(c echo.Context) error {
 func (h *Handler) GetUser(c echo.Context) error {
 	id, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	u, err := h.Service.UserService.AdminGetUser(c, id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, u)
+	return SuccessResponse(c, u, "user")
 }
 
 // UpdateUser godoc
@@ -84,14 +85,14 @@ func (h *Handler) GetUser(c echo.Context) error {
 func (h *Handler) UpdateUser(c echo.Context) error {
 	uID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	usr := new(UpdateChannelRequest)
 	if err := c.Bind(usr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(usr); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	uDto := user.User{
 		ID:       uID,
@@ -100,9 +101,9 @@ func (h *Handler) UpdateUser(c echo.Context) error {
 	}
 	u, err := h.Service.UserService.AdminUpdateUser(c, uDto)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, u)
+	return SuccessResponse(c, u, "user updated")
 }
 
 // DeleteUser godoc
@@ -121,11 +122,26 @@ func (h *Handler) UpdateUser(c echo.Context) error {
 func (h *Handler) DeleteUser(c echo.Context) error {
 	id, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	err = h.Service.UserService.AdminDeleteUser(c, id)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
+
+	// destroy sessions
+	err = h.SessionManager.Iterate(c.Request().Context(), func(ctx context.Context) error {
+		userID := sessionManager.GetString(ctx, "user_id")
+
+		if userID == id.String() {
+			return sessionManager.Destroy(ctx)
+		}
+
+		return nil
+	})
+	if err != nil {
+		return ErrorResponse(c, 500, "error deleting user sessions")
+	}
+
 	return c.NoContent(http.StatusOK)
 }
diff --git a/internal/transport/http/vod.go b/internal/transport/http/vod.go
index a12e2f15..df37d271 100644
--- a/internal/transport/http/vod.go
+++ b/internal/transport/http/vod.go
@@ -22,12 +22,13 @@ type VodService interface {
 	CreateVod(vod vod.Vod, cID uuid.UUID) (*ent.Vod, error)
 	GetVods(c echo.Context) ([]*ent.Vod, error)
 	GetVodsByChannel(c echo.Context, cUUID uuid.UUID) ([]*ent.Vod, error)
-	GetVod(vID uuid.UUID, withChannel bool, withChapters bool, withMutedSegments bool) (*ent.Vod, error)
+	GetVod(ctx context.Context, vID uuid.UUID, withChannel bool, withChapters bool, withMutedSegments bool, withQueue bool) (*ent.Vod, error)
+	GetVodByExternalId(ctx context.Context, externalId string) (*ent.Vod, error)
 	DeleteVod(c echo.Context, vID uuid.UUID, deleteFiles bool) error
 	UpdateVod(c echo.Context, vID uuid.UUID, vod vod.Vod, cID uuid.UUID) (*ent.Vod, error)
-	SearchVods(c echo.Context, query string, limit int, offset int) (vod.Pagination, error)
+	SearchVods(c echo.Context, query string, limit int, offset int, types []utils.VodType) (vod.Pagination, error)
 	GetVodPlaylists(c echo.Context, vID uuid.UUID) ([]*ent.Playlist, error)
-	GetVodsPagination(c echo.Context, limit int, offset int, channelId uuid.UUID, types []utils.VodType) (vod.Pagination, error)
+	GetVodsPagination(c echo.Context, limit int, offset int, channelId uuid.UUID, types []utils.VodType, playlistId uuid.UUID) (vod.Pagination, error)
 	GetVodChatComments(c echo.Context, vodID uuid.UUID, start float64, end float64) (*[]chat.Comment, error)
 	GetUserIdFromChat(c echo.Context, vodID uuid.UUID) (*int64, error)
 	GetChatEmotes(ctx context.Context, vodID uuid.UUID) (*platform.Emotes, error)
@@ -35,6 +36,9 @@ type VodService interface {
 	GetNumberOfVodChatCommentsFromTime(c echo.Context, vodID uuid.UUID, start float64, commentCount int64) (*[]chat.Comment, error)
 	LockVod(c echo.Context, vID uuid.UUID, status bool) error
 	GenerateStaticThumbnail(ctx context.Context, videoID uuid.UUID) (*rivertype.JobInsertResult, error)
+	GenerateSpriteThumbnails(ctx context.Context, videoID uuid.UUID) (*rivertype.JobInsertResult, error)
+	GetVodClips(ctx context.Context, id uuid.UUID) ([]*ent.Vod, error)
+	GetVodChatHistogram(ctx context.Context, vodID uuid.UUID, resolutionSeconds float64) (map[int]int, error)
 }
 
 type CreateVodRequest struct {
@@ -75,19 +79,19 @@ type CreateVodRequest struct {
 func (h *Handler) CreateVod(c echo.Context) error {
 	var req CreateVodRequest
 	if err := c.Bind(&req); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(&req); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	cUUID, err := uuid.Parse(req.ChannelID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	// Parse streamed at time
 	streamedAt, err := time.Parse(time.RFC3339, req.StreamedAt)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	var vodID uuid.UUID
 	if req.ID == "" {
@@ -95,11 +99,11 @@ func (h *Handler) CreateVod(c echo.Context) error {
 	} else {
 		vID, err := uuid.Parse(req.ID)
 		if err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
 		}
-		_, err = h.Service.VodService.GetVod(vID, false, false, false)
+		_, err = h.Service.VodService.GetVod(c.Request().Context(), vID, false, false, false, false)
 		if err == nil {
-			return echo.NewHTTPError(http.StatusConflict, "vod already exists")
+			return ErrorResponse(c, http.StatusConflict, "vod already exists")
 		}
 		vodID = vID
 	}
@@ -127,9 +131,9 @@ func (h *Handler) CreateVod(c echo.Context) error {
 
 	v, err := h.Service.VodService.CreateVod(cvrDto, cUUID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "video created")
 }
 
 // GetVods godoc
@@ -149,19 +153,19 @@ func (h *Handler) GetVods(c echo.Context) error {
 	if cID == "" {
 		v, err := h.Service.VodService.GetVods(c)
 		if err != nil {
-			return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+			return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 		}
-		return c.JSON(http.StatusOK, v)
+		return SuccessResponse(c, v, "videos")
 	}
 	cUUID, err := uuid.Parse(cID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, "invalid channel id")
+		return ErrorResponse(c, http.StatusBadRequest, "invalid channel id")
 	}
 	v, err := h.Service.VodService.GetVodsByChannel(c, cUUID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "videos")
 }
 
 // GetVod godoc
@@ -181,14 +185,34 @@ func (h *Handler) GetVods(c echo.Context) error {
 //		@Failure		500				{object}	utils.ErrorResponse
 //		@Router			/vod/{id} [get]
 func (h *Handler) GetVod(c echo.Context) error {
-	vID, err := uuid.Parse(c.Param("id"))
-	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+	var id string
+	var videoUUID uuid.UUID
+
+	if c.Param("id") != "" {
+		id = c.Param("id")
+
+		vUUID, err := uuid.Parse(id)
+		if err != nil {
+			return echo.NewHTTPError(http.StatusBadRequest, "Invalid UUID provided: "+err.Error())
+		}
+		videoUUID = vUUID
+	} else if c.Param("external_id") != "" {
+		id = c.Param("external_id")
+
+		v, err := h.Service.VodService.GetVodByExternalId(c.Request().Context(), id)
+		if err != nil {
+			return echo.NewHTTPError(http.StatusBadRequest, "VOD not found by external ID: "+err.Error())
+		}
+		videoUUID = v.ID
+	} else {
+		// If neither "id" nor "external_id" is provided, return an error
+		return echo.NewHTTPError(http.StatusBadRequest, "Either 'id' or 'external_id' must be provided")
 	}
 
 	withChannel := false
 	withChapters := false
 	withMutedSegments := false
+	withQueue := false
 
 	wC := c.QueryParam("with_channel")
 	if wC == "true" {
@@ -205,14 +229,19 @@ func (h *Handler) GetVod(c echo.Context) error {
 		withMutedSegments = true
 	}
 
-	v, err := h.Service.VodService.GetVod(vID, withChannel, withChapters, withMutedSegments)
+	wQueue := c.QueryParam("with_queue")
+	if wQueue == "true" {
+		withQueue = true
+	}
+
+	v, err := h.Service.VodService.GetVod(c.Request().Context(), videoUUID, withChannel, withChapters, withMutedSegments, withQueue)
 	if err != nil {
 		if err.Error() == "vod not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "video")
 }
 
 // DeleteVod godoc
@@ -233,7 +262,7 @@ func (h *Handler) GetVod(c echo.Context) error {
 func (h *Handler) DeleteVod(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	// get query param of delete_files if exists
 	deleteFiles := false
@@ -244,9 +273,9 @@ func (h *Handler) DeleteVod(c echo.Context) error {
 	err = h.Service.VodService.DeleteVod(c, vID, deleteFiles)
 	if err != nil {
 		if err.Error() == "vod not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 	return c.NoContent(http.StatusOK)
 }
@@ -269,23 +298,23 @@ func (h *Handler) DeleteVod(c echo.Context) error {
 func (h *Handler) UpdateVod(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	var req CreateVodRequest
 	if err := c.Bind(&req); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	if err := c.Validate(&req); err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	cUUID, err := uuid.Parse(req.ChannelID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	// Parse streamed at time
 	streamedAt, err := time.Parse(time.RFC3339, req.StreamedAt)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	cvrDto := vod.Vod{
 		ExtID:            req.ExtID,
@@ -310,11 +339,11 @@ func (h *Handler) UpdateVod(c echo.Context) error {
 	v, err := h.Service.VodService.UpdateVod(c, vID, cvrDto, cUUID)
 	if err != nil {
 		if err.Error() == "vod not found" {
-			return echo.NewHTTPError(http.StatusNotFound, err.Error())
+			return ErrorResponse(c, http.StatusNotFound, err.Error())
 		}
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "video updated")
 }
 
 // SearchVods godoc
@@ -334,21 +363,29 @@ func (h *Handler) UpdateVod(c echo.Context) error {
 func (h *Handler) SearchVods(c echo.Context) error {
 	q := c.QueryParam("q")
 	if q == "" {
-		return echo.NewHTTPError(http.StatusBadRequest, "q is required")
+		return ErrorResponse(c, http.StatusBadRequest, "q is required")
 	}
 	limit, err := strconv.Atoi(c.QueryParam("limit"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid limit: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid limit: %w", err).Error())
 	}
 	offset, err := strconv.Atoi(c.QueryParam("offset"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid offset: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid offset: %w", err).Error())
+	}
+	vTypes := c.QueryParam("types")
+	var types []utils.VodType
+	if vTypes != "" {
+		for _, vType := range strings.Split(vTypes, ",") {
+			types = append(types, utils.VodType(vType))
+		}
 	}
-	v, err := h.Service.VodService.SearchVods(c, q, limit, offset)
+
+	v, err := h.Service.VodService.SearchVods(c, q, limit, offset, types)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "videos")
 }
 
 // GetVodPlaylists godoc
@@ -367,13 +404,13 @@ func (h *Handler) SearchVods(c echo.Context) error {
 func (h *Handler) GetVodPlaylists(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	v, err := h.Service.VodService.GetVodPlaylists(c, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "playlists video is in")
 }
 
 // GetVodsPagination godoc
@@ -393,20 +430,28 @@ func (h *Handler) GetVodPlaylists(c echo.Context) error {
 func (h *Handler) GetVodsPagination(c echo.Context) error {
 	limit, err := strconv.Atoi(c.QueryParam("limit"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid limit: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid limit: %w", err).Error())
 	}
 	offset, err := strconv.Atoi(c.QueryParam("offset"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid offset: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid offset: %w", err).Error())
 	}
 
 	cID := c.QueryParam("channel_id")
 	cUUID := uuid.Nil
-
 	if cID != "" {
 		cUUID, err = uuid.Parse(cID)
 		if err != nil {
-			return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
+		}
+	}
+
+	playlistId := c.QueryParam("playlist_id")
+	playlistUUID := uuid.Nil
+	if playlistId != "" {
+		playlistUUID, err = uuid.Parse(playlistId)
+		if err != nil {
+			return ErrorResponse(c, http.StatusBadRequest, err.Error())
 		}
 	}
 
@@ -418,11 +463,11 @@ func (h *Handler) GetVodsPagination(c echo.Context) error {
 		}
 	}
 
-	v, err := h.Service.VodService.GetVodsPagination(c, limit, offset, cUUID, types)
+	v, err := h.Service.VodService.GetVodsPagination(c, limit, offset, cUUID, types, playlistUUID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "paginated videos")
 }
 
 // GetUserIdFromChat godoc
@@ -441,13 +486,13 @@ func (h *Handler) GetVodsPagination(c echo.Context) error {
 func (h *Handler) GetUserIdFromChat(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	v, err := h.Service.VodService.GetUserIdFromChat(c, vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, "user id from chat")
 }
 
 // GetVodChatComments godoc
@@ -468,25 +513,25 @@ func (h *Handler) GetUserIdFromChat(c echo.Context) error {
 func (h *Handler) GetVodChatComments(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	start := c.QueryParam("start")
 	end := c.QueryParam("end")
 	startFloat, err := strconv.ParseFloat(start, 64)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid start: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid start: %w", err).Error())
 	}
 	endFloat, err := strconv.ParseFloat(end, 64)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid end: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid end: %w", err).Error())
 	}
 
 	v, err := h.Service.VodService.GetVodChatComments(c, vID, startFloat, endFloat)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, fmt.Sprintf("comments for %s %f - %f", vID, startFloat, endFloat))
 }
 
 // GetChatEmotes godoc
@@ -505,15 +550,15 @@ func (h *Handler) GetVodChatComments(c echo.Context) error {
 func (h *Handler) GetChatEmotes(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	emotes, err := h.Service.VodService.GetChatEmotes(c.Request().Context(), vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, emotes)
+	return SuccessResponse(c, emotes.Emotes, "video emotes")
 }
 
 // GetChatBadges godoc
@@ -532,15 +577,15 @@ func (h *Handler) GetChatEmotes(c echo.Context) error {
 func (h *Handler) GetChatBadges(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	badges, err := h.Service.VodService.GetChatBadges(c.Request().Context(), vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 
-	return c.JSON(http.StatusOK, badges)
+	return SuccessResponse(c, badges.Badges, "video badges")
 }
 
 // GetNumberOfVodChatComments godoc
@@ -561,34 +606,34 @@ func (h *Handler) GetChatBadges(c echo.Context) error {
 func (h *Handler) GetNumberOfVodChatCommentsFromTime(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 
 	start := c.QueryParam("start")
 	count := c.QueryParam("count")
 	startFloat, err := strconv.ParseFloat(start, 64)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid start: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid start: %w", err).Error())
 	}
 	countInt, err := strconv.Atoi(count)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, fmt.Errorf("invalid count: %w", err).Error())
+		return ErrorResponse(c, http.StatusBadRequest, fmt.Errorf("invalid count: %w", err).Error())
 	}
 	if countInt < 1 {
-		return echo.NewHTTPError(http.StatusBadRequest, "count must be greater than 0")
+		return ErrorResponse(c, http.StatusBadRequest, "count must be greater than 0")
 	}
 
 	v, err := h.Service.VodService.GetNumberOfVodChatCommentsFromTime(c, vID, startFloat, int64(countInt))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, v)
+	return SuccessResponse(c, v, fmt.Sprintf("comments for %s from %f", vID, startFloat))
 }
 
 func (h *Handler) LockVod(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	status := true
 	param := c.QueryParam("locked")
@@ -597,19 +642,155 @@ func (h *Handler) LockVod(c echo.Context) error {
 	}
 	err = h.Service.VodService.LockVod(c, vID, status)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
-	return c.JSON(http.StatusOK, nil)
+	return SuccessResponse(c, "", "video locked")
 }
 
 func (h *Handler) GenerateStaticThumbnail(c echo.Context) error {
 	vID, err := uuid.Parse(c.Param("id"))
 	if err != nil {
-		return echo.NewHTTPError(http.StatusBadRequest, err.Error())
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
 	}
 	job, err := h.Service.VodService.GenerateStaticThumbnail(c.Request().Context(), vID)
 	if err != nil {
-		return echo.NewHTTPError(http.StatusInternalServerError, err.Error())
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+	return SuccessResponse(c, nil, fmt.Sprintf("job created: %d", job.Job.ID))
+}
+
+func (h *Handler) GetVodClips(c echo.Context) error {
+	id := c.Param("id")
+	videoId, err := uuid.Parse(id)
+	if err != nil {
+		return ErrorResponse(c, http.StatusBadRequest, "Invalid video ID")
+	}
+	clips, err := h.Service.VodService.GetVodClips(c.Request().Context(), videoId)
+	if err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+
+	return SuccessResponse(c, clips, "clips for video")
+}
+
+func (h *Handler) GetVodSpriteThumbnails(c echo.Context) error {
+	var id string
+	var videoUUID uuid.UUID
+
+	id = c.Param("id")
+
+	videoUUID, err := uuid.Parse(id)
+	if err != nil {
+		return echo.NewHTTPError(http.StatusBadRequest, "Invalid UUID provided: "+err.Error())
+	}
+
+	video, err := h.Service.VodService.GetVod(c.Request().Context(), videoUUID, false, false, false, false)
+	if err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+
+	if !video.SpriteThumbnailsEnabled {
+		return ErrorResponse(c, http.StatusBadRequest, "Video does not have sprite thumbnails enabled.")
+	}
+
+	spriteMetata := SpriteMetadata{
+		Duration:       video.Duration,
+		SpriteImages:   video.SpriteThumbnailsImages,
+		SpriteInterval: video.SpriteThumbnailsInterval,
+		SpriteRows:     video.SpriteThumbnailsRows,
+		SpriteColumns:  video.SpriteThumbnailsColumns,
+		SpriteHeight:   video.SpriteThumbnailsHeight,
+		SpriteWidth:    video.SpriteThumbnailsWidth,
+	}
+	webvtt, err := GenerateThumbnailsVTT(spriteMetata)
+	if err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+
+	return c.String(http.StatusOK, webvtt)
+}
+
+type SpriteMetadata struct {
+	Duration       int
+	SpriteImages   []string
+	SpriteInterval int
+	SpriteRows     int
+	SpriteColumns  int
+	SpriteHeight   int
+	SpriteWidth    int
+}
+
+func GenerateThumbnailsVTT(metadata SpriteMetadata) (string, error) {
+	var builder strings.Builder
+
+	// Write VTT header
+	builder.WriteString("WEBVTT\n\n")
+
+	// Calculate frame dimensions
+	totalFrames := metadata.Duration / metadata.SpriteInterval
+
+	frameIndex := 0
+
+	// Generate VTT entries
+	for _, imagePath := range metadata.SpriteImages {
+		for row := 0; row < metadata.SpriteRows; row++ {
+			for col := 0; col < metadata.SpriteColumns; col++ {
+				start := frameIndex * metadata.SpriteInterval
+				end := start + metadata.SpriteInterval
+				if frameIndex >= totalFrames {
+					break
+				}
+
+				startTime := formatTimestamp(start)
+				endTime := formatTimestamp(end)
+				x := col * metadata.SpriteWidth
+				y := row * metadata.SpriteHeight
+
+				entry := fmt.Sprintf("%s --> %s\n%s#xywh=%d,%d,%d,%d\n\n",
+					startTime, endTime, imagePath, x, y, metadata.SpriteWidth, metadata.SpriteHeight)
+
+				builder.WriteString(entry)
+
+				frameIndex++
+			}
+		}
+		if frameIndex >= totalFrames {
+			break
+		}
+	}
+
+	return builder.String(), nil
+}
+
+func formatTimestamp(seconds int) string {
+	hours := seconds / 3600
+	minutes := (seconds % 3600) / 60
+	secs := seconds % 60
+	milliseconds := 0
+	return fmt.Sprintf("%02d:%02d:%02d.%03d", hours, minutes, secs, milliseconds)
+}
+
+func (h *Handler) GenerateSpriteThumbnails(c echo.Context) error {
+	vID, err := uuid.Parse(c.Param("id"))
+	if err != nil {
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
+	}
+	job, err := h.Service.VodService.GenerateSpriteThumbnails(c.Request().Context(), vID)
+	if err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
 	}
 	return SuccessResponse(c, nil, fmt.Sprintf("job created: %d", job.Job.ID))
 }
+
+func (h *Handler) GetVodChatHistogram(c echo.Context) error {
+	vID, err := uuid.Parse(c.Param("id"))
+	if err != nil {
+		return ErrorResponse(c, http.StatusBadRequest, err.Error())
+	}
+	histogram, err := h.Service.VodService.GetVodChatHistogram(c.Request().Context(), vID, 60)
+	if err != nil {
+		return ErrorResponse(c, http.StatusInternalServerError, err.Error())
+	}
+
+	return SuccessResponse(c, histogram, "chat histogram")
+}
diff --git a/internal/utils/enum.go b/internal/utils/enum.go
index 15ec8ed2..f87ee284 100644
--- a/internal/utils/enum.go
+++ b/internal/utils/enum.go
@@ -16,6 +16,19 @@ func (Role) Values() (kinds []string) {
 	return
 }
 
+// IsValidRole checks if a string is a valid Role.
+func IsValidRole(role string) bool {
+	validRoles := map[string]struct{}{
+		string(AdminRole):    {},
+		string(EditorRole):   {},
+		string(ArchiverRole): {},
+		string(UserRole):     {},
+	}
+
+	_, exists := validRoles[role]
+	return exists
+}
+
 type VideoPlatform string
 
 const (
diff --git a/internal/vod/vod.go b/internal/vod/vod.go
index a33c71e9..ac12e2a7 100644
--- a/internal/vod/vod.go
+++ b/internal/vod/vod.go
@@ -21,6 +21,7 @@ import (
 	"github.com/zibbp/ganymede/ent/channel"
 	entChapter "github.com/zibbp/ganymede/ent/chapter"
 	entMutedSegment "github.com/zibbp/ganymede/ent/mutedsegment"
+	"github.com/zibbp/ganymede/ent/playlist"
 	"github.com/zibbp/ganymede/ent/vod"
 	"github.com/zibbp/ganymede/internal/cache"
 	"github.com/zibbp/ganymede/internal/chat"
@@ -45,10 +46,12 @@ type Vod struct {
 	ID                      uuid.UUID           `json:"id"`
 	ExtID                   string              `json:"ext_id"`
 	ExtStreamID             string              `json:"ext_stream_id"`
+	ClipExtVodID            string              `json:"clip_ext_vod_id"`
 	Platform                utils.VideoPlatform `json:"platform"`
 	Type                    utils.VodType       `json:"type"`
 	Title                   string              `json:"title"`
 	Duration                int                 `json:"duration"`
+	ClipVodOffset           int                 `json:"clip_vod_offset"`
 	Views                   int                 `json:"views"`
 	Resolution              string              `json:"resolution"`
 	Processing              bool                `json:"processing"`
@@ -92,7 +95,7 @@ type MutedSegment struct {
 }
 
 func (s *Service) CreateVod(vodDto Vod, cUUID uuid.UUID) (*ent.Vod, error) {
-	v, err := s.Store.Client.Vod.Create().SetID(vodDto.ID).SetChannelID(cUUID).SetExtID(vodDto.ExtID).SetExtStreamID(vodDto.ExtStreamID).SetPlatform(vodDto.Platform).SetType(vodDto.Type).SetTitle(vodDto.Title).SetDuration(vodDto.Duration).SetViews(vodDto.Views).SetResolution(vodDto.Resolution).SetProcessing(vodDto.Processing).SetThumbnailPath(vodDto.ThumbnailPath).SetWebThumbnailPath(vodDto.WebThumbnailPath).SetVideoPath(vodDto.VideoPath).SetChatPath(vodDto.ChatPath).SetChatVideoPath(vodDto.ChatVideoPath).SetInfoPath(vodDto.InfoPath).SetCaptionPath(vodDto.CaptionPath).SetStreamedAt(vodDto.StreamedAt).SetFolderName(vodDto.FolderName).SetFileName(vodDto.FileName).SetLocked(vodDto.Locked).SetTmpVideoDownloadPath(vodDto.TmpVideoDownloadPath).SetTmpVideoConvertPath(vodDto.TmpVideoConvertPath).SetTmpChatDownloadPath(vodDto.TmpChatDownloadPath).SetTmpLiveChatDownloadPath(vodDto.TmpLiveChatDownloadPath).SetTmpLiveChatConvertPath(vodDto.TmpLiveChatConvertPath).SetTmpChatRenderPath(vodDto.TmpChatRenderPath).SetLiveChatPath(vodDto.LiveChatPath).SetLiveChatConvertPath(vodDto.LiveChatConvertPath).SetVideoHlsPath(vodDto.VideoHLSPath).SetTmpVideoHlsPath(vodDto.TmpVideoHLSPath).Save(context.Background())
+	v, err := s.Store.Client.Vod.Create().SetID(vodDto.ID).SetChannelID(cUUID).SetExtID(vodDto.ExtID).SetExtStreamID(vodDto.ExtStreamID).SetPlatform(vodDto.Platform).SetType(vodDto.Type).SetTitle(vodDto.Title).SetDuration(vodDto.Duration).SetViews(vodDto.Views).SetResolution(vodDto.Resolution).SetProcessing(vodDto.Processing).SetThumbnailPath(vodDto.ThumbnailPath).SetWebThumbnailPath(vodDto.WebThumbnailPath).SetVideoPath(vodDto.VideoPath).SetChatPath(vodDto.ChatPath).SetChatVideoPath(vodDto.ChatVideoPath).SetInfoPath(vodDto.InfoPath).SetCaptionPath(vodDto.CaptionPath).SetStreamedAt(vodDto.StreamedAt).SetFolderName(vodDto.FolderName).SetFileName(vodDto.FileName).SetLocked(vodDto.Locked).SetTmpVideoDownloadPath(vodDto.TmpVideoDownloadPath).SetTmpVideoConvertPath(vodDto.TmpVideoConvertPath).SetTmpChatDownloadPath(vodDto.TmpChatDownloadPath).SetTmpLiveChatDownloadPath(vodDto.TmpLiveChatDownloadPath).SetTmpLiveChatConvertPath(vodDto.TmpLiveChatConvertPath).SetTmpChatRenderPath(vodDto.TmpChatRenderPath).SetLiveChatPath(vodDto.LiveChatPath).SetLiveChatConvertPath(vodDto.LiveChatConvertPath).SetVideoHlsPath(vodDto.VideoHLSPath).SetTmpVideoHlsPath(vodDto.TmpVideoHLSPath).SetClipVodOffset(vodDto.ClipVodOffset).SetClipExtVodID(vodDto.ClipExtVodID).Save(context.Background())
 	if err != nil {
 		log.Debug().Err(err).Msg("error creating vod")
 		if _, ok := err.(*ent.ConstraintError); ok {
@@ -124,7 +127,22 @@ func (s *Service) GetVodsByChannel(c echo.Context, cUUID uuid.UUID) ([]*ent.Vod,
 	return v, nil
 }
 
-func (s *Service) GetVod(vodID uuid.UUID, withChannel bool, withChapters bool, withMutedSegments bool) (*ent.Vod, error) {
+// GetVodByExternalId gets a VOD by it's external (platform) ID. For more advanced usage use GetVod().
+func (s *Service) GetVodByExternalId(ctx context.Context, externalId string) (*ent.Vod, error) {
+	v, err := s.Store.Client.Vod.Query().Where(vod.ExtID(externalId)).Only(ctx)
+	if err != nil {
+		log.Debug().Err(err).Msg("error getting vod")
+		// if vod not found
+		if _, ok := err.(*ent.NotFoundError); ok {
+			return nil, fmt.Errorf("vod not found")
+		}
+		return nil, fmt.Errorf("error getting vod: %v", err)
+	}
+
+	return v, nil
+}
+
+func (s *Service) GetVod(ctx context.Context, vodID uuid.UUID, withChannel bool, withChapters bool, withMutedSegments bool, withQueue bool) (*ent.Vod, error) {
 	q := s.Store.Client.Vod.Query()
 	q.Where(vod.ID(vodID))
 
@@ -137,8 +155,11 @@ func (s *Service) GetVod(vodID uuid.UUID, withChannel bool, withChapters bool, w
 	if withMutedSegments {
 		q.WithMutedSegments()
 	}
+	if withQueue {
+		q.WithQueue()
+	}
 
-	v, err := q.Only(context.Background())
+	v, err := q.Only(ctx)
 	if err != nil {
 		log.Debug().Err(err).Msg("error getting vod")
 		// if vod not found
@@ -253,7 +274,7 @@ func (s *Service) DeleteVod(c echo.Context, vodID uuid.UUID, deleteFiles bool) e
 }
 
 func (s *Service) UpdateVod(c echo.Context, vodID uuid.UUID, vodDto Vod, cUUID uuid.UUID) (*ent.Vod, error) {
-	v, err := s.Store.Client.Vod.UpdateOneID(vodID).SetChannelID(cUUID).SetExtID(vodDto.ExtID).SetExtID(vodDto.ExtID).SetPlatform(vodDto.Platform).SetType(vodDto.Type).SetTitle(vodDto.Title).SetDuration(vodDto.Duration).SetViews(vodDto.Views).SetResolution(vodDto.Resolution).SetProcessing(vodDto.Processing).SetThumbnailPath(vodDto.ThumbnailPath).SetWebThumbnailPath(vodDto.WebThumbnailPath).SetVideoPath(vodDto.VideoPath).SetChatPath(vodDto.ChatPath).SetChatVideoPath(vodDto.ChatVideoPath).SetInfoPath(vodDto.InfoPath).SetCaptionPath(vodDto.CaptionPath).SetStreamedAt(vodDto.StreamedAt).SetLocked(vodDto.Locked).Save(c.Request().Context())
+	v, err := s.Store.Client.Vod.UpdateOneID(vodID).SetChannelID(cUUID).SetExtID(vodDto.ExtID).SetExtID(vodDto.ExtID).SetPlatform(vodDto.Platform).SetType(vodDto.Type).SetTitle(vodDto.Title).SetDuration(vodDto.Duration).SetViews(vodDto.Views).SetResolution(vodDto.Resolution).SetProcessing(vodDto.Processing).SetThumbnailPath(vodDto.ThumbnailPath).SetWebThumbnailPath(vodDto.WebThumbnailPath).SetVideoPath(vodDto.VideoPath).SetChatPath(vodDto.ChatPath).SetChatVideoPath(vodDto.ChatVideoPath).SetInfoPath(vodDto.InfoPath).SetCaptionPath(vodDto.CaptionPath).SetStreamedAt(vodDto.StreamedAt).SetLocked(vodDto.Locked).SetClipVodOffset(vodDto.ClipVodOffset).SetClipExtVodID(vodDto.ClipExtVodID).Save(c.Request().Context())
 	if err != nil {
 		log.Debug().Err(err).Msg("error updating vod")
 
@@ -282,17 +303,29 @@ func (s *Service) CheckVodExists(extID string) (bool, error) {
 	return true, nil
 }
 
-func (s *Service) SearchVods(c echo.Context, term string, limit int, offset int) (Pagination, error) {
+func (s *Service) SearchVods(c echo.Context, term string, limit int, offset int, types []utils.VodType) (Pagination, error) {
 
 	var pagination Pagination
 
-	v, err := s.Store.Client.Vod.Query().Where(vod.TitleContainsFold(term)).Order(ent.Desc(vod.FieldStreamedAt)).WithChannel().Limit(limit).Offset(offset).All(c.Request().Context())
+	queryBuilder := s.Store.Client.Vod.Query().Where(vod.TitleContainsFold(term)).Order(ent.Desc(vod.FieldStreamedAt)).WithChannel().Limit(limit).Offset(offset)
+
+	if len(types) > 0 {
+		queryBuilder = queryBuilder.Where(vod.TypeIn(types...))
+	}
+
+	v, err := queryBuilder.All(c.Request().Context())
 	if err != nil {
 		log.Debug().Err(err).Msg("error searching vods")
 		return pagination, fmt.Errorf("error searching vods: %v", err)
 	}
 
-	totalCount, err := s.Store.Client.Vod.Query().Where(vod.TitleContainsFold(term)).Count(c.Request().Context())
+	countQueryBuilder := s.Store.Client.Vod.Query().Where(vod.TitleContainsFold(term))
+
+	if len(types) > 0 {
+		countQueryBuilder = countQueryBuilder.Where(vod.TypeIn(types...))
+	}
+
+	totalCount, err := countQueryBuilder.Count(c.Request().Context())
 	if err != nil {
 		log.Debug().Err(err).Msg("error getting total vod count")
 		return pagination, fmt.Errorf("error getting total vod count: %v", err)
@@ -317,9 +350,13 @@ func (s *Service) GetVodPlaylists(c echo.Context, vodID uuid.UUID) ([]*ent.Playl
 	return v.Edges.Playlists, nil
 }
 
-func (s *Service) GetVodsPagination(c echo.Context, limit int, offset int, channelId uuid.UUID, types []utils.VodType) (Pagination, error) {
+func (s *Service) GetVodsPagination(c echo.Context, limit int, offset int, channelId uuid.UUID, types []utils.VodType, playlistId uuid.UUID) (Pagination, error) {
 	var pagination Pagination
 
+	if channelId != uuid.Nil && playlistId != uuid.Nil {
+		return pagination, fmt.Errorf("either channelid or playlistid can be specified, not both")
+	}
+
 	// Query builder
 	vodQuery := s.Store.Client.Vod.Query()
 
@@ -328,6 +365,11 @@ func (s *Service) GetVodsPagination(c echo.Context, limit int, offset int, chann
 		vodQuery = vodQuery.Where(vod.HasChannelWith(channel.ID(channelId)))
 	}
 
+	// If playlist id is not nil
+	if playlistId != uuid.Nil {
+		vodQuery = vodQuery.Where(vod.HasPlaylistsWith(playlist.ID(playlistId)))
+	}
+
 	// If types is not nil
 	if len(types) > 0 {
 		vodQuery = vodQuery.Where(vod.TypeIn(types...))
@@ -348,6 +390,11 @@ func (s *Service) GetVodsPagination(c echo.Context, limit int, offset int, chann
 		totalCountQuery = totalCountQuery.Where(vod.HasChannelWith(channel.ID(channelId)))
 	}
 
+	// If playlist id is not nil
+	if playlistId != uuid.Nil {
+		totalCountQuery = totalCountQuery.Where(vod.HasPlaylistsWith(playlist.ID(playlistId)))
+	}
+
 	// If types is not nil
 	if len(types) > 0 {
 		totalCountQuery = totalCountQuery.Where(vod.TypeIn(types...))
@@ -374,6 +421,25 @@ func (s *Service) GenerateStaticThumbnail(ctx context.Context, videoID uuid.UUID
 	}, nil)
 }
 
+func (s *Service) GenerateSpriteThumbnails(ctx context.Context, videoID uuid.UUID) (*rivertype.JobInsertResult, error) {
+	return s.RiverClient.Client.Insert(ctx, tasks.GenerateSpriteThumbnailArgs{
+		VideoId: videoID.String(),
+	}, nil)
+}
+
+func (s *Service) GetVodClips(ctx context.Context, id uuid.UUID) ([]*ent.Vod, error) {
+	video, err := s.Store.Client.Vod.Query().Where(vod.ID(id)).Only(ctx)
+	if err != nil {
+		return nil, err
+	}
+
+	clips, err := s.Store.Client.Vod.Query().Where(vod.ClipExtVodID(video.ExtID)).All(ctx)
+	if err != nil {
+		return nil, err
+	}
+	return clips, nil
+}
+
 func (s *Service) GetUserIdFromChat(c echo.Context, vodID uuid.UUID) (*int64, error) {
 	v, err := s.Store.Client.Vod.Query().Where(vod.ID(vodID)).Only(c.Request().Context())
 	if err != nil {
@@ -418,42 +484,17 @@ func (s *Service) GetVodChatComments(c echo.Context, vodID uuid.UUID, start floa
 		return nil, fmt.Errorf("error getting vod chat: %v", err)
 	}
 
-	var chatData *chat.ChatNoEmotes
 	var comments []chat.Comment
 	cacheData, exists := cache.Cache().Get(v.ID.String())
-	if exists {
-		comments = cacheData.([]chat.Comment)
-	} else {
-		data, err := utils.ReadChatFile(v.ChatPath)
-		if err != nil {
-			log.Debug().Err(err).Msg("error getting vod chat")
-			return nil, fmt.Errorf("error getting vod chat: %v", err)
-		}
-		err = json.Unmarshal(data, &chatData)
+	if !exists {
+		err = loadChatIntoCache(v)
 		if err != nil {
-			log.Debug().Err(err).Msg("error getting vod chat")
-			return nil, fmt.Errorf("error getting vod chat: %v", err)
+			log.Debug().Err(err).Msg("error loading chat into cache")
+			return nil, fmt.Errorf("error loading chat into cache: %v", err)
 		}
-
-		comments = chatData.Comments
-		chatData = nil
-		runtime.GC()
-
-		// Sort the comments by their content offset seconds
-		sort.Slice(comments, func(i, j int) bool {
-			return comments[i].ContentOffsetSeconds < comments[j].ContentOffsetSeconds
-		})
-
-		// Set cache
-		err = cache.Cache().Set(v.ID.String(), comments, 10*time.Minute)
-		if err != nil {
-			log.Debug().Err(err).Msg("error setting cache")
-			return nil, fmt.Errorf("error setting cache: %v", err)
-		}
-
-		runtime.GC()
-
+		cacheData, _ = cache.Cache().Get(v.ID.String())
 	}
+	comments = cacheData.([]chat.Comment)
 
 	// Reset the cache
 	err = cache.Cache().Set(v.ID.String(), comments, 10*time.Minute)
@@ -476,7 +517,6 @@ func (s *Service) GetVodChatComments(c echo.Context, vodID uuid.UUID, start floa
 	}
 
 	// Cleanup
-	chatData = nil
 	comments = nil
 
 	defer runtime.GC()
@@ -484,6 +524,42 @@ func (s *Service) GetVodChatComments(c echo.Context, vodID uuid.UUID, start floa
 	return &filteredComments, nil
 }
 
+func loadChatIntoCache(vod *ent.Vod) error {
+	var chatData *chat.ChatNoEmotes
+	var comments []chat.Comment
+
+	data, err := utils.ReadChatFile(vod.ChatPath)
+	if err != nil {
+		log.Debug().Err(err).Msg("error getting vod chat")
+		return fmt.Errorf("error getting vod chat: %v", err)
+	}
+	err = json.Unmarshal(data, &chatData)
+	if err != nil {
+		log.Debug().Err(err).Msg("error getting vod chat")
+		return fmt.Errorf("error getting vod chat: %v", err)
+	}
+
+	comments = chatData.Comments
+	chatData = nil
+	runtime.GC()
+
+	// Sort the comments by their content offset seconds
+	sort.Slice(comments, func(i, j int) bool {
+		return comments[i].ContentOffsetSeconds < comments[j].ContentOffsetSeconds
+	})
+
+	// Set cache
+	err = cache.Cache().Set(vod.ID.String(), comments, 10*time.Minute)
+	if err != nil {
+		log.Debug().Err(err).Msg("error setting cache")
+		return fmt.Errorf("error setting cache: %v", err)
+	}
+
+	runtime.GC()
+
+	return nil
+}
+
 func (s *Service) GetNumberOfVodChatCommentsFromTime(c echo.Context, vodID uuid.UUID, start float64, commentCount int64) (*[]chat.Comment, error) {
 	v, err := s.Store.Client.Vod.Query().Where(vod.ID(vodID)).Only(c.Request().Context())
 	if err != nil {
@@ -491,43 +567,18 @@ func (s *Service) GetNumberOfVodChatCommentsFromTime(c echo.Context, vodID uuid.
 		return nil, fmt.Errorf("error getting vod chat: %v", err)
 	}
 
-	var chatData *chat.ChatNoEmotes
 	var comments []chat.Comment
 
 	cacheData, exists := cache.Cache().Get(v.ID.String())
-
-	if exists {
-		comments = cacheData.([]chat.Comment)
-	} else {
-		data, err := utils.ReadChatFile(v.ChatPath)
-		if err != nil {
-			log.Debug().Err(err).Msg("error getting vod chat")
-			return nil, fmt.Errorf("error getting vod chat: %v", err)
-		}
-		err = json.Unmarshal(data, &chatData)
-		if err != nil {
-			log.Debug().Err(err).Msg("error getting vod chat")
-			return nil, fmt.Errorf("error getting vod chat: %v", err)
-		}
-
-		comments = chatData.Comments
-		chatData = nil
-		runtime.GC()
-
-		// Sort the comments by their content offset seconds
-		sort.Slice(comments, func(i, j int) bool {
-			return comments[i].ContentOffsetSeconds < comments[j].ContentOffsetSeconds
-		})
-
-		err = cache.Cache().Set(v.ID.String(), comments, 10*time.Minute)
+	if !exists {
+		err = loadChatIntoCache(v)
 		if err != nil {
-			log.Debug().Err(err).Msg("error setting cache")
-			return nil, fmt.Errorf("error setting cache: %v", err)
+			log.Debug().Err(err).Msg("error loading chat into cache")
+			return nil, fmt.Errorf("error loading chat into cache: %v", err)
 		}
-
-		runtime.GC()
-
+		cacheData, _ = cache.Cache().Get(v.ID.String())
 	}
+	comments = cacheData.([]chat.Comment)
 
 	// Reset the cache
 	err = cache.Cache().Set(v.ID.String(), comments, 10*time.Minute)
@@ -557,7 +608,6 @@ func (s *Service) GetNumberOfVodChatCommentsFromTime(c echo.Context, vodID uuid.
 	}
 
 	// Cleanup
-	chatData = nil
 	comments = nil
 	defer runtime.GC()
 
@@ -868,6 +918,7 @@ func (s *Service) GetChatBadges(ctx context.Context, vodID uuid.UUID) (*platform
 	return &badgeResp, nil
 }
 
+// LockVod locks or unlocks a VOD
 func (s *Service) LockVod(c echo.Context, vID uuid.UUID, status bool) error {
 	_, err := s.Store.Client.Vod.UpdateOneID(vID).SetLocked(status).Save(c.Request().Context())
 	if err != nil {
@@ -902,3 +953,53 @@ func getStreamerIdFromInterface(id interface{}) (string, error) {
 	}
 	return streamerId, nil
 }
+
+// GetVodChatHistogram returns a histogram of chat messages for a VOD
+func (s *Service) GetVodChatHistogram(ctx context.Context, videoId uuid.UUID, resolutionSeconds float64) (map[int]int, error) {
+	if resolutionSeconds <= 0 {
+		return nil, fmt.Errorf("resolutionSeconds must be greater than 0")
+	}
+
+	video, err := s.Store.Client.Vod.Query().Where(vod.ID(videoId)).Only(ctx)
+	if err != nil {
+		return nil, err
+	}
+
+	cacheData, exists := cache.Cache().Get(video.ID.String())
+	if !exists {
+		err = loadChatIntoCache(video)
+		if err != nil {
+			log.Debug().Err(err).Msg("error loading chat into cache")
+			return nil, fmt.Errorf("error loading chat into cache: %v", err)
+		}
+		cacheData, _ = cache.Cache().Get(video.ID.String())
+	}
+	comments := cacheData.([]chat.Comment)
+
+	histogram := make(map[int]int)
+
+	// Populate histogram with bucket start times as keys
+	for _, comment := range comments {
+		if comment.ContentOffsetSeconds < 0 || comment.ContentOffsetSeconds > float64(video.Duration) {
+			continue
+		}
+
+		// Calculate the bucket's start time as an integer
+		bucketStart := int(math.Floor(comment.ContentOffsetSeconds/resolutionSeconds) * resolutionSeconds)
+		histogram[bucketStart]++
+	}
+
+	// Convert the histogram to a sorted map
+	sortedHistogram := make(map[int]int)
+	keys := make([]int, 0, len(histogram))
+	for k := range histogram {
+		keys = append(keys, k)
+	}
+	sort.Ints(keys) // Sort the bucket start times
+
+	for _, k := range keys {
+		sortedHistogram[k] = histogram[k]
+	}
+
+	return sortedHistogram, nil
+}
diff --git a/supervisord.conf b/supervisord.conf
new file mode 100644
index 00000000..3ea754de
--- /dev/null
+++ b/supervisord.conf
@@ -0,0 +1,32 @@
+[supervisord]
+nodaemon=true
+logfile=/var/log/supervisord.log
+pidfile=/var/run/supervisord.pid
+
+[program:api]
+command=gosu abc /opt/app/ganymede-api
+autostart=true
+autorestart=true
+stderr_logfile=/dev/stderr
+stdout_logfile=/dev/stdout
+stderr_logfile_maxbytes=0
+stdout_logfile_maxbytes=0
+
+[program:worker]
+command=gosu abc /opt/app/ganymede-worker
+autostart=true
+autorestart=true
+stderr_logfile=/dev/stderr
+stdout_logfile=/dev/stdout
+stderr_logfile_maxbytes=0
+stdout_logfile_maxbytes=0
+
+[program:frontend]
+directory=/opt/app
+command=node server.js
+autostart=true
+autorestart=true
+stderr_logfile=/dev/stderr
+stdout_logfile=/dev/stdout
+stderr_logfile_maxbytes=0
+stdout_logfile_maxbytes=0